diff --git a/features/bootstrap/MassiveChangeHostsContext.php b/features/bootstrap/MassiveChangeHostsContext.php index 11a3f2d42ae34853f9fe42a743230a3b7c86f797..625e8ff39f09a25b3d60b4bd4b83c7509564f09e 100644 --- a/features/bootstrap/MassiveChangeHostsContext.php +++ b/features/bootstrap/MassiveChangeHostsContext.php @@ -313,34 +313,32 @@ class MassiveChangeHostsContext extends CentreonContext */ public function allSelectedHostsAreUpdatedWithTheSameValues() { - $this->tableau = array(); - try { - $this->spin( - function ($context) { - $this->currentPage = new HostConfigurationListingPage($this); - $this->currentPage = $this->currentPage->inspect($this->updatedHost1['name']); - $object = $this->currentPage->getProperties(); - foreach ($this->updatedHost1 as $key => $value) { - if ($value != $object[$key]) { - $this->tableau[] = $key . '1'; - } - } - $this->currentPage = new HostConfigurationListingPage($this); - $this->currentPage = $this->currentPage->inspect($this->updatedHost2['name']); - $object = $this->currentPage->getProperties(); - foreach ($this->updatedHost2 as $key => $value) { - if ($value != $object[$key]) { - $this->tableau[] = $key . '2'; + foreach (array($this->updatedHost1, $this->updatedHost2) as $hostProperties) { + $this->notUpdatedProperties = array(); + + $this->currentPage = new HostConfigurationListingPage($this); + $this->currentPage = $this->currentPage->inspect($hostProperties['name']); + + try { + $this->spin( + function ($context) use ($hostProperties) { + $object = $context->currentPage->getProperties(); + foreach ($hostProperties as $key => $value) { + if ($value != $object[$key]) { + $context->notUpdatedProperties[] = $key; + } } - } - return count($this->tableau) == 0; - }, - "Some properties are not being updated : ", - 5 - ); - } catch (\Exception $e) { - $this->tableau = array_unique($this->tableau); - throw new \Exception("Some properties are not being updated : " . implode(',', $this->tableau)); + return count($context->notUpdatedProperties) == 0; + }, + 'Some properties have not been updated', + 5 + ); + } catch (\Exception $e) { + throw new \Exception( + "Some properties have not been update on host " . $hostProperties['name'] . " : " . + implode(',', array_unique($this->notUpdatedProperties)) + ); + } } } } diff --git a/features/bootstrap/TrapsSNMPConfigurationContext.php b/features/bootstrap/TrapsSNMPConfigurationContext.php index ab8b3ab6fdf3fbfe92550adaa63304b3a7123a5d..3812c6b9d39046cd8b8d036573d88b532a755b1c 100644 --- a/features/bootstrap/TrapsSNMPConfigurationContext.php +++ b/features/bootstrap/TrapsSNMPConfigurationContext.php @@ -147,15 +147,13 @@ class TrapsSNMPConfigurationContext extends CentreonContext */ public function theTrapDefinitionIsSavedWithItsPropertiesEspeciallyTheContentOfRegexpField() { - - - $this->tableau = array(); + + $this->currentPage = new SnmpTrapsConfigurationListingPage($this); + $this->currentPage = $this->currentPage->inspect($this->updatedProperties['name']); try { $this->spin( function ($context) { - $this->currentPage = new SnmpTrapsConfigurationListingPage($this); - $this->currentPage = $this->currentPage->inspect($this->updatedProperties['name']); $object = $this->currentPage->getProperties(); foreach ($this->updatedProperties as $key => $value) { if ($key != 'rule' && $value != $object[$key]) { diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_444444_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_444444_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..19f664d970194372c3228494e34ac01d611a4d45 Binary files /dev/null and b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_444444_256x240.png differ diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_555555_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_555555_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..e965f6d97c6e39e711dbba68889a7d1f3d95eb45 Binary files /dev/null and b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_555555_256x240.png differ diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777620_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777620_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..9785948a293a095a65e34ffb775dfc252bb11c7b Binary files /dev/null and b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777620_256x240.png differ diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777777_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777777_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..323c4564a74caa26eca81548d184610bcaedfb1d Binary files /dev/null and b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777777_256x240.png differ diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_cc0000_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_cc0000_256x240.png new file mode 100644 index 0000000000000000000000000000000000000000..45ac7787cd2bb4d6c3eea7e6e4a893034ddf75d8 Binary files /dev/null and b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_cc0000_256x240.png differ diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_ffffff_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_ffffff_256x240.png index 42f8f992c727ddaa617da224a522e463df690387..fe41d2d0fdd40f87538d2312fa537a799994e55b 100644 Binary files a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_ffffff_256x240.png and b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_ffffff_256x240.png differ diff --git a/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css b/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css index 02afc5059129030e45f24e2a1459de966514d8da..cb996859e1f945f46703eb1d9f7dcb0daea6f75b 100644 --- a/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css +++ b/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css @@ -10,7 +10,25 @@ .portlet-header .ui-icon { float: right; cursor: pointer} .ui-sortable-placeholder { border: 1px dotted black; visibility: visible !important; height: 50px !important; } .ui-sortable-placeholder { visibility: hidden; } -.portlet-content { + +.ui-button, .ui-button:hover, .ui-button:focus { + padding: .2em 1em .2em .2em; + color: #ffffff; + font-weight: bold; + font-family: segoe ui, Arial, sans-serif; + font-size: 1.1em; +} +.ui-button .ui-icon { + background-image: url(images/ui-icons_ffffff_256x240.png); +} +.ui-button:hover .ui-icon { + background-image: url(images/ui-icons_ffffff_256x240.png); +} +.ui-button:focus .ui-icon { + background-image: url(images/ui-icons_ffffff_256x240.png); +} + +.portlet-content { padding: 0.2em; width: 100%; border: none; @@ -37,7 +55,7 @@ iframe { .ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 0.4em; background: none; } .ui-tabs .ui-tabs-nav li a { float: left; padding: .4em 1em 0.4em .4em; text-decoration: none; background: #009fdf;} -.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; background: none; } +.ui-tabs .ui-tabs-nav li.ui-state-active a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; background: none; } .ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .2em 1em .2em 2.1em; } diff --git a/www/Themes/Centreon-2/jquery-ui/jquery-ui.css b/www/Themes/Centreon-2/jquery-ui/jquery-ui.css index 784635969eefb96edeb4707b3b60ebb8ee11949f..45721b175e75fee2fc27b2f499bace9117214017 100644 --- a/www/Themes/Centreon-2/jquery-ui/jquery-ui.css +++ b/www/Themes/Centreon-2/jquery-ui/jquery-ui.css @@ -1,119 +1,1114 @@ -/* - * jQuery UI CSS Framework 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - */ +/*! jQuery UI - v1.12.1 - 2018-03-18 +* http://jqueryui.com +* Includes: draggable.css, core.css, resizable.css, selectable.css, sortable.css, accordion.css, autocomplete.css, menu.css, button.css, controlgroup.css, checkboxradio.css, datepicker.css, dialog.css, progressbar.css, selectmenu.css, slider.css, spinner.css, tabs.css, tooltip.css, theme.css +* To view and modify this theme, visit http://jqueryui.com/themeroller/?scope=&folderName=base&cornerRadiusShadow=8px&offsetLeftShadow=0px&offsetTopShadow=0px&thicknessShadow=5px&opacityShadow=30&bgImgOpacityShadow=0&bgTextureShadow=flat&bgColorShadow=666666&opacityOverlay=30&bgImgOpacityOverlay=0&bgTextureOverlay=flat&bgColorOverlay=aaaaaa&iconColorError=cc0000&fcError=5f3f3f&borderColorError=f1a899&bgTextureError=flat&bgColorError=fddfdf&iconColorHighlight=777620&fcHighlight=777620&borderColorHighlight=dad55e&bgTextureHighlight=flat&bgColorHighlight=fffa90&iconColorActive=ffffff&fcActive=ffffff&borderColorActive=003eff&bgTextureActive=flat&bgColorActive=007fff&iconColorHover=555555&fcHover=2b2b2b&borderColorHover=cccccc&bgTextureHover=flat&bgColorHover=ededed&iconColorDefault=777777&fcDefault=454545&borderColorDefault=c5c5c5&bgTextureDefault=flat&bgColorDefault=f6f6f6&iconColorContent=444444&fcContent=333333&borderColorContent=dddddd&bgTextureContent=flat&bgColorContent=ffffff&iconColorHeader=444444&fcHeader=333333&borderColorHeader=dddddd&bgTextureHeader=flat&bgColorHeader=e9e9e9&cornerRadius=3px&fwDefault=normal&fsDefault=1em&ffDefault=Arial%2CHelvetica%2Csans-serif +* Copyright jQuery Foundation and other contributors; Licensed MIT */ +.ui-draggable-handle { + -ms-touch-action: none; + touch-action: none; +} /* Layout helpers ----------------------------------*/ -.ui-helper-hidden { display: none; } -.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } -.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } -.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } -.ui-helper-clearfix { display: inline-block; } -/* required comment for clearfix to work in Opera \*/ -* html .ui-helper-clearfix { height:1%; } -.ui-helper-clearfix { display:block; } -/* end clearfix */ -.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } +.ui-helper-hidden { + display: none; +} +.ui-helper-hidden-accessible { + border: 0; + clip: rect(0 0 0 0); + height: 1px; + margin: -1px; + overflow: hidden; + padding: 0; + position: absolute; + width: 1px; +} +.ui-helper-reset { + margin: 0; + padding: 0; + border: 0; + outline: 0; + line-height: 1.3; + text-decoration: none; + font-size: 100%; + list-style: none; +} +.ui-helper-clearfix:before, +.ui-helper-clearfix:after { + content: ""; + display: table; + border-collapse: collapse; +} +.ui-helper-clearfix:after { + clear: both; +} +.ui-helper-zfix { + width: 100%; + height: 100%; + top: 0; + left: 0; + position: absolute; + opacity: 0; + filter:Alpha(Opacity=0); /* support: IE8 */ +} + +.ui-front { + z-index: 100; +} /* Interaction Cues ----------------------------------*/ -.ui-state-disabled { cursor: default !important; } +.ui-state-disabled { + cursor: default !important; + pointer-events: none; +} /* Icons ----------------------------------*/ +.ui-icon { + display: inline-block; + vertical-align: middle; + margin-top: -.25em; + position: relative; + text-indent: -99999px; + overflow: hidden; + background-repeat: no-repeat; +} -/* states and images */ -.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } - +.ui-widget-icon-block { + left: 50%; + margin-left: -8px; + display: block; +} /* Misc visuals ----------------------------------*/ /* Overlays */ -.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } +.ui-widget-overlay { + position: fixed; + top: 0; + left: 0; + width: 100%; + height: 100%; +} +.ui-resizable { + position: relative; +} +.ui-resizable-handle { + position: absolute; + font-size: 0.1px; + display: block; + -ms-touch-action: none; + touch-action: none; +} +.ui-resizable-disabled .ui-resizable-handle, +.ui-resizable-autohide .ui-resizable-handle { + display: none; +} +.ui-resizable-n { + cursor: n-resize; + height: 7px; + width: 100%; + top: -5px; + left: 0; +} +.ui-resizable-s { + cursor: s-resize; + height: 7px; + width: 100%; + bottom: -5px; + left: 0; +} +.ui-resizable-e { + cursor: e-resize; + width: 7px; + right: -5px; + top: 0; + height: 100%; +} +.ui-resizable-w { + cursor: w-resize; + width: 7px; + left: -5px; + top: 0; + height: 100%; +} +.ui-resizable-se { + cursor: se-resize; + width: 12px; + height: 12px; + right: 1px; + bottom: 1px; +} +.ui-resizable-sw { + cursor: sw-resize; + width: 9px; + height: 9px; + left: -5px; + bottom: -5px; +} +.ui-resizable-nw { + cursor: nw-resize; + width: 9px; + height: 9px; + left: -5px; + top: -5px; +} +.ui-resizable-ne { + cursor: ne-resize; + width: 9px; + height: 9px; + right: -5px; + top: -5px; +} +.ui-selectable { + -ms-touch-action: none; + touch-action: none; +} +.ui-selectable-helper { + position: absolute; + z-index: 100; + border: 1px dotted black; +} +.ui-sortable-handle { + -ms-touch-action: none; + touch-action: none; +} +.ui-accordion .ui-accordion-header { + display: block; + cursor: pointer; + position: relative; + margin: 2px 0 0 0; + padding: .5em .5em .5em .7em; + font-size: 100%; +} +.ui-accordion .ui-accordion-content { + padding: 1em 2.2em; + border-top: 0; + overflow: auto; +} +.ui-autocomplete { + position: absolute; + top: 0; + left: 0; + cursor: default; +} +.ui-menu { + list-style: none; + padding: 0; + margin: 0; + display: block; + outline: 0; +} +.ui-menu .ui-menu { + position: absolute; +} +.ui-menu .ui-menu-item { + margin: 0; + cursor: pointer; + /* support: IE10, see #8844 */ + list-style-image: url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7"); +} +.ui-menu .ui-menu-item-wrapper { + position: relative; + padding: 3px 1em 3px .4em; +} +.ui-menu .ui-menu-divider { + margin: 5px 0; + height: 0; + font-size: 0; + line-height: 0; + border-width: 1px 0 0 0; +} +.ui-menu .ui-state-focus, +.ui-menu .ui-state-active { + margin: -1px; +} + +/* icon support */ +.ui-menu-icons { + position: relative; +} +.ui-menu-icons .ui-menu-item-wrapper { + padding-left: 2em; +} + +/* left-aligned */ +.ui-menu .ui-icon { + position: absolute; + top: 0; + bottom: 0; + left: .2em; + margin: auto 0; +} + +/* right-aligned */ +.ui-menu .ui-menu-icon { + left: auto; + right: 0; +} +.ui-button { + padding: .4em 1em; + display: inline-block; + position: relative; + line-height: normal; + margin-right: .1em; + cursor: pointer; + vertical-align: middle; + text-align: center; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + + /* Support: IE <= 11 */ + overflow: visible; +} + +.ui-button, +.ui-button:link, +.ui-button:visited, +.ui-button:hover, +.ui-button:active { + text-decoration: none; +} + +/* to make room for the icon, a width needs to be set here */ +.ui-button-icon-only { + width: 2em; + box-sizing: border-box; + text-indent: -9999px; + white-space: nowrap; +} + +/* no icon support for input elements */ +input.ui-button.ui-button-icon-only { + text-indent: 0; +} + +/* button icon element(s) */ +.ui-button-icon-only .ui-icon { + position: absolute; + top: 50%; + left: 50%; + margin-top: -8px; + margin-left: -8px; +} + +.ui-button.ui-icon-notext .ui-icon { + padding: 0; + width: 2.1em; + height: 2.1em; + text-indent: -9999px; + white-space: nowrap; + +} + +input.ui-button.ui-icon-notext .ui-icon { + width: auto; + height: auto; + text-indent: 0; + white-space: normal; + padding: .4em 1em; +} + +/* workarounds */ +/* Support: Firefox 5 - 40 */ +input.ui-button::-moz-focus-inner, +button.ui-button::-moz-focus-inner { + border: 0; + padding: 0; +} +.ui-controlgroup { + vertical-align: middle; + display: inline-block; +} +.ui-controlgroup > .ui-controlgroup-item { + float: left; + margin-left: 0; + margin-right: 0; +} +.ui-controlgroup > .ui-controlgroup-item:focus, +.ui-controlgroup > .ui-controlgroup-item.ui-visual-focus { + z-index: 9999; +} +.ui-controlgroup-vertical > .ui-controlgroup-item { + display: block; + float: none; + width: 100%; + margin-top: 0; + margin-bottom: 0; + text-align: left; +} +.ui-controlgroup-vertical .ui-controlgroup-item { + box-sizing: border-box; +} +.ui-controlgroup .ui-controlgroup-label { + padding: .4em 1em; +} +.ui-controlgroup .ui-controlgroup-label span { + font-size: 80%; +} +.ui-controlgroup-horizontal .ui-controlgroup-label + .ui-controlgroup-item { + border-left: none; +} +.ui-controlgroup-vertical .ui-controlgroup-label + .ui-controlgroup-item { + border-top: none; +} +.ui-controlgroup-horizontal .ui-controlgroup-label.ui-widget-content { + border-right: none; +} +.ui-controlgroup-vertical .ui-controlgroup-label.ui-widget-content { + border-bottom: none; +} + +/* Spinner specific style fixes */ +.ui-controlgroup-vertical .ui-spinner-input { + + /* Support: IE8 only, Android < 4.4 only */ + width: 75%; + width: calc( 100% - 2.4em ); +} +.ui-controlgroup-vertical .ui-spinner .ui-spinner-up { + border-top-style: solid; +} + +.ui-checkboxradio-label .ui-icon-background { + box-shadow: inset 1px 1px 1px #ccc; + border-radius: .12em; + border: none; +} +.ui-checkboxradio-radio-label .ui-icon-background { + width: 16px; + height: 16px; + border-radius: 1em; + overflow: visible; + border: none; +} +.ui-checkboxradio-radio-label.ui-checkboxradio-checked .ui-icon, +.ui-checkboxradio-radio-label.ui-checkboxradio-checked:hover .ui-icon { + background-image: none; + width: 8px; + height: 8px; + border-width: 4px; + border-style: solid; +} +.ui-checkboxradio-disabled { + pointer-events: none; +} +.ui-datepicker { + width: 17em; + padding: .2em .2em 0; + display: none; +} +.ui-datepicker .ui-datepicker-header { + position: relative; + padding: .2em 0; +} +.ui-datepicker .ui-datepicker-prev, +.ui-datepicker .ui-datepicker-next { + position: absolute; + top: 2px; + width: 1.8em; + height: 1.8em; +} +.ui-datepicker .ui-datepicker-prev-hover, +.ui-datepicker .ui-datepicker-next-hover { + top: 1px; +} +.ui-datepicker .ui-datepicker-prev { + left: 2px; +} +.ui-datepicker .ui-datepicker-next { + right: 2px; +} +.ui-datepicker .ui-datepicker-prev-hover { + left: 1px; +} +.ui-datepicker .ui-datepicker-next-hover { + right: 1px; +} +.ui-datepicker .ui-datepicker-prev span, +.ui-datepicker .ui-datepicker-next span { + display: block; + position: absolute; + left: 50%; + margin-left: -8px; + top: 50%; + margin-top: -8px; +} +.ui-datepicker .ui-datepicker-title { + margin: 0 2.3em; + line-height: 1.8em; + text-align: center; +} +.ui-datepicker .ui-datepicker-title select { + font-size: 1em; + margin: 1px 0; +} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { + width: 45%; +} +.ui-datepicker table { + width: 100%; + font-size: .9em; + border-collapse: collapse; + margin: 0 0 .4em; +} +.ui-datepicker th { + padding: .7em .3em; + text-align: center; + font-weight: bold; + border: 0; +} +.ui-datepicker td { + border: 0; + padding: 1px; +} +.ui-datepicker td span, +.ui-datepicker td a { + display: block; + padding: .2em; + text-align: right; + text-decoration: none; +} +.ui-datepicker .ui-datepicker-buttonpane { + background-image: none; + margin: .7em 0 0 0; + padding: 0 .2em; + border-left: 0; + border-right: 0; + border-bottom: 0; +} +.ui-datepicker .ui-datepicker-buttonpane button { + float: right; + margin: .5em .2em .4em; + cursor: pointer; + padding: .2em .6em .3em .6em; + width: auto; + overflow: visible; +} +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { + float: left; +} + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { + width: auto; +} +.ui-datepicker-multi .ui-datepicker-group { + float: left; +} +.ui-datepicker-multi .ui-datepicker-group table { + width: 95%; + margin: 0 auto .4em; +} +.ui-datepicker-multi-2 .ui-datepicker-group { + width: 50%; +} +.ui-datepicker-multi-3 .ui-datepicker-group { + width: 33.3%; +} +.ui-datepicker-multi-4 .ui-datepicker-group { + width: 25%; +} +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header, +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { + border-left-width: 0; +} +.ui-datepicker-multi .ui-datepicker-buttonpane { + clear: left; +} +.ui-datepicker-row-break { + clear: both; + width: 100%; + font-size: 0; +} + +/* RTL support */ +.ui-datepicker-rtl { + direction: rtl; +} +.ui-datepicker-rtl .ui-datepicker-prev { + right: 2px; + left: auto; +} +.ui-datepicker-rtl .ui-datepicker-next { + left: 2px; + right: auto; +} +.ui-datepicker-rtl .ui-datepicker-prev:hover { + right: 1px; + left: auto; +} +.ui-datepicker-rtl .ui-datepicker-next:hover { + left: 1px; + right: auto; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane { + clear: right; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane button { + float: left; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current, +.ui-datepicker-rtl .ui-datepicker-group { + float: right; +} +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header, +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { + border-right-width: 0; + border-left-width: 1px; +} +/* Icons */ +.ui-datepicker .ui-icon { + display: block; + text-indent: -99999px; + overflow: hidden; + background-repeat: no-repeat; + left: .5em; + top: .3em; +} +.ui-dialog { + position: absolute; + top: 0; + left: 0; + padding: .2em; + outline: 0; +} +.ui-dialog .ui-dialog-titlebar { + padding: .4em 1em; + position: relative; +} +.ui-dialog .ui-dialog-title { + float: left; + margin: .1em 0; + white-space: nowrap; + width: 90%; + overflow: hidden; + text-overflow: ellipsis; +} +.ui-dialog .ui-dialog-titlebar-close { + position: absolute; + right: .3em; + top: 50%; + width: 20px; + margin: -10px 0 0 0; + padding: 1px; + height: 20px; +} +.ui-dialog .ui-dialog-content { + position: relative; + border: 0; + padding: .5em 1em; + background: none; + overflow: auto; +} +.ui-dialog .ui-dialog-buttonpane { + text-align: left; + border-width: 1px 0 0 0; + background-image: none; + margin-top: .5em; + padding: .3em 1em .5em .4em; +} +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { + float: right; +} +.ui-dialog .ui-dialog-buttonpane button { + margin: .5em .4em .5em 0; + cursor: pointer; +} +.ui-dialog .ui-resizable-n { + height: 2px; + top: 0; +} +.ui-dialog .ui-resizable-e { + width: 2px; + right: 0; +} +.ui-dialog .ui-resizable-s { + height: 2px; + bottom: 0; +} +.ui-dialog .ui-resizable-w { + width: 2px; + left: 0; +} +.ui-dialog .ui-resizable-se, +.ui-dialog .ui-resizable-sw, +.ui-dialog .ui-resizable-ne, +.ui-dialog .ui-resizable-nw { + width: 7px; + height: 7px; +} +.ui-dialog .ui-resizable-se { + right: 0; + bottom: 0; +} +.ui-dialog .ui-resizable-sw { + left: 0; + bottom: 0; +} +.ui-dialog .ui-resizable-ne { + right: 0; + top: 0; +} +.ui-dialog .ui-resizable-nw { + left: 0; + top: 0; +} +.ui-draggable .ui-dialog-titlebar { + cursor: move; +} +.ui-progressbar { + height: 2em; + text-align: left; + overflow: hidden; +} +.ui-progressbar .ui-progressbar-value { + margin: -1px; + height: 100%; +} +.ui-progressbar .ui-progressbar-overlay { + background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw=="); + height: 100%; + filter: alpha(opacity=25); /* support: IE8 */ + opacity: 0.25; +} +.ui-progressbar-indeterminate .ui-progressbar-value { + background-image: none; +} +.ui-selectmenu-menu { + padding: 0; + margin: 0; + position: absolute; + top: 0; + left: 0; + display: none; +} +.ui-selectmenu-menu .ui-menu { + overflow: auto; + overflow-x: hidden; + padding-bottom: 1px; +} +.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup { + font-size: 1em; + font-weight: bold; + line-height: 1.5; + padding: 2px 0.4em; + margin: 0.5em 0 0 0; + height: auto; + border: 0; +} +.ui-selectmenu-open { + display: block; +} +.ui-selectmenu-text { + display: block; + margin-right: 20px; + overflow: hidden; + text-overflow: ellipsis; +} +.ui-selectmenu-button.ui-button { + text-align: left; + white-space: nowrap; + width: 14em; +} +.ui-selectmenu-icon.ui-icon { + float: right; + margin-top: 0; +} +.ui-slider { + position: relative; + text-align: left; +} +.ui-slider .ui-slider-handle { + position: absolute; + z-index: 2; + width: 1.2em; + height: 1.2em; + cursor: default; + -ms-touch-action: none; + touch-action: none; +} +.ui-slider .ui-slider-range { + position: absolute; + z-index: 1; + font-size: .7em; + display: block; + border: 0; + background-position: 0 0; +} -/* - * jQuery UI CSS Framework 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - * - * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=segoe%20ui,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=6px&bgColorHeader=ece8da&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=100&borderColorHeader=d4ccb0&fcHeader=433f38&iconColorHeader=847e71&bgColorContent=f5f3e5&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=dfd9c3&fcContent=312e25&iconColorContent=808080&bgColorDefault=459e00&bgTextureDefault=04_highlight_hard.png&bgImgOpacityDefault=15&borderColorDefault=327E04&fcDefault=ffffff&iconColorDefault=eeeeee&bgColorHover=67b021&bgTextureHover=03_highlight_soft.png&bgImgOpacityHover=25&borderColorHover=327E04&fcHover=ffffff&iconColorHover=ffffff&bgColorActive=fafaf4&bgTextureActive=04_highlight_hard.png&bgImgOpacityActive=100&borderColorActive=d4ccb0&fcActive=459e00&iconColorActive=8DC262&bgColorHighlight=fcf0ba&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=e8e1b5&fcHighlight=363636&iconColorHighlight=8DC262&bgColorError=ffedad&bgTextureError=03_highlight_soft.png&bgImgOpacityError=95&borderColorError=e3a345&fcError=cd5c0a&iconColorError=cd0a0a&bgColorOverlay=2b2922&bgTextureOverlay=05_inset_soft.png&bgImgOpacityOverlay=15&opacityOverlay=90&bgColorShadow=cccccc&bgTextureShadow=04_highlight_hard.png&bgImgOpacityShadow=95&opacityShadow=20&thicknessShadow=12px&offsetTopShadow=-12px&offsetLeftShadow=-12px&cornerRadiusShadow=10px - */ +/* support: IE8 - See #6727 */ +.ui-slider.ui-state-disabled .ui-slider-handle, +.ui-slider.ui-state-disabled .ui-slider-range { + filter: inherit; +} +.ui-slider-horizontal { + height: .8em; +} +.ui-slider-horizontal .ui-slider-handle { + top: -.3em; + margin-left: -.6em; +} +.ui-slider-horizontal .ui-slider-range { + top: 0; + height: 100%; +} +.ui-slider-horizontal .ui-slider-range-min { + left: 0; +} +.ui-slider-horizontal .ui-slider-range-max { + right: 0; +} + +.ui-slider-vertical { + width: .8em; + height: 100px; +} +.ui-slider-vertical .ui-slider-handle { + left: -.3em; + margin-left: 0; + margin-bottom: -.6em; +} +.ui-slider-vertical .ui-slider-range { + left: 0; + width: 100%; +} +.ui-slider-vertical .ui-slider-range-min { + bottom: 0; +} +.ui-slider-vertical .ui-slider-range-max { + top: 0; +} +.ui-spinner { + position: relative; + display: inline-block; + overflow: hidden; + padding: 0; + vertical-align: middle; +} +.ui-spinner-input { + border: none; + background: none; + color: inherit; + padding: .222em 0; + margin: .2em 0; + vertical-align: middle; + margin-left: .4em; + margin-right: 2em; +} +.ui-spinner-button { + width: 1.6em; + height: 50%; + font-size: .5em; + padding: 0; + margin: 0; + text-align: center; + position: absolute; + cursor: default; + display: block; + overflow: hidden; + right: 0; +} +/* more specificity required here to override default borders */ +.ui-spinner a.ui-spinner-button { + border-top-style: none; + border-bottom-style: none; + border-right-style: none; +} +.ui-spinner-up { + top: 0; +} +.ui-spinner-down { + bottom: 0; +} +.ui-tabs { + position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ + padding: .2em; +} +.ui-tabs .ui-tabs-nav { + margin: 0; + padding: .2em .2em 0; +} +.ui-tabs .ui-tabs-nav li { + list-style: none; + float: left; + position: relative; + top: 0; + margin: 1px .2em 0 0; + border-bottom-width: 0; + padding: 0; + white-space: nowrap; +} +.ui-tabs .ui-tabs-nav .ui-tabs-anchor { + float: left; + padding: .5em 1em; + text-decoration: none; +} +.ui-tabs .ui-tabs-nav li.ui-tabs-active { + margin-bottom: -1px; + padding-bottom: 1px; +} +.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor, +.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor, +.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor { + cursor: text; +} +.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor { + cursor: pointer; +} +.ui-tabs .ui-tabs-panel { + display: block; + border-width: 0; + padding: 1em 1.4em; + background: none; +} +.ui-tooltip { + padding: 8px; + position: absolute; + z-index: 9999; + max-width: 300px; +} +body .ui-tooltip { + border-width: 2px; +} /* Component containers ----------------------------------*/ -.ui-widget { font-family: segoe ui, Arial, sans-serif; font-size: 1.1em; } -.ui-widget .ui-widget { font-size: 1em; } -.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: segoe ui, Arial, sans-serif; font-size: 1em; } -.ui-widget-content { border: 1px solid #dfd9c3; background: #f5f3e5 url(images/ui-bg_highlight-hard_100_f5f3e5_1x100.png) 50% top repeat-x; color: #312e25; } -.ui-widget-content a { color: #312e25; } -.ui-widget-header { border: 1px solid #d4ccb0; background: #ece8da url(images/ui-bg_gloss-wave_100_ece8da_500x100.png) 50% 50% repeat-x; color: #433f38; font-weight: bold; } -.ui-widget-header a { color: #433f38; } +.ui-widget { + font-family: Arial,Helvetica,sans-serif; + font-size: 1em; +} +.ui-widget .ui-widget { + font-size: 1em; +} +.ui-widget input, +.ui-widget select, +.ui-widget textarea, +.ui-widget button { + font-family: Arial,Helvetica,sans-serif; + font-size: 1em; +} +.ui-widget.ui-widget-content { + border: 1px solid #c5c5c5; +} +.ui-widget-content { + border: 1px solid #dddddd; + background: #ffffff; + color: #333333; +} +.ui-widget-content a { + color: #333333; +} +.ui-widget-header { + border: 1px solid #dddddd; + background: #e9e9e9; + color: #333333; + font-weight: bold; +} +.ui-widget-header a { + color: #333333; +} /* Interaction states ----------------------------------*/ -.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #327e04; background: #459e00 url(images/ui-bg_highlight-hard_15_459e00_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; } -.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #ffffff; text-decoration: none; } -.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #327e04; background: #67b021 url(images/ui-bg_highlight-soft_25_67b021_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; } -.ui-state-hover a, .ui-state-hover a:hover { color: #ffffff; text-decoration: none; } -.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #d4ccb0; background: #fafaf4 url(images/ui-bg_highlight-hard_100_fafaf4_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #459e00; } -.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #459e00; text-decoration: none; } -.ui-widget :active { outline: none; } +.ui-state-default, +.ui-widget-content .ui-state-default, +.ui-widget-header .ui-state-default, +.ui-button, + +/* We use html here because we need a greater specificity to make sure disabled +works properly when clicked or hovered */ +html .ui-button.ui-state-disabled:hover, +html .ui-button.ui-state-disabled:active { + border: 1px solid #c5c5c5; + background: #f6f6f6; + font-weight: normal; + color: #454545; +} +.ui-state-default a, +.ui-state-default a:link, +.ui-state-default a:visited, +a.ui-button, +a:link.ui-button, +a:visited.ui-button, +.ui-button { + color: #454545; + text-decoration: none; +} +.ui-state-hover, +.ui-widget-content .ui-state-hover, +.ui-widget-header .ui-state-hover, +.ui-state-focus, +.ui-widget-content .ui-state-focus, +.ui-widget-header .ui-state-focus, +.ui-button:hover, +.ui-button:focus { + border: 1px solid #cccccc; + background: #ededed; + font-weight: normal; + color: #2b2b2b; +} +.ui-state-hover a, +.ui-state-hover a:hover, +.ui-state-hover a:link, +.ui-state-hover a:visited, +.ui-state-focus a, +.ui-state-focus a:hover, +.ui-state-focus a:link, +.ui-state-focus a:visited, +a.ui-button:hover, +a.ui-button:focus { + color: #2b2b2b; + text-decoration: none; +} + +.ui-visual-focus { + box-shadow: 0 0 3px 1px rgb(94, 158, 214); +} +.ui-state-active, +.ui-widget-content .ui-state-active, +.ui-widget-header .ui-state-active, +a.ui-button:active, +.ui-button:active, +.ui-button.ui-state-active:hover { + border: 1px solid #003eff; + background: #007fff; + font-weight: normal; + color: #ffffff; +} +.ui-icon-background, +.ui-state-active .ui-icon-background { + border: #003eff; + background-color: #ffffff; +} +.ui-state-active a, +.ui-state-active a:link, +.ui-state-active a:visited { + color: #ffffff; + text-decoration: none; +} /* Interaction Cues ----------------------------------*/ -.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #e8e1b5; background: #fcf0ba url(images/ui-bg_glass_55_fcf0ba_1x400.png) 50% 50% repeat-x; color: #363636; } -.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } -.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #e3a345; background: #ffedad url(images/ui-bg_highlight-soft_95_ffedad_1x100.png) 50% top repeat-x; color: #cd5c0a; } -.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd5c0a; } -.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd5c0a; } -.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } -.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } -.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-state-highlight, +.ui-widget-content .ui-state-highlight, +.ui-widget-header .ui-state-highlight { + border: 1px solid #dad55e; + background: #fffa90; + color: #777620; +} +.ui-state-checked { + border: 1px solid #dad55e; + background: #fffa90; +} +.ui-state-highlight a, +.ui-widget-content .ui-state-highlight a, +.ui-widget-header .ui-state-highlight a { + color: #777620; +} +.ui-state-error, +.ui-widget-content .ui-state-error, +.ui-widget-header .ui-state-error { + border: 1px solid #f1a899; + background: #fddfdf; + color: #5f3f3f; +} +.ui-state-error a, +.ui-widget-content .ui-state-error a, +.ui-widget-header .ui-state-error a { + color: #5f3f3f; +} +.ui-state-error-text, +.ui-widget-content .ui-state-error-text, +.ui-widget-header .ui-state-error-text { + color: #5f3f3f; +} +.ui-priority-primary, +.ui-widget-content .ui-priority-primary, +.ui-widget-header .ui-priority-primary { + font-weight: bold; +} +.ui-priority-secondary, +.ui-widget-content .ui-priority-secondary, +.ui-widget-header .ui-priority-secondary { + opacity: .7; + filter:Alpha(Opacity=70); /* support: IE8 */ + font-weight: normal; +} +.ui-state-disabled, +.ui-widget-content .ui-state-disabled, +.ui-widget-header .ui-state-disabled { + opacity: .35; + filter:Alpha(Opacity=35); /* support: IE8 */ + background-image: none; +} +.ui-state-disabled .ui-icon { + filter:Alpha(Opacity=35); /* support: IE8 - See #6059 */ +} /* Icons ----------------------------------*/ /* states and images */ -.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_808080_256x240.png); } -.ui-widget-content .ui-icon {background-image: url(images/ui-icons_808080_256x240.png); } -.ui-widget-header .ui-icon {background-image: url(images/ui-icons_847e71_256x240.png); } -.ui-state-default .ui-icon { background-image: url(images/ui-icons_eeeeee_256x240.png); } -.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } -.ui-state-active .ui-icon {background-image: url(images/ui-icons_8dc262_256x240.png); } -.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_8dc262_256x240.png); } -.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } +.ui-icon { + width: 16px; + height: 16px; +} +.ui-icon, +.ui-widget-content .ui-icon { + background-image: url("images/ui-icons_444444_256x240.png"); +} +.ui-widget-header .ui-icon { + background-image: url("images/ui-icons_444444_256x240.png"); +} +.ui-state-hover .ui-icon, +.ui-state-focus .ui-icon, +.ui-button:hover .ui-icon, +.ui-button:focus .ui-icon { + background-image: url("images/ui-icons_555555_256x240.png"); +} +.ui-state-active .ui-icon, +.ui-button:active .ui-icon { + background-image: url("images/ui-icons_ffffff_256x240.png"); +} +.ui-state-highlight .ui-icon, +.ui-button .ui-state-highlight.ui-icon { + background-image: url("images/ui-icons_777620_256x240.png"); +} +.ui-state-error .ui-icon, +.ui-state-error-text .ui-icon { + background-image: url("images/ui-icons_cc0000_256x240.png"); +} +.ui-button .ui-icon { + background-image: url("images/ui-icons_777777_256x240.png"); +} /* positioning */ -.ui-icon-carat-1-n { background-position: 0 0; } -.ui-icon-carat-1-ne { background-position: -16px 0; } -.ui-icon-carat-1-e { background-position: -32px 0; } -.ui-icon-carat-1-se { background-position: -48px 0; } -.ui-icon-carat-1-s { background-position: -64px 0; } -.ui-icon-carat-1-sw { background-position: -80px 0; } -.ui-icon-carat-1-w { background-position: -96px 0; } -.ui-icon-carat-1-nw { background-position: -112px 0; } -.ui-icon-carat-2-n-s { background-position: -128px 0; } -.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-blank { background-position: 16px 16px; } +.ui-icon-caret-1-n { background-position: 0 0; } +.ui-icon-caret-1-ne { background-position: -16px 0; } +.ui-icon-caret-1-e { background-position: -32px 0; } +.ui-icon-caret-1-se { background-position: -48px 0; } +.ui-icon-caret-1-s { background-position: -65px 0; } +.ui-icon-caret-1-sw { background-position: -80px 0; } +.ui-icon-caret-1-w { background-position: -96px 0; } +.ui-icon-caret-1-nw { background-position: -112px 0; } +.ui-icon-caret-2-n-s { background-position: -128px 0; } +.ui-icon-caret-2-e-w { background-position: -144px 0; } .ui-icon-triangle-1-n { background-position: 0 -16px; } .ui-icon-triangle-1-ne { background-position: -16px -16px; } .ui-icon-triangle-1-e { background-position: -32px -16px; } .ui-icon-triangle-1-se { background-position: -48px -16px; } -.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-s { background-position: -65px -16px; } .ui-icon-triangle-1-sw { background-position: -80px -16px; } .ui-icon-triangle-1-w { background-position: -96px -16px; } .ui-icon-triangle-1-nw { background-position: -112px -16px; } @@ -123,7 +1118,7 @@ .ui-icon-arrow-1-ne { background-position: -16px -32px; } .ui-icon-arrow-1-e { background-position: -32px -32px; } .ui-icon-arrow-1-se { background-position: -48px -32px; } -.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-s { background-position: -65px -32px; } .ui-icon-arrow-1-sw { background-position: -80px -32px; } .ui-icon-arrow-1-w { background-position: -96px -32px; } .ui-icon-arrow-1-nw { background-position: -112px -32px; } @@ -135,7 +1130,7 @@ .ui-icon-arrowstop-1-e { background-position: -208px -32px; } .ui-icon-arrowstop-1-s { background-position: -224px -32px; } .ui-icon-arrowstop-1-w { background-position: -240px -32px; } -.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-n { background-position: 1px -48px; } .ui-icon-arrowthick-1-ne { background-position: -16px -48px; } .ui-icon-arrowthick-1-e { background-position: -32px -48px; } .ui-icon-arrowthick-1-se { background-position: -48px -48px; } @@ -225,8 +1220,8 @@ .ui-icon-help { background-position: -48px -144px; } .ui-icon-check { background-position: -64px -144px; } .ui-icon-bullet { background-position: -80px -144px; } -.ui-icon-radio-off { background-position: -96px -144px; } -.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-radio-on { background-position: -96px -144px; } +.ui-icon-radio-off { background-position: -112px -144px; } .ui-icon-pin-w { background-position: -128px -144px; } .ui-icon-pin-s { background-position: -144px -144px; } .ui-icon-play { background-position: 0 -160px; } @@ -280,289 +1275,38 @@ ----------------------------------*/ /* Corner radius */ -.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; -khtml-border-top-left-radius: 6px; border-top-left-radius: 6px; } -.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; -khtml-border-top-right-radius: 6px; border-top-right-radius: 6px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 6px; -webkit-border-bottom-left-radius: 6px; -khtml-border-bottom-left-radius: 6px; border-bottom-left-radius: 6px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 6px; -webkit-border-bottom-right-radius: 6px; -khtml-border-bottom-right-radius: 6px; border-bottom-right-radius: 6px; } - -/* Overlays */ -.ui-widget-overlay { background: #2b2922 url(images/ui-bg_inset-soft_15_2b2922_1x100.png) 50% bottom repeat-x; opacity: .90;filter:Alpha(Opacity=90); } -.ui-widget-shadow { margin: -12px 0 0 -12px; padding: 12px; background: #cccccc url(images/ui-bg_highlight-hard_95_cccccc_1x100.png) 50% top repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 10px; -khtml-border-radius: 10px; -webkit-border-radius: 10px; border-radius: 10px; }/* - * jQuery UI Resizable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Resizable#theming - */ -.ui-resizable { position: relative;} -.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } -.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } -.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } -.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } -.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } -.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } -.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } -.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } -.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } -.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* - * jQuery UI Selectable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectable#theming - */ -.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } -/* - * jQuery UI Accordion 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Accordion#theming - */ -/* IE/Win - Fix animation bug - #4615 */ -.ui-accordion { width: 100%; } -.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } -.ui-accordion .ui-accordion-li-fix { display: inline; } -.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } -.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } -.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } -.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } -.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } -.ui-accordion .ui-accordion-content-active { display: block; } -/* - * jQuery UI Autocomplete 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete#theming - */ -.ui-autocomplete { position: absolute; cursor: default; } - -/* workarounds */ -* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ - -/* - * jQuery UI Menu 1.8.14 - * - * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Menu#theming - */ -.ui-menu { - list-style:none; - padding: 2px; - margin: 0; - display:block; - float: left; +.ui-corner-all, +.ui-corner-top, +.ui-corner-left, +.ui-corner-tl { + border-top-left-radius: 3px; } -.ui-menu .ui-menu { - margin-top: -3px; +.ui-corner-all, +.ui-corner-top, +.ui-corner-right, +.ui-corner-tr { + border-top-right-radius: 3px; } -.ui-menu .ui-menu-item { - margin:0; - padding: 0; - zoom: 1; - float: left; - clear: left; - width: 100%; -} -.ui-menu .ui-menu-item a { - text-decoration:none; - display:block; - padding:.2em .4em; - line-height:1.5; - zoom:1; +.ui-corner-all, +.ui-corner-bottom, +.ui-corner-left, +.ui-corner-bl { + border-bottom-left-radius: 3px; } -.ui-menu .ui-menu-item a.ui-state-hover, -.ui-menu .ui-menu-item a.ui-state-active { - font-weight: normal; - margin: -1px; +.ui-corner-all, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-br { + border-bottom-right-radius: 3px; } -/* - * jQuery UI Button 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button#theming - */ -.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ -.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ -button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ -.ui-button-icons-only { width: 3.4em; } -button.ui-button-icons-only { width: 3.7em; } - -/*button text element */ -.ui-button .ui-button-text { display: block; line-height: 1.4; } -.ui-button-text-only .ui-button-text { padding: .4em 1em; } -.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } -.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } -.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } -.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } -/* no icon support for input elements, provide padding by default */ -input.ui-button { padding: .4em 1em; } - -/*button icon element(s) */ -.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } -.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } -.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } -.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } -.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } - -/*button sets*/ -.ui-buttonset { margin-right: 7px; } -.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } -/* workarounds */ -button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ -/* - * jQuery UI Dialog 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog#theming - */ -.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } -.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } -.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } -.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } -.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } -.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } -.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } -.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } -.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } -.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } -.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } -.ui-draggable .ui-dialog-titlebar { cursor: move; } -/* - * jQuery UI Slider 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider#theming - */ -.ui-slider { position: relative; text-align: left; } -.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } -.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } - -.ui-slider-horizontal { height: .8em; } -.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } -.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } -.ui-slider-horizontal .ui-slider-range-min { left: 0; } -.ui-slider-horizontal .ui-slider-range-max { right: 0; } - -.ui-slider-vertical { width: .8em; height: 100px; } -.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } -.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } -.ui-slider-vertical .ui-slider-range-min { bottom: 0; } -.ui-slider-vertical .ui-slider-range-max { top: 0; }/* - * jQuery UI Tabs 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs#theming - */ -.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ -.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } -.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } -.ui-tabs .ui-tabs-nav li a { float: left; padding: .4em 1em 0.4em .4em; text-decoration: none; } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } -.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ -.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } -.ui-tabs .ui-tabs-hide { display: none !important; } -/* - * jQuery UI Datepicker 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker#theming - */ -.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } -.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } -.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } -.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } -.ui-datepicker .ui-datepicker-prev { left:2px; } -.ui-datepicker .ui-datepicker-next { right:2px; } -.ui-datepicker .ui-datepicker-prev-hover { left:1px; } -.ui-datepicker .ui-datepicker-next-hover { right:1px; } -.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } -.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } -.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } -.ui-datepicker select.ui-datepicker-month-year {width: 100%;} -.ui-datepicker select.ui-datepicker-month, -.ui-datepicker select.ui-datepicker-year { width: 49%;} -.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } -.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } -.ui-datepicker td { border: 0; padding: 1px; } -.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } -.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } -.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } -.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } - -/* with multiple calendars */ -.ui-datepicker.ui-datepicker-multi { width:auto; } -.ui-datepicker-multi .ui-datepicker-group { float:left; } -.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } -.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } -.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } -.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } -.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } -.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } - -/* RTL support */ -.ui-datepicker-rtl { direction: rtl; } -.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } -.ui-datepicker-rtl .ui-datepicker-group { float:right; } -.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } -.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } - -/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ -.ui-datepicker-cover { - display: none; /*sorry for IE5*/ - display/**/: block; /*sorry for IE5*/ - position: absolute; /*must have*/ - z-index: -1; /*must have*/ - filter: mask(); /*must have*/ - top: -4px; /*must have*/ - left: -4px; /*must have*/ - width: 200px; /*must have*/ - height: 200px; /*must have*/ -}/* - * jQuery UI Progressbar 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar#theming - */ -.ui-progressbar { height:2em; text-align: left; } -.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file +/* Overlays */ +.ui-widget-overlay { + background: #aaaaaa; + opacity: .3; + filter: Alpha(Opacity=30); /* support: IE8 */ +} +.ui-widget-shadow { + -webkit-box-shadow: 0px 0px 5px #666666; + box-shadow: 0px 0px 5px #666666; +} diff --git a/www/Themes/Centreon-2/style.css b/www/Themes/Centreon-2/style.css index e0accae0ff5d500248e3bc4c2bad7e42f1a20a50..a666cc1c13b643b5dda58ca50411a8bc5fb8bb39 100644 --- a/www/Themes/Centreon-2/style.css +++ b/www/Themes/Centreon-2/style.css @@ -1003,6 +1003,11 @@ div.menuLeft { background: #fff !important; } +.ui-state-default a { + color: #ffffff !important; + font-weight: bold; +} + .ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #00a499 !important; } diff --git a/www/include/common/javascript/centreon/macroPasswordField.js b/www/include/common/javascript/centreon/macroPasswordField.js index abe03df4cc5742b8f61d0e03e868c5468c0673d9..9b0af0bbcc1d24ce71d7850875839039b5939c2d 100644 --- a/www/include/common/javascript/centreon/macroPasswordField.js +++ b/www/include/common/javascript/centreon/macroPasswordField.js @@ -1,5 +1,5 @@ /* - * Copyright 2005-2015 Centreon + * Copyright 2005-2018 Centreon * Centreon is developped by : Julien Mathis and Romain Le Merlus under * GPL Licence 2.0. * @@ -41,12 +41,12 @@ jQuery(function() { function change_macro_input_type(box, must_disable) { var tmp = box.id.split('_'); var macro_dom_id = tmp[1]; - var input = jQuery("#macroValue_" + macro_dom_id); + var input = jQuery("#macroValue_" + macro_dom_id.replace(/(#)/g, "\\$1")); if (must_disable === true) { jQuery(box).parent().hide(); } - + if (typeof input[0] != 'undefined') { if (box.checked) { input[0].type = 'password'; diff --git a/www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js b/www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js new file mode 100644 index 0000000000000000000000000000000000000000..71a6e719215d91afb28a79ac35a18a998e188a04 --- /dev/null +++ b/www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js @@ -0,0 +1,76 @@ +;(function($){ + $.extend( $.ui.tabs.prototype, { + rotation: null, + rotationDelay: null, + continuing: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + if((ms > 1 || self.rotationDelay === null) && ms !== undefined){//only set rotationDelay if this is the first time through or if not immediately moving on from an unpause + self.rotationDelay = ms; + } + + if(continuing !== undefined){ + self.continuing = continuing; + } + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.active; + self.option( "active", ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.active; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsactivate", rotate ); + this.anchors.bind( o.event + ".tabs", $.proxy(self.unpause, self) ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsactivate", rotate ); + this.anchors.unbind( o.event + ".tabs", $.proxy(self.pause, self) ); + delete this._rotate; + delete this._unrotate; + } + + //rotate immediately and then have normal rotation delay + if(ms === 1){ + //set ms back to what it was originally set to + ms = self.rotationDelay; + } + + return this; + }, + pause: function() { + var self = this, + o = this.options; + + self.rotate(0); + }, + unpause: function(){ + var self = this, + o = this.options; + + self.rotate(1, self.continuing); + } + }); +})(jQuery); diff --git a/www/include/common/javascript/jquery/jquery-ui.js b/www/include/common/javascript/jquery/jquery-ui.js index f9e4f1e840001850557fc95f918af50bc7628a7c..e54edf070a0bbd2eb4d61303252e0617f866f9ce 100644 --- a/www/include/common/javascript/jquery/jquery-ui.js +++ b/www/include/common/javascript/jquery/jquery-ui.js @@ -1,789 +1,18706 @@ +/*! jQuery UI - v1.12.1 - 2018-03-18 +* http://jqueryui.com +* Includes: widget.js, position.js, data.js, disable-selection.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/draggable.js, widgets/droppable.js, widgets/resizable.js, widgets/selectable.js, widgets/sortable.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/selectmenu.js, widgets/slider.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js +* Copyright jQuery Foundation and other contributors; Licensed MIT */ + +(function( factory ) { + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define([ "jquery" ], factory ); + } else { + + // Browser globals + factory( jQuery ); + } +}(function( $ ) { + +$.ui = $.ui || {}; + +var version = $.ui.version = "1.12.1"; + + /*! - * jQuery UI 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); -b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, -"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", -function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, -outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); -return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= -0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); -;/*! - * jQuery UI Widget 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ -(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, -a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; -e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, -this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, -widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, -enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -;/*! - * jQuery UI Mouse 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ -(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ -this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!== -false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& -!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Draggable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= -this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= -this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, -_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= -false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| -!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& -a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= -"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), -10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ -this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left; -if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/ -b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version< -526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b, -c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.14"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert}); -h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval= -false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true); -this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top; -c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&& -this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity= -a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!= -"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left< -c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()- -c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this, -width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&& -o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t= -p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&& -(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"), -10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); -;/* - * jQuery UI Droppable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Droppables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.mouse.js - * jquery.ui.draggable.js - */ -(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); -a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& -this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); -this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= -d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", -a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.14"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; -switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= -i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= -"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| -a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parentsUntil("body").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c= -!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parentsUntil("body").unbind("scroll.droppable"); -a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery); -;/* - * jQuery UI Resizable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Resizables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, -_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== -String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= -false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= -{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; -if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, -_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, -{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: -Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width= -b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&& -a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= -null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)|| -0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ -c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); -b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), -10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- -f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? -e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= -e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, -step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= -e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; -var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: -a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- -d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, -f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, -display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= -e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= -d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); -;/* - * jQuery UI Selectable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), -selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, -c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", -c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= -this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); -a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& -!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= -e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Sortable 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Sortables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); -this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== -"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& -!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, -left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; -this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= -document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); -return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top< -b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()- -b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this, -a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], -e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); -c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): -this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, -dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, -toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| -this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection(); -var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)}, -_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); -if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), -this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element), -this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&& -this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= -this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= -d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| -0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", -a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- -f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b= -this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width== -""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top= -this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a= -{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"), -10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"? -document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), -10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b= -this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&& -this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset(); -var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- -this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g- -this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0], -this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]= -"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove", -f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, -this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", -a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()}, -_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Accordion 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Accordion - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); -a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); -if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", -function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= -this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); -this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); -b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); -a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ -c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; -if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); -if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), -e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| -e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", -"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14", -animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); -f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", -paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); -;/* - * jQuery UI Autocomplete 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.position.js - */ -(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= -false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= -a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; -this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& -a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); -d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& -b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= -this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close(); -this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label|| -b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this; -d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, -"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); -(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", --1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); -this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, -this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); -;/* - * jQuery UI Button 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!== -"boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover"); -this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g= -false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed",true); -var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE|| -d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type=== -"radio"){var a=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element}, -widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title"); -b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true): -b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), -c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only": -"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== -"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); -b.Widget.prototype.destroy.call(this)}})})(jQuery); -;/* - * jQuery UI Dialog 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), -h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", -e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== -b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= -1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== -f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, -function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, -originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", -f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): -[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); -if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): -e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= -this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- -b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), -create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), -height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); -b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a= -a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); -;/* - * jQuery UI Slider 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=a.values&&a.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ -this.orientation+" ui-widget ui-widget-content ui-corner-all"+(a.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(a.range){if(a.range===true){if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>"); -this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", -g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? -(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- -m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; -this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= -this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= -this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); -c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c<f))c=f;if(c!==this.values(a)){f=this.values();f[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:f});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],value:c}); -b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value= -this._trimAlignValue(b);this._refreshValue();this._change(null,0)}else return this._value()},values:function(b,a){var c,f,e;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b): -this.value();else return this._values()},_setOption:function(b,a){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); -this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b]; -return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, -_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); -if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, -1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Tabs 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& -a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); -;/* - * jQuery UI Datepicker 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker - * - * Depends: - * jquery.ui.core.js - */ -(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= -"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", -"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", -minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout",function(b){b= -d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover"); -b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults, -a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0, -selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]= -h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c= -this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a, -"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker", -function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput); -a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", -this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus", -this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b= -b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", -cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false}, -_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e, -"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a, -b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv); -c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target); -c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey|| -a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b= -d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); -d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c= -d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c= -{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover"); -if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv); -J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); -a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]|| -c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+ -i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b= -this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", -left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&& -d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth= -b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear= -!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a); -a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a)); -d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()% -100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1<a.length&&a.charAt(B+1)==p)&&B++;return p},m=function(p){var D=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+= -p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s=function(){if(b.charAt(q)!=a.charAt(B))throw"Unexpected literal at position "+q;q++},q=0,B=0;B<a.length;B++)if(k)if(a.charAt(B)=="'"&&!o("'"))k=false; -else s();else switch(a.charAt(B)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q); -if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", -TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length< -n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h, -c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+= -"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth= -f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g= -(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j, -l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= -a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), -b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= -this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+ -(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+ -(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+A+'.datepicker._hideDatepicker();">'+this._get(a, -"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B= -this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O="";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right": -"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>": -"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+ -this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()==P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+ -this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+A+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?" ":L?'<span class="ui-state-default">'+r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+ -r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"), -l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+ -n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()): -g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c== -"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear"); -if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); -c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, -"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= -function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, -[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery); -;/* - * jQuery UI Progressbar 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery); -;/* - * jQuery UI Effects 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/ - */ -jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], -16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, -a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= -a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", -"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, -0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, -211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, -d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; -f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, -[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b= -0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); -c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, -a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); -a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", -"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* -((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= -e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= -e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/ -h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5* -h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c, -e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); -;/* - * jQuery UI Effects Blind 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Blind - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, -g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); -;/* - * jQuery UI Effects Bounce 1.8.14 + * jQuery UI Widget 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Widget +//>>group: Core +//>>description: Provides a factory for creating stateful widgets with a common API. +//>>docs: http://api.jqueryui.com/jQuery.widget/ +//>>demos: http://jqueryui.com/widget/ + + + +var widgetUuid = 0; +var widgetSlice = Array.prototype.slice; + +$.cleanData = ( function( orig ) { + return function( elems ) { + var events, elem, i; + for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) { + try { + + // Only trigger remove when necessary to save time + events = $._data( elem, "events" ); + if ( events && events.remove ) { + $( elem ).triggerHandler( "remove" ); + } + + // Http://bugs.jquery.com/ticket/8235 + } catch ( e ) {} + } + orig( elems ); + }; +} )( $.cleanData ); + +$.widget = function( name, base, prototype ) { + var existingConstructor, constructor, basePrototype; + + // ProxiedPrototype allows the provided prototype to remain unmodified + // so that it can be used as a mixin for multiple widgets (#8876) + var proxiedPrototype = {}; + + var namespace = name.split( "." )[ 0 ]; + name = name.split( "." )[ 1 ]; + var fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + if ( $.isArray( prototype ) ) { + prototype = $.extend.apply( null, [ {} ].concat( prototype ) ); + } + + // Create selector for plugin + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + + // Allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // Allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + // Extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + + // Copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + + // Track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + } ); + + basePrototype = new base(); + + // We need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( !$.isFunction( value ) ) { + proxiedPrototype[ prop ] = value; + return; + } + proxiedPrototype[ prop ] = ( function() { + function _super() { + return base.prototype[ prop ].apply( this, arguments ); + } + + function _superApply( args ) { + return base.prototype[ prop ].apply( this, args ); + } + + return function() { + var __super = this._super; + var __superApply = this._superApply; + var returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + } )(); + } ); + constructor.prototype = $.widget.extend( basePrototype, { + + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name + }, proxiedPrototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + widgetFullName: fullName + } ); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // Redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, + child._proto ); + } ); + + // Remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); + + return constructor; +}; + +$.widget.extend = function( target ) { + var input = widgetSlice.call( arguments, 1 ); + var inputIndex = 0; + var inputLength = input.length; + var key; + var value; + + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string"; + var args = widgetSlice.call( arguments, 1 ); + var returnValue = this; + + if ( isMethodCall ) { + + // If this is an empty collection, we need to have the instance method + // return undefined instead of the jQuery instance + if ( !this.length && options === "instance" ) { + returnValue = undefined; + } else { + this.each( function() { + var methodValue; + var instance = $.data( this, fullName ); + + if ( options === "instance" ) { + returnValue = instance; + return false; + } + + if ( !instance ) { + return $.error( "cannot call methods on " + name + + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + + if ( !$.isFunction( instance[ options ] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + + " widget instance" ); + } + + methodValue = instance[ options ].apply( instance, args ); + + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + } ); + } + } else { + + // Allow multiple hashes to be passed on init + if ( args.length ) { + options = $.widget.extend.apply( null, [ options ].concat( args ) ); + } + + this.each( function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} ); + if ( instance._init ) { + instance._init(); + } + } else { + $.data( this, fullName, new object( options, this ) ); + } + } ); + } + + return returnValue; + }; +}; + +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "<div>", + + options: { + classes: {}, + disabled: false, + + // Callbacks + create: null + }, + + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = widgetUuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + this.classesElementLookup = {}; + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + } ); + this.document = $( element.style ? + + // Element within the document + element.ownerDocument : + + // Element is window or document + element.document || element ); + this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow ); + } + + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this._create(); + + if ( this.options.disabled ) { + this._setOptionDisabled( this.options.disabled ); + } + + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + + _getCreateOptions: function() { + return {}; + }, + + _getCreateEventData: $.noop, + + _create: $.noop, + + _init: $.noop, + + destroy: function() { + var that = this; + + this._destroy(); + $.each( this.classesElementLookup, function( key, value ) { + that._removeClass( value, key ); + } ); + + // We can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .off( this.eventNamespace ) + .removeData( this.widgetFullName ); + this.widget() + .off( this.eventNamespace ) + .removeAttr( "aria-disabled" ); + + // Clean up events and states + this.bindings.off( this.eventNamespace ); + }, + + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + var parts; + var curOption; + var i; + + if ( arguments.length === 0 ) { + + // Don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + + // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( arguments.length === 1 ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( arguments.length === 1 ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + + _setOption: function( key, value ) { + if ( key === "classes" ) { + this._setOptionClasses( value ); + } + + this.options[ key ] = value; + + if ( key === "disabled" ) { + this._setOptionDisabled( value ); + } + + return this; + }, + + _setOptionClasses: function( value ) { + var classKey, elements, currentElements; + + for ( classKey in value ) { + currentElements = this.classesElementLookup[ classKey ]; + if ( value[ classKey ] === this.options.classes[ classKey ] || + !currentElements || + !currentElements.length ) { + continue; + } + + // We are doing this to create a new jQuery object because the _removeClass() call + // on the next line is going to destroy the reference to the current elements being + // tracked. We need to save a copy of this collection so that we can add the new classes + // below. + elements = $( currentElements.get() ); + this._removeClass( currentElements, classKey ); + + // We don't use _addClass() here, because that uses this.options.classes + // for generating the string of classes. We want to use the value passed in from + // _setOption(), this is the new value of the classes option which was passed to + // _setOption(). We pass this value directly to _classes(). + elements.addClass( this._classes( { + element: elements, + keys: classKey, + classes: value, + add: true + } ) ); + } + }, + + _setOptionDisabled: function( value ) { + this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value ); + + // If the widget is becoming disabled, then nothing is interactive + if ( value ) { + this._removeClass( this.hoverable, null, "ui-state-hover" ); + this._removeClass( this.focusable, null, "ui-state-focus" ); + } + }, + + enable: function() { + return this._setOptions( { disabled: false } ); + }, + + disable: function() { + return this._setOptions( { disabled: true } ); + }, + + _classes: function( options ) { + var full = []; + var that = this; + + options = $.extend( { + element: this.element, + classes: this.options.classes || {} + }, options ); + + function processClassString( classes, checkOption ) { + var current, i; + for ( i = 0; i < classes.length; i++ ) { + current = that.classesElementLookup[ classes[ i ] ] || $(); + if ( options.add ) { + current = $( $.unique( current.get().concat( options.element.get() ) ) ); + } else { + current = $( current.not( options.element ).get() ); + } + that.classesElementLookup[ classes[ i ] ] = current; + full.push( classes[ i ] ); + if ( checkOption && options.classes[ classes[ i ] ] ) { + full.push( options.classes[ classes[ i ] ] ); + } + } + } + + this._on( options.element, { + "remove": "_untrackClassesElement" + } ); + + if ( options.keys ) { + processClassString( options.keys.match( /\S+/g ) || [], true ); + } + if ( options.extra ) { + processClassString( options.extra.match( /\S+/g ) || [] ); + } + + return full.join( " " ); + }, + + _untrackClassesElement: function( event ) { + var that = this; + $.each( that.classesElementLookup, function( key, value ) { + if ( $.inArray( event.target, value ) !== -1 ) { + that.classesElementLookup[ key ] = $( value.not( event.target ).get() ); + } + } ); + }, + + _removeClass: function( element, keys, extra ) { + return this._toggleClass( element, keys, extra, false ); + }, + + _addClass: function( element, keys, extra ) { + return this._toggleClass( element, keys, extra, true ); + }, + + _toggleClass: function( element, keys, extra, add ) { + add = ( typeof add === "boolean" ) ? add : extra; + var shift = ( typeof element === "string" || element === null ), + options = { + extra: shift ? keys : extra, + keys: shift ? element : keys, + element: shift ? this.element : element, + add: add + }; + options.element.toggleClass( this._classes( options ), add ); + return this; + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement; + var instance = this; + + // No suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // No element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + + // Allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // Copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^([\w:-]*)\s*(.*)$/ ); + var eventName = match[ 1 ] + instance.eventNamespace; + var selector = match[ 2 ]; + + if ( selector ) { + delegateElement.on( eventName, selector, handlerProxy ); + } else { + element.on( eventName, handlerProxy ); + } + } ); + }, + + _off: function( element, eventName ) { + eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) + + this.eventNamespace; + element.off( eventName ).off( eventName ); + + // Clear the stack to avoid memory leaks (#10056) + this.bindings = $( this.bindings.not( element ).get() ); + this.focusable = $( this.focusable.not( element ).get() ); + this.hoverable = $( this.hoverable.not( element ).get() ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + this._addClass( $( event.currentTarget ), null, "ui-state-hover" ); + }, + mouseleave: function( event ) { + this._removeClass( $( event.currentTarget ), null, "ui-state-hover" ); + } + } ); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + this._addClass( $( event.currentTarget ), null, "ui-state-focus" ); + }, + focusout: function( event ) { + this._removeClass( $( event.currentTarget ), null, "ui-state-focus" ); + } + } ); + }, + + _trigger: function( type, event, data ) { + var prop, orig; + var callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + + // The original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // Copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + + var hasOptions; + var effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + + if ( options.delay ) { + element.delay( options.delay ); + } + + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue( function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + } ); + } + }; +} ); + +var widget = $.widget; + + +/*! + * jQuery UI Position 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + * http://api.jqueryui.com/position/ + */ + +//>>label: Position +//>>group: Core +//>>description: Positions elements relative to other elements. +//>>docs: http://api.jqueryui.com/position/ +//>>demos: http://jqueryui.com/position/ + + +( function() { +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+(\.[\d]+)?%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} + +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +function getDimensions( elem ) { + var raw = elem[ 0 ]; + if ( raw.nodeType === 9 ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: 0, left: 0 } + }; + } + if ( $.isWindow( raw ) ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: elem.scrollTop(), left: elem.scrollLeft() } + }; + } + if ( raw.preventDefault ) { + return { + width: 0, + height: 0, + offset: { top: raw.pageY, left: raw.pageX } + }; + } + return { + width: elem.outerWidth(), + height: elem.outerHeight(), + offset: elem.offset() + }; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "<div " + + "style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" + + "<div style='height:100px;width:auto;'></div></div>" ), + innerDiv = div.children()[ 0 ]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[ 0 ].clientWidth; + } + + div.remove(); + + return ( cachedScrollbarWidth = w1 - w2 ); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-x" ), + overflowY = within.isWindow || within.isDocument ? "" : + within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[ 0 ].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[ 0 ].scrollHeight ); + return { + width: hasOverflowY ? $.position.scrollbarWidth() : 0, + height: hasOverflowX ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[ 0 ] ), + isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9, + hasOffset = !isWindow && !isDocument; + return { + element: withinElement, + isWindow: isWindow, + isDocument: isDocument, + offset: hasOffset ? $( element ).offset() : { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: withinElement.outerWidth(), + height: withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // Make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + dimensions = getDimensions( target ); + if ( target[ 0 ].preventDefault ) { + + // Force left top to allow flipping + options.at = "left top"; + } + targetWidth = dimensions.width; + targetHeight = dimensions.height; + targetOffset = dimensions.offset; + + // Clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // Force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1 ) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // Calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // Reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + } ); + + // Normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each( function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem: elem + } ); + } + } ); + + if ( options.using ) { + + // Adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + } ); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // Element is wider than within + if ( data.collisionWidth > outerWidth ) { + + // Element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - + withinOffset; + position.left += overLeft - newOverRight; + + // Element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + + // Element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + + // Too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + + // Too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + + // Adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // Element is taller than within + if ( data.collisionHeight > outerHeight ) { + + // Element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - + withinOffset; + position.top += overTop - newOverBottom; + + // Element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + + // Element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + + // Too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + + // Too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + + // Adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - + outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - + outerHeight - withinOffset; + if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) { + position.top += myOffset + atOffset + offset; + } + } else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + + offset - offsetTop; + if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +} )(); + +var position = $.ui.position; + + +/*! + * jQuery UI :data 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: :data Selector +//>>group: Core +//>>description: Selects elements which have data stored under the specified key. +//>>docs: http://api.jqueryui.com/data-selector/ + + +var data = $.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo( function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + } ) : + + // Support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + } +} ); + +/*! + * jQuery UI Disable Selection 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: disableSelection +//>>group: Core +//>>description: Disable selection of text content within the set of matched elements. +//>>docs: http://api.jqueryui.com/disableSelection/ + +// This file is deprecated + + +var disableSelection = $.fn.extend( { + disableSelection: ( function() { + var eventType = "onselectstart" in document.createElement( "div" ) ? + "selectstart" : + "mousedown"; + + return function() { + return this.on( eventType + ".ui-disableSelection", function( event ) { + event.preventDefault(); + } ); + }; + } )(), + + enableSelection: function() { + return this.off( ".ui-disableSelection" ); + } +} ); + + +/*! + * jQuery UI Focusable 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: :focusable Selector +//>>group: Core +//>>description: Selects elements which can be focused. +//>>docs: http://api.jqueryui.com/focusable-selector/ + + + +// Selectors +$.ui.focusable = function( element, hasTabindex ) { + var map, mapName, img, focusableIfVisible, fieldset, + nodeName = element.nodeName.toLowerCase(); + + if ( "area" === nodeName ) { + map = element.parentNode; + mapName = map.name; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap='#" + mapName + "']" ); + return img.length > 0 && img.is( ":visible" ); + } + + if ( /^(input|select|textarea|button|object)$/.test( nodeName ) ) { + focusableIfVisible = !element.disabled; + + if ( focusableIfVisible ) { + + // Form controls within a disabled fieldset are disabled. + // However, controls within the fieldset's legend do not get disabled. + // Since controls generally aren't placed inside legends, we skip + // this portion of the check. + fieldset = $( element ).closest( "fieldset" )[ 0 ]; + if ( fieldset ) { + focusableIfVisible = !fieldset.disabled; + } + } + } else if ( "a" === nodeName ) { + focusableIfVisible = element.href || hasTabindex; + } else { + focusableIfVisible = hasTabindex; + } + + return focusableIfVisible && $( element ).is( ":visible" ) && visible( $( element ) ); +}; + +// Support: IE 8 only +// IE 8 doesn't resolve inherit to visible/hidden for computed values +function visible( element ) { + var visibility = element.css( "visibility" ); + while ( visibility === "inherit" ) { + element = element.parent(); + visibility = element.css( "visibility" ); + } + return visibility !== "hidden"; +} + +$.extend( $.expr[ ":" ], { + focusable: function( element ) { + return $.ui.focusable( element, $.attr( element, "tabindex" ) != null ); + } +} ); + +var focusable = $.ui.focusable; + + + + +// Support: IE8 Only +// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop +// with a string, so we need to find the proper form. +var form = $.fn.form = function() { + return typeof this[ 0 ].form === "string" ? this.closest( "form" ) : $( this[ 0 ].form ); +}; + + +/*! + * jQuery UI Form Reset Mixin 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Form Reset Mixin +//>>group: Core +//>>description: Refresh input widgets when their form is reset +//>>docs: http://api.jqueryui.com/form-reset-mixin/ + + + +var formResetMixin = $.ui.formResetMixin = { + _formResetHandler: function() { + var form = $( this ); + + // Wait for the form reset to actually happen before refreshing + setTimeout( function() { + var instances = form.data( "ui-form-reset-instances" ); + $.each( instances, function() { + this.refresh(); + } ); + } ); + }, + + _bindFormResetHandler: function() { + this.form = this.element.form(); + if ( !this.form.length ) { + return; + } + + var instances = this.form.data( "ui-form-reset-instances" ) || []; + if ( !instances.length ) { + + // We don't use _on() here because we use a single event handler per form + this.form.on( "reset.ui-form-reset", this._formResetHandler ); + } + instances.push( this ); + this.form.data( "ui-form-reset-instances", instances ); + }, + + _unbindFormResetHandler: function() { + if ( !this.form.length ) { + return; + } + + var instances = this.form.data( "ui-form-reset-instances" ); + instances.splice( $.inArray( this, instances ), 1 ); + if ( instances.length ) { + this.form.data( "ui-form-reset-instances", instances ); + } else { + this.form + .removeData( "ui-form-reset-instances" ) + .off( "reset.ui-form-reset" ); + } + } +}; + + +/*! + * jQuery UI Support for jQuery core 1.7.x 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + */ + +//>>label: jQuery 1.7 Support +//>>group: Core +//>>description: Support version 1.7.x of jQuery core + + + +// Support: jQuery 1.7 only +// Not a great way to check versions, but since we only support 1.7+ and only +// need to detect <1.8, this is a simple check that should suffice. Checking +// for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0 +// and we'll never reach 1.70.0 (if we do, we certainly won't be supporting +// 1.7 anymore). See #11197 for why we're not using feature detection. +if ( $.fn.jquery.substring( 0, 3 ) === "1.7" ) { + + // Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight() + // Unlike jQuery Core 1.8+, these only support numeric values to set the + // dimensions in pixels + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + } ); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each( function() { + $( this ).css( type, reduce( this, size ) + "px" ); + } ); + }; + + $.fn[ "outer" + name ] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each( function() { + $( this ).css( type, reduce( this, size, true, margin ) + "px" ); + } ); + }; + } ); + + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +; +/*! + * jQuery UI Keycode 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Keycode +//>>group: Core +//>>description: Provide keycodes as keynames +//>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/ + + +var keycode = $.ui.keyCode = { + BACKSPACE: 8, + COMMA: 188, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + LEFT: 37, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SPACE: 32, + TAB: 9, + UP: 38 +}; + + + + +// Internal use only +var escapeSelector = $.ui.escapeSelector = ( function() { + var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g; + return function( selector ) { + return selector.replace( selectorEscape, "\\$1" ); + }; +} )(); + + +/*! + * jQuery UI Labels 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: labels +//>>group: Core +//>>description: Find all the labels associated with a given input +//>>docs: http://api.jqueryui.com/labels/ + + + +var labels = $.fn.labels = function() { + var ancestor, selector, id, labels, ancestors; + + // Check control.labels first + if ( this[ 0 ].labels && this[ 0 ].labels.length ) { + return this.pushStack( this[ 0 ].labels ); + } + + // Support: IE <= 11, FF <= 37, Android <= 2.3 only + // Above browsers do not support control.labels. Everything below is to support them + // as well as document fragments. control.labels does not work on document fragments + labels = this.eq( 0 ).parents( "label" ); + + // Look for the label based on the id + id = this.attr( "id" ); + if ( id ) { + + // We don't search against the document in case the element + // is disconnected from the DOM + ancestor = this.eq( 0 ).parents().last(); + + // Get a full set of top level ancestors + ancestors = ancestor.add( ancestor.length ? ancestor.siblings() : this.siblings() ); + + // Create a selector for the label based on the id + selector = "label[for='" + $.ui.escapeSelector( id ) + "']"; + + labels = labels.add( ancestors.find( selector ).addBack( selector ) ); + + } + + // Return whatever we have found for labels + return this.pushStack( labels ); +}; + + +/*! + * jQuery UI Scroll Parent 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: scrollParent +//>>group: Core +//>>description: Get the closest ancestor element that is scrollable. +//>>docs: http://api.jqueryui.com/scrollParent/ + + + +var scrollParent = $.fn.scrollParent = function( includeHidden ) { + var position = this.css( "position" ), + excludeStaticParent = position === "absolute", + overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/, + scrollParent = this.parents().filter( function() { + var parent = $( this ); + if ( excludeStaticParent && parent.css( "position" ) === "static" ) { + return false; + } + return overflowRegex.test( parent.css( "overflow" ) + parent.css( "overflow-y" ) + + parent.css( "overflow-x" ) ); + } ).eq( 0 ); + + return position === "fixed" || !scrollParent.length ? + $( this[ 0 ].ownerDocument || document ) : + scrollParent; +}; + + +/*! + * jQuery UI Tabbable 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: :tabbable Selector +//>>group: Core +//>>description: Selects elements which can be tabbed to. +//>>docs: http://api.jqueryui.com/tabbable-selector/ + + + +var tabbable = $.extend( $.expr[ ":" ], { + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + hasTabindex = tabIndex != null; + return ( !hasTabindex || tabIndex >= 0 ) && $.ui.focusable( element, hasTabindex ); + } +} ); + + +/*! + * jQuery UI Unique ID 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Bounce + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: uniqueId +//>>group: Core +//>>description: Functions to generate and remove uniqueId's +//>>docs: http://api.jqueryui.com/uniqueId/ + + + +var uniqueId = $.fn.extend( { + uniqueId: ( function() { + var uuid = 0; + + return function() { + return this.each( function() { + if ( !this.id ) { + this.id = "ui-id-" + ( ++uuid ); + } + } ); + }; + } )(), + + removeUniqueId: function() { + return this.each( function() { + if ( /^ui-id-\d+$/.test( this.id ) ) { + $( this ).removeAttr( "id" ); + } + } ); + } +} ); + + + + +// This file is deprecated +var ie = $.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() ); + +/*! + * jQuery UI Mouse 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ -3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); -b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); -;/* - * jQuery UI Effects Clip 1.8.14 + +//>>label: Mouse +//>>group: Widgets +//>>description: Abstracts mouse-based interactions to assist in creating certain widgets. +//>>docs: http://api.jqueryui.com/mouse/ + + + +var mouseHandled = false; +$( document ).on( "mouseup", function() { + mouseHandled = false; +} ); + +var widgetsMouse = $.widget( "ui.mouse", { + version: "1.12.1", + options: { + cancel: "input, textarea, button, select, option", + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .on( "mousedown." + this.widgetName, function( event ) { + return that._mouseDown( event ); + } ) + .on( "click." + this.widgetName, function( event ) { + if ( true === $.data( event.target, that.widgetName + ".preventClickEvent" ) ) { + $.removeData( event.target, that.widgetName + ".preventClickEvent" ); + event.stopImmediatePropagation(); + return false; + } + } ); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.off( "." + this.widgetName ); + if ( this._mouseMoveDelegate ) { + this.document + .off( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .off( "mouseup." + this.widgetName, this._mouseUpDelegate ); + } + }, + + _mouseDown: function( event ) { + + // don't let more than one widget handle mouseStart + if ( mouseHandled ) { + return; + } + + this._mouseMoved = false; + + // We may have missed mouseup (out of window) + ( this._mouseStarted && this._mouseUp( event ) ); + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = ( event.which === 1 ), + + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = ( typeof this.options.cancel === "string" && event.target.nodeName ? + $( event.target ).closest( this.options.cancel ).length : false ); + if ( !btnIsLeft || elIsCancel || !this._mouseCapture( event ) ) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if ( !this.mouseDelayMet ) { + this._mouseDelayTimer = setTimeout( function() { + that.mouseDelayMet = true; + }, this.options.delay ); + } + + if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) { + this._mouseStarted = ( this._mouseStart( event ) !== false ); + if ( !this._mouseStarted ) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if ( true === $.data( event.target, this.widgetName + ".preventClickEvent" ) ) { + $.removeData( event.target, this.widgetName + ".preventClickEvent" ); + } + + // These delegates are required to keep context + this._mouseMoveDelegate = function( event ) { + return that._mouseMove( event ); + }; + this._mouseUpDelegate = function( event ) { + return that._mouseUp( event ); + }; + + this.document + .on( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .on( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function( event ) { + + // Only check for mouseups outside the document if you've moved inside the document + // at least once. This prevents the firing of mouseup in the case of IE<9, which will + // fire a mousemove event if content is placed under the cursor. See #7778 + // Support: IE <9 + if ( this._mouseMoved ) { + + // IE mouseup check - mouseup happened when mouse was out of window + if ( $.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && + !event.button ) { + return this._mouseUp( event ); + + // Iframe mouseup check - mouseup occurred in another document + } else if ( !event.which ) { + + // Support: Safari <=8 - 9 + // Safari sets which to 0 if you press any of the following keys + // during a drag (#14461) + if ( event.originalEvent.altKey || event.originalEvent.ctrlKey || + event.originalEvent.metaKey || event.originalEvent.shiftKey ) { + this.ignoreMissingWhich = true; + } else if ( !this.ignoreMissingWhich ) { + return this._mouseUp( event ); + } + } + } + + if ( event.which || event.button ) { + this._mouseMoved = true; + } + + if ( this._mouseStarted ) { + this._mouseDrag( event ); + return event.preventDefault(); + } + + if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) { + this._mouseStarted = + ( this._mouseStart( this._mouseDownEvent, event ) !== false ); + ( this._mouseStarted ? this._mouseDrag( event ) : this._mouseUp( event ) ); + } + + return !this._mouseStarted; + }, + + _mouseUp: function( event ) { + this.document + .off( "mousemove." + this.widgetName, this._mouseMoveDelegate ) + .off( "mouseup." + this.widgetName, this._mouseUpDelegate ); + + if ( this._mouseStarted ) { + this._mouseStarted = false; + + if ( event.target === this._mouseDownEvent.target ) { + $.data( event.target, this.widgetName + ".preventClickEvent", true ); + } + + this._mouseStop( event ); + } + + if ( this._mouseDelayTimer ) { + clearTimeout( this._mouseDelayTimer ); + delete this._mouseDelayTimer; + } + + this.ignoreMissingWhich = false; + mouseHandled = false; + event.preventDefault(); + }, + + _mouseDistanceMet: function( event ) { + return ( Math.max( + Math.abs( this._mouseDownEvent.pageX - event.pageX ), + Math.abs( this._mouseDownEvent.pageY - event.pageY ) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function( /* event */ ) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function( /* event */ ) {}, + _mouseDrag: function( /* event */ ) {}, + _mouseStop: function( /* event */ ) {}, + _mouseCapture: function( /* event */ ) { return true; } +} ); + + + + +// $.ui.plugin is deprecated. Use $.widget() extensions instead. +var plugin = $.ui.plugin = { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args, allowDisconnected ) { + var i, + set = instance.plugins[ name ]; + + if ( !set ) { + return; + } + + if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode || + instance.element[ 0 ].parentNode.nodeType === 11 ) ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } +}; + + + +var safeActiveElement = $.ui.safeActiveElement = function( document ) { + var activeElement; + + // Support: IE 9 only + // IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe> + try { + activeElement = document.activeElement; + } catch ( error ) { + activeElement = document.body; + } + + // Support: IE 9 - 11 only + // IE may return null instead of an element + // Interestingly, this only seems to occur when NOT in an iframe + if ( !activeElement ) { + activeElement = document.body; + } + + // Support: IE 11 only + // IE11 returns a seemingly empty object in some cases when accessing + // document.activeElement from an <iframe> + if ( !activeElement.nodeName ) { + activeElement = document.body; + } + + return activeElement; +}; + + + +var safeBlur = $.ui.safeBlur = function( element ) { + + // Support: IE9 - 10 only + // If the <body> is blurred, IE will switch windows, see #9420 + if ( element && element.nodeName.toLowerCase() !== "body" ) { + $( element ).trigger( "blur" ); + } +}; + + +/*! + * jQuery UI Draggable 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Draggable +//>>group: Interactions +//>>description: Enables dragging functionality for any element. +//>>docs: http://api.jqueryui.com/draggable/ +//>>demos: http://jqueryui.com/draggable/ +//>>css.structure: ../../themes/base/draggable.css + + + +$.widget( "ui.draggable", $.ui.mouse, { + version: "1.12.1", + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false, + + // Callbacks + drag: null, + start: null, + stop: null + }, + _create: function() { + + if ( this.options.helper === "original" ) { + this._setPositionRelative(); + } + if ( this.options.addClasses ) { + this._addClass( "ui-draggable" ); + } + this._setHandleClassName(); + + this._mouseInit(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "handle" ) { + this._removeHandleClassName(); + this._setHandleClassName(); + } + }, + + _destroy: function() { + if ( ( this.helper || this.element ).is( ".ui-draggable-dragging" ) ) { + this.destroyOnClear = true; + return; + } + this._removeHandleClassName(); + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var o = this.options; + + // Among others, prevent a drag on a resizable-handle + if ( this.helper || o.disabled || + $( event.target ).closest( ".ui-resizable-handle" ).length > 0 ) { + return false; + } + + //Quit if we're not on a valid handle + this.handle = this._getHandle( event ); + if ( !this.handle ) { + return false; + } + + this._blurActiveElement( event ); + + this._blockFrames( o.iframeFix === true ? "iframe" : o.iframeFix ); + + return true; + + }, + + _blockFrames: function( selector ) { + this.iframeBlocks = this.document.find( selector ).map( function() { + var iframe = $( this ); + + return $( "<div>" ) + .css( "position", "absolute" ) + .appendTo( iframe.parent() ) + .outerWidth( iframe.outerWidth() ) + .outerHeight( iframe.outerHeight() ) + .offset( iframe.offset() )[ 0 ]; + } ); + }, + + _unblockFrames: function() { + if ( this.iframeBlocks ) { + this.iframeBlocks.remove(); + delete this.iframeBlocks; + } + }, + + _blurActiveElement: function( event ) { + var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ), + target = $( event.target ); + + // Don't blur if the event occurred on an element that is within + // the currently focused element + // See #10527, #12472 + if ( target.closest( activeElement ).length ) { + return; + } + + // Blur any element that currently has focus, see #4261 + $.ui.safeBlur( activeElement ); + }, + + _mouseStart: function( event ) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper( event ); + + this._addClass( this.helper, "ui-draggable-dragging" ); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if ( $.ui.ddmanager ) { + $.ui.ddmanager.current = this; + } + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css( "position" ); + this.scrollParent = this.helper.scrollParent( true ); + this.offsetParent = this.helper.offsetParent(); + this.hasFixedAncestor = this.helper.parents().filter( function() { + return $( this ).css( "position" ) === "fixed"; + } ).length > 0; + + //The element's absolute position on the page minus margins + this.positionAbs = this.element.offset(); + this._refreshOffsets( event ); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition( event, false ); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + ( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) ); + + //Set a containment if given in the options + this._setContainment(); + + //Trigger event + callbacks + if ( this._trigger( "start", event ) === false ) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ( $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( this, event ); + } + + // Execute the drag once - this causes the helper not to be visible before getting its + // correct position + this._mouseDrag( event, true ); + + // If the ddmanager is used for droppables, inform the manager that dragging has started + // (see #5003) + if ( $.ui.ddmanager ) { + $.ui.ddmanager.dragStart( this, event ); + } + + return true; + }, + + _refreshOffsets: function( event ) { + this.offset = { + top: this.positionAbs.top - this.margins.top, + left: this.positionAbs.left - this.margins.left, + scroll: false, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() + }; + + this.offset.click = { + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }; + }, + + _mouseDrag: function( event, noPropagation ) { + + // reset any necessary cached properties (see #5009) + if ( this.hasFixedAncestor ) { + this.offset.parent = this._getParentOffset(); + } + + //Compute the helpers position + this.position = this._generatePosition( event, true ); + this.positionAbs = this._convertPositionTo( "absolute" ); + + //Call plugins and callbacks and use the resulting position if something is returned + if ( !noPropagation ) { + var ui = this._uiHash(); + if ( this._trigger( "drag", event, ui ) === false ) { + this._mouseUp( new $.Event( "mouseup", event ) ); + return false; + } + this.position = ui.position; + } + + this.helper[ 0 ].style.left = this.position.left + "px"; + this.helper[ 0 ].style.top = this.position.top + "px"; + + if ( $.ui.ddmanager ) { + $.ui.ddmanager.drag( this, event ); + } + + return false; + }, + + _mouseStop: function( event ) { + + //If we are using droppables, inform the manager about the drop + var that = this, + dropped = false; + if ( $.ui.ddmanager && !this.options.dropBehaviour ) { + dropped = $.ui.ddmanager.drop( this, event ); + } + + //if a drop comes from outside (a sortable) + if ( this.dropped ) { + dropped = this.dropped; + this.dropped = false; + } + + if ( ( this.options.revert === "invalid" && !dropped ) || + ( this.options.revert === "valid" && dropped ) || + this.options.revert === true || ( $.isFunction( this.options.revert ) && + this.options.revert.call( this.element, dropped ) ) + ) { + $( this.helper ).animate( + this.originalPosition, + parseInt( this.options.revertDuration, 10 ), + function() { + if ( that._trigger( "stop", event ) !== false ) { + that._clear(); + } + } + ); + } else { + if ( this._trigger( "stop", event ) !== false ) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function( event ) { + this._unblockFrames(); + + // If the ddmanager is used for droppables, inform the manager that dragging has stopped + // (see #5003) + if ( $.ui.ddmanager ) { + $.ui.ddmanager.dragStop( this, event ); + } + + // Only need to focus if the event occurred on the draggable itself, see #10527 + if ( this.handleElement.is( event.target ) ) { + + // The interaction is over; whether or not the click resulted in a drag, + // focus the element + this.element.trigger( "focus" ); + } + + return $.ui.mouse.prototype._mouseUp.call( this, event ); + }, + + cancel: function() { + + if ( this.helper.is( ".ui-draggable-dragging" ) ) { + this._mouseUp( new $.Event( "mouseup", { target: this.element[ 0 ] } ) ); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function( event ) { + return this.options.handle ? + !!$( event.target ).closest( this.element.find( this.options.handle ) ).length : + true; + }, + + _setHandleClassName: function() { + this.handleElement = this.options.handle ? + this.element.find( this.options.handle ) : this.element; + this._addClass( this.handleElement, "ui-draggable-handle" ); + }, + + _removeHandleClassName: function() { + this._removeClass( this.handleElement, "ui-draggable-handle" ); + }, + + _createHelper: function( event ) { + + var o = this.options, + helperIsFunction = $.isFunction( o.helper ), + helper = helperIsFunction ? + $( o.helper.apply( this.element[ 0 ], [ event ] ) ) : + ( o.helper === "clone" ? + this.element.clone().removeAttr( "id" ) : + this.element ); + + if ( !helper.parents( "body" ).length ) { + helper.appendTo( ( o.appendTo === "parent" ? + this.element[ 0 ].parentNode : + o.appendTo ) ); + } + + // Http://bugs.jqueryui.com/ticket/9446 + // a helper function can return the original element + // which wouldn't have been set to relative in _create + if ( helperIsFunction && helper[ 0 ] === this.element[ 0 ] ) { + this._setPositionRelative(); + } + + if ( helper[ 0 ] !== this.element[ 0 ] && + !( /(fixed|absolute)/ ).test( helper.css( "position" ) ) ) { + helper.css( "position", "absolute" ); + } + + return helper; + + }, + + _setPositionRelative: function() { + if ( !( /^(?:r|a|f)/ ).test( this.element.css( "position" ) ) ) { + this.element[ 0 ].style.position = "relative"; + } + }, + + _adjustOffsetFromHelper: function( obj ) { + if ( typeof obj === "string" ) { + obj = obj.split( " " ); + } + if ( $.isArray( obj ) ) { + obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 }; + } + if ( "left" in obj ) { + this.offset.click.left = obj.left + this.margins.left; + } + if ( "right" in obj ) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ( "top" in obj ) { + this.offset.click.top = obj.top + this.margins.top; + } + if ( "bottom" in obj ) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _isRootNode: function( element ) { + return ( /(html|body)/i ).test( element.tagName ) || element === this.document[ 0 ]; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + var po = this.offsetParent.offset(), + document = this.document[ 0 ]; + + // This is a special case where we need to modify a offset calculated on start, since the + // following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the + // next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't + // the document, which means that the scroll is included in the initial calculation of the + // offset of the parent, and never recalculated upon drag + if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== document && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if ( this._isRootNode( this.offsetParent[ 0 ] ) ) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ), + left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 ) + }; + + }, + + _getRelativeOffset: function() { + if ( this.cssPosition !== "relative" ) { + return { top: 0, left: 0 }; + } + + var p = this.element.position(), + scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ); + + return { + top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) + + ( !scrollIsRootNode ? this.scrollParent.scrollTop() : 0 ), + left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) + + ( !scrollIsRootNode ? this.scrollParent.scrollLeft() : 0 ) + }; + + }, + + _cacheMargins: function() { + this.margins = { + left: ( parseInt( this.element.css( "marginLeft" ), 10 ) || 0 ), + top: ( parseInt( this.element.css( "marginTop" ), 10 ) || 0 ), + right: ( parseInt( this.element.css( "marginRight" ), 10 ) || 0 ), + bottom: ( parseInt( this.element.css( "marginBottom" ), 10 ) || 0 ) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var isUserScrollable, c, ce, + o = this.options, + document = this.document[ 0 ]; + + this.relativeContainer = null; + + if ( !o.containment ) { + this.containment = null; + return; + } + + if ( o.containment === "window" ) { + this.containment = [ + $( window ).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + $( window ).scrollTop() - this.offset.relative.top - this.offset.parent.top, + $( window ).scrollLeft() + $( window ).width() - + this.helperProportions.width - this.margins.left, + $( window ).scrollTop() + + ( $( window ).height() || document.body.parentNode.scrollHeight ) - + this.helperProportions.height - this.margins.top + ]; + return; + } + + if ( o.containment === "document" ) { + this.containment = [ + 0, + 0, + $( document ).width() - this.helperProportions.width - this.margins.left, + ( $( document ).height() || document.body.parentNode.scrollHeight ) - + this.helperProportions.height - this.margins.top + ]; + return; + } + + if ( o.containment.constructor === Array ) { + this.containment = o.containment; + return; + } + + if ( o.containment === "parent" ) { + o.containment = this.helper[ 0 ].parentNode; + } + + c = $( o.containment ); + ce = c[ 0 ]; + + if ( !ce ) { + return; + } + + isUserScrollable = /(scroll|auto)/.test( c.css( "overflow" ) ); + + this.containment = [ + ( parseInt( c.css( "borderLeftWidth" ), 10 ) || 0 ) + + ( parseInt( c.css( "paddingLeft" ), 10 ) || 0 ), + ( parseInt( c.css( "borderTopWidth" ), 10 ) || 0 ) + + ( parseInt( c.css( "paddingTop" ), 10 ) || 0 ), + ( isUserScrollable ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) - + ( parseInt( c.css( "borderRightWidth" ), 10 ) || 0 ) - + ( parseInt( c.css( "paddingRight" ), 10 ) || 0 ) - + this.helperProportions.width - + this.margins.left - + this.margins.right, + ( isUserScrollable ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) - + ( parseInt( c.css( "borderBottomWidth" ), 10 ) || 0 ) - + ( parseInt( c.css( "paddingBottom" ), 10 ) || 0 ) - + this.helperProportions.height - + this.margins.top - + this.margins.bottom + ]; + this.relativeContainer = c; + }, + + _convertPositionTo: function( d, pos ) { + + if ( !pos ) { + pos = this.position; + } + + var mod = d === "absolute" ? 1 : -1, + scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ); + + return { + top: ( + + // The absolute mouse position + pos.top + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top * mod - + ( ( this.cssPosition === "fixed" ? + -this.offset.scroll.top : + ( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) * mod ) + ), + left: ( + + // The absolute mouse position + pos.left + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left * mod - + ( ( this.cssPosition === "fixed" ? + -this.offset.scroll.left : + ( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) * mod ) + ) + }; + + }, + + _generatePosition: function( event, constrainPosition ) { + + var containment, co, top, left, + o = this.options, + scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ), + pageX = event.pageX, + pageY = event.pageY; + + // Cache the scroll + if ( !scrollIsRootNode || !this.offset.scroll ) { + this.offset.scroll = { + top: this.scrollParent.scrollTop(), + left: this.scrollParent.scrollLeft() + }; + } + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + // If we are not dragging yet, we won't check for options + if ( constrainPosition ) { + if ( this.containment ) { + if ( this.relativeContainer ) { + co = this.relativeContainer.offset(); + containment = [ + this.containment[ 0 ] + co.left, + this.containment[ 1 ] + co.top, + this.containment[ 2 ] + co.left, + this.containment[ 3 ] + co.top + ]; + } else { + containment = this.containment; + } + + if ( event.pageX - this.offset.click.left < containment[ 0 ] ) { + pageX = containment[ 0 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top < containment[ 1 ] ) { + pageY = containment[ 1 ] + this.offset.click.top; + } + if ( event.pageX - this.offset.click.left > containment[ 2 ] ) { + pageX = containment[ 2 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top > containment[ 3 ] ) { + pageY = containment[ 3 ] + this.offset.click.top; + } + } + + if ( o.grid ) { + + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid + // argument errors in IE (see ticket #6950) + top = o.grid[ 1 ] ? this.originalPageY + Math.round( ( pageY - + this.originalPageY ) / o.grid[ 1 ] ) * o.grid[ 1 ] : this.originalPageY; + pageY = containment ? ( ( top - this.offset.click.top >= containment[ 1 ] || + top - this.offset.click.top > containment[ 3 ] ) ? + top : + ( ( top - this.offset.click.top >= containment[ 1 ] ) ? + top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : top; + + left = o.grid[ 0 ] ? this.originalPageX + + Math.round( ( pageX - this.originalPageX ) / o.grid[ 0 ] ) * o.grid[ 0 ] : + this.originalPageX; + pageX = containment ? ( ( left - this.offset.click.left >= containment[ 0 ] || + left - this.offset.click.left > containment[ 2 ] ) ? + left : + ( ( left - this.offset.click.left >= containment[ 0 ] ) ? + left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : left; + } + + if ( o.axis === "y" ) { + pageX = this.originalPageX; + } + + if ( o.axis === "x" ) { + pageY = this.originalPageY; + } + } + + return { + top: ( + + // The absolute mouse position + pageY - + + // Click offset (relative to the element) + this.offset.click.top - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top + + ( this.cssPosition === "fixed" ? + -this.offset.scroll.top : + ( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) + ), + left: ( + + // The absolute mouse position + pageX - + + // Click offset (relative to the element) + this.offset.click.left - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left + + ( this.cssPosition === "fixed" ? + -this.offset.scroll.left : + ( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) + ) + }; + + }, + + _clear: function() { + this._removeClass( this.helper, "ui-draggable-dragging" ); + if ( this.helper[ 0 ] !== this.element[ 0 ] && !this.cancelHelperRemoval ) { + this.helper.remove(); + } + this.helper = null; + this.cancelHelperRemoval = false; + if ( this.destroyOnClear ) { + this.destroy(); + } + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function( type, event, ui ) { + ui = ui || this._uiHash(); + $.ui.plugin.call( this, type, [ event, ui, this ], true ); + + // Absolute position and offset (see #6884 ) have to be recalculated after plugins + if ( /^(drag|start|stop)/.test( type ) ) { + this.positionAbs = this._convertPositionTo( "absolute" ); + ui.offset = this.positionAbs; + } + return $.Widget.prototype._trigger.call( this, type, event, ui ); + }, + + plugins: {}, + + _uiHash: function() { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +} ); + +$.ui.plugin.add( "draggable", "connectToSortable", { + start: function( event, ui, draggable ) { + var uiSortable = $.extend( {}, ui, { + item: draggable.element + } ); + + draggable.sortables = []; + $( draggable.options.connectToSortable ).each( function() { + var sortable = $( this ).sortable( "instance" ); + + if ( sortable && !sortable.options.disabled ) { + draggable.sortables.push( sortable ); + + // RefreshPositions is called at drag start to refresh the containerCache + // which is used in drag. This ensures it's initialized and synchronized + // with any changes that might have happened on the page since initialization. + sortable.refreshPositions(); + sortable._trigger( "activate", event, uiSortable ); + } + } ); + }, + stop: function( event, ui, draggable ) { + var uiSortable = $.extend( {}, ui, { + item: draggable.element + } ); + + draggable.cancelHelperRemoval = false; + + $.each( draggable.sortables, function() { + var sortable = this; + + if ( sortable.isOver ) { + sortable.isOver = 0; + + // Allow this sortable to handle removing the helper + draggable.cancelHelperRemoval = true; + sortable.cancelHelperRemoval = false; + + // Use _storedCSS To restore properties in the sortable, + // as this also handles revert (#9675) since the draggable + // may have modified them in unexpected ways (#8809) + sortable._storedCSS = { + position: sortable.placeholder.css( "position" ), + top: sortable.placeholder.css( "top" ), + left: sortable.placeholder.css( "left" ) + }; + + sortable._mouseStop( event ); + + // Once drag has ended, the sortable should return to using + // its original helper, not the shared helper from draggable + sortable.options.helper = sortable.options._helper; + } else { + + // Prevent this Sortable from removing the helper. + // However, don't set the draggable to remove the helper + // either as another connected Sortable may yet handle the removal. + sortable.cancelHelperRemoval = true; + + sortable._trigger( "deactivate", event, uiSortable ); + } + } ); + }, + drag: function( event, ui, draggable ) { + $.each( draggable.sortables, function() { + var innermostIntersecting = false, + sortable = this; + + // Copy over variables that sortable's _intersectsWith uses + sortable.positionAbs = draggable.positionAbs; + sortable.helperProportions = draggable.helperProportions; + sortable.offset.click = draggable.offset.click; + + if ( sortable._intersectsWith( sortable.containerCache ) ) { + innermostIntersecting = true; + + $.each( draggable.sortables, function() { + + // Copy over variables that sortable's _intersectsWith uses + this.positionAbs = draggable.positionAbs; + this.helperProportions = draggable.helperProportions; + this.offset.click = draggable.offset.click; + + if ( this !== sortable && + this._intersectsWith( this.containerCache ) && + $.contains( sortable.element[ 0 ], this.element[ 0 ] ) ) { + innermostIntersecting = false; + } + + return innermostIntersecting; + } ); + } + + if ( innermostIntersecting ) { + + // If it intersects, we use a little isOver variable and set it once, + // so that the move-in stuff gets fired only once. + if ( !sortable.isOver ) { + sortable.isOver = 1; + + // Store draggable's parent in case we need to reappend to it later. + draggable._parent = ui.helper.parent(); + + sortable.currentItem = ui.helper + .appendTo( sortable.element ) + .data( "ui-sortable-item", true ); + + // Store helper option to later restore it + sortable.options._helper = sortable.options.helper; + + sortable.options.helper = function() { + return ui.helper[ 0 ]; + }; + + // Fire the start events of the sortable with our passed browser event, + // and our own helper (so it doesn't create a new one) + event.target = sortable.currentItem[ 0 ]; + sortable._mouseCapture( event, true ); + sortable._mouseStart( event, true, true ); + + // Because the browser event is way off the new appended portlet, + // modify necessary variables to reflect the changes + sortable.offset.click.top = draggable.offset.click.top; + sortable.offset.click.left = draggable.offset.click.left; + sortable.offset.parent.left -= draggable.offset.parent.left - + sortable.offset.parent.left; + sortable.offset.parent.top -= draggable.offset.parent.top - + sortable.offset.parent.top; + + draggable._trigger( "toSortable", event ); + + // Inform draggable that the helper is in a valid drop zone, + // used solely in the revert option to handle "valid/invalid". + draggable.dropped = sortable.element; + + // Need to refreshPositions of all sortables in the case that + // adding to one sortable changes the location of the other sortables (#9675) + $.each( draggable.sortables, function() { + this.refreshPositions(); + } ); + + // Hack so receive/update callbacks work (mostly) + draggable.currentItem = draggable.element; + sortable.fromOutside = draggable; + } + + if ( sortable.currentItem ) { + sortable._mouseDrag( event ); + + // Copy the sortable's position because the draggable's can potentially reflect + // a relative position, while sortable is always absolute, which the dragged + // element has now become. (#8809) + ui.position = sortable.position; + } + } else { + + // If it doesn't intersect with the sortable, and it intersected before, + // we fake the drag stop of the sortable, but make sure it doesn't remove + // the helper by using cancelHelperRemoval. + if ( sortable.isOver ) { + + sortable.isOver = 0; + sortable.cancelHelperRemoval = true; + + // Calling sortable's mouseStop would trigger a revert, + // so revert must be temporarily false until after mouseStop is called. + sortable.options._revert = sortable.options.revert; + sortable.options.revert = false; + + sortable._trigger( "out", event, sortable._uiHash( sortable ) ); + sortable._mouseStop( event, true ); + + // Restore sortable behaviors that were modfied + // when the draggable entered the sortable area (#9481) + sortable.options.revert = sortable.options._revert; + sortable.options.helper = sortable.options._helper; + + if ( sortable.placeholder ) { + sortable.placeholder.remove(); + } + + // Restore and recalculate the draggable's offset considering the sortable + // may have modified them in unexpected ways. (#8809, #10669) + ui.helper.appendTo( draggable._parent ); + draggable._refreshOffsets( event ); + ui.position = draggable._generatePosition( event, true ); + + draggable._trigger( "fromSortable", event ); + + // Inform draggable that the helper is no longer in a valid drop zone + draggable.dropped = false; + + // Need to refreshPositions of all sortables just in case removing + // from one sortable changes the location of other sortables (#9675) + $.each( draggable.sortables, function() { + this.refreshPositions(); + } ); + } + } + } ); + } +} ); + +$.ui.plugin.add( "draggable", "cursor", { + start: function( event, ui, instance ) { + var t = $( "body" ), + o = instance.options; + + if ( t.css( "cursor" ) ) { + o._cursor = t.css( "cursor" ); + } + t.css( "cursor", o.cursor ); + }, + stop: function( event, ui, instance ) { + var o = instance.options; + if ( o._cursor ) { + $( "body" ).css( "cursor", o._cursor ); + } + } +} ); + +$.ui.plugin.add( "draggable", "opacity", { + start: function( event, ui, instance ) { + var t = $( ui.helper ), + o = instance.options; + if ( t.css( "opacity" ) ) { + o._opacity = t.css( "opacity" ); + } + t.css( "opacity", o.opacity ); + }, + stop: function( event, ui, instance ) { + var o = instance.options; + if ( o._opacity ) { + $( ui.helper ).css( "opacity", o._opacity ); + } + } +} ); + +$.ui.plugin.add( "draggable", "scroll", { + start: function( event, ui, i ) { + if ( !i.scrollParentNotHidden ) { + i.scrollParentNotHidden = i.helper.scrollParent( false ); + } + + if ( i.scrollParentNotHidden[ 0 ] !== i.document[ 0 ] && + i.scrollParentNotHidden[ 0 ].tagName !== "HTML" ) { + i.overflowOffset = i.scrollParentNotHidden.offset(); + } + }, + drag: function( event, ui, i ) { + + var o = i.options, + scrolled = false, + scrollParent = i.scrollParentNotHidden[ 0 ], + document = i.document[ 0 ]; + + if ( scrollParent !== document && scrollParent.tagName !== "HTML" ) { + if ( !o.axis || o.axis !== "x" ) { + if ( ( i.overflowOffset.top + scrollParent.offsetHeight ) - event.pageY < + o.scrollSensitivity ) { + scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed; + } else if ( event.pageY - i.overflowOffset.top < o.scrollSensitivity ) { + scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed; + } + } + + if ( !o.axis || o.axis !== "y" ) { + if ( ( i.overflowOffset.left + scrollParent.offsetWidth ) - event.pageX < + o.scrollSensitivity ) { + scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed; + } else if ( event.pageX - i.overflowOffset.left < o.scrollSensitivity ) { + scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed; + } + } + + } else { + + if ( !o.axis || o.axis !== "x" ) { + if ( event.pageY - $( document ).scrollTop() < o.scrollSensitivity ) { + scrolled = $( document ).scrollTop( $( document ).scrollTop() - o.scrollSpeed ); + } else if ( $( window ).height() - ( event.pageY - $( document ).scrollTop() ) < + o.scrollSensitivity ) { + scrolled = $( document ).scrollTop( $( document ).scrollTop() + o.scrollSpeed ); + } + } + + if ( !o.axis || o.axis !== "y" ) { + if ( event.pageX - $( document ).scrollLeft() < o.scrollSensitivity ) { + scrolled = $( document ).scrollLeft( + $( document ).scrollLeft() - o.scrollSpeed + ); + } else if ( $( window ).width() - ( event.pageX - $( document ).scrollLeft() ) < + o.scrollSensitivity ) { + scrolled = $( document ).scrollLeft( + $( document ).scrollLeft() + o.scrollSpeed + ); + } + } + + } + + if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( i, event ); + } + + } +} ); + +$.ui.plugin.add( "draggable", "snap", { + start: function( event, ui, i ) { + + var o = i.options; + + i.snapElements = []; + + $( o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap ) + .each( function() { + var $t = $( this ), + $o = $t.offset(); + if ( this !== i.element[ 0 ] ) { + i.snapElements.push( { + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + } ); + } + } ); + + }, + drag: function( event, ui, inst ) { + + var ts, bs, ls, rs, l, r, t, b, i, first, + o = inst.options, + d = o.snapTolerance, + x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for ( i = inst.snapElements.length - 1; i >= 0; i-- ) { + + l = inst.snapElements[ i ].left - inst.margins.left; + r = l + inst.snapElements[ i ].width; + t = inst.snapElements[ i ].top - inst.margins.top; + b = t + inst.snapElements[ i ].height; + + if ( x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d || + !$.contains( inst.snapElements[ i ].item.ownerDocument, + inst.snapElements[ i ].item ) ) { + if ( inst.snapElements[ i ].snapping ) { + ( inst.options.snap.release && + inst.options.snap.release.call( + inst.element, + event, + $.extend( inst._uiHash(), { snapItem: inst.snapElements[ i ].item } ) + ) ); + } + inst.snapElements[ i ].snapping = false; + continue; + } + + if ( o.snapMode !== "inner" ) { + ts = Math.abs( t - y2 ) <= d; + bs = Math.abs( b - y1 ) <= d; + ls = Math.abs( l - x2 ) <= d; + rs = Math.abs( r - x1 ) <= d; + if ( ts ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: t - inst.helperProportions.height, + left: 0 + } ).top; + } + if ( bs ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: b, + left: 0 + } ).top; + } + if ( ls ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: l - inst.helperProportions.width + } ).left; + } + if ( rs ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: r + } ).left; + } + } + + first = ( ts || bs || ls || rs ); + + if ( o.snapMode !== "outer" ) { + ts = Math.abs( t - y1 ) <= d; + bs = Math.abs( b - y2 ) <= d; + ls = Math.abs( l - x1 ) <= d; + rs = Math.abs( r - x2 ) <= d; + if ( ts ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: t, + left: 0 + } ).top; + } + if ( bs ) { + ui.position.top = inst._convertPositionTo( "relative", { + top: b - inst.helperProportions.height, + left: 0 + } ).top; + } + if ( ls ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: l + } ).left; + } + if ( rs ) { + ui.position.left = inst._convertPositionTo( "relative", { + top: 0, + left: r - inst.helperProportions.width + } ).left; + } + } + + if ( !inst.snapElements[ i ].snapping && ( ts || bs || ls || rs || first ) ) { + ( inst.options.snap.snap && + inst.options.snap.snap.call( + inst.element, + event, + $.extend( inst._uiHash(), { + snapItem: inst.snapElements[ i ].item + } ) ) ); + } + inst.snapElements[ i ].snapping = ( ts || bs || ls || rs || first ); + + } + + } +} ); + +$.ui.plugin.add( "draggable", "stack", { + start: function( event, ui, instance ) { + var min, + o = instance.options, + group = $.makeArray( $( o.stack ) ).sort( function( a, b ) { + return ( parseInt( $( a ).css( "zIndex" ), 10 ) || 0 ) - + ( parseInt( $( b ).css( "zIndex" ), 10 ) || 0 ); + } ); + + if ( !group.length ) { return; } + + min = parseInt( $( group[ 0 ] ).css( "zIndex" ), 10 ) || 0; + $( group ).each( function( i ) { + $( this ).css( "zIndex", min + i ); + } ); + this.css( "zIndex", ( min + group.length ) ); + } +} ); + +$.ui.plugin.add( "draggable", "zIndex", { + start: function( event, ui, instance ) { + var t = $( ui.helper ), + o = instance.options; + + if ( t.css( "zIndex" ) ) { + o._zIndex = t.css( "zIndex" ); + } + t.css( "zIndex", o.zIndex ); + }, + stop: function( event, ui, instance ) { + var o = instance.options; + + if ( o._zIndex ) { + $( ui.helper ).css( "zIndex", o._zIndex ); + } + } +} ); + +var widgetsDraggable = $.ui.draggable; + + +/*! + * jQuery UI Droppable 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Clip + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Droppable +//>>group: Interactions +//>>description: Enables drop targets for draggable elements. +//>>docs: http://api.jqueryui.com/droppable/ +//>>demos: http://jqueryui.com/droppable/ + + + +$.widget( "ui.droppable", { + version: "1.12.1", + widgetEventPrefix: "drop", + options: { + accept: "*", + addClasses: true, + greedy: false, + scope: "default", + tolerance: "intersect", + + // Callbacks + activate: null, + deactivate: null, + drop: null, + out: null, + over: null + }, + _create: function() { + + var proportions, + o = this.options, + accept = o.accept; + + this.isover = false; + this.isout = true; + + this.accept = $.isFunction( accept ) ? accept : function( d ) { + return d.is( accept ); + }; + + this.proportions = function( /* valueToWrite */ ) { + if ( arguments.length ) { + + // Store the droppable's proportions + proportions = arguments[ 0 ]; + } else { + + // Retrieve or derive the droppable's proportions + return proportions ? + proportions : + proportions = { + width: this.element[ 0 ].offsetWidth, + height: this.element[ 0 ].offsetHeight + }; + } + }; + + this._addToManager( o.scope ); + + o.addClasses && this._addClass( "ui-droppable" ); + + }, + + _addToManager: function( scope ) { + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[ scope ] = $.ui.ddmanager.droppables[ scope ] || []; + $.ui.ddmanager.droppables[ scope ].push( this ); + }, + + _splice: function( drop ) { + var i = 0; + for ( ; i < drop.length; i++ ) { + if ( drop[ i ] === this ) { + drop.splice( i, 1 ); + } + } + }, + + _destroy: function() { + var drop = $.ui.ddmanager.droppables[ this.options.scope ]; + + this._splice( drop ); + }, + + _setOption: function( key, value ) { + + if ( key === "accept" ) { + this.accept = $.isFunction( value ) ? value : function( d ) { + return d.is( value ); + }; + } else if ( key === "scope" ) { + var drop = $.ui.ddmanager.droppables[ this.options.scope ]; + + this._splice( drop ); + this._addToManager( value ); + } + + this._super( key, value ); + }, + + _activate: function( event ) { + var draggable = $.ui.ddmanager.current; + + this._addActiveClass(); + if ( draggable ) { + this._trigger( "activate", event, this.ui( draggable ) ); + } + }, + + _deactivate: function( event ) { + var draggable = $.ui.ddmanager.current; + + this._removeActiveClass(); + if ( draggable ) { + this._trigger( "deactivate", event, this.ui( draggable ) ); + } + }, + + _over: function( event ) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if ( !draggable || ( draggable.currentItem || + draggable.element )[ 0 ] === this.element[ 0 ] ) { + return; + } + + if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem || + draggable.element ) ) ) { + this._addHoverClass(); + this._trigger( "over", event, this.ui( draggable ) ); + } + + }, + + _out: function( event ) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if ( !draggable || ( draggable.currentItem || + draggable.element )[ 0 ] === this.element[ 0 ] ) { + return; + } + + if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem || + draggable.element ) ) ) { + this._removeHoverClass(); + this._trigger( "out", event, this.ui( draggable ) ); + } + + }, + + _drop: function( event, custom ) { + + var draggable = custom || $.ui.ddmanager.current, + childrenIntersection = false; + + // Bail if draggable and droppable are same element + if ( !draggable || ( draggable.currentItem || + draggable.element )[ 0 ] === this.element[ 0 ] ) { + return false; + } + + this.element + .find( ":data(ui-droppable)" ) + .not( ".ui-draggable-dragging" ) + .each( function() { + var inst = $( this ).droppable( "instance" ); + if ( + inst.options.greedy && + !inst.options.disabled && + inst.options.scope === draggable.options.scope && + inst.accept.call( + inst.element[ 0 ], ( draggable.currentItem || draggable.element ) + ) && + intersect( + draggable, + $.extend( inst, { offset: inst.element.offset() } ), + inst.options.tolerance, event + ) + ) { + childrenIntersection = true; + return false; } + } ); + if ( childrenIntersection ) { + return false; + } + + if ( this.accept.call( this.element[ 0 ], + ( draggable.currentItem || draggable.element ) ) ) { + this._removeActiveClass(); + this._removeHoverClass(); + + this._trigger( "drop", event, this.ui( draggable ) ); + return this.element; + } + + return false; + + }, + + ui: function( c ) { + return { + draggable: ( c.currentItem || c.element ), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + }, + + // Extension points just to make backcompat sane and avoid duplicating logic + // TODO: Remove in 1.13 along with call to it below + _addHoverClass: function() { + this._addClass( "ui-droppable-hover" ); + }, + + _removeHoverClass: function() { + this._removeClass( "ui-droppable-hover" ); + }, + + _addActiveClass: function() { + this._addClass( "ui-droppable-active" ); + }, + + _removeActiveClass: function() { + this._removeClass( "ui-droppable-active" ); + } +} ); + +var intersect = $.ui.intersect = ( function() { + function isOverAxis( x, reference, size ) { + return ( x >= reference ) && ( x < ( reference + size ) ); + } + + return function( draggable, droppable, toleranceMode, event ) { + + if ( !droppable.offset ) { + return false; + } + + var x1 = ( draggable.positionAbs || + draggable.position.absolute ).left + draggable.margins.left, + y1 = ( draggable.positionAbs || + draggable.position.absolute ).top + draggable.margins.top, + x2 = x1 + draggable.helperProportions.width, + y2 = y1 + draggable.helperProportions.height, + l = droppable.offset.left, + t = droppable.offset.top, + r = l + droppable.proportions().width, + b = t + droppable.proportions().height; + + switch ( toleranceMode ) { + case "fit": + return ( l <= x1 && x2 <= r && t <= y1 && y2 <= b ); + case "intersect": + return ( l < x1 + ( draggable.helperProportions.width / 2 ) && // Right Half + x2 - ( draggable.helperProportions.width / 2 ) < r && // Left Half + t < y1 + ( draggable.helperProportions.height / 2 ) && // Bottom Half + y2 - ( draggable.helperProportions.height / 2 ) < b ); // Top Half + case "pointer": + return isOverAxis( event.pageY, t, droppable.proportions().height ) && + isOverAxis( event.pageX, l, droppable.proportions().width ); + case "touch": + return ( + ( y1 >= t && y1 <= b ) || // Top edge touching + ( y2 >= t && y2 <= b ) || // Bottom edge touching + ( y1 < t && y2 > b ) // Surrounded vertically + ) && ( + ( x1 >= l && x1 <= r ) || // Left edge touching + ( x2 >= l && x2 <= r ) || // Right edge touching + ( x1 < l && x2 > r ) // Surrounded horizontally + ); + default: + return false; + } + }; +} )(); + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { "default": [] }, + prepareOffsets: function( t, event ) { + + var i, j, + m = $.ui.ddmanager.droppables[ t.options.scope ] || [], + type = event ? event.type : null, // workaround for #2317 + list = ( t.currentItem || t.element ).find( ":data(ui-droppable)" ).addBack(); + + droppablesLoop: for ( i = 0; i < m.length; i++ ) { + + // No disabled and non-accepted + if ( m[ i ].options.disabled || ( t && !m[ i ].accept.call( m[ i ].element[ 0 ], + ( t.currentItem || t.element ) ) ) ) { + continue; + } + + // Filter out elements in the current dragged item + for ( j = 0; j < list.length; j++ ) { + if ( list[ j ] === m[ i ].element[ 0 ] ) { + m[ i ].proportions().height = 0; + continue droppablesLoop; + } + } + + m[ i ].visible = m[ i ].element.css( "display" ) !== "none"; + if ( !m[ i ].visible ) { + continue; + } + + // Activate the droppable if used directly from draggables + if ( type === "mousedown" ) { + m[ i ]._activate.call( m[ i ], event ); + } + + m[ i ].offset = m[ i ].element.offset(); + m[ i ].proportions( { + width: m[ i ].element[ 0 ].offsetWidth, + height: m[ i ].element[ 0 ].offsetHeight + } ); + + } + + }, + drop: function( draggable, event ) { + + var dropped = false; + + // Create a copy of the droppables in case the list changes during the drop (#9116) + $.each( ( $.ui.ddmanager.droppables[ draggable.options.scope ] || [] ).slice(), function() { + + if ( !this.options ) { + return; + } + if ( !this.options.disabled && this.visible && + intersect( draggable, this, this.options.tolerance, event ) ) { + dropped = this._drop.call( this, event ) || dropped; + } + + if ( !this.options.disabled && this.visible && this.accept.call( this.element[ 0 ], + ( draggable.currentItem || draggable.element ) ) ) { + this.isout = true; + this.isover = false; + this._deactivate.call( this, event ); + } + + } ); + return dropped; + + }, + dragStart: function( draggable, event ) { + + // Listen for scrolling so that if the dragging causes scrolling the position of the + // droppables can be recalculated (see #5003) + draggable.element.parentsUntil( "body" ).on( "scroll.droppable", function() { + if ( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + } ); + }, + drag: function( draggable, event ) { + + // If you have a highly dynamic page, you might try this option. It renders positions + // every time you move the mouse. + if ( draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + + // Run through all droppables and check their positions based on specific tolerance options + $.each( $.ui.ddmanager.droppables[ draggable.options.scope ] || [], function() { + + if ( this.options.disabled || this.greedyChild || !this.visible ) { + return; + } + + var parentInstance, scope, parent, + intersects = intersect( draggable, this, this.options.tolerance, event ), + c = !intersects && this.isover ? + "isout" : + ( intersects && !this.isover ? "isover" : null ); + if ( !c ) { + return; + } + + if ( this.options.greedy ) { + + // find droppable parents with same scope + scope = this.options.scope; + parent = this.element.parents( ":data(ui-droppable)" ).filter( function() { + return $( this ).droppable( "instance" ).options.scope === scope; + } ); + + if ( parent.length ) { + parentInstance = $( parent[ 0 ] ).droppable( "instance" ); + parentInstance.greedyChild = ( c === "isover" ); + } + } + + // We just moved into a greedy child + if ( parentInstance && c === "isover" ) { + parentInstance.isover = false; + parentInstance.isout = true; + parentInstance._out.call( parentInstance, event ); + } + + this[ c ] = true; + this[ c === "isout" ? "isover" : "isout" ] = false; + this[ c === "isover" ? "_over" : "_out" ].call( this, event ); + + // We just moved out of a greedy child + if ( parentInstance && c === "isout" ) { + parentInstance.isout = false; + parentInstance.isover = true; + parentInstance._over.call( parentInstance, event ); + } + } ); + + }, + dragStop: function( draggable, event ) { + draggable.element.parentsUntil( "body" ).off( "scroll.droppable" ); + + // Call prepareOffsets one final time since IE does not fire return scroll events when + // overflow was caused by drag (see #5003) + if ( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + } +}; + +// DEPRECATED +// TODO: switch return back to widget declaration at top of file when this is removed +if ( $.uiBackCompat !== false ) { + + // Backcompat for activeClass and hoverClass options + $.widget( "ui.droppable", $.ui.droppable, { + options: { + hoverClass: false, + activeClass: false + }, + _addActiveClass: function() { + this._super(); + if ( this.options.activeClass ) { + this.element.addClass( this.options.activeClass ); + } + }, + _removeActiveClass: function() { + this._super(); + if ( this.options.activeClass ) { + this.element.removeClass( this.options.activeClass ); + } + }, + _addHoverClass: function() { + this._super(); + if ( this.options.hoverClass ) { + this.element.addClass( this.options.hoverClass ); + } + }, + _removeHoverClass: function() { + this._super(); + if ( this.options.hoverClass ) { + this.element.removeClass( this.options.hoverClass ); + } + } + } ); +} + +var widgetsDroppable = $.ui.droppable; + + +/*! + * jQuery UI Resizable 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Resizable +//>>group: Interactions +//>>description: Enables resize functionality for any element. +//>>docs: http://api.jqueryui.com/resizable/ +//>>demos: http://jqueryui.com/resizable/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/resizable.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.resizable", $.ui.mouse, { + version: "1.12.1", + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + classes: { + "ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se" + }, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + + // See #7960 + zIndex: 90, + + // Callbacks + resize: null, + start: null, + stop: null + }, + + _num: function( value ) { + return parseFloat( value ) || 0; + }, + + _isNumber: function( value ) { + return !isNaN( parseFloat( value ) ); + }, + + _hasScroll: function( el, a ) { + + if ( $( el ).css( "overflow" ) === "hidden" ) { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + _create: function() { + + var margins, + o = this.options, + that = this; + this._addClass( "ui-resizable" ); + + $.extend( this, { + _aspectRatio: !!( o.aspectRatio ), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null + } ); + + // Wrap the element if it cannot hold child nodes + if ( this.element[ 0 ].nodeName.match( /^(canvas|textarea|input|select|button|img)$/i ) ) { + + this.element.wrap( + $( "<div class='ui-wrapper' style='overflow: hidden;'></div>" ).css( { + position: this.element.css( "position" ), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css( "top" ), + left: this.element.css( "left" ) + } ) + ); + + this.element = this.element.parent().data( + "ui-resizable", this.element.resizable( "instance" ) + ); + + this.elementIsWrapper = true; + + margins = { + marginTop: this.originalElement.css( "marginTop" ), + marginRight: this.originalElement.css( "marginRight" ), + marginBottom: this.originalElement.css( "marginBottom" ), + marginLeft: this.originalElement.css( "marginLeft" ) + }; + + this.element.css( margins ); + this.originalElement.css( "margin", 0 ); + + // support: Safari + // Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css( "resize" ); + this.originalElement.css( "resize", "none" ); + + this._proportionallyResizeElements.push( this.originalElement.css( { + position: "static", + zoom: 1, + display: "block" + } ) ); + + // Support: IE9 + // avoid IE jump (hard set the margin) + this.originalElement.css( margins ); + + this._proportionallyResize(); + } + + this._setupHandles(); + + if ( o.autoHide ) { + $( this.element ) + .on( "mouseenter", function() { + if ( o.disabled ) { + return; + } + that._removeClass( "ui-resizable-autohide" ); + that._handles.show(); + } ) + .on( "mouseleave", function() { + if ( o.disabled ) { + return; + } + if ( !that.resizing ) { + that._addClass( "ui-resizable-autohide" ); + that._handles.hide(); + } + } ); + } + + this._mouseInit(); + }, + + _destroy: function() { + + this._mouseDestroy(); + + var wrapper, + _destroy = function( exp ) { + $( exp ) + .removeData( "resizable" ) + .removeData( "ui-resizable" ) + .off( ".resizable" ) + .find( ".ui-resizable-handle" ) + .remove(); + }; + + // TODO: Unwrap at same DOM position + if ( this.elementIsWrapper ) { + _destroy( this.element ); + wrapper = this.element; + this.originalElement.css( { + position: wrapper.css( "position" ), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css( "top" ), + left: wrapper.css( "left" ) + } ).insertAfter( wrapper ); + wrapper.remove(); + } + + this.originalElement.css( "resize", this.originalResizeStyle ); + _destroy( this.originalElement ); + + return this; + }, + + _setOption: function( key, value ) { + this._super( key, value ); + + switch ( key ) { + case "handles": + this._removeHandles(); + this._setupHandles(); + break; + default: + break; + } + }, + + _setupHandles: function() { + var o = this.options, handle, i, n, hname, axis, that = this; + this.handles = o.handles || + ( !$( ".ui-resizable-handle", this.element ).length ? + "e,s,se" : { + n: ".ui-resizable-n", + e: ".ui-resizable-e", + s: ".ui-resizable-s", + w: ".ui-resizable-w", + se: ".ui-resizable-se", + sw: ".ui-resizable-sw", + ne: ".ui-resizable-ne", + nw: ".ui-resizable-nw" + } ); + + this._handles = $(); + if ( this.handles.constructor === String ) { + + if ( this.handles === "all" ) { + this.handles = "n,e,s,w,se,sw,ne,nw"; + } + + n = this.handles.split( "," ); + this.handles = {}; + + for ( i = 0; i < n.length; i++ ) { + + handle = $.trim( n[ i ] ); + hname = "ui-resizable-" + handle; + axis = $( "<div>" ); + this._addClass( axis, "ui-resizable-handle " + hname ); + + axis.css( { zIndex: o.zIndex } ); + + this.handles[ handle ] = ".ui-resizable-" + handle; + this.element.append( axis ); + } + + } + + this._renderAxis = function( target ) { + + var i, axis, padPos, padWrapper; + + target = target || this.element; + + for ( i in this.handles ) { + + if ( this.handles[ i ].constructor === String ) { + this.handles[ i ] = this.element.children( this.handles[ i ] ).first().show(); + } else if ( this.handles[ i ].jquery || this.handles[ i ].nodeType ) { + this.handles[ i ] = $( this.handles[ i ] ); + this._on( this.handles[ i ], { "mousedown": that._mouseDown } ); + } + + if ( this.elementIsWrapper && + this.originalElement[ 0 ] + .nodeName + .match( /^(textarea|input|select|button)$/i ) ) { + axis = $( this.handles[ i ], this.element ); + + padWrapper = /sw|ne|nw|se|n|s/.test( i ) ? + axis.outerHeight() : + axis.outerWidth(); + + padPos = [ "padding", + /ne|nw|n/.test( i ) ? "Top" : + /se|sw|s/.test( i ) ? "Bottom" : + /^e$/.test( i ) ? "Right" : "Left" ].join( "" ); + + target.css( padPos, padWrapper ); + + this._proportionallyResize(); + } + + this._handles = this._handles.add( this.handles[ i ] ); + } + }; + + // TODO: make renderAxis a prototype function + this._renderAxis( this.element ); + + this._handles = this._handles.add( this.element.find( ".ui-resizable-handle" ) ); + this._handles.disableSelection(); + + this._handles.on( "mouseover", function() { + if ( !that.resizing ) { + if ( this.className ) { + axis = this.className.match( /ui-resizable-(se|sw|ne|nw|n|e|s|w)/i ); + } + that.axis = axis && axis[ 1 ] ? axis[ 1 ] : "se"; + } + } ); + + if ( o.autoHide ) { + this._handles.hide(); + this._addClass( "ui-resizable-autohide" ); + } + }, + + _removeHandles: function() { + this._handles.remove(); + }, + + _mouseCapture: function( event ) { + var i, handle, + capture = false; + + for ( i in this.handles ) { + handle = $( this.handles[ i ] )[ 0 ]; + if ( handle === event.target || $.contains( handle, event.target ) ) { + capture = true; + } + } + + return !this.options.disabled && capture; + }, + + _mouseStart: function( event ) { + + var curleft, curtop, cursor, + o = this.options, + el = this.element; + + this.resizing = true; + + this._renderProxy(); + + curleft = this._num( this.helper.css( "left" ) ); + curtop = this._num( this.helper.css( "top" ) ); + + if ( o.containment ) { + curleft += $( o.containment ).scrollLeft() || 0; + curtop += $( o.containment ).scrollTop() || 0; + } + + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + + this.size = this._helper ? { + width: this.helper.width(), + height: this.helper.height() + } : { + width: el.width(), + height: el.height() + }; + + this.originalSize = this._helper ? { + width: el.outerWidth(), + height: el.outerHeight() + } : { + width: el.width(), + height: el.height() + }; + + this.sizeDiff = { + width: el.outerWidth() - el.width(), + height: el.outerHeight() - el.height() + }; + + this.originalPosition = { left: curleft, top: curtop }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + this.aspectRatio = ( typeof o.aspectRatio === "number" ) ? + o.aspectRatio : + ( ( this.originalSize.width / this.originalSize.height ) || 1 ); + + cursor = $( ".ui-resizable-" + this.axis ).css( "cursor" ); + $( "body" ).css( "cursor", cursor === "auto" ? this.axis + "-resize" : cursor ); + + this._addClass( "ui-resizable-resizing" ); + this._propagate( "start", event ); + return true; + }, + + _mouseDrag: function( event ) { + + var data, props, + smp = this.originalMousePosition, + a = this.axis, + dx = ( event.pageX - smp.left ) || 0, + dy = ( event.pageY - smp.top ) || 0, + trigger = this._change[ a ]; + + this._updatePrevProperties(); + + if ( !trigger ) { + return false; + } + + data = trigger.apply( this, [ event, dx, dy ] ); + + this._updateVirtualBoundaries( event.shiftKey ); + if ( this._aspectRatio || event.shiftKey ) { + data = this._updateRatio( data, event ); + } + + data = this._respectSize( data, event ); + + this._updateCache( data ); + + this._propagate( "resize", event ); + + props = this._applyChanges(); + + if ( !this._helper && this._proportionallyResizeElements.length ) { + this._proportionallyResize(); + } + + if ( !$.isEmptyObject( props ) ) { + this._updatePrevProperties(); + this._trigger( "resize", event, this.ui() ); + this._applyChanges(); + } + + return false; + }, + + _mouseStop: function( event ) { + + this.resizing = false; + var pr, ista, soffseth, soffsetw, s, left, top, + o = this.options, that = this; + + if ( this._helper ) { + + pr = this._proportionallyResizeElements; + ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ); + soffseth = ista && this._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height; + soffsetw = ista ? 0 : that.sizeDiff.width; + + s = { + width: ( that.helper.width() - soffsetw ), + height: ( that.helper.height() - soffseth ) + }; + left = ( parseFloat( that.element.css( "left" ) ) + + ( that.position.left - that.originalPosition.left ) ) || null; + top = ( parseFloat( that.element.css( "top" ) ) + + ( that.position.top - that.originalPosition.top ) ) || null; + + if ( !o.animate ) { + this.element.css( $.extend( s, { top: top, left: left } ) ); + } + + that.helper.height( that.size.height ); + that.helper.width( that.size.width ); + + if ( this._helper && !o.animate ) { + this._proportionallyResize(); + } + } + + $( "body" ).css( "cursor", "auto" ); + + this._removeClass( "ui-resizable-resizing" ); + + this._propagate( "stop", event ); + + if ( this._helper ) { + this.helper.remove(); + } + + return false; + + }, + + _updatePrevProperties: function() { + this.prevPosition = { + top: this.position.top, + left: this.position.left + }; + this.prevSize = { + width: this.size.width, + height: this.size.height + }; + }, + + _applyChanges: function() { + var props = {}; + + if ( this.position.top !== this.prevPosition.top ) { + props.top = this.position.top + "px"; + } + if ( this.position.left !== this.prevPosition.left ) { + props.left = this.position.left + "px"; + } + if ( this.size.width !== this.prevSize.width ) { + props.width = this.size.width + "px"; + } + if ( this.size.height !== this.prevSize.height ) { + props.height = this.size.height + "px"; + } + + this.helper.css( props ); + + return props; + }, + + _updateVirtualBoundaries: function( forceAspectRatio ) { + var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b, + o = this.options; + + b = { + minWidth: this._isNumber( o.minWidth ) ? o.minWidth : 0, + maxWidth: this._isNumber( o.maxWidth ) ? o.maxWidth : Infinity, + minHeight: this._isNumber( o.minHeight ) ? o.minHeight : 0, + maxHeight: this._isNumber( o.maxHeight ) ? o.maxHeight : Infinity + }; + + if ( this._aspectRatio || forceAspectRatio ) { + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if ( pMinWidth > b.minWidth ) { + b.minWidth = pMinWidth; + } + if ( pMinHeight > b.minHeight ) { + b.minHeight = pMinHeight; + } + if ( pMaxWidth < b.maxWidth ) { + b.maxWidth = pMaxWidth; + } + if ( pMaxHeight < b.maxHeight ) { + b.maxHeight = pMaxHeight; + } + } + this._vBoundaries = b; + }, + + _updateCache: function( data ) { + this.offset = this.helper.offset(); + if ( this._isNumber( data.left ) ) { + this.position.left = data.left; + } + if ( this._isNumber( data.top ) ) { + this.position.top = data.top; + } + if ( this._isNumber( data.height ) ) { + this.size.height = data.height; + } + if ( this._isNumber( data.width ) ) { + this.size.width = data.width; + } + }, + + _updateRatio: function( data ) { + + var cpos = this.position, + csize = this.size, + a = this.axis; + + if ( this._isNumber( data.height ) ) { + data.width = ( data.height * this.aspectRatio ); + } else if ( this._isNumber( data.width ) ) { + data.height = ( data.width / this.aspectRatio ); + } + + if ( a === "sw" ) { + data.left = cpos.left + ( csize.width - data.width ); + data.top = null; + } + if ( a === "nw" ) { + data.top = cpos.top + ( csize.height - data.height ); + data.left = cpos.left + ( csize.width - data.width ); + } + + return data; + }, + + _respectSize: function( data ) { + + var o = this._vBoundaries, + a = this.axis, + ismaxw = this._isNumber( data.width ) && o.maxWidth && ( o.maxWidth < data.width ), + ismaxh = this._isNumber( data.height ) && o.maxHeight && ( o.maxHeight < data.height ), + isminw = this._isNumber( data.width ) && o.minWidth && ( o.minWidth > data.width ), + isminh = this._isNumber( data.height ) && o.minHeight && ( o.minHeight > data.height ), + dw = this.originalPosition.left + this.originalSize.width, + dh = this.originalPosition.top + this.originalSize.height, + cw = /sw|nw|w/.test( a ), ch = /nw|ne|n/.test( a ); + if ( isminw ) { + data.width = o.minWidth; + } + if ( isminh ) { + data.height = o.minHeight; + } + if ( ismaxw ) { + data.width = o.maxWidth; + } + if ( ismaxh ) { + data.height = o.maxHeight; + } + + if ( isminw && cw ) { + data.left = dw - o.minWidth; + } + if ( ismaxw && cw ) { + data.left = dw - o.maxWidth; + } + if ( isminh && ch ) { + data.top = dh - o.minHeight; + } + if ( ismaxh && ch ) { + data.top = dh - o.maxHeight; + } + + // Fixing jump error on top/left - bug #2330 + if ( !data.width && !data.height && !data.left && data.top ) { + data.top = null; + } else if ( !data.width && !data.height && !data.top && data.left ) { + data.left = null; + } + + return data; + }, + + _getPaddingPlusBorderDimensions: function( element ) { + var i = 0, + widths = [], + borders = [ + element.css( "borderTopWidth" ), + element.css( "borderRightWidth" ), + element.css( "borderBottomWidth" ), + element.css( "borderLeftWidth" ) + ], + paddings = [ + element.css( "paddingTop" ), + element.css( "paddingRight" ), + element.css( "paddingBottom" ), + element.css( "paddingLeft" ) + ]; + + for ( ; i < 4; i++ ) { + widths[ i ] = ( parseFloat( borders[ i ] ) || 0 ); + widths[ i ] += ( parseFloat( paddings[ i ] ) || 0 ); + } + + return { + height: widths[ 0 ] + widths[ 2 ], + width: widths[ 1 ] + widths[ 3 ] + }; + }, + + _proportionallyResize: function() { + + if ( !this._proportionallyResizeElements.length ) { + return; + } + + var prel, + i = 0, + element = this.helper || this.element; + + for ( ; i < this._proportionallyResizeElements.length; i++ ) { + + prel = this._proportionallyResizeElements[ i ]; + + // TODO: Seems like a bug to cache this.outerDimensions + // considering that we are in a loop. + if ( !this.outerDimensions ) { + this.outerDimensions = this._getPaddingPlusBorderDimensions( prel ); + } + + prel.css( { + height: ( element.height() - this.outerDimensions.height ) || 0, + width: ( element.width() - this.outerDimensions.width ) || 0 + } ); + + } + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if ( this._helper ) { + + this.helper = this.helper || $( "<div style='overflow:hidden;'></div>" ); + + this._addClass( this.helper, this._helper ); + this.helper.css( { + width: this.element.outerWidth(), + height: this.element.outerHeight(), + position: "absolute", + left: this.elementOffset.left + "px", + top: this.elementOffset.top + "px", + zIndex: ++o.zIndex //TODO: Don't modify option + } ); + + this.helper + .appendTo( "body" ) + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function( event, dx ) { + return { width: this.originalSize.width + dx }; + }, + w: function( event, dx ) { + var cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function( event, dx, dy ) { + var cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function( event, dx, dy ) { + return { height: this.originalSize.height + dy }; + }, + se: function( event, dx, dy ) { + return $.extend( this._change.s.apply( this, arguments ), + this._change.e.apply( this, [ event, dx, dy ] ) ); + }, + sw: function( event, dx, dy ) { + return $.extend( this._change.s.apply( this, arguments ), + this._change.w.apply( this, [ event, dx, dy ] ) ); + }, + ne: function( event, dx, dy ) { + return $.extend( this._change.n.apply( this, arguments ), + this._change.e.apply( this, [ event, dx, dy ] ) ); + }, + nw: function( event, dx, dy ) { + return $.extend( this._change.n.apply( this, arguments ), + this._change.w.apply( this, [ event, dx, dy ] ) ); + } + }, + + _propagate: function( n, event ) { + $.ui.plugin.call( this, n, [ event, this.ui() ] ); + ( n !== "resize" && this._trigger( n, event, this.ui() ) ); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +} ); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add( "resizable", "animate", { + + stop: function( event ) { + var that = $( this ).resizable( "instance" ), + o = that.options, + pr = that._proportionallyResizeElements, + ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ), + soffseth = ista && that._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width, + style = { + width: ( that.size.width - soffsetw ), + height: ( that.size.height - soffseth ) + }, + left = ( parseFloat( that.element.css( "left" ) ) + + ( that.position.left - that.originalPosition.left ) ) || null, + top = ( parseFloat( that.element.css( "top" ) ) + + ( that.position.top - that.originalPosition.top ) ) || null; + + that.element.animate( + $.extend( style, top && left ? { top: top, left: left } : {} ), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseFloat( that.element.css( "width" ) ), + height: parseFloat( that.element.css( "height" ) ), + top: parseFloat( that.element.css( "top" ) ), + left: parseFloat( that.element.css( "left" ) ) + }; + + if ( pr && pr.length ) { + $( pr[ 0 ] ).css( { width: data.width, height: data.height } ); + } + + // Propagating resize, and updating values for each animation step + that._updateCache( data ); + that._propagate( "resize", event ); + + } + } + ); + } + +} ); + +$.ui.plugin.add( "resizable", "containment", { + + start: function() { + var element, p, co, ch, cw, width, height, + that = $( this ).resizable( "instance" ), + o = that.options, + el = that.element, + oc = o.containment, + ce = ( oc instanceof $ ) ? + oc.get( 0 ) : + ( /parent/.test( oc ) ) ? el.parent().get( 0 ) : oc; + + if ( !ce ) { + return; + } + + that.containerElement = $( ce ); + + if ( /document/.test( oc ) || oc === document ) { + that.containerOffset = { + left: 0, + top: 0 + }; + that.containerPosition = { + left: 0, + top: 0 + }; + + that.parentData = { + element: $( document ), + left: 0, + top: 0, + width: $( document ).width(), + height: $( document ).height() || document.body.parentNode.scrollHeight + }; + } else { + element = $( ce ); + p = []; + $( [ "Top", "Right", "Left", "Bottom" ] ).each( function( i, name ) { + p[ i ] = that._num( element.css( "padding" + name ) ); + } ); + + that.containerOffset = element.offset(); + that.containerPosition = element.position(); + that.containerSize = { + height: ( element.innerHeight() - p[ 3 ] ), + width: ( element.innerWidth() - p[ 1 ] ) + }; + + co = that.containerOffset; + ch = that.containerSize.height; + cw = that.containerSize.width; + width = ( that._hasScroll ( ce, "left" ) ? ce.scrollWidth : cw ); + height = ( that._hasScroll ( ce ) ? ce.scrollHeight : ch ) ; + + that.parentData = { + element: ce, + left: co.left, + top: co.top, + width: width, + height: height + }; + } + }, + + resize: function( event ) { + var woset, hoset, isParent, isOffsetRelative, + that = $( this ).resizable( "instance" ), + o = that.options, + co = that.containerOffset, + cp = that.position, + pRatio = that._aspectRatio || event.shiftKey, + cop = { + top: 0, + left: 0 + }, + ce = that.containerElement, + continueResize = true; + + if ( ce[ 0 ] !== document && ( /static/ ).test( ce.css( "position" ) ) ) { + cop = co; + } + + if ( cp.left < ( that._helper ? co.left : 0 ) ) { + that.size.width = that.size.width + + ( that._helper ? + ( that.position.left - co.left ) : + ( that.position.left - cop.left ) ); + + if ( pRatio ) { + that.size.height = that.size.width / that.aspectRatio; + continueResize = false; + } + that.position.left = o.helper ? co.left : 0; + } + + if ( cp.top < ( that._helper ? co.top : 0 ) ) { + that.size.height = that.size.height + + ( that._helper ? + ( that.position.top - co.top ) : + that.position.top ); + + if ( pRatio ) { + that.size.width = that.size.height * that.aspectRatio; + continueResize = false; + } + that.position.top = that._helper ? co.top : 0; + } + + isParent = that.containerElement.get( 0 ) === that.element.parent().get( 0 ); + isOffsetRelative = /relative|absolute/.test( that.containerElement.css( "position" ) ); + + if ( isParent && isOffsetRelative ) { + that.offset.left = that.parentData.left + that.position.left; + that.offset.top = that.parentData.top + that.position.top; + } else { + that.offset.left = that.element.offset().left; + that.offset.top = that.element.offset().top; + } + + woset = Math.abs( that.sizeDiff.width + + ( that._helper ? + that.offset.left - cop.left : + ( that.offset.left - co.left ) ) ); + + hoset = Math.abs( that.sizeDiff.height + + ( that._helper ? + that.offset.top - cop.top : + ( that.offset.top - co.top ) ) ); + + if ( woset + that.size.width >= that.parentData.width ) { + that.size.width = that.parentData.width - woset; + if ( pRatio ) { + that.size.height = that.size.width / that.aspectRatio; + continueResize = false; + } + } + + if ( hoset + that.size.height >= that.parentData.height ) { + that.size.height = that.parentData.height - hoset; + if ( pRatio ) { + that.size.width = that.size.height * that.aspectRatio; + continueResize = false; + } + } + + if ( !continueResize ) { + that.position.left = that.prevPosition.left; + that.position.top = that.prevPosition.top; + that.size.width = that.prevSize.width; + that.size.height = that.prevSize.height; + } + }, + + stop: function() { + var that = $( this ).resizable( "instance" ), + o = that.options, + co = that.containerOffset, + cop = that.containerPosition, + ce = that.containerElement, + helper = $( that.helper ), + ho = helper.offset(), + w = helper.outerWidth() - that.sizeDiff.width, + h = helper.outerHeight() - that.sizeDiff.height; + + if ( that._helper && !o.animate && ( /relative/ ).test( ce.css( "position" ) ) ) { + $( this ).css( { + left: ho.left - cop.left - co.left, + width: w, + height: h + } ); + } + + if ( that._helper && !o.animate && ( /static/ ).test( ce.css( "position" ) ) ) { + $( this ).css( { + left: ho.left - cop.left - co.left, + width: w, + height: h + } ); + } + } +} ); + +$.ui.plugin.add( "resizable", "alsoResize", { + + start: function() { + var that = $( this ).resizable( "instance" ), + o = that.options; + + $( o.alsoResize ).each( function() { + var el = $( this ); + el.data( "ui-resizable-alsoresize", { + width: parseFloat( el.width() ), height: parseFloat( el.height() ), + left: parseFloat( el.css( "left" ) ), top: parseFloat( el.css( "top" ) ) + } ); + } ); + }, + + resize: function( event, ui ) { + var that = $( this ).resizable( "instance" ), + o = that.options, + os = that.originalSize, + op = that.originalPosition, + delta = { + height: ( that.size.height - os.height ) || 0, + width: ( that.size.width - os.width ) || 0, + top: ( that.position.top - op.top ) || 0, + left: ( that.position.left - op.left ) || 0 + }; + + $( o.alsoResize ).each( function() { + var el = $( this ), start = $( this ).data( "ui-resizable-alsoresize" ), style = {}, + css = el.parents( ui.originalElement[ 0 ] ).length ? + [ "width", "height" ] : + [ "width", "height", "top", "left" ]; + + $.each( css, function( i, prop ) { + var sum = ( start[ prop ] || 0 ) + ( delta[ prop ] || 0 ); + if ( sum && sum >= 0 ) { + style[ prop ] = sum || null; + } + } ); + + el.css( style ); + } ); + }, + + stop: function() { + $( this ).removeData( "ui-resizable-alsoresize" ); + } +} ); + +$.ui.plugin.add( "resizable", "ghost", { + + start: function() { + + var that = $( this ).resizable( "instance" ), cs = that.size; + + that.ghost = that.originalElement.clone(); + that.ghost.css( { + opacity: 0.25, + display: "block", + position: "relative", + height: cs.height, + width: cs.width, + margin: 0, + left: 0, + top: 0 + } ); + + that._addClass( that.ghost, "ui-resizable-ghost" ); + + // DEPRECATED + // TODO: remove after 1.12 + if ( $.uiBackCompat !== false && typeof that.options.ghost === "string" ) { + + // Ghost option + that.ghost.addClass( this.options.ghost ); + } + + that.ghost.appendTo( that.helper ); + + }, + + resize: function() { + var that = $( this ).resizable( "instance" ); + if ( that.ghost ) { + that.ghost.css( { + position: "relative", + height: that.size.height, + width: that.size.width + } ); + } + }, + + stop: function() { + var that = $( this ).resizable( "instance" ); + if ( that.ghost && that.helper ) { + that.helper.get( 0 ).removeChild( that.ghost.get( 0 ) ); + } + } + +} ); + +$.ui.plugin.add( "resizable", "grid", { + + resize: function() { + var outerDimensions, + that = $( this ).resizable( "instance" ), + o = that.options, + cs = that.size, + os = that.originalSize, + op = that.originalPosition, + a = that.axis, + grid = typeof o.grid === "number" ? [ o.grid, o.grid ] : o.grid, + gridX = ( grid[ 0 ] || 1 ), + gridY = ( grid[ 1 ] || 1 ), + ox = Math.round( ( cs.width - os.width ) / gridX ) * gridX, + oy = Math.round( ( cs.height - os.height ) / gridY ) * gridY, + newWidth = os.width + ox, + newHeight = os.height + oy, + isMaxWidth = o.maxWidth && ( o.maxWidth < newWidth ), + isMaxHeight = o.maxHeight && ( o.maxHeight < newHeight ), + isMinWidth = o.minWidth && ( o.minWidth > newWidth ), + isMinHeight = o.minHeight && ( o.minHeight > newHeight ); + + o.grid = grid; + + if ( isMinWidth ) { + newWidth += gridX; + } + if ( isMinHeight ) { + newHeight += gridY; + } + if ( isMaxWidth ) { + newWidth -= gridX; + } + if ( isMaxHeight ) { + newHeight -= gridY; + } + + if ( /^(se|s|e)$/.test( a ) ) { + that.size.width = newWidth; + that.size.height = newHeight; + } else if ( /^(ne)$/.test( a ) ) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.top = op.top - oy; + } else if ( /^(sw)$/.test( a ) ) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.left = op.left - ox; + } else { + if ( newHeight - gridY <= 0 || newWidth - gridX <= 0 ) { + outerDimensions = that._getPaddingPlusBorderDimensions( this ); + } + + if ( newHeight - gridY > 0 ) { + that.size.height = newHeight; + that.position.top = op.top - oy; + } else { + newHeight = gridY - outerDimensions.height; + that.size.height = newHeight; + that.position.top = op.top + os.height - newHeight; + } + if ( newWidth - gridX > 0 ) { + that.size.width = newWidth; + that.position.left = op.left - ox; + } else { + newWidth = gridX - outerDimensions.width; + that.size.width = newWidth; + that.position.left = op.left + os.width - newWidth; + } + } + } + +} ); + +var widgetsResizable = $.ui.resizable; + + +/*! + * jQuery UI Selectable 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Selectable +//>>group: Interactions +//>>description: Allows groups of elements to be selected with the mouse. +//>>docs: http://api.jqueryui.com/selectable/ +//>>demos: http://jqueryui.com/selectable/ +//>>css.structure: ../../themes/base/selectable.css + + + +var widgetsSelectable = $.widget( "ui.selectable", $.ui.mouse, { + version: "1.12.1", + options: { + appendTo: "body", + autoRefresh: true, + distance: 0, + filter: "*", + tolerance: "touch", + + // Callbacks + selected: null, + selecting: null, + start: null, + stop: null, + unselected: null, + unselecting: null + }, + _create: function() { + var that = this; + + this._addClass( "ui-selectable" ); + + this.dragged = false; + + // Cache selectee children based on filter + this.refresh = function() { + that.elementPos = $( that.element[ 0 ] ).offset(); + that.selectees = $( that.options.filter, that.element[ 0 ] ); + that._addClass( that.selectees, "ui-selectee" ); + that.selectees.each( function() { + var $this = $( this ), + selecteeOffset = $this.offset(), + pos = { + left: selecteeOffset.left - that.elementPos.left, + top: selecteeOffset.top - that.elementPos.top + }; + $.data( this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass( "ui-selected" ), + selecting: $this.hasClass( "ui-selecting" ), + unselecting: $this.hasClass( "ui-unselecting" ) + } ); + } ); + }; + this.refresh(); + + this._mouseInit(); + + this.helper = $( "<div>" ); + this._addClass( this.helper, "ui-selectable-helper" ); + }, + + _destroy: function() { + this.selectees.removeData( "selectable-item" ); + this._mouseDestroy(); + }, + + _mouseStart: function( event ) { + var that = this, + options = this.options; + + this.opos = [ event.pageX, event.pageY ]; + this.elementPos = $( this.element[ 0 ] ).offset(); + + if ( this.options.disabled ) { + return; + } + + this.selectees = $( options.filter, this.element[ 0 ] ); + + this._trigger( "start", event ); + + $( options.appendTo ).append( this.helper ); + + // position helper (lasso) + this.helper.css( { + "left": event.pageX, + "top": event.pageY, + "width": 0, + "height": 0 + } ); + + if ( options.autoRefresh ) { + this.refresh(); + } + + this.selectees.filter( ".ui-selected" ).each( function() { + var selectee = $.data( this, "selectable-item" ); + selectee.startselected = true; + if ( !event.metaKey && !event.ctrlKey ) { + that._removeClass( selectee.$element, "ui-selected" ); + selectee.selected = false; + that._addClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = true; + + // selectable UNSELECTING callback + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + } ); + + $( event.target ).parents().addBack().each( function() { + var doSelect, + selectee = $.data( this, "selectable-item" ); + if ( selectee ) { + doSelect = ( !event.metaKey && !event.ctrlKey ) || + !selectee.$element.hasClass( "ui-selected" ); + that._removeClass( selectee.$element, doSelect ? "ui-unselecting" : "ui-selected" ) + ._addClass( selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting" ); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + + // selectable (UN)SELECTING callback + if ( doSelect ) { + that._trigger( "selecting", event, { + selecting: selectee.element + } ); + } else { + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + return false; + } + } ); + + }, + + _mouseDrag: function( event ) { + + this.dragged = true; + + if ( this.options.disabled ) { + return; + } + + var tmp, + that = this, + options = this.options, + x1 = this.opos[ 0 ], + y1 = this.opos[ 1 ], + x2 = event.pageX, + y2 = event.pageY; + + if ( x1 > x2 ) { tmp = x2; x2 = x1; x1 = tmp; } + if ( y1 > y2 ) { tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css( { left: x1, top: y1, width: x2 - x1, height: y2 - y1 } ); + + this.selectees.each( function() { + var selectee = $.data( this, "selectable-item" ), + hit = false, + offset = {}; + + //prevent helper from being selected if appendTo: selectable + if ( !selectee || selectee.element === that.element[ 0 ] ) { + return; + } + + offset.left = selectee.left + that.elementPos.left; + offset.right = selectee.right + that.elementPos.left; + offset.top = selectee.top + that.elementPos.top; + offset.bottom = selectee.bottom + that.elementPos.top; + + if ( options.tolerance === "touch" ) { + hit = ( !( offset.left > x2 || offset.right < x1 || offset.top > y2 || + offset.bottom < y1 ) ); + } else if ( options.tolerance === "fit" ) { + hit = ( offset.left > x1 && offset.right < x2 && offset.top > y1 && + offset.bottom < y2 ); + } + + if ( hit ) { + + // SELECT + if ( selectee.selected ) { + that._removeClass( selectee.$element, "ui-selected" ); + selectee.selected = false; + } + if ( selectee.unselecting ) { + that._removeClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = false; + } + if ( !selectee.selecting ) { + that._addClass( selectee.$element, "ui-selecting" ); + selectee.selecting = true; + + // selectable SELECTING callback + that._trigger( "selecting", event, { + selecting: selectee.element + } ); + } + } else { + + // UNSELECT + if ( selectee.selecting ) { + if ( ( event.metaKey || event.ctrlKey ) && selectee.startselected ) { + that._removeClass( selectee.$element, "ui-selecting" ); + selectee.selecting = false; + that._addClass( selectee.$element, "ui-selected" ); + selectee.selected = true; + } else { + that._removeClass( selectee.$element, "ui-selecting" ); + selectee.selecting = false; + if ( selectee.startselected ) { + that._addClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = true; + } + + // selectable UNSELECTING callback + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + } + if ( selectee.selected ) { + if ( !event.metaKey && !event.ctrlKey && !selectee.startselected ) { + that._removeClass( selectee.$element, "ui-selected" ); + selectee.selected = false; + + that._addClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = true; + + // selectable UNSELECTING callback + that._trigger( "unselecting", event, { + unselecting: selectee.element + } ); + } + } + } + } ); + + return false; + }, + + _mouseStop: function( event ) { + var that = this; + + this.dragged = false; + + $( ".ui-unselecting", this.element[ 0 ] ).each( function() { + var selectee = $.data( this, "selectable-item" ); + that._removeClass( selectee.$element, "ui-unselecting" ); + selectee.unselecting = false; + selectee.startselected = false; + that._trigger( "unselected", event, { + unselected: selectee.element + } ); + } ); + $( ".ui-selecting", this.element[ 0 ] ).each( function() { + var selectee = $.data( this, "selectable-item" ); + that._removeClass( selectee.$element, "ui-selecting" ) + ._addClass( selectee.$element, "ui-selected" ); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + that._trigger( "selected", event, { + selected: selectee.element + } ); + } ); + this._trigger( "stop", event ); + + this.helper.remove(); + + return false; + } + +} ); + + +/*! + * jQuery UI Sortable 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Sortable +//>>group: Interactions +//>>description: Enables items in a list to be sorted using the mouse. +//>>docs: http://api.jqueryui.com/sortable/ +//>>demos: http://jqueryui.com/sortable/ +//>>css.structure: ../../themes/base/sortable.css + + + +var widgetsSortable = $.widget( "ui.sortable", $.ui.mouse, { + version: "1.12.1", + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: "auto", + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: "> *", + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000, + + // Callbacks + activate: null, + beforeStop: null, + change: null, + deactivate: null, + out: null, + over: null, + receive: null, + remove: null, + sort: null, + start: null, + stop: null, + update: null + }, + + _isOverAxis: function( x, reference, size ) { + return ( x >= reference ) && ( x < ( reference + size ) ); + }, + + _isFloating: function( item ) { + return ( /left|right/ ).test( item.css( "float" ) ) || + ( /inline|table-cell/ ).test( item.css( "display" ) ); + }, + + _create: function() { + this.containerCache = {}; + this._addClass( "ui-sortable" ); + + //Get the items + this.refresh(); + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + this._setHandleClassName(); + + //We're ready to go + this.ready = true; + + }, + + _setOption: function( key, value ) { + this._super( key, value ); + + if ( key === "handle" ) { + this._setHandleClassName(); + } + }, + + _setHandleClassName: function() { + var that = this; + this._removeClass( this.element.find( ".ui-sortable-handle" ), "ui-sortable-handle" ); + $.each( this.items, function() { + that._addClass( + this.instance.options.handle ? + this.item.find( this.instance.options.handle ) : + this.item, + "ui-sortable-handle" + ); + } ); + }, + + _destroy: function() { + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) { + this.items[ i ].item.removeData( this.widgetName + "-item" ); + } + + return this; + }, + + _mouseCapture: function( event, overrideHandle ) { + var currentItem = null, + validHandle = false, + that = this; + + if ( this.reverting ) { + return false; + } + + if ( this.options.disabled || this.options.type === "static" ) { + return false; + } + + //We have to refresh the items data once first + this._refreshItems( event ); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + $( event.target ).parents().each( function() { + if ( $.data( this, that.widgetName + "-item" ) === that ) { + currentItem = $( this ); + return false; + } + } ); + if ( $.data( event.target, that.widgetName + "-item" ) === that ) { + currentItem = $( event.target ); + } + + if ( !currentItem ) { + return false; + } + if ( this.options.handle && !overrideHandle ) { + $( this.options.handle, currentItem ).find( "*" ).addBack().each( function() { + if ( this === event.target ) { + validHandle = true; + } + } ); + if ( !validHandle ) { + return false; + } + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function( event, overrideHandle, noActivation ) { + + var i, body, + o = this.options; + + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to + // mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper( event ); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend( this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + + // This is a relative to absolute position minus the actual position calculation - + // only used for relative positioned helper + relative: this._getRelativeOffset() + } ); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css( "position", "absolute" ); + this.cssPosition = this.helper.css( "position" ); + + //Generate the original position + this.originalPosition = this._generatePosition( event ); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + ( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) ); + + //Cache the former DOM position + this.domPosition = { + prev: this.currentItem.prev()[ 0 ], + parent: this.currentItem.parent()[ 0 ] + }; + + // If the helper is not the original, hide the original so it's not playing any role during + // the drag, won't cause anything bad this way + if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if ( o.containment ) { + this._setContainment(); + } + + if ( o.cursor && o.cursor !== "auto" ) { // cursor option + body = this.document.find( "body" ); + + // Support: IE + this.storedCursor = body.css( "cursor" ); + body.css( "cursor", o.cursor ); + + this.storedStylesheet = + $( "<style>*{ cursor: " + o.cursor + " !important; }</style>" ).appendTo( body ); + } + + if ( o.opacity ) { // opacity option + if ( this.helper.css( "opacity" ) ) { + this._storedOpacity = this.helper.css( "opacity" ); + } + this.helper.css( "opacity", o.opacity ); + } + + if ( o.zIndex ) { // zIndex option + if ( this.helper.css( "zIndex" ) ) { + this._storedZIndex = this.helper.css( "zIndex" ); + } + this.helper.css( "zIndex", o.zIndex ); + } + + //Prepare scrolling + if ( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ].tagName !== "HTML" ) { + this.overflowOffset = this.scrollParent.offset(); + } + + //Call callbacks + this._trigger( "start", event, this._uiHash() ); + + //Recache the helper size + if ( !this._preserveHelperProportions ) { + this._cacheHelperProportions(); + } + + //Post "activate" events to possible containers + if ( !noActivation ) { + for ( i = this.containers.length - 1; i >= 0; i-- ) { + this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) ); + } + } + + //Prepare possible droppables + if ( $.ui.ddmanager ) { + $.ui.ddmanager.current = this; + } + + if ( $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( this, event ); + } + + this.dragging = true; + + this._addClass( this.helper, "ui-sortable-helper" ); + + // Execute the drag once - this causes the helper not to be visiblebefore getting its + // correct position + this._mouseDrag( event ); + return true; + + }, + + _mouseDrag: function( event ) { + var i, item, itemElement, intersection, + o = this.options, + scrolled = false; + + //Compute the helpers position + this.position = this._generatePosition( event ); + this.positionAbs = this._convertPositionTo( "absolute" ); + + if ( !this.lastPositionAbs ) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if ( this.options.scroll ) { + if ( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ].tagName !== "HTML" ) { + + if ( ( this.overflowOffset.top + this.scrollParent[ 0 ].offsetHeight ) - + event.pageY < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollTop = + scrolled = this.scrollParent[ 0 ].scrollTop + o.scrollSpeed; + } else if ( event.pageY - this.overflowOffset.top < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollTop = + scrolled = this.scrollParent[ 0 ].scrollTop - o.scrollSpeed; + } + + if ( ( this.overflowOffset.left + this.scrollParent[ 0 ].offsetWidth ) - + event.pageX < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollLeft = scrolled = + this.scrollParent[ 0 ].scrollLeft + o.scrollSpeed; + } else if ( event.pageX - this.overflowOffset.left < o.scrollSensitivity ) { + this.scrollParent[ 0 ].scrollLeft = scrolled = + this.scrollParent[ 0 ].scrollLeft - o.scrollSpeed; + } + + } else { + + if ( event.pageY - this.document.scrollTop() < o.scrollSensitivity ) { + scrolled = this.document.scrollTop( this.document.scrollTop() - o.scrollSpeed ); + } else if ( this.window.height() - ( event.pageY - this.document.scrollTop() ) < + o.scrollSensitivity ) { + scrolled = this.document.scrollTop( this.document.scrollTop() + o.scrollSpeed ); + } + + if ( event.pageX - this.document.scrollLeft() < o.scrollSensitivity ) { + scrolled = this.document.scrollLeft( + this.document.scrollLeft() - o.scrollSpeed + ); + } else if ( this.window.width() - ( event.pageX - this.document.scrollLeft() ) < + o.scrollSensitivity ) { + scrolled = this.document.scrollLeft( + this.document.scrollLeft() + o.scrollSpeed + ); + } + + } + + if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) { + $.ui.ddmanager.prepareOffsets( this, event ); + } + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo( "absolute" ); + + //Set the helper position + if ( !this.options.axis || this.options.axis !== "y" ) { + this.helper[ 0 ].style.left = this.position.left + "px"; + } + if ( !this.options.axis || this.options.axis !== "x" ) { + this.helper[ 0 ].style.top = this.position.top + "px"; + } + + //Rearrange + for ( i = this.items.length - 1; i >= 0; i-- ) { + + //Cache variables and intersection, continue if no intersection + item = this.items[ i ]; + itemElement = item.item[ 0 ]; + intersection = this._intersectsWithPointer( item ); + if ( !intersection ) { + continue; + } + + // Only put the placeholder inside the current Container, skip all + // items from other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this, moving items in "sub-sortables" can cause + // the placeholder to jitter between the outer and inner container. + if ( item.instance !== this.currentContainer ) { + continue; + } + + // Cannot intersect with itself + // no useless actions that have been done before + // no action if the item moved is the parent of the item checked + if ( itemElement !== this.currentItem[ 0 ] && + this.placeholder[ intersection === 1 ? "next" : "prev" ]()[ 0 ] !== itemElement && + !$.contains( this.placeholder[ 0 ], itemElement ) && + ( this.options.type === "semi-dynamic" ? + !$.contains( this.element[ 0 ], itemElement ) : + true + ) + ) { + + this.direction = intersection === 1 ? "down" : "up"; + + if ( this.options.tolerance === "pointer" || this._intersectsWithSides( item ) ) { + this._rearrange( event, item ); + } else { + break; + } + + this._trigger( "change", event, this._uiHash() ); + break; + } + } + + //Post events to containers + this._contactContainers( event ); + + //Interconnect with droppables + if ( $.ui.ddmanager ) { + $.ui.ddmanager.drag( this, event ); + } + + //Call callbacks + this._trigger( "sort", event, this._uiHash() ); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function( event, noPropagation ) { + + if ( !event ) { + return; + } + + //If we are using droppables, inform the manager about the drop + if ( $.ui.ddmanager && !this.options.dropBehaviour ) { + $.ui.ddmanager.drop( this, event ); + } + + if ( this.options.revert ) { + var that = this, + cur = this.placeholder.offset(), + axis = this.options.axis, + animation = {}; + + if ( !axis || axis === "x" ) { + animation.left = cur.left - this.offset.parent.left - this.margins.left + + ( this.offsetParent[ 0 ] === this.document[ 0 ].body ? + 0 : + this.offsetParent[ 0 ].scrollLeft + ); + } + if ( !axis || axis === "y" ) { + animation.top = cur.top - this.offset.parent.top - this.margins.top + + ( this.offsetParent[ 0 ] === this.document[ 0 ].body ? + 0 : + this.offsetParent[ 0 ].scrollTop + ); + } + this.reverting = true; + $( this.helper ).animate( + animation, + parseInt( this.options.revert, 10 ) || 500, + function() { + that._clear( event ); + } + ); + } else { + this._clear( event, noPropagation ); + } + + return false; + + }, + + cancel: function() { + + if ( this.dragging ) { + + this._mouseUp( new $.Event( "mouseup", { target: null } ) ); + + if ( this.options.helper === "original" ) { + this.currentItem.css( this._storedCSS ); + this._removeClass( this.currentItem, "ui-sortable-helper" ); + } else { + this.currentItem.show(); + } + + //Post deactivating events to containers + for ( var i = this.containers.length - 1; i >= 0; i-- ) { + this.containers[ i ]._trigger( "deactivate", null, this._uiHash( this ) ); + if ( this.containers[ i ].containerCache.over ) { + this.containers[ i ]._trigger( "out", null, this._uiHash( this ) ); + this.containers[ i ].containerCache.over = 0; + } + } + + } + + if ( this.placeholder ) { + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, + // it unbinds ALL events from the original node! + if ( this.placeholder[ 0 ].parentNode ) { + this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] ); + } + if ( this.options.helper !== "original" && this.helper && + this.helper[ 0 ].parentNode ) { + this.helper.remove(); + } + + $.extend( this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + } ); + + if ( this.domPosition.prev ) { + $( this.domPosition.prev ).after( this.currentItem ); + } else { + $( this.domPosition.parent ).prepend( this.currentItem ); + } + } + + return this; + + }, + + serialize: function( o ) { + + var items = this._getItemsAsjQuery( o && o.connected ), + str = []; + o = o || {}; + + $( items ).each( function() { + var res = ( $( o.item || this ).attr( o.attribute || "id" ) || "" ) + .match( o.expression || ( /(.+)[\-=_](.+)/ ) ); + if ( res ) { + str.push( + ( o.key || res[ 1 ] + "[]" ) + + "=" + ( o.key && o.expression ? res[ 1 ] : res[ 2 ] ) ); + } + } ); + + if ( !str.length && o.key ) { + str.push( o.key + "=" ); + } + + return str.join( "&" ); + + }, + + toArray: function( o ) { + + var items = this._getItemsAsjQuery( o && o.connected ), + ret = []; + + o = o || {}; + + items.each( function() { + ret.push( $( o.item || this ).attr( o.attribute || "id" ) || "" ); + } ); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function( item ) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height, + l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height, + dyClick = this.offset.click.top, + dxClick = this.offset.click.left, + isOverElementHeight = ( this.options.axis === "x" ) || ( ( y1 + dyClick ) > t && + ( y1 + dyClick ) < b ), + isOverElementWidth = ( this.options.axis === "y" ) || ( ( x1 + dxClick ) > l && + ( x1 + dxClick ) < r ), + isOverElement = isOverElementHeight && isOverElementWidth; + + if ( this.options.tolerance === "pointer" || + this.options.forcePointerForContainers || + ( this.options.tolerance !== "pointer" && + this.helperProportions[ this.floating ? "width" : "height" ] > + item[ this.floating ? "width" : "height" ] ) + ) { + return isOverElement; + } else { + + return ( l < x1 + ( this.helperProportions.width / 2 ) && // Right Half + x2 - ( this.helperProportions.width / 2 ) < r && // Left Half + t < y1 + ( this.helperProportions.height / 2 ) && // Bottom Half + y2 - ( this.helperProportions.height / 2 ) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function( item ) { + var verticalDirection, horizontalDirection, + isOverElementHeight = ( this.options.axis === "x" ) || + this._isOverAxis( + this.positionAbs.top + this.offset.click.top, item.top, item.height ), + isOverElementWidth = ( this.options.axis === "y" ) || + this._isOverAxis( + this.positionAbs.left + this.offset.click.left, item.left, item.width ), + isOverElement = isOverElementHeight && isOverElementWidth; + + if ( !isOverElement ) { + return false; + } + + verticalDirection = this._getDragVerticalDirection(); + horizontalDirection = this._getDragHorizontalDirection(); + + return this.floating ? + ( ( horizontalDirection === "right" || verticalDirection === "down" ) ? 2 : 1 ) + : ( verticalDirection && ( verticalDirection === "down" ? 2 : 1 ) ); + + }, + + _intersectsWithSides: function( item ) { + + var isOverBottomHalf = this._isOverAxis( this.positionAbs.top + + this.offset.click.top, item.top + ( item.height / 2 ), item.height ), + isOverRightHalf = this._isOverAxis( this.positionAbs.left + + this.offset.click.left, item.left + ( item.width / 2 ), item.width ), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if ( this.floating && horizontalDirection ) { + return ( ( horizontalDirection === "right" && isOverRightHalf ) || + ( horizontalDirection === "left" && !isOverRightHalf ) ); + } else { + return verticalDirection && ( ( verticalDirection === "down" && isOverBottomHalf ) || + ( verticalDirection === "up" && !isOverBottomHalf ) ); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta !== 0 && ( delta > 0 ? "down" : "up" ); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta !== 0 && ( delta > 0 ? "right" : "left" ); + }, + + refresh: function( event ) { + this._refreshItems( event ); + this._setHandleClassName(); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor === String ? + [ options.connectWith ] : + options.connectWith; + }, + + _getItemsAsjQuery: function( connected ) { + + var i, j, cur, inst, + items = [], + queries = [], + connectWith = this._connectWith(); + + if ( connectWith && connected ) { + for ( i = connectWith.length - 1; i >= 0; i-- ) { + cur = $( connectWith[ i ], this.document[ 0 ] ); + for ( j = cur.length - 1; j >= 0; j-- ) { + inst = $.data( cur[ j ], this.widgetFullName ); + if ( inst && inst !== this && !inst.options.disabled ) { + queries.push( [ $.isFunction( inst.options.items ) ? + inst.options.items.call( inst.element ) : + $( inst.options.items, inst.element ) + .not( ".ui-sortable-helper" ) + .not( ".ui-sortable-placeholder" ), inst ] ); + } + } + } + } + + queries.push( [ $.isFunction( this.options.items ) ? + this.options.items + .call( this.element, null, { options: this.options, item: this.currentItem } ) : + $( this.options.items, this.element ) + .not( ".ui-sortable-helper" ) + .not( ".ui-sortable-placeholder" ), this ] ); + + function addItems() { + items.push( this ); + } + for ( i = queries.length - 1; i >= 0; i-- ) { + queries[ i ][ 0 ].each( addItems ); + } + + return $( items ); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find( ":data(" + this.widgetName + "-item)" ); + + this.items = $.grep( this.items, function( item ) { + for ( var j = 0; j < list.length; j++ ) { + if ( list[ j ] === item.item[ 0 ] ) { + return false; + } + } + return true; + } ); + + }, + + _refreshItems: function( event ) { + + this.items = []; + this.containers = [ this ]; + + var i, j, cur, inst, targetData, _queries, item, queriesLength, + items = this.items, + queries = [ [ $.isFunction( this.options.items ) ? + this.options.items.call( this.element[ 0 ], event, { item: this.currentItem } ) : + $( this.options.items, this.element ), this ] ], + connectWith = this._connectWith(); + + //Shouldn't be run the first time through due to massive slow-down + if ( connectWith && this.ready ) { + for ( i = connectWith.length - 1; i >= 0; i-- ) { + cur = $( connectWith[ i ], this.document[ 0 ] ); + for ( j = cur.length - 1; j >= 0; j-- ) { + inst = $.data( cur[ j ], this.widgetFullName ); + if ( inst && inst !== this && !inst.options.disabled ) { + queries.push( [ $.isFunction( inst.options.items ) ? + inst.options.items + .call( inst.element[ 0 ], event, { item: this.currentItem } ) : + $( inst.options.items, inst.element ), inst ] ); + this.containers.push( inst ); + } + } + } + } + + for ( i = queries.length - 1; i >= 0; i-- ) { + targetData = queries[ i ][ 1 ]; + _queries = queries[ i ][ 0 ]; + + for ( j = 0, queriesLength = _queries.length; j < queriesLength; j++ ) { + item = $( _queries[ j ] ); + + // Data for target checking (mouse manager) + item.data( this.widgetName + "-item", targetData ); + + items.push( { + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + } ); + } + } + + }, + + refreshPositions: function( fast ) { + + // Determine whether items are being displayed horizontally + this.floating = this.items.length ? + this.options.axis === "x" || this._isFloating( this.items[ 0 ].item ) : + false; + + //This has to be redone because due to the item being moved out/into the offsetParent, + // the offsetParent's position will change + if ( this.offsetParent && this.helper ) { + this.offset.parent = this._getParentOffset(); + } + + var i, item, t, p; + + for ( i = this.items.length - 1; i >= 0; i-- ) { + item = this.items[ i ]; + + //We ignore calculating positions of all connected containers when we're not over them + if ( item.instance !== this.currentContainer && this.currentContainer && + item.item[ 0 ] !== this.currentItem[ 0 ] ) { + continue; + } + + t = this.options.toleranceElement ? + $( this.options.toleranceElement, item.item ) : + item.item; + + if ( !fast ) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + p = t.offset(); + item.left = p.left; + item.top = p.top; + } + + if ( this.options.custom && this.options.custom.refreshContainers ) { + this.options.custom.refreshContainers.call( this ); + } else { + for ( i = this.containers.length - 1; i >= 0; i-- ) { + p = this.containers[ i ].element.offset(); + this.containers[ i ].containerCache.left = p.left; + this.containers[ i ].containerCache.top = p.top; + this.containers[ i ].containerCache.width = + this.containers[ i ].element.outerWidth(); + this.containers[ i ].containerCache.height = + this.containers[ i ].element.outerHeight(); + } + } + + return this; + }, + + _createPlaceholder: function( that ) { + that = that || this; + var className, + o = that.options; + + if ( !o.placeholder || o.placeholder.constructor === String ) { + className = o.placeholder; + o.placeholder = { + element: function() { + + var nodeName = that.currentItem[ 0 ].nodeName.toLowerCase(), + element = $( "<" + nodeName + ">", that.document[ 0 ] ); + + that._addClass( element, "ui-sortable-placeholder", + className || that.currentItem[ 0 ].className ) + ._removeClass( element, "ui-sortable-helper" ); + + if ( nodeName === "tbody" ) { + that._createTrPlaceholder( + that.currentItem.find( "tr" ).eq( 0 ), + $( "<tr>", that.document[ 0 ] ).appendTo( element ) + ); + } else if ( nodeName === "tr" ) { + that._createTrPlaceholder( that.currentItem, element ); + } else if ( nodeName === "img" ) { + element.attr( "src", that.currentItem.attr( "src" ) ); + } + + if ( !className ) { + element.css( "visibility", "hidden" ); + } + + return element; + }, + update: function( container, p ) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - + // the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a + // class name is specified + if ( className && !o.forcePlaceholderSize ) { + return; + } + + //If the element doesn't have a actual height by itself (without styles coming + // from a stylesheet), it receives the inline height from the dragged item + if ( !p.height() ) { + p.height( + that.currentItem.innerHeight() - + parseInt( that.currentItem.css( "paddingTop" ) || 0, 10 ) - + parseInt( that.currentItem.css( "paddingBottom" ) || 0, 10 ) ); + } + if ( !p.width() ) { + p.width( + that.currentItem.innerWidth() - + parseInt( that.currentItem.css( "paddingLeft" ) || 0, 10 ) - + parseInt( that.currentItem.css( "paddingRight" ) || 0, 10 ) ); + } + } + }; + } + + //Create the placeholder + that.placeholder = $( o.placeholder.element.call( that.element, that.currentItem ) ); + + //Append it after the actual current item + that.currentItem.after( that.placeholder ); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update( that, that.placeholder ); + + }, + + _createTrPlaceholder: function( sourceTr, targetTr ) { + var that = this; + + sourceTr.children().each( function() { + $( "<td> </td>", that.document[ 0 ] ) + .attr( "colspan", $( this ).attr( "colspan" ) || 1 ) + .appendTo( targetTr ); + } ); + }, + + _contactContainers: function( event ) { + var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom, + floating, axis, + innermostContainer = null, + innermostIndex = null; + + // Get innermost container that intersects with item + for ( i = this.containers.length - 1; i >= 0; i-- ) { + + // Never consider a container that's located within the item itself + if ( $.contains( this.currentItem[ 0 ], this.containers[ i ].element[ 0 ] ) ) { + continue; + } + + if ( this._intersectsWith( this.containers[ i ].containerCache ) ) { + + // If we've already found a container and it's more "inner" than this, then continue + if ( innermostContainer && + $.contains( + this.containers[ i ].element[ 0 ], + innermostContainer.element[ 0 ] ) ) { + continue; + } + + innermostContainer = this.containers[ i ]; + innermostIndex = i; + + } else { + + // container doesn't intersect. trigger "out" event if necessary + if ( this.containers[ i ].containerCache.over ) { + this.containers[ i ]._trigger( "out", event, this._uiHash( this ) ); + this.containers[ i ].containerCache.over = 0; + } + } + + } + + // If no intersecting containers found, return + if ( !innermostContainer ) { + return; + } + + // Move the item into the container if it's not there already + if ( this.containers.length === 1 ) { + if ( !this.containers[ innermostIndex ].containerCache.over ) { + this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) ); + this.containers[ innermostIndex ].containerCache.over = 1; + } + } else { + + // When entering a new container, we will find the item with the least distance and + // append our item near it + dist = 10000; + itemWithLeastDistance = null; + floating = innermostContainer.floating || this._isFloating( this.currentItem ); + posProperty = floating ? "left" : "top"; + sizeProperty = floating ? "width" : "height"; + axis = floating ? "pageX" : "pageY"; + + for ( j = this.items.length - 1; j >= 0; j-- ) { + if ( !$.contains( + this.containers[ innermostIndex ].element[ 0 ], this.items[ j ].item[ 0 ] ) + ) { + continue; + } + if ( this.items[ j ].item[ 0 ] === this.currentItem[ 0 ] ) { + continue; + } + + cur = this.items[ j ].item.offset()[ posProperty ]; + nearBottom = false; + if ( event[ axis ] - cur > this.items[ j ][ sizeProperty ] / 2 ) { + nearBottom = true; + } + + if ( Math.abs( event[ axis ] - cur ) < dist ) { + dist = Math.abs( event[ axis ] - cur ); + itemWithLeastDistance = this.items[ j ]; + this.direction = nearBottom ? "up" : "down"; + } + } + + //Check if dropOnEmpty is enabled + if ( !itemWithLeastDistance && !this.options.dropOnEmpty ) { + return; + } + + if ( this.currentContainer === this.containers[ innermostIndex ] ) { + if ( !this.currentContainer.containerCache.over ) { + this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash() ); + this.currentContainer.containerCache.over = 1; + } + return; + } + + itemWithLeastDistance ? + this._rearrange( event, itemWithLeastDistance, null, true ) : + this._rearrange( event, null, this.containers[ innermostIndex ].element, true ); + this._trigger( "change", event, this._uiHash() ); + this.containers[ innermostIndex ]._trigger( "change", event, this._uiHash( this ) ); + this.currentContainer = this.containers[ innermostIndex ]; + + //Update the placeholder + this.options.placeholder.update( this.currentContainer, this.placeholder ); + + this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) ); + this.containers[ innermostIndex ].containerCache.over = 1; + } + + }, + + _createHelper: function( event ) { + + var o = this.options, + helper = $.isFunction( o.helper ) ? + $( o.helper.apply( this.element[ 0 ], [ event, this.currentItem ] ) ) : + ( o.helper === "clone" ? this.currentItem.clone() : this.currentItem ); + + //Add the helper to the DOM if that didn't happen already + if ( !helper.parents( "body" ).length ) { + $( o.appendTo !== "parent" ? + o.appendTo : + this.currentItem[ 0 ].parentNode )[ 0 ].appendChild( helper[ 0 ] ); + } + + if ( helper[ 0 ] === this.currentItem[ 0 ] ) { + this._storedCSS = { + width: this.currentItem[ 0 ].style.width, + height: this.currentItem[ 0 ].style.height, + position: this.currentItem.css( "position" ), + top: this.currentItem.css( "top" ), + left: this.currentItem.css( "left" ) + }; + } + + if ( !helper[ 0 ].style.width || o.forceHelperSize ) { + helper.width( this.currentItem.width() ); + } + if ( !helper[ 0 ].style.height || o.forceHelperSize ) { + helper.height( this.currentItem.height() ); + } + + return helper; + + }, + + _adjustOffsetFromHelper: function( obj ) { + if ( typeof obj === "string" ) { + obj = obj.split( " " ); + } + if ( $.isArray( obj ) ) { + obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 }; + } + if ( "left" in obj ) { + this.offset.click.left = obj.left + this.margins.left; + } + if ( "right" in obj ) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ( "top" in obj ) { + this.offset.click.top = obj.top + this.margins.top; + } + if ( "bottom" in obj ) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the + // following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the + // next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't + // the document, which means that the scroll is included in the initial calculation of the + // offset of the parent, and never recalculated upon drag + if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== this.document[ 0 ] && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + // This needs to be actually done for all browsers, since pageX/pageY includes this + // information with an ugly IE fix + if ( this.offsetParent[ 0 ] === this.document[ 0 ].body || + ( this.offsetParent[ 0 ].tagName && + this.offsetParent[ 0 ].tagName.toLowerCase() === "html" && $.ui.ie ) ) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ), + left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 ) + }; + + }, + + _getRelativeOffset: function() { + + if ( this.cssPosition === "relative" ) { + var p = this.currentItem.position(); + return { + top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) + + this.scrollParent.scrollTop(), + left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) + + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: ( parseInt( this.currentItem.css( "marginLeft" ), 10 ) || 0 ), + top: ( parseInt( this.currentItem.css( "marginTop" ), 10 ) || 0 ) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var ce, co, over, + o = this.options; + if ( o.containment === "parent" ) { + o.containment = this.helper[ 0 ].parentNode; + } + if ( o.containment === "document" || o.containment === "window" ) { + this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + o.containment === "document" ? + this.document.width() : + this.window.width() - this.helperProportions.width - this.margins.left, + ( o.containment === "document" ? + ( this.document.height() || document.body.parentNode.scrollHeight ) : + this.window.height() || this.document[ 0 ].body.parentNode.scrollHeight + ) - this.helperProportions.height - this.margins.top + ]; + } + + if ( !( /^(document|window|parent)$/ ).test( o.containment ) ) { + ce = $( o.containment )[ 0 ]; + co = $( o.containment ).offset(); + over = ( $( ce ).css( "overflow" ) !== "hidden" ); + + this.containment = [ + co.left + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) + + ( parseInt( $( ce ).css( "paddingLeft" ), 10 ) || 0 ) - this.margins.left, + co.top + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) + + ( parseInt( $( ce ).css( "paddingTop" ), 10 ) || 0 ) - this.margins.top, + co.left + ( over ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) - + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) - + ( parseInt( $( ce ).css( "paddingRight" ), 10 ) || 0 ) - + this.helperProportions.width - this.margins.left, + co.top + ( over ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) - + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) - + ( parseInt( $( ce ).css( "paddingBottom" ), 10 ) || 0 ) - + this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function( d, pos ) { + + if ( !pos ) { + pos = this.position; + } + var mod = d === "absolute" ? 1 : -1, + scroll = this.cssPosition === "absolute" && + !( this.scrollParent[ 0 ] !== this.document[ 0 ] && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ? + this.offsetParent : + this.scrollParent, + scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName ); + + return { + top: ( + + // The absolute mouse position + pos.top + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top * mod - + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollTop() : + ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod ) + ), + left: ( + + // The absolute mouse position + pos.left + + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left * mod + + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left * mod - + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : + scroll.scrollLeft() ) * mod ) + ) + }; + + }, + + _generatePosition: function( event ) { + + var top, left, + o = this.options, + pageX = event.pageX, + pageY = event.pageY, + scroll = this.cssPosition === "absolute" && + !( this.scrollParent[ 0 ] !== this.document[ 0 ] && + $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ? + this.offsetParent : + this.scrollParent, + scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName ); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if ( this.cssPosition === "relative" && !( this.scrollParent[ 0 ] !== this.document[ 0 ] && + this.scrollParent[ 0 ] !== this.offsetParent[ 0 ] ) ) { + this.offset.relative = this._getRelativeOffset(); + } + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if ( this.originalPosition ) { //If we are not dragging yet, we won't check for options + + if ( this.containment ) { + if ( event.pageX - this.offset.click.left < this.containment[ 0 ] ) { + pageX = this.containment[ 0 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top < this.containment[ 1 ] ) { + pageY = this.containment[ 1 ] + this.offset.click.top; + } + if ( event.pageX - this.offset.click.left > this.containment[ 2 ] ) { + pageX = this.containment[ 2 ] + this.offset.click.left; + } + if ( event.pageY - this.offset.click.top > this.containment[ 3 ] ) { + pageY = this.containment[ 3 ] + this.offset.click.top; + } + } + + if ( o.grid ) { + top = this.originalPageY + Math.round( ( pageY - this.originalPageY ) / + o.grid[ 1 ] ) * o.grid[ 1 ]; + pageY = this.containment ? + ( ( top - this.offset.click.top >= this.containment[ 1 ] && + top - this.offset.click.top <= this.containment[ 3 ] ) ? + top : + ( ( top - this.offset.click.top >= this.containment[ 1 ] ) ? + top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : + top; + + left = this.originalPageX + Math.round( ( pageX - this.originalPageX ) / + o.grid[ 0 ] ) * o.grid[ 0 ]; + pageX = this.containment ? + ( ( left - this.offset.click.left >= this.containment[ 0 ] && + left - this.offset.click.left <= this.containment[ 2 ] ) ? + left : + ( ( left - this.offset.click.left >= this.containment[ 0 ] ) ? + left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : + left; + } + + } + + return { + top: ( + + // The absolute mouse position + pageY - + + // Click offset (relative to the element) + this.offset.click.top - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.top - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.top + + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollTop() : + ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) ) + ), + left: ( + + // The absolute mouse position + pageX - + + // Click offset (relative to the element) + this.offset.click.left - + + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.relative.left - + + // The offsetParent's offset without borders (offset + border) + this.offset.parent.left + + ( ( this.cssPosition === "fixed" ? + -this.scrollParent.scrollLeft() : + scrollIsRootNode ? 0 : scroll.scrollLeft() ) ) + ) + }; + + }, + + _rearrange: function( event, i, a, hardRefresh ) { + + a ? a[ 0 ].appendChild( this.placeholder[ 0 ] ) : + i.item[ 0 ].parentNode.insertBefore( this.placeholder[ 0 ], + ( this.direction === "down" ? i.item[ 0 ] : i.item[ 0 ].nextSibling ) ); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, + // if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var counter = this.counter; + + this._delay( function() { + if ( counter === this.counter ) { + + //Precompute after each DOM insertion, NOT on mousemove + this.refreshPositions( !hardRefresh ); + } + } ); + + }, + + _clear: function( event, noPropagation ) { + + this.reverting = false; + + // We delay all events that have to be triggered to after the point where the placeholder + // has been removed and everything else normalized again + var i, + delayedTriggers = []; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets + // reappended (see #4088) + if ( !this._noFinalSort && this.currentItem.parent().length ) { + this.placeholder.before( this.currentItem ); + } + this._noFinalSort = null; + + if ( this.helper[ 0 ] === this.currentItem[ 0 ] ) { + for ( i in this._storedCSS ) { + if ( this._storedCSS[ i ] === "auto" || this._storedCSS[ i ] === "static" ) { + this._storedCSS[ i ] = ""; + } + } + this.currentItem.css( this._storedCSS ); + this._removeClass( this.currentItem, "ui-sortable-helper" ); + } else { + this.currentItem.show(); + } + + if ( this.fromOutside && !noPropagation ) { + delayedTriggers.push( function( event ) { + this._trigger( "receive", event, this._uiHash( this.fromOutside ) ); + } ); + } + if ( ( this.fromOutside || + this.domPosition.prev !== + this.currentItem.prev().not( ".ui-sortable-helper" )[ 0 ] || + this.domPosition.parent !== this.currentItem.parent()[ 0 ] ) && !noPropagation ) { + + // Trigger update callback if the DOM position has changed + delayedTriggers.push( function( event ) { + this._trigger( "update", event, this._uiHash() ); + } ); + } + + // Check if the items Container has Changed and trigger appropriate + // events. + if ( this !== this.currentContainer ) { + if ( !noPropagation ) { + delayedTriggers.push( function( event ) { + this._trigger( "remove", event, this._uiHash() ); + } ); + delayedTriggers.push( ( function( c ) { + return function( event ) { + c._trigger( "receive", event, this._uiHash( this ) ); + }; + } ).call( this, this.currentContainer ) ); + delayedTriggers.push( ( function( c ) { + return function( event ) { + c._trigger( "update", event, this._uiHash( this ) ); + }; + } ).call( this, this.currentContainer ) ); + } + } + + //Post events to containers + function delayEvent( type, instance, container ) { + return function( event ) { + container._trigger( type, event, instance._uiHash( instance ) ); + }; + } + for ( i = this.containers.length - 1; i >= 0; i-- ) { + if ( !noPropagation ) { + delayedTriggers.push( delayEvent( "deactivate", this, this.containers[ i ] ) ); + } + if ( this.containers[ i ].containerCache.over ) { + delayedTriggers.push( delayEvent( "out", this, this.containers[ i ] ) ); + this.containers[ i ].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if ( this.storedCursor ) { + this.document.find( "body" ).css( "cursor", this.storedCursor ); + this.storedStylesheet.remove(); + } + if ( this._storedOpacity ) { + this.helper.css( "opacity", this._storedOpacity ); + } + if ( this._storedZIndex ) { + this.helper.css( "zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex ); + } + + this.dragging = false; + + if ( !noPropagation ) { + this._trigger( "beforeStop", event, this._uiHash() ); + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, + // it unbinds ALL events from the original node! + this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] ); + + if ( !this.cancelHelperRemoval ) { + if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) { + this.helper.remove(); + } + this.helper = null; + } + + if ( !noPropagation ) { + for ( i = 0; i < delayedTriggers.length; i++ ) { + + // Trigger all delayed events + delayedTriggers[ i ].call( this, event ); + } + this._trigger( "stop", event, this._uiHash() ); + } + + this.fromOutside = false; + return !this.cancelHelperRemoval; + + }, + + _trigger: function() { + if ( $.Widget.prototype._trigger.apply( this, arguments ) === false ) { + this.cancel(); + } + }, + + _uiHash: function( _inst ) { + var inst = _inst || this; + return { + helper: inst.helper, + placeholder: inst.placeholder || $( [] ), + position: inst.position, + originalPosition: inst.originalPosition, + offset: inst.positionAbs, + item: inst.currentItem, + sender: _inst ? _inst.element : null + }; + } + +} ); + + +/*! + * jQuery UI Accordion 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Accordion +//>>group: Widgets +// jscs:disable maximumLineLength +//>>description: Displays collapsible content panels for presenting information in a limited amount of space. +// jscs:enable maximumLineLength +//>>docs: http://api.jqueryui.com/accordion/ +//>>demos: http://jqueryui.com/accordion/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/accordion.css +//>>css.theme: ../../themes/base/theme.css + + + +var widgetsAccordion = $.widget( "ui.accordion", { + version: "1.12.1", + options: { + active: 0, + animate: {}, + classes: { + "ui-accordion-header": "ui-corner-top", + "ui-accordion-header-collapsed": "ui-corner-all", + "ui-accordion-content": "ui-corner-bottom" + }, + collapsible: false, + event: "click", + header: "> li > :first-child, > :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // Callbacks + activate: null, + beforeActivate: null + }, + + hideProps: { + borderTopWidth: "hide", + borderBottomWidth: "hide", + paddingTop: "hide", + paddingBottom: "hide", + height: "hide" + }, + + showProps: { + borderTopWidth: "show", + borderBottomWidth: "show", + paddingTop: "show", + paddingBottom: "show", + height: "show" + }, + + _create: function() { + var options = this.options; + + this.prevShow = this.prevHide = $(); + this._addClass( "ui-accordion", "ui-widget ui-helper-reset" ); + this.element.attr( "role", "tablist" ); + + // Don't allow collapsible: false and active: false / null + if ( !options.collapsible && ( options.active === false || options.active == null ) ) { + options.active = 0; + } + + this._processPanels(); + + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this._refresh(); + }, + + _getCreateEventData: function() { + return { + header: this.active, + panel: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icon, children, + icons = this.options.icons; + + if ( icons ) { + icon = $( "<span>" ); + this._addClass( icon, "ui-accordion-header-icon", "ui-icon " + icons.header ); + icon.prependTo( this.headers ); + children = this.active.children( ".ui-accordion-header-icon" ); + this._removeClass( children, icons.header ) + ._addClass( children, null, icons.activeHeader ) + ._addClass( this.headers, "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this._removeClass( this.headers, "ui-accordion-icons" ); + this.headers.children( ".ui-accordion-header-icon" ).remove(); + }, + + _destroy: function() { + var contents; + + // Clean up main element + this.element.removeAttr( "role" ); + + // Clean up headers + this.headers + .removeAttr( "role aria-expanded aria-selected aria-controls tabIndex" ) + .removeUniqueId(); + + this._destroyIcons(); + + // Clean up content panels + contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role aria-hidden aria-labelledby" ) + .removeUniqueId(); + + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // Setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this.element.attr( "aria-disabled", value ); + + // Support: IE8 Only + // #5332 / #6059 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + this._toggleClass( null, "ui-state-disabled", !!value ); + this._toggleClass( this.headers.add( this.headers.next() ), null, "ui-state-disabled", + !!value ); + }, + + _keydown: function( event ) { + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + $( toFocus ).trigger( "focus" ); + event.preventDefault(); + } + }, + + _panelKeyDown: function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().trigger( "focus" ); + } + }, + + refresh: function() { + var options = this.options; + this._processPanels(); + + // Was collapsed or no panel + if ( ( options.active === false && options.collapsible === true ) || + !this.headers.length ) { + options.active = false; + this.active = $(); + + // active false only when collapsible is true + } else if ( options.active === false ) { + this._activate( 0 ); + + // was active, but active panel is gone + } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + + // all remaining panel are disabled + if ( this.headers.length === this.headers.find( ".ui-state-disabled" ).length ) { + options.active = false; + this.active = $(); + + // activate previous panel + } else { + this._activate( Math.max( 0, options.active - 1 ) ); + } + + // was active, active panel still exists + } else { + + // make sure active index is correct + options.active = this.headers.index( this.active ); + } + + this._destroyIcons(); + + this._refresh(); + }, + + _processPanels: function() { + var prevHeaders = this.headers, + prevPanels = this.panels; + + this.headers = this.element.find( this.options.header ); + this._addClass( this.headers, "ui-accordion-header ui-accordion-header-collapsed", + "ui-state-default" ); + + this.panels = this.headers.next().filter( ":not(.ui-accordion-content-active)" ).hide(); + this._addClass( this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content" ); + + // Avoid memory leaks (#10056) + if ( prevPanels ) { + this._off( prevHeaders.not( this.headers ) ); + this._off( prevPanels.not( this.panels ) ); + } + }, + + _refresh: function() { + var maxHeight, + options = this.options, + heightStyle = options.heightStyle, + parent = this.element.parent(); + + this.active = this._findActive( options.active ); + this._addClass( this.active, "ui-accordion-header-active", "ui-state-active" ) + ._removeClass( this.active, "ui-accordion-header-collapsed" ); + this._addClass( this.active.next(), "ui-accordion-content-active" ); + this.active.next().show(); + + this.headers + .attr( "role", "tab" ) + .each( function() { + var header = $( this ), + headerId = header.uniqueId().attr( "id" ), + panel = header.next(), + panelId = panel.uniqueId().attr( "id" ); + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + } ) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr( { + "aria-selected": "false", + "aria-expanded": "false", + tabIndex: -1 + } ) + .next() + .attr( { + "aria-hidden": "true" + } ) + .hide(); + + // Make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr( { + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + } ) + .next() + .attr( { + "aria-hidden": "false" + } ); + } + + this._createIcons(); + + this._setupEvents( options.event ); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each( function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + } ); + + this.headers.each( function() { + maxHeight -= $( this ).outerHeight( true ); + } ); + + this.headers.next() + .each( function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + } ) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each( function() { + var isVisible = $( this ).is( ":visible" ); + if ( !isVisible ) { + $( this ).show(); + } + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + if ( !isVisible ) { + $( this ).hide(); + } + } ) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // Trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // Trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler( { + target: active, + currentTarget: active, + preventDefault: $.noop + } ); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = { + keydown: "_keydown" + }; + if ( event ) { + $.each( event.split( " " ), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + } ); + } + + this._off( this.headers.add( this.headers.next() ) ); + this._on( this.headers, events ); + this._on( this.headers.next(), { keydown: "_panelKeyDown" } ); + this._hoverable( this.headers ); + this._focusable( this.headers ); + }, + + _eventHandler: function( event ) { + var activeChildren, clickedChildren, + options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // When the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // Switch classes + // corner classes on the previously active header stay after the animation + this._removeClass( active, "ui-accordion-header-active", "ui-state-active" ); + if ( options.icons ) { + activeChildren = active.children( ".ui-accordion-header-icon" ); + this._removeClass( activeChildren, null, options.icons.activeHeader ) + ._addClass( activeChildren, null, options.icons.header ); + } + + if ( !clickedIsActive ) { + this._removeClass( clicked, "ui-accordion-header-collapsed" ) + ._addClass( clicked, "ui-accordion-header-active", "ui-state-active" ); + if ( options.icons ) { + clickedChildren = clicked.children( ".ui-accordion-header-icon" ); + this._removeClass( clickedChildren, null, options.icons.header ) + ._addClass( clickedChildren, null, options.icons.activeHeader ); + } + + this._addClass( clicked.next(), "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // Handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr( { + "aria-hidden": "true" + } ); + toHide.prev().attr( { + "aria-selected": "false", + "aria-expanded": "false" + } ); + + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr( { + "tabIndex": -1, + "aria-expanded": "false" + } ); + } else if ( toShow.length ) { + this.headers.filter( function() { + return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0; + } ) + .attr( "tabIndex", -1 ); + } + + toShow + .attr( "aria-hidden", "false" ) + .prev() + .attr( { + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + } ); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + boxSizing = toShow.css( "box-sizing" ), + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( this.showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( this.hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( this.hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + } ); + toShow + .hide() + .animate( this.showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + if ( boxSizing === "content-box" ) { + adjust += fx.now; + } + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + } ); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel, + prev = toHide.prev(); + + this._removeClass( toHide, "ui-accordion-content-active" ); + this._removeClass( prev, "ui-accordion-header-active" ) + ._addClass( prev, "ui-accordion-header-collapsed" ); + + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[ 0 ].className = toHide.parent()[ 0 ].className; + } + this._trigger( "activate", null, data ); + } +} ); + + +/*! + * jQuery UI Menu 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, -c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Drop 1.8.14 + +//>>label: Menu +//>>group: Widgets +//>>description: Creates nestable menus. +//>>docs: http://api.jqueryui.com/menu/ +//>>demos: http://jqueryui.com/menu/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/menu.css +//>>css.theme: ../../themes/base/theme.css + + + +var widgetsMenu = $.widget( "ui.menu", { + version: "1.12.1", + defaultElement: "<ul>", + delay: 300, + options: { + icons: { + submenu: "ui-icon-caret-1-e" + }, + items: "> *", + menus: "ul", + position: { + my: "left top", + at: "right top" + }, + role: "menu", + + // Callbacks + blur: null, + focus: null, + select: null + }, + + _create: function() { + this.activeMenu = this.element; + + // Flag used to prevent firing of the click handler + // as the event bubbles up through nested menus + this.mouseHandled = false; + this.element + .uniqueId() + .attr( { + role: this.options.role, + tabIndex: 0 + } ); + + this._addClass( "ui-menu", "ui-widget ui-widget-content" ); + this._on( { + + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item": function( event ) { + var target = $( event.target ); + var active = $( $.ui.safeActiveElement( this.document[ 0 ] ) ); + if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) { + this.select( event ); + + // Only set the mouseHandled flag if the event will bubble, see #9469. + if ( !event.isPropagationStopped() ) { + this.mouseHandled = true; + } + + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) && + active.closest( ".ui-menu" ).length ) { + + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + + // Ignore mouse events while typeahead is active, see #10458. + // Prevents focusing the wrong item when typeahead causes a scroll while the mouse + // is over an item in the menu + if ( this.previousFilter ) { + return; + } + + var actualTarget = $( event.target ).closest( ".ui-menu-item" ), + target = $( event.currentTarget ); + + // Ignore bubbled events on parent items, see #11641 + if ( actualTarget[ 0 ] !== target[ 0 ] ) { + return; + } + + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + this._removeClass( target.siblings().children( ".ui-state-active" ), + null, "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.find( this.options.items ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); + } + }, + blur: function( event ) { + this._delay( function() { + var notContained = !$.contains( + this.element[ 0 ], + $.ui.safeActiveElement( this.document[ 0 ] ) + ); + if ( notContained ) { + this.collapseAll( event ); + } + } ); + }, + keydown: "_keydown" + } ); + + this.refresh(); + + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( this._closeOnDocumentClick( event ) ) { + this.collapseAll( event ); + } + + // Reset the mouseHandled flag + this.mouseHandled = false; + } + } ); + }, + + _destroy: function() { + var items = this.element.find( ".ui-menu-item" ) + .removeAttr( "role aria-disabled" ), + submenus = items.children( ".ui-menu-item-wrapper" ) + .removeUniqueId() + .removeAttr( "tabIndex role aria-haspopup" ); + + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).addBack() + .removeAttr( "role aria-labelledby aria-expanded aria-hidden aria-disabled " + + "tabIndex" ) + .removeUniqueId() + .show(); + + submenus.children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-caret" ) ) { + elem.remove(); + } + } ); + }, + + _keydown: function( event ) { + var match, prev, character, skip, + preventDefault = true; + + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + skip = false; + + // Support number pad values + character = event.keyCode >= 96 && event.keyCode <= 105 ? + ( event.keyCode - 96 ).toString() : String.fromCharCode( event.keyCode ); + + clearTimeout( this.filterTimer ); + + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } + + match = this._filterMenuItems( character ); + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + match = this._filterMenuItems( character ); + } + + if ( match.length ) { + this.focus( event, match ); + this.previousFilter = character; + this.filterTimer = this._delay( function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; + } + } + + if ( preventDefault ) { + event.preventDefault(); + } + }, + + _activate: function( event ) { + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.children( "[aria-haspopup='true']" ).length ) { + this.expand( event ); + } else { + this.select( event ); + } + } + }, + + refresh: function() { + var menus, items, newSubmenus, newItems, newWrappers, + that = this, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); + + this._toggleClass( "ui-menu-icons", null, !!this.element.find( ".ui-icon" ).length ); + + // Initialize nested menus + newSubmenus = submenus.filter( ":not(.ui-menu)" ) + .hide() + .attr( { + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + } ) + .each( function() { + var menu = $( this ), + item = menu.prev(), + submenuCaret = $( "<span>" ).data( "ui-menu-submenu-caret", true ); + + that._addClass( submenuCaret, "ui-menu-icon", "ui-icon " + icon ); + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCaret ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + } ); + + this._addClass( newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front" ); + + menus = submenus.add( this.element ); + items = menus.find( this.options.items ); + + // Initialize menu-items containing spaces and/or dashes only as dividers + items.not( ".ui-menu-item" ).each( function() { + var item = $( this ); + if ( that._isDivider( item ) ) { + that._addClass( item, "ui-menu-divider", "ui-widget-content" ); + } + } ); + + // Don't refresh list items that are already adapted + newItems = items.not( ".ui-menu-item, .ui-menu-divider" ); + newWrappers = newItems.children() + .not( ".ui-menu" ) + .uniqueId() + .attr( { + tabIndex: -1, + role: this._itemRole() + } ); + this._addClass( newItems, "ui-menu-item" ) + ._addClass( newWrappers, "ui-menu-item-wrapper" ); + + // Add aria-disabled attribute to any disabled menu item + items.filter( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); + + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } + }, + + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; + }, + + _setOption: function( key, value ) { + if ( key === "icons" ) { + var icons = this.element.find( ".ui-menu-icon" ); + this._removeClass( icons, null, this.options.icons.submenu ) + ._addClass( icons, null, value.submenu ); + } + this._super( key, value ); + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this.element.attr( "aria-disabled", String( value ) ); + this._toggleClass( null, "ui-state-disabled", !!value ); + }, + + focus: function( event, item ) { + var nested, focused, activeParent; + this.blur( event, event && event.type === "focus" ); + + this._scrollIntoView( item ); + + this.active = item.first(); + + focused = this.active.children( ".ui-menu-item-wrapper" ); + this._addClass( focused, null, "ui-state-active" ); + + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } + + // Highlight active parent menu item, if any + activeParent = this.active + .parent() + .closest( ".ui-menu-item" ) + .children( ".ui-menu-item-wrapper" ); + this._addClass( activeParent, null, "ui-state-active" ); + + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay( function() { + this._close(); + }, this.delay ); + } + + nested = item.children( ".ui-menu" ); + if ( nested.length && event && ( /^mouse/.test( event.type ) ) ) { + this._startOpening( nested ); + } + this.activeMenu = item.parent(); + + this._trigger( "focus", event, { item: item } ); + }, + + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[ 0 ], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[ 0 ], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.outerHeight(); + + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } + } + }, + + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } + + if ( !this.active ) { + return; + } + + this._removeClass( this.active.children( ".ui-menu-item-wrapper" ), + null, "ui-state-active" ); + + this._trigger( "blur", event, { item: this.active } ); + this.active = null; + }, + + _startOpening: function( submenu ) { + clearTimeout( this.timer ); + + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the caret icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; + } + + this.timer = this._delay( function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, + + _open: function( submenu ) { + var position = $.extend( { + of: this.active + }, this.options.position ); + + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); + + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, + + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay( function() { + + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); + + // If we found no valid submenu ancestor, use the main menu to close all + // sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + + // Work around active item staying active after menu is blurred + this._removeClass( currentMenu.find( ".ui-state-active" ), null, "ui-state-active" ); + + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; + } + + startMenu.find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ); + }, + + _closeOnDocumentClick: function( event ) { + return !$( event.target ).closest( ".ui-menu" ).length; + }, + + _isDivider: function( item ) { + + // Match hyphen, em dash, en dash + return !/[^\-\u2014\u2013\s]/.test( item.text() ); + }, + + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); + } + }, + + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .find( this.options.items ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay( function() { + this.focus( event, newItem ); + } ); + } + }, + + next: function( event ) { + this._move( "next", "first", event ); + }, + + previous: function( event ) { + this._move( "prev", "last", event ); + }, + + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, + + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, + + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); + } + } + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.find( this.options.items )[ filter ](); + } + + this.focus( event, next ); + }, + + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isLastItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each( function() { + item = $( this ); + return item.offset().top - base - height < 0; + } ); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.find( this.options.items ) + [ !this.active ? "first" : "last" ]() ); + } + }, + + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isFirstItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each( function() { + item = $( this ); + return item.offset().top - base + height > 0; + } ); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.find( this.options.items ).first() ); + } + }, + + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); + }, + + select: function( event ) { + + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + }, + + _filterMenuItems: function( character ) { + var escapedCharacter = character.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ), + regex = new RegExp( "^" + escapedCharacter, "i" ); + + return this.activeMenu + .find( this.options.items ) + + // Only match on items, not dividers or other content (#10571) + .filter( ".ui-menu-item" ) + .filter( function() { + return regex.test( + $.trim( $( this ).children( ".ui-menu-item-wrapper" ).text() ) ); + } ); + } +} ); + + +/*! + * jQuery UI Autocomplete 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Autocomplete +//>>group: Widgets +//>>description: Lists suggested words as the user is typing. +//>>docs: http://api.jqueryui.com/autocomplete/ +//>>demos: http://jqueryui.com/autocomplete/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/autocomplete.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.autocomplete", { + version: "1.12.1", + defaultElement: "<input>", + options: { + appendTo: null, + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, + + // Callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, + + requestIndex: 0, + pending: 0, + + _create: function() { + + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput, + nodeName = this.element[ 0 ].nodeName.toLowerCase(), + isTextarea = nodeName === "textarea", + isInput = nodeName === "input"; + + // Textareas are always multi-line + // Inputs are always single-line, even if inside a contentEditable element + // IE also treats inputs as contentEditable + // All other element types are determined by whether or not they're contentEditable + this.isMultiLine = isTextarea || !isInput && this._isContentEditable( this.element ); + + this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ]; + this.isNewMenu = true; + + this._addClass( "ui-autocomplete-input" ); + this.element.attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; + } + + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch ( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + + // when menu is open and has focus + if ( this.menu.active ) { + + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + if ( !this.isMultiLine ) { + this._value( this.term ); + } + this.close( event ); + + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + event.preventDefault(); + } + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // Replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch ( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } + } ); + + this._initSource(); + this.menu = $( "<ul>" ) + .appendTo( this._appendTo() ) + .menu( { + + // disable ARIA support, the live region takes care of that + role: null + } ) + .hide() + .menu( "instance" ); + + this._addClass( this.menu.element, "ui-autocomplete", "ui-front" ); + this._on( this.menu.element, { + mousedown: function( event ) { + + // prevent moving focus out of the text field + event.preventDefault(); + + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + this.cancelBlur = true; + this._delay( function() { + delete this.cancelBlur; + + // Support: IE 8 only + // Right clicking a menu item or selecting text from the menu items will + // result in focus moving out of the input. However, we've already received + // and ignored the blur event because of the cancelBlur flag set above. So + // we restore focus to ensure that the menu closes properly based on the user's + // next actions. + if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) { + this.element.trigger( "focus" ); + } + } ); + }, + menufocus: function( event, ui ) { + var label, item; + + // support: Firefox + // Prevent accidental activation of menu items in Firefox (#7024 #9118) + if ( this.isNewMenu ) { + this.isNewMenu = false; + if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) { + this.menu.blur(); + + this.document.one( "mousemove", function() { + $( event.target ).trigger( event.originalEvent ); + } ); + + return; + } + } + + item = ui.item.data( "ui-autocomplete-item" ); + if ( false !== this._trigger( "focus", event, { item: item } ) ) { + + // use value to match what will end up in the input, if it was a key event + if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) { + this._value( item.value ); + } + } + + // Announce the value in the liveRegion + label = ui.item.attr( "aria-label" ) || item.value; + if ( label && $.trim( label ).length ) { + this.liveRegion.children().hide(); + $( "<div>" ).text( label ).appendTo( this.liveRegion ); + } + }, + menuselect: function( event, ui ) { + var item = ui.item.data( "ui-autocomplete-item" ), + previous = this.previous; + + // Only trigger when focus was lost (click on menu) + if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) { + this.element.trigger( "focus" ); + this.previous = previous; + + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + this._delay( function() { + this.previous = previous; + this.selectedItem = item; + } ); + } + + if ( false !== this._trigger( "select", event, { item: item } ) ) { + this._value( item.value ); + } + + // reset the term after the select event + // this allows custom select handling to work properly + this.term = this._value(); + + this.close( event ); + this.selectedItem = item; + } + } ); + + this.liveRegion = $( "<div>", { + role: "status", + "aria-live": "assertive", + "aria-relevant": "additions" + } ) + .appendTo( this.document[ 0 ].body ); + + this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" ); + + // Turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + } ); + }, + + _destroy: function() { + clearTimeout( this.searching ); + this.element.removeAttr( "autocomplete" ); + this.menu.element.remove(); + this.liveRegion.remove(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( this._appendTo() ); + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _isEventTargetInWidget: function( event ) { + var menuElement = this.menu.element[ 0 ]; + + return event.target === this.element[ 0 ] || + event.target === menuElement || + $.contains( menuElement, event.target ); + }, + + _closeOnClickOutside: function( event ) { + if ( !this._isEventTargetInWidget( event ) ) { + this.close(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + + if ( element ) { + element = element.jquery || element.nodeType ? + $( element ) : + this.document.find( element ).eq( 0 ); + } + + if ( !element || !element[ 0 ] ) { + element = this.element.closest( ".ui-front, dialog" ); + } + + if ( !element.length ) { + element = this.document[ 0 ].body; + } + + return element; + }, + + _initSource: function() { + var array, url, + that = this; + if ( $.isArray( this.options.source ) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter( array, request.term ) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( that.xhr ) { + that.xhr.abort(); + } + that.xhr = $.ajax( { + url: url, + data: request, + dataType: "json", + success: function( data ) { + response( data ); + }, + error: function() { + response( [] ); + } + } ); + }; + } else { + this.source = this.options.source; + } + }, + + _searchTimeout: function( event ) { + clearTimeout( this.searching ); + this.searching = this._delay( function() { + + // Search if the value has changed, or if the user retypes the same value (see #7434) + var equalValues = this.term === this._value(), + menuVisible = this.menu.element.is( ":visible" ), + modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey; + + if ( !equalValues || ( equalValues && !menuVisible && !modifierKey ) ) { + this.selectedItem = null; + this.search( null, event ); + } + }, this.options.delay ); + }, + + search: function( value, event ) { + value = value != null ? value : this._value(); + + // Always save the actual value, not the one passed as an argument + this.term = this._value(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this._addClass( "ui-autocomplete-loading" ); + this.cancelSearch = false; + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var index = ++this.requestIndex; + + return $.proxy( function( content ) { + if ( index === this.requestIndex ) { + this.__response( content ); + } + + this.pending--; + if ( !this.pending ) { + this._removeClass( "ui-autocomplete-loading" ); + } + }, this ); + }, + + __response: function( content ) { + if ( content ) { + content = this._normalize( content ); + } + this._trigger( "response", null, { content: content } ); + if ( !this.options.disabled && content && content.length && !this.cancelSearch ) { + this._suggest( content ); + this._trigger( "open" ); + } else { + + // use ._close() instead of .close() so we don't cancel future searches + this._close(); + } + }, + + close: function( event ) { + this.cancelSearch = true; + this._close( event ); + }, + + _close: function( event ) { + + // Remove the handler that closes the menu on outside clicks + this._off( this.document, "mousedown" ); + + if ( this.menu.element.is( ":visible" ) ) { + this.menu.element.hide(); + this.menu.blur(); + this.isNewMenu = true; + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this._value() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + + // assume all items have the right format when the first item is complete + if ( items.length && items[ 0 ].label && items[ 0 ].value ) { + return items; + } + return $.map( items, function( item ) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend( {}, item, { + label: item.label || item.value, + value: item.value || item.label + } ); + } ); + }, + + _suggest: function( items ) { + var ul = this.menu.element.empty(); + this._renderMenu( ul, items ); + this.isNewMenu = true; + this.menu.refresh(); + + // Size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend( { + of: this.element + }, this.options.position ) ); + + if ( this.options.autoFocus ) { + this.menu.next(); + } + + // Listen for interactions outside of the widget (#6642) + this._on( this.document, { + mousedown: "_closeOnClickOutside" + } ); + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var that = this; + $.each( items, function( index, item ) { + that._renderItemData( ul, item ); + } ); + }, + + _renderItemData: function( ul, item ) { + return this._renderItem( ul, item ).data( "ui-autocomplete-item", item ); + }, + + _renderItem: function( ul, item ) { + return $( "<li>" ) + .append( $( "<div>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is( ":visible" ) ) { + this.search( null, event ); + return; + } + if ( this.menu.isFirstItem() && /^previous/.test( direction ) || + this.menu.isLastItem() && /^next/.test( direction ) ) { + + if ( !this.isMultiLine ) { + this._value( this.term ); + } + + this.menu.blur(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + + _value: function() { + return this.valueMethod.apply( this.element, arguments ); + }, + + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // Prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + }, + + // Support: Chrome <=50 + // We should be able to just use this.element.prop( "isContentEditable" ) + // but hidden elements always report false in Chrome. + // https://code.google.com/p/chromium/issues/detail?id=313082 + _isContentEditable: function( element ) { + if ( !element.length ) { + return false; + } + + var editable = element.prop( "contentEditable" ); + + if ( editable === "inherit" ) { + return this._isContentEditable( element.parent() ); + } + + return editable === "true"; + } +} ); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ); + }, + filter: function( array, term ) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex( term ), "i" ); + return $.grep( array, function( value ) { + return matcher.test( value.label || value.value || value ); + } ); + } +} ); + +// Live region extension, adding a `messages` option +// NOTE: This is an experimental API. We are still investigating +// a full solution for string manipulation and internationalization. +$.widget( "ui.autocomplete", $.ui.autocomplete, { + options: { + messages: { + noResults: "No search results.", + results: function( amount ) { + return amount + ( amount > 1 ? " results are" : " result is" ) + + " available, use up and down arrow keys to navigate."; + } + } + }, + + __response: function( content ) { + var message; + this._superApply( arguments ); + if ( this.options.disabled || this.cancelSearch ) { + return; + } + if ( content && content.length ) { + message = this.options.messages.results( content.length ); + } else { + message = this.options.messages.noResults; + } + this.liveRegion.children().hide(); + $( "<div>" ).text( message ).appendTo( this.liveRegion ); + } +} ); + +var widgetsAutocomplete = $.ui.autocomplete; + + +/*! + * jQuery UI Controlgroup 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Drop + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Controlgroup +//>>group: Widgets +//>>description: Visually groups form control widgets +//>>docs: http://api.jqueryui.com/controlgroup/ +//>>demos: http://jqueryui.com/controlgroup/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/controlgroup.css +//>>css.theme: ../../themes/base/theme.css + + +var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g; + +var widgetsControlgroup = $.widget( "ui.controlgroup", { + version: "1.12.1", + defaultElement: "<div>", + options: { + direction: "horizontal", + disabled: null, + onlyVisible: true, + items: { + "button": "input[type=button], input[type=submit], input[type=reset], button, a", + "controlgroupLabel": ".ui-controlgroup-label", + "checkboxradio": "input[type='checkbox'], input[type='radio']", + "selectmenu": "select", + "spinner": ".ui-spinner-input" + } + }, + + _create: function() { + this._enhance(); + }, + + // To support the enhanced option in jQuery Mobile, we isolate DOM manipulation + _enhance: function() { + this.element.attr( "role", "toolbar" ); + this.refresh(); + }, + + _destroy: function() { + this._callChildMethod( "destroy" ); + this.childWidgets.removeData( "ui-controlgroup-data" ); + this.element.removeAttr( "role" ); + if ( this.options.items.controlgroupLabel ) { + this.element + .find( this.options.items.controlgroupLabel ) + .find( ".ui-controlgroup-label-contents" ) + .contents().unwrap(); + } + }, + + _initWidgets: function() { + var that = this, + childWidgets = []; + + // First we iterate over each of the items options + $.each( this.options.items, function( widget, selector ) { + var labels; + var options = {}; + + // Make sure the widget has a selector set + if ( !selector ) { + return; + } + + if ( widget === "controlgroupLabel" ) { + labels = that.element.find( selector ); + labels.each( function() { + var element = $( this ); + + if ( element.children( ".ui-controlgroup-label-contents" ).length ) { + return; + } + element.contents() + .wrapAll( "<span class='ui-controlgroup-label-contents'></span>" ); + } ); + that._addClass( labels, null, "ui-widget ui-widget-content ui-state-default" ); + childWidgets = childWidgets.concat( labels.get() ); + return; + } + + // Make sure the widget actually exists + if ( !$.fn[ widget ] ) { + return; + } + + // We assume everything is in the middle to start because we can't determine + // first / last elements until all enhancments are done. + if ( that[ "_" + widget + "Options" ] ) { + options = that[ "_" + widget + "Options" ]( "middle" ); + } else { + options = { classes: {} }; + } + + // Find instances of this widget inside controlgroup and init them + that.element + .find( selector ) + .each( function() { + var element = $( this ); + var instance = element[ widget ]( "instance" ); + + // We need to clone the default options for this type of widget to avoid + // polluting the variable options which has a wider scope than a single widget. + var instanceOptions = $.widget.extend( {}, options ); + + // If the button is the child of a spinner ignore it + // TODO: Find a more generic solution + if ( widget === "button" && element.parent( ".ui-spinner" ).length ) { + return; + } + + // Create the widget if it doesn't exist + if ( !instance ) { + instance = element[ widget ]()[ widget ]( "instance" ); + } + if ( instance ) { + instanceOptions.classes = + that._resolveClassesValues( instanceOptions.classes, instance ); + } + element[ widget ]( instanceOptions ); + + // Store an instance of the controlgroup to be able to reference + // from the outermost element for changing options and refresh + var widgetElement = element[ widget ]( "widget" ); + $.data( widgetElement[ 0 ], "ui-controlgroup-data", + instance ? instance : element[ widget ]( "instance" ) ); + + childWidgets.push( widgetElement[ 0 ] ); + } ); + } ); + + this.childWidgets = $( $.unique( childWidgets ) ); + this._addClass( this.childWidgets, "ui-controlgroup-item" ); + }, + + _callChildMethod: function( method ) { + this.childWidgets.each( function() { + var element = $( this ), + data = element.data( "ui-controlgroup-data" ); + if ( data && data[ method ] ) { + data[ method ](); + } + } ); + }, + + _updateCornerClass: function( element, position ) { + var remove = "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all"; + var add = this._buildSimpleOptions( position, "label" ).classes.label; + + this._removeClass( element, null, remove ); + this._addClass( element, null, add ); + }, + + _buildSimpleOptions: function( position, key ) { + var direction = this.options.direction === "vertical"; + var result = { + classes: {} + }; + result.classes[ key ] = { + "middle": "", + "first": "ui-corner-" + ( direction ? "top" : "left" ), + "last": "ui-corner-" + ( direction ? "bottom" : "right" ), + "only": "ui-corner-all" + }[ position ]; + + return result; + }, + + _spinnerOptions: function( position ) { + var options = this._buildSimpleOptions( position, "ui-spinner" ); + + options.classes[ "ui-spinner-up" ] = ""; + options.classes[ "ui-spinner-down" ] = ""; + + return options; + }, + + _buttonOptions: function( position ) { + return this._buildSimpleOptions( position, "ui-button" ); + }, + + _checkboxradioOptions: function( position ) { + return this._buildSimpleOptions( position, "ui-checkboxradio-label" ); + }, + + _selectmenuOptions: function( position ) { + var direction = this.options.direction === "vertical"; + return { + width: direction ? "auto" : false, + classes: { + middle: { + "ui-selectmenu-button-open": "", + "ui-selectmenu-button-closed": "" + }, + first: { + "ui-selectmenu-button-open": "ui-corner-" + ( direction ? "top" : "tl" ), + "ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "top" : "left" ) + }, + last: { + "ui-selectmenu-button-open": direction ? "" : "ui-corner-tr", + "ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "bottom" : "right" ) + }, + only: { + "ui-selectmenu-button-open": "ui-corner-top", + "ui-selectmenu-button-closed": "ui-corner-all" + } + + }[ position ] + }; + }, + + _resolveClassesValues: function( classes, instance ) { + var result = {}; + $.each( classes, function( key ) { + var current = instance.options.classes[ key ] || ""; + current = $.trim( current.replace( controlgroupCornerRegex, "" ) ); + result[ key ] = ( current + " " + classes[ key ] ).replace( /\s+/g, " " ); + } ); + return result; + }, + + _setOption: function( key, value ) { + if ( key === "direction" ) { + this._removeClass( "ui-controlgroup-" + this.options.direction ); + } + + this._super( key, value ); + if ( key === "disabled" ) { + this._callChildMethod( value ? "disable" : "enable" ); + return; + } + + this.refresh(); + }, + + refresh: function() { + var children, + that = this; + + this._addClass( "ui-controlgroup ui-controlgroup-" + this.options.direction ); + + if ( this.options.direction === "horizontal" ) { + this._addClass( null, "ui-helper-clearfix" ); + } + this._initWidgets(); + + children = this.childWidgets; + + // We filter here because we need to track all childWidgets not just the visible ones + if ( this.options.onlyVisible ) { + children = children.filter( ":visible" ); + } + + if ( children.length ) { + + // We do this last because we need to make sure all enhancment is done + // before determining first and last + $.each( [ "first", "last" ], function( index, value ) { + var instance = children[ value ]().data( "ui-controlgroup-data" ); + + if ( instance && that[ "_" + instance.widgetName + "Options" ] ) { + var options = that[ "_" + instance.widgetName + "Options" ]( + children.length === 1 ? "only" : value + ); + options.classes = that._resolveClassesValues( options.classes, instance ); + instance.element[ instance.widgetName ]( options ); + } else { + that._updateCornerClass( children[ value ](), value ); + } + } ); + + // Finally call the refresh method on each of the child widgets. + this._callChildMethod( "refresh" ); + } + } +} ); + +/*! + * jQuery UI Checkboxradio 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== -"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Explode 1.8.14 + +//>>label: Checkboxradio +//>>group: Widgets +//>>description: Enhances a form with multiple themeable checkboxes or radio buttons. +//>>docs: http://api.jqueryui.com/checkboxradio/ +//>>demos: http://jqueryui.com/checkboxradio/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/button.css +//>>css.structure: ../../themes/base/checkboxradio.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.checkboxradio", [ $.ui.formResetMixin, { + version: "1.12.1", + options: { + disabled: null, + label: null, + icon: true, + classes: { + "ui-checkboxradio-label": "ui-corner-all", + "ui-checkboxradio-icon": "ui-corner-all" + } + }, + + _getCreateOptions: function() { + var disabled, labels; + var that = this; + var options = this._super() || {}; + + // We read the type here, because it makes more sense to throw a element type error first, + // rather then the error for lack of a label. Often if its the wrong type, it + // won't have a label (e.g. calling on a div, btn, etc) + this._readType(); + + labels = this.element.labels(); + + // If there are multiple labels, use the last one + this.label = $( labels[ labels.length - 1 ] ); + if ( !this.label.length ) { + $.error( "No label found for checkboxradio widget" ); + } + + this.originalLabel = ""; + + // We need to get the label text but this may also need to make sure it does not contain the + // input itself. + this.label.contents().not( this.element[ 0 ] ).each( function() { + + // The label contents could be text, html, or a mix. We concat each element to get a + // string representation of the label, without the input as part of it. + that.originalLabel += this.nodeType === 3 ? $( this ).text() : this.outerHTML; + } ); + + // Set the label option if we found label text + if ( this.originalLabel ) { + options.label = this.originalLabel; + } + + disabled = this.element[ 0 ].disabled; + if ( disabled != null ) { + options.disabled = disabled; + } + return options; + }, + + _create: function() { + var checked = this.element[ 0 ].checked; + + this._bindFormResetHandler(); + + if ( this.options.disabled == null ) { + this.options.disabled = this.element[ 0 ].disabled; + } + + this._setOption( "disabled", this.options.disabled ); + this._addClass( "ui-checkboxradio", "ui-helper-hidden-accessible" ); + this._addClass( this.label, "ui-checkboxradio-label", "ui-button ui-widget" ); + + if ( this.type === "radio" ) { + this._addClass( this.label, "ui-checkboxradio-radio-label" ); + } + + if ( this.options.label && this.options.label !== this.originalLabel ) { + this._updateLabel(); + } else if ( this.originalLabel ) { + this.options.label = this.originalLabel; + } + + this._enhance(); + + if ( checked ) { + this._addClass( this.label, "ui-checkboxradio-checked", "ui-state-active" ); + if ( this.icon ) { + this._addClass( this.icon, null, "ui-state-hover" ); + } + } + + this._on( { + change: "_toggleClasses", + focus: function() { + this._addClass( this.label, null, "ui-state-focus ui-visual-focus" ); + }, + blur: function() { + this._removeClass( this.label, null, "ui-state-focus ui-visual-focus" ); + } + } ); + }, + + _readType: function() { + var nodeName = this.element[ 0 ].nodeName.toLowerCase(); + this.type = this.element[ 0 ].type; + if ( nodeName !== "input" || !/radio|checkbox/.test( this.type ) ) { + $.error( "Can't create checkboxradio on element.nodeName=" + nodeName + + " and element.type=" + this.type ); + } + }, + + // Support jQuery Mobile enhanced option + _enhance: function() { + this._updateIcon( this.element[ 0 ].checked ); + }, + + widget: function() { + return this.label; + }, + + _getRadioGroup: function() { + var group; + var name = this.element[ 0 ].name; + var nameSelector = "input[name='" + $.ui.escapeSelector( name ) + "']"; + + if ( !name ) { + return $( [] ); + } + + if ( this.form.length ) { + group = $( this.form[ 0 ].elements ).filter( nameSelector ); + } else { + + // Not inside a form, check all inputs that also are not inside a form + group = $( nameSelector ).filter( function() { + return $( this ).form().length === 0; + } ); + } + + return group.not( this.element ); + }, + + _toggleClasses: function() { + var checked = this.element[ 0 ].checked; + this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked ); + + if ( this.options.icon && this.type === "checkbox" ) { + this._toggleClass( this.icon, null, "ui-icon-check ui-state-checked", checked ) + ._toggleClass( this.icon, null, "ui-icon-blank", !checked ); + } + + if ( this.type === "radio" ) { + this._getRadioGroup() + .each( function() { + var instance = $( this ).checkboxradio( "instance" ); + + if ( instance ) { + instance._removeClass( instance.label, + "ui-checkboxradio-checked", "ui-state-active" ); + } + } ); + } + }, + + _destroy: function() { + this._unbindFormResetHandler(); + + if ( this.icon ) { + this.icon.remove(); + this.iconSpace.remove(); + } + }, + + _setOption: function( key, value ) { + + // We don't allow the value to be set to nothing + if ( key === "label" && !value ) { + return; + } + + this._super( key, value ); + + if ( key === "disabled" ) { + this._toggleClass( this.label, null, "ui-state-disabled", value ); + this.element[ 0 ].disabled = value; + + // Don't refresh when setting disabled + return; + } + this.refresh(); + }, + + _updateIcon: function( checked ) { + var toAdd = "ui-icon ui-icon-background "; + + if ( this.options.icon ) { + if ( !this.icon ) { + this.icon = $( "<span>" ); + this.iconSpace = $( "<span> </span>" ); + this._addClass( this.iconSpace, "ui-checkboxradio-icon-space" ); + } + + if ( this.type === "checkbox" ) { + toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank"; + this._removeClass( this.icon, null, checked ? "ui-icon-blank" : "ui-icon-check" ); + } else { + toAdd += "ui-icon-blank"; + } + this._addClass( this.icon, "ui-checkboxradio-icon", toAdd ); + if ( !checked ) { + this._removeClass( this.icon, null, "ui-icon-check ui-state-checked" ); + } + this.icon.prependTo( this.label ).after( this.iconSpace ); + } else if ( this.icon !== undefined ) { + this.icon.remove(); + this.iconSpace.remove(); + delete this.icon; + } + }, + + _updateLabel: function() { + + // Remove the contents of the label ( minus the icon, icon space, and input ) + var contents = this.label.contents().not( this.element[ 0 ] ); + if ( this.icon ) { + contents = contents.not( this.icon[ 0 ] ); + } + if ( this.iconSpace ) { + contents = contents.not( this.iconSpace[ 0 ] ); + } + contents.remove(); + + this.label.append( this.options.label ); + }, + + refresh: function() { + var checked = this.element[ 0 ].checked, + isDisabled = this.element[ 0 ].disabled; + + this._updateIcon( checked ); + this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked ); + if ( this.options.label !== null ) { + this._updateLabel(); + } + + if ( isDisabled !== this.options.disabled ) { + this._setOptions( { "disabled": isDisabled } ); + } + } + +} ] ); + +var widgetsCheckboxradio = $.ui.checkboxradio; + + +/*! + * jQuery UI Button 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Button +//>>group: Widgets +//>>description: Enhances a form with themeable buttons. +//>>docs: http://api.jqueryui.com/button/ +//>>demos: http://jqueryui.com/button/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/button.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.button", { + version: "1.12.1", + defaultElement: "<button>", + options: { + classes: { + "ui-button": "ui-corner-all" + }, + disabled: null, + icon: null, + iconPosition: "beginning", + label: null, + showLabel: true + }, + + _getCreateOptions: function() { + var disabled, + + // This is to support cases like in jQuery Mobile where the base widget does have + // an implementation of _getCreateOptions + options = this._super() || {}; + + this.isInput = this.element.is( "input" ); + + disabled = this.element[ 0 ].disabled; + if ( disabled != null ) { + options.disabled = disabled; + } + + this.originalLabel = this.isInput ? this.element.val() : this.element.html(); + if ( this.originalLabel ) { + options.label = this.originalLabel; + } + + return options; + }, + + _create: function() { + if ( !this.option.showLabel & !this.options.icon ) { + this.options.showLabel = true; + } + + // We have to check the option again here even though we did in _getCreateOptions, + // because null may have been passed on init which would override what was set in + // _getCreateOptions + if ( this.options.disabled == null ) { + this.options.disabled = this.element[ 0 ].disabled || false; + } + + this.hasTitle = !!this.element.attr( "title" ); + + // Check to see if the label needs to be set or if its already correct + if ( this.options.label && this.options.label !== this.originalLabel ) { + if ( this.isInput ) { + this.element.val( this.options.label ); + } else { + this.element.html( this.options.label ); + } + } + this._addClass( "ui-button", "ui-widget" ); + this._setOption( "disabled", this.options.disabled ); + this._enhance(); + + if ( this.element.is( "a" ) ) { + this._on( { + "keyup": function( event ) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + event.preventDefault(); + + // Support: PhantomJS <= 1.9, IE 8 Only + // If a native click is available use it so we actually cause navigation + // otherwise just trigger a click event + if ( this.element[ 0 ].click ) { + this.element[ 0 ].click(); + } else { + this.element.trigger( "click" ); + } + } + } + } ); + } + }, + + _enhance: function() { + if ( !this.element.is( "button" ) ) { + this.element.attr( "role", "button" ); + } + + if ( this.options.icon ) { + this._updateIcon( "icon", this.options.icon ); + this._updateTooltip(); + } + }, + + _updateTooltip: function() { + this.title = this.element.attr( "title" ); + + if ( !this.options.showLabel && !this.title ) { + this.element.attr( "title", this.options.label ); + } + }, + + _updateIcon: function( option, value ) { + var icon = option !== "iconPosition", + position = icon ? this.options.iconPosition : value, + displayBlock = position === "top" || position === "bottom"; + + // Create icon + if ( !this.icon ) { + this.icon = $( "<span>" ); + + this._addClass( this.icon, "ui-button-icon", "ui-icon" ); + + if ( !this.options.showLabel ) { + this._addClass( "ui-button-icon-only" ); + } + } else if ( icon ) { + + // If we are updating the icon remove the old icon class + this._removeClass( this.icon, null, this.options.icon ); + } + + // If we are updating the icon add the new icon class + if ( icon ) { + this._addClass( this.icon, null, value ); + } + + this._attachIcon( position ); + + // If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove + // the iconSpace if there is one. + if ( displayBlock ) { + this._addClass( this.icon, null, "ui-widget-icon-block" ); + if ( this.iconSpace ) { + this.iconSpace.remove(); + } + } else { + + // Position is beginning or end so remove the ui-widget-icon-block class and add the + // space if it does not exist + if ( !this.iconSpace ) { + this.iconSpace = $( "<span> </span>" ); + this._addClass( this.iconSpace, "ui-button-icon-space" ); + } + this._removeClass( this.icon, null, "ui-wiget-icon-block" ); + this._attachIconSpace( position ); + } + }, + + _destroy: function() { + this.element.removeAttr( "role" ); + + if ( this.icon ) { + this.icon.remove(); + } + if ( this.iconSpace ) { + this.iconSpace.remove(); + } + if ( !this.hasTitle ) { + this.element.removeAttr( "title" ); + } + }, + + _attachIconSpace: function( iconPosition ) { + this.icon[ /^(?:end|bottom)/.test( iconPosition ) ? "before" : "after" ]( this.iconSpace ); + }, + + _attachIcon: function( iconPosition ) { + this.element[ /^(?:end|bottom)/.test( iconPosition ) ? "append" : "prepend" ]( this.icon ); + }, + + _setOptions: function( options ) { + var newShowLabel = options.showLabel === undefined ? + this.options.showLabel : + options.showLabel, + newIcon = options.icon === undefined ? this.options.icon : options.icon; + + if ( !newShowLabel && !newIcon ) { + options.showLabel = true; + } + this._super( options ); + }, + + _setOption: function( key, value ) { + if ( key === "icon" ) { + if ( value ) { + this._updateIcon( key, value ); + } else if ( this.icon ) { + this.icon.remove(); + if ( this.iconSpace ) { + this.iconSpace.remove(); + } + } + } + + if ( key === "iconPosition" ) { + this._updateIcon( key, value ); + } + + // Make sure we can't end up with a button that has neither text nor icon + if ( key === "showLabel" ) { + this._toggleClass( "ui-button-icon-only", null, !value ); + this._updateTooltip(); + } + + if ( key === "label" ) { + if ( this.isInput ) { + this.element.val( value ); + } else { + + // If there is an icon, append it, else nothing then append the value + // this avoids removal of the icon when setting label text + this.element.html( value ); + if ( this.icon ) { + this._attachIcon( this.options.iconPosition ); + this._attachIconSpace( this.options.iconPosition ); + } + } + } + + this._super( key, value ); + + if ( key === "disabled" ) { + this._toggleClass( null, "ui-state-disabled", value ); + this.element[ 0 ].disabled = value; + if ( value ) { + this.element.blur(); + } + } + }, + + refresh: function() { + + // Make sure to only check disabled if its an element that supports this otherwise + // check for the disabled class to determine state + var isDisabled = this.element.is( "input, button" ) ? + this.element[ 0 ].disabled : this.element.hasClass( "ui-button-disabled" ); + + if ( isDisabled !== this.options.disabled ) { + this._setOptions( { disabled: isDisabled } ); + } + + this._updateTooltip(); + } +} ); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + + // Text and Icons options + $.widget( "ui.button", $.ui.button, { + options: { + text: true, + icons: { + primary: null, + secondary: null + } + }, + + _create: function() { + if ( this.options.showLabel && !this.options.text ) { + this.options.showLabel = this.options.text; + } + if ( !this.options.showLabel && this.options.text ) { + this.options.text = this.options.showLabel; + } + if ( !this.options.icon && ( this.options.icons.primary || + this.options.icons.secondary ) ) { + if ( this.options.icons.primary ) { + this.options.icon = this.options.icons.primary; + } else { + this.options.icon = this.options.icons.secondary; + this.options.iconPosition = "end"; + } + } else if ( this.options.icon ) { + this.options.icons.primary = this.options.icon; + } + this._super(); + }, + + _setOption: function( key, value ) { + if ( key === "text" ) { + this._super( "showLabel", value ); + return; + } + if ( key === "showLabel" ) { + this.options.text = value; + } + if ( key === "icon" ) { + this.options.icons.primary = value; + } + if ( key === "icons" ) { + if ( value.primary ) { + this._super( "icon", value.primary ); + this._super( "iconPosition", "beginning" ); + } else if ( value.secondary ) { + this._super( "icon", value.secondary ); + this._super( "iconPosition", "end" ); + } + } + this._superApply( arguments ); + } + } ); + + $.fn.button = ( function( orig ) { + return function() { + if ( !this.length || ( this.length && this[ 0 ].tagName !== "INPUT" ) || + ( this.length && this[ 0 ].tagName === "INPUT" && ( + this.attr( "type" ) !== "checkbox" && this.attr( "type" ) !== "radio" + ) ) ) { + return orig.apply( this, arguments ); + } + if ( !$.ui.checkboxradio ) { + $.error( "Checkboxradio widget missing" ); + } + if ( arguments.length === 0 ) { + return this.checkboxradio( { + "icon": false + } ); + } + return this.checkboxradio.apply( this, arguments ); + }; + } )( $.fn.button ); + + $.fn.buttonset = function() { + if ( !$.ui.controlgroup ) { + $.error( "Controlgroup widget missing" ); + } + if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" && arguments[ 2 ] ) { + return this.controlgroup.apply( this, + [ arguments[ 0 ], "items.button", arguments[ 2 ] ] ); + } + if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" ) { + return this.controlgroup.apply( this, [ arguments[ 0 ], "items.button" ] ); + } + if ( typeof arguments[ 0 ] === "object" && arguments[ 0 ].items ) { + arguments[ 0 ].items = { + button: arguments[ 0 ].items + }; + } + return this.controlgroup.apply( this, arguments ); + }; +} + +var widgetsButton = $.ui.button; + + +// jscs:disable maximumLineLength +/* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */ +/*! + * jQuery UI Datepicker 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Explode + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Datepicker +//>>group: Widgets +//>>description: Displays a calendar from an input or inline for selecting dates. +//>>docs: http://api.jqueryui.com/datepicker/ +//>>demos: http://jqueryui.com/datepicker/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/datepicker.css +//>>css.theme: ../../themes/base/theme.css + + + +$.extend( $.ui, { datepicker: { version: "1.12.1" } } ); + +var datepicker_instActive; + +function datepicker_getZindex( elem ) { + var position, value; + while ( elem.length && elem[ 0 ] !== document ) { + + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + + return 0; +} +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division + this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class + this._appendClass = "ui-datepicker-append"; // The name of the append marker class + this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class + this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class + this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class + this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class + this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class + this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[ "" ] = { // Default regional settings + closeText: "Done", // Display text for close link + prevText: "Prev", // Display text for previous month link + nextText: "Next", // Display text for next month link + currentText: "Today", // Display text for current month link + monthNames: [ "January","February","March","April","May","June", + "July","August","September","October","November","December" ], // Names of months for drop-down and formatting + monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], // For formatting + dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], // For formatting + dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], // For formatting + dayNamesMin: [ "Su","Mo","Tu","We","Th","Fr","Sa" ], // Column headings for days starting at Sunday + weekHeader: "Wk", // Column header for week of the year + dateFormat: "mm/dd/yy", // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: "" // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: "focus", // "focus" for popup on focus, + // "button" for trigger button, or "both" for either + showAnim: "fadeIn", // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: "", // Display text following the input box, e.g. showing the format + buttonText: "...", // Text for trigger button + buttonImage: "", // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: "c-10:c+10", // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: "+10", // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with "+" for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: "fast", // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "", + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: "", // Selector for an alternate field to store selected dates into + altFormat: "", // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend( this._defaults, this.regional[ "" ] ); + this.regional.en = $.extend( true, {}, this.regional[ "" ] ); + this.regional[ "en-US" ] = $.extend( true, {}, this.regional.en ); + this.dpDiv = datepicker_bindHover( $( "<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) ); +} + +$.extend( Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: "hasDatepicker", + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + * @param settings object - the new settings to use as defaults (anonymous object) + * @return the manager object + */ + setDefaults: function( settings ) { + datepicker_extendRemove( this._defaults, settings || {} ); + return this; + }, + + /* Attach the date picker to a jQuery selection. + * @param target element - the target input field or division or span + * @param settings object - the new settings to use for this date picker instance (anonymous) + */ + _attachDatepicker: function( target, settings ) { + var nodeName, inline, inst; + nodeName = target.nodeName.toLowerCase(); + inline = ( nodeName === "div" || nodeName === "span" ); + if ( !target.id ) { + this.uuid += 1; + target.id = "dp" + this.uuid; + } + inst = this._newInst( $( target ), inline ); + inst.settings = $.extend( {}, settings || {} ); + if ( nodeName === "input" ) { + this._connectDatepicker( target, inst ); + } else if ( inline ) { + this._inlineDatepicker( target, inst ); + } + }, + + /* Create a new instance object. */ + _newInst: function( target, inline ) { + var id = target[ 0 ].id.replace( /([^A-Za-z0-9_\-])/g, "\\\\$1" ); // escape jQuery meta chars + return { id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: ( !inline ? this.dpDiv : // presentation div + datepicker_bindHover( $( "<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) ) ) }; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function( target, inst ) { + var input = $( target ); + inst.append = $( [] ); + inst.trigger = $( [] ); + if ( input.hasClass( this.markerClassName ) ) { + return; + } + this._attachments( input, inst ); + input.addClass( this.markerClassName ).on( "keydown", this._doKeyDown ). + on( "keypress", this._doKeyPress ).on( "keyup", this._doKeyUp ); + this._autoSize( inst ); + $.data( target, "datepicker", inst ); + + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if ( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function( input, inst ) { + var showOn, buttonText, buttonImage, + appendText = this._get( inst, "appendText" ), + isRTL = this._get( inst, "isRTL" ); + + if ( inst.append ) { + inst.append.remove(); + } + if ( appendText ) { + inst.append = $( "<span class='" + this._appendClass + "'>" + appendText + "</span>" ); + input[ isRTL ? "before" : "after" ]( inst.append ); + } + + input.off( "focus", this._showDatepicker ); + + if ( inst.trigger ) { + inst.trigger.remove(); + } + + showOn = this._get( inst, "showOn" ); + if ( showOn === "focus" || showOn === "both" ) { // pop-up date picker when in the marked field + input.on( "focus", this._showDatepicker ); + } + if ( showOn === "button" || showOn === "both" ) { // pop-up date picker when button clicked + buttonText = this._get( inst, "buttonText" ); + buttonImage = this._get( inst, "buttonImage" ); + inst.trigger = $( this._get( inst, "buttonImageOnly" ) ? + $( "<img/>" ).addClass( this._triggerClass ). + attr( { src: buttonImage, alt: buttonText, title: buttonText } ) : + $( "<button type='button'></button>" ).addClass( this._triggerClass ). + html( !buttonImage ? buttonText : $( "<img/>" ).attr( + { src:buttonImage, alt:buttonText, title:buttonText } ) ) ); + input[ isRTL ? "before" : "after" ]( inst.trigger ); + inst.trigger.on( "click", function() { + if ( $.datepicker._datepickerShowing && $.datepicker._lastInput === input[ 0 ] ) { + $.datepicker._hideDatepicker(); + } else if ( $.datepicker._datepickerShowing && $.datepicker._lastInput !== input[ 0 ] ) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker( input[ 0 ] ); + } else { + $.datepicker._showDatepicker( input[ 0 ] ); + } + return false; + } ); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function( inst ) { + if ( this._get( inst, "autoSize" ) && !inst.inline ) { + var findMax, max, maxI, i, + date = new Date( 2009, 12 - 1, 20 ), // Ensure double digits + dateFormat = this._get( inst, "dateFormat" ); + + if ( dateFormat.match( /[DM]/ ) ) { + findMax = function( names ) { + max = 0; + maxI = 0; + for ( i = 0; i < names.length; i++ ) { + if ( names[ i ].length > max ) { + max = names[ i ].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth( findMax( this._get( inst, ( dateFormat.match( /MM/ ) ? + "monthNames" : "monthNamesShort" ) ) ) ); + date.setDate( findMax( this._get( inst, ( dateFormat.match( /DD/ ) ? + "dayNames" : "dayNamesShort" ) ) ) + 20 - date.getDay() ); + } + inst.input.attr( "size", this._formatDate( inst, date ).length ); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function( target, inst ) { + var divSpan = $( target ); + if ( divSpan.hasClass( this.markerClassName ) ) { + return; + } + divSpan.addClass( this.markerClassName ).append( inst.dpDiv ); + $.data( target, "datepicker", inst ); + this._setDate( inst, this._getDefaultDate( inst ), true ); + this._updateDatepicker( inst ); + this._updateAlternate( inst ); + + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if ( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + * @param input element - ignored + * @param date string or Date - the initial date to display + * @param onSelect function - the function to call when a date is selected + * @param settings object - update the dialog date picker instance's settings (anonymous object) + * @param pos int[2] - coordinates for the dialog's position within the screen or + * event - with x/y coordinates or + * leave empty for default (screen centre) + * @return the manager object + */ + _dialogDatepicker: function( input, date, onSelect, settings, pos ) { + var id, browserWidth, browserHeight, scrollX, scrollY, + inst = this._dialogInst; // internal instance + + if ( !inst ) { + this.uuid += 1; + id = "dp" + this.uuid; + this._dialogInput = $( "<input type='text' id='" + id + + "' style='position: absolute; top: -100px; width: 0px;'/>" ); + this._dialogInput.on( "keydown", this._doKeyDown ); + $( "body" ).append( this._dialogInput ); + inst = this._dialogInst = this._newInst( this._dialogInput, false ); + inst.settings = {}; + $.data( this._dialogInput[ 0 ], "datepicker", inst ); + } + datepicker_extendRemove( inst.settings, settings || {} ); + date = ( date && date.constructor === Date ? this._formatDate( inst, date ) : date ); + this._dialogInput.val( date ); + + this._pos = ( pos ? ( pos.length ? pos : [ pos.pageX, pos.pageY ] ) : null ); + if ( !this._pos ) { + browserWidth = document.documentElement.clientWidth; + browserHeight = document.documentElement.clientHeight; + scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [ ( browserWidth / 2 ) - 100 + scrollX, ( browserHeight / 2 ) - 150 + scrollY ]; + } + + // Move input on screen for focus, but hidden behind dialog + this._dialogInput.css( "left", ( this._pos[ 0 ] + 20 ) + "px" ).css( "top", this._pos[ 1 ] + "px" ); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass( this._dialogClass ); + this._showDatepicker( this._dialogInput[ 0 ] ); + if ( $.blockUI ) { + $.blockUI( this.dpDiv ); + } + $.data( this._dialogInput[ 0 ], "datepicker", inst ); + return this; + }, + + /* Detach a datepicker from its control. + * @param target element - the target input field or division or span + */ + _destroyDatepicker: function( target ) { + var nodeName, + $target = $( target ), + inst = $.data( target, "datepicker" ); + + if ( !$target.hasClass( this.markerClassName ) ) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + $.removeData( target, "datepicker" ); + if ( nodeName === "input" ) { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass( this.markerClassName ). + off( "focus", this._showDatepicker ). + off( "keydown", this._doKeyDown ). + off( "keypress", this._doKeyPress ). + off( "keyup", this._doKeyUp ); + } else if ( nodeName === "div" || nodeName === "span" ) { + $target.removeClass( this.markerClassName ).empty(); + } + + if ( datepicker_instActive === inst ) { + datepicker_instActive = null; + } + }, + + /* Enable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _enableDatepicker: function( target ) { + var nodeName, inline, + $target = $( target ), + inst = $.data( target, "datepicker" ); + + if ( !$target.hasClass( this.markerClassName ) ) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if ( nodeName === "input" ) { + target.disabled = false; + inst.trigger.filter( "button" ). + each( function() { this.disabled = false; } ).end(). + filter( "img" ).css( { opacity: "1.0", cursor: "" } ); + } else if ( nodeName === "div" || nodeName === "span" ) { + inline = $target.children( "." + this._inlineClass ); + inline.children().removeClass( "ui-state-disabled" ); + inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ). + prop( "disabled", false ); + } + this._disabledInputs = $.map( this._disabledInputs, + function( value ) { return ( value === target ? null : value ); } ); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _disableDatepicker: function( target ) { + var nodeName, inline, + $target = $( target ), + inst = $.data( target, "datepicker" ); + + if ( !$target.hasClass( this.markerClassName ) ) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if ( nodeName === "input" ) { + target.disabled = true; + inst.trigger.filter( "button" ). + each( function() { this.disabled = true; } ).end(). + filter( "img" ).css( { opacity: "0.5", cursor: "default" } ); + } else if ( nodeName === "div" || nodeName === "span" ) { + inline = $target.children( "." + this._inlineClass ); + inline.children().addClass( "ui-state-disabled" ); + inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ). + prop( "disabled", true ); + } + this._disabledInputs = $.map( this._disabledInputs, + function( value ) { return ( value === target ? null : value ); } ); // delete entry + this._disabledInputs[ this._disabledInputs.length ] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + * @param target element - the target input field or division or span + * @return boolean - true if disabled, false if enabled + */ + _isDisabledDatepicker: function( target ) { + if ( !target ) { + return false; + } + for ( var i = 0; i < this._disabledInputs.length; i++ ) { + if ( this._disabledInputs[ i ] === target ) { + return true; + } + } + return false; + }, + + /* Retrieve the instance data for the target control. + * @param target element - the target input field or division or span + * @return object - the associated instance data + * @throws error if a jQuery problem getting data + */ + _getInst: function( target ) { + try { + return $.data( target, "datepicker" ); + } + catch ( err ) { + throw "Missing instance data for this datepicker"; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + * @param target element - the target input field or division or span + * @param name object - the new settings to update or + * string - the name of the setting to change or retrieve, + * when retrieving also "all" for all instance settings or + * "defaults" for all global defaults + * @param value any - the new value for the setting + * (omit if above is an object or to retrieve a value) + */ + _optionDatepicker: function( target, name, value ) { + var settings, date, minDate, maxDate, + inst = this._getInst( target ); + + if ( arguments.length === 2 && typeof name === "string" ) { + return ( name === "defaults" ? $.extend( {}, $.datepicker._defaults ) : + ( inst ? ( name === "all" ? $.extend( {}, inst.settings ) : + this._get( inst, name ) ) : null ) ); + } + + settings = name || {}; + if ( typeof name === "string" ) { + settings = {}; + settings[ name ] = value; + } + + if ( inst ) { + if ( this._curInst === inst ) { + this._hideDatepicker(); + } + + date = this._getDateDatepicker( target, true ); + minDate = this._getMinMaxDate( inst, "min" ); + maxDate = this._getMinMaxDate( inst, "max" ); + datepicker_extendRemove( inst.settings, settings ); + + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if ( minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined ) { + inst.settings.minDate = this._formatDate( inst, minDate ); + } + if ( maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined ) { + inst.settings.maxDate = this._formatDate( inst, maxDate ); + } + if ( "disabled" in settings ) { + if ( settings.disabled ) { + this._disableDatepicker( target ); + } else { + this._enableDatepicker( target ); + } + } + this._attachments( $( target ), inst ); + this._autoSize( inst ); + this._setDate( inst, date ); + this._updateAlternate( inst ); + this._updateDatepicker( inst ); + } + }, + + // Change method deprecated + _changeDatepicker: function( target, name, value ) { + this._optionDatepicker( target, name, value ); + }, + + /* Redraw the date picker attached to an input field or division. + * @param target element - the target input field or division or span + */ + _refreshDatepicker: function( target ) { + var inst = this._getInst( target ); + if ( inst ) { + this._updateDatepicker( inst ); + } + }, + + /* Set the dates for a jQuery selection. + * @param target element - the target input field or division or span + * @param date Date - the new date + */ + _setDateDatepicker: function( target, date ) { + var inst = this._getInst( target ); + if ( inst ) { + this._setDate( inst, date ); + this._updateDatepicker( inst ); + this._updateAlternate( inst ); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + * @param target element - the target input field or division or span + * @param noDefault boolean - true if no default date is to be used + * @return Date - the current date + */ + _getDateDatepicker: function( target, noDefault ) { + var inst = this._getInst( target ); + if ( inst && !inst.inline ) { + this._setDateFromField( inst, noDefault ); + } + return ( inst ? this._getDate( inst ) : null ); + }, + + /* Handle keystrokes. */ + _doKeyDown: function( event ) { + var onSelect, dateStr, sel, + inst = $.datepicker._getInst( event.target ), + handled = true, + isRTL = inst.dpDiv.is( ".ui-datepicker-rtl" ); + + inst._keyEvent = true; + if ( $.datepicker._datepickerShowing ) { + switch ( event.keyCode ) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: sel = $( "td." + $.datepicker._dayOverClass + ":not(." + + $.datepicker._currentClass + ")", inst.dpDiv ); + if ( sel[ 0 ] ) { + $.datepicker._selectDay( event.target, inst.selectedMonth, inst.selectedYear, sel[ 0 ] ); + } + + onSelect = $.datepicker._get( inst, "onSelect" ); + if ( onSelect ) { + dateStr = $.datepicker._formatDate( inst ); + + // Trigger custom callback + onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] ); + } else { + $.datepicker._hideDatepicker(); + } + + return false; // don't submit the form + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate( event.target, ( event.ctrlKey ? + -$.datepicker._get( inst, "stepBigMonths" ) : + -$.datepicker._get( inst, "stepMonths" ) ), "M" ); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate( event.target, ( event.ctrlKey ? + +$.datepicker._get( inst, "stepBigMonths" ) : + +$.datepicker._get( inst, "stepMonths" ) ), "M" ); + break; // next month/year on page down/+ ctrl + case 35: if ( event.ctrlKey || event.metaKey ) { + $.datepicker._clearDate( event.target ); + } + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if ( event.ctrlKey || event.metaKey ) { + $.datepicker._gotoToday( event.target ); + } + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if ( event.ctrlKey || event.metaKey ) { + $.datepicker._adjustDate( event.target, ( isRTL ? +1 : -1 ), "D" ); + } + handled = event.ctrlKey || event.metaKey; + + // -1 day on ctrl or command +left + if ( event.originalEvent.altKey ) { + $.datepicker._adjustDate( event.target, ( event.ctrlKey ? + -$.datepicker._get( inst, "stepBigMonths" ) : + -$.datepicker._get( inst, "stepMonths" ) ), "M" ); + } + + // next month/year on alt +left on Mac + break; + case 38: if ( event.ctrlKey || event.metaKey ) { + $.datepicker._adjustDate( event.target, -7, "D" ); + } + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if ( event.ctrlKey || event.metaKey ) { + $.datepicker._adjustDate( event.target, ( isRTL ? -1 : +1 ), "D" ); + } + handled = event.ctrlKey || event.metaKey; + + // +1 day on ctrl or command +right + if ( event.originalEvent.altKey ) { + $.datepicker._adjustDate( event.target, ( event.ctrlKey ? + +$.datepicker._get( inst, "stepBigMonths" ) : + +$.datepicker._get( inst, "stepMonths" ) ), "M" ); + } + + // next month/year on alt +right + break; + case 40: if ( event.ctrlKey || event.metaKey ) { + $.datepicker._adjustDate( event.target, +7, "D" ); + } + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + } else if ( event.keyCode === 36 && event.ctrlKey ) { // display the date picker on ctrl+home + $.datepicker._showDatepicker( this ); + } else { + handled = false; + } + + if ( handled ) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function( event ) { + var chars, chr, + inst = $.datepicker._getInst( event.target ); + + if ( $.datepicker._get( inst, "constrainInput" ) ) { + chars = $.datepicker._possibleChars( $.datepicker._get( inst, "dateFormat" ) ); + chr = String.fromCharCode( event.charCode == null ? event.keyCode : event.charCode ); + return event.ctrlKey || event.metaKey || ( chr < " " || !chars || chars.indexOf( chr ) > -1 ); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function( event ) { + var date, + inst = $.datepicker._getInst( event.target ); + + if ( inst.input.val() !== inst.lastVal ) { + try { + date = $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ), + ( inst.input ? inst.input.val() : null ), + $.datepicker._getFormatConfig( inst ) ); + + if ( date ) { // only if valid + $.datepicker._setDateFromField( inst ); + $.datepicker._updateAlternate( inst ); + $.datepicker._updateDatepicker( inst ); + } + } + catch ( err ) { + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + * If false returned from beforeShow event handler do not show. + * @param input element - the input field attached to the date picker or + * event - if triggered by focus + */ + _showDatepicker: function( input ) { + input = input.target || input; + if ( input.nodeName.toLowerCase() !== "input" ) { // find from button/image trigger + input = $( "input", input.parentNode )[ 0 ]; + } + + if ( $.datepicker._isDisabledDatepicker( input ) || $.datepicker._lastInput === input ) { // already here + return; + } + + var inst, beforeShow, beforeShowSettings, isFixed, + offset, showAnim, duration; + + inst = $.datepicker._getInst( input ); + if ( $.datepicker._curInst && $.datepicker._curInst !== inst ) { + $.datepicker._curInst.dpDiv.stop( true, true ); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[ 0 ] ); + } + } + + beforeShow = $.datepicker._get( inst, "beforeShow" ); + beforeShowSettings = beforeShow ? beforeShow.apply( input, [ input, inst ] ) : {}; + if ( beforeShowSettings === false ) { + return; + } + datepicker_extendRemove( inst.settings, beforeShowSettings ); + + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField( inst ); + + if ( $.datepicker._inDialog ) { // hide cursor + input.value = ""; + } + if ( !$.datepicker._pos ) { // position below input + $.datepicker._pos = $.datepicker._findPos( input ); + $.datepicker._pos[ 1 ] += input.offsetHeight; // add the height + } + + isFixed = false; + $( input ).parents().each( function() { + isFixed |= $( this ).css( "position" ) === "fixed"; + return !isFixed; + } ); + + offset = { left: $.datepicker._pos[ 0 ], top: $.datepicker._pos[ 1 ] }; + $.datepicker._pos = null; + + //to avoid flashes on Firefox + inst.dpDiv.empty(); + + // determine sizing offscreen + inst.dpDiv.css( { position: "absolute", display: "block", top: "-1000px" } ); + $.datepicker._updateDatepicker( inst ); + + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset( inst, offset, isFixed ); + inst.dpDiv.css( { position: ( $.datepicker._inDialog && $.blockUI ? + "static" : ( isFixed ? "fixed" : "absolute" ) ), display: "none", + left: offset.left + "px", top: offset.top + "px" } ); + + if ( !inst.inline ) { + showAnim = $.datepicker._get( inst, "showAnim" ); + duration = $.datepicker._get( inst, "duration" ); + inst.dpDiv.css( "z-index", datepicker_getZindex( $( input ) ) + 1 ); + $.datepicker._datepickerShowing = true; + + if ( $.effects && $.effects.effect[ showAnim ] ) { + inst.dpDiv.show( showAnim, $.datepicker._get( inst, "showOptions" ), duration ); + } else { + inst.dpDiv[ showAnim || "show" ]( showAnim ? duration : null ); + } + + if ( $.datepicker._shouldFocusInput( inst ) ) { + inst.input.trigger( "focus" ); + } + + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function( inst ) { + this.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + datepicker_instActive = inst; // for delegate hover events + inst.dpDiv.empty().append( this._generateHTML( inst ) ); + this._attachHandlers( inst ); + + var origyearshtml, + numMonths = this._getNumberOfMonths( inst ), + cols = numMonths[ 1 ], + width = 17, + activeCell = inst.dpDiv.find( "." + this._dayOverClass + " a" ); + + if ( activeCell.length > 0 ) { + datepicker_handleMouseover.apply( activeCell.get( 0 ) ); + } + + inst.dpDiv.removeClass( "ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4" ).width( "" ); + if ( cols > 1 ) { + inst.dpDiv.addClass( "ui-datepicker-multi-" + cols ).css( "width", ( width * cols ) + "em" ); + } + inst.dpDiv[ ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ? "add" : "remove" ) + + "Class" ]( "ui-datepicker-multi" ); + inst.dpDiv[ ( this._get( inst, "isRTL" ) ? "add" : "remove" ) + + "Class" ]( "ui-datepicker-rtl" ); + + if ( inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput( inst ) ) { + inst.input.trigger( "focus" ); + } + + // Deffered render of the years select (to avoid flashes on Firefox) + if ( inst.yearshtml ) { + origyearshtml = inst.yearshtml; + setTimeout( function() { + + //assure that inst.yearshtml didn't change. + if ( origyearshtml === inst.yearshtml && inst.yearshtml ) { + inst.dpDiv.find( "select.ui-datepicker-year:first" ).replaceWith( inst.yearshtml ); + } + origyearshtml = inst.yearshtml = null; + }, 0 ); + } + }, + + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + // Support: IE and jQuery <1.9 + _shouldFocusInput: function( inst ) { + return inst.input && inst.input.is( ":visible" ) && !inst.input.is( ":disabled" ) && !inst.input.is( ":focus" ); + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function( inst, offset, isFixed ) { + var dpWidth = inst.dpDiv.outerWidth(), + dpHeight = inst.dpDiv.outerHeight(), + inputWidth = inst.input ? inst.input.outerWidth() : 0, + inputHeight = inst.input ? inst.input.outerHeight() : 0, + viewWidth = document.documentElement.clientWidth + ( isFixed ? 0 : $( document ).scrollLeft() ), + viewHeight = document.documentElement.clientHeight + ( isFixed ? 0 : $( document ).scrollTop() ); + + offset.left -= ( this._get( inst, "isRTL" ) ? ( dpWidth - inputWidth ) : 0 ); + offset.left -= ( isFixed && offset.left === inst.input.offset().left ) ? $( document ).scrollLeft() : 0; + offset.top -= ( isFixed && offset.top === ( inst.input.offset().top + inputHeight ) ) ? $( document ).scrollTop() : 0; + + // Now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min( offset.left, ( offset.left + dpWidth > viewWidth && viewWidth > dpWidth ) ? + Math.abs( offset.left + dpWidth - viewWidth ) : 0 ); + offset.top -= Math.min( offset.top, ( offset.top + dpHeight > viewHeight && viewHeight > dpHeight ) ? + Math.abs( dpHeight + inputHeight ) : 0 ); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function( obj ) { + var position, + inst = this._getInst( obj ), + isRTL = this._get( inst, "isRTL" ); + + while ( obj && ( obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden( obj ) ) ) { + obj = obj[ isRTL ? "previousSibling" : "nextSibling" ]; + } + + position = $( obj ).offset(); + return [ position.left, position.top ]; + }, + + /* Hide the date picker from view. + * @param input element - the input field attached to the date picker + */ + _hideDatepicker: function( input ) { + var showAnim, duration, postProcess, onClose, + inst = this._curInst; + + if ( !inst || ( input && inst !== $.data( input, "datepicker" ) ) ) { + return; + } + + if ( this._datepickerShowing ) { + showAnim = this._get( inst, "showAnim" ); + duration = this._get( inst, "duration" ); + postProcess = function() { + $.datepicker._tidyDialog( inst ); + }; + + // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed + if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) { + inst.dpDiv.hide( showAnim, $.datepicker._get( inst, "showOptions" ), duration, postProcess ); + } else { + inst.dpDiv[ ( showAnim === "slideDown" ? "slideUp" : + ( showAnim === "fadeIn" ? "fadeOut" : "hide" ) ) ]( ( showAnim ? duration : null ), postProcess ); + } + + if ( !showAnim ) { + postProcess(); + } + this._datepickerShowing = false; + + onClose = this._get( inst, "onClose" ); + if ( onClose ) { + onClose.apply( ( inst.input ? inst.input[ 0 ] : null ), [ ( inst.input ? inst.input.val() : "" ), inst ] ); + } + + this._lastInput = null; + if ( this._inDialog ) { + this._dialogInput.css( { position: "absolute", left: "0", top: "-100px" } ); + if ( $.blockUI ) { + $.unblockUI(); + $( "body" ).append( this.dpDiv ); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function( inst ) { + inst.dpDiv.removeClass( this._dialogClass ).off( ".ui-datepicker-calendar" ); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function( event ) { + if ( !$.datepicker._curInst ) { + return; + } + + var $target = $( event.target ), + inst = $.datepicker._getInst( $target[ 0 ] ); + + if ( ( ( $target[ 0 ].id !== $.datepicker._mainDivId && + $target.parents( "#" + $.datepicker._mainDivId ).length === 0 && + !$target.hasClass( $.datepicker.markerClassName ) && + !$target.closest( "." + $.datepicker._triggerClass ).length && + $.datepicker._datepickerShowing && !( $.datepicker._inDialog && $.blockUI ) ) ) || + ( $target.hasClass( $.datepicker.markerClassName ) && $.datepicker._curInst !== inst ) ) { + $.datepicker._hideDatepicker(); + } + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function( id, offset, period ) { + var target = $( id ), + inst = this._getInst( target[ 0 ] ); + + if ( this._isDisabledDatepicker( target[ 0 ] ) ) { + return; + } + this._adjustInstDate( inst, offset + + ( period === "M" ? this._get( inst, "showCurrentAtPos" ) : 0 ), // undo positioning + period ); + this._updateDatepicker( inst ); + }, + + /* Action for current link. */ + _gotoToday: function( id ) { + var date, + target = $( id ), + inst = this._getInst( target[ 0 ] ); + + if ( this._get( inst, "gotoCurrent" ) && inst.currentDay ) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } else { + date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange( inst ); + this._adjustDate( target ); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function( id, select, period ) { + var target = $( id ), + inst = this._getInst( target[ 0 ] ); + + inst[ "selected" + ( period === "M" ? "Month" : "Year" ) ] = + inst[ "draw" + ( period === "M" ? "Month" : "Year" ) ] = + parseInt( select.options[ select.selectedIndex ].value, 10 ); + + this._notifyChange( inst ); + this._adjustDate( target ); + }, + + /* Action for selecting a day. */ + _selectDay: function( id, month, year, td ) { + var inst, + target = $( id ); + + if ( $( td ).hasClass( this._unselectableClass ) || this._isDisabledDatepicker( target[ 0 ] ) ) { + return; + } + + inst = this._getInst( target[ 0 ] ); + inst.selectedDay = inst.currentDay = $( "a", td ).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate( id, this._formatDate( inst, + inst.currentDay, inst.currentMonth, inst.currentYear ) ); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function( id ) { + var target = $( id ); + this._selectDate( target, "" ); + }, + + /* Update the input field with the selected date. */ + _selectDate: function( id, dateStr ) { + var onSelect, + target = $( id ), + inst = this._getInst( target[ 0 ] ); + + dateStr = ( dateStr != null ? dateStr : this._formatDate( inst ) ); + if ( inst.input ) { + inst.input.val( dateStr ); + } + this._updateAlternate( inst ); + + onSelect = this._get( inst, "onSelect" ); + if ( onSelect ) { + onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] ); // trigger custom callback + } else if ( inst.input ) { + inst.input.trigger( "change" ); // fire the change event + } + + if ( inst.inline ) { + this._updateDatepicker( inst ); + } else { + this._hideDatepicker(); + this._lastInput = inst.input[ 0 ]; + if ( typeof( inst.input[ 0 ] ) !== "object" ) { + inst.input.trigger( "focus" ); // restore focus + } + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function( inst ) { + var altFormat, date, dateStr, + altField = this._get( inst, "altField" ); + + if ( altField ) { // update alternate field too + altFormat = this._get( inst, "altFormat" ) || this._get( inst, "dateFormat" ); + date = this._getDate( inst ); + dateStr = this.formatDate( altFormat, date, this._getFormatConfig( inst ) ); + $( altField ).val( dateStr ); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + * @param date Date - the date to customise + * @return [boolean, string] - is this date selectable?, what is its CSS class? + */ + noWeekends: function( date ) { + var day = date.getDay(); + return [ ( day > 0 && day < 6 ), "" ]; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + * @param date Date - the date to get the week for + * @return number - the number of the week within the year that contains this date + */ + iso8601Week: function( date ) { + var time, + checkDate = new Date( date.getTime() ); + + // Find Thursday of this week starting on Monday + checkDate.setDate( checkDate.getDate() + 4 - ( checkDate.getDay() || 7 ) ); + + time = checkDate.getTime(); + checkDate.setMonth( 0 ); // Compare with Jan 1 + checkDate.setDate( 1 ); + return Math.floor( Math.round( ( time - checkDate ) / 86400000 ) / 7 ) + 1; + }, + + /* Parse a string value into a date object. + * See formatDate below for the possible formats. + * + * @param format string - the expected format of the date + * @param value string - the date in the above format + * @param settings Object - attributes include: + * shortYearCutoff number - the cutoff year for determining the century (optional) + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return Date - the extracted date value or null if value is blank + */ + parseDate: function( format, value, settings ) { + if ( format == null || value == null ) { + throw "Invalid arguments"; + } + + value = ( typeof value === "object" ? value.toString() : value + "" ); + if ( value === "" ) { + return null; + } + + var iFormat, dim, extra, + iValue = 0, + shortYearCutoffTemp = ( settings ? settings.shortYearCutoff : null ) || this._defaults.shortYearCutoff, + shortYearCutoff = ( typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp : + new Date().getFullYear() % 100 + parseInt( shortYearCutoffTemp, 10 ) ), + dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort, + dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames, + monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort, + monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames, + year = -1, + month = -1, + day = -1, + doy = -1, + literal = false, + date, + + // Check whether a format character is doubled + lookAhead = function( match ) { + var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match ); + if ( matches ) { + iFormat++; + } + return matches; + }, + + // Extract a number from the string value + getNumber = function( match ) { + var isDoubled = lookAhead( match ), + size = ( match === "@" ? 14 : ( match === "!" ? 20 : + ( match === "y" && isDoubled ? 4 : ( match === "o" ? 3 : 2 ) ) ) ), + minSize = ( match === "y" ? size : 1 ), + digits = new RegExp( "^\\d{" + minSize + "," + size + "}" ), + num = value.substring( iValue ).match( digits ); + if ( !num ) { + throw "Missing number at position " + iValue; + } + iValue += num[ 0 ].length; + return parseInt( num[ 0 ], 10 ); + }, + + // Extract a name from the string value and convert to an index + getName = function( match, shortNames, longNames ) { + var index = -1, + names = $.map( lookAhead( match ) ? longNames : shortNames, function( v, k ) { + return [ [ k, v ] ]; + } ).sort( function( a, b ) { + return -( a[ 1 ].length - b[ 1 ].length ); + } ); + + $.each( names, function( i, pair ) { + var name = pair[ 1 ]; + if ( value.substr( iValue, name.length ).toLowerCase() === name.toLowerCase() ) { + index = pair[ 0 ]; + iValue += name.length; + return false; + } + } ); + if ( index !== -1 ) { + return index + 1; + } else { + throw "Unknown name at position " + iValue; + } + }, + + // Confirm that a literal character matches the string value + checkLiteral = function() { + if ( value.charAt( iValue ) !== format.charAt( iFormat ) ) { + throw "Unexpected literal at position " + iValue; + } + iValue++; + }; + + for ( iFormat = 0; iFormat < format.length; iFormat++ ) { + if ( literal ) { + if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) { + literal = false; + } else { + checkLiteral(); + } + } else { + switch ( format.charAt( iFormat ) ) { + case "d": + day = getNumber( "d" ); + break; + case "D": + getName( "D", dayNamesShort, dayNames ); + break; + case "o": + doy = getNumber( "o" ); + break; + case "m": + month = getNumber( "m" ); + break; + case "M": + month = getName( "M", monthNamesShort, monthNames ); + break; + case "y": + year = getNumber( "y" ); + break; + case "@": + date = new Date( getNumber( "@" ) ); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "!": + date = new Date( ( getNumber( "!" ) - this._ticksTo1970 ) / 10000 ); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if ( lookAhead( "'" ) ) { + checkLiteral(); + } else { + literal = true; + } + break; + default: + checkLiteral(); + } + } + } + + if ( iValue < value.length ) { + extra = value.substr( iValue ); + if ( !/^\s+/.test( extra ) ) { + throw "Extra/unparsed characters found in date: " + extra; + } + } + + if ( year === -1 ) { + year = new Date().getFullYear(); + } else if ( year < 100 ) { + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + ( year <= shortYearCutoff ? 0 : -100 ); + } + + if ( doy > -1 ) { + month = 1; + day = doy; + do { + dim = this._getDaysInMonth( year, month - 1 ); + if ( day <= dim ) { + break; + } + month++; + day -= dim; + } while ( true ); + } + + date = this._daylightSavingAdjust( new Date( year, month - 1, day ) ); + if ( date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day ) { + throw "Invalid date"; // E.g. 31/02/00 + } + return date; + }, + + /* Standard date formats. */ + ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601) + COOKIE: "D, dd M yy", + ISO_8601: "yy-mm-dd", + RFC_822: "D, d M y", + RFC_850: "DD, dd-M-y", + RFC_1036: "D, d M y", + RFC_1123: "D, d M yy", + RFC_2822: "D, d M yy", + RSS: "D, d M y", // RFC 822 + TICKS: "!", + TIMESTAMP: "@", + W3C: "yy-mm-dd", // ISO 8601 + + _ticksTo1970: ( ( ( 1970 - 1 ) * 365 + Math.floor( 1970 / 4 ) - Math.floor( 1970 / 100 ) + + Math.floor( 1970 / 400 ) ) * 24 * 60 * 60 * 10000000 ), + + /* Format a date object into a string value. + * The format can be combinations of the following: + * d - day of month (no leading zero) + * dd - day of month (two digit) + * o - day of year (no leading zeros) + * oo - day of year (three digit) + * D - day name short + * DD - day name long + * m - month of year (no leading zero) + * mm - month of year (two digit) + * M - month name short + * MM - month name long + * y - year (two digit) + * yy - year (four digit) + * @ - Unix timestamp (ms since 01/01/1970) + * ! - Windows ticks (100ns since 01/01/0001) + * "..." - literal text + * '' - single quote + * + * @param format string - the desired format of the date + * @param date Date - the date value to format + * @param settings Object - attributes include: + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return string - the date in the above format + */ + formatDate: function( format, date, settings ) { + if ( !date ) { + return ""; + } + + var iFormat, + dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort, + dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames, + monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort, + monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames, + + // Check whether a format character is doubled + lookAhead = function( match ) { + var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match ); + if ( matches ) { + iFormat++; + } + return matches; + }, + + // Format a number, with leading zero if necessary + formatNumber = function( match, value, len ) { + var num = "" + value; + if ( lookAhead( match ) ) { + while ( num.length < len ) { + num = "0" + num; + } + } + return num; + }, + + // Format a name, short or long as requested + formatName = function( match, value, shortNames, longNames ) { + return ( lookAhead( match ) ? longNames[ value ] : shortNames[ value ] ); + }, + output = "", + literal = false; + + if ( date ) { + for ( iFormat = 0; iFormat < format.length; iFormat++ ) { + if ( literal ) { + if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) { + literal = false; + } else { + output += format.charAt( iFormat ); + } + } else { + switch ( format.charAt( iFormat ) ) { + case "d": + output += formatNumber( "d", date.getDate(), 2 ); + break; + case "D": + output += formatName( "D", date.getDay(), dayNamesShort, dayNames ); + break; + case "o": + output += formatNumber( "o", + Math.round( ( new Date( date.getFullYear(), date.getMonth(), date.getDate() ).getTime() - new Date( date.getFullYear(), 0, 0 ).getTime() ) / 86400000 ), 3 ); + break; + case "m": + output += formatNumber( "m", date.getMonth() + 1, 2 ); + break; + case "M": + output += formatName( "M", date.getMonth(), monthNamesShort, monthNames ); + break; + case "y": + output += ( lookAhead( "y" ) ? date.getFullYear() : + ( date.getFullYear() % 100 < 10 ? "0" : "" ) + date.getFullYear() % 100 ); + break; + case "@": + output += date.getTime(); + break; + case "!": + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if ( lookAhead( "'" ) ) { + output += "'"; + } else { + literal = true; + } + break; + default: + output += format.charAt( iFormat ); + } + } + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function( format ) { + var iFormat, + chars = "", + literal = false, + + // Check whether a format character is doubled + lookAhead = function( match ) { + var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match ); + if ( matches ) { + iFormat++; + } + return matches; + }; + + for ( iFormat = 0; iFormat < format.length; iFormat++ ) { + if ( literal ) { + if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) { + literal = false; + } else { + chars += format.charAt( iFormat ); + } + } else { + switch ( format.charAt( iFormat ) ) { + case "d": case "m": case "y": case "@": + chars += "0123456789"; + break; + case "D": case "M": + return null; // Accept anything + case "'": + if ( lookAhead( "'" ) ) { + chars += "'"; + } else { + literal = true; + } + break; + default: + chars += format.charAt( iFormat ); + } + } + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function( inst, name ) { + return inst.settings[ name ] !== undefined ? + inst.settings[ name ] : this._defaults[ name ]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function( inst, noDefault ) { + if ( inst.input.val() === inst.lastVal ) { + return; + } + + var dateFormat = this._get( inst, "dateFormat" ), + dates = inst.lastVal = inst.input ? inst.input.val() : null, + defaultDate = this._getDefaultDate( inst ), + date = defaultDate, + settings = this._getFormatConfig( inst ); + + try { + date = this.parseDate( dateFormat, dates, settings ) || defaultDate; + } catch ( event ) { + dates = ( noDefault ? "" : dates ); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = ( dates ? date.getDate() : 0 ); + inst.currentMonth = ( dates ? date.getMonth() : 0 ); + inst.currentYear = ( dates ? date.getFullYear() : 0 ); + this._adjustInstDate( inst ); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function( inst ) { + return this._restrictMinMax( inst, + this._determineDate( inst, this._get( inst, "defaultDate" ), new Date() ) ); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function( inst, date, defaultDate ) { + var offsetNumeric = function( offset ) { + var date = new Date(); + date.setDate( date.getDate() + offset ); + return date; + }, + offsetString = function( offset ) { + try { + return $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ), + offset, $.datepicker._getFormatConfig( inst ) ); + } + catch ( e ) { + + // Ignore + } + + var date = ( offset.toLowerCase().match( /^c/ ) ? + $.datepicker._getDate( inst ) : null ) || new Date(), + year = date.getFullYear(), + month = date.getMonth(), + day = date.getDate(), + pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g, + matches = pattern.exec( offset ); + + while ( matches ) { + switch ( matches[ 2 ] || "d" ) { + case "d" : case "D" : + day += parseInt( matches[ 1 ], 10 ); break; + case "w" : case "W" : + day += parseInt( matches[ 1 ], 10 ) * 7; break; + case "m" : case "M" : + month += parseInt( matches[ 1 ], 10 ); + day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) ); + break; + case "y": case "Y" : + year += parseInt( matches[ 1 ], 10 ); + day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) ); + break; + } + matches = pattern.exec( offset ); + } + return new Date( year, month, day ); + }, + newDate = ( date == null || date === "" ? defaultDate : ( typeof date === "string" ? offsetString( date ) : + ( typeof date === "number" ? ( isNaN( date ) ? defaultDate : offsetNumeric( date ) ) : new Date( date.getTime() ) ) ) ); + + newDate = ( newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate ); + if ( newDate ) { + newDate.setHours( 0 ); + newDate.setMinutes( 0 ); + newDate.setSeconds( 0 ); + newDate.setMilliseconds( 0 ); + } + return this._daylightSavingAdjust( newDate ); + }, + + /* Handle switch to/from daylight saving. + * Hours may be non-zero on daylight saving cut-over: + * > 12 when midnight changeover, but then cannot generate + * midnight datetime, so jump to 1AM, otherwise reset. + * @param date (Date) the date to check + * @return (Date) the corrected date + */ + _daylightSavingAdjust: function( date ) { + if ( !date ) { + return null; + } + date.setHours( date.getHours() > 12 ? date.getHours() + 2 : 0 ); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function( inst, date, noChange ) { + var clear = !date, + origMonth = inst.selectedMonth, + origYear = inst.selectedYear, + newDate = this._restrictMinMax( inst, this._determineDate( inst, date, new Date() ) ); + + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ( ( origMonth !== inst.selectedMonth || origYear !== inst.selectedYear ) && !noChange ) { + this._notifyChange( inst ); + } + this._adjustInstDate( inst ); + if ( inst.input ) { + inst.input.val( clear ? "" : this._formatDate( inst ) ); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function( inst ) { + var startDate = ( !inst.currentYear || ( inst.input && inst.input.val() === "" ) ? null : + this._daylightSavingAdjust( new Date( + inst.currentYear, inst.currentMonth, inst.currentDay ) ) ); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function( inst ) { + var stepMonths = this._get( inst, "stepMonths" ), + id = "#" + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find( "[data-handler]" ).map( function() { + var handler = { + prev: function() { + $.datepicker._adjustDate( id, -stepMonths, "M" ); + }, + next: function() { + $.datepicker._adjustDate( id, +stepMonths, "M" ); + }, + hide: function() { + $.datepicker._hideDatepicker(); + }, + today: function() { + $.datepicker._gotoToday( id ); + }, + selectDay: function() { + $.datepicker._selectDay( id, +this.getAttribute( "data-month" ), +this.getAttribute( "data-year" ), this ); + return false; + }, + selectMonth: function() { + $.datepicker._selectMonthYear( id, this, "M" ); + return false; + }, + selectYear: function() { + $.datepicker._selectMonthYear( id, this, "Y" ); + return false; + } + }; + $( this ).on( this.getAttribute( "data-event" ), handler[ this.getAttribute( "data-handler" ) ] ); + } ); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function( inst ) { + var maxDraw, prevText, prev, nextText, next, currentText, gotoDate, + controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin, + monthNames, monthNamesShort, beforeShowDay, showOtherMonths, + selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate, + cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows, + printDate, dRow, tbody, daySettings, otherMonth, unselectable, + tempDate = new Date(), + today = this._daylightSavingAdjust( + new Date( tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate() ) ), // clear time + isRTL = this._get( inst, "isRTL" ), + showButtonPanel = this._get( inst, "showButtonPanel" ), + hideIfNoPrevNext = this._get( inst, "hideIfNoPrevNext" ), + navigationAsDateFormat = this._get( inst, "navigationAsDateFormat" ), + numMonths = this._getNumberOfMonths( inst ), + showCurrentAtPos = this._get( inst, "showCurrentAtPos" ), + stepMonths = this._get( inst, "stepMonths" ), + isMultiMonth = ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ), + currentDate = this._daylightSavingAdjust( ( !inst.currentDay ? new Date( 9999, 9, 9 ) : + new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) ), + minDate = this._getMinMaxDate( inst, "min" ), + maxDate = this._getMinMaxDate( inst, "max" ), + drawMonth = inst.drawMonth - showCurrentAtPos, + drawYear = inst.drawYear; + + if ( drawMonth < 0 ) { + drawMonth += 12; + drawYear--; + } + if ( maxDate ) { + maxDraw = this._daylightSavingAdjust( new Date( maxDate.getFullYear(), + maxDate.getMonth() - ( numMonths[ 0 ] * numMonths[ 1 ] ) + 1, maxDate.getDate() ) ); + maxDraw = ( minDate && maxDraw < minDate ? minDate : maxDraw ); + while ( this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 ) ) > maxDraw ) { + drawMonth--; + if ( drawMonth < 0 ) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + + prevText = this._get( inst, "prevText" ); + prevText = ( !navigationAsDateFormat ? prevText : this.formatDate( prevText, + this._daylightSavingAdjust( new Date( drawYear, drawMonth - stepMonths, 1 ) ), + this._getFormatConfig( inst ) ) ); + + prev = ( this._canAdjustMonth( inst, -1, drawYear, drawMonth ) ? + "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" + + " title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" : + ( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" ) ); + + nextText = this._get( inst, "nextText" ); + nextText = ( !navigationAsDateFormat ? nextText : this.formatDate( nextText, + this._daylightSavingAdjust( new Date( drawYear, drawMonth + stepMonths, 1 ) ), + this._getFormatConfig( inst ) ) ); + + next = ( this._canAdjustMonth( inst, +1, drawYear, drawMonth ) ? + "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" + + " title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" : + ( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" ) ); + + currentText = this._get( inst, "currentText" ); + gotoDate = ( this._get( inst, "gotoCurrent" ) && inst.currentDay ? currentDate : today ); + currentText = ( !navigationAsDateFormat ? currentText : + this.formatDate( currentText, gotoDate, this._getFormatConfig( inst ) ) ); + + controls = ( !inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" + + this._get( inst, "closeText" ) + "</button>" : "" ); + + buttonPanel = ( showButtonPanel ) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + ( isRTL ? controls : "" ) + + ( this._isInRange( inst, gotoDate ) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" + + ">" + currentText + "</button>" : "" ) + ( isRTL ? "" : controls ) + "</div>" : ""; + + firstDay = parseInt( this._get( inst, "firstDay" ), 10 ); + firstDay = ( isNaN( firstDay ) ? 0 : firstDay ); + + showWeek = this._get( inst, "showWeek" ); + dayNames = this._get( inst, "dayNames" ); + dayNamesMin = this._get( inst, "dayNamesMin" ); + monthNames = this._get( inst, "monthNames" ); + monthNamesShort = this._get( inst, "monthNamesShort" ); + beforeShowDay = this._get( inst, "beforeShowDay" ); + showOtherMonths = this._get( inst, "showOtherMonths" ); + selectOtherMonths = this._get( inst, "selectOtherMonths" ); + defaultDate = this._getDefaultDate( inst ); + html = ""; + + for ( row = 0; row < numMonths[ 0 ]; row++ ) { + group = ""; + this.maxRows = 4; + for ( col = 0; col < numMonths[ 1 ]; col++ ) { + selectedDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, inst.selectedDay ) ); + cornerClass = " ui-corner-all"; + calender = ""; + if ( isMultiMonth ) { + calender += "<div class='ui-datepicker-group"; + if ( numMonths[ 1 ] > 1 ) { + switch ( col ) { + case 0: calender += " ui-datepicker-group-first"; + cornerClass = " ui-corner-" + ( isRTL ? "right" : "left" ); break; + case numMonths[ 1 ] - 1: calender += " ui-datepicker-group-last"; + cornerClass = " ui-corner-" + ( isRTL ? "left" : "right" ); break; + default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break; + } + } + calender += "'>"; + } + calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" + + ( /all|left/.test( cornerClass ) && row === 0 ? ( isRTL ? next : prev ) : "" ) + + ( /all|right/.test( cornerClass ) && row === 0 ? ( isRTL ? prev : next ) : "" ) + + this._generateMonthYearHeader( inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort ) + // draw month headers + "</div><table class='ui-datepicker-calendar'><thead>" + + "<tr>"; + thead = ( showWeek ? "<th class='ui-datepicker-week-col'>" + this._get( inst, "weekHeader" ) + "</th>" : "" ); + for ( dow = 0; dow < 7; dow++ ) { // days of the week + day = ( dow + firstDay ) % 7; + thead += "<th scope='col'" + ( ( dow + firstDay + 6 ) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "" ) + ">" + + "<span title='" + dayNames[ day ] + "'>" + dayNamesMin[ day ] + "</span></th>"; + } + calender += thead + "</tr></thead><tbody>"; + daysInMonth = this._getDaysInMonth( drawYear, drawMonth ); + if ( drawYear === inst.selectedYear && drawMonth === inst.selectedMonth ) { + inst.selectedDay = Math.min( inst.selectedDay, daysInMonth ); + } + leadDays = ( this._getFirstDayOfMonth( drawYear, drawMonth ) - firstDay + 7 ) % 7; + curRows = Math.ceil( ( leadDays + daysInMonth ) / 7 ); // calculate the number of rows to generate + numRows = ( isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows ); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + printDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 - leadDays ) ); + for ( dRow = 0; dRow < numRows; dRow++ ) { // create date picker rows + calender += "<tr>"; + tbody = ( !showWeek ? "" : "<td class='ui-datepicker-week-col'>" + + this._get( inst, "calculateWeek" )( printDate ) + "</td>" ); + for ( dow = 0; dow < 7; dow++ ) { // create date picker days + daySettings = ( beforeShowDay ? + beforeShowDay.apply( ( inst.input ? inst.input[ 0 ] : null ), [ printDate ] ) : [ true, "" ] ); + otherMonth = ( printDate.getMonth() !== drawMonth ); + unselectable = ( otherMonth && !selectOtherMonths ) || !daySettings[ 0 ] || + ( minDate && printDate < minDate ) || ( maxDate && printDate > maxDate ); + tbody += "<td class='" + + ( ( dow + firstDay + 6 ) % 7 >= 5 ? " ui-datepicker-week-end" : "" ) + // highlight weekends + ( otherMonth ? " ui-datepicker-other-month" : "" ) + // highlight days from other months + ( ( printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent ) || // user pressed key + ( defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime() ) ? + + // or defaultDate is current printedDate and defaultDate is selectedDate + " " + this._dayOverClass : "" ) + // highlight selected day + ( unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "" ) + // highlight unselectable days + ( otherMonth && !showOtherMonths ? "" : " " + daySettings[ 1 ] + // highlight custom dates + ( printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "" ) + // highlight selected day + ( printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "" ) ) + "'" + // highlight today (if different) + ( ( !otherMonth || showOtherMonths ) && daySettings[ 2 ] ? " title='" + daySettings[ 2 ].replace( /'/g, "'" ) + "'" : "" ) + // cell title + ( unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'" ) + ">" + // actions + ( otherMonth && !showOtherMonths ? " " : // display for other months + ( unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" + + ( printDate.getTime() === today.getTime() ? " ui-state-highlight" : "" ) + + ( printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "" ) + // highlight selected day + ( otherMonth ? " ui-priority-secondary" : "" ) + // distinguish dates from other months + "' href='#'>" + printDate.getDate() + "</a>" ) ) + "</td>"; // display selectable date + printDate.setDate( printDate.getDate() + 1 ); + printDate = this._daylightSavingAdjust( printDate ); + } + calender += tbody + "</tr>"; + } + drawMonth++; + if ( drawMonth > 11 ) { + drawMonth = 0; + drawYear++; + } + calender += "</tbody></table>" + ( isMultiMonth ? "</div>" + + ( ( numMonths[ 0 ] > 0 && col === numMonths[ 1 ] - 1 ) ? "<div class='ui-datepicker-row-break'></div>" : "" ) : "" ); + group += calender; + } + html += group; + } + html += buttonPanel; + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function( inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort ) { + + var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear, + changeMonth = this._get( inst, "changeMonth" ), + changeYear = this._get( inst, "changeYear" ), + showMonthAfterYear = this._get( inst, "showMonthAfterYear" ), + html = "<div class='ui-datepicker-title'>", + monthHtml = ""; + + // Month selection + if ( secondary || !changeMonth ) { + monthHtml += "<span class='ui-datepicker-month'>" + monthNames[ drawMonth ] + "</span>"; + } else { + inMinYear = ( minDate && minDate.getFullYear() === drawYear ); + inMaxYear = ( maxDate && maxDate.getFullYear() === drawYear ); + monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>"; + for ( month = 0; month < 12; month++ ) { + if ( ( !inMinYear || month >= minDate.getMonth() ) && ( !inMaxYear || month <= maxDate.getMonth() ) ) { + monthHtml += "<option value='" + month + "'" + + ( month === drawMonth ? " selected='selected'" : "" ) + + ">" + monthNamesShort[ month ] + "</option>"; + } + } + monthHtml += "</select>"; + } + + if ( !showMonthAfterYear ) { + html += monthHtml + ( secondary || !( changeMonth && changeYear ) ? " " : "" ); + } + + // Year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ""; + if ( secondary || !changeYear ) { + html += "<span class='ui-datepicker-year'>" + drawYear + "</span>"; + } else { + + // determine range of years to display + years = this._get( inst, "yearRange" ).split( ":" ); + thisYear = new Date().getFullYear(); + determineYear = function( value ) { + var year = ( value.match( /c[+\-].*/ ) ? drawYear + parseInt( value.substring( 1 ), 10 ) : + ( value.match( /[+\-].*/ ) ? thisYear + parseInt( value, 10 ) : + parseInt( value, 10 ) ) ); + return ( isNaN( year ) ? thisYear : year ); + }; + year = determineYear( years[ 0 ] ); + endYear = Math.max( year, determineYear( years[ 1 ] || "" ) ); + year = ( minDate ? Math.max( year, minDate.getFullYear() ) : year ); + endYear = ( maxDate ? Math.min( endYear, maxDate.getFullYear() ) : endYear ); + inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>"; + for ( ; year <= endYear; year++ ) { + inst.yearshtml += "<option value='" + year + "'" + + ( year === drawYear ? " selected='selected'" : "" ) + + ">" + year + "</option>"; + } + inst.yearshtml += "</select>"; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + + html += this._get( inst, "yearSuffix" ); + if ( showMonthAfterYear ) { + html += ( secondary || !( changeMonth && changeYear ) ? " " : "" ) + monthHtml; + } + html += "</div>"; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function( inst, offset, period ) { + var year = inst.selectedYear + ( period === "Y" ? offset : 0 ), + month = inst.selectedMonth + ( period === "M" ? offset : 0 ), + day = Math.min( inst.selectedDay, this._getDaysInMonth( year, month ) ) + ( period === "D" ? offset : 0 ), + date = this._restrictMinMax( inst, this._daylightSavingAdjust( new Date( year, month, day ) ) ); + + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if ( period === "M" || period === "Y" ) { + this._notifyChange( inst ); + } + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function( inst, date ) { + var minDate = this._getMinMaxDate( inst, "min" ), + maxDate = this._getMinMaxDate( inst, "max" ), + newDate = ( minDate && date < minDate ? minDate : date ); + return ( maxDate && newDate > maxDate ? maxDate : newDate ); + }, + + /* Notify change of month/year. */ + _notifyChange: function( inst ) { + var onChange = this._get( inst, "onChangeMonthYear" ); + if ( onChange ) { + onChange.apply( ( inst.input ? inst.input[ 0 ] : null ), + [ inst.selectedYear, inst.selectedMonth + 1, inst ] ); + } + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function( inst ) { + var numMonths = this._get( inst, "numberOfMonths" ); + return ( numMonths == null ? [ 1, 1 ] : ( typeof numMonths === "number" ? [ 1, numMonths ] : numMonths ) ); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function( inst, minMax ) { + return this._determineDate( inst, this._get( inst, minMax + "Date" ), null ); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function( year, month ) { + return 32 - this._daylightSavingAdjust( new Date( year, month, 32 ) ).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function( year, month ) { + return new Date( year, month, 1 ).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function( inst, offset, curYear, curMonth ) { + var numMonths = this._getNumberOfMonths( inst ), + date = this._daylightSavingAdjust( new Date( curYear, + curMonth + ( offset < 0 ? offset : numMonths[ 0 ] * numMonths[ 1 ] ), 1 ) ); + + if ( offset < 0 ) { + date.setDate( this._getDaysInMonth( date.getFullYear(), date.getMonth() ) ); + } + return this._isInRange( inst, date ); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function( inst, date ) { + var yearSplit, currentYear, + minDate = this._getMinMaxDate( inst, "min" ), + maxDate = this._getMinMaxDate( inst, "max" ), + minYear = null, + maxYear = null, + years = this._get( inst, "yearRange" ); + if ( years ) { + yearSplit = years.split( ":" ); + currentYear = new Date().getFullYear(); + minYear = parseInt( yearSplit[ 0 ], 10 ); + maxYear = parseInt( yearSplit[ 1 ], 10 ); + if ( yearSplit[ 0 ].match( /[+\-].*/ ) ) { + minYear += currentYear; + } + if ( yearSplit[ 1 ].match( /[+\-].*/ ) ) { + maxYear += currentYear; + } + } + + return ( ( !minDate || date.getTime() >= minDate.getTime() ) && + ( !maxDate || date.getTime() <= maxDate.getTime() ) && + ( !minYear || date.getFullYear() >= minYear ) && + ( !maxYear || date.getFullYear() <= maxYear ) ); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function( inst ) { + var shortYearCutoff = this._get( inst, "shortYearCutoff" ); + shortYearCutoff = ( typeof shortYearCutoff !== "string" ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt( shortYearCutoff, 10 ) ); + return { shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get( inst, "dayNamesShort" ), dayNames: this._get( inst, "dayNames" ), + monthNamesShort: this._get( inst, "monthNamesShort" ), monthNames: this._get( inst, "monthNames" ) }; + }, + + /* Format the given date for display. */ + _formatDate: function( inst, day, month, year ) { + if ( !day ) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = ( day ? ( typeof day === "object" ? day : + this._daylightSavingAdjust( new Date( year, month, day ) ) ) : + this._daylightSavingAdjust( new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) ); + return this.formatDate( this._get( inst, "dateFormat" ), date, this._getFormatConfig( inst ) ); + } +} ); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function datepicker_bindHover( dpDiv ) { + var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a"; + return dpDiv.on( "mouseout", selector, function() { + $( this ).removeClass( "ui-state-hover" ); + if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) { + $( this ).removeClass( "ui-datepicker-prev-hover" ); + } + if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) { + $( this ).removeClass( "ui-datepicker-next-hover" ); + } + } ) + .on( "mouseover", selector, datepicker_handleMouseover ); +} + +function datepicker_handleMouseover() { + if ( !$.datepicker._isDisabledDatepicker( datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[ 0 ] : datepicker_instActive.input[ 0 ] ) ) { + $( this ).parents( ".ui-datepicker-calendar" ).find( "a" ).removeClass( "ui-state-hover" ); + $( this ).addClass( "ui-state-hover" ); + if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) { + $( this ).addClass( "ui-datepicker-prev-hover" ); + } + if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) { + $( this ).addClass( "ui-datepicker-next-hover" ); + } + } +} + +/* jQuery extend now ignores nulls! */ +function datepicker_extendRemove( target, props ) { + $.extend( target, props ); + for ( var name in props ) { + if ( props[ name ] == null ) { + target[ name ] = props[ name ]; + } + } + return target; +} + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function( options ) { + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if ( !$.datepicker.initialized ) { + $( document ).on( "mousedown", $.datepicker._checkExternalClick ); + $.datepicker.initialized = true; + } + + /* Append datepicker main container to body if not exist. */ + if ( $( "#" + $.datepicker._mainDivId ).length === 0 ) { + $( "body" ).append( $.datepicker.dpDiv ); + } + + var otherArgs = Array.prototype.slice.call( arguments, 1 ); + if ( typeof options === "string" && ( options === "isDisabled" || options === "getDate" || options === "widget" ) ) { + return $.datepicker[ "_" + options + "Datepicker" ]. + apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) ); + } + if ( options === "option" && arguments.length === 2 && typeof arguments[ 1 ] === "string" ) { + return $.datepicker[ "_" + options + "Datepicker" ]. + apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) ); + } + return this.each( function() { + typeof options === "string" ? + $.datepicker[ "_" + options + "Datepicker" ]. + apply( $.datepicker, [ this ].concat( otherArgs ) ) : + $.datepicker._attachDatepicker( this, options ); + } ); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.12.1"; + +var widgetsDatepicker = $.datepicker; + + +/*! + * jQuery UI Dialog 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= -0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ -e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); -;/* - * jQuery UI Effects Fade 1.8.14 + +//>>label: Dialog +//>>group: Widgets +//>>description: Displays customizable dialog windows. +//>>docs: http://api.jqueryui.com/dialog/ +//>>demos: http://jqueryui.com/dialog/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/dialog.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.dialog", { + version: "1.12.1", + options: { + appendTo: "body", + autoOpen: true, + buttons: [], + classes: { + "ui-dialog": "ui-corner-all", + "ui-dialog-titlebar": "ui-corner-all" + }, + closeOnEscape: true, + closeText: "Close", + draggable: true, + hide: null, + height: "auto", + maxHeight: null, + maxWidth: null, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: "center", + at: "center", + of: window, + collision: "fit", + + // Ensure the titlebar is always visible + using: function( pos ) { + var topOffset = $( this ).css( pos ).offset().top; + if ( topOffset < 0 ) { + $( this ).css( "top", pos.top - topOffset ); + } + } + }, + resizable: true, + show: null, + title: null, + width: 300, + + // Callbacks + beforeClose: null, + close: null, + drag: null, + dragStart: null, + dragStop: null, + focus: null, + open: null, + resize: null, + resizeStart: null, + resizeStop: null + }, + + sizeRelatedOptions: { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + + resizableRelatedOptions: { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + + _create: function() { + this.originalCss = { + display: this.element[ 0 ].style.display, + width: this.element[ 0 ].style.width, + minHeight: this.element[ 0 ].style.minHeight, + maxHeight: this.element[ 0 ].style.maxHeight, + height: this.element[ 0 ].style.height + }; + this.originalPosition = { + parent: this.element.parent(), + index: this.element.parent().children().index( this.element ) + }; + this.originalTitle = this.element.attr( "title" ); + if ( this.options.title == null && this.originalTitle != null ) { + this.options.title = this.originalTitle; + } + + // Dialogs can't be disabled + if ( this.options.disabled ) { + this.options.disabled = false; + } + + this._createWrapper(); + + this.element + .show() + .removeAttr( "title" ) + .appendTo( this.uiDialog ); + + this._addClass( "ui-dialog-content", "ui-widget-content" ); + + this._createTitlebar(); + this._createButtonPane(); + + if ( this.options.draggable && $.fn.draggable ) { + this._makeDraggable(); + } + if ( this.options.resizable && $.fn.resizable ) { + this._makeResizable(); + } + + this._isOpen = false; + + this._trackFocus(); + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + if ( element && ( element.jquery || element.nodeType ) ) { + return $( element ); + } + return this.document.find( element || "body" ).eq( 0 ); + }, + + _destroy: function() { + var next, + originalPosition = this.originalPosition; + + this._untrackInstance(); + this._destroyOverlay(); + + this.element + .removeUniqueId() + .css( this.originalCss ) + + // Without detaching first, the following becomes really slow + .detach(); + + this.uiDialog.remove(); + + if ( this.originalTitle ) { + this.element.attr( "title", this.originalTitle ); + } + + next = originalPosition.parent.children().eq( originalPosition.index ); + + // Don't try to place the dialog next to itself (#8613) + if ( next.length && next[ 0 ] !== this.element[ 0 ] ) { + next.before( this.element ); + } else { + originalPosition.parent.append( this.element ); + } + }, + + widget: function() { + return this.uiDialog; + }, + + disable: $.noop, + enable: $.noop, + + close: function( event ) { + var that = this; + + if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) { + return; + } + + this._isOpen = false; + this._focusedElement = null; + this._destroyOverlay(); + this._untrackInstance(); + + if ( !this.opener.filter( ":focusable" ).trigger( "focus" ).length ) { + + // Hiding a focused element doesn't trigger blur in WebKit + // so in case we have nothing to focus on, explicitly blur the active element + // https://bugs.webkit.org/show_bug.cgi?id=47182 + $.ui.safeBlur( $.ui.safeActiveElement( this.document[ 0 ] ) ); + } + + this._hide( this.uiDialog, this.options.hide, function() { + that._trigger( "close", event ); + } ); + }, + + isOpen: function() { + return this._isOpen; + }, + + moveToTop: function() { + this._moveToTop(); + }, + + _moveToTop: function( event, silent ) { + var moved = false, + zIndices = this.uiDialog.siblings( ".ui-front:visible" ).map( function() { + return +$( this ).css( "z-index" ); + } ).get(), + zIndexMax = Math.max.apply( null, zIndices ); + + if ( zIndexMax >= +this.uiDialog.css( "z-index" ) ) { + this.uiDialog.css( "z-index", zIndexMax + 1 ); + moved = true; + } + + if ( moved && !silent ) { + this._trigger( "focus", event ); + } + return moved; + }, + + open: function() { + var that = this; + if ( this._isOpen ) { + if ( this._moveToTop() ) { + this._focusTabbable(); + } + return; + } + + this._isOpen = true; + this.opener = $( $.ui.safeActiveElement( this.document[ 0 ] ) ); + + this._size(); + this._position(); + this._createOverlay(); + this._moveToTop( null, true ); + + // Ensure the overlay is moved to the top with the dialog, but only when + // opening. The overlay shouldn't move after the dialog is open so that + // modeless dialogs opened after the modal dialog stack properly. + if ( this.overlay ) { + this.overlay.css( "z-index", this.uiDialog.css( "z-index" ) - 1 ); + } + + this._show( this.uiDialog, this.options.show, function() { + that._focusTabbable(); + that._trigger( "focus" ); + } ); + + // Track the dialog immediately upon openening in case a focus event + // somehow occurs outside of the dialog before an element inside the + // dialog is focused (#10152) + this._makeFocusTarget(); + + this._trigger( "open" ); + }, + + _focusTabbable: function() { + + // Set focus to the first match: + // 1. An element that was focused previously + // 2. First element inside the dialog matching [autofocus] + // 3. Tabbable element inside the content element + // 4. Tabbable element inside the buttonpane + // 5. The close button + // 6. The dialog itself + var hasFocus = this._focusedElement; + if ( !hasFocus ) { + hasFocus = this.element.find( "[autofocus]" ); + } + if ( !hasFocus.length ) { + hasFocus = this.element.find( ":tabbable" ); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialogButtonPane.find( ":tabbable" ); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialogTitlebarClose.filter( ":tabbable" ); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialog; + } + hasFocus.eq( 0 ).trigger( "focus" ); + }, + + _keepFocus: function( event ) { + function checkFocus() { + var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ), + isActive = this.uiDialog[ 0 ] === activeElement || + $.contains( this.uiDialog[ 0 ], activeElement ); + if ( !isActive ) { + this._focusTabbable(); + } + } + event.preventDefault(); + checkFocus.call( this ); + + // support: IE + // IE <= 8 doesn't prevent moving focus even with event.preventDefault() + // so we check again later + this._delay( checkFocus ); + }, + + _createWrapper: function() { + this.uiDialog = $( "<div>" ) + .hide() + .attr( { + + // Setting tabIndex makes the div focusable + tabIndex: -1, + role: "dialog" + } ) + .appendTo( this._appendTo() ); + + this._addClass( this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front" ); + this._on( this.uiDialog, { + keydown: function( event ) { + if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + event.preventDefault(); + this.close( event ); + return; + } + + // Prevent tabbing out of dialogs + if ( event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented() ) { + return; + } + var tabbables = this.uiDialog.find( ":tabbable" ), + first = tabbables.filter( ":first" ), + last = tabbables.filter( ":last" ); + + if ( ( event.target === last[ 0 ] || event.target === this.uiDialog[ 0 ] ) && + !event.shiftKey ) { + this._delay( function() { + first.trigger( "focus" ); + } ); + event.preventDefault(); + } else if ( ( event.target === first[ 0 ] || + event.target === this.uiDialog[ 0 ] ) && event.shiftKey ) { + this._delay( function() { + last.trigger( "focus" ); + } ); + event.preventDefault(); + } + }, + mousedown: function( event ) { + if ( this._moveToTop( event ) ) { + this._focusTabbable(); + } + } + } ); + + // We assume that any existing aria-describedby attribute means + // that the dialog content is marked up properly + // otherwise we brute force the content as the description + if ( !this.element.find( "[aria-describedby]" ).length ) { + this.uiDialog.attr( { + "aria-describedby": this.element.uniqueId().attr( "id" ) + } ); + } + }, + + _createTitlebar: function() { + var uiDialogTitle; + + this.uiDialogTitlebar = $( "<div>" ); + this._addClass( this.uiDialogTitlebar, + "ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix" ); + this._on( this.uiDialogTitlebar, { + mousedown: function( event ) { + + // Don't prevent click on close button (#8838) + // Focusing a dialog that is partially scrolled out of view + // causes the browser to scroll it into view, preventing the click event + if ( !$( event.target ).closest( ".ui-dialog-titlebar-close" ) ) { + + // Dialog isn't getting focus when dragging (#8063) + this.uiDialog.trigger( "focus" ); + } + } + } ); + + // Support: IE + // Use type="button" to prevent enter keypresses in textboxes from closing the + // dialog in IE (#9312) + this.uiDialogTitlebarClose = $( "<button type='button'></button>" ) + .button( { + label: $( "<a>" ).text( this.options.closeText ).html(), + icon: "ui-icon-closethick", + showLabel: false + } ) + .appendTo( this.uiDialogTitlebar ); + + this._addClass( this.uiDialogTitlebarClose, "ui-dialog-titlebar-close" ); + this._on( this.uiDialogTitlebarClose, { + click: function( event ) { + event.preventDefault(); + this.close( event ); + } + } ); + + uiDialogTitle = $( "<span>" ).uniqueId().prependTo( this.uiDialogTitlebar ); + this._addClass( uiDialogTitle, "ui-dialog-title" ); + this._title( uiDialogTitle ); + + this.uiDialogTitlebar.prependTo( this.uiDialog ); + + this.uiDialog.attr( { + "aria-labelledby": uiDialogTitle.attr( "id" ) + } ); + }, + + _title: function( title ) { + if ( this.options.title ) { + title.text( this.options.title ); + } else { + title.html( " " ); + } + }, + + _createButtonPane: function() { + this.uiDialogButtonPane = $( "<div>" ); + this._addClass( this.uiDialogButtonPane, "ui-dialog-buttonpane", + "ui-widget-content ui-helper-clearfix" ); + + this.uiButtonSet = $( "<div>" ) + .appendTo( this.uiDialogButtonPane ); + this._addClass( this.uiButtonSet, "ui-dialog-buttonset" ); + + this._createButtons(); + }, + + _createButtons: function() { + var that = this, + buttons = this.options.buttons; + + // If we already have a button pane, remove it + this.uiDialogButtonPane.remove(); + this.uiButtonSet.empty(); + + if ( $.isEmptyObject( buttons ) || ( $.isArray( buttons ) && !buttons.length ) ) { + this._removeClass( this.uiDialog, "ui-dialog-buttons" ); + return; + } + + $.each( buttons, function( name, props ) { + var click, buttonOptions; + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + + // Default to a non-submitting button + props = $.extend( { type: "button" }, props ); + + // Change the context for the click callback to be the main element + click = props.click; + buttonOptions = { + icon: props.icon, + iconPosition: props.iconPosition, + showLabel: props.showLabel, + + // Deprecated options + icons: props.icons, + text: props.text + }; + + delete props.click; + delete props.icon; + delete props.iconPosition; + delete props.showLabel; + + // Deprecated options + delete props.icons; + if ( typeof props.text === "boolean" ) { + delete props.text; + } + + $( "<button></button>", props ) + .button( buttonOptions ) + .appendTo( that.uiButtonSet ) + .on( "click", function() { + click.apply( that.element[ 0 ], arguments ); + } ); + } ); + this._addClass( this.uiDialog, "ui-dialog-buttons" ); + this.uiDialogButtonPane.appendTo( this.uiDialog ); + }, + + _makeDraggable: function() { + var that = this, + options = this.options; + + function filteredUi( ui ) { + return { + position: ui.position, + offset: ui.offset + }; + } + + this.uiDialog.draggable( { + cancel: ".ui-dialog-content, .ui-dialog-titlebar-close", + handle: ".ui-dialog-titlebar", + containment: "document", + start: function( event, ui ) { + that._addClass( $( this ), "ui-dialog-dragging" ); + that._blockFrames(); + that._trigger( "dragStart", event, filteredUi( ui ) ); + }, + drag: function( event, ui ) { + that._trigger( "drag", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + var left = ui.offset.left - that.document.scrollLeft(), + top = ui.offset.top - that.document.scrollTop(); + + options.position = { + my: "left top", + at: "left" + ( left >= 0 ? "+" : "" ) + left + " " + + "top" + ( top >= 0 ? "+" : "" ) + top, + of: that.window + }; + that._removeClass( $( this ), "ui-dialog-dragging" ); + that._unblockFrames(); + that._trigger( "dragStop", event, filteredUi( ui ) ); + } + } ); + }, + + _makeResizable: function() { + var that = this, + options = this.options, + handles = options.resizable, + + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = this.uiDialog.css( "position" ), + resizeHandles = typeof handles === "string" ? + handles : + "n,e,s,w,se,sw,ne,nw"; + + function filteredUi( ui ) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + this.uiDialog.resizable( { + cancel: ".ui-dialog-content", + containment: "document", + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: this._minHeight(), + handles: resizeHandles, + start: function( event, ui ) { + that._addClass( $( this ), "ui-dialog-resizing" ); + that._blockFrames(); + that._trigger( "resizeStart", event, filteredUi( ui ) ); + }, + resize: function( event, ui ) { + that._trigger( "resize", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + var offset = that.uiDialog.offset(), + left = offset.left - that.document.scrollLeft(), + top = offset.top - that.document.scrollTop(); + + options.height = that.uiDialog.height(); + options.width = that.uiDialog.width(); + options.position = { + my: "left top", + at: "left" + ( left >= 0 ? "+" : "" ) + left + " " + + "top" + ( top >= 0 ? "+" : "" ) + top, + of: that.window + }; + that._removeClass( $( this ), "ui-dialog-resizing" ); + that._unblockFrames(); + that._trigger( "resizeStop", event, filteredUi( ui ) ); + } + } ) + .css( "position", position ); + }, + + _trackFocus: function() { + this._on( this.widget(), { + focusin: function( event ) { + this._makeFocusTarget(); + this._focusedElement = $( event.target ); + } + } ); + }, + + _makeFocusTarget: function() { + this._untrackInstance(); + this._trackingInstances().unshift( this ); + }, + + _untrackInstance: function() { + var instances = this._trackingInstances(), + exists = $.inArray( this, instances ); + if ( exists !== -1 ) { + instances.splice( exists, 1 ); + } + }, + + _trackingInstances: function() { + var instances = this.document.data( "ui-dialog-instances" ); + if ( !instances ) { + instances = []; + this.document.data( "ui-dialog-instances", instances ); + } + return instances; + }, + + _minHeight: function() { + var options = this.options; + + return options.height === "auto" ? + options.minHeight : + Math.min( options.minHeight, options.height ); + }, + + _position: function() { + + // Need to show the dialog to get the actual offset in the position plugin + var isVisible = this.uiDialog.is( ":visible" ); + if ( !isVisible ) { + this.uiDialog.show(); + } + this.uiDialog.position( this.options.position ); + if ( !isVisible ) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var that = this, + resize = false, + resizableOptions = {}; + + $.each( options, function( key, value ) { + that._setOption( key, value ); + + if ( key in that.sizeRelatedOptions ) { + resize = true; + } + if ( key in that.resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + } ); + + if ( resize ) { + this._size(); + this._position(); + } + if ( this.uiDialog.is( ":data(ui-resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function( key, value ) { + var isDraggable, isResizable, + uiDialog = this.uiDialog; + + if ( key === "disabled" ) { + return; + } + + this._super( key, value ); + + if ( key === "appendTo" ) { + this.uiDialog.appendTo( this._appendTo() ); + } + + if ( key === "buttons" ) { + this._createButtons(); + } + + if ( key === "closeText" ) { + this.uiDialogTitlebarClose.button( { + + // Ensure that we always pass a string + label: $( "<a>" ).text( "" + this.options.closeText ).html() + } ); + } + + if ( key === "draggable" ) { + isDraggable = uiDialog.is( ":data(ui-draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + this._makeDraggable(); + } + } + + if ( key === "position" ) { + this._position(); + } + + if ( key === "resizable" ) { + + // currently resizable, becoming non-resizable + isResizable = uiDialog.is( ":data(ui-resizable)" ); + if ( isResizable && !value ) { + uiDialog.resizable( "destroy" ); + } + + // Currently resizable, changing handles + if ( isResizable && typeof value === "string" ) { + uiDialog.resizable( "option", "handles", value ); + } + + // Currently non-resizable, becoming resizable + if ( !isResizable && value !== false ) { + this._makeResizable(); + } + } + + if ( key === "title" ) { + this._title( this.uiDialogTitlebar.find( ".ui-dialog-title" ) ); + } + }, + + _size: function() { + + // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + // divs will both have width and height set, so we need to reset them + var nonContentHeight, minContentHeight, maxContentHeight, + options = this.options; + + // Reset content sizing + this.element.show().css( { + width: "auto", + minHeight: 0, + maxHeight: "none", + height: 0 + } ); + + if ( options.minWidth > options.width ) { + options.width = options.minWidth; + } + + // Reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css( { + height: "auto", + width: options.width + } ) + .outerHeight(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + maxContentHeight = typeof options.maxHeight === "number" ? + Math.max( 0, options.maxHeight - nonContentHeight ) : + "none"; + + if ( options.height === "auto" ) { + this.element.css( { + minHeight: minContentHeight, + maxHeight: maxContentHeight, + height: "auto" + } ); + } else { + this.element.height( Math.max( 0, options.height - nonContentHeight ) ); + } + + if ( this.uiDialog.is( ":data(ui-resizable)" ) ) { + this.uiDialog.resizable( "option", "minHeight", this._minHeight() ); + } + }, + + _blockFrames: function() { + this.iframeBlocks = this.document.find( "iframe" ).map( function() { + var iframe = $( this ); + + return $( "<div>" ) + .css( { + position: "absolute", + width: iframe.outerWidth(), + height: iframe.outerHeight() + } ) + .appendTo( iframe.parent() ) + .offset( iframe.offset() )[ 0 ]; + } ); + }, + + _unblockFrames: function() { + if ( this.iframeBlocks ) { + this.iframeBlocks.remove(); + delete this.iframeBlocks; + } + }, + + _allowInteraction: function( event ) { + if ( $( event.target ).closest( ".ui-dialog" ).length ) { + return true; + } + + // TODO: Remove hack when datepicker implements + // the .ui-front logic (#8989) + return !!$( event.target ).closest( ".ui-datepicker" ).length; + }, + + _createOverlay: function() { + if ( !this.options.modal ) { + return; + } + + // We use a delay in case the overlay is created from an + // event that we're going to be cancelling (#2804) + var isOpening = true; + this._delay( function() { + isOpening = false; + } ); + + if ( !this.document.data( "ui-dialog-overlays" ) ) { + + // Prevent use of anchors and inputs + // Using _on() for an event handler shared across many instances is + // safe because the dialogs stack and must be closed in reverse order + this._on( this.document, { + focusin: function( event ) { + if ( isOpening ) { + return; + } + + if ( !this._allowInteraction( event ) ) { + event.preventDefault(); + this._trackingInstances()[ 0 ]._focusTabbable(); + } + } + } ); + } + + this.overlay = $( "<div>" ) + .appendTo( this._appendTo() ); + + this._addClass( this.overlay, null, "ui-widget-overlay ui-front" ); + this._on( this.overlay, { + mousedown: "_keepFocus" + } ); + this.document.data( "ui-dialog-overlays", + ( this.document.data( "ui-dialog-overlays" ) || 0 ) + 1 ); + }, + + _destroyOverlay: function() { + if ( !this.options.modal ) { + return; + } + + if ( this.overlay ) { + var overlays = this.document.data( "ui-dialog-overlays" ) - 1; + + if ( !overlays ) { + this._off( this.document, "focusin" ); + this.document.removeData( "ui-dialog-overlays" ); + } else { + this.document.data( "ui-dialog-overlays", overlays ); + } + + this.overlay.remove(); + this.overlay = null; + } + } +} ); + +// DEPRECATED +// TODO: switch return back to widget declaration at top of file when this is removed +if ( $.uiBackCompat !== false ) { + + // Backcompat for dialogClass option + $.widget( "ui.dialog", $.ui.dialog, { + options: { + dialogClass: "" + }, + _createWrapper: function() { + this._super(); + this.uiDialog.addClass( this.options.dialogClass ); + }, + _setOption: function( key, value ) { + if ( key === "dialogClass" ) { + this.uiDialog + .removeClass( this.options.dialogClass ) + .addClass( value ); + } + this._superApply( arguments ); + } + } ); +} + +var widgetsDialog = $.ui.dialog; + + +/*! + * jQuery UI Progressbar 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Progressbar +//>>group: Widgets +// jscs:disable maximumLineLength +//>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators. +// jscs:enable maximumLineLength +//>>docs: http://api.jqueryui.com/progressbar/ +//>>demos: http://jqueryui.com/progressbar/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/progressbar.css +//>>css.theme: ../../themes/base/theme.css + + + +var widgetsProgressbar = $.widget( "ui.progressbar", { + version: "1.12.1", + options: { + classes: { + "ui-progressbar": "ui-corner-all", + "ui-progressbar-value": "ui-corner-left", + "ui-progressbar-complete": "ui-corner-right" + }, + max: 100, + value: 0, + + change: null, + complete: null + }, + + min: 0, + + _create: function() { + + // Constrain initial value + this.oldValue = this.options.value = this._constrainedValue(); + + this.element.attr( { + + // Only set static values; aria-valuenow and aria-valuemax are + // set inside _refreshValue() + role: "progressbar", + "aria-valuemin": this.min + } ); + this._addClass( "ui-progressbar", "ui-widget ui-widget-content" ); + + this.valueDiv = $( "<div>" ).appendTo( this.element ); + this._addClass( this.valueDiv, "ui-progressbar-value", "ui-widget-header" ); + this._refreshValue(); + }, + + _destroy: function() { + this.element.removeAttr( "role aria-valuemin aria-valuemax aria-valuenow" ); + + this.valueDiv.remove(); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this.options.value; + } + + this.options.value = this._constrainedValue( newValue ); + this._refreshValue(); + }, + + _constrainedValue: function( newValue ) { + if ( newValue === undefined ) { + newValue = this.options.value; + } + + this.indeterminate = newValue === false; + + // Sanitize value + if ( typeof newValue !== "number" ) { + newValue = 0; + } + + return this.indeterminate ? false : + Math.min( this.options.max, Math.max( this.min, newValue ) ); + }, + + _setOptions: function( options ) { + + // Ensure "value" option is set after other values (like max) + var value = options.value; + delete options.value; + + this._super( options ); + + this.options.value = this._constrainedValue( value ); + this._refreshValue(); + }, + + _setOption: function( key, value ) { + if ( key === "max" ) { + + // Don't allow a max less than min + value = Math.max( this.min, value ); + } + this._super( key, value ); + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this.element.attr( "aria-disabled", value ); + this._toggleClass( null, "ui-state-disabled", !!value ); + }, + + _percentage: function() { + return this.indeterminate ? + 100 : + 100 * ( this.options.value - this.min ) / ( this.options.max - this.min ); + }, + + _refreshValue: function() { + var value = this.options.value, + percentage = this._percentage(); + + this.valueDiv + .toggle( this.indeterminate || value > this.min ) + .width( percentage.toFixed( 0 ) + "%" ); + + this + ._toggleClass( this.valueDiv, "ui-progressbar-complete", null, + value === this.options.max ) + ._toggleClass( "ui-progressbar-indeterminate", null, this.indeterminate ); + + if ( this.indeterminate ) { + this.element.removeAttr( "aria-valuenow" ); + if ( !this.overlayDiv ) { + this.overlayDiv = $( "<div>" ).appendTo( this.valueDiv ); + this._addClass( this.overlayDiv, "ui-progressbar-overlay" ); + } + } else { + this.element.attr( { + "aria-valuemax": this.options.max, + "aria-valuenow": value + } ); + if ( this.overlayDiv ) { + this.overlayDiv.remove(); + this.overlayDiv = null; + } + } + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + if ( value === this.options.max ) { + this._trigger( "complete" ); + } + } +} ); + + +/*! + * jQuery UI Selectmenu 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Fade + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Selectmenu +//>>group: Widgets +// jscs:disable maximumLineLength +//>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select. +// jscs:enable maximumLineLength +//>>docs: http://api.jqueryui.com/selectmenu/ +//>>demos: http://jqueryui.com/selectmenu/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css +//>>css.theme: ../../themes/base/theme.css + + + +var widgetsSelectmenu = $.widget( "ui.selectmenu", [ $.ui.formResetMixin, { + version: "1.12.1", + defaultElement: "<select>", + options: { + appendTo: null, + classes: { + "ui-selectmenu-button-open": "ui-corner-top", + "ui-selectmenu-button-closed": "ui-corner-all" + }, + disabled: null, + icons: { + button: "ui-icon-triangle-1-s" + }, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + width: false, + + // Callbacks + change: null, + close: null, + focus: null, + open: null, + select: null + }, + + _create: function() { + var selectmenuId = this.element.uniqueId().attr( "id" ); + this.ids = { + element: selectmenuId, + button: selectmenuId + "-button", + menu: selectmenuId + "-menu" + }; + + this._drawButton(); + this._drawMenu(); + this._bindFormResetHandler(); + + this._rendered = false; + this.menuItems = $(); + }, + + _drawButton: function() { + var icon, + that = this, + item = this._parseOption( + this.element.find( "option:selected" ), + this.element[ 0 ].selectedIndex + ); + + // Associate existing label with the new button + this.labels = this.element.labels().attr( "for", this.ids.button ); + this._on( this.labels, { + click: function( event ) { + this.button.focus(); + event.preventDefault(); + } + } ); + + // Hide original select element + this.element.hide(); + + // Create button + this.button = $( "<span>", { + tabindex: this.options.disabled ? -1 : 0, + id: this.ids.button, + role: "combobox", + "aria-expanded": "false", + "aria-autocomplete": "list", + "aria-owns": this.ids.menu, + "aria-haspopup": "true", + title: this.element.attr( "title" ) + } ) + .insertAfter( this.element ); + + this._addClass( this.button, "ui-selectmenu-button ui-selectmenu-button-closed", + "ui-button ui-widget" ); + + icon = $( "<span>" ).appendTo( this.button ); + this._addClass( icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons.button ); + this.buttonItem = this._renderButtonItem( item ) + .appendTo( this.button ); + + if ( this.options.width !== false ) { + this._resizeButton(); + } + + this._on( this.button, this._buttonEvents ); + this.button.one( "focusin", function() { + + // Delay rendering the menu items until the button receives focus. + // The menu may have already been rendered via a programmatic open. + if ( !that._rendered ) { + that._refreshMenu(); + } + } ); + }, + + _drawMenu: function() { + var that = this; + + // Create menu + this.menu = $( "<ul>", { + "aria-hidden": "true", + "aria-labelledby": this.ids.button, + id: this.ids.menu + } ); + + // Wrap menu + this.menuWrap = $( "<div>" ).append( this.menu ); + this._addClass( this.menuWrap, "ui-selectmenu-menu", "ui-front" ); + this.menuWrap.appendTo( this._appendTo() ); + + // Initialize menu widget + this.menuInstance = this.menu + .menu( { + classes: { + "ui-menu": "ui-corner-bottom" + }, + role: "listbox", + select: function( event, ui ) { + event.preventDefault(); + + // Support: IE8 + // If the item was selected via a click, the text selection + // will be destroyed in IE + that._setSelection(); + + that._select( ui.item.data( "ui-selectmenu-item" ), event ); + }, + focus: function( event, ui ) { + var item = ui.item.data( "ui-selectmenu-item" ); + + // Prevent inital focus from firing and check if its a newly focused item + if ( that.focusIndex != null && item.index !== that.focusIndex ) { + that._trigger( "focus", event, { item: item } ); + if ( !that.isOpen ) { + that._select( item, event ); + } + } + that.focusIndex = item.index; + + that.button.attr( "aria-activedescendant", + that.menuItems.eq( item.index ).attr( "id" ) ); + } + } ) + .menu( "instance" ); + + // Don't close the menu on mouseleave + this.menuInstance._off( this.menu, "mouseleave" ); + + // Cancel the menu's collapseAll on document click + this.menuInstance._closeOnDocumentClick = function() { + return false; + }; + + // Selects often contain empty items, but never contain dividers + this.menuInstance._isDivider = function() { + return false; + }; + }, + + refresh: function() { + this._refreshMenu(); + this.buttonItem.replaceWith( + this.buttonItem = this._renderButtonItem( + + // Fall back to an empty object in case there are no options + this._getSelectedItem().data( "ui-selectmenu-item" ) || {} + ) + ); + if ( this.options.width === null ) { + this._resizeButton(); + } + }, + + _refreshMenu: function() { + var item, + options = this.element.find( "option" ); + + this.menu.empty(); + + this._parseOptions( options ); + this._renderMenu( this.menu, this.items ); + + this.menuInstance.refresh(); + this.menuItems = this.menu.find( "li" ) + .not( ".ui-selectmenu-optgroup" ) + .find( ".ui-menu-item-wrapper" ); + + this._rendered = true; + + if ( !options.length ) { + return; + } + + item = this._getSelectedItem(); + + // Update the menu to have the correct item focused + this.menuInstance.focus( null, item ); + this._setAria( item.data( "ui-selectmenu-item" ) ); + + // Set disabled state + this._setOption( "disabled", this.element.prop( "disabled" ) ); + }, + + open: function( event ) { + if ( this.options.disabled ) { + return; + } + + // If this is the first time the menu is being opened, render the items + if ( !this._rendered ) { + this._refreshMenu(); + } else { + + // Menu clears focus on close, reset focus to selected item + this._removeClass( this.menu.find( ".ui-state-active" ), null, "ui-state-active" ); + this.menuInstance.focus( null, this._getSelectedItem() ); + } + + // If there are no options, don't open the menu + if ( !this.menuItems.length ) { + return; + } + + this.isOpen = true; + this._toggleAttr(); + this._resizeMenu(); + this._position(); + + this._on( this.document, this._documentClick ); + + this._trigger( "open", event ); + }, + + _position: function() { + this.menuWrap.position( $.extend( { of: this.button }, this.options.position ) ); + }, + + close: function( event ) { + if ( !this.isOpen ) { + return; + } + + this.isOpen = false; + this._toggleAttr(); + + this.range = null; + this._off( this.document ); + + this._trigger( "close", event ); + }, + + widget: function() { + return this.button; + }, + + menuWidget: function() { + return this.menu; + }, + + _renderButtonItem: function( item ) { + var buttonItem = $( "<span>" ); + + this._setText( buttonItem, item.label ); + this._addClass( buttonItem, "ui-selectmenu-text" ); + + return buttonItem; + }, + + _renderMenu: function( ul, items ) { + var that = this, + currentOptgroup = ""; + + $.each( items, function( index, item ) { + var li; + + if ( item.optgroup !== currentOptgroup ) { + li = $( "<li>", { + text: item.optgroup + } ); + that._addClass( li, "ui-selectmenu-optgroup", "ui-menu-divider" + + ( item.element.parent( "optgroup" ).prop( "disabled" ) ? + " ui-state-disabled" : + "" ) ); + + li.appendTo( ul ); + + currentOptgroup = item.optgroup; + } + + that._renderItemData( ul, item ); + } ); + }, + + _renderItemData: function( ul, item ) { + return this._renderItem( ul, item ).data( "ui-selectmenu-item", item ); + }, + + _renderItem: function( ul, item ) { + var li = $( "<li>" ), + wrapper = $( "<div>", { + title: item.element.attr( "title" ) + } ); + + if ( item.disabled ) { + this._addClass( li, null, "ui-state-disabled" ); + } + this._setText( wrapper, item.label ); + + return li.append( wrapper ).appendTo( ul ); + }, + + _setText: function( element, value ) { + if ( value ) { + element.text( value ); + } else { + element.html( " " ); + } + }, + + _move: function( direction, event ) { + var item, next, + filter = ".ui-menu-item"; + + if ( this.isOpen ) { + item = this.menuItems.eq( this.focusIndex ).parent( "li" ); + } else { + item = this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" ); + filter += ":not(.ui-state-disabled)"; + } + + if ( direction === "first" || direction === "last" ) { + next = item[ direction === "first" ? "prevAll" : "nextAll" ]( filter ).eq( -1 ); + } else { + next = item[ direction + "All" ]( filter ).eq( 0 ); + } + + if ( next.length ) { + this.menuInstance.focus( event, next ); + } + }, + + _getSelectedItem: function() { + return this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" ); + }, + + _toggle: function( event ) { + this[ this.isOpen ? "close" : "open" ]( event ); + }, + + _setSelection: function() { + var selection; + + if ( !this.range ) { + return; + } + + if ( window.getSelection ) { + selection = window.getSelection(); + selection.removeAllRanges(); + selection.addRange( this.range ); + + // Support: IE8 + } else { + this.range.select(); + } + + // Support: IE + // Setting the text selection kills the button focus in IE, but + // restoring the focus doesn't kill the selection. + this.button.focus(); + }, + + _documentClick: { + mousedown: function( event ) { + if ( !this.isOpen ) { + return; + } + + if ( !$( event.target ).closest( ".ui-selectmenu-menu, #" + + $.ui.escapeSelector( this.ids.button ) ).length ) { + this.close( event ); + } + } + }, + + _buttonEvents: { + + // Prevent text selection from being reset when interacting with the selectmenu (#10144) + mousedown: function() { + var selection; + + if ( window.getSelection ) { + selection = window.getSelection(); + if ( selection.rangeCount ) { + this.range = selection.getRangeAt( 0 ); + } + + // Support: IE8 + } else { + this.range = document.selection.createRange(); + } + }, + + click: function( event ) { + this._setSelection(); + this._toggle( event ); + }, + + keydown: function( event ) { + var preventDefault = true; + switch ( event.keyCode ) { + case $.ui.keyCode.TAB: + case $.ui.keyCode.ESCAPE: + this.close( event ); + preventDefault = false; + break; + case $.ui.keyCode.ENTER: + if ( this.isOpen ) { + this._selectFocusedItem( event ); + } + break; + case $.ui.keyCode.UP: + if ( event.altKey ) { + this._toggle( event ); + } else { + this._move( "prev", event ); + } + break; + case $.ui.keyCode.DOWN: + if ( event.altKey ) { + this._toggle( event ); + } else { + this._move( "next", event ); + } + break; + case $.ui.keyCode.SPACE: + if ( this.isOpen ) { + this._selectFocusedItem( event ); + } else { + this._toggle( event ); + } + break; + case $.ui.keyCode.LEFT: + this._move( "prev", event ); + break; + case $.ui.keyCode.RIGHT: + this._move( "next", event ); + break; + case $.ui.keyCode.HOME: + case $.ui.keyCode.PAGE_UP: + this._move( "first", event ); + break; + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_DOWN: + this._move( "last", event ); + break; + default: + this.menu.trigger( event ); + preventDefault = false; + } + + if ( preventDefault ) { + event.preventDefault(); + } + } + }, + + _selectFocusedItem: function( event ) { + var item = this.menuItems.eq( this.focusIndex ).parent( "li" ); + if ( !item.hasClass( "ui-state-disabled" ) ) { + this._select( item.data( "ui-selectmenu-item" ), event ); + } + }, + + _select: function( item, event ) { + var oldIndex = this.element[ 0 ].selectedIndex; + + // Change native select element + this.element[ 0 ].selectedIndex = item.index; + this.buttonItem.replaceWith( this.buttonItem = this._renderButtonItem( item ) ); + this._setAria( item ); + this._trigger( "select", event, { item: item } ); + + if ( item.index !== oldIndex ) { + this._trigger( "change", event, { item: item } ); + } + + this.close( event ); + }, + + _setAria: function( item ) { + var id = this.menuItems.eq( item.index ).attr( "id" ); + + this.button.attr( { + "aria-labelledby": id, + "aria-activedescendant": id + } ); + this.menu.attr( "aria-activedescendant", id ); + }, + + _setOption: function( key, value ) { + if ( key === "icons" ) { + var icon = this.button.find( "span.ui-icon" ); + this._removeClass( icon, null, this.options.icons.button ) + ._addClass( icon, null, value.button ); + } + + this._super( key, value ); + + if ( key === "appendTo" ) { + this.menuWrap.appendTo( this._appendTo() ); + } + + if ( key === "width" ) { + this._resizeButton(); + } + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this.menuInstance.option( "disabled", value ); + this.button.attr( "aria-disabled", value ); + this._toggleClass( this.button, null, "ui-state-disabled", value ); + + this.element.prop( "disabled", value ); + if ( value ) { + this.button.attr( "tabindex", -1 ); + this.close(); + } else { + this.button.attr( "tabindex", 0 ); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + + if ( element ) { + element = element.jquery || element.nodeType ? + $( element ) : + this.document.find( element ).eq( 0 ); + } + + if ( !element || !element[ 0 ] ) { + element = this.element.closest( ".ui-front, dialog" ); + } + + if ( !element.length ) { + element = this.document[ 0 ].body; + } + + return element; + }, + + _toggleAttr: function() { + this.button.attr( "aria-expanded", this.isOpen ); + + // We can't use two _toggleClass() calls here, because we need to make sure + // we always remove classes first and add them second, otherwise if both classes have the + // same theme class, it will be removed after we add it. + this._removeClass( this.button, "ui-selectmenu-button-" + + ( this.isOpen ? "closed" : "open" ) ) + ._addClass( this.button, "ui-selectmenu-button-" + + ( this.isOpen ? "open" : "closed" ) ) + ._toggleClass( this.menuWrap, "ui-selectmenu-open", null, this.isOpen ); + + this.menu.attr( "aria-hidden", !this.isOpen ); + }, + + _resizeButton: function() { + var width = this.options.width; + + // For `width: false`, just remove inline style and stop + if ( width === false ) { + this.button.css( "width", "" ); + return; + } + + // For `width: null`, match the width of the original element + if ( width === null ) { + width = this.element.show().outerWidth(); + this.element.hide(); + } + + this.button.outerWidth( width ); + }, + + _resizeMenu: function() { + this.menu.outerWidth( Math.max( + this.button.outerWidth(), + + // Support: IE10 + // IE10 wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping + this.menu.width( "" ).outerWidth() + 1 + ) ); + }, + + _getCreateOptions: function() { + var options = this._super(); + + options.disabled = this.element.prop( "disabled" ); + + return options; + }, + + _parseOptions: function( options ) { + var that = this, + data = []; + options.each( function( index, item ) { + data.push( that._parseOption( $( item ), index ) ); + } ); + this.items = data; + }, + + _parseOption: function( option, index ) { + var optgroup = option.parent( "optgroup" ); + + return { + element: option, + index: index, + value: option.val(), + label: option.text(), + optgroup: optgroup.attr( "label" ) || "", + disabled: optgroup.prop( "disabled" ) || option.prop( "disabled" ) + }; + }, + + _destroy: function() { + this._unbindFormResetHandler(); + this.menuWrap.remove(); + this.button.remove(); + this.element.show(); + this.element.removeUniqueId(); + this.labels.attr( "for", this.ids.element ); + } +} ] ); + + +/*! + * jQuery UI Slider 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Fold 1.8.14 + +//>>label: Slider +//>>group: Widgets +//>>description: Displays a flexible slider with ranges and accessibility via keyboard. +//>>docs: http://api.jqueryui.com/slider/ +//>>demos: http://jqueryui.com/slider/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/slider.css +//>>css.theme: ../../themes/base/theme.css + + + +var widgetsSlider = $.widget( "ui.slider", $.ui.mouse, { + version: "1.12.1", + widgetEventPrefix: "slide", + + options: { + animate: false, + classes: { + "ui-slider": "ui-corner-all", + "ui-slider-handle": "ui-corner-all", + + // Note: ui-widget-header isn't the most fittingly semantic framework class for this + // element, but worked best visually with a variety of themes + "ui-slider-range": "ui-corner-all ui-widget-header" + }, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null, + + // Callbacks + change: null, + slide: null, + start: null, + stop: null + }, + + // Number of pages in a slider + // (how many times can you page up/down to go through the whole range) + numPages: 5, + + _create: function() { + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + this._calculateNewMax(); + + this._addClass( "ui-slider ui-slider-" + this.orientation, + "ui-widget ui-widget-content" ); + + this._refresh(); + + this._animateOff = false; + }, + + _refresh: function() { + this._createRange(); + this._createHandles(); + this._setupEvents(); + this._refreshValue(); + }, + + _createHandles: function() { + var i, handleCount, + options = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ), + handle = "<span tabindex='0'></span>", + handles = []; + + handleCount = ( options.values && options.values.length ) || 1; + + if ( existingHandles.length > handleCount ) { + existingHandles.slice( handleCount ).remove(); + existingHandles = existingHandles.slice( 0, handleCount ); + } + + for ( i = existingHandles.length; i < handleCount; i++ ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) ); + + this._addClass( this.handles, "ui-slider-handle", "ui-state-default" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.each( function( i ) { + $( this ) + .data( "ui-slider-handle-index", i ) + .attr( "tabIndex", 0 ); + } ); + }, + + _createRange: function() { + var options = this.options; + + if ( options.range ) { + if ( options.range === true ) { + if ( !options.values ) { + options.values = [ this._valueMin(), this._valueMin() ]; + } else if ( options.values.length && options.values.length !== 2 ) { + options.values = [ options.values[ 0 ], options.values[ 0 ] ]; + } else if ( $.isArray( options.values ) ) { + options.values = options.values.slice( 0 ); + } + } + + if ( !this.range || !this.range.length ) { + this.range = $( "<div>" ) + .appendTo( this.element ); + + this._addClass( this.range, "ui-slider-range" ); + } else { + this._removeClass( this.range, "ui-slider-range-min ui-slider-range-max" ); + + // Handle range switching from true to min/max + this.range.css( { + "left": "", + "bottom": "" + } ); + } + if ( options.range === "min" || options.range === "max" ) { + this._addClass( this.range, "ui-slider-range-" + options.range ); + } + } else { + if ( this.range ) { + this.range.remove(); + } + this.range = null; + } + }, + + _setupEvents: function() { + this._off( this.handles ); + this._on( this.handles, this._handleEvents ); + this._hoverable( this.handles ); + this._focusable( this.handles ); + }, + + _destroy: function() { + this.handles.remove(); + if ( this.range ) { + this.range.remove(); + } + + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, + that = this, + o = this.options; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + this.handles.each( function( i ) { + var thisDistance = Math.abs( normValue - that.values( i ) ); + if ( ( distance > thisDistance ) || + ( distance === thisDistance && + ( i === that._lastChangedValue || that.values( i ) === o.min ) ) ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + } ); + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + this._handleIndex = index; + + this._addClass( closestHandle, null, "ui-state-active" ); + closestHandle.trigger( "focus" ); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css( "borderTopWidth" ), 10 ) || 0 ) - + ( parseInt( closestHandle.css( "borderBottomWidth" ), 10 ) || 0 ) + + ( parseInt( closestHandle.css( "marginTop" ), 10 ) || 0 ) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function() { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this._removeClass( this.handles, null, "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - + ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - + ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _uiHash: function( index, value, values ) { + var uiHash = { + handle: this.handles[ index ], + handleIndex: index, + value: value !== undefined ? value : this.value() + }; + + if ( this._hasMultipleValues() ) { + uiHash.value = value !== undefined ? value : this.values( index ); + uiHash.values = values || this.values(); + } + + return uiHash; + }, + + _hasMultipleValues: function() { + return this.options.values && this.options.values.length; + }, + + _start: function( event, index ) { + return this._trigger( "start", event, this._uiHash( index ) ); + }, + + _slide: function( event, index, newVal ) { + var allowed, otherVal, + currentValue = this.value(), + newValues = this.values(); + + if ( this._hasMultipleValues() ) { + otherVal = this.values( index ? 0 : 1 ); + currentValue = this.values( index ); + + if ( this.options.values.length === 2 && this.options.range === true ) { + newVal = index === 0 ? Math.min( otherVal, newVal ) : Math.max( otherVal, newVal ); + } + + newValues[ index ] = newVal; + } + + if ( newVal === currentValue ) { + return; + } + + allowed = this._trigger( "slide", event, this._uiHash( index, newVal, newValues ) ); + + // A slide can be canceled by returning false from the slide callback + if ( allowed === false ) { + return; + } + + if ( this._hasMultipleValues() ) { + this.values( index, newVal ); + } else { + this.value( newVal ); + } + }, + + _stop: function( event, index ) { + this._trigger( "stop", event, this._uiHash( index ) ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + + //store the last changed value index for reference when handles overlap + this._lastChangedValue = index; + this._trigger( "change", event, this._uiHash( index ) ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this._hasMultipleValues() ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( key === "range" && this.options.range === true ) { + if ( value === "min" ) { + this.options.value = this._values( 0 ); + this.options.values = null; + } else if ( value === "max" ) { + this.options.value = this._values( this.options.values.length - 1 ); + this.options.values = null; + } + } + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + this._super( key, value ); + + switch ( key ) { + case "orientation": + this._detectOrientation(); + this._removeClass( "ui-slider-horizontal ui-slider-vertical" ) + ._addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + if ( this.options.range ) { + this._refreshRange( value ); + } + + // Reset positioning from previous orientation + this.handles.css( value === "horizontal" ? "bottom" : "left", "" ); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + + // Start from the last handle to prevent unreachable handles (#9046) + for ( i = valsLength - 1; i >= 0; i-- ) { + this._change( null, i ); + } + this._animateOff = false; + break; + case "step": + case "min": + case "max": + this._animateOff = true; + this._calculateNewMax(); + this._refreshValue(); + this._animateOff = false; + break; + case "range": + this._animateOff = true; + this._refresh(); + this._animateOff = false; + break; + } + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this._toggleClass( null, "ui-state-disabled", !!value ); + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else if ( this._hasMultipleValues() ) { + + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } else { + return []; + } + }, + + // Returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = ( val - this._valueMin() ) % step, + alignValue = val - valModStep; + + if ( Math.abs( valModStep ) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed( 5 ) ); + }, + + _calculateNewMax: function() { + var max = this.options.max, + min = this._valueMin(), + step = this.options.step, + aboveMin = Math.round( ( max - min ) / step ) * step; + max = aboveMin + min; + if ( max > this.options.max ) { + + //If max is not divisible by step, rounding off may increase its value + max -= step; + } + this.max = parseFloat( max.toFixed( this._precision() ) ); + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); + } + return precision; + }, + + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.max; + }, + + _refreshRange: function( orientation ) { + if ( orientation === "vertical" ) { + this.range.css( { "width": "", "left": "" } ); + } + if ( orientation === "horizontal" ) { + this.range.css( { "height": "", "bottom": "" } ); + } + }, + + _refreshValue: function() { + var lastValPercent, valPercent, value, valueMin, valueMax, + oRange = this.options.range, + o = this.options, + that = this, + animate = ( !this._animateOff ) ? o.animate : false, + _set = {}; + + if ( this._hasMultipleValues() ) { + this.handles.each( function( i ) { + valPercent = ( that.values( i ) - that._valueMin() ) / ( that._valueMax() - + that._valueMin() ) * 100; + _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( that.options.range === true ) { + if ( that.orientation === "horizontal" ) { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { + left: valPercent + "%" + }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { + width: ( valPercent - lastValPercent ) + "%" + }, { + queue: false, + duration: o.animate + } ); + } + } else { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { + bottom: ( valPercent ) + "%" + }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { + height: ( valPercent - lastValPercent ) + "%" + }, { + queue: false, + duration: o.animate + } ); + } + } + } + lastValPercent = valPercent; + } ); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { + width: valPercent + "%" + }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { + width: ( 100 - valPercent ) + "%" + }, o.animate ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { + height: valPercent + "%" + }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { + height: ( 100 - valPercent ) + "%" + }, o.animate ); + } + } + }, + + _handleEvents: { + keydown: function( event ) { + var allowed, curVal, newVal, step, + index = $( event.target ).data( "ui-slider-handle-index" ); + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !this._keySliding ) { + this._keySliding = true; + this._addClass( $( event.target ), null, "ui-state-active" ); + allowed = this._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = this.options.step; + if ( this._hasMultipleValues() ) { + curVal = newVal = this.values( index ); + } else { + curVal = newVal = this.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = this._valueMin(); + break; + case $.ui.keyCode.END: + newVal = this._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = this._trimAlignValue( + curVal + ( ( this._valueMax() - this._valueMin() ) / this.numPages ) + ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = this._trimAlignValue( + curVal - ( ( this._valueMax() - this._valueMin() ) / this.numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === this._valueMax() ) { + return; + } + newVal = this._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === this._valueMin() ) { + return; + } + newVal = this._trimAlignValue( curVal - step ); + break; + } + + this._slide( event, index, newVal ); + }, + keyup: function( event ) { + var index = $( event.target ).data( "ui-slider-handle-index" ); + + if ( this._keySliding ) { + this._keySliding = false; + this._stop( event, index ); + this._change( event, index ); + this._removeClass( $( event.target ), null, "ui-state-active" ); + } + } + } +} ); + + +/*! + * jQuery UI Spinner 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Spinner +//>>group: Widgets +//>>description: Displays buttons to easily input numbers via the keyboard or mouse. +//>>docs: http://api.jqueryui.com/spinner/ +//>>demos: http://jqueryui.com/spinner/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/spinner.css +//>>css.theme: ../../themes/base/theme.css + + + +function spinnerModifer( fn ) { + return function() { + var previous = this.element.val(); + fn.apply( this, arguments ); + this._refresh(); + if ( previous !== this.element.val() ) { + this._trigger( "change" ); + } + }; +} + +$.widget( "ui.spinner", { + version: "1.12.1", + defaultElement: "<input>", + widgetEventPrefix: "spin", + options: { + classes: { + "ui-spinner": "ui-corner-all", + "ui-spinner-down": "ui-corner-br", + "ui-spinner-up": "ui-corner-tr" + }, + culture: null, + icons: { + down: "ui-icon-triangle-1-s", + up: "ui-icon-triangle-1-n" + }, + incremental: true, + max: null, + min: null, + numberFormat: null, + page: 10, + step: 1, + + change: null, + spin: null, + start: null, + stop: null + }, + + _create: function() { + + // handle string values that need to be parsed + this._setOption( "max", this.options.max ); + this._setOption( "min", this.options.min ); + this._setOption( "step", this.options.step ); + + // Only format if there is a value, prevents the field from being marked + // as invalid in Firefox, see #9573. + if ( this.value() !== "" ) { + + // Format the value, but don't constrain. + this._value( this.element.val(), true ); + } + + this._draw(); + this._on( this._events ); + this._refresh(); + + // Turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + } ); + }, + + _getCreateOptions: function() { + var options = this._super(); + var element = this.element; + + $.each( [ "min", "max", "step" ], function( i, option ) { + var value = element.attr( option ); + if ( value != null && value.length ) { + options[ option ] = value; + } + } ); + + return options; + }, + + _events: { + keydown: function( event ) { + if ( this._start( event ) && this._keydown( event ) ) { + event.preventDefault(); + } + }, + keyup: "_stop", + focus: function() { + this.previous = this.element.val(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + this._stop(); + this._refresh(); + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event ); + } + }, + mousewheel: function( event, delta ) { + if ( !delta ) { + return; + } + if ( !this.spinning && !this._start( event ) ) { + return false; + } + + this._spin( ( delta > 0 ? 1 : -1 ) * this.options.step, event ); + clearTimeout( this.mousewheelTimer ); + this.mousewheelTimer = this._delay( function() { + if ( this.spinning ) { + this._stop( event ); + } + }, 100 ); + event.preventDefault(); + }, + "mousedown .ui-spinner-button": function( event ) { + var previous; + + // We never want the buttons to have focus; whenever the user is + // interacting with the spinner, the focus should be on the input. + // If the input is focused then this.previous is properly set from + // when the input first received focus. If the input is not focused + // then we need to set this.previous based on the value before spinning. + previous = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] ) ? + this.previous : this.element.val(); + function checkFocus() { + var isActive = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] ); + if ( !isActive ) { + this.element.trigger( "focus" ); + this.previous = previous; + + // support: IE + // IE sets focus asynchronously, so we need to check if focus + // moved off of the input because the user clicked on the button. + this._delay( function() { + this.previous = previous; + } ); + } + } + + // Ensure focus is on (or stays on) the text field + event.preventDefault(); + checkFocus.call( this ); + + // Support: IE + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + // and check (again) if focus moved off of the input. + this.cancelBlur = true; + this._delay( function() { + delete this.cancelBlur; + checkFocus.call( this ); + } ); + + if ( this._start( event ) === false ) { + return; + } + + this._repeat( null, $( event.currentTarget ) + .hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + "mouseup .ui-spinner-button": "_stop", + "mouseenter .ui-spinner-button": function( event ) { + + // button will add ui-state-active if mouse was down while mouseleave and kept down + if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) { + return; + } + + if ( this._start( event ) === false ) { + return false; + } + this._repeat( null, $( event.currentTarget ) + .hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + + // TODO: do we really want to consider this a stop? + // shouldn't we just stop the repeater and wait until mouseup before + // we trigger the stop event? + "mouseleave .ui-spinner-button": "_stop" + }, + + // Support mobile enhanced option and make backcompat more sane + _enhance: function() { + this.uiSpinner = this.element + .attr( "autocomplete", "off" ) + .wrap( "<span>" ) + .parent() + + // Add buttons + .append( + "<a></a><a></a>" + ); + }, + + _draw: function() { + this._enhance(); + + this._addClass( this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content" ); + this._addClass( "ui-spinner-input" ); + + this.element.attr( "role", "spinbutton" ); + + // Button bindings + this.buttons = this.uiSpinner.children( "a" ) + .attr( "tabIndex", -1 ) + .attr( "aria-hidden", true ) + .button( { + classes: { + "ui-button": "" + } + } ); + + // TODO: Right now button does not support classes this is already updated in button PR + this._removeClass( this.buttons, "ui-corner-all" ); + + this._addClass( this.buttons.first(), "ui-spinner-button ui-spinner-up" ); + this._addClass( this.buttons.last(), "ui-spinner-button ui-spinner-down" ); + this.buttons.first().button( { + "icon": this.options.icons.up, + "showLabel": false + } ); + this.buttons.last().button( { + "icon": this.options.icons.down, + "showLabel": false + } ); + + // IE 6 doesn't understand height: 50% for the buttons + // unless the wrapper has an explicit height + if ( this.buttons.height() > Math.ceil( this.uiSpinner.height() * 0.5 ) && + this.uiSpinner.height() > 0 ) { + this.uiSpinner.height( this.uiSpinner.height() ); + } + }, + + _keydown: function( event ) { + var options = this.options, + keyCode = $.ui.keyCode; + + switch ( event.keyCode ) { + case keyCode.UP: + this._repeat( null, 1, event ); + return true; + case keyCode.DOWN: + this._repeat( null, -1, event ); + return true; + case keyCode.PAGE_UP: + this._repeat( null, options.page, event ); + return true; + case keyCode.PAGE_DOWN: + this._repeat( null, -options.page, event ); + return true; + } + + return false; + }, + + _start: function( event ) { + if ( !this.spinning && this._trigger( "start", event ) === false ) { + return false; + } + + if ( !this.counter ) { + this.counter = 1; + } + this.spinning = true; + return true; + }, + + _repeat: function( i, steps, event ) { + i = i || 500; + + clearTimeout( this.timer ); + this.timer = this._delay( function() { + this._repeat( 40, steps, event ); + }, i ); + + this._spin( steps * this.options.step, event ); + }, + + _spin: function( step, event ) { + var value = this.value() || 0; + + if ( !this.counter ) { + this.counter = 1; + } + + value = this._adjustValue( value + step * this._increment( this.counter ) ); + + if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false ) { + this._value( value ); + this.counter++; + } + }, + + _increment: function( i ) { + var incremental = this.options.incremental; + + if ( incremental ) { + return $.isFunction( incremental ) ? + incremental( i ) : + Math.floor( i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1 ); + } + + return 1; + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); + } + return precision; + }, + + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _adjustValue: function( value ) { + var base, aboveMin, + options = this.options; + + // Make sure we're at a valid step + // - find out where we are relative to the base (min or 0) + base = options.min !== null ? options.min : 0; + aboveMin = value - base; + + // - round to the nearest step + aboveMin = Math.round( aboveMin / options.step ) * options.step; + + // - rounding is based on 0, so adjust back to our base + value = base + aboveMin; + + // Fix precision from bad JS floating point math + value = parseFloat( value.toFixed( this._precision() ) ); + + // Clamp the value + if ( options.max !== null && value > options.max ) { + return options.max; + } + if ( options.min !== null && value < options.min ) { + return options.min; + } + + return value; + }, + + _stop: function( event ) { + if ( !this.spinning ) { + return; + } + + clearTimeout( this.timer ); + clearTimeout( this.mousewheelTimer ); + this.counter = 0; + this.spinning = false; + this._trigger( "stop", event ); + }, + + _setOption: function( key, value ) { + var prevValue, first, last; + + if ( key === "culture" || key === "numberFormat" ) { + prevValue = this._parse( this.element.val() ); + this.options[ key ] = value; + this.element.val( this._format( prevValue ) ); + return; + } + + if ( key === "max" || key === "min" || key === "step" ) { + if ( typeof value === "string" ) { + value = this._parse( value ); + } + } + if ( key === "icons" ) { + first = this.buttons.first().find( ".ui-icon" ); + this._removeClass( first, null, this.options.icons.up ); + this._addClass( first, null, value.up ); + last = this.buttons.last().find( ".ui-icon" ); + this._removeClass( last, null, this.options.icons.down ); + this._addClass( last, null, value.down ); + } + + this._super( key, value ); + }, + + _setOptionDisabled: function( value ) { + this._super( value ); + + this._toggleClass( this.uiSpinner, null, "ui-state-disabled", !!value ); + this.element.prop( "disabled", !!value ); + this.buttons.button( value ? "disable" : "enable" ); + }, + + _setOptions: spinnerModifer( function( options ) { + this._super( options ); + } ), + + _parse: function( val ) { + if ( typeof val === "string" && val !== "" ) { + val = window.Globalize && this.options.numberFormat ? + Globalize.parseFloat( val, 10, this.options.culture ) : +val; + } + return val === "" || isNaN( val ) ? null : val; + }, + + _format: function( value ) { + if ( value === "" ) { + return ""; + } + return window.Globalize && this.options.numberFormat ? + Globalize.format( value, this.options.numberFormat, this.options.culture ) : + value; + }, + + _refresh: function() { + this.element.attr( { + "aria-valuemin": this.options.min, + "aria-valuemax": this.options.max, + + // TODO: what should we do with values that can't be parsed? + "aria-valuenow": this._parse( this.element.val() ) + } ); + }, + + isValid: function() { + var value = this.value(); + + // Null is invalid + if ( value === null ) { + return false; + } + + // If value gets adjusted, it's invalid + return value === this._adjustValue( value ); + }, + + // Update the value without triggering change + _value: function( value, allowAny ) { + var parsed; + if ( value !== "" ) { + parsed = this._parse( value ); + if ( parsed !== null ) { + if ( !allowAny ) { + parsed = this._adjustValue( parsed ); + } + value = this._format( parsed ); + } + } + this.element.val( value ); + this._refresh(); + }, + + _destroy: function() { + this.element + .prop( "disabled", false ) + .removeAttr( "autocomplete role aria-valuemin aria-valuemax aria-valuenow" ); + + this.uiSpinner.replaceWith( this.element ); + }, + + stepUp: spinnerModifer( function( steps ) { + this._stepUp( steps ); + } ), + _stepUp: function( steps ) { + if ( this._start() ) { + this._spin( ( steps || 1 ) * this.options.step ); + this._stop(); + } + }, + + stepDown: spinnerModifer( function( steps ) { + this._stepDown( steps ); + } ), + _stepDown: function( steps ) { + if ( this._start() ) { + this._spin( ( steps || 1 ) * -this.options.step ); + this._stop(); + } + }, + + pageUp: spinnerModifer( function( pages ) { + this._stepUp( ( pages || 1 ) * this.options.page ); + } ), + + pageDown: spinnerModifer( function( pages ) { + this._stepDown( ( pages || 1 ) * this.options.page ); + } ), + + value: function( newVal ) { + if ( !arguments.length ) { + return this._parse( this.element.val() ); + } + spinnerModifer( this._value ).call( this, newVal ); + }, + + widget: function() { + return this.uiSpinner; + } +} ); + +// DEPRECATED +// TODO: switch return back to widget declaration at top of file when this is removed +if ( $.uiBackCompat !== false ) { + + // Backcompat for spinner html extension points + $.widget( "ui.spinner", $.ui.spinner, { + _enhance: function() { + this.uiSpinner = this.element + .attr( "autocomplete", "off" ) + .wrap( this._uiSpinnerHtml() ) + .parent() + + // Add buttons + .append( this._buttonHtml() ); + }, + _uiSpinnerHtml: function() { + return "<span>"; + }, + + _buttonHtml: function() { + return "<a></a><a></a>"; + } + } ); +} + +var widgetsSpinner = $.ui.spinner; + + +/*! + * jQuery UI Tabs 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Fold + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Tabs +//>>group: Widgets +//>>description: Transforms a set of container elements into a tab structure. +//>>docs: http://api.jqueryui.com/tabs/ +//>>demos: http://jqueryui.com/tabs/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/tabs.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.tabs", { + version: "1.12.1", + delay: 300, + options: { + active: null, + classes: { + "ui-tabs": "ui-corner-all", + "ui-tabs-nav": "ui-corner-all", + "ui-tabs-panel": "ui-corner-bottom", + "ui-tabs-tab": "ui-corner-top" + }, + collapsible: false, + event: "click", + heightStyle: "content", + hide: null, + show: null, + + // Callbacks + activate: null, + beforeActivate: null, + beforeLoad: null, + load: null + }, + + _isLocal: ( function() { + var rhash = /#.*$/; + + return function( anchor ) { + var anchorUrl, locationUrl; + + anchorUrl = anchor.href.replace( rhash, "" ); + locationUrl = location.href.replace( rhash, "" ); + + // Decoding may throw an error if the URL isn't UTF-8 (#9518) + try { + anchorUrl = decodeURIComponent( anchorUrl ); + } catch ( error ) {} + try { + locationUrl = decodeURIComponent( locationUrl ); + } catch ( error ) {} + + return anchor.hash.length > 1 && anchorUrl === locationUrl; + }; + } )(), + + _create: function() { + var that = this, + options = this.options; + + this.running = false; + + this._addClass( "ui-tabs", "ui-widget ui-widget-content" ); + this._toggleClass( "ui-tabs-collapsible", null, options.collapsible ); + + this._processTabs(); + options.active = this._initialActive(); + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + if ( $.isArray( options.disabled ) ) { + options.disabled = $.unique( options.disabled.concat( + $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) { + return that.tabs.index( li ); + } ) + ) ).sort(); + } + + // Check for length avoids error when initializing empty list + if ( this.options.active !== false && this.anchors.length ) { + this.active = this._findActive( options.active ); + } else { + this.active = $(); + } + + this._refresh(); + + if ( this.active.length ) { + this.load( options.active ); + } + }, + + _initialActive: function() { + var active = this.options.active, + collapsible = this.options.collapsible, + locationHash = location.hash.substring( 1 ); + + if ( active === null ) { + + // check the fragment identifier in the URL + if ( locationHash ) { + this.tabs.each( function( i, tab ) { + if ( $( tab ).attr( "aria-controls" ) === locationHash ) { + active = i; + return false; + } + } ); + } + + // Check for a tab marked active via a class + if ( active === null ) { + active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) ); + } + + // No active tab, set to false + if ( active === null || active === -1 ) { + active = this.tabs.length ? 0 : false; + } + } + + // Handle numbers: negative, out of range + if ( active !== false ) { + active = this.tabs.index( this.tabs.eq( active ) ); + if ( active === -1 ) { + active = collapsible ? false : 0; + } + } + + // Don't allow collapsible: false and active: false + if ( !collapsible && active === false && this.anchors.length ) { + active = 0; + } + + return active; + }, + + _getCreateEventData: function() { + return { + tab: this.active, + panel: !this.active.length ? $() : this._getPanelForTab( this.active ) + }; + }, + + _tabKeydown: function( event ) { + var focusedTab = $( $.ui.safeActiveElement( this.document[ 0 ] ) ).closest( "li" ), + selectedIndex = this.tabs.index( focusedTab ), + goingForward = true; + + if ( this._handlePageNav( event ) ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + selectedIndex++; + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.LEFT: + goingForward = false; + selectedIndex--; + break; + case $.ui.keyCode.END: + selectedIndex = this.anchors.length - 1; + break; + case $.ui.keyCode.HOME: + selectedIndex = 0; + break; + case $.ui.keyCode.SPACE: + + // Activate only, no collapsing + event.preventDefault(); + clearTimeout( this.activating ); + this._activate( selectedIndex ); + return; + case $.ui.keyCode.ENTER: + + // Toggle (cancel delayed activation, allow collapsing) + event.preventDefault(); + clearTimeout( this.activating ); + + // Determine if we should collapse or activate + this._activate( selectedIndex === this.options.active ? false : selectedIndex ); + return; + default: + return; + } + + // Focus the appropriate tab, based on which key was pressed + event.preventDefault(); + clearTimeout( this.activating ); + selectedIndex = this._focusNextTab( selectedIndex, goingForward ); + + // Navigating with control/command key will prevent automatic activation + if ( !event.ctrlKey && !event.metaKey ) { + + // Update aria-selected immediately so that AT think the tab is already selected. + // Otherwise AT may confuse the user by stating that they need to activate the tab, + // but the tab will already be activated by the time the announcement finishes. + focusedTab.attr( "aria-selected", "false" ); + this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" ); + + this.activating = this._delay( function() { + this.option( "active", selectedIndex ); + }, this.delay ); + } + }, + + _panelKeydown: function( event ) { + if ( this._handlePageNav( event ) ) { + return; + } + + // Ctrl+up moves focus to the current tab + if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) { + event.preventDefault(); + this.active.trigger( "focus" ); + } + }, + + // Alt+page up/down moves focus to the previous/next tab (and activates) + _handlePageNav: function( event ) { + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) { + this._activate( this._focusNextTab( this.options.active - 1, false ) ); + return true; + } + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) { + this._activate( this._focusNextTab( this.options.active + 1, true ) ); + return true; + } + }, + + _findNextTab: function( index, goingForward ) { + var lastTabIndex = this.tabs.length - 1; + + function constrain() { + if ( index > lastTabIndex ) { + index = 0; + } + if ( index < 0 ) { + index = lastTabIndex; + } + return index; + } + + while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) { + index = goingForward ? index + 1 : index - 1; + } + + return index; + }, + + _focusNextTab: function( index, goingForward ) { + index = this._findNextTab( index, goingForward ); + this.tabs.eq( index ).trigger( "focus" ); + return index; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + this._super( key, value ); + + if ( key === "collapsible" ) { + this._toggleClass( "ui-tabs-collapsible", null, value ); + + // Setting collapsible: false while collapsed; open first panel + if ( !value && this.options.active === false ) { + this._activate( 0 ); + } + } + + if ( key === "event" ) { + this._setupEvents( value ); + } + + if ( key === "heightStyle" ) { + this._setupHeightStyle( value ); + } + }, + + _sanitizeSelector: function( hash ) { + return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : ""; + }, + + refresh: function() { + var options = this.options, + lis = this.tablist.children( ":has(a[href])" ); + + // Get disabled tabs from class attribute from HTML + // this will get converted to a boolean if needed in _refresh() + options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) { + return lis.index( tab ); + } ); + + this._processTabs(); + + // Was collapsed or no tabs + if ( options.active === false || !this.anchors.length ) { + options.active = false; + this.active = $(); + + // was active, but active tab is gone + } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) { + + // all remaining tabs are disabled + if ( this.tabs.length === options.disabled.length ) { + options.active = false; + this.active = $(); + + // activate previous tab + } else { + this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) ); + } + + // was active, active tab still exists + } else { + + // make sure active index is correct + options.active = this.tabs.index( this.active ); + } + + this._refresh(); + }, + + _refresh: function() { + this._setOptionDisabled( this.options.disabled ); + this._setupEvents( this.options.event ); + this._setupHeightStyle( this.options.heightStyle ); + + this.tabs.not( this.active ).attr( { + "aria-selected": "false", + "aria-expanded": "false", + tabIndex: -1 + } ); + this.panels.not( this._getPanelForTab( this.active ) ) + .hide() + .attr( { + "aria-hidden": "true" + } ); + + // Make sure one tab is in the tab order + if ( !this.active.length ) { + this.tabs.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active + .attr( { + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + } ); + this._addClass( this.active, "ui-tabs-active", "ui-state-active" ); + this._getPanelForTab( this.active ) + .show() + .attr( { + "aria-hidden": "false" + } ); + } + }, + + _processTabs: function() { + var that = this, + prevTabs = this.tabs, + prevAnchors = this.anchors, + prevPanels = this.panels; + + this.tablist = this._getList().attr( "role", "tablist" ); + this._addClass( this.tablist, "ui-tabs-nav", + "ui-helper-reset ui-helper-clearfix ui-widget-header" ); + + // Prevent users from focusing disabled tabs via click + this.tablist + .on( "mousedown" + this.eventNamespace, "> li", function( event ) { + if ( $( this ).is( ".ui-state-disabled" ) ) { + event.preventDefault(); + } + } ) + + // Support: IE <9 + // Preventing the default action in mousedown doesn't prevent IE + // from focusing the element, so if the anchor gets focused, blur. + // We don't have to worry about focusing the previously focused + // element since clicking on a non-focusable element should focus + // the body anyway. + .on( "focus" + this.eventNamespace, ".ui-tabs-anchor", function() { + if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) { + this.blur(); + } + } ); + + this.tabs = this.tablist.find( "> li:has(a[href])" ) + .attr( { + role: "tab", + tabIndex: -1 + } ); + this._addClass( this.tabs, "ui-tabs-tab", "ui-state-default" ); + + this.anchors = this.tabs.map( function() { + return $( "a", this )[ 0 ]; + } ) + .attr( { + role: "presentation", + tabIndex: -1 + } ); + this._addClass( this.anchors, "ui-tabs-anchor" ); + + this.panels = $(); + + this.anchors.each( function( i, anchor ) { + var selector, panel, panelId, + anchorId = $( anchor ).uniqueId().attr( "id" ), + tab = $( anchor ).closest( "li" ), + originalAriaControls = tab.attr( "aria-controls" ); + + // Inline tab + if ( that._isLocal( anchor ) ) { + selector = anchor.hash; + panelId = selector.substring( 1 ); + panel = that.element.find( that._sanitizeSelector( selector ) ); + + // remote tab + } else { + + // If the tab doesn't already have aria-controls, + // generate an id by using a throw-away element + panelId = tab.attr( "aria-controls" ) || $( {} ).uniqueId()[ 0 ].id; + selector = "#" + panelId; + panel = that.element.find( selector ); + if ( !panel.length ) { + panel = that._createPanel( panelId ); + panel.insertAfter( that.panels[ i - 1 ] || that.tablist ); + } + panel.attr( "aria-live", "polite" ); + } + + if ( panel.length ) { + that.panels = that.panels.add( panel ); + } + if ( originalAriaControls ) { + tab.data( "ui-tabs-aria-controls", originalAriaControls ); + } + tab.attr( { + "aria-controls": panelId, + "aria-labelledby": anchorId + } ); + panel.attr( "aria-labelledby", anchorId ); + } ); + + this.panels.attr( "role", "tabpanel" ); + this._addClass( this.panels, "ui-tabs-panel", "ui-widget-content" ); + + // Avoid memory leaks (#10056) + if ( prevTabs ) { + this._off( prevTabs.not( this.tabs ) ); + this._off( prevAnchors.not( this.anchors ) ); + this._off( prevPanels.not( this.panels ) ); + } + }, + + // Allow overriding how to find the list for rare usage scenarios (#7715) + _getList: function() { + return this.tablist || this.element.find( "ol, ul" ).eq( 0 ); + }, + + _createPanel: function( id ) { + return $( "<div>" ) + .attr( "id", id ) + .data( "ui-tabs-destroy", true ); + }, + + _setOptionDisabled: function( disabled ) { + var currentItem, li, i; + + if ( $.isArray( disabled ) ) { + if ( !disabled.length ) { + disabled = false; + } else if ( disabled.length === this.anchors.length ) { + disabled = true; + } + } + + // Disable tabs + for ( i = 0; ( li = this.tabs[ i ] ); i++ ) { + currentItem = $( li ); + if ( disabled === true || $.inArray( i, disabled ) !== -1 ) { + currentItem.attr( "aria-disabled", "true" ); + this._addClass( currentItem, null, "ui-state-disabled" ); + } else { + currentItem.removeAttr( "aria-disabled" ); + this._removeClass( currentItem, null, "ui-state-disabled" ); + } + } + + this.options.disabled = disabled; + + this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, + disabled === true ); + }, + + _setupEvents: function( event ) { + var events = {}; + if ( event ) { + $.each( event.split( " " ), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + } ); + } + + this._off( this.anchors.add( this.tabs ).add( this.panels ) ); + + // Always prevent the default action, even when disabled + this._on( true, this.anchors, { + click: function( event ) { + event.preventDefault(); + } + } ); + this._on( this.anchors, events ); + this._on( this.tabs, { keydown: "_tabKeydown" } ); + this._on( this.panels, { keydown: "_panelKeydown" } ); + + this._focusable( this.tabs ); + this._hoverable( this.tabs ); + }, + + _setupHeightStyle: function( heightStyle ) { + var maxHeight, + parent = this.element.parent(); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + maxHeight -= this.element.outerHeight() - this.element.height(); + + this.element.siblings( ":visible" ).each( function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + } ); + + this.element.children().not( this.panels ).each( function() { + maxHeight -= $( this ).outerHeight( true ); + } ); + + this.panels.each( function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + } ) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.panels.each( function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + } ).height( maxHeight ); + } + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + anchor = $( event.currentTarget ), + tab = anchor.closest( "li" ), + clickedIsActive = tab[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : this._getPanelForTab( tab ), + toHide = !active.length ? $() : this._getPanelForTab( active ), + eventData = { + oldTab: active, + oldPanel: toHide, + newTab: collapsing ? $() : tab, + newPanel: toShow + }; + + event.preventDefault(); + + if ( tab.hasClass( "ui-state-disabled" ) || + + // tab is already loading + tab.hasClass( "ui-tabs-loading" ) || + + // can't switch durning an animation + this.running || + + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.tabs.index( tab ); + + this.active = clickedIsActive ? $() : tab; + if ( this.xhr ) { + this.xhr.abort(); + } + + if ( !toHide.length && !toShow.length ) { + $.error( "jQuery UI Tabs: Mismatching fragment identifier." ); + } + + if ( toShow.length ) { + this.load( this.tabs.index( tab ), event ); + } + this._toggle( event, eventData ); + }, + + // Handles show/hide for selecting tabs + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel; + + this.running = true; + + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + that._addClass( eventData.newTab.closest( "li" ), "ui-tabs-active", "ui-state-active" ); + + if ( toShow.length && that.options.show ) { + that._show( toShow, that.options.show, complete ); + } else { + toShow.show(); + complete(); + } + } + + // Start out by hiding, then showing, then completing + if ( toHide.length && this.options.hide ) { + this._hide( toHide, this.options.hide, function() { + that._removeClass( eventData.oldTab.closest( "li" ), + "ui-tabs-active", "ui-state-active" ); + show(); + } ); + } else { + this._removeClass( eventData.oldTab.closest( "li" ), + "ui-tabs-active", "ui-state-active" ); + toHide.hide(); + show(); + } + + toHide.attr( "aria-hidden", "true" ); + eventData.oldTab.attr( { + "aria-selected": "false", + "aria-expanded": "false" + } ); + + // If we're switching tabs, remove the old tab from the tab order. + // If we're opening from collapsed state, remove the previous tab from the tab order. + // If we're collapsing, then keep the collapsing tab in the tab order. + if ( toShow.length && toHide.length ) { + eventData.oldTab.attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.tabs.filter( function() { + return $( this ).attr( "tabIndex" ) === 0; + } ) + .attr( "tabIndex", -1 ); + } + + toShow.attr( "aria-hidden", "false" ); + eventData.newTab.attr( { + "aria-selected": "true", + "aria-expanded": "true", + tabIndex: 0 + } ); + }, + + _activate: function( index ) { + var anchor, + active = this._findActive( index ); + + // Trying to activate the already active panel + if ( active[ 0 ] === this.active[ 0 ] ) { + return; + } + + // Trying to collapse, simulate a click on the current active header + if ( !active.length ) { + active = this.active; + } + + anchor = active.find( ".ui-tabs-anchor" )[ 0 ]; + this._eventHandler( { + target: anchor, + currentTarget: anchor, + preventDefault: $.noop + } ); + }, + + _findActive: function( index ) { + return index === false ? $() : this.tabs.eq( index ); + }, + + _getIndex: function( index ) { + + // meta-function to give users option to provide a href string instead of a numerical index. + if ( typeof index === "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + + $.ui.escapeSelector( index ) + "']" ) ); + } + + return index; + }, + + _destroy: function() { + if ( this.xhr ) { + this.xhr.abort(); + } + + this.tablist + .removeAttr( "role" ) + .off( this.eventNamespace ); + + this.anchors + .removeAttr( "role tabIndex" ) + .removeUniqueId(); + + this.tabs.add( this.panels ).each( function() { + if ( $.data( this, "ui-tabs-destroy" ) ) { + $( this ).remove(); + } else { + $( this ).removeAttr( "role tabIndex " + + "aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded" ); + } + } ); + + this.tabs.each( function() { + var li = $( this ), + prev = li.data( "ui-tabs-aria-controls" ); + if ( prev ) { + li + .attr( "aria-controls", prev ) + .removeData( "ui-tabs-aria-controls" ); + } else { + li.removeAttr( "aria-controls" ); + } + } ); + + this.panels.show(); + + if ( this.options.heightStyle !== "content" ) { + this.panels.css( "height", "" ); + } + }, + + enable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === false ) { + return; + } + + if ( index === undefined ) { + disabled = false; + } else { + index = this._getIndex( index ); + if ( $.isArray( disabled ) ) { + disabled = $.map( disabled, function( num ) { + return num !== index ? num : null; + } ); + } else { + disabled = $.map( this.tabs, function( li, num ) { + return num !== index ? num : null; + } ); + } + } + this._setOptionDisabled( disabled ); + }, + + disable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === true ) { + return; + } + + if ( index === undefined ) { + disabled = true; + } else { + index = this._getIndex( index ); + if ( $.inArray( index, disabled ) !== -1 ) { + return; + } + if ( $.isArray( disabled ) ) { + disabled = $.merge( [ index ], disabled ).sort(); + } else { + disabled = [ index ]; + } + } + this._setOptionDisabled( disabled ); + }, + + load: function( index, event ) { + index = this._getIndex( index ); + var that = this, + tab = this.tabs.eq( index ), + anchor = tab.find( ".ui-tabs-anchor" ), + panel = this._getPanelForTab( tab ), + eventData = { + tab: tab, + panel: panel + }, + complete = function( jqXHR, status ) { + if ( status === "abort" ) { + that.panels.stop( false, true ); + } + + that._removeClass( tab, "ui-tabs-loading" ); + panel.removeAttr( "aria-busy" ); + + if ( jqXHR === that.xhr ) { + delete that.xhr; + } + }; + + // Not remote + if ( this._isLocal( anchor[ 0 ] ) ) { + return; + } + + this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) ); + + // Support: jQuery <1.8 + // jQuery <1.8 returns false if the request is canceled in beforeSend, + // but as of 1.8, $.ajax() always returns a jqXHR object. + if ( this.xhr && this.xhr.statusText !== "canceled" ) { + this._addClass( tab, "ui-tabs-loading" ); + panel.attr( "aria-busy", "true" ); + + this.xhr + .done( function( response, status, jqXHR ) { + + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout( function() { + panel.html( response ); + that._trigger( "load", event, eventData ); + + complete( jqXHR, status ); + }, 1 ); + } ) + .fail( function( jqXHR, status ) { + + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout( function() { + complete( jqXHR, status ); + }, 1 ); + } ); + } + }, + + _ajaxSettings: function( anchor, event, eventData ) { + var that = this; + return { + + // Support: IE <11 only + // Strip any hash that exists to prevent errors with the Ajax request + url: anchor.attr( "href" ).replace( /#.*$/, "" ), + beforeSend: function( jqXHR, settings ) { + return that._trigger( "beforeLoad", event, + $.extend( { jqXHR: jqXHR, ajaxSettings: settings }, eventData ) ); + } + }; + }, + + _getPanelForTab: function( tab ) { + var id = $( tab ).attr( "aria-controls" ); + return this.element.find( this._sanitizeSelector( "#" + id ) ); + } +} ); + +// DEPRECATED +// TODO: Switch return back to widget declaration at top of file when this is removed +if ( $.uiBackCompat !== false ) { + + // Backcompat for ui-tab class (now ui-tabs-tab) + $.widget( "ui.tabs", $.ui.tabs, { + _processTabs: function() { + this._superApply( arguments ); + this._addClass( this.tabs, "ui-tab" ); + } + } ); +} + +var widgetsTabs = $.ui.tabs; + + +/*! + * jQuery UI Tooltip 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], -10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); -;/* - * jQuery UI Effects Highlight 1.8.14 + +//>>label: Tooltip +//>>group: Widgets +//>>description: Shows additional information for any element on hover or focus. +//>>docs: http://api.jqueryui.com/tooltip/ +//>>demos: http://jqueryui.com/tooltip/ +//>>css.structure: ../../themes/base/core.css +//>>css.structure: ../../themes/base/tooltip.css +//>>css.theme: ../../themes/base/theme.css + + + +$.widget( "ui.tooltip", { + version: "1.12.1", + options: { + classes: { + "ui-tooltip": "ui-corner-all ui-widget-shadow" + }, + content: function() { + + // support: IE<9, Opera in jQuery <1.7 + // .text() can't accept undefined, so coerce to a string + var title = $( this ).attr( "title" ) || ""; + + // Escape title, since we're going from an attribute to raw HTML + return $( "<a>" ).text( title ).html(); + }, + hide: true, + + // Disabled elements have inconsistent behavior across browsers (#8661) + items: "[title]:not([disabled])", + position: { + my: "left top+15", + at: "left bottom", + collision: "flipfit flip" + }, + show: true, + track: false, + + // Callbacks + close: null, + open: null + }, + + _addDescribedBy: function( elem, id ) { + var describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ ); + describedby.push( id ); + elem + .data( "ui-tooltip-id", id ) + .attr( "aria-describedby", $.trim( describedby.join( " " ) ) ); + }, + + _removeDescribedBy: function( elem ) { + var id = elem.data( "ui-tooltip-id" ), + describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ ), + index = $.inArray( id, describedby ); + + if ( index !== -1 ) { + describedby.splice( index, 1 ); + } + + elem.removeData( "ui-tooltip-id" ); + describedby = $.trim( describedby.join( " " ) ); + if ( describedby ) { + elem.attr( "aria-describedby", describedby ); + } else { + elem.removeAttr( "aria-describedby" ); + } + }, + + _create: function() { + this._on( { + mouseover: "open", + focusin: "open" + } ); + + // IDs of generated tooltips, needed for destroy + this.tooltips = {}; + + // IDs of parent tooltips where we removed the title attribute + this.parents = {}; + + // Append the aria-live region so tooltips announce correctly + this.liveRegion = $( "<div>" ) + .attr( { + role: "log", + "aria-live": "assertive", + "aria-relevant": "additions" + } ) + .appendTo( this.document[ 0 ].body ); + this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" ); + + this.disabledTitles = $( [] ); + }, + + _setOption: function( key, value ) { + var that = this; + + this._super( key, value ); + + if ( key === "content" ) { + $.each( this.tooltips, function( id, tooltipData ) { + that._updateContent( tooltipData.element ); + } ); + } + }, + + _setOptionDisabled: function( value ) { + this[ value ? "_disable" : "_enable" ](); + }, + + _disable: function() { + var that = this; + + // Close open tooltips + $.each( this.tooltips, function( id, tooltipData ) { + var event = $.Event( "blur" ); + event.target = event.currentTarget = tooltipData.element[ 0 ]; + that.close( event, true ); + } ); + + // Remove title attributes to prevent native tooltips + this.disabledTitles = this.disabledTitles.add( + this.element.find( this.options.items ).addBack() + .filter( function() { + var element = $( this ); + if ( element.is( "[title]" ) ) { + return element + .data( "ui-tooltip-title", element.attr( "title" ) ) + .removeAttr( "title" ); + } + } ) + ); + }, + + _enable: function() { + + // restore title attributes + this.disabledTitles.each( function() { + var element = $( this ); + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } + } ); + this.disabledTitles = $( [] ); + }, + + open: function( event ) { + var that = this, + target = $( event ? event.target : this.element ) + + // we need closest here due to mouseover bubbling, + // but always pointing at the same event target + .closest( this.options.items ); + + // No element to show a tooltip for or the tooltip is already open + if ( !target.length || target.data( "ui-tooltip-id" ) ) { + return; + } + + if ( target.attr( "title" ) ) { + target.data( "ui-tooltip-title", target.attr( "title" ) ); + } + + target.data( "ui-tooltip-open", true ); + + // Kill parent tooltips, custom or native, for hover + if ( event && event.type === "mouseover" ) { + target.parents().each( function() { + var parent = $( this ), + blurEvent; + if ( parent.data( "ui-tooltip-open" ) ) { + blurEvent = $.Event( "blur" ); + blurEvent.target = blurEvent.currentTarget = this; + that.close( blurEvent, true ); + } + if ( parent.attr( "title" ) ) { + parent.uniqueId(); + that.parents[ this.id ] = { + element: this, + title: parent.attr( "title" ) + }; + parent.attr( "title", "" ); + } + } ); + } + + this._registerCloseHandlers( event, target ); + this._updateContent( target, event ); + }, + + _updateContent: function( target, event ) { + var content, + contentOption = this.options.content, + that = this, + eventType = event ? event.type : null; + + if ( typeof contentOption === "string" || contentOption.nodeType || + contentOption.jquery ) { + return this._open( event, target, contentOption ); + } + + content = contentOption.call( target[ 0 ], function( response ) { + + // IE may instantly serve a cached response for ajax requests + // delay this call to _open so the other call to _open runs first + that._delay( function() { + + // Ignore async response if tooltip was closed already + if ( !target.data( "ui-tooltip-open" ) ) { + return; + } + + // JQuery creates a special event for focusin when it doesn't + // exist natively. To improve performance, the native event + // object is reused and the type is changed. Therefore, we can't + // rely on the type being correct after the event finished + // bubbling, so we set it back to the previous value. (#8740) + if ( event ) { + event.type = eventType; + } + this._open( event, target, response ); + } ); + } ); + if ( content ) { + this._open( event, target, content ); + } + }, + + _open: function( event, target, content ) { + var tooltipData, tooltip, delayedShow, a11yContent, + positionOption = $.extend( {}, this.options.position ); + + if ( !content ) { + return; + } + + // Content can be updated multiple times. If the tooltip already + // exists, then just update the content and bail. + tooltipData = this._find( target ); + if ( tooltipData ) { + tooltipData.tooltip.find( ".ui-tooltip-content" ).html( content ); + return; + } + + // If we have a title, clear it to prevent the native tooltip + // we have to check first to avoid defining a title if none exists + // (we don't want to cause an element to start matching [title]) + // + // We use removeAttr only for key events, to allow IE to export the correct + // accessible attributes. For mouse events, set to empty string to avoid + // native tooltip showing up (happens only when removing inside mouseover). + if ( target.is( "[title]" ) ) { + if ( event && event.type === "mouseover" ) { + target.attr( "title", "" ); + } else { + target.removeAttr( "title" ); + } + } + + tooltipData = this._tooltip( target ); + tooltip = tooltipData.tooltip; + this._addDescribedBy( target, tooltip.attr( "id" ) ); + tooltip.find( ".ui-tooltip-content" ).html( content ); + + // Support: Voiceover on OS X, JAWS on IE <= 9 + // JAWS announces deletions even when aria-relevant="additions" + // Voiceover will sometimes re-read the entire log region's contents from the beginning + this.liveRegion.children().hide(); + a11yContent = $( "<div>" ).html( tooltip.find( ".ui-tooltip-content" ).html() ); + a11yContent.removeAttr( "name" ).find( "[name]" ).removeAttr( "name" ); + a11yContent.removeAttr( "id" ).find( "[id]" ).removeAttr( "id" ); + a11yContent.appendTo( this.liveRegion ); + + function position( event ) { + positionOption.of = event; + if ( tooltip.is( ":hidden" ) ) { + return; + } + tooltip.position( positionOption ); + } + if ( this.options.track && event && /^mouse/.test( event.type ) ) { + this._on( this.document, { + mousemove: position + } ); + + // trigger once to override element-relative positioning + position( event ); + } else { + tooltip.position( $.extend( { + of: target + }, this.options.position ) ); + } + + tooltip.hide(); + + this._show( tooltip, this.options.show ); + + // Handle tracking tooltips that are shown with a delay (#8644). As soon + // as the tooltip is visible, position the tooltip using the most recent + // event. + // Adds the check to add the timers only when both delay and track options are set (#14682) + if ( this.options.track && this.options.show && this.options.show.delay ) { + delayedShow = this.delayedShow = setInterval( function() { + if ( tooltip.is( ":visible" ) ) { + position( positionOption.of ); + clearInterval( delayedShow ); + } + }, $.fx.interval ); + } + + this._trigger( "open", event, { tooltip: tooltip } ); + }, + + _registerCloseHandlers: function( event, target ) { + var events = { + keyup: function( event ) { + if ( event.keyCode === $.ui.keyCode.ESCAPE ) { + var fakeEvent = $.Event( event ); + fakeEvent.currentTarget = target[ 0 ]; + this.close( fakeEvent, true ); + } + } + }; + + // Only bind remove handler for delegated targets. Non-delegated + // tooltips will handle this in destroy. + if ( target[ 0 ] !== this.element[ 0 ] ) { + events.remove = function() { + this._removeTooltip( this._find( target ).tooltip ); + }; + } + + if ( !event || event.type === "mouseover" ) { + events.mouseleave = "close"; + } + if ( !event || event.type === "focusin" ) { + events.focusout = "close"; + } + this._on( true, target, events ); + }, + + close: function( event ) { + var tooltip, + that = this, + target = $( event ? event.currentTarget : this.element ), + tooltipData = this._find( target ); + + // The tooltip may already be closed + if ( !tooltipData ) { + + // We set ui-tooltip-open immediately upon open (in open()), but only set the + // additional data once there's actually content to show (in _open()). So even if the + // tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in + // the period between open() and _open(). + target.removeData( "ui-tooltip-open" ); + return; + } + + tooltip = tooltipData.tooltip; + + // Disabling closes the tooltip, so we need to track when we're closing + // to avoid an infinite loop in case the tooltip becomes disabled on close + if ( tooltipData.closing ) { + return; + } + + // Clear the interval for delayed tracking tooltips + clearInterval( this.delayedShow ); + + // Only set title if we had one before (see comment in _open()) + // If the title attribute has changed since open(), don't restore + if ( target.data( "ui-tooltip-title" ) && !target.attr( "title" ) ) { + target.attr( "title", target.data( "ui-tooltip-title" ) ); + } + + this._removeDescribedBy( target ); + + tooltipData.hiding = true; + tooltip.stop( true ); + this._hide( tooltip, this.options.hide, function() { + that._removeTooltip( $( this ) ); + } ); + + target.removeData( "ui-tooltip-open" ); + this._off( target, "mouseleave focusout keyup" ); + + // Remove 'remove' binding only on delegated targets + if ( target[ 0 ] !== this.element[ 0 ] ) { + this._off( target, "remove" ); + } + this._off( this.document, "mousemove" ); + + if ( event && event.type === "mouseleave" ) { + $.each( this.parents, function( id, parent ) { + $( parent.element ).attr( "title", parent.title ); + delete that.parents[ id ]; + } ); + } + + tooltipData.closing = true; + this._trigger( "close", event, { tooltip: tooltip } ); + if ( !tooltipData.hiding ) { + tooltipData.closing = false; + } + }, + + _tooltip: function( element ) { + var tooltip = $( "<div>" ).attr( "role", "tooltip" ), + content = $( "<div>" ).appendTo( tooltip ), + id = tooltip.uniqueId().attr( "id" ); + + this._addClass( content, "ui-tooltip-content" ); + this._addClass( tooltip, "ui-tooltip", "ui-widget ui-widget-content" ); + + tooltip.appendTo( this._appendTo( element ) ); + + return this.tooltips[ id ] = { + element: element, + tooltip: tooltip + }; + }, + + _find: function( target ) { + var id = target.data( "ui-tooltip-id" ); + return id ? this.tooltips[ id ] : null; + }, + + _removeTooltip: function( tooltip ) { + tooltip.remove(); + delete this.tooltips[ tooltip.attr( "id" ) ]; + }, + + _appendTo: function( target ) { + var element = target.closest( ".ui-front, dialog" ); + + if ( !element.length ) { + element = this.document[ 0 ].body; + } + + return element; + }, + + _destroy: function() { + var that = this; + + // Close open tooltips + $.each( this.tooltips, function( id, tooltipData ) { + + // Delegate to close method to handle common cleanup + var event = $.Event( "blur" ), + element = tooltipData.element; + event.target = event.currentTarget = element[ 0 ]; + that.close( event, true ); + + // Remove immediately; destroying an open tooltip doesn't use the + // hide animation + $( "#" + id ).remove(); + + // Restore the title + if ( element.data( "ui-tooltip-title" ) ) { + + // If the title attribute has changed since open(), don't restore + if ( !element.attr( "title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } + element.removeData( "ui-tooltip-title" ); + } + } ); + this.liveRegion.remove(); + } +} ); + +// DEPRECATED +// TODO: Switch return back to widget declaration at top of file when this is removed +if ( $.uiBackCompat !== false ) { + + // Backcompat for tooltipClass option + $.widget( "ui.tooltip", $.ui.tooltip, { + options: { + tooltipClass: null + }, + _tooltip: function() { + var tooltipData = this._superApply( arguments ); + if ( this.options.tooltipClass ) { + tooltipData.tooltip.addClass( this.options.tooltipClass ); + } + return tooltipData; + } + } ); +} + +var widgetsTooltip = $.ui.tooltip; + + +/*! + * jQuery UI Effects 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Effects Core +//>>group: Effects +// jscs:disable maximumLineLength +//>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects. +// jscs:enable maximumLineLength +//>>docs: http://api.jqueryui.com/category/effects-core/ +//>>demos: http://jqueryui.com/effect/ + + + +var dataSpace = "ui-effects-", + dataSpaceStyle = "ui-effects-style", + dataSpaceAnimated = "ui-effects-animated", + + // Create a local jQuery because jQuery Color relies on it and the + // global may not exist with AMD and a custom build (#10199) + jQuery = $; + +$.effects = { + effect: {} +}; + +/*! + * jQuery Color Animations v2.1.2 + * https://github.com/jquery/jquery-color * - * http://docs.jquery.com/UI/Effects/Highlight + * Copyright 2014 jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license * - * Depends: - * jquery.effects.core.js + * Date: Wed Jan 16 08:47:09 2013 -0600 */ -(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& -this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Pulsate 1.8.14 +( function( jQuery, undefined ) { + + var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " + + "borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor", + + // Plusequals test for += 100 -= 100 + rplusequals = /^([\-+])=\s*(\d+\.?\d*)/, + + // A set of RE's that can match strings and generate color tuples. + stringParsers = [ { + re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ], + execResult[ 3 ], + execResult[ 4 ] + ]; + } + }, { + re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ] * 2.55, + execResult[ 2 ] * 2.55, + execResult[ 3 ] * 2.55, + execResult[ 4 ] + ]; + } + }, { + + // This regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ], 16 ) + ]; + } + }, { + + // This regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9])([a-f0-9])([a-f0-9])/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ] + execResult[ 3 ], 16 ) + ]; + } + }, { + re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + space: "hsla", + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ] / 100, + execResult[ 3 ] / 100, + execResult[ 4 ] + ]; + } + } ], + + // JQuery.Color( ) + color = jQuery.Color = function( color, green, blue, alpha ) { + return new jQuery.Color.fn.parse( color, green, blue, alpha ); + }, + spaces = { + rgba: { + props: { + red: { + idx: 0, + type: "byte" + }, + green: { + idx: 1, + type: "byte" + }, + blue: { + idx: 2, + type: "byte" + } + } + }, + + hsla: { + props: { + hue: { + idx: 0, + type: "degrees" + }, + saturation: { + idx: 1, + type: "percent" + }, + lightness: { + idx: 2, + type: "percent" + } + } + } + }, + propTypes = { + "byte": { + floor: true, + max: 255 + }, + "percent": { + max: 1 + }, + "degrees": { + mod: 360, + floor: true + } + }, + support = color.support = {}, + + // Element for support tests + supportElem = jQuery( "<p>" )[ 0 ], + + // Colors = jQuery.Color.names + colors, + + // Local aliases of functions called often + each = jQuery.each; + +// Determine rgba support immediately +supportElem.style.cssText = "background-color:rgba(1,1,1,.5)"; +support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1; + +// Define cache name and alpha properties +// for rgba and hsla spaces +each( spaces, function( spaceName, space ) { + space.cache = "_" + spaceName; + space.props.alpha = { + idx: 3, + type: "percent", + def: 1 + }; +} ); + +function clamp( value, prop, allowEmpty ) { + var type = propTypes[ prop.type ] || {}; + + if ( value == null ) { + return ( allowEmpty || !prop.def ) ? null : prop.def; + } + + // ~~ is an short way of doing floor for positive numbers + value = type.floor ? ~~value : parseFloat( value ); + + // IE will pass in empty strings as value for alpha, + // which will hit this case + if ( isNaN( value ) ) { + return prop.def; + } + + if ( type.mod ) { + + // We add mod before modding to make sure that negatives values + // get converted properly: -10 -> 350 + return ( value + type.mod ) % type.mod; + } + + // For now all property types without mod have min and max + return 0 > value ? 0 : type.max < value ? type.max : value; +} + +function stringParse( string ) { + var inst = color(), + rgba = inst._rgba = []; + + string = string.toLowerCase(); + + each( stringParsers, function( i, parser ) { + var parsed, + match = parser.re.exec( string ), + values = match && parser.parse( match ), + spaceName = parser.space || "rgba"; + + if ( values ) { + parsed = inst[ spaceName ]( values ); + + // If this was an rgba parse the assignment might happen twice + // oh well.... + inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ]; + rgba = inst._rgba = parsed._rgba; + + // Exit each( stringParsers ) here because we matched + return false; + } + } ); + + // Found a stringParser that handled it + if ( rgba.length ) { + + // If this came from a parsed string, force "transparent" when alpha is 0 + // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0) + if ( rgba.join() === "0,0,0,0" ) { + jQuery.extend( rgba, colors.transparent ); + } + return inst; + } + + // Named colors + return colors[ string ]; +} + +color.fn = jQuery.extend( color.prototype, { + parse: function( red, green, blue, alpha ) { + if ( red === undefined ) { + this._rgba = [ null, null, null, null ]; + return this; + } + if ( red.jquery || red.nodeType ) { + red = jQuery( red ).css( green ); + green = undefined; + } + + var inst = this, + type = jQuery.type( red ), + rgba = this._rgba = []; + + // More than 1 argument specified - assume ( red, green, blue, alpha ) + if ( green !== undefined ) { + red = [ red, green, blue, alpha ]; + type = "array"; + } + + if ( type === "string" ) { + return this.parse( stringParse( red ) || colors._default ); + } + + if ( type === "array" ) { + each( spaces.rgba.props, function( key, prop ) { + rgba[ prop.idx ] = clamp( red[ prop.idx ], prop ); + } ); + return this; + } + + if ( type === "object" ) { + if ( red instanceof color ) { + each( spaces, function( spaceName, space ) { + if ( red[ space.cache ] ) { + inst[ space.cache ] = red[ space.cache ].slice(); + } + } ); + } else { + each( spaces, function( spaceName, space ) { + var cache = space.cache; + each( space.props, function( key, prop ) { + + // If the cache doesn't exist, and we know how to convert + if ( !inst[ cache ] && space.to ) { + + // If the value was null, we don't need to copy it + // if the key was alpha, we don't need to copy it either + if ( key === "alpha" || red[ key ] == null ) { + return; + } + inst[ cache ] = space.to( inst._rgba ); + } + + // This is the only case where we allow nulls for ALL properties. + // call clamp with alwaysAllowEmpty + inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true ); + } ); + + // Everything defined but alpha? + if ( inst[ cache ] && + jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) { + + // Use the default of 1 + inst[ cache ][ 3 ] = 1; + if ( space.from ) { + inst._rgba = space.from( inst[ cache ] ); + } + } + } ); + } + return this; + } + }, + is: function( compare ) { + var is = color( compare ), + same = true, + inst = this; + + each( spaces, function( _, space ) { + var localCache, + isCache = is[ space.cache ]; + if ( isCache ) { + localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || []; + each( space.props, function( _, prop ) { + if ( isCache[ prop.idx ] != null ) { + same = ( isCache[ prop.idx ] === localCache[ prop.idx ] ); + return same; + } + } ); + } + return same; + } ); + return same; + }, + _space: function() { + var used = [], + inst = this; + each( spaces, function( spaceName, space ) { + if ( inst[ space.cache ] ) { + used.push( spaceName ); + } + } ); + return used.pop(); + }, + transition: function( other, distance ) { + var end = color( other ), + spaceName = end._space(), + space = spaces[ spaceName ], + startColor = this.alpha() === 0 ? color( "transparent" ) : this, + start = startColor[ space.cache ] || space.to( startColor._rgba ), + result = start.slice(); + + end = end[ space.cache ]; + each( space.props, function( key, prop ) { + var index = prop.idx, + startValue = start[ index ], + endValue = end[ index ], + type = propTypes[ prop.type ] || {}; + + // If null, don't override start value + if ( endValue === null ) { + return; + } + + // If null - use end + if ( startValue === null ) { + result[ index ] = endValue; + } else { + if ( type.mod ) { + if ( endValue - startValue > type.mod / 2 ) { + startValue += type.mod; + } else if ( startValue - endValue > type.mod / 2 ) { + startValue -= type.mod; + } + } + result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop ); + } + } ); + return this[ spaceName ]( result ); + }, + blend: function( opaque ) { + + // If we are already opaque - return ourself + if ( this._rgba[ 3 ] === 1 ) { + return this; + } + + var rgb = this._rgba.slice(), + a = rgb.pop(), + blend = color( opaque )._rgba; + + return color( jQuery.map( rgb, function( v, i ) { + return ( 1 - a ) * blend[ i ] + a * v; + } ) ); + }, + toRgbaString: function() { + var prefix = "rgba(", + rgba = jQuery.map( this._rgba, function( v, i ) { + return v == null ? ( i > 2 ? 1 : 0 ) : v; + } ); + + if ( rgba[ 3 ] === 1 ) { + rgba.pop(); + prefix = "rgb("; + } + + return prefix + rgba.join() + ")"; + }, + toHslaString: function() { + var prefix = "hsla(", + hsla = jQuery.map( this.hsla(), function( v, i ) { + if ( v == null ) { + v = i > 2 ? 1 : 0; + } + + // Catch 1 and 2 + if ( i && i < 3 ) { + v = Math.round( v * 100 ) + "%"; + } + return v; + } ); + + if ( hsla[ 3 ] === 1 ) { + hsla.pop(); + prefix = "hsl("; + } + return prefix + hsla.join() + ")"; + }, + toHexString: function( includeAlpha ) { + var rgba = this._rgba.slice(), + alpha = rgba.pop(); + + if ( includeAlpha ) { + rgba.push( ~~( alpha * 255 ) ); + } + + return "#" + jQuery.map( rgba, function( v ) { + + // Default to 0 when nulls exist + v = ( v || 0 ).toString( 16 ); + return v.length === 1 ? "0" + v : v; + } ).join( "" ); + }, + toString: function() { + return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString(); + } +} ); +color.fn.parse.prototype = color.fn; + +// Hsla conversions adapted from: +// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021 + +function hue2rgb( p, q, h ) { + h = ( h + 1 ) % 1; + if ( h * 6 < 1 ) { + return p + ( q - p ) * h * 6; + } + if ( h * 2 < 1 ) { + return q; + } + if ( h * 3 < 2 ) { + return p + ( q - p ) * ( ( 2 / 3 ) - h ) * 6; + } + return p; +} + +spaces.hsla.to = function( rgba ) { + if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) { + return [ null, null, null, rgba[ 3 ] ]; + } + var r = rgba[ 0 ] / 255, + g = rgba[ 1 ] / 255, + b = rgba[ 2 ] / 255, + a = rgba[ 3 ], + max = Math.max( r, g, b ), + min = Math.min( r, g, b ), + diff = max - min, + add = max + min, + l = add * 0.5, + h, s; + + if ( min === max ) { + h = 0; + } else if ( r === max ) { + h = ( 60 * ( g - b ) / diff ) + 360; + } else if ( g === max ) { + h = ( 60 * ( b - r ) / diff ) + 120; + } else { + h = ( 60 * ( r - g ) / diff ) + 240; + } + + // Chroma (diff) == 0 means greyscale which, by definition, saturation = 0% + // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add) + if ( diff === 0 ) { + s = 0; + } else if ( l <= 0.5 ) { + s = diff / add; + } else { + s = diff / ( 2 - add ); + } + return [ Math.round( h ) % 360, s, l, a == null ? 1 : a ]; +}; + +spaces.hsla.from = function( hsla ) { + if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) { + return [ null, null, null, hsla[ 3 ] ]; + } + var h = hsla[ 0 ] / 360, + s = hsla[ 1 ], + l = hsla[ 2 ], + a = hsla[ 3 ], + q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s, + p = 2 * l - q; + + return [ + Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ), + Math.round( hue2rgb( p, q, h ) * 255 ), + Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ), + a + ]; +}; + +each( spaces, function( spaceName, space ) { + var props = space.props, + cache = space.cache, + to = space.to, + from = space.from; + + // Makes rgba() and hsla() + color.fn[ spaceName ] = function( value ) { + + // Generate a cache for this space if it doesn't exist + if ( to && !this[ cache ] ) { + this[ cache ] = to( this._rgba ); + } + if ( value === undefined ) { + return this[ cache ].slice(); + } + + var ret, + type = jQuery.type( value ), + arr = ( type === "array" || type === "object" ) ? value : arguments, + local = this[ cache ].slice(); + + each( props, function( key, prop ) { + var val = arr[ type === "object" ? key : prop.idx ]; + if ( val == null ) { + val = local[ prop.idx ]; + } + local[ prop.idx ] = clamp( val, prop ); + } ); + + if ( from ) { + ret = color( from( local ) ); + ret[ cache ] = local; + return ret; + } else { + return color( local ); + } + }; + + // Makes red() green() blue() alpha() hue() saturation() lightness() + each( props, function( key, prop ) { + + // Alpha is included in more than one space + if ( color.fn[ key ] ) { + return; + } + color.fn[ key ] = function( value ) { + var vtype = jQuery.type( value ), + fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ), + local = this[ fn ](), + cur = local[ prop.idx ], + match; + + if ( vtype === "undefined" ) { + return cur; + } + + if ( vtype === "function" ) { + value = value.call( this, cur ); + vtype = jQuery.type( value ); + } + if ( value == null && prop.empty ) { + return this; + } + if ( vtype === "string" ) { + match = rplusequals.exec( value ); + if ( match ) { + value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 ); + } + } + local[ prop.idx ] = value; + return this[ fn ]( local ); + }; + } ); +} ); + +// Add cssHook and .fx.step function for each named hook. +// accept a space separated string of properties +color.hook = function( hook ) { + var hooks = hook.split( " " ); + each( hooks, function( i, hook ) { + jQuery.cssHooks[ hook ] = { + set: function( elem, value ) { + var parsed, curElem, + backgroundColor = ""; + + if ( value !== "transparent" && ( jQuery.type( value ) !== "string" || + ( parsed = stringParse( value ) ) ) ) { + value = color( parsed || value ); + if ( !support.rgba && value._rgba[ 3 ] !== 1 ) { + curElem = hook === "backgroundColor" ? elem.parentNode : elem; + while ( + ( backgroundColor === "" || backgroundColor === "transparent" ) && + curElem && curElem.style + ) { + try { + backgroundColor = jQuery.css( curElem, "backgroundColor" ); + curElem = curElem.parentNode; + } catch ( e ) { + } + } + + value = value.blend( backgroundColor && backgroundColor !== "transparent" ? + backgroundColor : + "_default" ); + } + + value = value.toRgbaString(); + } + try { + elem.style[ hook ] = value; + } catch ( e ) { + + // Wrapped to prevent IE from throwing errors on "invalid" values like + // 'auto' or 'inherit' + } + } + }; + jQuery.fx.step[ hook ] = function( fx ) { + if ( !fx.colorInit ) { + fx.start = color( fx.elem, hook ); + fx.end = color( fx.end ); + fx.colorInit = true; + } + jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) ); + }; + } ); + +}; + +color.hook( stepHooks ); + +jQuery.cssHooks.borderColor = { + expand: function( value ) { + var expanded = {}; + + each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) { + expanded[ "border" + part + "Color" ] = value; + } ); + return expanded; + } +}; + +// Basic color names only. +// Usage of any of the other color names requires adding yourself or including +// jquery.color.svg-names.js. +colors = jQuery.Color.names = { + + // 4.1. Basic color keywords + aqua: "#00ffff", + black: "#000000", + blue: "#0000ff", + fuchsia: "#ff00ff", + gray: "#808080", + green: "#008000", + lime: "#00ff00", + maroon: "#800000", + navy: "#000080", + olive: "#808000", + purple: "#800080", + red: "#ff0000", + silver: "#c0c0c0", + teal: "#008080", + white: "#ffffff", + yellow: "#ffff00", + + // 4.2.3. "transparent" color keyword + transparent: [ null, null, null, 0 ], + + _default: "#ffffff" +}; + +} )( jQuery ); + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ +( function() { + +var classAnimationActions = [ "add", "remove", "toggle" ], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +$.each( + [ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], + function( _, prop ) { + $.fx.step[ prop ] = function( fx ) { + if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) { + jQuery.style( fx.elem, prop, fx.end ); + fx.setAttr = true; + } + }; + } +); + +function getElementStyles( elem ) { + var key, len, + style = elem.ownerDocument.defaultView ? + elem.ownerDocument.defaultView.getComputedStyle( elem, null ) : + elem.currentStyle, + styles = {}; + + if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) { + len = style.length; + while ( len-- ) { + key = style[ len ]; + if ( typeof style[ key ] === "string" ) { + styles[ $.camelCase( key ) ] = style[ key ]; + } + } + + // Support: Opera, IE <9 + } else { + for ( key in style ) { + if ( typeof style[ key ] === "string" ) { + styles[ key ] = style[ key ]; + } + } + } + + return styles; +} + +function styleDifference( oldStyle, newStyle ) { + var diff = {}, + name, value; + + for ( name in newStyle ) { + value = newStyle[ name ]; + if ( oldStyle[ name ] !== value ) { + if ( !shorthandStyles[ name ] ) { + if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) { + diff[ name ] = value; + } + } + } + } + + return diff; +} + +// Support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +$.effects.animateClass = function( value, duration, easing, callback ) { + var o = $.speed( duration, easing, callback ); + + return this.queue( function() { + var animated = $( this ), + baseClass = animated.attr( "class" ) || "", + applyClassChange, + allAnimations = o.children ? animated.find( "*" ).addBack() : animated; + + // Map the animated objects to store the original styles. + allAnimations = allAnimations.map( function() { + var el = $( this ); + return { + el: el, + start: getElementStyles( this ) + }; + } ); + + // Apply class change + applyClassChange = function() { + $.each( classAnimationActions, function( i, action ) { + if ( value[ action ] ) { + animated[ action + "Class" ]( value[ action ] ); + } + } ); + }; + applyClassChange(); + + // Map all animated objects again - calculate new styles and diff + allAnimations = allAnimations.map( function() { + this.end = getElementStyles( this.el[ 0 ] ); + this.diff = styleDifference( this.start, this.end ); + return this; + } ); + + // Apply original class + animated.attr( "class", baseClass ); + + // Map all animated objects again - this time collecting a promise + allAnimations = allAnimations.map( function() { + var styleInfo = this, + dfd = $.Deferred(), + opts = $.extend( {}, o, { + queue: false, + complete: function() { + dfd.resolve( styleInfo ); + } + } ); + + this.el.animate( this.diff, opts ); + return dfd.promise(); + } ); + + // Once all animations have completed: + $.when.apply( $, allAnimations.get() ).done( function() { + + // Set the final class + applyClassChange(); + + // For each animated element, + // clear all css properties that were animated + $.each( arguments, function() { + var el = this.el; + $.each( this.diff, function( key ) { + el.css( key, "" ); + } ); + } ); + + // This is guarnteed to be there if you use jQuery.speed() + // it also handles dequeuing the next anim... + o.complete.call( animated[ 0 ] ); + } ); + } ); +}; + +$.fn.extend( { + addClass: ( function( orig ) { + return function( classNames, speed, easing, callback ) { + return speed ? + $.effects.animateClass.call( this, + { add: classNames }, speed, easing, callback ) : + orig.apply( this, arguments ); + }; + } )( $.fn.addClass ), + + removeClass: ( function( orig ) { + return function( classNames, speed, easing, callback ) { + return arguments.length > 1 ? + $.effects.animateClass.call( this, + { remove: classNames }, speed, easing, callback ) : + orig.apply( this, arguments ); + }; + } )( $.fn.removeClass ), + + toggleClass: ( function( orig ) { + return function( classNames, force, speed, easing, callback ) { + if ( typeof force === "boolean" || force === undefined ) { + if ( !speed ) { + + // Without speed parameter + return orig.apply( this, arguments ); + } else { + return $.effects.animateClass.call( this, + ( force ? { add: classNames } : { remove: classNames } ), + speed, easing, callback ); + } + } else { + + // Without force parameter + return $.effects.animateClass.call( this, + { toggle: classNames }, force, speed, easing ); + } + }; + } )( $.fn.toggleClass ), + + switchClass: function( remove, add, speed, easing, callback ) { + return $.effects.animateClass.call( this, { + add: add, + remove: remove + }, speed, easing, callback ); + } +} ); + +} )(); + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +( function() { + +if ( $.expr && $.expr.filters && $.expr.filters.animated ) { + $.expr.filters.animated = ( function( orig ) { + return function( elem ) { + return !!$( elem ).data( dataSpaceAnimated ) || orig( elem ); + }; + } )( $.expr.filters.animated ); +} + +if ( $.uiBackCompat !== false ) { + $.extend( $.effects, { + + // Saves a set of properties in a data storage + save: function( element, set ) { + var i = 0, length = set.length; + for ( ; i < length; i++ ) { + if ( set[ i ] !== null ) { + element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] ); + } + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function( element, set ) { + var val, i = 0, length = set.length; + for ( ; i < length; i++ ) { + if ( set[ i ] !== null ) { + val = element.data( dataSpace + set[ i ] ); + element.css( set[ i ], val ); + } + } + }, + + setMode: function( el, mode ) { + if ( mode === "toggle" ) { + mode = el.is( ":hidden" ) ? "show" : "hide"; + } + return mode; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function( element ) { + + // If the element is already wrapped, return it + if ( element.parent().is( ".ui-effects-wrapper" ) ) { + return element.parent(); + } + + // Wrap the element + var props = { + width: element.outerWidth( true ), + height: element.outerHeight( true ), + "float": element.css( "float" ) + }, + wrapper = $( "<div></div>" ) + .addClass( "ui-effects-wrapper" ) + .css( { + fontSize: "100%", + background: "transparent", + border: "none", + margin: 0, + padding: 0 + } ), + + // Store the size in case width/height are defined in % - Fixes #5245 + size = { + width: element.width(), + height: element.height() + }, + active = document.activeElement; + + // Support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch ( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).trigger( "focus" ); + } + + // Hotfix for jQuery 1.4 since some change in wrap() seems to actually + // lose the reference to the wrapped element + wrapper = element.parent(); + + // Transfer positioning properties to the wrapper + if ( element.css( "position" ) === "static" ) { + wrapper.css( { position: "relative" } ); + element.css( { position: "relative" } ); + } else { + $.extend( props, { + position: element.css( "position" ), + zIndex: element.css( "z-index" ) + } ); + $.each( [ "top", "left", "bottom", "right" ], function( i, pos ) { + props[ pos ] = element.css( pos ); + if ( isNaN( parseInt( props[ pos ], 10 ) ) ) { + props[ pos ] = "auto"; + } + } ); + element.css( { + position: "relative", + top: 0, + left: 0, + right: "auto", + bottom: "auto" + } ); + } + element.css( size ); + + return wrapper.css( props ).show(); + }, + + removeWrapper: function( element ) { + var active = document.activeElement; + + if ( element.parent().is( ".ui-effects-wrapper" ) ) { + element.parent().replaceWith( element ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).trigger( "focus" ); + } + } + + return element; + } + } ); +} + +$.extend( $.effects, { + version: "1.12.1", + + define: function( name, mode, effect ) { + if ( !effect ) { + effect = mode; + mode = "effect"; + } + + $.effects.effect[ name ] = effect; + $.effects.effect[ name ].mode = mode; + + return effect; + }, + + scaledDimensions: function( element, percent, direction ) { + if ( percent === 0 ) { + return { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + }; + } + + var x = direction !== "horizontal" ? ( ( percent || 100 ) / 100 ) : 1, + y = direction !== "vertical" ? ( ( percent || 100 ) / 100 ) : 1; + + return { + height: element.height() * y, + width: element.width() * x, + outerHeight: element.outerHeight() * y, + outerWidth: element.outerWidth() * x + }; + + }, + + clipToBox: function( animation ) { + return { + width: animation.clip.right - animation.clip.left, + height: animation.clip.bottom - animation.clip.top, + left: animation.clip.left, + top: animation.clip.top + }; + }, + + // Injects recently queued functions to be first in line (after "inprogress") + unshift: function( element, queueLength, count ) { + var queue = element.queue(); + + if ( queueLength > 1 ) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queueLength, count ) ) ); + } + element.dequeue(); + }, + + saveStyle: function( element ) { + element.data( dataSpaceStyle, element[ 0 ].style.cssText ); + }, + + restoreStyle: function( element ) { + element[ 0 ].style.cssText = element.data( dataSpaceStyle ) || ""; + element.removeData( dataSpaceStyle ); + }, + + mode: function( element, mode ) { + var hidden = element.is( ":hidden" ); + + if ( mode === "toggle" ) { + mode = hidden ? "show" : "hide"; + } + if ( hidden ? mode === "hide" : mode === "show" ) { + mode = "none"; + } + return mode; + }, + + // Translates a [top,left] array into a baseline value + getBaseline: function( origin, original ) { + var y, x; + + switch ( origin[ 0 ] ) { + case "top": + y = 0; + break; + case "middle": + y = 0.5; + break; + case "bottom": + y = 1; + break; + default: + y = origin[ 0 ] / original.height; + } + + switch ( origin[ 1 ] ) { + case "left": + x = 0; + break; + case "center": + x = 0.5; + break; + case "right": + x = 1; + break; + default: + x = origin[ 1 ] / original.width; + } + + return { + x: x, + y: y + }; + }, + + // Creates a placeholder element so that the original element can be made absolute + createPlaceholder: function( element ) { + var placeholder, + cssPosition = element.css( "position" ), + position = element.position(); + + // Lock in margins first to account for form elements, which + // will change margin if you explicitly set height + // see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380 + // Support: Safari + element.css( { + marginTop: element.css( "marginTop" ), + marginBottom: element.css( "marginBottom" ), + marginLeft: element.css( "marginLeft" ), + marginRight: element.css( "marginRight" ) + } ) + .outerWidth( element.outerWidth() ) + .outerHeight( element.outerHeight() ); + + if ( /^(static|relative)/.test( cssPosition ) ) { + cssPosition = "absolute"; + + placeholder = $( "<" + element[ 0 ].nodeName + ">" ).insertAfter( element ).css( { + + // Convert inline to inline block to account for inline elements + // that turn to inline block based on content (like img) + display: /^(inline|ruby)/.test( element.css( "display" ) ) ? + "inline-block" : + "block", + visibility: "hidden", + + // Margins need to be set to account for margin collapse + marginTop: element.css( "marginTop" ), + marginBottom: element.css( "marginBottom" ), + marginLeft: element.css( "marginLeft" ), + marginRight: element.css( "marginRight" ), + "float": element.css( "float" ) + } ) + .outerWidth( element.outerWidth() ) + .outerHeight( element.outerHeight() ) + .addClass( "ui-effects-placeholder" ); + + element.data( dataSpace + "placeholder", placeholder ); + } + + element.css( { + position: cssPosition, + left: position.left, + top: position.top + } ); + + return placeholder; + }, + + removePlaceholder: function( element ) { + var dataKey = dataSpace + "placeholder", + placeholder = element.data( dataKey ); + + if ( placeholder ) { + placeholder.remove(); + element.removeData( dataKey ); + } + }, + + // Removes a placeholder if it exists and restores + // properties that were modified during placeholder creation + cleanUp: function( element ) { + $.effects.restoreStyle( element ); + $.effects.removePlaceholder( element ); + }, + + setTransition: function( element, list, factor, value ) { + value = value || {}; + $.each( list, function( i, x ) { + var unit = element.cssUnit( x ); + if ( unit[ 0 ] > 0 ) { + value[ x ] = unit[ 0 ] * factor + unit[ 1 ]; + } + } ); + return value; + } +} ); + +// Return an effect options object for the given parameters: +function _normalizeArguments( effect, options, speed, callback ) { + + // Allow passing all options as the first parameter + if ( $.isPlainObject( effect ) ) { + options = effect; + effect = effect.effect; + } + + // Convert to an object + effect = { effect: effect }; + + // Catch (effect, null, ...) + if ( options == null ) { + options = {}; + } + + // Catch (effect, callback) + if ( $.isFunction( options ) ) { + callback = options; + speed = null; + options = {}; + } + + // Catch (effect, speed, ?) + if ( typeof options === "number" || $.fx.speeds[ options ] ) { + callback = speed; + speed = options; + options = {}; + } + + // Catch (effect, options, callback) + if ( $.isFunction( speed ) ) { + callback = speed; + speed = null; + } + + // Add options to effect + if ( options ) { + $.extend( effect, options ); + } + + speed = speed || options.duration; + effect.duration = $.fx.off ? 0 : + typeof speed === "number" ? speed : + speed in $.fx.speeds ? $.fx.speeds[ speed ] : + $.fx.speeds._default; + + effect.complete = callback || options.complete; + + return effect; +} + +function standardAnimationOption( option ) { + + // Valid standard speeds (nothing, number, named speed) + if ( !option || typeof option === "number" || $.fx.speeds[ option ] ) { + return true; + } + + // Invalid strings - treat as "normal" speed + if ( typeof option === "string" && !$.effects.effect[ option ] ) { + return true; + } + + // Complete callback + if ( $.isFunction( option ) ) { + return true; + } + + // Options hash (but not naming an effect) + if ( typeof option === "object" && !option.effect ) { + return true; + } + + // Didn't match any standard API + return false; +} + +$.fn.extend( { + effect: function( /* effect, options, speed, callback */ ) { + var args = _normalizeArguments.apply( this, arguments ), + effectMethod = $.effects.effect[ args.effect ], + defaultMode = effectMethod.mode, + queue = args.queue, + queueName = queue || "fx", + complete = args.complete, + mode = args.mode, + modes = [], + prefilter = function( next ) { + var el = $( this ), + normalizedMode = $.effects.mode( el, mode ) || defaultMode; + + // Sentinel for duck-punching the :animated psuedo-selector + el.data( dataSpaceAnimated, true ); + + // Save effect mode for later use, + // we can't just call $.effects.mode again later, + // as the .show() below destroys the initial state + modes.push( normalizedMode ); + + // See $.uiBackCompat inside of run() for removal of defaultMode in 1.13 + if ( defaultMode && ( normalizedMode === "show" || + ( normalizedMode === defaultMode && normalizedMode === "hide" ) ) ) { + el.show(); + } + + if ( !defaultMode || normalizedMode !== "none" ) { + $.effects.saveStyle( el ); + } + + if ( $.isFunction( next ) ) { + next(); + } + }; + + if ( $.fx.off || !effectMethod ) { + + // Delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args.duration, complete ); + } else { + return this.each( function() { + if ( complete ) { + complete.call( this ); + } + } ); + } + } + + function run( next ) { + var elem = $( this ); + + function cleanup() { + elem.removeData( dataSpaceAnimated ); + + $.effects.cleanUp( elem ); + + if ( args.mode === "hide" ) { + elem.hide(); + } + + done(); + } + + function done() { + if ( $.isFunction( complete ) ) { + complete.call( elem[ 0 ] ); + } + + if ( $.isFunction( next ) ) { + next(); + } + } + + // Override mode option on a per element basis, + // as toggle can be either show or hide depending on element state + args.mode = modes.shift(); + + if ( $.uiBackCompat !== false && !defaultMode ) { + if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) { + + // Call the core method to track "olddisplay" properly + elem[ mode ](); + done(); + } else { + effectMethod.call( elem[ 0 ], args, done ); + } + } else { + if ( args.mode === "none" ) { + + // Call the core method to track "olddisplay" properly + elem[ mode ](); + done(); + } else { + effectMethod.call( elem[ 0 ], args, cleanup ); + } + } + } + + // Run prefilter on all elements first to ensure that + // any showing or hiding happens before placeholder creation, + // which ensures that any layout changes are correctly captured. + return queue === false ? + this.each( prefilter ).each( run ) : + this.queue( queueName, prefilter ).queue( queueName, run ); + }, + + show: ( function( orig ) { + return function( option ) { + if ( standardAnimationOption( option ) ) { + return orig.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "show"; + return this.effect.call( this, args ); + } + }; + } )( $.fn.show ), + + hide: ( function( orig ) { + return function( option ) { + if ( standardAnimationOption( option ) ) { + return orig.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "hide"; + return this.effect.call( this, args ); + } + }; + } )( $.fn.hide ), + + toggle: ( function( orig ) { + return function( option ) { + if ( standardAnimationOption( option ) || typeof option === "boolean" ) { + return orig.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "toggle"; + return this.effect.call( this, args ); + } + }; + } )( $.fn.toggle ), + + cssUnit: function( key ) { + var style = this.css( key ), + val = []; + + $.each( [ "em", "px", "%", "pt" ], function( i, unit ) { + if ( style.indexOf( unit ) > 0 ) { + val = [ parseFloat( style ), unit ]; + } + } ); + return val; + }, + + cssClip: function( clipObj ) { + if ( clipObj ) { + return this.css( "clip", "rect(" + clipObj.top + "px " + clipObj.right + "px " + + clipObj.bottom + "px " + clipObj.left + "px)" ); + } + return parseClip( this.css( "clip" ), this ); + }, + + transfer: function( options, done ) { + var element = $( this ), + target = $( options.to ), + targetFixed = target.css( "position" ) === "fixed", + body = $( "body" ), + fixTop = targetFixed ? body.scrollTop() : 0, + fixLeft = targetFixed ? body.scrollLeft() : 0, + endPosition = target.offset(), + animation = { + top: endPosition.top - fixTop, + left: endPosition.left - fixLeft, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = element.offset(), + transfer = $( "<div class='ui-effects-transfer'></div>" ) + .appendTo( "body" ) + .addClass( options.className ) + .css( { + top: startPosition.top - fixTop, + left: startPosition.left - fixLeft, + height: element.innerHeight(), + width: element.innerWidth(), + position: targetFixed ? "fixed" : "absolute" + } ) + .animate( animation, options.duration, options.easing, function() { + transfer.remove(); + if ( $.isFunction( done ) ) { + done(); + } + } ); + } +} ); + +function parseClip( str, element ) { + var outerWidth = element.outerWidth(), + outerHeight = element.outerHeight(), + clipRegex = /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/, + values = clipRegex.exec( str ) || [ "", 0, outerWidth, outerHeight, 0 ]; + + return { + top: parseFloat( values[ 1 ] ) || 0, + right: values[ 2 ] === "auto" ? outerWidth : parseFloat( values[ 2 ] ), + bottom: values[ 3 ] === "auto" ? outerHeight : parseFloat( values[ 3 ] ), + left: parseFloat( values[ 4 ] ) || 0 + }; +} + +$.fx.step.clip = function( fx ) { + if ( !fx.clipInit ) { + fx.start = $( fx.elem ).cssClip(); + if ( typeof fx.end === "string" ) { + fx.end = parseClip( fx.end, fx.elem ); + } + fx.clipInit = true; + } + + $( fx.elem ).cssClip( { + top: fx.pos * ( fx.end.top - fx.start.top ) + fx.start.top, + right: fx.pos * ( fx.end.right - fx.start.right ) + fx.start.right, + bottom: fx.pos * ( fx.end.bottom - fx.start.bottom ) + fx.start.bottom, + left: fx.pos * ( fx.end.left - fx.start.left ) + fx.start.left + } ); +}; + +} )(); + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +( function() { + +// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +} ); + +$.extend( baseEasings, { + Sine: function( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * ( p - 1 ) ) * Math.sin( ( ( p - 1 ) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +} ); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < 0.5 ? + easeIn( p * 2 ) / 2 : + 1 - easeIn( p * -2 + 2 ) / 2; + }; +} ); + +} )(); + +var effect = $.effects; + + +/*! + * jQuery UI Effects Blind 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Blind Effect +//>>group: Effects +//>>description: Blinds the element. +//>>docs: http://api.jqueryui.com/blind-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectBlind = $.effects.define( "blind", "hide", function( options, done ) { + var map = { + up: [ "bottom", "top" ], + vertical: [ "bottom", "top" ], + down: [ "top", "bottom" ], + left: [ "right", "left" ], + horizontal: [ "right", "left" ], + right: [ "left", "right" ] + }, + element = $( this ), + direction = options.direction || "up", + start = element.cssClip(), + animate = { clip: $.extend( {}, start ) }, + placeholder = $.effects.createPlaceholder( element ); + + animate.clip[ map[ direction ][ 0 ] ] = animate.clip[ map[ direction ][ 1 ] ]; + + if ( options.mode === "show" ) { + element.cssClip( animate.clip ); + if ( placeholder ) { + placeholder.css( $.effects.clipToBox( animate ) ); + } + + animate.clip = start; + } + + if ( placeholder ) { + placeholder.animate( $.effects.clipToBox( animate ), options.duration, options.easing ); + } + + element.animate( animate, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: done + } ); +} ); + + +/*! + * jQuery UI Effects Bounce 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Pulsate + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Bounce Effect +//>>group: Effects +//>>description: Bounces an element horizontally or vertically n times. +//>>docs: http://api.jqueryui.com/bounce-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectBounce = $.effects.define( "bounce", function( options, done ) { + var upAnim, downAnim, refValue, + element = $( this ), + + // Defaults: + mode = options.mode, + hide = mode === "hide", + show = mode === "show", + direction = options.direction || "up", + distance = options.distance, + times = options.times || 5, + + // Number of internal animations + anims = times * 2 + ( show || hide ? 1 : 0 ), + speed = options.duration / anims, + easing = options.easing, + + // Utility: + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ), + i = 0, + + queuelen = element.queue().length; + + $.effects.createPlaceholder( element ); + + refValue = element.css( ref ); + + // Default distance for the BIGGEST bounce is the outer Distance / 3 + if ( !distance ) { + distance = element[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3; + } + + if ( show ) { + downAnim = { opacity: 1 }; + downAnim[ ref ] = refValue; + + // If we are showing, force opacity 0 and set the initial position + // then do the "first" animation + element + .css( "opacity", 0 ) + .css( ref, motion ? -distance * 2 : distance * 2 ) + .animate( downAnim, speed, easing ); + } + + // Start at the smallest distance if we are hiding + if ( hide ) { + distance = distance / Math.pow( 2, times - 1 ); + } + + downAnim = {}; + downAnim[ ref ] = refValue; + + // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here + for ( ; i < times; i++ ) { + upAnim = {}; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + element + .animate( upAnim, speed, easing ) + .animate( downAnim, speed, easing ); + + distance = hide ? distance * 2 : distance / 2; + } + + // Last Bounce when Hiding + if ( hide ) { + upAnim = { opacity: 0 }; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + element.animate( upAnim, speed, easing ); + } + + element.queue( done ); + + $.effects.unshift( element, queuelen, anims + 1 ); +} ); + + +/*! + * jQuery UI Effects Clip 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, -a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); -;/* - * jQuery UI Effects Scale 1.8.14 + +//>>label: Clip Effect +//>>group: Effects +//>>description: Clips the element on and off like an old TV. +//>>docs: http://api.jqueryui.com/clip-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectClip = $.effects.define( "clip", "hide", function( options, done ) { + var start, + animate = {}, + element = $( this ), + direction = options.direction || "vertical", + both = direction === "both", + horizontal = both || direction === "horizontal", + vertical = both || direction === "vertical"; + + start = element.cssClip(); + animate.clip = { + top: vertical ? ( start.bottom - start.top ) / 2 : start.top, + right: horizontal ? ( start.right - start.left ) / 2 : start.right, + bottom: vertical ? ( start.bottom - start.top ) / 2 : start.bottom, + left: horizontal ? ( start.right - start.left ) / 2 : start.left + }; + + $.effects.createPlaceholder( element ); + + if ( options.mode === "show" ) { + element.cssClip( animate.clip ); + animate.clip = start; + } + + element.animate( animate, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: done + } ); + +} ); + + +/*! + * jQuery UI Effects Drop 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Drop Effect +//>>group: Effects +//>>description: Moves an element in one direction and hides it at the same time. +//>>docs: http://api.jqueryui.com/drop-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectDrop = $.effects.define( "drop", "hide", function( options, done ) { + + var distance, + element = $( this ), + mode = options.mode, + show = mode === "show", + direction = options.direction || "left", + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ) ? "-=" : "+=", + oppositeMotion = ( motion === "+=" ) ? "-=" : "+=", + animation = { + opacity: 0 + }; + + $.effects.createPlaceholder( element ); + + distance = options.distance || + element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ) / 2; + + animation[ ref ] = motion + distance; + + if ( show ) { + element.css( animation ); + + animation[ ref ] = oppositeMotion + distance; + animation.opacity = 1; + } + + // Animate + element.animate( animation, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: done + } ); +} ); + + +/*! + * jQuery UI Effects Explode 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Scale + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Explode Effect +//>>group: Effects +// jscs:disable maximumLineLength +//>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness. +// jscs:enable maximumLineLength +//>>docs: http://api.jqueryui.com/explode-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectExplode = $.effects.define( "explode", "hide", function( options, done ) { + + var i, j, left, top, mx, my, + rows = options.pieces ? Math.round( Math.sqrt( options.pieces ) ) : 3, + cells = rows, + element = $( this ), + mode = options.mode, + show = mode === "show", + + // Show and then visibility:hidden the element before calculating offset + offset = element.show().css( "visibility", "hidden" ).offset(), + + // Width and height of a piece + width = Math.ceil( element.outerWidth() / cells ), + height = Math.ceil( element.outerHeight() / rows ), + pieces = []; + + // Children animate complete: + function childComplete() { + pieces.push( this ); + if ( pieces.length === rows * cells ) { + animComplete(); + } + } + + // Clone the element for each row and cell. + for ( i = 0; i < rows; i++ ) { // ===> + top = offset.top + i * height; + my = i - ( rows - 1 ) / 2; + + for ( j = 0; j < cells; j++ ) { // ||| + left = offset.left + j * width; + mx = j - ( cells - 1 ) / 2; + + // Create a clone of the now hidden main element that will be absolute positioned + // within a wrapper div off the -left and -top equal to size of our pieces + element + .clone() + .appendTo( "body" ) + .wrap( "<div></div>" ) + .css( { + position: "absolute", + visibility: "visible", + left: -j * width, + top: -i * height + } ) + + // Select the wrapper - make it overflow: hidden and absolute positioned based on + // where the original was located +left and +top equal to the size of pieces + .parent() + .addClass( "ui-effects-explode" ) + .css( { + position: "absolute", + overflow: "hidden", + width: width, + height: height, + left: left + ( show ? mx * width : 0 ), + top: top + ( show ? my * height : 0 ), + opacity: show ? 0 : 1 + } ) + .animate( { + left: left + ( show ? 0 : mx * width ), + top: top + ( show ? 0 : my * height ), + opacity: show ? 1 : 0 + }, options.duration || 500, options.easing, childComplete ); + } + } + + function animComplete() { + element.css( { + visibility: "visible" + } ); + $( pieces ).remove(); + done(); + } +} ); + + +/*! + * jQuery UI Effects Fade 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, -b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= -1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], -p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; -if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); -a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); -child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, -n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Shake 1.8.14 + +//>>label: Fade Effect +//>>group: Effects +//>>description: Fades the element. +//>>docs: http://api.jqueryui.com/fade-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectFade = $.effects.define( "fade", "toggle", function( options, done ) { + var show = options.mode === "show"; + + $( this ) + .css( "opacity", show ? 0 : 1 ) + .animate( { + opacity: show ? 1 : 0 + }, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: done + } ); +} ); + + +/*! + * jQuery UI Effects Fold 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Fold Effect +//>>group: Effects +//>>description: Folds an element first horizontally and then vertically. +//>>docs: http://api.jqueryui.com/fold-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectFold = $.effects.define( "fold", "hide", function( options, done ) { + + // Create element + var element = $( this ), + mode = options.mode, + show = mode === "show", + hide = mode === "hide", + size = options.size || 15, + percent = /([0-9]+)%/.exec( size ), + horizFirst = !!options.horizFirst, + ref = horizFirst ? [ "right", "bottom" ] : [ "bottom", "right" ], + duration = options.duration / 2, + + placeholder = $.effects.createPlaceholder( element ), + + start = element.cssClip(), + animation1 = { clip: $.extend( {}, start ) }, + animation2 = { clip: $.extend( {}, start ) }, + + distance = [ start[ ref[ 0 ] ], start[ ref[ 1 ] ] ], + + queuelen = element.queue().length; + + if ( percent ) { + size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ]; + } + animation1.clip[ ref[ 0 ] ] = size; + animation2.clip[ ref[ 0 ] ] = size; + animation2.clip[ ref[ 1 ] ] = 0; + + if ( show ) { + element.cssClip( animation2.clip ); + if ( placeholder ) { + placeholder.css( $.effects.clipToBox( animation2 ) ); + } + + animation2.clip = start; + } + + // Animate + element + .queue( function( next ) { + if ( placeholder ) { + placeholder + .animate( $.effects.clipToBox( animation1 ), duration, options.easing ) + .animate( $.effects.clipToBox( animation2 ), duration, options.easing ); + } + + next(); + } ) + .animate( animation1, duration, options.easing ) + .animate( animation2, duration, options.easing ) + .queue( done ); + + $.effects.unshift( element, queuelen, 4 ); +} ); + + +/*! + * jQuery UI Effects Highlight 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Shake + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Highlight Effect +//>>group: Effects +//>>description: Highlights the background of an element in a defined color for a custom duration. +//>>docs: http://api.jqueryui.com/highlight-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectHighlight = $.effects.define( "highlight", "show", function( options, done ) { + var element = $( this ), + animation = { + backgroundColor: element.css( "backgroundColor" ) + }; + + if ( options.mode === "hide" ) { + animation.opacity = 0; + } + + $.effects.saveStyle( element ); + + element + .css( { + backgroundImage: "none", + backgroundColor: options.color || "#ffff99" + } ) + .animate( animation, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: done + } ); +} ); + + +/*! + * jQuery UI Effects Size 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= -(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); -;/* - * jQuery UI Effects Slide 1.8.14 + +//>>label: Size Effect +//>>group: Effects +//>>description: Resize an element to a specified width and height. +//>>docs: http://api.jqueryui.com/size-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectSize = $.effects.define( "size", function( options, done ) { + + // Create element + var baseline, factor, temp, + element = $( this ), + + // Copy for children + cProps = [ "fontSize" ], + vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ], + hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ], + + // Set options + mode = options.mode, + restore = mode !== "effect", + scale = options.scale || "both", + origin = options.origin || [ "middle", "center" ], + position = element.css( "position" ), + pos = element.position(), + original = $.effects.scaledDimensions( element ), + from = options.from || original, + to = options.to || $.effects.scaledDimensions( element, 0 ); + + $.effects.createPlaceholder( element ); + + if ( mode === "show" ) { + temp = from; + from = to; + to = temp; + } + + // Set scaling factor + factor = { + from: { + y: from.height / original.height, + x: from.width / original.width + }, + to: { + y: to.height / original.height, + x: to.width / original.width + } + }; + + // Scale the css box + if ( scale === "box" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + from = $.effects.setTransition( element, vProps, factor.from.y, from ); + to = $.effects.setTransition( element, vProps, factor.to.y, to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + from = $.effects.setTransition( element, hProps, factor.from.x, from ); + to = $.effects.setTransition( element, hProps, factor.to.x, to ); + } + } + + // Scale the content + if ( scale === "content" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + from = $.effects.setTransition( element, cProps, factor.from.y, from ); + to = $.effects.setTransition( element, cProps, factor.to.y, to ); + } + } + + // Adjust the position properties based on the provided origin points + if ( origin ) { + baseline = $.effects.getBaseline( origin, original ); + from.top = ( original.outerHeight - from.outerHeight ) * baseline.y + pos.top; + from.left = ( original.outerWidth - from.outerWidth ) * baseline.x + pos.left; + to.top = ( original.outerHeight - to.outerHeight ) * baseline.y + pos.top; + to.left = ( original.outerWidth - to.outerWidth ) * baseline.x + pos.left; + } + element.css( from ); + + // Animate the children if desired + if ( scale === "content" || scale === "both" ) { + + vProps = vProps.concat( [ "marginTop", "marginBottom" ] ).concat( cProps ); + hProps = hProps.concat( [ "marginLeft", "marginRight" ] ); + + // Only animate children with width attributes specified + // TODO: is this right? should we include anything with css width specified as well + element.find( "*[width]" ).each( function() { + var child = $( this ), + childOriginal = $.effects.scaledDimensions( child ), + childFrom = { + height: childOriginal.height * factor.from.y, + width: childOriginal.width * factor.from.x, + outerHeight: childOriginal.outerHeight * factor.from.y, + outerWidth: childOriginal.outerWidth * factor.from.x + }, + childTo = { + height: childOriginal.height * factor.to.y, + width: childOriginal.width * factor.to.x, + outerHeight: childOriginal.height * factor.to.y, + outerWidth: childOriginal.width * factor.to.x + }; + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + childFrom = $.effects.setTransition( child, vProps, factor.from.y, childFrom ); + childTo = $.effects.setTransition( child, vProps, factor.to.y, childTo ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + childFrom = $.effects.setTransition( child, hProps, factor.from.x, childFrom ); + childTo = $.effects.setTransition( child, hProps, factor.to.x, childTo ); + } + + if ( restore ) { + $.effects.saveStyle( child ); + } + + // Animate children + child.css( childFrom ); + child.animate( childTo, options.duration, options.easing, function() { + + // Restore children + if ( restore ) { + $.effects.restoreStyle( child ); + } + } ); + } ); + } + + // Animate + element.animate( to, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: function() { + + var offset = element.offset(); + + if ( to.opacity === 0 ) { + element.css( "opacity", from.opacity ); + } + + if ( !restore ) { + element + .css( "position", position === "static" ? "relative" : position ) + .offset( offset ); + + // Need to save style here so that automatic style restoration + // doesn't restore to the original styles from before the animation. + $.effects.saveStyle( element ); + } + + done(); + } + } ); + +} ); + + +/*! + * jQuery UI Effects Scale 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Scale Effect +//>>group: Effects +//>>description: Grows or shrinks an element and its content. +//>>docs: http://api.jqueryui.com/scale-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectScale = $.effects.define( "scale", function( options, done ) { + + // Create element + var el = $( this ), + mode = options.mode, + percent = parseInt( options.percent, 10 ) || + ( parseInt( options.percent, 10 ) === 0 ? 0 : ( mode !== "effect" ? 0 : 100 ) ), + + newOptions = $.extend( true, { + from: $.effects.scaledDimensions( el ), + to: $.effects.scaledDimensions( el, percent, options.direction || "both" ), + origin: options.origin || [ "middle", "center" ] + }, options ); + + // Fade option to support puff + if ( options.fade ) { + newOptions.from.opacity = 1; + newOptions.to.opacity = 0; + } + + $.effects.effect.size.call( this, newOptions, done ); +} ); + + +/*! + * jQuery UI Effects Puff 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Slide + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Puff Effect +//>>group: Effects +//>>description: Creates a puff effect by scaling the element up and hiding it at the same time. +//>>docs: http://api.jqueryui.com/puff-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectPuff = $.effects.define( "puff", "hide", function( options, done ) { + var newOptions = $.extend( true, {}, options, { + fade: true, + percent: parseInt( options.percent, 10 ) || 150 + } ); + + $.effects.effect.scale.call( this, newOptions, done ); +} ); + + +/*! + * jQuery UI Effects Pulsate 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); -var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Transfer 1.8.14 + +//>>label: Pulsate Effect +//>>group: Effects +//>>description: Pulsates an element n times by changing the opacity to zero and back. +//>>docs: http://api.jqueryui.com/pulsate-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectPulsate = $.effects.define( "pulsate", "show", function( options, done ) { + var element = $( this ), + mode = options.mode, + show = mode === "show", + hide = mode === "hide", + showhide = show || hide, + + // Showing or hiding leaves off the "last" animation + anims = ( ( options.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ), + duration = options.duration / anims, + animateTo = 0, + i = 1, + queuelen = element.queue().length; + + if ( show || !element.is( ":visible" ) ) { + element.css( "opacity", 0 ).show(); + animateTo = 1; + } + + // Anims - 1 opacity "toggles" + for ( ; i < anims; i++ ) { + element.animate( { opacity: animateTo }, duration, options.easing ); + animateTo = 1 - animateTo; + } + + element.animate( { opacity: animateTo }, duration, options.easing ); + + element.queue( done ); + + $.effects.unshift( element, queuelen, anims + 1 ); +} ); + + +/*! + * jQuery UI Effects Shake 1.12.1 + * http://jqueryui.com * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. * http://jquery.org/license + */ + +//>>label: Shake Effect +//>>group: Effects +//>>description: Shakes an element horizontally or vertically n times. +//>>docs: http://api.jqueryui.com/shake-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectShake = $.effects.define( "shake", function( options, done ) { + + var i = 1, + element = $( this ), + direction = options.direction || "left", + distance = options.distance || 20, + times = options.times || 3, + anims = times * 2 + 1, + speed = Math.round( options.duration / anims ), + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + positiveMotion = ( direction === "up" || direction === "left" ), + animation = {}, + animation1 = {}, + animation2 = {}, + + queuelen = element.queue().length; + + $.effects.createPlaceholder( element ); + + // Animation + animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance; + animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2; + animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2; + + // Animate + element.animate( animation, speed, options.easing ); + + // Shakes + for ( ; i < times; i++ ) { + element + .animate( animation1, speed, options.easing ) + .animate( animation2, speed, options.easing ); + } + + element + .animate( animation1, speed, options.easing ) + .animate( animation, speed / 2, options.easing ) + .queue( done ); + + $.effects.unshift( element, queuelen, anims + 1 ); +} ); + + +/*! + * jQuery UI Effects Slide 1.12.1 + * http://jqueryui.com * - * http://docs.jquery.com/UI/Effects/Transfer + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +//>>label: Slide Effect +//>>group: Effects +//>>description: Slides an element in and out of the viewport. +//>>docs: http://api.jqueryui.com/slide-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effectsEffectSlide = $.effects.define( "slide", "show", function( options, done ) { + var startClip, startRef, + element = $( this ), + map = { + up: [ "bottom", "top" ], + down: [ "top", "bottom" ], + left: [ "right", "left" ], + right: [ "left", "right" ] + }, + mode = options.mode, + direction = options.direction || "left", + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + positiveMotion = ( direction === "up" || direction === "left" ), + distance = options.distance || + element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ), + animation = {}; + + $.effects.createPlaceholder( element ); + + startClip = element.cssClip(); + startRef = element.position()[ ref ]; + + // Define hide animation + animation[ ref ] = ( positiveMotion ? -1 : 1 ) * distance + startRef; + animation.clip = element.cssClip(); + animation.clip[ map[ direction ][ 1 ] ] = animation.clip[ map[ direction ][ 0 ] ]; + + // Reverse the animation if we're showing + if ( mode === "show" ) { + element.cssClip( animation.clip ); + element.css( ref, animation[ ref ] ); + animation.clip = startClip; + animation[ ref ] = startRef; + } + + // Actually animate + element.animate( animation, { + queue: false, + duration: options.duration, + easing: options.easing, + complete: done + } ); +} ); + + +/*! + * jQuery UI Effects Transfer 1.12.1 + * http://jqueryui.com * - * Depends: - * jquery.effects.core.js + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license */ -(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); -b.dequeue()})})}})(jQuery); -; \ No newline at end of file + +//>>label: Transfer Effect +//>>group: Effects +//>>description: Displays a transfer effect from one element to another. +//>>docs: http://api.jqueryui.com/transfer-effect/ +//>>demos: http://jqueryui.com/effect/ + + + +var effect; +if ( $.uiBackCompat !== false ) { + effect = $.effects.define( "transfer", function( options, done ) { + $( this ).transfer( options, done ); + } ); +} +var effectsEffectTransfer = effect; + + + + +})); \ No newline at end of file diff --git a/www/include/common/javascript/jquery/jquery.js b/www/include/common/javascript/jquery/jquery.js index 3774ff986139c8a7534e14bc8987fe80418dcc1b..0b1232b7fe76d4aaa4be22b168a724d52d7cec64 100644 --- a/www/include/common/javascript/jquery/jquery.js +++ b/www/include/common/javascript/jquery/jquery.js @@ -1,291 +1,150 @@ /*! - * jQuery JavaScript Library v1.7.2 + * jQuery JavaScript Library v1.12.4 * http://jquery.com/ * - * Copyright 2011, John Resig - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * * Includes Sizzle.js * http://sizzlejs.com/ - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. * - * Date: Wed Mar 21 12:46:34 2012 -0700 + * Copyright jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: 2016-05-20T17:17Z */ -(function( window, undefined ) { - -// Use the correct document accordingly with window argument (sandbox) -var document = window.document, - navigator = window.navigator, - location = window.location; -var jQuery = (function() { - -// Define a local copy of jQuery -var jQuery = function( selector, context ) { - // The jQuery object is actually just the init constructor 'enhanced' - return new jQuery.fn.init( selector, context, rootjQuery ); - }, - - // Map over jQuery in case of overwrite - _jQuery = window.jQuery, - - // Map over the $ in case of overwrite - _$ = window.$, - - // A central reference to the root jQuery(document) - rootjQuery, - - // A simple way to check for HTML strings or ID strings - // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) - quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, - - // Check if a string has a non-whitespace character in it - rnotwhite = /\S/, - - // Used for trimming whitespace - trimLeft = /^\s+/, - trimRight = /\s+$/, - - // Match a standalone tag - rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, - - // JSON RegExp - rvalidchars = /^[\],:{}\s]*$/, - rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, - rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, - rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, - - // Useragent RegExp - rwebkit = /(webkit)[ \/]([\w.]+)/, - ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, - rmsie = /(msie) ([\w.]+)/, - rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, - - // Matches dashed string for camelizing - rdashAlpha = /-([a-z]|[0-9])/ig, - rmsPrefix = /^-ms-/, - - // Used by jQuery.camelCase as callback to replace() - fcamelCase = function( all, letter ) { - return ( letter + "" ).toUpperCase(); - }, - - // Keep a UserAgent string for use with jQuery.browser - userAgent = navigator.userAgent, - - // For matching the engine and version of the browser - browserMatch, - - // The deferred used on DOM ready - readyList, - - // The ready event handler - DOMContentLoaded, - // Save a reference to some core methods - toString = Object.prototype.toString, - hasOwn = Object.prototype.hasOwnProperty, - push = Array.prototype.push, - slice = Array.prototype.slice, - trim = String.prototype.trim, - indexOf = Array.prototype.indexOf, - - // [[Class]] -> type pairs - class2type = {}; +(function( global, factory ) { + + if ( typeof module === "object" && typeof module.exports === "object" ) { + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } -jQuery.fn = jQuery.prototype = { - constructor: jQuery, - init: function( selector, context, rootjQuery ) { - var match, elem, ret, doc; +// Pass this if window is not defined yet +}(typeof window !== "undefined" ? window : this, function( window, noGlobal ) { - // Handle $(""), $(null), or $(undefined) - if ( !selector ) { - return this; - } +// Support: Firefox 18+ +// Can't be in strict mode, several libs including ASP.NET trace +// the stack via arguments.caller.callee and Firefox dies if +// you try to trace through "use strict" call chains. (#13335) +//"use strict"; +var deletedIds = []; - // Handle $(DOMElement) - if ( selector.nodeType ) { - this.context = this[0] = selector; - this.length = 1; - return this; - } +var document = window.document; - // The body element only exists once, optimize finding it - if ( selector === "body" && !context && document.body ) { - this.context = document; - this[0] = document.body; - this.selector = selector; - this.length = 1; - return this; - } +var slice = deletedIds.slice; - // Handle HTML strings - if ( typeof selector === "string" ) { - // Are we dealing with HTML string or an ID? - if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { - // Assume that strings that start and end with <> are HTML and skip the regex check - match = [ null, selector, null ]; +var concat = deletedIds.concat; - } else { - match = quickExpr.exec( selector ); - } +var push = deletedIds.push; - // Verify a match, and that no context was specified for #id - if ( match && (match[1] || !context) ) { +var indexOf = deletedIds.indexOf; - // HANDLE: $(html) -> $(array) - if ( match[1] ) { - context = context instanceof jQuery ? context[0] : context; - doc = ( context ? context.ownerDocument || context : document ); +var class2type = {}; - // If a single string is passed in and it's a single tag - // just do a createElement and skip the rest - ret = rsingleTag.exec( selector ); +var toString = class2type.toString; - if ( ret ) { - if ( jQuery.isPlainObject( context ) ) { - selector = [ document.createElement( ret[1] ) ]; - jQuery.fn.attr.call( selector, context, true ); +var hasOwn = class2type.hasOwnProperty; - } else { - selector = [ doc.createElement( ret[1] ) ]; - } +var support = {}; - } else { - ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); - selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; - } - return jQuery.merge( this, selector ); - // HANDLE: $("#id") - } else { - elem = document.getElementById( match[2] ); +var + version = "1.12.4", - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - if ( elem && elem.parentNode ) { - // Handle the case where IE and Opera return items - // by name instead of ID - if ( elem.id !== match[2] ) { - return rootjQuery.find( selector ); - } + // Define a local copy of jQuery + jQuery = function( selector, context ) { - // Otherwise, we inject the element directly into the jQuery object - this.length = 1; - this[0] = elem; - } + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, - this.context = document; - this.selector = selector; - return this; - } + // Support: Android<4.1, IE<9 + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, - // HANDLE: $(expr, $(...)) - } else if ( !context || context.jquery ) { - return ( context || rootjQuery ).find( selector ); + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, - // HANDLE: $(expr, context) - // (which is just equivalent to: $(context).find(expr) - } else { - return this.constructor( context ).find( selector ); - } + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }; - // HANDLE: $(function) - // Shortcut for document ready - } else if ( jQuery.isFunction( selector ) ) { - return rootjQuery.ready( selector ); - } +jQuery.fn = jQuery.prototype = { - if ( selector.selector !== undefined ) { - this.selector = selector.selector; - this.context = selector.context; - } + // The current version of jQuery being used + jquery: version, - return jQuery.makeArray( selector, this ); - }, + constructor: jQuery, // Start with an empty selector selector: "", - // The current version of jQuery being used - jquery: "1.7.2", - // The default length of a jQuery object is 0 length: 0, - // The number of elements contained in the matched element set - size: function() { - return this.length; - }, - toArray: function() { - return slice.call( this, 0 ); + return slice.call( this ); }, // Get the Nth element in the matched element set OR // Get the whole matched element set as a clean array get: function( num ) { - return num == null ? + return num != null ? - // Return a 'clean' array - this.toArray() : + // Return just the one element from the set + ( num < 0 ? this[ num + this.length ] : this[ num ] ) : - // Return just the object - ( num < 0 ? this[ this.length + num ] : this[ num ] ); + // Return all the elements in a clean array + slice.call( this ); }, // Take an array of elements and push it onto the stack // (returning the new matched element set) - pushStack: function( elems, name, selector ) { - // Build a new jQuery matched element set - var ret = this.constructor(); - - if ( jQuery.isArray( elems ) ) { - push.apply( ret, elems ); + pushStack: function( elems ) { - } else { - jQuery.merge( ret, elems ); - } + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); // Add the old object onto the stack (as a reference) ret.prevObject = this; - ret.context = this.context; - if ( name === "find" ) { - ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; - } else if ( name ) { - ret.selector = this.selector + "." + name + "(" + selector + ")"; - } - // Return the newly-formed element set return ret; }, // Execute a callback for every element in the matched set. - // (You can seed the arguments with an array of args, but this is - // only used internally.) - each: function( callback, args ) { - return jQuery.each( this, callback, args ); + each: function( callback ) { + return jQuery.each( this, callback ); }, - ready: function( fn ) { - // Attach the listeners - jQuery.bindReady(); - - // Add the callback - readyList.add( fn ); - - return this; + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); }, - eq: function( i ) { - i = +i; - return i === -1 ? - this.slice( i ) : - this.slice( i, i + 1 ); + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); }, first: function() { @@ -296,34 +155,26 @@ jQuery.fn = jQuery.prototype = { return this.eq( -1 ); }, - slice: function() { - return this.pushStack( slice.apply( this, arguments ), - "slice", slice.call(arguments).join(",") ); - }, - - map: function( callback ) { - return this.pushStack( jQuery.map(this, function( elem, i ) { - return callback.call( elem, i, elem ); - })); + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); }, end: function() { - return this.prevObject || this.constructor(null); + return this.prevObject || this.constructor(); }, // For internal use only. // Behaves like an Array's method, not like a jQuery method. push: push, - sort: [].sort, - splice: [].splice + sort: deletedIds.sort, + splice: deletedIds.splice }; -// Give the init function the jQuery prototype for later instantiation -jQuery.fn.init.prototype = jQuery.fn; - jQuery.extend = jQuery.fn.extend = function() { - var options, name, src, copy, copyIsArray, clone, - target = arguments[0] || {}, + var src, copyIsArray, copy, name, options, clone, + target = arguments[ 0 ] || {}, i = 1, length = arguments.length, deep = false; @@ -331,25 +182,28 @@ jQuery.extend = jQuery.fn.extend = function() { // Handle a deep copy situation if ( typeof target === "boolean" ) { deep = target; - target = arguments[1] || {}; + // skip the boolean and the target - i = 2; + target = arguments[ i ] || {}; + i++; } // Handle case when target is a string or something (possible in deep copy) - if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + if ( typeof target !== "object" && !jQuery.isFunction( target ) ) { target = {}; } // extend jQuery itself if only one argument is passed - if ( length === i ) { + if ( i === length ) { target = this; - --i; + i--; } for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values - if ( (options = arguments[ i ]) != null ) { + if ( ( options = arguments[ i ] ) != null ) { + // Extend the base object for ( name in options ) { src = target[ name ]; @@ -361,13 +215,15 @@ jQuery.extend = jQuery.fn.extend = function() { } // Recurse if we're merging plain objects or arrays - if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = jQuery.isArray( copy ) ) ) ) { + if ( copyIsArray ) { copyIsArray = false; - clone = src && jQuery.isArray(src) ? src : []; + clone = src && jQuery.isArray( src ) ? src : []; } else { - clone = src && jQuery.isPlainObject(src) ? src : {}; + clone = src && jQuery.isPlainObject( src ) ? src : {}; } // Never move original objects, clone them @@ -385,233 +241,112 @@ jQuery.extend = jQuery.fn.extend = function() { return target; }; -jQuery.extend({ - noConflict: function( deep ) { - if ( window.$ === jQuery ) { - window.$ = _$; - } - - if ( deep && window.jQuery === jQuery ) { - window.jQuery = _jQuery; - } - - return jQuery; - }, - - // Is the DOM ready to be used? Set to true once it occurs. - isReady: false, - - // A counter to track how many items to wait for before - // the ready event fires. See #6781 - readyWait: 1, - - // Hold (or release) the ready event - holdReady: function( hold ) { - if ( hold ) { - jQuery.readyWait++; - } else { - jQuery.ready( true ); - } - }, - - // Handle when the DOM is ready - ready: function( wait ) { - // Either a released hold or an DOMready/load event and not yet ready - if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { - // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). - if ( !document.body ) { - return setTimeout( jQuery.ready, 1 ); - } - - // Remember that the DOM is ready - jQuery.isReady = true; +jQuery.extend( { - // If a normal DOM Ready event fired, decrement, and wait if need be - if ( wait !== true && --jQuery.readyWait > 0 ) { - return; - } + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), - // If there are functions bound, to execute - readyList.fireWith( document, [ jQuery ] ); + // Assume jQuery is ready without the ready module + isReady: true, - // Trigger any bound ready events - if ( jQuery.fn.trigger ) { - jQuery( document ).trigger( "ready" ).off( "ready" ); - } - } + error: function( msg ) { + throw new Error( msg ); }, - bindReady: function() { - if ( readyList ) { - return; - } - - readyList = jQuery.Callbacks( "once memory" ); - - // Catch cases where $(document).ready() is called after the - // browser event has already occurred. - if ( document.readyState === "complete" ) { - // Handle it asynchronously to allow scripts the opportunity to delay ready - return setTimeout( jQuery.ready, 1 ); - } - - // Mozilla, Opera and webkit nightlies currently support this event - if ( document.addEventListener ) { - // Use the handy event callback - document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); - - // A fallback to window.onload, that will always work - window.addEventListener( "load", jQuery.ready, false ); - - // If IE event model is used - } else if ( document.attachEvent ) { - // ensure firing before onload, - // maybe late but safe also for iframes - document.attachEvent( "onreadystatechange", DOMContentLoaded ); - - // A fallback to window.onload, that will always work - window.attachEvent( "onload", jQuery.ready ); - - // If IE and not a frame - // continually check to see if the document is ready - var toplevel = false; - - try { - toplevel = window.frameElement == null; - } catch(e) {} - - if ( document.documentElement.doScroll && toplevel ) { - doScrollCheck(); - } - } - }, + noop: function() {}, // See test/unit/core.js for details concerning isFunction. // Since version 1.3, DOM methods and functions like alert // aren't supported. They return false on IE (#2968). isFunction: function( obj ) { - return jQuery.type(obj) === "function"; + return jQuery.type( obj ) === "function"; }, isArray: Array.isArray || function( obj ) { - return jQuery.type(obj) === "array"; + return jQuery.type( obj ) === "array"; }, isWindow: function( obj ) { + /* jshint eqeqeq: false */ return obj != null && obj == obj.window; }, isNumeric: function( obj ) { - return !isNaN( parseFloat(obj) ) && isFinite( obj ); + + // parseFloat NaNs numeric-cast false positives (null|true|false|"") + // ...but misinterprets leading-number strings, particularly hex literals ("0x...") + // subtraction forces infinities to NaN + // adding 1 corrects loss of precision from parseFloat (#15100) + var realStringObj = obj && obj.toString(); + return !jQuery.isArray( obj ) && ( realStringObj - parseFloat( realStringObj ) + 1 ) >= 0; }, - type: function( obj ) { - return obj == null ? - String( obj ) : - class2type[ toString.call(obj) ] || "object"; + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; }, isPlainObject: function( obj ) { + var key; + // Must be an Object. // Because of IE, we also have to check the presence of the constructor property. // Make sure that DOM nodes and window objects don't pass through, as well - if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + if ( !obj || jQuery.type( obj ) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { return false; } try { + // Not own constructor property must be Object if ( obj.constructor && - !hasOwn.call(obj, "constructor") && - !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + !hasOwn.call( obj, "constructor" ) && + !hasOwn.call( obj.constructor.prototype, "isPrototypeOf" ) ) { return false; } } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 return false; } + // Support: IE<9 + // Handle iteration over inherited properties before own properties. + if ( !support.ownFirst ) { + for ( key in obj ) { + return hasOwn.call( obj, key ); + } + } + // Own properties are enumerated firstly, so to speed up, // if last one is own, then all properties are own. - - var key; for ( key in obj ) {} return key === undefined || hasOwn.call( obj, key ); }, - isEmptyObject: function( obj ) { - for ( var name in obj ) { - return false; - } - return true; - }, - - error: function( msg ) { - throw new Error( msg ); - }, - - parseJSON: function( data ) { - if ( typeof data !== "string" || !data ) { - return null; - } - - // Make sure leading/trailing whitespace is removed (IE can't handle it) - data = jQuery.trim( data ); - - // Attempt to parse using the native JSON parser first - if ( window.JSON && window.JSON.parse ) { - return window.JSON.parse( data ); - } - - // Make sure the incoming data is actual JSON - // Logic borrowed from http://json.org/json2.js - if ( rvalidchars.test( data.replace( rvalidescape, "@" ) - .replace( rvalidtokens, "]" ) - .replace( rvalidbraces, "")) ) { - - return ( new Function( "return " + data ) )(); - - } - jQuery.error( "Invalid JSON: " + data ); - }, - - // Cross-browser xml parsing - parseXML: function( data ) { - if ( typeof data !== "string" || !data ) { - return null; - } - var xml, tmp; - try { - if ( window.DOMParser ) { // Standard - tmp = new DOMParser(); - xml = tmp.parseFromString( data , "text/xml" ); - } else { // IE - xml = new ActiveXObject( "Microsoft.XMLDOM" ); - xml.async = "false"; - xml.loadXML( data ); - } - } catch( e ) { - xml = undefined; - } - if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { - jQuery.error( "Invalid XML: " + data ); + type: function( obj ) { + if ( obj == null ) { + return obj + ""; } - return xml; + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; }, - noop: function() {}, - - // Evaluates a script in a global context // Workarounds based on findings by Jim Driscoll // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context globalEval: function( data ) { - if ( data && rnotwhite.test( data ) ) { + if ( data && jQuery.trim( data ) ) { + // We use execScript on Internet Explorer // We use an anonymous function so that context is window // rather than jQuery in Firefox ( window.execScript || function( data ) { - window[ "eval" ].call( window, data ); + window[ "eval" ].call( window, data ); // jscs:ignore requireDotNotation } )( data ); } }, @@ -623,98 +358,70 @@ jQuery.extend({ }, nodeName: function( elem, name ) { - return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); }, - // args is for internal usage only - each: function( object, callback, args ) { - var name, i = 0, - length = object.length, - isObj = length === undefined || jQuery.isFunction( object ); + each: function( obj, callback ) { + var length, i = 0; - if ( args ) { - if ( isObj ) { - for ( name in object ) { - if ( callback.apply( object[ name ], args ) === false ) { - break; - } - } - } else { - for ( ; i < length; ) { - if ( callback.apply( object[ i++ ], args ) === false ) { - break; - } + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; } } - - // A special, fast, case for the most common use of each } else { - if ( isObj ) { - for ( name in object ) { - if ( callback.call( object[ name ], name, object[ name ] ) === false ) { - break; - } - } - } else { - for ( ; i < length; ) { - if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { - break; - } + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; } } } - return object; + return obj; }, - // Use native String.trim function wherever possible - trim: trim ? - function( text ) { - return text == null ? - "" : - trim.call( text ); - } : - - // Otherwise use our own trimming functionality - function( text ) { - return text == null ? - "" : - text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); - }, + // Support: Android<4.1, IE<9 + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, // results is for internal usage only - makeArray: function( array, results ) { + makeArray: function( arr, results ) { var ret = results || []; - if ( array != null ) { - // The window, strings (and functions) also have 'length' - // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 - var type = jQuery.type( array ); - - if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { - push.call( ret, array ); + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); } else { - jQuery.merge( ret, array ); + push.call( ret, arr ); } } return ret; }, - inArray: function( elem, array, i ) { + inArray: function( elem, arr, i ) { var len; - if ( array ) { + if ( arr ) { if ( indexOf ) { - return indexOf.call( array, elem, i ); + return indexOf.call( arr, elem, i ); } - len = array.length; + len = arr.length; i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays - if ( i in array && array[ i ] === elem ) { + if ( i in arr && arr[ i ] === elem ) { return i; } } @@ -724,16 +431,18 @@ jQuery.extend({ }, merge: function( first, second ) { - var i = first.length, - j = 0; + var len = +second.length, + j = 0, + i = first.length; - if ( typeof second.length === "number" ) { - for ( var l = second.length; j < l; j++ ) { - first[ i++ ] = second[ j ]; - } + while ( j < len ) { + first[ i++ ] = second[ j++ ]; + } - } else { - while ( second[j] !== undefined ) { + // Support: IE<9 + // Workaround casting of .length to NaN on otherwise arraylike objects (e.g., NodeLists) + if ( len !== len ) { + while ( second[ j ] !== undefined ) { first[ i++ ] = second[ j++ ]; } } @@ -743,53 +452,55 @@ jQuery.extend({ return first; }, - grep: function( elems, callback, inv ) { - var ret = [], retVal; - inv = !!inv; + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; // Go through the array, only saving the items // that pass the validator function - for ( var i = 0, length = elems.length; i < length; i++ ) { - retVal = !!callback( elems[ i ], i ); - if ( inv !== retVal ) { - ret.push( elems[ i ] ); + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); } } - return ret; + return matches; }, // arg is for internal usage only map: function( elems, callback, arg ) { - var value, key, ret = [], + var length, value, i = 0, - length = elems.length, - // jquery objects are treated as arrays - isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + ret = []; - // Go through the array, translating each of the items to their - if ( isArray ) { + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; for ( ; i < length; i++ ) { value = callback( elems[ i ], i, arg ); if ( value != null ) { - ret[ ret.length ] = value; + ret.push( value ); } } // Go through every key on the object, } else { - for ( key in elems ) { - value = callback( elems[ key ], key, arg ); + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); if ( value != null ) { - ret[ ret.length ] = value; + ret.push( value ); } } } // Flatten any nested arrays - return ret.concat.apply( [], ret ); + return concat.apply( [], ret ); }, // A global GUID counter for objects @@ -798,8 +509,10 @@ jQuery.extend({ // Bind a function to a context, optionally partially applying any // arguments. proxy: function( fn, context ) { + var args, proxy, tmp; + if ( typeof context === "string" ) { - var tmp = fn[ context ]; + tmp = fn[ context ]; context = fn; fn = tmp; } @@ -811,2092 +524,4314 @@ jQuery.extend({ } // Simulated bind - var args = slice.call( arguments, 2 ), - proxy = function() { - return fn.apply( context, args.concat( slice.call( arguments ) ) ); - }; + args = slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( slice.call( arguments ) ) ); + }; // Set the guid of unique handler to the same of original handler, so it can be removed - proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + proxy.guid = fn.guid = fn.guid || jQuery.guid++; return proxy; }, - // Mutifunctional method to get and set values to a collection - // The value/s can optionally be executed if it's a function - access: function( elems, fn, key, value, chainable, emptyGet, pass ) { - var exec, - bulk = key == null, - i = 0, - length = elems.length; - - // Sets many values - if ( key && typeof key === "object" ) { - for ( i in key ) { - jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); - } - chainable = 1; - - // Sets one value - } else if ( value !== undefined ) { - // Optionally, function values get executed if exec is true - exec = pass === undefined && jQuery.isFunction( value ); + now: function() { + return +( new Date() ); + }, - if ( bulk ) { - // Bulk operations only iterate when executing function values - if ( exec ) { - exec = fn; - fn = function( elem, key, value ) { - return exec.call( jQuery( elem ), value ); - }; + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); - // Otherwise they run against the entire set - } else { - fn.call( elems, value ); - fn = null; - } - } +// JSHint would error on this code due to the Symbol not being defined in ES5. +// Defining this global in .jshintrc would create a danger of using the global +// unguarded in another place, it seems safer to just disable JSHint for these +// three lines. +/* jshint ignore: start */ +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = deletedIds[ Symbol.iterator ]; +} +/* jshint ignore: end */ - if ( fn ) { - for (; i < length; i++ ) { - fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); - } - } +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); - chainable = 1; - } +function isArrayLike( obj ) { - return chainable ? - elems : + // Support: iOS 8.2 (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = jQuery.type( obj ); - // Gets - bulk ? - fn.call( elems ) : - length ? fn( elems[0], key ) : emptyGet; - }, + if ( type === "function" || jQuery.isWindow( obj ) ) { + return false; + } - now: function() { - return ( new Date() ).getTime(); + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.2.1 + * http://sizzlejs.com/ + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: 2015-10-17 + */ +(function( window ) { + +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; }, - // Use of jQuery.browser is frowned upon. - // More details: http://docs.jquery.com/Utilities/jQuery.browser - uaMatch: function( ua ) { - ua = ua.toLowerCase(); + // General-purpose constants + MAX_NEGATIVE = 1 << 31, - var match = rwebkit.exec( ua ) || - ropera.exec( ua ) || - rmsie.exec( ua ) || - ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || - []; - - return { browser: match[1] || "", version: match[2] || "0" }; - }, - - sub: function() { - function jQuerySub( selector, context ) { - return new jQuerySub.fn.init( selector, context ); - } - jQuery.extend( true, jQuerySub, this ); - jQuerySub.superclass = this; - jQuerySub.fn = jQuerySub.prototype = this(); - jQuerySub.fn.constructor = jQuerySub; - jQuerySub.sub = this.sub; - jQuerySub.fn.init = function init( selector, context ) { - if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { - context = jQuerySub( context ); + // Instance methods + hasOwn = ({}).hasOwnProperty, + arr = [], + pop = arr.pop, + push_native = arr.push, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf as it's faster than native + // http://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[i] === elem ) { + return i; } - - return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); - }; - jQuerySub.fn.init.prototype = jQuerySub.fn; - var rootjQuerySub = jQuerySub(document); - return jQuerySub; + } + return -1; }, - browser: {} -}); - -// Populate the class2type map -jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { - class2type[ "[object " + name + "]" ] = name.toLowerCase(); -}); + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ), + + rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + rescape = /'|\\/g, + + // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ), + funescape = function( _, escaped, escapedWhitespace ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + // Support: Firefox<24 + // Workaround erroneous numeric interpretation of +"0x" + return high !== high || escapedWhitespace ? + escaped : + high < 0 ? + // BMP codepoint + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }; -browserMatch = jQuery.uaMatch( userAgent ); -if ( browserMatch.browser ) { - jQuery.browser[ browserMatch.browser ] = true; - jQuery.browser.version = browserMatch.version; -} +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + (arr = slice.call( preferredDoc.childNodes )), + preferredDoc.childNodes + ); + // Support: Android<4.0 + // Detect silently failing push.apply + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + push_native.apply( target, slice.call(els) ); + } : -// Deprecated, use jQuery.browser.webkit instead -if ( jQuery.browser.webkit ) { - jQuery.browser.safari = true; + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + // Can't trust NodeList.length + while ( (target[j++] = els[i++]) ) {} + target.length = j - 1; + } + }; } -// IE doesn't match non-breaking spaces with \s -if ( rnotwhite.test( "\xA0" ) ) { - trimLeft = /^[\s\xA0]+/; - trimRight = /[\s\xA0]+$/; -} +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, nidselect, match, groups, newSelector, + newContext = context && context.ownerDocument, -// All jQuery objects should point back to these -rootjQuery = jQuery(document); + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; -// Cleanup functions for the document ready method -if ( document.addEventListener ) { - DOMContentLoaded = function() { - document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); - jQuery.ready(); - }; + results = results || []; -} else if ( document.attachEvent ) { - DOMContentLoaded = function() { - // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). - if ( document.readyState === "complete" ) { - document.detachEvent( "onreadystatechange", DOMContentLoaded ); - jQuery.ready(); - } - }; -} + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { -// The DOM ready check for Internet Explorer -function doScrollCheck() { - if ( jQuery.isReady ) { - return; + return results; } - try { - // If IE is used, use the trick by Diego Perini - // http://javascript.nwbox.com/IEContentLoaded/ - document.documentElement.doScroll("left"); - } catch(e) { - setTimeout( doScrollCheck, 1 ); - return; - } + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { - // and execute any waiting functions - jQuery.ready(); -} + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + context = context || document; -return jQuery; + if ( documentIsHTML ) { -})(); + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) { + // ID selector + if ( (m = match[1]) ) { -// String to Object flags format cache -var flagsCache = {}; + // Document context + if ( nodeType === 9 ) { + if ( (elem = context.getElementById( m )) ) { -// Convert String-formatted flags into Object-formatted ones and store in cache -function createFlags( flags ) { - var object = flagsCache[ flags ] = {}, - i, length; - flags = flags.split( /\s+/ ); - for ( i = 0, length = flags.length; i < length; i++ ) { - object[ flags[i] ] = true; - } - return object; -} + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } -/* - * Create a callback list using the following parameters: - * - * flags: an optional list of space-separated flags that will change how - * the callback list behaves - * - * By default a callback list will act like an event callback list and can be - * "fired" multiple times. - * - * Possible flags: - * - * once: will ensure the callback list can only be fired once (like a Deferred) - * - * memory: will keep track of previous values and will call any callback added - * after the list has been fired right away with the latest "memorized" - * values (like a Deferred) - * - * unique: will ensure a callback can only be added once (no duplicate in the list) - * - * stopOnFalse: interrupt callings when a callback returns false - * - */ -jQuery.Callbacks = function( flags ) { + // Element context + } else { - // Convert flags from String-formatted to Object-formatted - // (we check in cache first) - flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && (elem = newContext.getElementById( m )) && + contains( context, elem ) && + elem.id === m ) { - var // Actual callback list - list = [], - // Stack of fire calls for repeatable lists - stack = [], - // Last fire value (for non-forgettable lists) - memory, - // Flag to know if list was already fired - fired, - // Flag to know if list is currently firing - firing, - // First callback to fire (used internally by add and fireWith) - firingStart, - // End of the loop when firing - firingLength, - // Index of currently firing callback (modified by remove if needed) - firingIndex, - // Add one or several callbacks to the list - add = function( args ) { - var i, - length, - elem, - type, - actual; - for ( i = 0, length = args.length; i < length; i++ ) { - elem = args[ i ]; - type = jQuery.type( elem ); - if ( type === "array" ) { - // Inspect recursively - add( elem ); - } else if ( type === "function" ) { - // Add if not in unique mode and callback is not in - if ( !flags.unique || !self.has( elem ) ) { - list.push( elem ); - } - } - } - }, - // Fire callbacks - fire = function( context, args ) { - args = args || []; - memory = !flags.memory || [ context, args ]; - fired = true; - firing = true; - firingIndex = firingStart || 0; - firingStart = 0; - firingLength = list.length; - for ( ; list && firingIndex < firingLength; firingIndex++ ) { - if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { - memory = true; // Mark as halted - break; - } - } - firing = false; - if ( list ) { - if ( !flags.once ) { - if ( stack && stack.length ) { - memory = stack.shift(); - self.fireWith( memory[ 0 ], memory[ 1 ] ); - } - } else if ( memory === true ) { - self.disable(); - } else { - list = []; - } - } - }, - // Actual Callbacks object - self = { - // Add a callback or a collection of callbacks to the list - add: function() { - if ( list ) { - var length = list.length; - add( arguments ); - // Do we need to add the callbacks to the - // current firing batch? - if ( firing ) { - firingLength = list.length; - // With memory, if we're not firing then - // we should call right away, unless previous - // firing was halted (stopOnFalse) - } else if ( memory && memory !== true ) { - firingStart = length; - fire( memory[ 0 ], memory[ 1 ] ); - } - } - return this; - }, - // Remove a callback from the list - remove: function() { - if ( list ) { - var args = arguments, - argIndex = 0, - argLength = args.length; - for ( ; argIndex < argLength ; argIndex++ ) { - for ( var i = 0; i < list.length; i++ ) { - if ( args[ argIndex ] === list[ i ] ) { - // Handle firingIndex and firingLength - if ( firing ) { - if ( i <= firingLength ) { - firingLength--; - if ( i <= firingIndex ) { - firingIndex--; - } - } - } - // Remove the element - list.splice( i--, 1 ); - // If we have some unicity property then - // we only need to do this once - if ( flags.unique ) { - break; - } - } - } - } - } - return this; - }, - // Control if a given callback is in the list - has: function( fn ) { - if ( list ) { - var i = 0, - length = list.length; - for ( ; i < length; i++ ) { - if ( fn === list[ i ] ) { - return true; - } - } - } - return false; - }, - // Remove all callbacks from the list - empty: function() { - list = []; - return this; - }, - // Have the list do nothing anymore - disable: function() { - list = stack = memory = undefined; - return this; - }, - // Is it disabled? - disabled: function() { - return !list; - }, - // Lock the list in its current state - lock: function() { - stack = undefined; - if ( !memory || memory === true ) { - self.disable(); - } - return this; - }, - // Is it locked? - locked: function() { - return !stack; - }, - // Call all callbacks with the given context and arguments - fireWith: function( context, args ) { - if ( stack ) { - if ( firing ) { - if ( !flags.once ) { - stack.push( [ context, args ] ); + results.push( elem ); + return results; } - } else if ( !( flags.once && memory ) ) { - fire( context, args ); } - } - return this; - }, - // Call all the callbacks with the given arguments - fire: function() { - self.fireWith( this, arguments ); - return this; - }, - // To know if the callbacks have already been called at least once - fired: function() { - return !!fired; - } - }; - return self; -}; + // Type selector + } else if ( match[2] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + // Class selector + } else if ( (m = match[3]) && support.getElementsByClassName && + context.getElementsByClassName ) { + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + // Take advantage of querySelectorAll + if ( support.qsa && + !compilerCache[ selector + " " ] && + (!rbuggyQSA || !rbuggyQSA.test( selector )) ) { -var // Static reference to slice - sliceDeferred = [].slice; + if ( nodeType !== 1 ) { + newContext = context; + newSelector = selector; -jQuery.extend({ + // qSA looks outside Element context, which is not what we want + // Thanks to Andrew Dupont for this workaround technique + // Support: IE <=8 + // Exclude object elements + } else if ( context.nodeName.toLowerCase() !== "object" ) { - Deferred: function( func ) { - var doneList = jQuery.Callbacks( "once memory" ), - failList = jQuery.Callbacks( "once memory" ), - progressList = jQuery.Callbacks( "memory" ), - state = "pending", - lists = { - resolve: doneList, - reject: failList, - notify: progressList - }, - promise = { - done: doneList.add, - fail: failList.add, - progress: progressList.add, + // Capture the context ID, setting it first if necessary + if ( (nid = context.getAttribute( "id" )) ) { + nid = nid.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", (nid = expando) ); + } - state: function() { - return state; - }, + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + nidselect = ridentifier.test( nid ) ? "#" + nid : "[id='" + nid + "']"; + while ( i-- ) { + groups[i] = nidselect + " " + toSelector( groups[i] ); + } + newSelector = groups.join( "," ); - // Deprecated - isResolved: doneList.fired, - isRejected: failList.fired, + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + } - then: function( doneCallbacks, failCallbacks, progressCallbacks ) { - deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); - return this; - }, - always: function() { - deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); - return this; - }, - pipe: function( fnDone, fnFail, fnProgress ) { - return jQuery.Deferred(function( newDefer ) { - jQuery.each( { - done: [ fnDone, "resolve" ], - fail: [ fnFail, "reject" ], - progress: [ fnProgress, "notify" ] - }, function( handler, data ) { - var fn = data[ 0 ], - action = data[ 1 ], - returned; - if ( jQuery.isFunction( fn ) ) { - deferred[ handler ](function() { - returned = fn.apply( this, arguments ); - if ( returned && jQuery.isFunction( returned.promise ) ) { - returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); - } else { - newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); - } - }); - } else { - deferred[ handler ]( newDefer[ action ] ); - } - }); - }).promise(); - }, - // Get a promise for this deferred - // If obj is provided, the promise aspect is added to the object - promise: function( obj ) { - if ( obj == null ) { - obj = promise; - } else { - for ( var key in promise ) { - obj[ key ] = promise[ key ]; + if ( newSelector ) { + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); } } - return obj; } - }, - deferred = promise.promise({}), - key; - - for ( key in lists ) { - deferred[ key ] = lists[ key ].fire; - deferred[ key + "With" ] = lists[ key ].fireWith; + } } + } - // Handle state - deferred.done( function() { - state = "resolved"; - }, failList.disable, progressList.lock ).fail( function() { - state = "rejected"; - }, doneList.disable, progressList.lock ); - - // Call given func if any - if ( func ) { - func.call( deferred, deferred ); - } + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} - // All done! - return deferred; - }, +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; - // Deferred helper - when: function( firstParam ) { - var args = sliceDeferred.call( arguments, 0 ), - i = 0, - length = args.length, - pValues = new Array( length ), - count = length, - pCount = length, - deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? - firstParam : - jQuery.Deferred(), - promise = deferred.promise(); - function resolveFunc( i ) { - return function( value ) { - args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; - if ( !( --count ) ) { - deferred.resolveWith( deferred, args ); - } - }; - } - function progressFunc( i ) { - return function( value ) { - pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; - deferred.notifyWith( promise, pValues ); - }; - } - if ( length > 1 ) { - for ( ; i < length; i++ ) { - if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { - args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); - } else { - --count; - } - } - if ( !count ) { - deferred.resolveWith( deferred, args ); - } - } else if ( deferred !== firstParam ) { - deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + function cache( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; } - return promise; + return (cache[ key + " " ] = value); } -}); - + return cache; +} +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} +/** + * Support testing using an element + * @param {Function} fn Passed the created div and expects a boolean result + */ +function assert( fn ) { + var div = document.createElement("div"); -jQuery.support = (function() { + try { + return !!fn( div ); + } catch (e) { + return false; + } finally { + // Remove from its parent by default + if ( div.parentNode ) { + div.parentNode.removeChild( div ); + } + // release memory in IE + div = null; + } +} - var support, - all, - a, - select, - opt, - input, - fragment, - tds, - events, - eventName, - i, - isSupported, - div = document.createElement( "div" ), - documentElement = document.documentElement; +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split("|"), + i = arr.length; - // Preliminary tests - div.setAttribute("className", "t"); - div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + while ( i-- ) { + Expr.attrHandle[ arr[i] ] = handler; + } +} - all = div.getElementsByTagName( "*" ); - a = div.getElementsByTagName( "a" )[ 0 ]; +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + ( ~b.sourceIndex || MAX_NEGATIVE ) - + ( ~a.sourceIndex || MAX_NEGATIVE ); + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } - // Can't get basic test support - if ( !all || !all.length || !a ) { - return {}; - } - - // First batch of supports tests - select = document.createElement( "select" ); - opt = select.appendChild( document.createElement("option") ); - input = div.getElementsByTagName( "input" )[ 0 ]; - - support = { - // IE strips leading whitespace when .innerHTML is used - leadingWhitespace: ( div.firstChild.nodeType === 3 ), - - // Make sure that tbody elements aren't automatically inserted - // IE will insert them into empty tables - tbody: !div.getElementsByTagName("tbody").length, - - // Make sure that link elements get serialized correctly by innerHTML - // This requires a wrapper element in IE - htmlSerialize: !!div.getElementsByTagName("link").length, - - // Get the style information from getAttribute - // (IE uses .cssText instead) - style: /top/.test( a.getAttribute("style") ), - - // Make sure that URLs aren't manipulated - // (IE normalizes it by default) - hrefNormalized: ( a.getAttribute("href") === "/a" ), - - // Make sure that element opacity exists - // (IE uses filter instead) - // Use a regex to work around a WebKit issue. See #5145 - opacity: /^0.55/.test( a.style.opacity ), - - // Verify style float existence - // (IE uses styleFloat instead of cssFloat) - cssFloat: !!a.style.cssFloat, - - // Make sure that if no value is specified for a checkbox - // that it defaults to "on". - // (WebKit defaults to "" instead) - checkOn: ( input.value === "on" ), - - // Make sure that a selected-by-default option has a working selected property. - // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) - optSelected: opt.selected, - - // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) - getSetAttribute: div.className !== "t", - - // Tests for enctype support on a form(#6743) - enctype: !!document.createElement("form").enctype, - - // Makes sure cloning an html5 element does not cause problems - // Where outerHTML is undefined, this still works - html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>", - - // Will be defined later - submitBubbles: true, - changeBubbles: true, - focusinBubbles: false, - deleteExpando: true, - noCloneEvent: true, - inlineBlockNeedsLayout: false, - shrinkWrapBlocks: false, - reliableMarginRight: true, - pixelMargin: true - }; + // Check if b follows a + if ( cur ) { + while ( (cur = cur.nextSibling) ) { + if ( cur === b ) { + return -1; + } + } + } - // jQuery.boxModel DEPRECATED in 1.3, use jQuery.support.boxModel instead - jQuery.boxModel = support.boxModel = (document.compatMode === "CSS1Compat"); + return a ? 1 : -1; +} - // Make sure checked status is properly cloned - input.checked = true; - support.noCloneChecked = input.cloneNode( true ).checked; +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} - // Make sure that the options inside disabled selects aren't marked as disabled - // (WebKit marks them as disabled) - select.disabled = true; - support.optDisabled = !opt.disabled; +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} - // Test to see if it's possible to delete an expando from an element - // Fails in Internet Explorer - try { - delete div.test; - } catch( e ) { - support.deleteExpando = false; - } +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; - if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { - div.attachEvent( "onclick", function() { - // Cloning a node shouldn't copy over any - // bound event handlers (IE does this) - support.noCloneEvent = false; + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } }); - div.cloneNode( true ).fireEvent( "onclick" ); - } + }); +} - // Check if a radio maintains its value - // after being appended to the DOM - input = document.createElement("input"); - input.value = "t"; - input.setAttribute("type", "radio"); - support.radioValue = input.value === "t"; +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} - input.setAttribute("checked", "checked"); +// Expose support vars for convenience +support = Sizzle.support = {}; - // #11217 - WebKit loses check when the name is after the checked attribute - input.setAttribute( "name", "t" ); +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; - div.appendChild( input ); - fragment = document.createDocumentFragment(); - fragment.appendChild( div.lastChild ); +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, parent, + doc = node ? node.ownerDocument || node : preferredDoc; - // WebKit doesn't clone checked state correctly in fragments - support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + // Return early if doc is invalid or already selected + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } - // Check if a disconnected checkbox will retain its checked - // value of true after appended to the DOM (IE6/7) - support.appendChecked = input.checked; + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); - fragment.removeChild( input ); - fragment.appendChild( div ); + // Support: IE 9-11, Edge + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + if ( (parent = document.defaultView) && parent.top !== parent ) { + // Support: IE 11 + if ( parent.addEventListener ) { + parent.addEventListener( "unload", unloadHandler, false ); - // Technique from Juriy Zaytsev - // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ - // We only care about the case where non-standard event systems - // are used, namely in IE. Short-circuiting here helps us to - // avoid an eval call (in setAttribute) which can cause CSP - // to go haywire. See: https://developer.mozilla.org/en/Security/CSP - if ( div.attachEvent ) { - for ( i in { - submit: 1, - change: 1, - focusin: 1 - }) { - eventName = "on" + i; - isSupported = ( eventName in div ); - if ( !isSupported ) { - div.setAttribute( eventName, "return;" ); - isSupported = ( typeof div[ eventName ] === "function" ); - } - support[ i + "Bubbles" ] = isSupported; - } - } - - fragment.removeChild( div ); - - // Null elements to avoid leaks in IE - fragment = select = opt = div = input = null; - - // Run tests that need a body at doc ready - jQuery(function() { - var container, outer, inner, table, td, offsetSupport, - marginDiv, conMarginTop, style, html, positionTopLeftWidthHeight, - paddingMarginBorderVisibility, paddingMarginBorder, - body = document.getElementsByTagName("body")[0]; - - if ( !body ) { - // Return for frameset docs that don't have a body - return; + // Support: IE 9 - 10 only + } else if ( parent.attachEvent ) { + parent.attachEvent( "onunload", unloadHandler ); } + } - conMarginTop = 1; - paddingMarginBorder = "padding:0;margin:0;border:"; - positionTopLeftWidthHeight = "position:absolute;top:0;left:0;width:1px;height:1px;"; - paddingMarginBorderVisibility = paddingMarginBorder + "0;visibility:hidden;"; - style = "style='" + positionTopLeftWidthHeight + paddingMarginBorder + "5px solid #000;"; - html = "<div " + style + "display:block;'><div style='" + paddingMarginBorder + "0;display:block;overflow:hidden;'></div></div>" + - "<table " + style + "' cellpadding='0' cellspacing='0'>" + - "<tr><td></td></tr></table>"; + /* Attributes + ---------------------------------------------------------------------- */ - container = document.createElement("div"); - container.style.cssText = paddingMarginBorderVisibility + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; - body.insertBefore( container, body.firstChild ); + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert(function( div ) { + div.className = "i"; + return !div.getAttribute("className"); + }); - // Construct the test element - div = document.createElement("div"); - container.appendChild( div ); + /* getElement(s)By* + ---------------------------------------------------------------------- */ - // Check if table cells still have offsetWidth/Height when they are set - // to display:none and there are still other visible table cells in a - // table row; if so, offsetWidth/Height are not reliable for use when - // determining if an element has been hidden directly using - // display:none (it is still safe to use offsets if a parent element is - // hidden; don safety goggles and see bug #4512 for more information). - // (only IE 8 fails this test) - div.innerHTML = "<table><tr><td style='" + paddingMarginBorder + "0;display:none'></td><td>t</td></tr></table>"; - tds = div.getElementsByTagName( "td" ); - isSupported = ( tds[ 0 ].offsetHeight === 0 ); - - tds[ 0 ].style.display = ""; - tds[ 1 ].style.display = "none"; - - // Check if empty table cells still have offsetWidth/Height - // (IE <= 8 fail this test) - support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); - - // Check if div with explicit width and no margin-right incorrectly - // gets computed margin-right based on width of container. For more - // info see bug #3333 - // Fails in WebKit before Feb 2011 nightlies - // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right - if ( window.getComputedStyle ) { - div.innerHTML = ""; - marginDiv = document.createElement( "div" ); - marginDiv.style.width = "0"; - marginDiv.style.marginRight = "0"; - div.style.width = "2px"; - div.appendChild( marginDiv ); - support.reliableMarginRight = - ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; - } + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert(function( div ) { + div.appendChild( document.createComment("") ); + return !div.getElementsByTagName("*").length; + }); - if ( typeof div.style.zoom !== "undefined" ) { - // Check if natively block-level elements act like inline-block - // elements when setting their display to 'inline' and giving - // them layout - // (IE < 8 does this) - div.innerHTML = ""; - div.style.width = div.style.padding = "1px"; - div.style.border = 0; - div.style.overflow = "hidden"; - div.style.display = "inline"; - div.style.zoom = 1; - support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); - - // Check if elements with layout shrink-wrap their children - // (IE 6 does this) - div.style.display = "block"; - div.style.overflow = "visible"; - div.innerHTML = "<div style='width:5px;'></div>"; - support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); - } - - div.style.cssText = positionTopLeftWidthHeight + paddingMarginBorderVisibility; - div.innerHTML = html; - - outer = div.firstChild; - inner = outer.firstChild; - td = outer.nextSibling.firstChild.firstChild; - - offsetSupport = { - doesNotAddBorder: ( inner.offsetTop !== 5 ), - doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert(function( div ) { + docElem.appendChild( div ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + }); + + // ID find and filter + if ( support.getById ) { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var m = context.getElementById( id ); + return m ? [ m ] : []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + } else { + // Support: IE6/7 + // getElementById is not reliable as a find shortcut + delete Expr.find["ID"]; + + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode("id"); + return node && node.value === attrId; + }; }; + } - inner.style.position = "fixed"; - inner.style.top = "20px"; + // Tag + Expr.find["TAG"] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); - // safari subtracts parent border width here which is 5px - offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); - inner.style.position = inner.style.top = ""; + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : - outer.style.overflow = "hidden"; - outer.style.position = "relative"; + function( tag, context ) { + var elem, + tmp = [], + i = 0, + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); - offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); - offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); + // Filter out possible comments + if ( tag === "*" ) { + while ( (elem = results[i++]) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } - if ( window.getComputedStyle ) { - div.style.marginTop = "1%"; - support.pixelMargin = ( window.getComputedStyle( div, null ) || { marginTop: 0 } ).marginTop !== "1%"; - } + return tmp; + } + return results; + }; - if ( typeof container.style.zoom !== "undefined" ) { - container.style.zoom = 1; + // Class + Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); } + }; - body.removeChild( container ); - marginDiv = div = container = null; - - jQuery.extend( support, offsetSupport ); - }); + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ - return support; -})(); + // QSA and matchesSelector support + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See http://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + if ( (support.qsa = rnative.test( document.querySelectorAll )) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + docElem.appendChild( div ).innerHTML = "<a id='" + expando + "'></a>" + + "<select id='" + expando + "-\r\\' msallowcapture=''>" + + "<option selected=''></option></select>"; -var rbrace = /^(?:\{.*\}|\[.*\])$/, - rmultiDash = /([A-Z])/g; + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // http://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( div.querySelectorAll("[msallowcapture^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } -jQuery.extend({ - cache: {}, + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } - // Please use with caution - uuid: 0, + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !div.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push("~="); + } - // Unique for each copy of jQuery on the page - // Non-digits removed to match rinlinejQuery - expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } - // The following elements throw uncatchable exceptions if you - // attempt to add expando properties to them. - noData: { - "embed": true, - // Ban all objects except for Flash (which handle expandos) - "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", - "applet": true - }, + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibing-combinator selector` fails + if ( !div.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push(".#.+[+~]"); + } + }); - hasData: function( elem ) { - elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; - return !!elem && !isEmptyDataObject( elem ); - }, + assert(function( div ) { + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement("input"); + input.setAttribute( "type", "hidden" ); + div.appendChild( input ).setAttribute( "name", "D" ); - data: function( elem, name, data, pvt /* Internal Use Only */ ) { - if ( !jQuery.acceptData( elem ) ) { - return; - } + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( div.querySelectorAll("[name=d]").length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } - var privateCache, thisCache, ret, - internalKey = jQuery.expando, - getByName = typeof name === "string", + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } - // We have to handle DOM nodes and JS objects differently because IE6-7 - // can't GC object references properly across the DOM-JS boundary - isNode = elem.nodeType, + // Opera 10-11 does not throw on post-comma invalid pseudos + div.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } - // Only DOM nodes need the global jQuery cache; JS object data is - // attached directly to the object so GC can occur automatically - cache = isNode ? jQuery.cache : elem, + if ( (support.matchesSelector = rnative.test( (matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { - // Only defining an ID for JS objects if its cache already exists allows - // the code to shortcut on the same path as a DOM node with no cache - id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey, - isEvents = name === "events"; + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( div, "div" ); - // Avoid doing any more work than we need to when trying to get data on an - // object that has no data at all - if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { - return; - } + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( div, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } - if ( !id ) { - // Only DOM nodes need a new unique ID for each element since their data - // ends up in the global cache - if ( isNode ) { - elem[ internalKey ] = id = ++jQuery.uuid; - } else { - id = internalKey; + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } } - } + return false; + }; - if ( !cache[ id ] ) { - cache[ id ] = {}; + /* Sorting + ---------------------------------------------------------------------- */ - // Avoids exposing jQuery metadata on plain JS objects when the object - // is serialized using JSON.stringify - if ( !isNode ) { - cache[ id ].toJSON = jQuery.noop; - } + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; } - // An object can be passed to jQuery.data instead of a key/value pair; this gets - // shallow copied over onto the existing cache - if ( typeof name === "object" || typeof name === "function" ) { - if ( pvt ) { - cache[ id ] = jQuery.extend( cache[ id ], name ); - } else { - cache[ id ].data = jQuery.extend( cache[ id ].data, name ); - } + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; } - privateCache = thisCache = cache[ id ]; + // Calculate position if both inputs belong to the same document + compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : - // jQuery data() is stored in a separate object inside the object's internal data - // cache in order to avoid key collisions between internal data and user-defined - // data. - if ( !pvt ) { - if ( !thisCache.data ) { - thisCache.data = {}; - } + // Otherwise we know they are disconnected + 1; - thisCache = thisCache.data; - } + // Disconnected nodes + if ( compare & 1 || + (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) { + + // Choose the first element that is related to our preferred document + if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) { + return -1; + } + if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) { + return 1; + } - if ( data !== undefined ) { - thisCache[ jQuery.camelCase( name ) ] = data; + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; } - // Users should not attempt to inspect the internal events object using jQuery.data, - // it is undocumented and subject to change. But does anyone listen? No. - if ( isEvents && !thisCache[ name ] ) { - return privateCache.events; + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; } - // Check for both converted-to-camel and non-converted data property names - // If a data property was specified - if ( getByName ) { + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + return a === document ? -1 : + b === document ? 1 : + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; - // First Try to find as-is property data - ret = thisCache[ name ]; + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } - // Test for null|undefined property data - if ( ret == null ) { + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } - // Try to find the camelCased property - ret = thisCache[ jQuery.camelCase( name ) ]; - } - } else { - ret = thisCache; + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; } - return ret; - }, + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : - removeData: function( elem, name, pvt /* Internal Use Only */ ) { - if ( !jQuery.acceptData( elem ) ) { - return; - } + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; - var thisCache, i, l, + return document; +}; - // Reference to internal data cache key - internalKey = jQuery.expando, +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; - isNode = elem.nodeType, +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } - // See jQuery.data for more information - cache = isNode ? jQuery.cache : elem, + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); - // See jQuery.data for more information - id = isNode ? elem[ internalKey ] : internalKey; + if ( support.matchesSelector && documentIsHTML && + !compilerCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { - // If there is already no cache entry for this object, there is no - // purpose in continuing - if ( !cache[ id ] ) { - return; - } + try { + var ret = matches.call( elem, expr ); - if ( name ) { + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch (e) {} + } - thisCache = pvt ? cache[ id ] : cache[ id ].data; + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; - if ( thisCache ) { +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; - // Support array or space separated string names for data keys - if ( !jQuery.isArray( name ) ) { +Sizzle.attr = function( elem, name ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } - // try the string as a key before any manipulation - if ( name in thisCache ) { - name = [ name ]; - } else { + var fn = Expr.attrHandle[ name.toLowerCase() ], + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; - // split the camel cased version by spaces unless a key with the spaces exists - name = jQuery.camelCase( name ); - if ( name in thisCache ) { - name = [ name ]; - } else { - name = name.split( " " ); - } - } - } + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; +}; - for ( i = 0, l = name.length; i < l; i++ ) { - delete thisCache[ name[i] ]; - } +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; - // If there is no data left in the cache, we want to continue - // and let the cache object itself get destroyed - if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { - return; - } - } - } +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; - // See jQuery.data for more information - if ( !pvt ) { - delete cache[ id ].data; + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); - // Don't destroy the parent cache unless the internal data object - // had been the only thing left in it - if ( !isEmptyDataObject(cache[ id ]) ) { - return; + if ( hasDuplicate ) { + while ( (elem = results[i++]) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); } } - - // Browsers that fail expando deletion also refuse to delete expandos on - // the window, but it will allow it on all other JS objects; other browsers - // don't care - // Ensure that `cache` is not a window object #10080 - if ( jQuery.support.deleteExpando || !cache.setInterval ) { - delete cache[ id ]; - } else { - cache[ id ] = null; + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); } + } - // We destroyed the cache and need to eliminate the expando on the node to avoid - // false lookups in the cache for entries that no longer exist - if ( isNode ) { - // IE does not allow us to delete expando properties from nodes, - // nor does it have a removeAttribute function on Document nodes; - // we must handle all of these cases - if ( jQuery.support.deleteExpando ) { - delete elem[ internalKey ]; - } else if ( elem.removeAttribute ) { - elem.removeAttribute( internalKey ); - } else { - elem[ internalKey ] = null; - } - } - }, + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; - // For internal use only. - _data: function( elem, name, data ) { - return jQuery.data( elem, name, data, true ); - }, + return results; +}; - // A method for determining if a DOM node can handle the data expando - acceptData: function( elem ) { - if ( elem.nodeName ) { - var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; - if ( match ) { - return !(match === true || elem.getAttribute("classid") !== match); + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + while ( (node = elem[i++]) ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); } } - - return true; + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; } -}); + // Do not include comment or processing instruction nodes -jQuery.fn.extend({ - data: function( key, value ) { - var parts, part, attr, name, l, - elem = this[0], - i = 0, - data = null; + return ret; +}; - // Gets all values - if ( key === undefined ) { - if ( this.length ) { - data = jQuery.data( elem ); +Expr = Sizzle.selectors = { - if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { - attr = elem.attributes; - for ( l = attr.length; i < l; i++ ) { - name = attr[i].name; + // Can be adjusted by the user + cacheLength: 50, - if ( name.indexOf( "data-" ) === 0 ) { - name = jQuery.camelCase( name.substring(5) ); + createPseudo: markFunction, - dataAttr( elem, name, data[ name ] ); - } - } - jQuery._data( elem, "parsedAttrs", true ); - } - } + match: matchExpr, - return data; - } + attrHandle: {}, - // Sets multiple values - if ( typeof key === "object" ) { - return this.each(function() { - jQuery.data( this, key ); - }); - } + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, - parts = key.split( ".", 2 ); - parts[1] = parts[1] ? "." + parts[1] : ""; - part = parts[1] + "!"; + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); - return jQuery.access( this, function( value ) { + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape ); - if ( value === undefined ) { - data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, - // Try to fetch any internally stored data first - if ( data === undefined && elem ) { - data = jQuery.data( elem, key ); - data = dataAttr( elem, key, data ); + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); } - return data === undefined && parts[1] ? - this.data( parts[0] ) : - data; + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); } - parts[1] = value; - this.each(function() { - var self = jQuery( this ); + return match; + }, - self.triggerHandler( "setData" + part, parts ); - jQuery.data( this, key, value ); - self.triggerHandler( "changeData" + part, parts ); - }); - }, null, value, arguments.length > 1, null, false ); - }, + "PSEUDO": function( match ) { + var excess, + unquoted = !match[6] && match[2]; - removeData: function( key ) { - return this.each(function() { - jQuery.removeData( this, key ); - }); - } -}); + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } -function dataAttr( elem, key, data ) { - // If nothing was found internally, try to fetch any - // data from the HTML5 data-* attribute - if ( data === undefined && elem.nodeType === 1 ) { + // Accept quoted arguments as-is + if ( match[3] ) { + match[2] = match[4] || match[5] || ""; - var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { - data = elem.getAttribute( name ); + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } - if ( typeof data === "string" ) { - try { - data = data === "true" ? true : - data === "false" ? false : - data === "null" ? null : - jQuery.isNumeric( data ) ? +data : - rbrace.test( data ) ? jQuery.parseJSON( data ) : - data; - } catch( e ) {} + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, - // Make sure we set the data so it isn't changed later - jQuery.data( elem, key, data ); + filter: { - } else { - data = undefined; - } - } + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { return true; } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, - return data; -} + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; -// checks a cache object for emptiness -function isEmptyDataObject( obj ) { - for ( var name in obj ) { + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" ); + }); + }, - // if the public data object is empty, the private is still empty - if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { - continue; - } - if ( name !== "toJSON" ) { - return false; - } - } + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); - return true; -} + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + result += ""; + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } -function handleQueueMarkDefer( elem, type, src ) { - var deferDataKey = type + "defer", - queueDataKey = type + "queue", - markDataKey = type + "mark", - defer = jQuery._data( elem, deferDataKey ); - if ( defer && - ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && - ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { - // Give room for hard-coded callbacks to fire first - // and eventually mark/queue something else on the element - setTimeout( function() { - if ( !jQuery._data( elem, queueDataKey ) && - !jQuery._data( elem, markDataKey ) ) { - jQuery.removeData( elem, deferDataKey, true ); - defer.fire(); - } - }, 0 ); - } -} + start = [ forward ? parent.firstChild : parent.lastChild ]; -jQuery.extend({ + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { - _mark: function( elem, type ) { - if ( elem ) { - type = ( type || "fx" ) + "mark"; - jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); - } - }, + // Seek `elem` from a previously-cached index - _unmark: function( force, elem, type ) { - if ( force !== true ) { - type = elem; - elem = force; - force = false; - } - if ( elem ) { - type = type || "fx"; - var key = type + "mark", - count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); - if ( count ) { - jQuery._data( elem, key, count ); - } else { - jQuery.removeData( elem, key, true ); - handleQueueMarkDefer( elem, type, "mark" ); - } - } - }, + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || (node[ expando ] = {}); - queue: function( elem, type, data ) { - var q; - if ( elem ) { - type = ( type || "fx" ) + "queue"; - q = jQuery._data( elem, type ); + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); - // Speed up dequeue by getting out quickly if this is just a lookup - if ( data ) { - if ( !q || jQuery.isArray(data) ) { - q = jQuery._data( elem, type, jQuery.makeArray(data) ); - } else { - q.push( data ); - } - } - return q || []; - } - }, + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; - dequeue: function( elem, type ) { - type = type || "fx"; + while ( (node = ++nodeIndex && node && node[ dir ] || - var queue = jQuery.queue( elem, type ), - fn = queue.shift(), - hooks = {}; + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { - // If the fx queue is dequeued, always remove the progress sentinel - if ( fn === "inprogress" ) { - fn = queue.shift(); - } + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } - if ( fn ) { - // Add a progress sentinel to prevent the fx queue from being - // automatically dequeued - if ( type === "fx" ) { - queue.unshift( "inprogress" ); - } + } else { + // Use previously-cached element index if available + if ( useCache ) { + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } - jQuery._data( elem, type + ".run", hooks ); - fn.call( elem, function() { - jQuery.dequeue( elem, type ); - }, hooks ); - } + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { - if ( !queue.length ) { - jQuery.removeData( elem, type + "queue " + type + ".run", true ); - handleQueueMarkDefer( elem, type, "queue" ); - } - } -}); + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { -jQuery.fn.extend({ - queue: function( type, data ) { - var setter = 2; + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || (node[ expando ] = {}); - if ( typeof type !== "string" ) { - data = type; - type = "fx"; - setter--; - } + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); - if ( arguments.length < setter ) { - return jQuery.queue( this[0], type ); - } + uniqueCache[ type ] = [ dirruns, diff ]; + } - return data === undefined ? - this : - this.each(function() { - var queue = jQuery.queue( this, type, data ); + if ( node === elem ) { + break; + } + } + } + } + } - if ( type === "fx" && queue[0] !== "inprogress" ) { - jQuery.dequeue( this, type ); - } - }); - }, - dequeue: function( type ) { - return this.each(function() { - jQuery.dequeue( this, type ); - }); - }, - // Based off of the plugin by Clint Helfers, with permission. - // http://blindsignals.com/index.php/2009/07/jquery-delay/ - delay: function( time, type ) { - time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; - type = type || "fx"; + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, - return this.queue( type, function( next, hooks ) { - var timeout = setTimeout( next, time ); - hooks.stop = function() { - clearTimeout( timeout ); - }; - }); - }, - clearQueue: function( type ) { - return this.queue( type || "fx", [] ); - }, - // Get a promise resolved when queues of a certain type - // are emptied (fx is the type by default) - promise: function( type, object ) { - if ( typeof type !== "string" ) { - object = type; - type = undefined; - } - type = type || "fx"; - var defer = jQuery.Deferred(), - elements = this, - i = elements.length, - count = 1, - deferDataKey = type + "defer", - queueDataKey = type + "queue", - markDataKey = type + "mark", - tmp; - function resolve() { - if ( !( --count ) ) { - defer.resolveWith( elements, [ elements ] ); - } - } - while( i-- ) { - if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || - ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || - jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && - jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { - count++; - tmp.add( resolve ); + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; } - } - resolve(); - return defer.promise( object ); - } -}); + return fn; + } + }, + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; -var rclass = /[\n\t\r]/g, - rspace = /\s+/, - rreturn = /\r/g, - rtype = /^(?:button|input)$/i, - rfocusable = /^(?:button|input|object|select|textarea)$/i, - rclickable = /^a(?:rea)?$/i, - rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, - getSetAttribute = jQuery.support.getSetAttribute, - nodeHook, boolHook, fixSpecified; + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + // Don't keep the element (issue #299) + input[0] = null; + return !results.pop(); + }; + }), -jQuery.fn.extend({ - attr: function( name, value ) { - return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); - }, + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), - removeAttr: function( name ) { - return this.each(function() { - jQuery.removeAttr( this, name ); - }); - }, + "contains": markFunction(function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifier + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), - prop: function( name, value ) { - return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); - }, + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, - removeProp: function( name ) { - name = jQuery.propFix[ name ] || name; - return this.each(function() { - // try/catch handles cases where IE balks (such as removing a property on window) - try { - this[ name ] = undefined; - delete this[ name ]; - } catch( e ) {} - }); - }, + "root": function( elem ) { + return elem === docElem; + }, - addClass: function( value ) { - var classNames, i, l, elem, - setClass, c, cl; + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, - if ( jQuery.isFunction( value ) ) { - return this.each(function( j ) { - jQuery( this ).addClass( value.call(this, j, this.className) ); - }); - } + // Boolean properties + "enabled": function( elem ) { + return elem.disabled === false; + }, - if ( value && typeof value === "string" ) { - classNames = value.split( rspace ); + "disabled": function( elem ) { + return elem.disabled === true; + }, - for ( i = 0, l = this.length; i < l; i++ ) { - elem = this[ i ]; + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, - if ( elem.nodeType === 1 ) { - if ( !elem.className && classNames.length === 1 ) { - elem.className = value; + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } - } else { - setClass = " " + elem.className + " "; + return elem.selected === true; + }, - for ( c = 0, cl = classNames.length; c < cl; c++ ) { - if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { - setClass += classNames[ c ] + " "; - } - } - elem.className = jQuery.trim( setClass ); - } + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; } } - } + return true; + }, - return this; - }, + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, - removeClass: function( value ) { - var classNames, i, l, elem, className, c, cl; + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, - if ( jQuery.isFunction( value ) ) { - return this.each(function( j ) { - jQuery( this ).removeClass( value.call(this, j, this.className) ); - }); - } + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, - if ( (value && typeof value === "string") || value === undefined ) { - classNames = ( value || "" ).split( rspace ); + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, - for ( i = 0, l = this.length; i < l; i++ ) { - elem = this[ i ]; + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && - if ( elem.nodeType === 1 && elem.className ) { - if ( value ) { - className = (" " + elem.className + " ").replace( rclass, " " ); - for ( c = 0, cl = classNames.length; c < cl; c++ ) { - className = className.replace(" " + classNames[ c ] + " ", " "); - } - elem.className = jQuery.trim( className ); + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" ); + }, - } else { - elem.className = ""; - } - } - } - } + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), - return this; - }, + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), - toggleClass: function( value, stateVal ) { - var type = typeof value, - isBool = typeof stateVal === "boolean"; + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), - if ( jQuery.isFunction( value ) ) { - return this.each(function( i ) { - jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); - }); - } - - return this.each(function() { - if ( type === "string" ) { - // toggle individual class names - var className, - i = 0, - self = jQuery( this ), - state = stateVal, - classNames = value.split( rspace ); - - while ( (className = classNames[ i++ ]) ) { - // check each className given, space seperated list - state = isBool ? state : !self.hasClass( className ); - self[ state ? "addClass" : "removeClass" ]( className ); - } - - } else if ( type === "undefined" || type === "boolean" ) { - if ( this.className ) { - // store className if set - jQuery._data( this, "__className__", this.className ); - } - - // toggle whole className - this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); } - }); - }, + return matchIndexes; + }), - hasClass: function( selector ) { - var className = " " + selector + " ", - i = 0, - l = this.length; - for ( ; i < l; i++ ) { - if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { - return true; + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); } - } + return matchIndexes; + }), - return false; - }, + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), - val: function( value ) { - var hooks, ret, isFunction, - elem = this[0]; + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; - if ( !arguments.length ) { - if ( elem ) { - hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; +Expr.pseudos["nth"] = Expr.pseudos["eq"]; - if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { - return ret; - } +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} - ret = elem.value; +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); - return typeof ret === "string" ? - // handle most common string cases - ret.replace(rreturn, "") : - // handle cases where value is null/undef or number - ret == null ? "" : ret; - } +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; - return; - } + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } - isFunction = jQuery.isFunction( value ); + soFar = selector; + groups = []; + preFilters = Expr.preFilter; - return this.each(function( i ) { - var self = jQuery(this), val; + while ( soFar ) { - if ( this.nodeType !== 1 ) { - return; + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; } + groups.push( (tokens = []) ); + } - if ( isFunction ) { - val = value.call( this, i, self.val() ); - } else { - val = value; - } + matched = false; - // Treat null/undefined as ""; convert numbers to string - if ( val == null ) { - val = ""; - } else if ( typeof val === "number" ) { - val += ""; - } else if ( jQuery.isArray( val ) ) { - val = jQuery.map(val, function ( value ) { - return value == null ? "" : value + ""; + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + matched = match.shift(); + tokens.push({ + value: matched, + // Cast descendant combinators to space + type: match[0].replace( rtrim, " " ) + }); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + matched = match.shift(); + tokens.push({ + value: matched, + type: type, + matches: match }); + soFar = soFar.slice( matched.length ); } + } - hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + if ( !matched ) { + break; + } + } - // If set returns undefined, fall back to normal setting - if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { - this.value = val; - } - }); + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[i].value; } -}); + return selector; +} -jQuery.extend({ - valHooks: { - option: { - get: function( elem ) { - // attributes.value is undefined in Blackberry 4.7 but - // uses .value. See #6932 - var val = elem.attributes.value; - return !val || val.specified ? elem.value : elem.text; +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } } - }, - select: { - get: function( elem ) { - var value, i, max, option, - index = elem.selectedIndex, - values = [], - options = elem.options, - one = elem.type === "select-one"; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; - // Nothing was selected - if ( index < 0 ) { - return null; + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); - // Loop through all the selected options - i = one ? index : 0; - max = one ? index + 1 : options.length; - for ( ; i < max; i++ ) { - option = options[ i ]; + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {}); - // Don't return options that are disabled or in a disabled optgroup - if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && - (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + if ( (oldCache = uniqueCache[ dir ]) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { - // Get the specific value for the option - value = jQuery( option ).val(); + // Assign to newCache so results back-propagate to previous elements + return (newCache[ 2 ] = oldCache[ 2 ]); + } else { + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ dir ] = newCache; - // We don't need an array for one selects - if ( one ) { - return value; + // A match means we're done; a fail means we have to keep checking + if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) { + return true; + } } - - // Multi-Selects return an array - values.push( value ); } } + } + }; +} - // Fixes Bug #2551 -- select.val() broken in IE after form.reset() - if ( one && !values.length && options.length ) { - return jQuery( options[ index ] ).val(); +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; } + } + return true; + } : + matchers[0]; +} - return values; - }, - - set: function( elem, value ) { - var values = jQuery.makeArray( value ); +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} - jQuery(elem).find("option").each(function() { - this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; - }); +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; - if ( !values.length ) { - elem.selectedIndex = -1; + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); } - return values; } } - }, + } - attrFn: { - val: true, - css: true, - html: true, - text: true, - data: true, - width: true, - height: true, - offset: true - }, + return newUnmatched; +} - attr: function( elem, name, value, pass ) { - var ret, hooks, notxml, - nType = elem.nodeType; +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, - // don't get/set attributes on text, comment and attribute nodes - if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { - return; - } + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), - if ( pass && name in jQuery.attrFn ) { - return jQuery( elem )[ name ]( value ); - } + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, - // Fallback to prop when attributes are not supported - if ( typeof elem.getAttribute === "undefined" ) { - return jQuery.prop( elem, name, value ); + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); } - notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); - // All attributes are lowercase - // Grab necessary hook if one is defined - if ( notxml ) { - name = name.toLowerCase(); - hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } } - if ( value !== undefined ) { + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } - if ( value === null ) { - jQuery.removeAttr( elem, name ); - return; + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) { - } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { - return ret; + seed[temp] = !(results[temp] = elem); + } + } + } + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); } else { - elem.setAttribute( name, "" + value ); - return value; + push.apply( results, matcherOut ); } + } + }); +} - } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + // Avoid hanging onto element (issue #299) + checkContext = null; return ret; + } ]; + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; } else { - - ret = elem.getAttribute( name ); - - // Non-existent attributes return null, we normalize to undefined - return ret === null ? - undefined : - ret; + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" }) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); } - }, - - removeAttr: function( elem, value ) { - var propName, attrNames, name, l, isBool, - i = 0; - - if ( value && elem.nodeType === 1 ) { - attrNames = value.toLowerCase().split( rspace ); - l = attrNames.length; + } - for ( ; i < l; i++ ) { - name = attrNames[ i ]; + return elementMatcher( matchers ); +} - if ( name ) { - propName = jQuery.propFix[ name ] || name; - isBool = rboolean.test( name ); +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find["TAG"]( "*", outermost ), + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), + len = elems.length; + + if ( outermost ) { + outermostContext = context === document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id + for ( ; i !== len && (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + if ( !context && elem.ownerDocument !== document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( (matcher = elementMatchers[j++]) ) { + if ( matcher( elem, context || document, xml) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } - // See #9699 for explanation of this approach (setting first, then removal) - // Do not do this for boolean attributes (see #10870) - if ( !isBool ) { - jQuery.attr( elem, name, "" ); + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; } - elem.removeAttribute( getSetAttribute ? name : propName ); - // Set corresponding property to false for boolean attributes - if ( isBool && propName in elem ) { - elem[ propName ] = false; + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); } } } - } - }, - attrHooks: { - type: { - set: function( elem, value ) { - // We can't allow the type property to be changed (since it causes problems in IE) - if ( rtype.test( elem.nodeName ) && elem.parentNode ) { - jQuery.error( "type property can't be changed" ); - } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { - // Setting the type on a radio button after the value resets the value in IE6-9 - // Reset value to it's default in case type is set after value - // This is for element creation - var val = elem.value; - elem.setAttribute( "type", value ); - if ( val ) { - elem.value = val; - } - return value; + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( (matcher = setMatchers[j++]) ) { + matcher( unmatched, setMatched, context, xml ); } - } - }, - // Use the value property for back compat - // Use the nodeHook for button elements in IE6/7 (#1954) - value: { - get: function( elem, name ) { - if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { - return nodeHook.get( elem, name ); + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); } - return name in elem ? - elem.value : - null; - }, - set: function( elem, value, name ) { - if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { - return nodeHook.set( elem, value, name ); + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); } - // Does not return so that setAttribute is also used - elem.value = value; } - } - }, - propFix: { - tabindex: "tabIndex", - readonly: "readOnly", - "for": "htmlFor", - "class": "className", - maxlength: "maxLength", - cellspacing: "cellSpacing", - cellpadding: "cellPadding", - rowspan: "rowSpan", - colspan: "colSpan", - usemap: "useMap", - frameborder: "frameBorder", - contenteditable: "contentEditable" - }, + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } - prop: function( elem, name, value ) { - var ret, hooks, notxml, - nType = elem.nodeType; + return unmatched; + }; - // don't get/set properties on text, comment and attribute nodes - if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { - return; + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } } - notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); - if ( notxml ) { - // Fix name and attach hooks - name = jQuery.propFix[ name ] || name; - hooks = jQuery.propHooks[ name ]; - } + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; - if ( value !== undefined ) { - if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { - return ret; +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( (selector = compiled.selector || selector) ); - } else { - return ( elem[ name ] = value ); - } + results = results || []; - } else { - if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { - return ret; + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { - } else { - return elem[ name ]; + // Reduce context if the leading compound selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + support.getById && context.nodeType === 9 && documentIsHTML && + Expr.relative[ tokens[1].type ] ) { + + context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; } + + selector = selector.slice( tokens.shift().value.length ); } - }, - propHooks: { - tabIndex: { - get: function( elem ) { - // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set - // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ - var attributeNode = elem.getAttributeNode("tabindex"); + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[i]; - return attributeNode && attributeNode.specified ? - parseInt( attributeNode.value, 10 ) : - rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? - 0 : - undefined; + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } } } } -}); -// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) -jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; -// Hook for boolean attributes -boolHook = { - get: function( elem, name ) { - // Align boolean attributes with corresponding properties - // Fall back to attribute presence where some booleans are not supported - var attrNode, - property = jQuery.prop( elem, name ); - return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? - name.toLowerCase() : - undefined; - }, - set: function( elem, value, name ) { - var propName; - if ( value === false ) { - // Remove boolean attributes when set to false - jQuery.removeAttr( elem, name ); +// One-time assignments + +// Sort stability +support.sortStable = expando.split("").sort( sortOrder ).join("") === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert(function( div1 ) { + // Should return 1, but returns 4 (following) + return div1.compareDocumentPosition( document.createElement("div") ) & 1; +}); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert(function( div ) { + div.innerHTML = "<a href='#'></a>"; + return div.firstChild.getAttribute("href") === "#" ; +}) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + }); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert(function( div ) { + div.innerHTML = "<input/>"; + div.firstChild.setAttribute( "value", "" ); + return div.firstChild.getAttribute( "value" ) === ""; +}) ) { + addHandle( "value", function( elem, name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + }); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert(function( div ) { + return div.getAttribute("disabled") == null; +}) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + (val = elem.getAttributeNode( name )) && val.specified ? + val.value : + null; + } + }); +} + +return Sizzle; + +})( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + +var rsingleTag = ( /^<([\w-]+)\s*\/?>(?:<\/\1>|)$/ ); + + + +var risSimple = /^.[^:#\[\.,]*$/; + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + /* jshint -W018 */ + return !!qualifier.call( elem, i, elem ) !== not; + } ); + + } + + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + + } + + if ( typeof qualifier === "string" ) { + if ( risSimple.test( qualifier ) ) { + return jQuery.filter( qualifier, elements, not ); + } + + qualifier = jQuery.filter( qualifier, elements ); + } + + return jQuery.grep( elements, function( elem ) { + return ( jQuery.inArray( elem, qualifier ) > -1 ) !== not; + } ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 && elem.nodeType === 1 ? + jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [] : + jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, + ret = [], + self = this, + len = self.length; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + // Needed because $( selector, context ) becomes $( context ).find( selector ) + ret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret ); + ret.selector = this.selector ? this.selector + " " + selector : selector; + return ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // init accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt( 0 ) === "<" && + selector.charAt( selector.length - 1 ) === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( jQuery.isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[ 2 ] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[ 0 ] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this.context = this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return typeof root.ready !== "undefined" ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( pos ? + pos.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[ 0 ], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem, this ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + ret = jQuery.uniqueSort( ret ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + } + + return this.pushStack( ret ); + }; +} ); +var rnotwhite = ( /\S+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnotwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( jQuery.isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && jQuery.type( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = true; + if ( !memory ) { + self.disable(); + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks( "once memory" ), "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), "rejected" ], + [ "notify", "progress", jQuery.Callbacks( "memory" ) ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var fn = jQuery.isFunction( fns[ i ] ) && fns[ i ]; + + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this === promise ? newDefer.promise() : this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( function() { + + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? promise : this, arguments ); + return this; + }; + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || + ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. + // If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( values === progressValues ) { + deferred.notifyWith( contexts, values ); + + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .progress( updateFunc( i, progressContexts, progressValues ) ) + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +} ); + + +// The deferred used on DOM ready +var readyList; + +jQuery.fn.ready = function( fn ) { + + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.triggerHandler ) { + jQuery( document ).triggerHandler( "ready" ); + jQuery( document ).off( "ready" ); + } + } +} ); + +/** + * Clean-up method for dom ready events + */ +function detach() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + + } else { + document.detachEvent( "onreadystatechange", completed ); + window.detachEvent( "onload", completed ); + } +} + +/** + * The ready event handler and self cleanup method + */ +function completed() { + + // readyState === "complete" is good enough for us to call the dom ready in oldIE + if ( document.addEventListener || + window.event.type === "load" || + document.readyState === "complete" ) { + + detach(); + jQuery.ready(); + } +} + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called + // after the browser event has already occurred. + // Support: IE6-10 + // Older IE sometimes signals "interactive" too soon + if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); + + // If IE event model is used + } else { + + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", completed ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", completed ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch ( e ) {} + + if ( top && top.doScroll ) { + ( function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll( "left" ); + } catch ( e ) { + return window.setTimeout( doScrollCheck, 50 ); + } + + // detach all dom ready events + detach(); + + // and execute any waiting functions + jQuery.ready(); + } + } )(); + } + } + } + return readyList.promise( obj ); +}; + +// Kick off the DOM ready check even if the user does not +jQuery.ready.promise(); + + + + +// Support: IE<9 +// Iteration over object's inherited properties before its own +var i; +for ( i in jQuery( support ) ) { + break; +} +support.ownFirst = i === "0"; + +// Note: most support tests are defined in their respective modules. +// false until the test is run +support.inlineBlockNeedsLayout = false; + +// Execute ASAP in case we need to set body.style.zoom +jQuery( function() { + + // Minified: var a,b,c,d + var val, div, body, container; + + body = document.getElementsByTagName( "body" )[ 0 ]; + if ( !body || !body.style ) { + + // Return for frameset docs that don't have a body + return; + } + + // Setup + div = document.createElement( "div" ); + container = document.createElement( "div" ); + container.style.cssText = "position:absolute;border:0;width:0;height:0;top:0;left:-9999px"; + body.appendChild( container ).appendChild( div ); + + if ( typeof div.style.zoom !== "undefined" ) { + + // Support: IE<8 + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + div.style.cssText = "display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1"; + + support.inlineBlockNeedsLayout = val = div.offsetWidth === 3; + if ( val ) { + + // Prevent IE 6 from affecting layout for positioned elements #11048 + // Prevent IE from shrinking the body in IE 7 mode #12869 + // Support: IE<8 + body.style.zoom = 1; + } + } + + body.removeChild( container ); +} ); + + +( function() { + var div = document.createElement( "div" ); + + // Support: IE<9 + support.deleteExpando = true; + try { + delete div.test; + } catch ( e ) { + support.deleteExpando = false; + } + + // Null elements to avoid leaks in IE. + div = null; +} )(); +var acceptData = function( elem ) { + var noData = jQuery.noData[ ( elem.nodeName + " " ).toLowerCase() ], + nodeType = +elem.nodeType || 1; + + // Do not set data on non-element DOM nodes because it will not be cleared (#8335). + return nodeType !== 1 && nodeType !== 9 ? + false : + + // Nodes accept data unless otherwise specified; rejection can be conditional + !noData || noData !== true && elem.getAttribute( "classid" ) === noData; +}; + + + + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /([A-Z])/g; + +function dataAttr( elem, key, data ) { + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[ name ] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + +function internalData( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !acceptData( elem ) ) { + return; + } + + var ret, thisCache, + internalKey = jQuery.expando, + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( ( !id || !cache[ id ] || ( !pvt && !cache[ id ].data ) ) && + data === undefined && typeof name === "string" ) { + return; + } + + if ( !id ) { + + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + id = elem[ internalKey ] = deletedIds.pop() || jQuery.guid++; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + + // Avoid exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + cache[ id ] = isNode ? {} : { toJSON: jQuery.noop }; + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); } else { - // value is true since we know at this point it's type boolean and not false - // Set boolean attributes to the same name and set the DOM property - propName = jQuery.propFix[ name ] || name; - if ( propName in elem ) { - // Only set the IDL specifically if it already exists on the element - elem[ propName ] = true; + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( typeof name === "string" ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; +} + +function internalRemoveData( elem, name, pvt ) { + if ( !acceptData( elem ) ) { + return; + } + + var thisCache, i, + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split( " " ); + } + } + } else { + + // If "name" is an array of keys... + // When data is initially created, via ("key", "val") signature, + // keys will be converted to camelCase. + // Since there is no way to tell _how_ a key was added, remove + // both plain key and camelCase key. #12786 + // This will only penalize the array argument path. + name = name.concat( jQuery.map( name, jQuery.camelCase ) ); + } + + i = name.length; + while ( i-- ) { + delete thisCache[ name[ i ] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( pvt ? !isEmptyDataObject( thisCache ) : !jQuery.isEmptyObject( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + /* jshint eqeqeq: false */ + } else if ( support.deleteExpando || cache != cache.window ) { + /* jshint eqeqeq: true */ + delete cache[ id ]; + + // When all else fails, undefined + } else { + cache[ id ] = undefined; + } +} + +jQuery.extend( { + cache: {}, + + // The following elements (space-suffixed to avoid Object.prototype collisions) + // throw uncatchable exceptions if you attempt to set expando properties + noData: { + "applet ": true, + "embed ": true, + + // ...but Flash objects (which have this classid) *can* handle expandos + "object ": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[ jQuery.expando ] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data ) { + return internalData( elem, name, data ); + }, + + removeData: function( elem, name ) { + return internalRemoveData( elem, name ); + }, + + // For internal use only. + _data: function( elem, name, data ) { + return internalData( elem, name, data, true ); + }, + + _removeData: function( elem, name ) { + return internalRemoveData( elem, name, true ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Special expections of .data basically thwart jQuery.access, + // so implement the relevant behavior ourselves + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE11+ + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + jQuery.data( this, key ); + } ); + } + + return arguments.length > 1 ? + + // Sets one value + this.each( function() { + jQuery.data( this, key, value ); + } ) : + + // Gets one value + // Try to fetch any internally stored data first + elem ? dataAttr( elem, key, jQuery.data( elem, key ) ) : undefined; + }, + + removeData: function( key ) { + return this.each( function() { + jQuery.removeData( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray( data ) ) { + queue = jQuery._data( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, + // or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + jQuery._removeData( elem, type + "queue" ); + jQuery._removeData( elem, key ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); + + +( function() { + var shrinkWrapBlocksVal; + + support.shrinkWrapBlocks = function() { + if ( shrinkWrapBlocksVal != null ) { + return shrinkWrapBlocksVal; + } + + // Will be changed later if needed. + shrinkWrapBlocksVal = false; + + // Minified: var b,c,d + var div, body, container; + + body = document.getElementsByTagName( "body" )[ 0 ]; + if ( !body || !body.style ) { + + // Test fired too early or in an unsupported environment, exit. + return; + } + + // Setup + div = document.createElement( "div" ); + container = document.createElement( "div" ); + container.style.cssText = "position:absolute;border:0;width:0;height:0;top:0;left:-9999px"; + body.appendChild( container ).appendChild( div ); + + // Support: IE6 + // Check if elements with layout shrink-wrap their children + if ( typeof div.style.zoom !== "undefined" ) { + + // Reset CSS: box-sizing; display; margin; border + div.style.cssText = + + // Support: Firefox<29, Android 2.3 + // Vendor-prefix box-sizing + "-webkit-box-sizing:content-box;-moz-box-sizing:content-box;" + + "box-sizing:content-box;display:block;margin:0;border:0;" + + "padding:1px;width:1px;zoom:1"; + div.appendChild( document.createElement( "div" ) ).style.width = "5px"; + shrinkWrapBlocksVal = div.offsetWidth !== 3; + } + + body.removeChild( container ); + + return shrinkWrapBlocksVal; + }; + +} )(); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var isHidden = function( elem, el ) { + + // isHidden might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || + !jQuery.contains( elem.ownerDocument, elem ); + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, + scale = 1, + maxIterations = 20, + currentValue = tween ? + function() { return tween.cur(); } : + function() { return jQuery.css( elem, prop, "" ); }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + do { + + // If previous iteration zeroed out, double until we get *something*. + // Use string for doubling so we don't accidentally see scale as unchanged below + scale = scale || ".5"; + + // Adjust and apply + initialInUnit = initialInUnit / scale; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Update scale, tolerating zero or NaN from tween.cur() + // Break the loop if scale is unchanged or perfect, or if we've just had enough. + } while ( + scale !== ( scale = currentValue() / initial ) && scale !== 1 && --maxIterations + ); + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + length = elems.length, + bulk = key == null; + + // Sets many values + if ( jQuery.type( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !jQuery.isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; } + } - elem.setAttribute( name, name.toLowerCase() ); + if ( fn ) { + for ( ; i < length; i++ ) { + fn( + elems[ i ], + key, + raw ? value : value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } } - return name; } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[ 0 ], key ) : emptyGet; }; +var rcheckableType = ( /^(?:checkbox|radio)$/i ); -// IE6/7 do not support getting/setting some attributes with get/setAttribute -if ( !getSetAttribute ) { +var rtagName = ( /<([\w:-]+)/ ); - fixSpecified = { - name: true, - id: true, - coords: true - }; +var rscriptType = ( /^$|\/(?:java|ecma)script/i ); - // Use this for any attribute in IE6/7 - // This fixes almost every IE6/7 issue - nodeHook = jQuery.valHooks.button = { - get: function( elem, name ) { - var ret; - ret = elem.getAttributeNode( name ); - return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? - ret.nodeValue : +var rleadingWhitespace = ( /^\s+/ ); + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|" + + "details|dialog|figcaption|figure|footer|header|hgroup|main|" + + "mark|meter|nav|output|picture|progress|section|summary|template|time|video"; + + + +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + + +( function() { + var div = document.createElement( "div" ), + fragment = document.createDocumentFragment(), + input = document.createElement( "input" ); + + // Setup + div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>"; + + // IE strips leading whitespace when .innerHTML is used + support.leadingWhitespace = div.firstChild.nodeType === 3; + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + support.tbody = !div.getElementsByTagName( "tbody" ).length; + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + support.htmlSerialize = !!div.getElementsByTagName( "link" ).length; + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + support.html5Clone = + document.createElement( "nav" ).cloneNode( true ).outerHTML !== "<:nav></:nav>"; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + input.type = "checkbox"; + input.checked = true; + fragment.appendChild( input ); + support.appendChecked = input.checked; + + // Make sure textarea (and checkbox) defaultValue is properly cloned + // Support: IE6-IE11+ + div.innerHTML = "<textarea>x</textarea>"; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // #11217 - WebKit loses check when the name is after the checked attribute + fragment.appendChild( div ); + + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input = document.createElement( "input" ); + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Safari 5.1, iOS 5.1, Android 4.x, Android 2.3 + // old WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE<9 + // Cloned elements keep attachEvent handlers, we use addEventListener on IE9+ + support.noCloneEvent = !!div.addEventListener; + + // Support: IE<9 + // Since attributes and properties are the same in IE, + // cleanData must set properties to undefined rather than use removeAttribute + div[ jQuery.expando ] = 1; + support.attributes = !div.getAttribute( jQuery.expando ); +} )(); + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + area: [ 1, "<map>", "</map>" ], + + // Support: IE8 + param: [ 1, "<object>", "</object>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + + // IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, + // unless wrapped in a div with non-breaking characters in front of it. + _default: support.htmlSerialize ? [ 0, "", "" ] : [ 1, "X<div>", "</div>" ] +}; + +// Support: IE8-IE9 +wrapMap.optgroup = wrapMap.option; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + + +function getAll( context, tag ) { + var elems, elem, + i = 0, + found = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( tag || "*" ) : + typeof context.querySelectorAll !== "undefined" ? + context.querySelectorAll( tag || "*" ) : undefined; - }, - set: function( elem, value, name ) { - // Set the existing or create a new attribute node - var ret = elem.getAttributeNode( name ); - if ( !ret ) { - ret = document.createAttribute( name ); - elem.setAttributeNode( ret ); + + if ( !found ) { + for ( found = [], elems = context.childNodes || context; + ( elem = elems[ i ] ) != null; + i++ + ) { + if ( !tag || jQuery.nodeName( elem, tag ) ) { + found.push( elem ); + } else { + jQuery.merge( found, getAll( elem, tag ) ); } - return ( ret.nodeValue = value + "" ); } - }; + } - // Apply the nodeHook to tabindex - jQuery.attrHooks.tabindex.set = nodeHook.set; + return tag === undefined || tag && jQuery.nodeName( context, tag ) ? + jQuery.merge( [ context ], found ) : + found; +} - // Set width and height to auto instead of 0 on empty string( Bug #8150 ) - // This is for removals - jQuery.each([ "width", "height" ], function( i, name ) { - jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { - set: function( elem, value ) { - if ( value === "" ) { - elem.setAttribute( name, "auto" ); - return value; + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var elem, + i = 0; + for ( ; ( elem = elems[ i ] ) != null; i++ ) { + jQuery._data( + elem, + "globalEval", + !refElements || jQuery._data( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/, + rtbody = /<tbody/i; + +function fixDefaultChecked( elem ) { + if ( rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +function buildFragment( elems, context, scripts, selection, ignored ) { + var j, elem, contains, + tmp, tag, tbody, wrap, + l = elems.length, + + // Ensure a safe fragment + safe = createSafeFragment( context ), + + nodes = [], + i = 0; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( jQuery.type( elem ) === "object" ) { + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || safe.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; } - } - }); - }); - // Set contenteditable to false on removals(#10429) - // Setting to empty string throws an error as an invalid value - jQuery.attrHooks.contenteditable = { - get: nodeHook.get, - set: function( elem, value, name ) { - if ( value === "" ) { - value = "false"; + // Manually add leading whitespace removed by IE + if ( !support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + nodes.push( context.createTextNode( rleadingWhitespace.exec( elem )[ 0 ] ) ); + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + elem = tag === "table" && !rtbody.test( elem ) ? + tmp.firstChild : + + // String was a bare <thead> or <tfoot> + wrap[ 1 ] === "<table>" && !rtbody.test( elem ) ? + tmp : + 0; + + j = elem && elem.childNodes.length; + while ( j-- ) { + if ( jQuery.nodeName( ( tbody = elem.childNodes[ j ] ), "tbody" ) && + !tbody.childNodes.length ) { + + elem.removeChild( tbody ); + } + } + } + + jQuery.merge( nodes, tmp.childNodes ); + + // Fix #12392 for WebKit and IE > 9 + tmp.textContent = ""; + + // Fix #12392 for oldIE + while ( tmp.firstChild ) { + tmp.removeChild( tmp.firstChild ); + } + + // Remember the top-level container for proper cleanup + tmp = safe.lastChild; } - nodeHook.set( elem, value, name ); } - }; -} + } + // Fix #11356: Clear elements from fragment + if ( tmp ) { + safe.removeChild( tmp ); + } -// Some attributes require a special call on IE -if ( !jQuery.support.hrefNormalized ) { - jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { - jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { - get: function( elem ) { - var ret = elem.getAttribute( name, 2 ); - return ret === null ? undefined : ret; + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !support.appendChecked ) { + jQuery.grep( getAll( nodes, "input" ), fixDefaultChecked ); + } + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); } - }); - }); -} -if ( !jQuery.support.style ) { - jQuery.attrHooks.style = { - get: function( elem ) { - // Return undefined in the case of empty string - // Normalize to lowercase since IE uppercases css property names - return elem.style.cssText.toLowerCase() || undefined; - }, - set: function( elem, value ) { - return ( elem.style.cssText = "" + value ); + continue; } - }; -} -// Safari mis-reports the default selected property of an option -// Accessing the parent's selectedIndex property fixes it -if ( !jQuery.support.optSelected ) { - jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { - get: function( elem ) { - var parent = elem.parentNode; + contains = jQuery.contains( elem.ownerDocument, elem ); - if ( parent ) { - parent.selectedIndex; + // Append to fragment + tmp = getAll( safe.appendChild( elem ), "script" ); - // Make sure that it also works with optgroups, see #5701 - if ( parent.parentNode ) { - parent.parentNode.selectedIndex; + // Preserve script evaluation history + if ( contains ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); } } - return null; } - }); + } + + tmp = null; + + return safe; } -// IE6/7 call enctype encoding -if ( !jQuery.support.enctype ) { - jQuery.propFix.enctype = "encoding"; + +( function() { + var i, eventName, + div = document.createElement( "div" ); + + // Support: IE<9 (lack submit/change bubble), Firefox (lack focus(in | out) events) + for ( i in { submit: true, change: true, focusin: true } ) { + eventName = "on" + i; + + if ( !( support[ i ] = eventName in window ) ) { + + // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP) + div.setAttribute( eventName, "t" ); + support[ i ] = div.attributes[ eventName ].expando === false; + } + } + + // Null elements to avoid leaks in IE. + div = null; +} )(); + + +var rformElems = /^(?:input|select|textarea)$/i, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; } -// Radios and checkboxes getter/setter -if ( !jQuery.support.checkOn ) { - jQuery.each([ "radio", "checkbox" ], function() { - jQuery.valHooks[ this ] = { - get: function( elem ) { - // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified - return elem.getAttribute("value") === null ? "on" : elem.value; - } - }; - }); +function returnFalse() { + return false; } -jQuery.each([ "radio", "checkbox" ], function() { - jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { - set: function( elem, value ) { - if ( jQuery.isArray( value ) ) { - return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); - } + +// Support: IE9 +// See #13393 for more info +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; } - }); -}); + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; -var rformElems = /^(?:textarea|input|select)$/i, - rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, - rhoverHack = /(?:^|\s)hover(\.\S+)?\b/, - rkeyEvent = /^key/, - rmouseEvent = /^(?:mouse|contextmenu)|click/, - rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, - rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, - quickParse = function( selector ) { - var quick = rquickIs.exec( selector ); - if ( quick ) { - // 0 1 2 3 - // [ _, tag, id, class ] - quick[1] = ( quick[1] || "" ).toLowerCase(); - quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); - } - return quick; - }, - quickIs = function( elem, m ) { - var attrs = elem.attributes || {}; - return ( - (!m[1] || elem.nodeName.toLowerCase() === m[1]) && - (!m[2] || (attrs.id || {}).value === m[2]) && - (!m[3] || m[3].test( (attrs[ "class" ] || {}).value )) - ); - }, - hoverHack = function( events ) { - return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); - }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} /* * Helper functions for managing events -- not part of the public interface. @@ -2904,14 +4839,16 @@ var rformElems = /^(?:textarea|input|select)$/i, */ jQuery.event = { - add: function( elem, types, handler, data, selector ) { + global: {}, - var elemData, eventHandle, events, - t, tns, type, namespaces, handleObj, - handleObjIn, quick, handlers, special; + add: function( elem, types, handler, data, selector ) { + var tmp, events, t, handleObjIn, + special, eventHandle, handleObj, + handlers, type, namespaces, origType, + elemData = jQuery._data( elem ); - // Don't attach events to noData or text/comment nodes (allow plain objects tho) - if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + // Don't attach events to noData or text/comment nodes (but allow plain objects) + if ( !elemData ) { return; } @@ -2928,31 +4865,37 @@ jQuery.event = { } // Init the element's event structure and main handler, if this is the first - events = elemData.events; - if ( !events ) { - elemData.events = events = {}; + if ( !( events = elemData.events ) ) { + events = elemData.events = {}; } - eventHandle = elemData.handle; - if ( !eventHandle ) { - elemData.handle = eventHandle = function( e ) { + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and // when an event is called after a page has unloaded - return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + return typeof jQuery !== "undefined" && + ( !e || jQuery.event.triggered !== e.type ) ? jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : undefined; }; - // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + + // Add elem as a property of the handle fn to prevent a memory leak + // with IE non-native events eventHandle.elem = elem; } // Handle multiple events separated by a space - // jQuery(...).bind("mouseover mouseout", fn); - types = jQuery.trim( hoverHack(types) ).split( " " ); - for ( t = 0; t < types.length; t++ ) { - - tns = rtypenamespace.exec( types[t] ) || []; - type = tns[1]; - namespaces = ( tns[2] || "" ).split( "." ).sort(); + types = ( types || "" ).match( rnotwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } // If event changes its type, use the special event handlers for the changed type special = jQuery.event.special[ type ] || {}; @@ -2964,25 +4907,26 @@ jQuery.event = { special = jQuery.event.special[ type ] || {}; // handleObj is passed to all event handlers - handleObj = jQuery.extend({ + handleObj = jQuery.extend( { type: type, - origType: tns[1], + origType: origType, data: data, handler: handler, guid: handler.guid, selector: selector, - quick: selector && quickParse( selector ), - namespace: namespaces.join(".") + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) }, handleObjIn ); // Init the event handler queue if we're the first - handlers = events[ type ]; - if ( !handlers ) { + if ( !( handlers = events[ type ] ) ) { handlers = events[ type ] = []; handlers.delegateCount = 0; // Only use addEventListener/attachEvent if the special events handler returns false - if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element if ( elem.addEventListener ) { elem.addEventListener( type, eventHandle, false ); @@ -3016,25 +4960,25 @@ jQuery.event = { elem = null; }, - global: {}, - // Detach an event or set of events from an element remove: function( elem, types, handler, selector, mappedTypes ) { + var j, handleObj, tmp, + origCount, t, events, + special, handlers, type, + namespaces, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); - var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), - t, tns, type, origType, namespaces, origCount, - j, events, special, handle, eventType, handleObj; - - if ( !elemData || !(events = elemData.events) ) { + if ( !elemData || !( events = elemData.events ) ) { return; } // Once for each type.namespace in types; type may be omitted - types = jQuery.trim( hoverHack( types || "" ) ).split(" "); - for ( t = 0; t < types.length; t++ ) { - tns = rtypenamespace.exec( types[t] ) || []; - type = origType = tns[1]; - namespaces = tns[2]; + types = ( types || "" ).match( rnotwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); // Unbind all events (on this namespace, if provided) for the element if ( !type ) { @@ -3045,23 +4989,25 @@ jQuery.event = { } special = jQuery.event.special[ type ] || {}; - type = ( selector? special.delegateType : special.bindType ) || type; - eventType = events[ type ] || []; - origCount = eventType.length; - namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); // Remove matching events - for ( j = 0; j < eventType.length; j++ ) { - handleObj = eventType[ j ]; + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; if ( ( mappedTypes || origType === handleObj.origType ) && - ( !handler || handler.guid === handleObj.guid ) && - ( !namespaces || namespaces.test( handleObj.namespace ) ) && - ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { - eventType.splice( j--, 1 ); + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); if ( handleObj.selector ) { - eventType.delegateCount--; + handlers.delegateCount--; } if ( special.remove ) { special.remove.call( elem, handleObj ); @@ -3071,8 +5017,10 @@ jQuery.event = { // Remove generic event handler if we removed something and no more handlers exist // (avoids potential for endless recursion during removal of special event handlers) - if ( eventType.length === 0 && origCount !== eventType.length ) { - if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); } @@ -3082,87 +5030,53 @@ jQuery.event = { // Remove the expando if it's no longer used if ( jQuery.isEmptyObject( events ) ) { - handle = elemData.handle; - if ( handle ) { - handle.elem = null; - } + delete elemData.handle; // removeData also checks for emptiness and clears the expando if empty // so use it instead of delete - jQuery.removeData( elem, [ "events", "handle" ], true ); + jQuery._removeData( elem, "events" ); } }, - // Events that are safe to short-circuit if no handlers are attached. - // Native DOM events should not be added, they may have inline handlers. - customEvent: { - "getData": true, - "setData": true, - "changeData": true - }, - trigger: function( event, data, elem, onlyHandlers ) { + var handle, ontype, cur, + bubbleType, special, tmp, i, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = tmp = elem = elem || document; + // Don't do events on text and comment nodes - if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { return; } - // Event object or event type - var type = event.type || event, - namespaces = [], - cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; - // focus/blur morphs to focusin/out; ensure we're not firing them right now if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { return; } - if ( type.indexOf( "!" ) >= 0 ) { - // Exclusive events trigger only for the exact event (no namespaces) - type = type.slice(0, -1); - exclusive = true; - } + if ( type.indexOf( "." ) > -1 ) { - if ( type.indexOf( "." ) >= 0 ) { // Namespaced trigger; create a regexp to match event type in handle() - namespaces = type.split("."); + namespaces = type.split( "." ); type = namespaces.shift(); namespaces.sort(); } + ontype = type.indexOf( ":" ) < 0 && "on" + type; - if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { - // No jQuery handlers for this event type, and it can't have inline handlers - return; - } - - // Caller can pass in an Event, Object, or just an event type string - event = typeof event === "object" ? - // jQuery.Event object - event[ jQuery.expando ] ? event : - // Object literal - new jQuery.Event( type, event ) : - // Just the event type (string) - new jQuery.Event( type ); + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); - event.type = type; - event.isTrigger = true; - event.exclusive = exclusive; + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; event.namespace = namespaces.join( "." ); - event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; - ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; - - // Handle a global trigger - if ( !elem ) { - - // TODO: Stop taunting the data cache; remove global events and always attach to document - cache = jQuery.cache; - for ( i in cache ) { - if ( cache[ i ].events && cache[ i ].events[ type ] ) { - jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); - } - } - return; - } + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; // Clean up the event in case it is being reused event.result = undefined; @@ -3171,48 +5085,58 @@ jQuery.event = { } // Clone any incoming data and prepend the event, creating the handler arg list - data = data != null ? jQuery.makeArray( data ) : []; - data.unshift( event ); + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); // Allow special events to draw outside the lines special = jQuery.event.special[ type ] || {}; - if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { return; } // Determine event propagation path in advance, per W3C events spec (#9951) // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) - eventPath = [[ elem, special.bindType || type ]]; if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { bubbleType = special.delegateType || type; - cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; - old = null; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } for ( ; cur; cur = cur.parentNode ) { - eventPath.push([ cur, bubbleType ]); - old = cur; + eventPath.push( cur ); + tmp = cur; } // Only add window if we got to document (e.g., not plain obj or detached DOM) - if ( old && old === elem.ownerDocument ) { - eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); } } // Fire handlers on the event path - for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + + event.type = i > 1 ? + bubbleType : + special.bindType || type; - cur = eventPath[i][0]; - event.type = eventPath[i][1]; + // jQuery handler + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && + jQuery._data( cur, "handle" ); - handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); if ( handle ) { handle.apply( cur, data ); } - // Note that this is a bare JS function and not a jQuery handler + + // Native handler handle = ontype && cur[ ontype ]; - if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { - event.preventDefault(); + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } } } event.type = type; @@ -3220,29 +5144,37 @@ jQuery.event = { // If nobody prevented the default action, do it now if ( !onlyHandlers && !event.isDefaultPrevented() ) { - if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && - !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + if ( + ( !special._default || + special._default.apply( eventPath.pop(), data ) === false + ) && acceptData( elem ) + ) { // Call a native DOM method on the target with the same name name as the event. // Can't use an .isFunction() check here because IE6/7 fails that test. // Don't do default actions on window, that's where global variables be (#6170) - // IE<9 dies on focus/blur to hidden element (#1486) - if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + if ( ontype && elem[ type ] && !jQuery.isWindow( elem ) ) { // Don't re-trigger an onFOO event when we call its FOO() method - old = elem[ ontype ]; + tmp = elem[ ontype ]; - if ( old ) { + if ( tmp ) { elem[ ontype ] = null; } // Prevent re-triggering of the same event, since we already bubbled it above jQuery.event.triggered = type; - elem[ type ](); + try { + elem[ type ](); + } catch ( e ) { + + // IE<9 dies on focus/blur to hidden element (#1486,#12518) + // only reproducible on winXP IE8 native, not IE9 in IE8 mode + } jQuery.event.triggered = undefined; - if ( old ) { - elem[ ontype ] = old; + if ( tmp ) { + elem[ ontype ] = tmp; } } } @@ -3254,18 +5186,16 @@ jQuery.event = { dispatch: function( event ) { // Make a writable jQuery.Event from the native event object - event = jQuery.event.fix( event || window.event ); + event = jQuery.event.fix( event ); - var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), - delegateCount = handlers.delegateCount, - args = [].slice.call( arguments, 0 ), - run_all = !event.exclusive && !event.namespace, - special = jQuery.event.special[ event.type ] || {}, + var i, j, ret, matched, handleObj, handlerQueue = [], - i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related; + args = slice.call( arguments ), + handlers = ( jQuery._data( this, "events" ) || {} )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; // Use the fix-ed jQuery.Event rather than the (read-only) native event - args[0] = event; + args[ 0 ] = event; event.delegateTarget = this; // Call the preDispatch hook for the mapped type, and let it bail if desired @@ -3273,91 +5203,153 @@ jQuery.event = { return; } - // Determine handlers that should run if there are delegated events - // Avoid non-left-click bubbling in Firefox (#3861) - if ( delegateCount && !(event.button && event.type === "click") ) { + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // Triggered event must either 1) have no namespace, or 2) have namespace(s) + // a subset or equal to those in the bound event (both can have no namespace). + if ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } - // Pregenerate a single jQuery object for reuse with .is() - jqcur = jQuery(this); - jqcur.context = this.ownerDocument || this; + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } - for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + return event.result; + }, - // Don't process events on disabled elements (#6911, #8165) - if ( cur.disabled !== true ) { - selMatch = {}; + handlers: function( event, handlers ) { + var i, matches, sel, handleObj, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Support (at least): Chrome, IE9 + // Find delegate handlers + // Black-hole SVG <use> instance trees (#13180) + // + // Support: Firefox<=42+ + // Avoid non-left-click in FF but don't block IE radio events (#3861, gh-2343) + if ( delegateCount && cur.nodeType && + ( event.type !== "click" || isNaN( event.button ) || event.button < 1 ) ) { + + /* jshint eqeqeq: false */ + for ( ; cur != this; cur = cur.parentNode || this ) { + /* jshint eqeqeq: true */ + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && ( cur.disabled !== true || event.type !== "click" ) ) { matches = []; - jqcur[0] = cur; for ( i = 0; i < delegateCount; i++ ) { handleObj = handlers[ i ]; - sel = handleObj.selector; - if ( selMatch[ sel ] === undefined ) { - selMatch[ sel ] = ( - handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel ) - ); + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matches[ sel ] === undefined ) { + matches[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; } - if ( selMatch[ sel ] ) { + if ( matches[ sel ] ) { matches.push( handleObj ); } } if ( matches.length ) { - handlerQueue.push({ elem: cur, matches: matches }); + handlerQueue.push( { elem: cur, handlers: matches } ); } } } } // Add the remaining (directly-bound) handlers - if ( handlers.length > delegateCount ) { - handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: this, handlers: handlers.slice( delegateCount ) } ); } - // Run delegates first; they may want to stop propagation beneath us - for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { - matched = handlerQueue[ i ]; - event.currentTarget = matched.elem; + return handlerQueue; + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } - for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { - handleObj = matched.matches[ j ]; + // Create a writable copy of the event object and normalize some properties + var i, prop, copy, + type = event.type, + originalEvent = event, + fixHook = this.fixHooks[ type ]; - // Triggered event must either 1) be non-exclusive and have no namespace, or - // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). - if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + if ( !fixHook ) { + this.fixHooks[ type ] = fixHook = + rmouseEvent.test( type ) ? this.mouseHooks : + rkeyEvent.test( type ) ? this.keyHooks : + {}; + } + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; - event.data = handleObj.data; - event.handleObj = handleObj; + event = new jQuery.Event( originalEvent ); - ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) - .apply( matched.elem, args ); + i = copy.length; + while ( i-- ) { + prop = copy[ i ]; + event[ prop ] = originalEvent[ prop ]; + } - if ( ret !== undefined ) { - event.result = ret; - if ( ret === false ) { - event.preventDefault(); - event.stopPropagation(); - } - } - } - } + // Support: IE<9 + // Fix target property (#1925) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; } - // Call the postDispatch hook for the mapped type - if ( special.postDispatch ) { - special.postDispatch.call( this, event ); + // Support: Safari 6-8+ + // Target should not be a text node (#504, #13143) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; } - return event.result; + // Support: IE<9 + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328) + event.metaKey = !!event.metaKey; + + return fixHook.filter ? fixHook.filter( event, originalEvent ) : event; }, // Includes some event props shared by KeyEvent and MouseEvent - // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** - props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + props: ( "altKey bubbles cancelable ctrlKey currentTarget detail eventPhase " + + "metaKey relatedTarget shiftKey target timeStamp view which" ).split( " " ), fixHooks: {}, keyHooks: { - props: "char charCode key keyCode".split(" "), + props: "char charCode key keyCode".split( " " ), filter: function( event, original ) { // Add which for key events @@ -3370,9 +5362,10 @@ jQuery.event = { }, mouseHooks: { - props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + props: ( "button buttons clientX clientY fromElement offsetX offsetY " + + "pageX pageY screenX screenY toElement" ).split( " " ), filter: function( event, original ) { - var eventDoc, doc, body, + var body, eventDoc, doc, button = original.button, fromElement = original.fromElement; @@ -3382,13 +5375,19 @@ jQuery.event = { doc = eventDoc.documentElement; body = eventDoc.body; - event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); - event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + event.pageX = original.clientX + + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - + ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - + ( doc && doc.clientTop || body && body.clientTop || 0 ); } // Add relatedTarget, if necessary if ( !event.relatedTarget && fromElement ) { - event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + event.relatedTarget = fromElement === event.target ? + original.toElement : + fromElement; } // Add which for click: 1 === left; 2 === middle; 3 === right @@ -3401,118 +5400,123 @@ jQuery.event = { } }, - fix: function( event ) { - if ( event[ jQuery.expando ] ) { - return event; - } - - // Create a writable copy of the event object and normalize some properties - var i, prop, - originalEvent = event, - fixHook = jQuery.event.fixHooks[ event.type ] || {}, - copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; - - event = jQuery.Event( originalEvent ); - - for ( i = copy.length; i; ) { - prop = copy[ --i ]; - event[ prop ] = originalEvent[ prop ]; - } - - // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) - if ( !event.target ) { - event.target = originalEvent.srcElement || document; - } - - // Target should not be a text node (#504, Safari) - if ( event.target.nodeType === 3 ) { - event.target = event.target.parentNode; - } - - // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) - if ( event.metaKey === undefined ) { - event.metaKey = event.ctrlKey; - } - - return fixHook.filter? fixHook.filter( event, originalEvent ) : event; - }, - special: { - ready: { - // Make sure the ready event is setup - setup: jQuery.bindReady - }, - load: { + // Prevent triggered image.load events from bubbling to window.load noBubble: true }, - focus: { + + // Fire native event if possible so blur/focus sequence is correct + trigger: function() { + if ( this !== safeActiveElement() && this.focus ) { + try { + this.focus(); + return false; + } catch ( e ) { + + // Support: IE<9 + // If we error on focus to hidden element (#1486, #12518), + // let .trigger() run the handlers + } + } + }, delegateType: "focusin" }, blur: { + trigger: function() { + if ( this === safeActiveElement() && this.blur ) { + this.blur(); + return false; + } + }, delegateType: "focusout" }, + click: { - beforeunload: { - setup: function( data, namespaces, eventHandle ) { - // We only want to do this special case on windows - if ( jQuery.isWindow( this ) ) { - this.onbeforeunload = eventHandle; + // For checkbox, fire native event so checked state will be right + trigger: function() { + if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) { + this.click(); + return false; } }, - teardown: function( namespaces, eventHandle ) { - if ( this.onbeforeunload === eventHandle ) { - this.onbeforeunload = null; + // For cross-browser consistency, don't fire native .click() on links + _default: function( event ) { + return jQuery.nodeName( event.target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; } } } }, - simulate: function( type, elem, event, bubble ) { - // Piggyback on a donor event to simulate a different one. - // Fake originalEvent to avoid donor's stopPropagation, but if the - // simulated event prevents default then we do the same on the donor. + // Piggyback on a donor event to simulate a different one + simulate: function( type, elem, event ) { var e = jQuery.extend( new jQuery.Event(), event, - { type: type, - isSimulated: true, - originalEvent: {} + { + type: type, + isSimulated: true + + // Previously, `originalEvent: {}` was set here, so stopPropagation call + // would not be triggered on donor event, since in our own + // jQuery.event.stopPropagation function we had a check for existence of + // originalEvent.stopPropagation method, so, consequently it would be a noop. + // + // Guard for simulated events was moved to jQuery.event.stopPropagation function + // since `originalEvent` should point to the original event for the + // constancy with other events and for more focused logic } ); - if ( bubble ) { - jQuery.event.trigger( e, null, elem ); - } else { - jQuery.event.dispatch.call( elem, e ); - } + + jQuery.event.trigger( e, null, elem ); + if ( e.isDefaultPrevented() ) { event.preventDefault(); } } }; -// Some plugins are using, but it's undocumented/deprecated and will be removed. -// The 1.7 special event interface should provide all the hooks needed now. -jQuery.event.handle = jQuery.event.dispatch; - jQuery.removeEvent = document.removeEventListener ? function( elem, type, handle ) { + + // This "if" is needed for plain objects if ( elem.removeEventListener ) { - elem.removeEventListener( type, handle, false ); + elem.removeEventListener( type, handle ); } } : function( elem, type, handle ) { + var name = "on" + type; + if ( elem.detachEvent ) { - elem.detachEvent( "on" + type, handle ); + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 + // detachEvent needed property on element, by name of that event, + // to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); } }; jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword - if ( !(this instanceof jQuery.Event) ) { + if ( !( this instanceof jQuery.Event ) ) { return new jQuery.Event( src, props ); } @@ -3523,8 +5527,13 @@ jQuery.Event = function( src, props ) { // Events bubbling up the document may have been marked as prevented // by a handler lower down the tree; reflect the correct value. - this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || - src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: IE < 9, Android < 4.0 + src.returnValue === false ? + returnTrue : + returnFalse; // Event type } else { @@ -3543,75 +5552,90 @@ jQuery.Event = function( src, props ) { this[ jQuery.expando ] = true; }; -function returnFalse() { - return false; -} -function returnTrue() { - return true; -} - // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding // http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html jQuery.Event.prototype = { - preventDefault: function() { - this.isDefaultPrevented = returnTrue; + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + preventDefault: function() { var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; if ( !e ) { return; } - // if preventDefault exists run it on the original event + // If preventDefault exists, run it on the original event if ( e.preventDefault ) { e.preventDefault(); - // otherwise set the returnValue property of the original event to false (IE) + // Support: IE + // Otherwise set the returnValue property of the original event to false } else { e.returnValue = false; } }, stopPropagation: function() { + var e = this.originalEvent; + this.isPropagationStopped = returnTrue; - var e = this.originalEvent; - if ( !e ) { + if ( !e || this.isSimulated ) { return; } - // if stopPropagation exists run it on the original event + + // If stopPropagation exists, run it on the original event if ( e.stopPropagation ) { e.stopPropagation(); } - // otherwise set the cancelBubble property of the original event to true (IE) + + // Support: IE + // Set the cancelBubble property of the original event to true e.cancelBubble = true; }, stopImmediatePropagation: function() { + var e = this.originalEvent; + this.isImmediatePropagationStopped = returnTrue; + + if ( e && e.stopImmediatePropagation ) { + e.stopImmediatePropagation(); + } + this.stopPropagation(); - }, - isDefaultPrevented: returnFalse, - isPropagationStopped: returnFalse, - isImmediatePropagationStopped: returnFalse + } }; // Create mouseenter/leave events using mouseover/out and event-time checks -jQuery.each({ +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://code.google.com/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { mouseenter: "mouseover", - mouseleave: "mouseout" + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" }, function( orig, fix ) { jQuery.event.special[ orig ] = { delegateType: fix, bindType: fix, handle: function( event ) { - var target = this, + var ret, + target = this, related = event.relatedTarget, - handleObj = event.handleObj, - selector = handleObj.selector, - ret; + handleObj = event.handleObj; - // For mousenter/leave call the handler if related is outside the target. + // For mouseenter/leave call the handler if related is outside the target. // NB: No relatedTarget if the mouse left/entered the browser window - if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { event.type = handleObj.origType; ret = handleObj.handler.apply( this, arguments ); event.type = fix; @@ -3619,13 +5643,14 @@ jQuery.each({ return ret; } }; -}); +} ); // IE submit delegation -if ( !jQuery.support.submitBubbles ) { +if ( !support.submit ) { jQuery.event.special.submit = { setup: function() { + // Only need this for delegated form submit events if ( jQuery.nodeName( this, "form" ) ) { return false; @@ -3633,30 +5658,42 @@ if ( !jQuery.support.submitBubbles ) { // Lazy-add a submit handler when a descendant form may potentially be submitted jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) var elem = e.target, - form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; - if ( form && !form._submit_attached ) { + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? + + // Support: IE <=8 + // We use jQuery.prop instead of elem.form + // to allow fixing the IE8 delegated submit issue (gh-2332) + // by 3rd party polyfills/workarounds. + jQuery.prop( elem, "form" ) : + undefined; + + if ( form && !jQuery._data( form, "submit" ) ) { jQuery.event.add( form, "submit._submit", function( event ) { - event._submit_bubble = true; - }); - form._submit_attached = true; + event._submitBubble = true; + } ); + jQuery._data( form, "submit", true ); } - }); + } ); + // return undefined since we don't need an event listener }, - + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree - if ( event._submit_bubble ) { - delete event._submit_bubble; + if ( event._submitBubble ) { + delete event._submitBubble; if ( this.parentNode && !event.isTrigger ) { - jQuery.event.simulate( "submit", this.parentNode, event, true ); + jQuery.event.simulate( "submit", this.parentNode, event ); } } }, teardown: function() { + // Only need this for delegated form submit events if ( jQuery.nodeName( this, "form" ) ) { return false; @@ -3669,51 +5706,57 @@ if ( !jQuery.support.submitBubbles ) { } // IE change delegation and checkbox/radio fix -if ( !jQuery.support.changeBubbles ) { +if ( !support.change ) { jQuery.event.special.change = { setup: function() { if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click // after a propertychange. Eat the blur-change in special.change.handle. // This still fires onchange a second time for check/radio after blur. if ( this.type === "checkbox" || this.type === "radio" ) { jQuery.event.add( this, "propertychange._change", function( event ) { if ( event.originalEvent.propertyName === "checked" ) { - this._just_changed = true; + this._justChanged = true; } - }); + } ); jQuery.event.add( this, "click._change", function( event ) { - if ( this._just_changed && !event.isTrigger ) { - this._just_changed = false; - jQuery.event.simulate( "change", this, event, true ); + if ( this._justChanged && !event.isTrigger ) { + this._justChanged = false; } - }); + + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event ); + } ); } return false; } + // Delegated event; lazy-add a change handler on descendant inputs jQuery.event.add( this, "beforeactivate._change", function( e ) { var elem = e.target; - if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "change" ) ) { jQuery.event.add( elem, "change._change", function( event ) { if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { - jQuery.event.simulate( "change", this.parentNode, event, true ); + jQuery.event.simulate( "change", this.parentNode, event ); } - }); - elem._change_attached = true; + } ); + jQuery._data( elem, "change", true ); } - }); + } ); }, handle: function( event ) { var elem = event.target; // Swallow native change events from checkbox/radio, we already triggered them above - if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + if ( this !== elem || event.isSimulated || event.isTrigger || + ( elem.type !== "radio" && elem.type !== "checkbox" ) ) { + return event.handleObj.handler.apply( this, arguments ); } }, @@ -3721,3272 +5764,3328 @@ if ( !jQuery.support.changeBubbles ) { teardown: function() { jQuery.event.remove( this, "._change" ); - return rformElems.test( this.nodeName ); + return !rformElems.test( this.nodeName ); } }; } -// Create "bubbling" focus and blur events -if ( !jQuery.support.focusinBubbles ) { - jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { - - // Attach a single capturing handler while someone wants focusin/focusout - var attaches = 0, - handler = function( event ) { - jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); - }; +// Support: Firefox +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome, Safari +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://code.google.com/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; jQuery.event.special[ fix ] = { setup: function() { - if ( attaches++ === 0 ) { - document.addEventListener( orig, handler, true ); + var doc = this.ownerDocument || this, + attaches = jQuery._data( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); } + jQuery._data( doc, fix, ( attaches || 0 ) + 1 ); }, teardown: function() { - if ( --attaches === 0 ) { - document.removeEventListener( orig, handler, true ); + var doc = this.ownerDocument || this, + attaches = jQuery._data( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + jQuery._removeData( doc, fix ); + } else { + jQuery._data( doc, fix, attaches ); } } }; - }); + } ); } -jQuery.fn.extend({ - - on: function( types, selector, data, fn, /*INTERNAL*/ one ) { - var origFn, type; - - // Types can be a map of types/handlers - if ( typeof types === "object" ) { - // ( types-Object, selector, data ) - if ( typeof selector !== "string" ) { // && selector != null - // ( types-Object, data ) - data = data || selector; - selector = undefined; - } - for ( type in types ) { - this.on( type, selector, data, types[ type ], one ); - } - return this; - } - - if ( data == null && fn == null ) { - // ( types, fn ) - fn = selector; - data = selector = undefined; - } else if ( fn == null ) { - if ( typeof selector === "string" ) { - // ( types, selector, fn ) - fn = data; - data = undefined; - } else { - // ( types, data, fn ) - fn = data; - data = selector; - selector = undefined; - } - } - if ( fn === false ) { - fn = returnFalse; - } else if ( !fn ) { - return this; - } - - if ( one === 1 ) { - origFn = fn; - fn = function( event ) { - // Can use an empty set, since event contains the info - jQuery().off( event ); - return origFn.apply( this, arguments ); - }; - // Use same guid so caller can remove using origFn - fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); - } - return this.each( function() { - jQuery.event.add( this, types, fn, data, selector ); - }); +jQuery.fn.extend( { + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + live: function( types, data, fn ) { + jQuery(this.context).on( types, this.selector, data, fn ); + return this; }, one: function( types, selector, data, fn ) { - return this.on( types, selector, data, fn, 1 ); + return on( this, types, selector, data, fn, 1 ); }, off: function( types, selector, fn ) { + var handleObj, type; if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event - var handleObj = types.handleObj; + handleObj = types.handleObj; jQuery( types.delegateTarget ).off( - handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, handleObj.selector, handleObj.handler ); return this; } if ( typeof types === "object" ) { - // ( types-object [, selector] ) - for ( var type in types ) { - this.off( type, selector, types[ type ] ); - } - return this; - } - if ( selector === false || typeof selector === "function" ) { - // ( types [, fn] ) - fn = selector; - selector = undefined; - } - if ( fn === false ) { - fn = returnFalse; - } - return this.each(function() { - jQuery.event.remove( this, types, fn, selector ); - }); - }, - - bind: function( types, data, fn ) { - return this.on( types, null, data, fn ); - }, - unbind: function( types, fn ) { - return this.off( types, null, fn ); - }, - live: function( types, data, fn ) { - jQuery( this.context ).on( types, this.selector, data, fn ); - return this; - }, - die: function( types, fn ) { - jQuery( this.context ).off( types, this.selector || "**", fn ); - return this; - }, + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { - delegate: function( selector, types, data, fn ) { - return this.on( types, selector, data, fn ); - }, - undelegate: function( selector, types, fn ) { - // ( namespace ) or ( selector, types [, fn] ) - return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); }, trigger: function( type, data ) { - return this.each(function() { + return this.each( function() { jQuery.event.trigger( type, data, this ); - }); + } ); }, triggerHandler: function( type, data ) { - if ( this[0] ) { - return jQuery.event.trigger( type, data, this[0], true ); + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); } - }, + } +} ); - toggle: function( fn ) { - // Save reference to arguments for access in closure - var args = arguments, - guid = fn.guid || jQuery.guid++, - i = 0, - toggler = function( event ) { - // Figure out which function to execute - var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; - jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); - // Make sure that clicks stop - event.preventDefault(); +var rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rnoshimcache = new RegExp( "<(?:" + nodeNames + ")[\\s/>]", "i" ), + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi, - // and execute the function - return args[ lastToggle ].apply( this, arguments ) || false; - }; + // Support: IE 10-11, Edge 10240+ + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /<script|<style|<link/i, - // link all the functions, so any of them can unbind this click handler - toggler.guid = guid; - while ( i < args.length ) { - args[ i++ ].guid = guid; - } + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptTypeMasked = /^true\/(.*)/, + rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement( "div" ) ); + +// Support: IE<8 +// Manipulating tables requires a tbody +function manipulationTarget( elem, content ) { + return jQuery.nodeName( elem, "table" ) && + jQuery.nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ? + + elem.getElementsByTagName( "tbody" )[ 0 ] || + elem.appendChild( elem.ownerDocument.createElement( "tbody" ) ) : + elem; +} - return this.click( toggler ); - }, +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( jQuery.find.attr( elem, "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + var match = rscriptTypeMasked.exec( elem.type ); + if ( match ) { + elem.type = match[ 1 ]; + } else { + elem.removeAttribute( "type" ); + } + return elem; +} - hover: function( fnOver, fnOut ) { - return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); +function cloneCopyEvent( src, dest ) { + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; } -}); -jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + - "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + - "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; - // Handle event binding - jQuery.fn[ name ] = function( data, fn ) { - if ( fn == null ) { - fn = data; - data = null; - } + if ( events ) { + delete curData.handle; + curData.events = {}; - return arguments.length > 0 ? - this.on( name, null, data, fn ) : - this.trigger( name ); - }; + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } - if ( jQuery.attrFn ) { - jQuery.attrFn[ name ] = true; + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); } +} + +function fixCloneNodeIssues( src, dest ) { + var nodeName, e, data; - if ( rkeyEvent.test( name ) ) { - jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; } - if ( rmouseEvent.test( name ) ) { - jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 copies events bound via attachEvent when using cloneNode. + if ( !support.noCloneEvent && dest[ jQuery.expando ] ) { + data = jQuery._data( dest ); + + for ( e in data.events ) { + jQuery.removeEvent( dest, e, data.handle ); + } + + // Event data gets referenced instead of copied if the expando gets copied too + dest.removeAttribute( jQuery.expando ); } -}); + // IE blanks contents when cloning scripts, and tries to evaluate newly-set text + if ( nodeName === "script" && dest.text !== src.text ) { + disableScript( dest ).text = src.text; + restoreScript( dest ); + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + } else if ( nodeName === "object" ) { + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } -/*! - * Sizzle CSS Selector Engine - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * More information: http://sizzlejs.com/ - */ -(function(){ + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( support.html5Clone && ( src.innerHTML && !jQuery.trim( dest.innerHTML ) ) ) { + dest.innerHTML = src.innerHTML; + } -var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, - expando = "sizcache" + (Math.random() + '').replace('.', ''), - done = 0, - toString = Object.prototype.toString, - hasDuplicate = false, - baseHasDuplicate = true, - rBackslash = /\\/g, - rReturn = /\r\n/g, - rNonWord = /\W/; - -// Here we check if the JavaScript engine is using some sort of -// optimization where it does not always call our comparision -// function. If that is the case, discard the hasDuplicate value. -// Thus far that includes Google Chrome. -[0, 0].sort(function() { - baseHasDuplicate = false; - return 0; -}); + } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) { -var Sizzle = function( selector, context, results, seed ) { - results = results || []; - context = context || document; + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set - var origContext = context; + dest.defaultChecked = dest.checked = src.checked; - if ( context.nodeType !== 1 && context.nodeType !== 9 ) { - return []; - } + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } - if ( !selector || typeof selector !== "string" ) { - return results; - } + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.defaultSelected = dest.selected = src.defaultSelected; - var m, set, checkSet, extra, ret, cur, pop, i, - prune = true, - contextXML = Sizzle.isXML( context ), - parts = [], - soFar = selector; + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} - // Reset the position of the chunker regexp (start from head) - do { - chunker.exec( "" ); - m = chunker.exec( soFar ); +function domManip( collection, args, callback, ignored ) { - if ( m ) { - soFar = m[3]; + // Flatten any nested arrays + args = concat.apply( [], args ); - parts.push( m[1] ); + var first, node, hasScripts, + scripts, doc, fragment, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + isFunction = jQuery.isFunction( value ); - if ( m[2] ) { - extra = m[3]; - break; + // We can't cloneNode fragments that contain checked, in WebKit + if ( isFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( isFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; } - } while ( m ); - if ( parts.length > 1 && origPOS.exec( selector ) ) { + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; - if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { - set = posProcess( parts[0] + parts[1], context, seed ); + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; - } else { - set = Expr.relative[ parts[0] ] ? - [ context ] : - Sizzle( parts.shift(), context ); + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); - while ( parts.length ) { - selector = parts.shift(); + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { - if ( Expr.relative[ selector ] ) { - selector += parts.shift(); + // Support: Android<4.1, PhantomJS<2 + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } } - set = posProcess( selector, set, seed ); + callback.call( collection[ i ], node, i ); } - } - } else { - // Take a shortcut and set the context if the root selector is an ID - // (but not if it'll be faster if the inner selector is an ID) - if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && - Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !jQuery._data( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl ) { + jQuery._evalUrl( node.src ); + } + } else { + jQuery.globalEval( + ( node.text || node.textContent || node.innerHTML || "" ) + .replace( rcleanScript, "" ) + ); + } + } + } + } - ret = Sizzle.find( parts.shift(), context, contextXML ); - context = ret.expr ? - Sizzle.filter( ret.expr, ret.set )[0] : - ret.set[0]; + // Fix #11809: Avoid leaking memory + fragment = first = null; } + } - if ( context ) { - ret = seed ? - { expr: parts.pop(), set: makeArray(seed) } : - Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + return collection; +} - set = ret.expr ? - Sizzle.filter( ret.expr, ret.set ) : - ret.set; +function remove( elem, selector, keepData ) { + var node, + elems = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; - if ( parts.length > 0 ) { - checkSet = makeArray( set ); + for ( ; ( node = elems[ i ] ) != null; i++ ) { - } else { - prune = false; + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && jQuery.contains( node.ownerDocument, node ) ) { + setGlobalEval( getAll( node, "script" ) ); } + node.parentNode.removeChild( node ); + } + } - while ( parts.length ) { - cur = parts.pop(); - pop = cur; + return elem; +} - if ( !Expr.relative[ cur ] ) { - cur = ""; - } else { - pop = parts.pop(); - } +jQuery.extend( { + htmlPrefilter: function( html ) { + return html.replace( rxhtmlTag, "<$1></$2>" ); + }, - if ( pop == null ) { - pop = context; - } + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var destElements, node, clone, i, srcElements, + inPage = jQuery.contains( elem.ownerDocument, elem ); - Expr.relative[ cur ]( checkSet, pop, contextXML ); - } + if ( support.html5Clone || jQuery.isXMLDoc( elem ) || + !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + + clone = elem.cloneNode( true ); + // IE<=8 does not properly clone detached, unknown element nodes } else { - checkSet = parts = []; + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); } - } - if ( !checkSet ) { - checkSet = set; - } + if ( ( !support.noCloneEvent || !support.noCloneChecked ) && + ( elem.nodeType === 1 || elem.nodeType === 11 ) && !jQuery.isXMLDoc( elem ) ) { - if ( !checkSet ) { - Sizzle.error( cur || selector ); - } + // We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); - if ( toString.call(checkSet) === "[object Array]" ) { - if ( !prune ) { - results.push.apply( results, checkSet ); + // Fix all IE cloning issues + for ( i = 0; ( node = srcElements[ i ] ) != null; ++i ) { - } else if ( context && context.nodeType === 1 ) { - for ( i = 0; checkSet[i] != null; i++ ) { - if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { - results.push( set[i] ); + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[ i ] ) { + fixCloneNodeIssues( node, destElements[ i ] ); } } + } - } else { - for ( i = 0; checkSet[i] != null; i++ ) { - if ( checkSet[i] && checkSet[i].nodeType === 1 ) { - results.push( set[i] ); + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0; ( node = srcElements[ i ] ) != null; i++ ) { + cloneCopyEvent( node, destElements[ i ] ); } + } else { + cloneCopyEvent( elem, clone ); } } - } else { - makeArray( checkSet, results ); - } + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } - if ( extra ) { - Sizzle( extra, origContext, results, seed ); - Sizzle.uniqueSort( results ); - } + destElements = srcElements = node = null; - return results; -}; + // Return the cloned set + return clone; + }, -Sizzle.uniqueSort = function( results ) { - if ( sortOrder ) { - hasDuplicate = baseHasDuplicate; - results.sort( sortOrder ); - - if ( hasDuplicate ) { - for ( var i = 1; i < results.length; i++ ) { - if ( results[i] === results[ i - 1 ] ) { - results.splice( i--, 1 ); - } - } - } - } + cleanData: function( elems, /* internal */ forceAcceptData ) { + var elem, type, id, data, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + attributes = support.attributes, + special = jQuery.event.special; - return results; -}; + for ( ; ( elem = elems[ i ] ) != null; i++ ) { + if ( forceAcceptData || acceptData( elem ) ) { -Sizzle.matches = function( expr, set ) { - return Sizzle( expr, null, null, set ); -}; + id = elem[ internalKey ]; + data = id && cache[ id ]; -Sizzle.matchesSelector = function( node, expr ) { - return Sizzle( expr, null, null, [node] ).length > 0; -}; + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); -Sizzle.find = function( expr, context, isXML ) { - var set, i, len, match, type, left; + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } - if ( !expr ) { - return []; - } + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { - for ( i = 0, len = Expr.order.length; i < len; i++ ) { - type = Expr.order[i]; + delete cache[ id ]; - if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { - left = match[1]; - match.splice( 1, 1 ); + // Support: IE<9 + // IE does not allow us to delete expando properties from nodes + // IE creates expando attributes along with the property + // IE does not have a removeAttribute function on Document nodes + if ( !attributes && typeof elem.removeAttribute !== "undefined" ) { + elem.removeAttribute( internalKey ); - if ( left.substr( left.length - 1 ) !== "\\" ) { - match[1] = (match[1] || "").replace( rBackslash, "" ); - set = Expr.find[ type ]( match, context, isXML ); + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://code.google.com/p/chromium/issues/detail?id=378607 + } else { + elem[ internalKey ] = undefined; + } - if ( set != null ) { - expr = expr.replace( Expr.match[ type ], "" ); - break; + deletedIds.push( id ); + } } } } } +} ); - if ( !set ) { - set = typeof context.getElementsByTagName !== "undefined" ? - context.getElementsByTagName( "*" ) : - []; - } +jQuery.fn.extend( { - return { set: set, expr: expr }; -}; + // Keep domManip exposed until 3.0 (gh-2225) + domManip: domManip, + + detach: function( selector ) { + return remove( this, selector, true ); + }, -Sizzle.filter = function( expr, set, inplace, not ) { - var match, anyFound, - type, found, item, filter, left, - i, pass, - old = expr, - result = [], - curLoop = set, - isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + remove: function( selector ) { + return remove( this, selector ); + }, - while ( expr && set.length ) { - for ( type in Expr.filter ) { - if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { - filter = Expr.filter[ type ]; - left = match[1]; + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( + ( this[ 0 ] && this[ 0 ].ownerDocument || document ).createTextNode( value ) + ); + }, null, value, arguments.length ); + }, - anyFound = false; + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, - match.splice(1,1); + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, - if ( left.substr( left.length - 1 ) === "\\" ) { - continue; - } + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, - if ( curLoop === result ) { - result = []; - } + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, - if ( Expr.preFilter[ type ] ) { - match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + empty: function() { + var elem, + i = 0; - if ( !match ) { - anyFound = found = true; + for ( ; ( elem = this[ i ] ) != null; i++ ) { - } else if ( match === true ) { - continue; - } - } + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + } - if ( match ) { - for ( i = 0; (item = curLoop[i]) != null; i++ ) { - if ( item ) { - found = filter( item, match, i, curLoop ); - pass = not ^ found; + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } - if ( inplace && found != null ) { - if ( pass ) { - anyFound = true; + // If this is a select, ensure that it displays empty (#12336) + // Support: IE<9 + if ( elem.options && jQuery.nodeName( elem, "select" ) ) { + elem.options.length = 0; + } + } - } else { - curLoop[i] = false; - } + return this; + }, - } else if ( pass ) { - result.push( item ); - anyFound = true; - } - } - } - } + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } - if ( found !== undefined ) { - if ( !inplace ) { - curLoop = result; - } + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { - expr = expr.replace( Expr.match[ type ], "" ); + value = jQuery.htmlPrefilter( value ); - if ( !anyFound ) { - return []; - } + try { + for ( ; i < l; i++ ) { - break; - } - } - } + // Remove element nodes and prevent memory leaks + elem = this[ i ] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } - // Improper expression - if ( expr === old ) { - if ( anyFound == null ) { - Sizzle.error( expr ); + elem = 0; - } else { - break; + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} } - } - old = expr; - } + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, - return curLoop; -}; + replaceWith: function() { + var ignored = []; -Sizzle.error = function( msg ) { - throw new Error( "Syntax error, unrecognized expression: " + msg ); -}; + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; -/** - * Utility function for retreiving the text value of an array of DOM nodes - * @param {Array|Element} elem - */ -var getText = Sizzle.getText = function( elem ) { - var i, node, - nodeType = elem.nodeType, - ret = ""; - - if ( nodeType ) { - if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { - // Use textContent || innerText for elements - if ( typeof elem.textContent === 'string' ) { - return elem.textContent; - } else if ( typeof elem.innerText === 'string' ) { - // Replace IE's carriage returns - return elem.innerText.replace( rReturn, '' ); - } else { - // Traverse it's children - for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { - ret += getText( elem ); + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); } } - } else if ( nodeType === 3 || nodeType === 4 ) { - return elem.nodeValue; - } - } else { - // If no nodeType, this is expected to be an array - for ( i = 0; (node = elem[i]); i++ ) { - // Do not traverse comment nodes - if ( node.nodeType !== 8 ) { - ret += getText( node ); - } - } + // Force callback invocation + }, ignored ); } - return ret; -}; +} ); -var Expr = Sizzle.selectors = { - order: [ "ID", "NAME", "TAG" ], - - match: { - ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, - CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, - NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, - ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, - TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, - CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, - POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, - PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ - }, - - leftMatch: {}, +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1; - attrMap: { - "class": "className", - "for": "htmlFor" - }, + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); - attrHandle: { - href: function( elem ) { - return elem.getAttribute( "href" ); - }, - type: function( elem ) { - return elem.getAttribute( "type" ); + // Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get() + push.apply( ret, elems.get() ); } - }, - relative: { - "+": function(checkSet, part){ - var isPartStr = typeof part === "string", - isTag = isPartStr && !rNonWord.test( part ), - isPartStrNotTag = isPartStr && !isTag; + return this.pushStack( ret ); + }; +} ); - if ( isTag ) { - part = part.toLowerCase(); - } - for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { - if ( (elem = checkSet[i]) ) { - while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} +var iframe, + elemdisplay = { - checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? - elem || false : - elem === part; - } - } + // Support: Firefox + // We have to pre-define these values for FF (#10227) + HTML: "block", + BODY: "block" + }; - if ( isPartStrNotTag ) { - Sizzle.filter( part, checkSet, true ); - } - }, +/** + * Retrieve the actual display of a element + * @param {String} name nodeName of the element + * @param {Object} doc Document object + */ - ">": function( checkSet, part ) { - var elem, - isPartStr = typeof part === "string", - i = 0, - l = checkSet.length; +// Called only from within defaultDisplay +function actualDisplay( name, doc ) { + var elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ), - if ( isPartStr && !rNonWord.test( part ) ) { - part = part.toLowerCase(); + display = jQuery.css( elem[ 0 ], "display" ); - for ( ; i < l; i++ ) { - elem = checkSet[i]; + // We don't have any data stored on the element, + // so use "detach" method as fast way to get rid of the element + elem.detach(); - if ( elem ) { - var parent = elem.parentNode; - checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; - } - } + return display; +} - } else { - for ( ; i < l; i++ ) { - elem = checkSet[i]; +/** + * Try to determine the default display value of an element + * @param {String} nodeName + */ +function defaultDisplay( nodeName ) { + var doc = document, + display = elemdisplay[ nodeName ]; - if ( elem ) { - checkSet[i] = isPartStr ? - elem.parentNode : - elem.parentNode === part; - } - } + if ( !display ) { + display = actualDisplay( nodeName, doc ); - if ( isPartStr ) { - Sizzle.filter( part, checkSet, true ); - } - } - }, + // If the simple way fails, read from inside an iframe + if ( display === "none" || !display ) { - "": function(checkSet, part, isXML){ - var nodeCheck, - doneName = done++, - checkFn = dirCheck; + // Use the already-created iframe if possible + iframe = ( iframe || jQuery( "<iframe frameborder='0' width='0' height='0'/>" ) ) + .appendTo( doc.documentElement ); - if ( typeof part === "string" && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - nodeCheck = part; - checkFn = dirNodeCheck; - } + // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse + doc = ( iframe[ 0 ].contentWindow || iframe[ 0 ].contentDocument ).document; - checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); - }, + // Support: IE + doc.write(); + doc.close(); - "~": function( checkSet, part, isXML ) { - var nodeCheck, - doneName = done++, - checkFn = dirCheck; + display = actualDisplay( nodeName, doc ); + iframe.detach(); + } - if ( typeof part === "string" && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - nodeCheck = part; - checkFn = dirNodeCheck; - } + // Store the correct default display + elemdisplay[ nodeName ] = display; + } - checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); - } - }, + return display; +} +var rmargin = ( /^margin/ ); - find: { - ID: function( match, context, isXML ) { - if ( typeof context.getElementById !== "undefined" && !isXML ) { - var m = context.getElementById(match[1]); - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - return m && m.parentNode ? [m] : []; - } - }, +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); - NAME: function( match, context ) { - if ( typeof context.getElementsByName !== "undefined" ) { - var ret = [], - results = context.getElementsByName( match[1] ); +var swap = function( elem, options, callback, args ) { + var ret, name, + old = {}; - for ( var i = 0, l = results.length; i < l; i++ ) { - if ( results[i].getAttribute("name") === match[1] ) { - ret.push( results[i] ); - } - } + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } - return ret.length === 0 ? null : ret; - } - }, + ret = callback.apply( elem, args || [] ); - TAG: function( match, context ) { - if ( typeof context.getElementsByTagName !== "undefined" ) { - return context.getElementsByTagName( match[1] ); - } - } - }, - preFilter: { - CLASS: function( match, curLoop, inplace, result, not, isXML ) { - match = " " + match[1].replace( rBackslash, "" ) + " "; + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } - if ( isXML ) { - return match; - } + return ret; +}; - for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { - if ( elem ) { - if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { - if ( !inplace ) { - result.push( elem ); - } - } else if ( inplace ) { - curLoop[i] = false; - } - } - } +var documentElement = document.documentElement; - return false; - }, - ID: function( match ) { - return match[1].replace( rBackslash, "" ); - }, - TAG: function( match, curLoop ) { - return match[1].replace( rBackslash, "" ).toLowerCase(); - }, +( function() { + var pixelPositionVal, pixelMarginRightVal, boxSizingReliableVal, + reliableHiddenOffsetsVal, reliableMarginRightVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); - CHILD: function( match ) { - if ( match[1] === "nth" ) { - if ( !match[2] ) { - Sizzle.error( match[0] ); - } + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } - match[2] = match[2].replace(/^\+|\s*/g, ''); + div.style.cssText = "float:left;opacity:.5"; - // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' - var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( - match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || - !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + // Support: IE<9 + // Make sure that element opacity exists (as opposed to filter) + support.opacity = div.style.opacity === "0.5"; - // calculate the numbers (first)n+(last) including if they are negative - match[2] = (test[1] + (test[2] || 1)) - 0; - match[3] = test[3] - 0; - } - else if ( match[2] ) { - Sizzle.error( match[0] ); - } + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + support.cssFloat = !!div.style.cssFloat; - // TODO: Move to normal caching system - match[0] = done++; + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; - return match; - }, + container = document.createElement( "div" ); + container.style.cssText = "border:0;width:8px;height:0;top:0;left:-9999px;" + + "padding:0;margin-top:1px;position:absolute"; + div.innerHTML = ""; + container.appendChild( div ); - ATTR: function( match, curLoop, inplace, result, not, isXML ) { - var name = match[1] = match[1].replace( rBackslash, "" ); + // Support: Firefox<29, Android 2.3 + // Vendor-prefix box-sizing + support.boxSizing = div.style.boxSizing === "" || div.style.MozBoxSizing === "" || + div.style.WebkitBoxSizing === ""; - if ( !isXML && Expr.attrMap[name] ) { - match[1] = Expr.attrMap[name]; + jQuery.extend( support, { + reliableHiddenOffsets: function() { + if ( pixelPositionVal == null ) { + computeStyleTests(); } + return reliableHiddenOffsetsVal; + }, - // Handle if an un-quoted value was used - match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + boxSizingReliable: function() { - if ( match[2] === "~=" ) { - match[4] = " " + match[4] + " "; + // We're checking for pixelPositionVal here instead of boxSizingReliableVal + // since that compresses better and they're computed together anyway. + if ( pixelPositionVal == null ) { + computeStyleTests(); } - - return match; + return boxSizingReliableVal; }, - PSEUDO: function( match, curLoop, inplace, result, not ) { - if ( match[1] === "not" ) { - // If we're dealing with a complex expression, or a simple one - if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { - match[3] = Sizzle(match[3], null, null, curLoop); + pixelMarginRight: function() { - } else { - var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + // Support: Android 4.0-4.3 + if ( pixelPositionVal == null ) { + computeStyleTests(); + } + return pixelMarginRightVal; + }, - if ( !inplace ) { - result.push.apply( result, ret ); - } + pixelPosition: function() { + if ( pixelPositionVal == null ) { + computeStyleTests(); + } + return pixelPositionVal; + }, - return false; - } + reliableMarginRight: function() { - } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { - return true; + // Support: Android 2.3 + if ( pixelPositionVal == null ) { + computeStyleTests(); } - - return match; + return reliableMarginRightVal; }, - POS: function( match ) { - match.unshift( true ); + reliableMarginLeft: function() { - return match; + // Support: IE <=8 only, Android 4.0 - 4.3 only, Firefox <=3 - 37 + if ( pixelPositionVal == null ) { + computeStyleTests(); + } + return reliableMarginLeftVal; } - }, + } ); - filters: { - enabled: function( elem ) { - return elem.disabled === false && elem.type !== "hidden"; - }, - - disabled: function( elem ) { - return elem.disabled === true; - }, + function computeStyleTests() { + var contents, divStyle, + documentElement = document.documentElement; - checked: function( elem ) { - return elem.checked === true; - }, + // Setup + documentElement.appendChild( container ); - selected: function( elem ) { - // Accessing this property makes selected-by-default - // options in Safari work properly - if ( elem.parentNode ) { - elem.parentNode.selectedIndex; - } + div.style.cssText = - return elem.selected === true; - }, + // Support: Android 2.3 + // Vendor-prefix box-sizing + "-webkit-box-sizing:border-box;box-sizing:border-box;" + + "position:relative;display:block;" + + "margin:auto;border:1px;padding:1px;" + + "top:1%;width:50%"; - parent: function( elem ) { - return !!elem.firstChild; - }, + // Support: IE<9 + // Assume reasonable values in the absence of getComputedStyle + pixelPositionVal = boxSizingReliableVal = reliableMarginLeftVal = false; + pixelMarginRightVal = reliableMarginRightVal = true; - empty: function( elem ) { - return !elem.firstChild; - }, + // Check for getComputedStyle so that this code is not run in IE<9. + if ( window.getComputedStyle ) { + divStyle = window.getComputedStyle( div ); + pixelPositionVal = ( divStyle || {} ).top !== "1%"; + reliableMarginLeftVal = ( divStyle || {} ).marginLeft === "2px"; + boxSizingReliableVal = ( divStyle || { width: "4px" } ).width === "4px"; - has: function( elem, i, match ) { - return !!Sizzle( match[3], elem ).length; - }, + // Support: Android 4.0 - 4.3 only + // Some styles come back with percentage values, even though they shouldn't + div.style.marginRight = "50%"; + pixelMarginRightVal = ( divStyle || { marginRight: "4px" } ).marginRight === "4px"; - header: function( elem ) { - return (/h\d/i).test( elem.nodeName ); - }, + // Support: Android 2.3 only + // Div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container (#3333) + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + contents = div.appendChild( document.createElement( "div" ) ); - text: function( elem ) { - var attr = elem.getAttribute( "type" ), type = elem.type; - // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) - // use getAttribute instead to test this case - return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); - }, + // Reset CSS: box-sizing; display; margin; border; padding + contents.style.cssText = div.style.cssText = - radio: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; - }, + // Support: Android 2.3 + // Vendor-prefix box-sizing + "-webkit-box-sizing:content-box;-moz-box-sizing:content-box;" + + "box-sizing:content-box;display:block;margin:0;border:0;padding:0"; + contents.style.marginRight = contents.style.width = "0"; + div.style.width = "1px"; - checkbox: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; - }, + reliableMarginRightVal = + !parseFloat( ( window.getComputedStyle( contents ) || {} ).marginRight ); - file: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; - }, + div.removeChild( contents ); + } - password: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; - }, + // Support: IE6-8 + // First check that getClientRects works as expected + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + div.style.display = "none"; + reliableHiddenOffsetsVal = div.getClientRects().length === 0; + if ( reliableHiddenOffsetsVal ) { + div.style.display = ""; + div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>"; + div.childNodes[ 0 ].style.borderCollapse = "separate"; + contents = div.getElementsByTagName( "td" ); + contents[ 0 ].style.cssText = "margin:0;border:0;padding:0;display:none"; + reliableHiddenOffsetsVal = contents[ 0 ].offsetHeight === 0; + if ( reliableHiddenOffsetsVal ) { + contents[ 0 ].style.display = ""; + contents[ 1 ].style.display = "none"; + reliableHiddenOffsetsVal = contents[ 0 ].offsetHeight === 0; + } + } + + // Teardown + documentElement.removeChild( container ); + } - submit: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return (name === "input" || name === "button") && "submit" === elem.type; - }, +} )(); - image: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; - }, - reset: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return (name === "input" || name === "button") && "reset" === elem.type; - }, +var getStyles, curCSS, + rposition = /^(top|right|bottom|left)$/; - button: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return name === "input" && "button" === elem.type || name === "button"; - }, +if ( window.getComputedStyle ) { + getStyles = function( elem ) { - input: function( elem ) { - return (/input|select|textarea|button/i).test( elem.nodeName ); - }, + // Support: IE<=11+, Firefox<=30+ (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; - focus: function( elem ) { - return elem === elem.ownerDocument.activeElement; + if ( !view || !view.opener ) { + view = window; } - }, - setFilters: { - first: function( elem, i ) { - return i === 0; - }, - - last: function( elem, i, match, array ) { - return i === array.length - 1; - }, - - even: function( elem, i ) { - return i % 2 === 0; - }, - odd: function( elem, i ) { - return i % 2 === 1; - }, + return view.getComputedStyle( elem ); + }; - lt: function( elem, i, match ) { - return i < match[3] - 0; - }, + curCSS = function( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + style = elem.style; - gt: function( elem, i, match ) { - return i > match[3] - 0; - }, + computed = computed || getStyles( elem ); - nth: function( elem, i, match ) { - return match[3] - 0 === i; - }, + // getPropertyValue is only needed for .css('filter') in IE9, see #12537 + ret = computed ? computed.getPropertyValue( name ) || computed[ name ] : undefined; - eq: function( elem, i, match ) { - return match[3] - 0 === i; + // Support: Opera 12.1x only + // Fall back to style even without computed + // computed is undefined for elems on document fragments + if ( ( ret === "" || ret === undefined ) && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); } - }, - filter: { - PSEUDO: function( elem, match, i, array ) { - var name = match[1], - filter = Expr.filters[ name ]; - if ( filter ) { - return filter( elem, i, match, array ); + if ( computed ) { - } else if ( name === "contains" ) { - return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" + // instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, + // but width seems to be reliably pixels + // this is against the CSSOM draft spec: + // http://dev.w3.org/csswg/cssom/#resolved-values + if ( !support.pixelMarginRight() && rnumnonpx.test( ret ) && rmargin.test( name ) ) { - } else if ( name === "not" ) { - var not = match[3]; + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; - for ( var j = 0, l = not.length; j < l; j++ ) { - if ( not[j] === elem ) { - return false; - } - } - - return true; + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; - } else { - Sizzle.error( name ); + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; } - }, + } - CHILD: function( elem, match ) { - var first, last, - doneName, parent, cache, - count, diff, - type = match[1], - node = elem; - - switch ( type ) { - case "only": - case "first": - while ( (node = node.previousSibling) ) { - if ( node.nodeType === 1 ) { - return false; - } - } + // Support: IE + // IE returns zIndex value as an integer. + return ret === undefined ? + ret : + ret + ""; + }; +} else if ( documentElement.currentStyle ) { + getStyles = function( elem ) { + return elem.currentStyle; + }; - if ( type === "first" ) { - return true; - } + curCSS = function( elem, name, computed ) { + var left, rs, rsLeft, ret, + style = elem.style; - node = elem; + computed = computed || getStyles( elem ); + ret = computed ? computed[ name ] : undefined; - /* falls through */ - case "last": - while ( (node = node.nextSibling) ) { - if ( node.nodeType === 1 ) { - return false; - } - } + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } - return true; + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are + // proportional to the parent element instead + // and we can't measure the parent instead because it + // might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { - case "nth": - first = match[2]; - last = match[3]; + // Remember the original values + left = style.left; + rs = elem.runtimeStyle; + rsLeft = rs && rs.left; - if ( first === 1 && last === 0 ) { - return true; - } + // Put in the new values to get a computed value out + if ( rsLeft ) { + rs.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + rs.left = rsLeft; + } + } - doneName = match[0]; - parent = elem.parentNode; + // Support: IE + // IE returns zIndex value as an integer. + return ret === undefined ? + ret : + ret + "" || "auto"; + }; +} - if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { - count = 0; - for ( node = parent.firstChild; node; node = node.nextSibling ) { - if ( node.nodeType === 1 ) { - node.nodeIndex = ++count; - } - } - parent[ expando ] = doneName; - } - diff = elem.nodeIndex - last; +function addGetHookIf( conditionFn, hookFn ) { - if ( first === 0 ) { - return diff === 0; + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { - } else { - return ( diff % first === 0 && diff / first >= 0 ); - } + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; } - }, - ID: function( elem, match ) { - return elem.nodeType === 1 && elem.getAttribute("id") === match; - }, + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} - TAG: function( elem, match ) { - return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; - }, - CLASS: function( elem, match ) { - return (" " + (elem.className || elem.getAttribute("class")) + " ") - .indexOf( match ) > -1; - }, +var - ATTR: function( elem, match ) { - var name = match[1], - result = Sizzle.attr ? - Sizzle.attr( elem, name ) : - Expr.attrHandle[ name ] ? - Expr.attrHandle[ name ]( elem ) : - elem[ name ] != null ? - elem[ name ] : - elem.getAttribute( name ), - value = result + "", - type = match[2], - check = match[4]; - - return result == null ? - type === "!=" : - !type && Sizzle.attr ? - result != null : - type === "=" ? - value === check : - type === "*=" ? - value.indexOf(check) >= 0 : - type === "~=" ? - (" " + value + " ").indexOf(check) >= 0 : - !check ? - value && result !== false : - type === "!=" ? - value !== check : - type === "^=" ? - value.indexOf(check) === 0 : - type === "$=" ? - value.substr(value.length - check.length) === check : - type === "|=" ? - value === check || value.substr(0, check.length + 1) === check + "-" : - false; - }, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity\s*=\s*([^)]*)/i, - POS: function( elem, match, i, array ) { - var name = match[2], - filter = Expr.setFilters[ name ]; + // swappable if display is none or starts with table except + // "table", "table-cell", or "table-caption" + // see here for display values: + // https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rnumsplit = new RegExp( "^(" + pnum + ")(.*)$", "i" ), - if ( filter ) { - return filter( elem, i, match, array ); - } - } - } -}; + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }, + + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style; -var origPOS = Expr.match.POS, - fescape = function(all, num){ - return "\\" + (num - 0 + 1); - }; -for ( var type in Expr.match ) { - Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); - Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); -} -// Expose origPOS -// "global" as in regardless of relation to brackets/parens -Expr.match.globalPOS = origPOS; +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( name ) { + + // shortcut for names that are not vendor prefixed + if ( name in emptyStyle ) { + return name; + } -var makeArray = function( array, results ) { - array = Array.prototype.slice.call( array, 0 ); + // check for vendor prefixed names + var capName = name.charAt( 0 ).toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; - if ( results ) { - results.push.apply( results, array ); - return results; + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } } +} - return array; -}; +function showHide( elements, show ) { + var display, elem, hidden, + values = [], + index = 0, + length = elements.length; -// Perform a simple check to determine if the browser is capable of -// converting a NodeList to an array using builtin methods. -// Also verifies that the returned array holds DOM nodes -// (which is not the case in the Blackberry browser) -try { - Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } -// Provide a fallback method if it does not work -} catch( e ) { - makeArray = function( array, results ) { - var i = 0, - ret = results || []; + values[ index ] = jQuery._data( elem, "olddisplay" ); + display = elem.style.display; + if ( show ) { - if ( toString.call(array) === "[object Array]" ) { - Array.prototype.push.apply( ret, array ); + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && display === "none" ) { + elem.style.display = ""; + } + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = + jQuery._data( elem, "olddisplay", defaultDisplay( elem.nodeName ) ); + } } else { - if ( typeof array.length === "number" ) { - for ( var l = array.length; i < l; i++ ) { - ret.push( array[i] ); - } + hidden = isHidden( elem ); - } else { - for ( ; array[i]; i++ ) { - ret.push( array[i] ); - } + if ( display && display !== "none" || !hidden ) { + jQuery._data( + elem, + "olddisplay", + hidden ? display : jQuery.css( elem, "display" ) + ); } } + } - return ret; - }; -} - -var sortOrder, siblingCheck; - -if ( document.documentElement.compareDocumentPosition ) { - sortOrder = function( a, b ) { - if ( a === b ) { - hasDuplicate = true; - return 0; + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; } - - if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { - return a.compareDocumentPosition ? -1 : 1; + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; } + } - return a.compareDocumentPosition(b) & 4 ? -1 : 1; - }; + return elements; +} -} else { - sortOrder = function( a, b ) { - // The nodes are identical, we can exit early - if ( a === b ) { - hasDuplicate = true; - return 0; +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? - // Fallback to using sourceIndex (in IE) if it's available on both nodes - } else if ( a.sourceIndex && b.sourceIndex ) { - return a.sourceIndex - b.sourceIndex; - } + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} - var al, bl, - ap = [], - bp = [], - aup = a.parentNode, - bup = b.parentNode, - cur = aup; +function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? - // If the nodes are siblings (or identical) we can do a quick check - if ( aup === bup ) { - return siblingCheck( a, b ); + // If we already have the right measurement, avoid augmentation + 4 : - // If no parents were found then the nodes are disconnected - } else if ( !aup ) { - return -1; + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, - } else if ( !bup ) { - return 1; - } + val = 0; - // Otherwise they're somewhere else in the tree so we need - // to build up a full list of the parentNodes for comparison - while ( cur ) { - ap.unshift( cur ); - cur = cur.parentNode; + for ( ; i < 4; i += 2 ) { + + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + val += jQuery.css( elem, extra + cssExpand[ i ], true, styles ); } - cur = bup; + if ( isBorderBox ) { - while ( cur ) { - bp.unshift( cur ); - cur = cur.parentNode; - } + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } else { - al = ap.length; - bl = bp.length; + // at this point, extra isn't content, so add padding + val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); - // Start walking down the tree looking for a discrepancy - for ( var i = 0; i < al && i < bl; i++ ) { - if ( ap[i] !== bp[i] ) { - return siblingCheck( ap[i], bp[i] ); + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); } } + } - // We ended someplace up the tree so do a sibling check - return i === al ? - siblingCheck( a, bp[i], -1 ) : - siblingCheck( ap[i], b, 1 ); - }; + return val; +} - siblingCheck = function( a, b, ret ) { - if ( a === b ) { - return ret; - } +function getWidthOrHeight( elem, name, extra ) { - var cur = a.nextSibling; + // Start with offset property, which is equivalent to the border-box value + var valueIsBorderBox = true, + val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + styles = getStyles( elem ), + isBorderBox = support.boxSizing && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; - while ( cur ) { - if ( cur === b ) { - return -1; - } + // some non-html elements return undefined for offsetWidth, so check for null/undefined + // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285 + // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668 + if ( val <= 0 || val == null ) { - cur = cur.nextSibling; + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, styles ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; } - return 1; - }; -} + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test( val ) ) { + return val; + } -// Check to see if the browser returns elements by name when -// querying by getElementById (and provide a workaround) -(function(){ - // We're going to inject a fake input element with a specified name - var form = document.createElement("div"), - id = "script" + (new Date()).getTime(), - root = document.documentElement; + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && + ( support.boxSizingReliable() || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } - form.innerHTML = "<a name='" + id + "'/>"; + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles + ) + ) + "px"; +} - // Inject it into the root element, check its status, and remove it quickly - root.insertBefore( form, root.firstChild ); +jQuery.extend( { - // The workaround has to do additional checks after a getElementById - // Which slows things down for other browsers (hence the branching) - if ( document.getElementById( id ) ) { - Expr.find.ID = function( match, context, isXML ) { - if ( typeof context.getElementById !== "undefined" && !isXML ) { - var m = context.getElementById(match[1]); + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { - return m ? - m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? - [m] : - undefined : - []; + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } } - }; + } + }, - Expr.filter.ID = function( elem, match ) { - var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, - return elem.nodeType === 1 && node && node.nodeValue === match; - }; - } + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { - root.removeChild( form ); + // normalize float css property + "float": support.cssFloat ? "cssFloat" : "styleFloat" + }, - // release memory in IE - root = form = null; -})(); + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { -(function(){ - // Check to see if the browser returns only elements - // when doing getElementsByTagName("*") + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } - // Create a fake element - var div = document.createElement("div"); - div.appendChild( document.createComment("") ); + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; - // Make sure no comments are found - if ( div.getElementsByTagName("*").length > 0 ) { - Expr.find.TAG = function( match, context ) { - var results = context.getElementsByTagName( match[1] ); + name = jQuery.cssProps[ origName ] || + ( jQuery.cssProps[ origName ] = vendorPropName( origName ) || origName ); - // Filter out possible comments - if ( match[1] === "*" ) { - var tmp = []; + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; - for ( var i = 0; results[i]; i++ ) { - if ( results[i].nodeType === 1 ) { - tmp.push( results[i] ); - } - } + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; - results = tmp; + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; } - return results; - }; - } + // Make sure that null and NaN values aren't set. See: #7116 + if ( value == null || value !== value ) { + return; + } - // Check to see if an attribute returns normalized href attributes - div.innerHTML = "<a href='#'></a>"; + // If a number was passed in, add the unit (except for certain CSS properties) + if ( type === "number" ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } - if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && - div.firstChild.getAttribute("href") !== "#" ) { + // Fixes #8908, it can be done more correctly by specifing setters in cssHooks, + // but it would mean to define eight + // (for every problematic property) identical functions + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } - Expr.attrHandle.href = function( elem ) { - return elem.getAttribute( "href", 2 ); - }; - } + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { - // release memory in IE - div = null; -})(); + // Support: IE + // Swallow errors from 'invalid' CSS values (#5509) + try { + style[ name ] = value; + } catch ( e ) {} + } -if ( document.querySelectorAll ) { - (function(){ - var oldSizzle = Sizzle, - div = document.createElement("div"), - id = "__sizzle__"; + } else { - div.innerHTML = "<p class='TEST'></p>"; + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { - // Safari can't handle uppercase or unicode characters when - // in quirks mode. - if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { - return; + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; } + }, - Sizzle = function( query, context, extra, seed ) { - context = context || document; + css: function( elem, name, extra, styles ) { + var num, val, hooks, + origName = jQuery.camelCase( name ); - // Only use querySelectorAll on non-XML documents - // (ID selectors don't work in non-HTML documents) - if ( !seed && !Sizzle.isXML(context) ) { - // See if we find a selector to speed up - var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || + ( jQuery.cssProps[ origName ] = vendorPropName( origName ) || origName ); - if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { - // Speed-up: Sizzle("TAG") - if ( match[1] ) { - return makeArray( context.getElementsByTagName( query ), extra ); + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; - // Speed-up: Sizzle(".CLASS") - } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { - return makeArray( context.getElementsByClassName( match[2] ), extra ); - } - } + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } - if ( context.nodeType === 9 ) { - // Speed-up: Sizzle("body") - // The body element only exists once, optimize finding it - if ( query === "body" && context.body ) { - return makeArray( [ context.body ], extra ); - - // Speed-up: Sizzle("#ID") - } else if ( match && match[3] ) { - var elem = context.getElementById( match[3] ); - - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - if ( elem && elem.parentNode ) { - // Handle the case where IE and Opera return items - // by name instead of ID - if ( elem.id === match[3] ) { - return makeArray( [ elem ], extra ); - } + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } - } else { - return makeArray( [], extra ); - } - } + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } - try { - return makeArray( context.querySelectorAll(query), extra ); - } catch(qsaError) {} - - // qSA works strangely on Element-rooted queries - // We can work around this by specifying an extra ID on the root - // and working up from there (Thanks to Andrew Dupont for the technique) - // IE 8 doesn't work on object elements - } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { - var oldContext = context, - old = context.getAttribute( "id" ), - nid = old || id, - hasParent = context.parentNode, - relativeHierarchySelector = /^\s*[+~]/.test( query ); - - if ( !old ) { - context.setAttribute( "id", nid ); - } else { - nid = nid.replace( /'/g, "\\$&" ); - } - if ( relativeHierarchySelector && hasParent ) { - context = context.parentNode; - } + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + return val; + } +} ); - try { - if ( !relativeHierarchySelector || hasParent ) { - return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); - } +jQuery.each( [ "height", "width" ], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + if ( computed ) { - } catch(pseudoError) { - } finally { - if ( !old ) { - oldContext.removeAttribute( "id" ); - } - } - } + // certain elements can have dimension info if we invisibly show them + // however, it must have a current display style that would benefit from this + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + elem.offsetWidth === 0 ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, name, extra ); + } ) : + getWidthOrHeight( elem, name, extra ); } + }, - return oldSizzle(query, context, extra, seed); - }; - - for ( var prop in oldSizzle ) { - Sizzle[ prop ] = oldSizzle[ prop ]; + set: function( elem, value, extra ) { + var styles = extra && getStyles( elem ); + return setPositiveNumber( elem, value, extra ? + augmentWidthOrHeight( + elem, + name, + extra, + support.boxSizing && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + styles + ) : 0 + ); } + }; +} ); - // release memory in IE - div = null; - })(); -} +if ( !support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { -(function(){ - var html = document.documentElement, - matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + // IE uses filters for opacity + return ropacity.test( ( computed && elem.currentStyle ? + elem.currentStyle.filter : + elem.style.filter ) || "" ) ? + ( 0.01 * parseFloat( RegExp.$1 ) ) + "" : + computed ? "1" : ""; + }, - if ( matches ) { - // Check to see if it's possible to do matchesSelector - // on a disconnected node (IE 9 fails this) - var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), - pseudoWorks = false; + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; - try { - // This should fail with an exception - // Gecko does not error, returns false instead - matches.call( document.documentElement, "[test!='']:sizzle" ); + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; - } catch( pseudoError ) { - pseudoWorks = true; - } + // if setting opacity to 1, and no other filters exist - + // attempt to remove filter attribute #6652 + // if value === "", then remove inline opacity #12685 + if ( ( value >= 1 || value === "" ) && + jQuery.trim( filter.replace( ralpha, "" ) ) === "" && + style.removeAttribute ) { - Sizzle.matchesSelector = function( node, expr ) { - // Make sure that attribute selectors are quoted - expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); - if ( !Sizzle.isXML( node ) ) { - try { - if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { - var ret = matches.call( node, expr ); - - // IE 9's matchesSelector returns false on disconnected nodes - if ( ret || !disconnectedMatch || - // As well, disconnected nodes are said to be in a document - // fragment in IE 9, so check for that - node.document && node.document.nodeType !== 11 ) { - return ret; - } - } - } catch(e) {} + // if there is no filter style applied in a css rule + // or unset inline opacity, we are done + if ( value === "" || currentStyle && !currentStyle.filter ) { + return; + } } - return Sizzle(expr, null, null, [node]).length > 0; - }; - } -})(); - -(function(){ - var div = document.createElement("div"); - - div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} - // Opera can't find a second classname (in 9.6) - // Also, make sure that getElementsByClassName actually exists - if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { - return; +jQuery.cssHooks.marginRight = addGetHookIf( support.reliableMarginRight, + function( elem, computed ) { + if ( computed ) { + return swap( elem, { "display": "inline-block" }, + curCSS, [ elem, "marginRight" ] ); + } } - - // Safari caches class attributes, doesn't catch changes (in 3.2) - div.lastChild.className = "e"; - - if ( div.getElementsByClassName("e").length === 1 ) { - return; +); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( + parseFloat( curCSS( elem, "marginLeft" ) ) || + + // Support: IE<=11+ + // Running getBoundingClientRect on a disconnected node in IE throws an error + // Support: IE8 only + // getClientRects() errors on disconnected elems + ( jQuery.contains( elem.ownerDocument, elem ) ? + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) : + 0 + ) + ) + "px"; + } } +); - Expr.order.splice(1, 0, "CLASS"); - Expr.find.CLASS = function( match, context, isXML ) { - if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { - return context.getElementsByClassName(match[1]); - } - }; +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, - // release memory in IE - div = null; -})(); + // assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; -function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { - for ( var i = 0, l = checkSet.length; i < l; i++ ) { - var elem = checkSet[i]; + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } - if ( elem ) { - var match = false; + return expanded; + } + }; - elem = elem[dir]; + if ( !rmargin.test( prefix ) ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); - while ( elem ) { - if ( elem[ expando ] === doneName ) { - match = checkSet[elem.sizset]; - break; - } +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; - if ( elem.nodeType === 1 && !isXML ){ - elem[ expando ] = doneName; - elem.sizset = i; - } + if ( jQuery.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; - if ( elem.nodeName.toLowerCase() === cur ) { - match = elem; - break; + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); } - elem = elem[dir]; + return map; } - checkSet[i] = match; + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); } - } -} -function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { - for ( var i = 0, l = checkSet.length; i < l; i++ ) { - var elem = checkSet[i]; - - if ( elem ) { - var match = false; + return this.each( function() { + if ( isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); - elem = elem[dir]; - while ( elem ) { - if ( elem[ expando ] === doneName ) { - match = checkSet[elem.sizset]; - break; - } +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; - if ( elem.nodeType === 1 ) { - if ( !isXML ) { - elem[ expando ] = doneName; - elem.sizset = i; - } +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; - if ( typeof cur !== "string" ) { - if ( elem === cur ) { - match = true; - break; - } + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; - } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { - match = elem; - break; - } - } + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; - elem = elem[dir]; - } + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } - checkSet[i] = match; + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); } + return this; } -} +}; -if ( document.documentElement.contains ) { - Sizzle.contains = function( a, b ) { - return a !== b && (a.contains ? a.contains(b) : true); - }; +Tween.prototype.init.prototype = Tween.prototype; -} else if ( document.documentElement.compareDocumentPosition ) { - Sizzle.contains = function( a, b ) { - return !!(a.compareDocumentPosition(b) & 16); - }; +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; -} else { - Sizzle.contains = function() { - return false; - }; -} + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } -Sizzle.isXML = function( elem ) { - // documentElement is verified for cases where it doesn't yet exist - // (such as loading iframes in IE - #4833) - var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + // passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails + // so, simple values such as "10px" are parsed to Float. + // complex values such as "rotate(1rad)" are returned as is. + result = jQuery.css( tween.elem, tween.prop, "" ); - return documentElement ? documentElement.nodeName !== "HTML" : false; + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // use step hook for back compat - use cssHook if its there - use .style if its + // available and use plain properties where available + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && + ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || + jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } }; -var posProcess = function( selector, context, seed ) { - var match, - tmpSet = [], - later = "", - root = context.nodeType ? [context] : context; +// Support: IE <=9 +// Panic based approach to setting things on disconnected nodes - // Position selectors must be done after the filter - // And so must :not(positional) so we move all PSEUDOs to the end - while ( (match = Expr.match.PSEUDO.exec( selector )) ) { - later += match[0]; - selector = selector.replace( Expr.match.PSEUDO, "" ); +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } } +}; - selector = Expr.relative[selector] ? selector + "*" : selector; +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; - for ( var i = 0, l = root.length; i < l; i++ ) { - Sizzle( selector, root[i], tmpSet, seed ); - } +jQuery.fx = Tween.prototype.init; - return Sizzle.filter( later, tmpSet ); -}; +// Back Compat <1.8 extension point +jQuery.fx.step = {}; -// EXPOSE -// Override sizzle attribute retrieval -Sizzle.attr = jQuery.attr; -Sizzle.selectors.attrMap = {}; -jQuery.find = Sizzle; -jQuery.expr = Sizzle.selectors; -jQuery.expr[":"] = jQuery.expr.filters; -jQuery.unique = Sizzle.uniqueSort; -jQuery.text = Sizzle.getText; -jQuery.isXMLDoc = Sizzle.isXML; -jQuery.contains = Sizzle.contains; -})(); +var + fxNow, timerId, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; -var runtil = /Until$/, - rparentsprev = /^(?:parents|prevUntil|prevAll)/, - // Note: This RegExp should be improved, or likely pulled from Sizzle - rmultiselector = /,/, - isSimple = /^.[^:#\[\.,]*$/, - slice = Array.prototype.slice, - POS = jQuery.expr.match.globalPOS, - // methods guaranteed to produce a unique set when starting from a unique set - guaranteedUnique = { - children: true, - contents: true, - next: true, - prev: true - }; +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = jQuery.now() ); +} -jQuery.fn.extend({ - find: function( selector ) { - var self = this, - i, l; +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + attrs = { height: type }, + i = 0; + + // if we include width, step value is 1 to do all cssExpand values, + // if we don't include width, step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4 ; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } - if ( typeof selector !== "string" ) { - return jQuery( selector ).filter(function() { - for ( i = 0, l = self.length; i < l; i++ ) { - if ( jQuery.contains( self[ i ], this ) ) { - return true; - } - } - }); - } + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } - var ret = this.pushStack( "", "find", selector ), - length, n, r; + return attrs; +} - for ( i = 0, l = this.length; i < l; i++ ) { - length = ret.length; - jQuery.find( selector, this[i], ret ); +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { - if ( i > 0 ) { - // Make sure that the results are unique - for ( n = length; n < ret.length; n++ ) { - for ( r = 0; r < length; r++ ) { - if ( ret[r] === ret[n] ) { - ret.splice(n--, 1); - break; - } - } - } - } + // we're done with this property + return tween; } + } +} - return ret; - }, - - has: function( target ) { - var targets = jQuery( target ); - return this.filter(function() { - for ( var i = 0, l = targets.length; i < l; i++ ) { - if ( jQuery.contains( this, targets[i] ) ) { - return true; +function defaultPrefilter( elem, props, opts ) { + /* jshint validthis: true */ + var prop, value, toggle, tween, hooks, oldfire, display, checkDisplay, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHidden( elem ), + dataShow = jQuery._data( elem, "fxshow" ); + + // handle queue: false promises + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); } - } - }); - }, + }; + } + hooks.unqueued++; - not: function( selector ) { - return this.pushStack( winnow(this, selector, false), "not", selector); - }, + anim.always( function() { - filter: function( selector ) { - return this.pushStack( winnow(this, selector, true), "filter", selector ); - }, + // doing this makes sure that the complete handler will be called + // before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } - is: function( selector ) { - return !!selector && ( - typeof selector === "string" ? - // If this is a positional selector, check membership in the returned set - // so $("p:first").is("p:last") won't return true for a doc with two "p". - POS.test( selector ) ? - jQuery( selector, this.context ).index( this[0] ) >= 0 : - jQuery.filter( selector, this ).length > 0 : - this.filter( selector ).length > 0 ); - }, + // height/width overflow pass + if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) { - closest: function( selectors, context ) { - var ret = [], i, l, cur = this[0]; + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; - // Array (deprecated as of jQuery 1.7) - if ( jQuery.isArray( selectors ) ) { - var level = 1; + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + display = jQuery.css( elem, "display" ); - while ( cur && cur.ownerDocument && cur !== context ) { - for ( i = 0; i < selectors.length; i++ ) { + // Test default display if display is currently "none" + checkDisplay = display === "none" ? + jQuery._data( elem, "olddisplay" ) || defaultDisplay( elem.nodeName ) : display; - if ( jQuery( cur ).is( selectors[ i ] ) ) { - ret.push({ selector: selectors[ i ], elem: cur, level: level }); - } - } + if ( checkDisplay === "inline" && jQuery.css( elem, "float" ) === "none" ) { - cur = cur.parentNode; - level++; + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !support.inlineBlockNeedsLayout || defaultDisplay( elem.nodeName ) === "inline" ) { + style.display = "inline-block"; + } else { + style.zoom = 1; } - - return ret; } + } - // String - var pos = POS.test( selectors ) || typeof selectors !== "string" ? - jQuery( selectors, context || this.context ) : - 0; - - for ( i = 0, l = this.length; i < l; i++ ) { - cur = this[i]; - - while ( cur ) { - if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { - ret.push( cur ); - break; + if ( opts.overflow ) { + style.overflow = "hidden"; + if ( !support.shrinkWrapBlocks() ) { + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + } + // show/hide pass + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.exec( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // If there is dataShow left over from a stopped hide or show + // and we are going to proceed with show, we should pretend to be hidden + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; } else { - cur = cur.parentNode; - if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { - break; - } + continue; } } - } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); - ret = ret.length > 1 ? jQuery.unique( ret ) : ret; - - return this.pushStack( ret, "closest", selectors ); - }, - - // Determine the position of an element within - // the matched set of elements - index: function( elem ) { - - // No argument, return index in parent - if ( !elem ) { - return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + // Any non-fx value stops us from restoring the original display value + } else { + display = undefined; } + } - // index in selector - if ( typeof elem === "string" ) { - return jQuery.inArray( this[0], jQuery( elem ) ); + if ( !jQuery.isEmptyObject( orig ) ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = jQuery._data( elem, "fxshow", {} ); } - // Locate the position of the desired element - return jQuery.inArray( - // If it receives a jQuery object, the first element is used - elem.jquery ? elem[0] : elem, this ); - }, - - add: function( selector, context ) { - var set = typeof selector === "string" ? - jQuery( selector, context ) : - jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), - all = jQuery.merge( this.get(), set ); + // store state if its toggle - enables .stop().toggle() to "reverse" + if ( toggle ) { + dataShow.hidden = !hidden; + } + if ( hidden ) { + jQuery( elem ).show(); + } else { + anim.done( function() { + jQuery( elem ).hide(); + } ); + } + anim.done( function() { + var prop; + jQuery._removeData( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + for ( prop in orig ) { + tween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); - return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? - all : - jQuery.unique( all ) ); - }, + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = tween.start; + if ( hidden ) { + tween.end = tween.start; + tween.start = prop === "width" || prop === "height" ? 1 : 0; + } + } + } - andSelf: function() { - return this.add( this.prevObject ); + // If this is a noop like .hide().hide(), restore an overwritten display value + } else if ( ( display === "none" ? defaultDisplay( elem.nodeName ) : display ) === "inline" ) { + style.display = display; } -}); - -// A painfully simple check to see if an element is disconnected -// from a document (should be improved, where feasible). -function isDisconnected( node ) { - return !node || !node.parentNode || node.parentNode.nodeType === 11; } -jQuery.each({ - parent: function( elem ) { - var parent = elem.parentNode; - return parent && parent.nodeType !== 11 ? parent : null; - }, - parents: function( elem ) { - return jQuery.dir( elem, "parentNode" ); - }, - parentsUntil: function( elem, i, until ) { - return jQuery.dir( elem, "parentNode", until ); - }, - next: function( elem ) { - return jQuery.nth( elem, 2, "nextSibling" ); - }, - prev: function( elem ) { - return jQuery.nth( elem, 2, "previousSibling" ); - }, - nextAll: function( elem ) { - return jQuery.dir( elem, "nextSibling" ); - }, - prevAll: function( elem ) { - return jQuery.dir( elem, "previousSibling" ); - }, - nextUntil: function( elem, i, until ) { - return jQuery.dir( elem, "nextSibling", until ); - }, - prevUntil: function( elem, i, until ) { - return jQuery.dir( elem, "previousSibling", until ); - }, - siblings: function( elem ) { - return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); - }, - children: function( elem ) { - return jQuery.sibling( elem.firstChild ); - }, - contents: function( elem ) { - return jQuery.nodeName( elem, "iframe" ) ? - elem.contentDocument || elem.contentWindow.document : - jQuery.makeArray( elem.childNodes ); - } -}, function( name, fn ) { - jQuery.fn[ name ] = function( until, selector ) { - var ret = jQuery.map( this, fn, until ); +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; - if ( !runtil.test( name ) ) { - selector = until; + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = jQuery.camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( jQuery.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; } - if ( selector && typeof selector === "string" ) { - ret = jQuery.filter( selector, ret ); + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; } - ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; - if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { - ret = ret.reverse(); + // not quite $.extend, this wont overwrite keys already present. + // also - reusing 'index' from above because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; } + } +} - return this.pushStack( ret, name, slice.call( arguments ).join(",") ); - }; -}); +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), -jQuery.extend({ - filter: function( expr, elems, not ) { - if ( not ) { - expr = ":not(" + expr + ")"; - } + // Support: Android 2.3 + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; - return elems.length === 1 ? - jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : - jQuery.find.matches(expr, elems); - }, + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( percent ); + } - dir: function( elem, dir, until ) { - var matched = [], - cur = elem[ dir ]; + deferred.notifyWith( elem, [ animation, percent, remaining ] ); - while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { - if ( cur.nodeType === 1 ) { - matched.push( cur ); + if ( percent < 1 && length ) { + return remaining; + } else { + deferred.resolveWith( elem, [ animation ] ); + return false; } - cur = cur[dir]; - } - return matched; - }, + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, - nth: function( cur, result, dir, elem ) { - result = result || 1; - var num = 0; + // if we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( 1 ); + } - for ( ; cur; cur = cur[dir] ) { - if ( cur.nodeType === 1 && ++num === result ) { - break; + // resolve when we played the last frame + // otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; } - } + } ), + props = animation.props; - return cur; - }, - - sibling: function( n, elem ) { - var r = []; + propFilter( props, animation.opts.specialEasing ); - for ( ; n; n = n.nextSibling ) { - if ( n.nodeType === 1 && n !== elem ) { - r.push( n ); + for ( ; index < length ; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( jQuery.isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + jQuery.proxy( result.stop, result ); } + return result; } - - return r; } -}); - -// Implement the identical functionality for filter and not -function winnow( elements, qualifier, keep ) { - - // Can't pass null or undefined to indexOf in Firefox 4 - // Set to 0 to skip string check - qualifier = qualifier || 0; - - if ( jQuery.isFunction( qualifier ) ) { - return jQuery.grep(elements, function( elem, i ) { - var retVal = !!qualifier.call( elem, i, elem ); - return retVal === keep; - }); - - } else if ( qualifier.nodeType ) { - return jQuery.grep(elements, function( elem, i ) { - return ( elem === qualifier ) === keep; - }); - } else if ( typeof qualifier === "string" ) { - var filtered = jQuery.grep(elements, function( elem ) { - return elem.nodeType === 1; - }); + jQuery.map( props, createTween, animation ); - if ( isSimple.test( qualifier ) ) { - return jQuery.filter(qualifier, filtered, !keep); - } else { - qualifier = jQuery.filter( qualifier, filtered ); - } + if ( jQuery.isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); } - return jQuery.grep(elements, function( elem, i ) { - return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; - }); + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + // attach callbacks from options + return animation.progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); } +jQuery.Animation = jQuery.extend( Animation, { + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, - -function createSafeFragment( document ) { - var list = nodeNames.split( "|" ), - safeFrag = document.createDocumentFragment(); - - if ( safeFrag.createElement ) { - while ( list.length ) { - safeFrag.createElement( - list.pop() - ); + tweener: function( props, callback ) { + if ( jQuery.isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnotwhite ); } - } - return safeFrag; -} - -var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + - "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", - rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, - rleadingWhitespace = /^\s+/, - rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, - rtagName = /<([\w:]+)/, - rtbody = /<tbody/i, - rhtml = /<|&#?\w+;/, - rnoInnerhtml = /<(?:script|style)/i, - rnocache = /<(?:script|object|embed|option|style)/i, - rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"), - // checked="checked" or checked - rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, - rscriptType = /\/(java|ecma)script/i, - rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, - wrapMap = { - option: [ 1, "<select multiple='multiple'>", "</select>" ], - legend: [ 1, "<fieldset>", "</fieldset>" ], - thead: [ 1, "<table>", "</table>" ], - tr: [ 2, "<table><tbody>", "</tbody></table>" ], - td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], - col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], - area: [ 1, "<map>", "</map>" ], - _default: [ 0, "", "" ] - }, - safeFragment = createSafeFragment( document ); - -wrapMap.optgroup = wrapMap.option; -wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; -wrapMap.th = wrapMap.td; -// IE can't serialize <link> and <script> tags normally -if ( !jQuery.support.htmlSerialize ) { - wrapMap._default = [ 1, "div<div>", "</div>" ]; -} + var prop, + index = 0, + length = props.length; -jQuery.fn.extend({ - text: function( value ) { - return jQuery.access( this, function( value ) { - return value === undefined ? - jQuery.text( this ) : - this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); - }, null, value, arguments.length ); + for ( ; index < length ; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } }, - wrapAll: function( html ) { - if ( jQuery.isFunction( html ) ) { - return this.each(function(i) { - jQuery(this).wrapAll( html.call(this, i) ); - }); - } + prefilters: [ defaultPrefilter ], - if ( this[0] ) { - // The elements to wrap the target around - var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; - if ( this[0].parentNode ) { - wrap.insertBefore( this[0] ); - } + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? + jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; - wrap.map(function() { - var elem = this; + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } - while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { - elem = elem.firstChild; - } + // Queueing + opt.old = opt.complete; - return elem; - }).append( this ); + opt.complete = function() { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); } - return this; - }, - - wrapInner: function( html ) { - if ( jQuery.isFunction( html ) ) { - return this.each(function(i) { - jQuery(this).wrapInner( html.call(this, i) ); - }); + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); } + }; - return this.each(function() { - var self = jQuery( this ), - contents = self.contents(); + return opt; +}; - if ( contents.length ) { - contents.wrapAll( html ); +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { - } else { - self.append( html ); - } - }); + // show any hidden elements after setting opacity to 0 + return this.filter( isHidden ).css( "opacity", 0 ).show() + + // animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { - wrap: function( html ) { - var isFunction = jQuery.isFunction( html ); + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); - return this.each(function(i) { - jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); - }); + // Empty animations, or finishing resolves immediately + if ( empty || jQuery._data( this, "finish" ) ) { + anim.stop( true ); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; - unwrap: function() { - return this.parent().each(function() { - if ( !jQuery.nodeName( this, "body" ) ) { - jQuery( this ).replaceWith( this.childNodes ); + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = jQuery._data( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } } - }).end(); - }, - append: function() { - return this.domManip(arguments, true, function( elem ) { - if ( this.nodeType === 1 ) { - this.appendChild( elem ); + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } } - }); - }, - prepend: function() { - return this.domManip(arguments, true, function( elem ) { - if ( this.nodeType === 1 ) { - this.insertBefore( elem, this.firstChild ); + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); } - }); + } ); }, - - before: function() { - if ( this[0] && this[0].parentNode ) { - return this.domManip(arguments, false, function( elem ) { - this.parentNode.insertBefore( elem, this ); - }); - } else if ( arguments.length ) { - var set = jQuery.clean( arguments ); - set.push.apply( set, this.toArray() ); - return this.pushStack( set, "before", arguments ); + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; } - }, + return this.each( function() { + var index, + data = jQuery._data( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; - after: function() { - if ( this[0] && this[0].parentNode ) { - return this.domManip(arguments, false, function( elem ) { - this.parentNode.insertBefore( elem, this.nextSibling ); - }); - } else if ( arguments.length ) { - var set = this.pushStack( this, "after", arguments ); - set.push.apply( set, jQuery.clean(arguments) ); - return set; - } - }, + // enable finishing flag on private data + data.finish = true; + + // empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } - // keepData is for internal use only--do not document - remove: function( selector, keepData ) { - for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { - if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { - if ( !keepData && elem.nodeType === 1 ) { - jQuery.cleanData( elem.getElementsByTagName("*") ); - jQuery.cleanData( [ elem ] ); + // look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); } + } - if ( elem.parentNode ) { - elem.parentNode.removeChild( elem ); + // look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); } } - } - return this; - }, + // turn off finishing flag + delete data.finish; + } ); + } +} ); - empty: function() { - for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { - // Remove element nodes and prevent memory leaks - if ( elem.nodeType === 1 ) { - jQuery.cleanData( elem.getElementsByTagName("*") ); - } +jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); - // Remove any remaining nodes - while ( elem.firstChild ) { - elem.removeChild( elem.firstChild ); - } +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + timers = jQuery.timers, + i = 0; + + fxNow = jQuery.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); } + } - return this; - }, + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; - clone: function( dataAndEvents, deepDataAndEvents ) { - dataAndEvents = dataAndEvents == null ? false : dataAndEvents; - deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + if ( timer() ) { + jQuery.fx.start(); + } else { + jQuery.timers.pop(); + } +}; - return this.map( function () { - return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); - }); - }, +jQuery.fx.interval = 13; - html: function( value ) { - return jQuery.access( this, function( value ) { - var elem = this[0] || {}, - i = 0, - l = this.length; +jQuery.fx.start = function() { + if ( !timerId ) { + timerId = window.setInterval( jQuery.fx.tick, jQuery.fx.interval ); + } +}; - if ( value === undefined ) { - return elem.nodeType === 1 ? - elem.innerHTML.replace( rinlinejQuery, "" ) : - null; - } +jQuery.fx.stop = function() { + window.clearInterval( timerId ); + timerId = null; +}; +jQuery.fx.speeds = { + slow: 600, + fast: 200, - if ( typeof value === "string" && !rnoInnerhtml.test( value ) && - ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && - !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + // Default speed + _default: 400 +}; - value = value.replace( rxhtmlTag, "<$1></$2>" ); - try { - for (; i < l; i++ ) { - // Remove element nodes and prevent memory leaks - elem = this[i] || {}; - if ( elem.nodeType === 1 ) { - jQuery.cleanData( elem.getElementsByTagName( "*" ) ); - elem.innerHTML = value; - } - } +// Based off of the plugin by Clint Helfers, with permission. +// http://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; - elem = 0; + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; - // If using innerHTML throws an exception, use the fallback method - } catch(e) {} - } - if ( elem ) { - this.empty().append( value ); - } - }, null, value, arguments.length ); - }, +( function() { + var a, + input = document.createElement( "input" ), + div = document.createElement( "div" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); - replaceWith: function( value ) { - if ( this[0] && this[0].parentNode ) { - // Make sure that the elements are removed from the DOM before they are inserted - // this can help fix replacing a parent with child elements - if ( jQuery.isFunction( value ) ) { - return this.each(function(i) { - var self = jQuery(this), old = self.html(); - self.replaceWith( value.call( this, i, old ) ); - }); - } + // Setup + div = document.createElement( "div" ); + div.setAttribute( "className", "t" ); + div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>"; + a = div.getElementsByTagName( "a" )[ 0 ]; - if ( typeof value !== "string" ) { - value = jQuery( value ).detach(); - } + // Support: Windows Web Apps (WWA) + // `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "checkbox" ); + div.appendChild( input ); - return this.each(function() { - var next = this.nextSibling, - parent = this.parentNode; + a = div.getElementsByTagName( "a" )[ 0 ]; - jQuery( this ).remove(); + // First batch of tests. + a.style.cssText = "top:1px"; - if ( next ) { - jQuery(next).before( value ); - } else { - jQuery(parent).append( value ); - } - }); - } else { - return this.length ? - this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : - this; - } - }, + // Test setAttribute on camelCase class. + // If it works, we need attrFixes when doing get/setAttribute (ie6/7) + support.getSetAttribute = div.className !== "t"; - detach: function( selector ) { - return this.remove( selector, true ); - }, + // Get the style information from getAttribute + // (IE uses .cssText instead) + support.style = /top/.test( a.getAttribute( "style" ) ); - domManip: function( args, table, callback ) { - var results, first, fragment, parent, - value = args[0], - scripts = []; + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + support.hrefNormalized = a.getAttribute( "href" ) === "/a"; - // We can't cloneNode fragments that contain checked, in WebKit - if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { - return this.each(function() { - jQuery(this).domManip( args, table, callback, true ); - }); - } + // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere) + support.checkOn = !!input.value; - if ( jQuery.isFunction(value) ) { - return this.each(function(i) { - var self = jQuery(this); - args[0] = value.call(this, i, table ? self.html() : undefined); - self.domManip( args, table, callback ); - }); - } + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + support.optSelected = opt.selected; + + // Tests for enctype support on a form (#6743) + support.enctype = !!document.createElement( "form" ).enctype; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; - if ( this[0] ) { - parent = value && value.parentNode; + // Support: IE8 only + // Check if we can trust getAttribute("value") + input = document.createElement( "input" ); + input.setAttribute( "value", "" ); + support.input = input.getAttribute( "value" ) === ""; - // If we're in a fragment, just use that instead of building a new one - if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { - results = { fragment: parent }; + // Check if an input maintains its value after becoming a radio + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; +} )(); - } else { - results = jQuery.buildFragment( args, this, scripts ); - } - fragment = results.fragment; +var rreturn = /\r/g, + rspaces = /[\x20\t\r\n\f]+/g; - if ( fragment.childNodes.length === 1 ) { - first = fragment = fragment.firstChild; - } else { - first = fragment.firstChild; - } - - if ( first ) { - table = table && jQuery.nodeName( first, "tr" ); - - for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { - callback.call( - table ? - root(this[i], first) : - this[i], - // Make sure that we do not leak memory by inadvertently discarding - // the original fragment (which might have attached data) instead of - // using it; in addition, use the original fragment object for the last - // item instead of first because it can end up being emptied incorrectly - // in certain situations (Bug #8070). - // Fragments from the fragment cache must always be cloned and never used - // in place. - results.cacheable || ( l > 1 && i < lastIndex ) ? - jQuery.clone( fragment, true, true ) : - fragment - ); +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, isFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( + hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; } - } - if ( scripts.length ) { - jQuery.each( scripts, function( i, elem ) { - if ( elem.src ) { - jQuery.ajax({ - type: "GET", - global: false, - url: elem.src, - async: false, - dataType: "script" - }); - } else { - jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); - } + ret = elem.value; - if ( elem.parentNode ) { - elem.parentNode.removeChild( elem ); - } - }); - } - } + return typeof ret === "string" ? - return this; - } -}); + // handle most common string cases + ret.replace( rreturn, "" ) : -function root( elem, cur ) { - return jQuery.nodeName(elem, "table") ? - (elem.getElementsByTagName("tbody")[0] || - elem.appendChild(elem.ownerDocument.createElement("tbody"))) : - elem; -} + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } -function cloneCopyEvent( src, dest ) { + return; + } - if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { - return; - } + isFunction = jQuery.isFunction( value ); - var type, i, l, - oldData = jQuery._data( src ), - curData = jQuery._data( dest, oldData ), - events = oldData.events; + return this.each( function( i ) { + var val; - if ( events ) { - delete curData.handle; - curData.events = {}; + if ( this.nodeType !== 1 ) { + return; + } - for ( type in events ) { - for ( i = 0, l = events[ type ].length; i < l; i++ ) { - jQuery.event.add( dest, type, events[ type ][ i ] ); + if ( isFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; } - } - } - // make the cloned public data object a copy from the original - if ( curData.data ) { - curData.data = jQuery.extend( {}, curData.data ); - } -} + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } -function cloneFixAttributes( src, dest ) { - var nodeName; + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; - // We do not need to do anything for non-Elements - if ( dest.nodeType !== 1 ) { - return; + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); } +} ); - // clearAttributes removes the attributes, which we don't want, - // but also removes the attachEvent events, which we *do* want - if ( dest.clearAttributes ) { - dest.clearAttributes(); - } +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : - // mergeAttributes, in contrast, only merges back on the - // original attributes, not the events - if ( dest.mergeAttributes ) { - dest.mergeAttributes( src ); - } + // Support: IE10-11+ + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + jQuery.trim( jQuery.text( elem ) ).replace( rspaces, " " ); + } + }, + select: { + get: function( elem ) { + var value, option, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; - nodeName = dest.nodeName.toLowerCase(); + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; - // IE6-8 fail to clone children inside object elements that use - // the proprietary classid attribute value (rather than the type - // attribute) to identify the type of content to display - if ( nodeName === "object" ) { - dest.outerHTML = src.outerHTML; + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && - } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { - // IE6-8 fails to persist the checked state of a cloned checkbox - // or radio button. Worse, IE6-7 fail to give the cloned element - // a checked appearance if the defaultChecked value isn't also set - if ( src.checked ) { - dest.defaultChecked = dest.checked = src.checked; - } + // Don't return options that are disabled or in a disabled optgroup + ( support.optDisabled ? + !option.disabled : + option.getAttribute( "disabled" ) === null ) && + ( !option.parentNode.disabled || + !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { - // IE6-7 get confused and end up setting the value of a cloned - // checkbox/radio button to an empty string instead of "on" - if ( dest.value !== src.value ) { - dest.value = src.value; - } + // Get the specific value for the option + value = jQuery( option ).val(); - // IE6-8 fails to return the selected option to the default selected - // state when cloning options - } else if ( nodeName === "option" ) { - dest.selected = src.defaultSelected; + // We don't need an array for one selects + if ( one ) { + return value; + } - // IE6-8 fails to set the defaultValue to the correct value when - // cloning other types of input fields - } else if ( nodeName === "input" || nodeName === "textarea" ) { - dest.defaultValue = src.defaultValue; + // Multi-Selects return an array + values.push( value ); + } + } - // IE blanks contents when cloning scripts - } else if ( nodeName === "script" && dest.text !== src.text ) { - dest.text = src.text; - } + return values; + }, - // Event data gets referenced instead of copied if the expando - // gets copied too - dest.removeAttribute( jQuery.expando ); + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; - // Clear flags for bubbling special change/submit events, they must - // be reattached when the newly cloned events are first activated - dest.removeAttribute( "_submit_attached" ); - dest.removeAttribute( "_change_attached" ); -} + while ( i-- ) { + option = options[ i ]; -jQuery.buildFragment = function( args, nodes, scripts ) { - var fragment, cacheable, cacheresults, doc, - first = args[ 0 ]; + if ( jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 ) { - // nodes may contain either an explicit document object, - // a jQuery collection or context object. - // If nodes[0] contains a valid object to assign to doc - if ( nodes && nodes[0] ) { - doc = nodes[0].ownerDocument || nodes[0]; - } + // Support: IE6 + // When new option element is added to select box we need to + // force reflow of newly added node in order to workaround delay + // of initialization properties + try { + option.selected = optionSet = true; - // Ensure that an attr object doesn't incorrectly stand in as a document object - // Chrome and Firefox seem to allow this to occur and will throw exception - // Fixes #8950 - if ( !doc.createDocumentFragment ) { - doc = document; - } + } catch ( _ ) { - // Only cache "small" (1/2 KB) HTML strings that are associated with the main document - // Cloning options loses the selected state, so don't cache them - // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment - // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache - // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 - if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document && - first.charAt(0) === "<" && !rnocache.test( first ) && - (jQuery.support.checkClone || !rchecked.test( first )) && - (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + // Will be executed only in IE6 + option.scrollHeight; + } - cacheable = true; + } else { + option.selected = false; + } + } - cacheresults = jQuery.fragments[ first ]; - if ( cacheresults && cacheresults !== 1 ) { - fragment = cacheresults; - } - } + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } - if ( !fragment ) { - fragment = doc.createDocumentFragment(); - jQuery.clean( args, doc, fragment, scripts ); + return options; + } + } } +} ); - if ( cacheable ) { - jQuery.fragments[ first ] = cacheresults ? fragment : 1; +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; } +} ); - return { fragment: fragment, cacheable: cacheable }; -}; -jQuery.fragments = {}; -jQuery.each({ - appendTo: "append", - prependTo: "prepend", - insertBefore: "before", - insertAfter: "after", - replaceAll: "replaceWith" -}, function( name, original ) { - jQuery.fn[ name ] = function( selector ) { - var ret = [], - insert = jQuery( selector ), - parent = this.length === 1 && this[0].parentNode; - if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { - insert[ original ]( this[0] ); - return this; +var nodeHook, boolHook, + attrHandle = jQuery.expr.attrHandle, + ruseDefault = /^(?:checked|selected)$/i, + getSetAttribute = support.getSetAttribute, + getSetInput = support.input; - } else { - for ( var i = 0, l = insert.length; i < l; i++ ) { - var elems = ( i > 0 ? this.clone(true) : this ).get(); - jQuery( insert[i] )[ original ]( elems ); - ret = ret.concat( elems ); - } +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, - return this.pushStack( ret, name, insert.selector ); - } - }; -}); + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); -function getAll( elem ) { - if ( typeof elem.getElementsByTagName !== "undefined" ) { - return elem.getElementsByTagName( "*" ); +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; - } else if ( typeof elem.querySelectorAll !== "undefined" ) { - return elem.querySelectorAll( "*" ); + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } - } else { - return []; - } -} + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } -// Used in clean, fixes the defaultChecked property -function fixDefaultChecked( elem ) { - if ( elem.type === "checkbox" || elem.type === "radio" ) { - elem.defaultChecked = elem.checked; - } -} -// Finds all inputs and passes them to fixDefaultChecked -function findInputs( elem ) { - var nodeName = ( elem.nodeName || "" ).toLowerCase(); - if ( nodeName === "input" ) { - fixDefaultChecked( elem ); - // Skip scripts, get other children - } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) { - jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); - } -} + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : nodeHook ); + } -// Derived From: http://www.iecss.com/shimprove/javascript/shimprove.1-0-1.js -function shimCloneNode( elem ) { - var div = document.createElement( "div" ); - safeFragment.appendChild( div ); + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } - div.innerHTML = elem.outerHTML; - return div.firstChild; -} + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } -jQuery.extend({ - clone: function( elem, dataAndEvents, deepDataAndEvents ) { - var srcElements, - destElements, - i, - // IE<=8 does not properly clone detached, unknown element nodes - clone = jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ? - elem.cloneNode( true ) : - shimCloneNode( elem ); - - if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && - (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { - // IE copies events bound via attachEvent when using cloneNode. - // Calling detachEvent on the clone will also remove the events - // from the original. In order to get around this, we use some - // proprietary methods to clear the events. Thanks to MooTools - // guys for this hotness. - - cloneFixAttributes( elem, clone ); - - // Using Sizzle here is crazy slow, so we use getElementsByTagName instead - srcElements = getAll( elem ); - destElements = getAll( clone ); + elem.setAttribute( name, value + "" ); + return value; + } - // Weird iteration because IE will replace the length property - // with an element if you are cloning the body and one of the - // elements on the page has a name or id of "length" - for ( i = 0; srcElements[i]; ++i ) { - // Ensure that the destination node is not null; Fixes #9587 - if ( destElements[i] ) { - cloneFixAttributes( srcElements[i], destElements[i] ); - } - } + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; } - // Copy the events from the original to the clone - if ( dataAndEvents ) { - cloneCopyEvent( elem, clone ); + ret = jQuery.find.attr( elem, name ); - if ( deepDataAndEvents ) { - srcElements = getAll( elem ); - destElements = getAll( clone ); + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + jQuery.nodeName( elem, "input" ) ) { - for ( i = 0; srcElements[i]; ++i ) { - cloneCopyEvent( srcElements[i], destElements[i] ); + // Setting the type on a radio button after the value resets the value in IE8-9 + // Reset value to default in case type is set after value during creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; } } } - - srcElements = destElements = null; - - // Return the cloned set - return clone; }, - clean: function( elems, context, fragment, scripts ) { - var checkScriptType, script, j, - ret = []; - - context = context || document; + removeAttr: function( elem, value ) { + var name, propName, + i = 0, + attrNames = value && value.match( rnotwhite ); - // !context.createElement fails in IE with an error but returns typeof 'object' - if ( typeof context.createElement === "undefined" ) { - context = context.ownerDocument || context[0] && context[0].ownerDocument || document; - } + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + propName = jQuery.propFix[ name ] || name; - for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { - if ( typeof elem === "number" ) { - elem += ""; - } + // Boolean attributes get special treatment (#10870) + if ( jQuery.expr.match.bool.test( name ) ) { - if ( !elem ) { - continue; - } + // Set corresponding property to false + if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) { + elem[ propName ] = false; - // Convert html string into DOM nodes - if ( typeof elem === "string" ) { - if ( !rhtml.test( elem ) ) { - elem = context.createTextNode( elem ); - } else { - // Fix "XHTML"-style tags in all browsers - elem = elem.replace(rxhtmlTag, "<$1></$2>"); - - // Trim whitespace, otherwise indexOf won't work as expected - var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(), - wrap = wrapMap[ tag ] || wrapMap._default, - depth = wrap[0], - div = context.createElement("div"), - safeChildNodes = safeFragment.childNodes, - remove; - - // Append wrapper element to unknown element safe doc fragment - if ( context === document ) { - // Use the fragment we've already created for this document - safeFragment.appendChild( div ); + // Support: IE<9 + // Also clear defaultChecked/defaultSelected (if appropriate) } else { - // Use a fragment created with the owner document - createSafeFragment( context ).appendChild( div ); + elem[ jQuery.camelCase( "default-" + name ) ] = + elem[ propName ] = false; } - // Go to html and back, then peel off extra wrappers - div.innerHTML = wrap[1] + elem + wrap[2]; - - // Move to the right depth - while ( depth-- ) { - div = div.lastChild; - } + // See #9699 for explanation of this approach (setting first, then removal) + } else { + jQuery.attr( elem, name, "" ); + } - // Remove IE's autoinserted <tbody> from table fragments - if ( !jQuery.support.tbody ) { + elem.removeAttribute( getSetAttribute ? name : propName ); + } + } + } +} ); - // String was a <table>, *may* have spurious <tbody> - var hasBody = rtbody.test(elem), - tbody = tag === "table" && !hasBody ? - div.firstChild && div.firstChild.childNodes : +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { - // String was a bare <thead> or <tfoot> - wrap[1] === "<table>" && !hasBody ? - div.childNodes : - []; + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) { - for ( j = tbody.length - 1; j >= 0 ; --j ) { - if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { - tbody[ j ].parentNode.removeChild( tbody[ j ] ); - } - } - } + // IE<8 needs the *property* name + elem.setAttribute( !getSetAttribute && jQuery.propFix[ name ] || name, name ); - // IE completely kills leading whitespace when innerHTML is used - if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { - div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); - } + } else { - elem = div.childNodes; + // Support: IE<9 + // Use defaultChecked and defaultSelected for oldIE + elem[ jQuery.camelCase( "default-" + name ) ] = elem[ name ] = true; + } + return name; + } +}; - // Clear elements from DocumentFragment (safeFragment or otherwise) - // to avoid hoarding elements. Fixes #11356 - if ( div ) { - div.parentNode.removeChild( div ); +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; - // Guard against -1 index exceptions in FF3.6 - if ( safeChildNodes.length > 0 ) { - remove = safeChildNodes[ safeChildNodes.length - 1 ]; + if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) { + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle; + if ( !isXML ) { - if ( remove && remove.parentNode ) { - remove.parentNode.removeChild( remove ); - } - } - } - } + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ name ]; + attrHandle[ name ] = ret; + ret = getter( elem, name, isXML ) != null ? + name.toLowerCase() : + null; + attrHandle[ name ] = handle; } - - // Resets defaultChecked for any radios and checkboxes - // about to be appended to the DOM in IE 6/7 (#8060) - var len; - if ( !jQuery.support.appendChecked ) { - if ( elem[0] && typeof (len = elem.length) === "number" ) { - for ( j = 0; j < len; j++ ) { - findInputs( elem[j] ); - } - } else { - findInputs( elem ); - } + return ret; + }; + } else { + attrHandle[ name ] = function( elem, name, isXML ) { + if ( !isXML ) { + return elem[ jQuery.camelCase( "default-" + name ) ] ? + name.toLowerCase() : + null; } + }; + } +} ); + +// fix oldIE attroperties +if ( !getSetInput || !getSetAttribute ) { + jQuery.attrHooks.value = { + set: function( elem, value, name ) { + if ( jQuery.nodeName( elem, "input" ) ) { - if ( elem.nodeType ) { - ret.push( elem ); + // Does not return so that setAttribute is also used + elem.defaultValue = value; } else { - ret = jQuery.merge( ret, elem ); + + // Use nodeHook if defined (#1954); otherwise setAttribute is fine + return nodeHook && nodeHook.set( elem, value, name ); } } + }; +} - if ( fragment ) { - checkScriptType = function( elem ) { - return !elem.type || rscriptType.test( elem.type ); - }; - for ( i = 0; ret[i]; i++ ) { - script = ret[i]; - if ( scripts && jQuery.nodeName( script, "script" ) && (!script.type || rscriptType.test( script.type )) ) { - scripts.push( script.parentNode ? script.parentNode.removeChild( script ) : script ); +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { - } else { - if ( script.nodeType === 1 ) { - var jsTags = jQuery.grep( script.getElementsByTagName( "script" ), checkScriptType ); + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = { + set: function( elem, value, name ) { - ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); - } - fragment.appendChild( script ); - } + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + elem.setAttributeNode( + ( ret = elem.ownerDocument.createAttribute( name ) ) + ); + } + + ret.value = value += ""; + + // Break association with cloned elements by also using setAttribute (#9646) + if ( name === "value" || value === elem.getAttribute( name ) ) { + return value; } } + }; - return ret; - }, + // Some attributes are constructed with empty-string values when not defined + attrHandle.id = attrHandle.name = attrHandle.coords = + function( elem, name, isXML ) { + var ret; + if ( !isXML ) { + return ( ret = elem.getAttributeNode( name ) ) && ret.value !== "" ? + ret.value : + null; + } + }; - cleanData: function( elems ) { - var data, id, - cache = jQuery.cache, - special = jQuery.event.special, - deleteExpando = jQuery.support.deleteExpando; + // Fixing value retrieval on a button requires this module + jQuery.valHooks.button = { + get: function( elem, name ) { + var ret = elem.getAttributeNode( name ); + if ( ret && ret.specified ) { + return ret.value; + } + }, + set: nodeHook.set + }; - for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { - if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { - continue; + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + set: function( elem, value, name ) { + nodeHook.set( elem, value === "" ? false : value, name ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each( [ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } } + }; + } ); +} - id = elem[ jQuery.expando ]; +if ( !support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { - if ( id ) { - data = cache[ id ]; + // Return undefined in the case of empty string + // Note: IE uppercases css property names, but if we were to .toLowerCase() + // .cssText, that would destroy case sensitivity in URL's, like in "background" + return elem.style.cssText || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = value + "" ); + } + }; +} - if ( data && data.events ) { - for ( var type in data.events ) { - if ( special[ type ] ) { - jQuery.event.remove( elem, type ); - // This is a shortcut to avoid jQuery.event.remove's overhead - } else { - jQuery.removeEvent( elem, type, data.handle ); - } - } - // Null the DOM reference to avoid IE6/7/8 leak (#7054) - if ( data.handle ) { - data.handle.elem = null; - } - } - if ( deleteExpando ) { - delete elem[ jQuery.expando ]; +var rfocusable = /^(?:input|select|textarea|button|object)$/i, + rclickable = /^(?:a|area)$/i; - } else if ( elem.removeAttribute ) { - elem.removeAttribute( jQuery.expando ); - } +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, - delete cache[ id ]; - } - } + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each( function() { + + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch ( e ) {} + } ); } -}); +} ); +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { -var ralpha = /alpha\([^)]*\)/i, - ropacity = /opacity=([^)]*)/, - // fixed for IE9, see #8346 - rupper = /([A-Z]|^ms)/g, - rnum = /^[\-+]?(?:\d*\.)?\d+$/i, - rnumnonpx = /^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i, - rrelNum = /^([\-+])=([\-+.\de]+)/, - rmargin = /^margin/, + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } - cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } - // order is important! - cssExpand = [ "Top", "Right", "Bottom", "Left" ], + return ( elem[ name ] = value ); + } - curCSS, + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } - getComputedStyle, - currentStyle; + return elem[ name ]; + }, -jQuery.fn.css = function( name, value ) { - return jQuery.access( this, function( elem, name, value ) { - return value !== undefined ? - jQuery.style( elem, name, value ) : - jQuery.css( elem, name ); - }, name, value, arguments.length > 1 ); -}; + propHooks: { + tabIndex: { + get: function( elem ) { -jQuery.extend({ - // Add in style property hooks for overriding the default - // behavior of getting and setting a style property - cssHooks: { - opacity: { - get: function( elem, computed ) { - if ( computed ) { - // We should always get a number back from opacity - var ret = curCSS( elem, "opacity" ); - return ret === "" ? "1" : ret; + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); - } else { - return elem.style.opacity; - } + return tabindex ? + parseInt( tabindex, 10 ) : + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && elem.href ? + 0 : + -1; } } }, - // Exclude the following css properties to add px - cssNumber: { - "fillOpacity": true, - "fontWeight": true, - "lineHeight": true, - "opacity": true, - "orphans": true, - "widows": true, - "zIndex": true, - "zoom": true - }, - - // Add in properties whose names you wish to fix before - // setting or getting the value - cssProps: { - // normalize float css property - "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" - }, + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); - // Get and set the style property on a DOM Node - style: function( elem, name, value, extra ) { - // Don't set styles on text and comment nodes - if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { - return; - } +// Some attributes require a special call on IE +// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !support.hrefNormalized ) { - // Make sure that we're working with the right name - var ret, type, origName = jQuery.camelCase( name ), - style = elem.style, hooks = jQuery.cssHooks[ origName ]; + // href/src property should get the full normalized URL (#10299/#12915) + jQuery.each( [ "href", "src" ], function( i, name ) { + jQuery.propHooks[ name ] = { + get: function( elem ) { + return elem.getAttribute( name, 4 ); + } + }; + } ); +} - name = jQuery.cssProps[ origName ] || origName; +// Support: Safari, IE9+ +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + var parent = elem.parentNode; - // Check if we're setting a value - if ( value !== undefined ) { - type = typeof value; + if ( parent ) { + parent.selectedIndex; - // convert relative number strings (+= or -=) to relative numbers. #7345 - if ( type === "string" && (ret = rrelNum.exec( value )) ) { - value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); - // Fixes bug #9237 - type = "number"; + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } } + return null; + }, + set: function( elem ) { + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; - // Make sure that NaN and null values aren't set. See: #7116 - if ( value == null || type === "number" && isNaN( value ) ) { - return; + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } } + } + }; +} - // If a number was passed in, add 'px' to the (except for certain CSS properties) - if ( type === "number" && !jQuery.cssNumber[ origName ] ) { - value += "px"; - } +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); - // If a hook was provided, use that value, otherwise just set the specified value - if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { - // Wrapped to prevent IE from throwing errors when 'invalid' values are provided - // Fixes bug #5509 - try { - style[ name ] = value; - } catch(e) {} - } +// IE6/7 call enctype encoding +if ( !support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} - } else { - // If a hook was provided get the non-computed value from there - if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { - return ret; - } - // Otherwise just get the value from the style object - return style[ name ]; - } - }, - css: function( elem, name, extra ) { - var ret, hooks; - // Make sure that we're working with the right name - name = jQuery.camelCase( name ); - hooks = jQuery.cssHooks[ name ]; - name = jQuery.cssProps[ name ] || name; +var rclass = /[\t\r\n\f]/g; + +function getClass( elem ) { + return jQuery.attr( elem, "class" ) || ""; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; - // cssFloat needs a special treatment - if ( name === "cssFloat" ) { - name = "float"; + if ( jQuery.isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); } - // If a hook was provided get the computed value from there - if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { - return ret; + if ( typeof value === "string" && value ) { + classes = value.match( rnotwhite ) || []; - // Otherwise, if a way to get the computed value exists, use that - } else if ( curCSS ) { - return curCSS( elem, name ); + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && + ( " " + curValue + " " ).replace( rclass, " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // only assign if different to avoid unneeded rendering. + finalValue = jQuery.trim( cur ); + if ( curValue !== finalValue ) { + jQuery.attr( elem, "class", finalValue ); + } + } + } } + + return this; }, - // A method for quickly swapping in/out CSS properties to get correct calculations - swap: function( elem, options, callback ) { - var old = {}, - ret, name; + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; - // Remember the old values, and insert the new ones - for ( name in options ) { - old[ name ] = elem.style[ name ]; - elem.style[ name ] = options[ name ]; + if ( jQuery.isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); } - ret = callback.call( elem ); - - // Revert the old values - for ( name in options ) { - elem.style[ name ] = old[ name ]; + if ( !arguments.length ) { + return this.attr( "class", "" ); } - return ret; - } -}); + if ( typeof value === "string" && value ) { + classes = value.match( rnotwhite ) || []; -// DEPRECATED in 1.3, Use jQuery.css() instead -jQuery.curCSS = jQuery.css; + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); -if ( document.defaultView && document.defaultView.getComputedStyle ) { - getComputedStyle = function( elem, name ) { - var ret, defaultView, computedStyle, width, - style = elem.style; + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && + ( " " + curValue + " " ).replace( rclass, " " ); - name = name.replace( rupper, "-$1" ).toLowerCase(); + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { - if ( (defaultView = elem.ownerDocument.defaultView) && - (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } - ret = computedStyle.getPropertyValue( name ); - if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { - ret = jQuery.style( elem, name ); + // Only assign if different to avoid unneeded rendering. + finalValue = jQuery.trim( cur ); + if ( curValue !== finalValue ) { + jQuery.attr( elem, "class", finalValue ); + } + } } } - // A tribute to the "awesome hack by Dean Edwards" - // WebKit uses "computed value (percentage if specified)" instead of "used value" for margins - // which is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values - if ( !jQuery.support.pixelMargin && computedStyle && rmargin.test( name ) && rnumnonpx.test( ret ) ) { - width = style.width; - style.width = ret; - ret = computedStyle.width; - style.width = width; - } + return this; + }, - return ret; - }; -} + toggleClass: function( value, stateVal ) { + var type = typeof value; -if ( document.documentElement.currentStyle ) { - currentStyle = function( elem, name ) { - var left, rsLeft, uncomputed, - ret = elem.currentStyle && elem.currentStyle[ name ], - style = elem.style; + if ( typeof stateVal === "boolean" && type === "string" ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } - // Avoid setting ret to empty string here - // so we don't default to auto - if ( ret == null && style && (uncomputed = style[ name ]) ) { - ret = uncomputed; + if ( jQuery.isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); } - // From the awesome hack by Dean Edwards - // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + return this.each( function() { + var className, i, self, classNames; - // If we're not dealing with a regular pixel number - // but a number that has a weird ending, we need to convert it to pixels - if ( rnumnonpx.test( ret ) ) { + if ( type === "string" ) { - // Remember the original values - left = style.left; - rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = value.match( rnotwhite ) || []; - // Put in the new values to get a computed value out - if ( rsLeft ) { - elem.runtimeStyle.left = elem.currentStyle.left; - } - style.left = name === "fontSize" ? "1em" : ret; - ret = style.pixelLeft + "px"; + while ( ( className = classNames[ i++ ] ) ) { - // Revert the changed values - style.left = left; - if ( rsLeft ) { - elem.runtimeStyle.left = rsLeft; - } - } + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } - return ret === "" ? "auto" : ret; - }; -} + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { -curCSS = getComputedStyle || currentStyle; + // store className if set + jQuery._data( this, "__className__", className ); + } -function getWidthOrHeight( elem, name, extra ) { + // If the element has a class name or if we're passed "false", + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + jQuery.attr( this, "class", + className || value === false ? + "" : + jQuery._data( this, "__className__" ) || "" + ); + } + } ); + }, - // Start with offset property - var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, - i = name === "width" ? 1 : 0, - len = 4; + hasClass: function( selector ) { + var className, elem, + i = 0; - if ( val > 0 ) { - if ( extra !== "border" ) { - for ( ; i < len; i += 2 ) { - if ( !extra ) { - val -= parseFloat( jQuery.css( elem, "padding" + cssExpand[ i ] ) ) || 0; - } - if ( extra === "margin" ) { - val += parseFloat( jQuery.css( elem, extra + cssExpand[ i ] ) ) || 0; - } else { - val -= parseFloat( jQuery.css( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; - } + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + getClass( elem ) + " " ).replace( rclass, " " ) + .indexOf( className ) > -1 + ) { + return true; } } - return val + "px"; + return false; } +} ); - // Fall back to computed then uncomputed css if necessary - val = curCSS( elem, name ); - if ( val < 0 || val == null ) { - val = elem.style[ name ]; - } - // Computed unit is not pixels. Stop here and return. - if ( rnumnonpx.test(val) ) { - return val; - } - // Normalize "", auto, and prepare for extra - val = parseFloat( val ) || 0; - // Add padding, border, margin - if ( extra ) { - for ( ; i < len; i += 2 ) { - val += parseFloat( jQuery.css( elem, "padding" + cssExpand[ i ] ) ) || 0; - if ( extra !== "padding" ) { - val += parseFloat( jQuery.css( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; - } - if ( extra === "margin" ) { - val += parseFloat( jQuery.css( elem, extra + cssExpand[ i ]) ) || 0; - } - } - } +// Return jQuery for attributes-only inclusion - return val + "px"; -} -jQuery.each([ "height", "width" ], function( i, name ) { - jQuery.cssHooks[ name ] = { - get: function( elem, computed, extra ) { - if ( computed ) { - if ( elem.offsetWidth !== 0 ) { - return getWidthOrHeight( elem, name, extra ); - } else { - return jQuery.swap( elem, cssShow, function() { - return getWidthOrHeight( elem, name, extra ); - }); - } - } - }, +jQuery.each( ( "blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu" ).split( " " ), + function( i, name ) { - set: function( elem, value ) { - return rnum.test( value ) ? - value + "px" : - value; - } + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); }; -}); +} ); -if ( !jQuery.support.opacity ) { - jQuery.cssHooks.opacity = { - get: function( elem, computed ) { - // IE uses filters for opacity - return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? - ( parseFloat( RegExp.$1 ) / 100 ) + "" : - computed ? "1" : ""; - }, - - set: function( elem, value ) { - var style = elem.style, - currentStyle = elem.currentStyle, - opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", - filter = currentStyle && currentStyle.filter || style.filter || ""; +jQuery.fn.extend( { + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +} ); - // IE has trouble with opacity if it does not have layout - // Force it by setting the zoom level - style.zoom = 1; - // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 - if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { +var location = window.location; - // Setting style.filter to null, "" & " " still leave "filter:" in the cssText - // if "filter:" is present at all, clearType is disabled, we want to avoid this - // style.removeAttribute is IE Only, but so apparently is this code path... - style.removeAttribute( "filter" ); +var nonce = jQuery.now(); - // if there there is no filter style applied in a css rule, we are done - if ( currentStyle && !currentStyle.filter ) { - return; - } - } +var rquery = ( /\?/ ); - // otherwise, set new filter values - style.filter = ralpha.test( filter ) ? - filter.replace( ralpha, opacity ) : - filter + " " + opacity; - } - }; -} -jQuery(function() { - // This hook cannot be added until DOM ready because the support test - // for it is not run until after DOM ready - if ( !jQuery.support.reliableMarginRight ) { - jQuery.cssHooks.marginRight = { - get: function( elem, computed ) { - // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right - // Work around by temporarily setting element display to inline-block - return jQuery.swap( elem, { "display": "inline-block" }, function() { - if ( computed ) { - return curCSS( elem, "margin-right" ); - } else { - return elem.style.marginRight; - } - }); - } - }; - } -}); -if ( jQuery.expr && jQuery.expr.filters ) { - jQuery.expr.filters.hidden = function( elem ) { - var width = elem.offsetWidth, - height = elem.offsetHeight; +var rvalidtokens = /(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g; - return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none"); - }; +jQuery.parseJSON = function( data ) { - jQuery.expr.filters.visible = function( elem ) { - return !jQuery.expr.filters.hidden( elem ); - }; -} + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { -// These hooks are used by animate to expand properties -jQuery.each({ - margin: "", - padding: "", - border: "Width" -}, function( prefix, suffix ) { + // Support: Android 2.3 + // Workaround failure to string-cast null input + return window.JSON.parse( data + "" ); + } - jQuery.cssHooks[ prefix + suffix ] = { - expand: function( value ) { - var i, + var requireNonComma, + depth = null, + str = jQuery.trim( data + "" ); - // assumes a single number if not a string - parts = typeof value === "string" ? value.split(" ") : [ value ], - expanded = {}; + // Guard against invalid (and possibly dangerous) input by ensuring that nothing remains + // after removing valid tokens + return str && !jQuery.trim( str.replace( rvalidtokens, function( token, comma, open, close ) { - for ( i = 0; i < 4; i++ ) { - expanded[ prefix + cssExpand[ i ] + suffix ] = - parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; - } + // Force termination if we see a misplaced comma + if ( requireNonComma && comma ) { + depth = 0; + } - return expanded; + // Perform no more replacements after returning to outermost depth + if ( depth === 0 ) { + return token; } - }; -}); + // Commas must not follow "[", "{", or "," + requireNonComma = open || comma; + // Determine new depth + // array/object open ("[" or "{"): depth += true - false (increment) + // array/object close ("]" or "}"): depth += false - true (decrement) + // other cases ("," or primitive): depth += true - true (numeric cast) + depth += !close - !open; + // Remove this token + return ""; + } ) ) ? + ( Function( "return " + str ) )() : + jQuery.error( "Invalid JSON: " + data ); +}; -var r20 = /%20/g, - rbracket = /\[\]$/, - rCRLF = /\r?\n/g, + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + try { + if ( window.DOMParser ) { // Standard + tmp = new window.DOMParser(); + xml = tmp.parseFromString( data, "text/xml" ); + } else { // IE + xml = new window.ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch ( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; +}; + + +var rhash = /#.*$/, - rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL - rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rts = /([?&])_=[^&]*/, + + // IE leaves an \r character at EOL + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, + // #7653, #8125, #8152: local protocol detection - rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, rnoContent = /^(?:GET|HEAD)$/, rprotocol = /^\/\//, - rquery = /\?/, - rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, - rselectTextarea = /^(?:select|textarea)/i, - rspacesAjax = /\s+/, - rts = /([?&])_=[^&]*/, - rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, - - // Keep a copy of the old load method - _load = jQuery.fn.load, + rurl = /^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/, /* Prefilters * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) @@ -7006,29 +9105,14 @@ var r20 = /%20/g, */ transports = {}, - // Document location - ajaxLocation, - - // Document location segments - ajaxLocParts, - // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression - allTypes = ["*/"] + ["*"]; + allTypes = "*/".concat( "*" ), -// #8138, IE may throw an exception when accessing -// a field from window.location if document.domain has been set -try { - ajaxLocation = location.href; -} catch( e ) { - // Use the href attribute of an A element - // since IE will modify it given document.location - ajaxLocation = document.createElement( "a" ); - ajaxLocation.href = ""; - ajaxLocation = ajaxLocation.href; -} + // Document location + ajaxLocation = location.href, -// Segment location into parts -ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + // Segment location into parts + ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; // Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport function addToPrefiltersOrTransports( structure ) { @@ -7041,77 +9125,63 @@ function addToPrefiltersOrTransports( structure ) { dataTypeExpression = "*"; } + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnotwhite ) || []; + if ( jQuery.isFunction( func ) ) { - var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), - i = 0, - length = dataTypes.length, - dataType, - list, - placeBefore; // For each dataType in the dataTypeExpression - for ( ; i < length; i++ ) { - dataType = dataTypes[ i ]; - // We control if we're asked to add before - // any existing element - placeBefore = /^\+/.test( dataType ); - if ( placeBefore ) { - dataType = dataType.substr( 1 ) || "*"; + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType.charAt( 0 ) === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); } - list = structure[ dataType ] = structure[ dataType ] || []; - // then we add to the structure accordingly - list[ placeBefore ? "unshift" : "push" ]( func ); } } }; } // Base inspection function for prefilters and transports -function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, - dataType /* internal */, inspected /* internal */ ) { +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { - dataType = dataType || options.dataTypes[ 0 ]; - inspected = inspected || {}; + var inspected = {}, + seekingTransport = ( structure === transports ); - inspected[ dataType ] = true; + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { - var list = structure[ dataType ], - i = 0, - length = list ? list.length : 0, - executeOnly = ( structure === prefilters ), - selection; - - for ( ; i < length && ( executeOnly || !selection ); i++ ) { - selection = list[ i ]( options, originalOptions, jqXHR ); - // If we got redirected to another dataType - // we try there if executing only and not done already - if ( typeof selection === "string" ) { - if ( !executeOnly || inspected[ selection ] ) { - selection = undefined; - } else { - options.dataTypes.unshift( selection ); - selection = inspectPrefiltersOrTransports( - structure, options, originalOptions, jqXHR, selection, inspected ); + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); } - } - } - // If we're only executing or nothing was selected - // we try the catchall dataType if not done already - if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { - selection = inspectPrefiltersOrTransports( - structure, options, originalOptions, jqXHR, "*", inspected ); + } ); + return selected; } - // unnecessary when only executing (prefilters) - // but it'll be ignored by the caller in that case - return selection; + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); } // A special extend for ajax options // that takes "flat" options (not to be deep extended) // Fixes #9887 function ajaxExtend( target, src ) { - var key, deep, + var deep, key, flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { if ( src[ key ] !== undefined ) { ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; @@ -7120,172 +9190,184 @@ function ajaxExtend( target, src ) { if ( deep ) { jQuery.extend( true, target, deep ); } + + return target; } -jQuery.fn.extend({ - load: function( url, params, callback ) { - if ( typeof url !== "string" && _load ) { - return _load.apply( this, arguments ); +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + var firstDataType, ct, finalDataType, type, + contents = s.contents, + dataTypes = s.dataTypes; - // Don't do a request if no elements are being requested - } else if ( !this.length ) { - return this; + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); } + } - var off = url.indexOf( " " ); - if ( off >= 0 ) { - var selector = url.slice( off, url.length ); - url = url.slice( 0, off ); + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } } + } - // Default to a GET request - var type = "GET"; - - // If the second parameter was provided - if ( params ) { - // If it's a function - if ( jQuery.isFunction( params ) ) { - // We assume that it's the callback - callback = params; - params = undefined; + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { - // Otherwise, build a param string - } else if ( typeof params === "object" ) { - params = jQuery.param( params, jQuery.ajaxSettings.traditional ); - type = "POST"; + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; } } - var self = this; + // Or just use first one + finalDataType = finalDataType || firstDataType; + } - // Request the remote document - jQuery.ajax({ - url: url, - type: type, - dataType: "html", - data: params, - // Complete callback (responseText is used internally) - complete: function( jqXHR, status, responseText ) { - // Store the response as specified by the jqXHR object - responseText = jqXHR.responseText; - // If successful, inject the HTML into all the matched elements - if ( jqXHR.isResolved() ) { - // #4825: Get the actual response in case - // a dataFilter is present in ajaxSettings - jqXHR.done(function( r ) { - responseText = r; - }); - // See if a selector was specified - self.html( selector ? - // Create a dummy div to hold the results - jQuery("<div>") - // inject the contents of the document in, removing the scripts - // to avoid any 'Permission Denied' errors in IE - .append(responseText.replace(rscript, "")) - - // Locate the specified elements - .find(selector) : - - // If not, just inject the full result - responseText ); - } + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} - if ( callback ) { - self.each( callback, [ responseText, status, jqXHR ] ); - } - } - }); +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, - return this; - }, + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); - serialize: function() { - return jQuery.param( this.serializeArray() ); - }, + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } - serializeArray: function() { - return this.map(function(){ - return this.elements ? jQuery.makeArray( this.elements ) : this; - }) - .filter(function(){ - return this.name && !this.disabled && - ( this.checked || rselectTextarea.test( this.nodeName ) || - rinput.test( this.type ) ); - }) - .map(function( i, elem ){ - var val = jQuery( this ).val(); + current = dataTypes.shift(); - return val == null ? - null : - jQuery.isArray( val ) ? - jQuery.map( val, function( val, i ){ - return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; - }) : - { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; - }).get(); - } -}); + // Convert to each sequential dataType + while ( current ) { -// Attach a bunch of functions for handling common AJAX events -jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ - jQuery.fn[ o ] = function( f ){ - return this.on( o, f ); - }; -}); + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } -jQuery.each( [ "get", "post" ], function( i, method ) { - jQuery[ method ] = function( url, data, callback, type ) { - // shift arguments if data argument was omitted - if ( jQuery.isFunction( data ) ) { - type = type || callback; - callback = data; - data = undefined; + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); } - return jQuery.ajax({ - type: method, - url: url, - data: data, - success: callback, - dataType: type - }); - }; -}); + prev = current; + current = dataTypes.shift(); -jQuery.extend({ + if ( current ) { - getScript: function( url, callback ) { - return jQuery.get( url, undefined, callback, "script" ); - }, + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { - getJSON: function( url, data, callback ) { - return jQuery.get( url, data, callback, "json" ); - }, + current = prev; - // Creates a full fledged settings object into target - // with both ajaxSettings and settings fields. - // If target is omitted, writes into ajaxSettings. - ajaxSetup: function( target, settings ) { - if ( settings ) { - // Building a settings object - ajaxExtend( target, jQuery.ajaxSettings ); - } else { - // Extending ajaxSettings - settings = target; - target = jQuery.ajaxSettings; + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s[ "throws" ] ) { // jscs:ignore requireDotNotation + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } } - ajaxExtend( target, settings ); - return target; - }, + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, ajaxSettings: { url: ajaxLocation, + type: "GET", isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), global: true, - type: "GET", - contentType: "application/x-www-form-urlencoded; charset=UTF-8", processData: true, async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", /* timeout: 0, data: null, @@ -7293,36 +9375,37 @@ jQuery.extend({ username: null, password: null, cache: null, + throws: false, traditional: false, headers: {}, */ accepts: { - xml: "application/xml, text/xml", - html: "text/html", + "*": allTypes, text: "text/plain", - json: "application/json, text/javascript", - "*": allTypes + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" }, contents: { - xml: /xml/, - html: /html/, - json: /json/ + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ }, responseFields: { xml: "responseXML", - text: "responseText" + text: "responseText", + json: "responseJSON" }, - // List of data converters - // 1) key format is "source_type destination_type" (a single space in-between) - // 2) the catchall symbol "*" can be used for source_type + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space converters: { // Convert anything to text - "* text": window.String, + "* text": String, // Text to html (true = no transformation) "text html": true, @@ -7339,11 +9422,24 @@ jQuery.extend({ // and when you create one that shouldn't be // deep extended (see ajaxExtend) flatOptions: { - context: true, - url: true + url: true, + context: true } }, + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), ajaxTransport: addToPrefiltersOrTransports( transports ), @@ -7359,74 +9455,92 @@ jQuery.extend({ // Force options to be an object options = options || {}; - var // Create the final options object + var + + // Cross-domain detection vars + parts, + + // Loop variable + i, + + // URL without anti-cache param + cacheURL, + + // Response headers as string + responseHeadersString, + + // timeout handle + timeoutTimer, + + // To know if global events are to be dispatched + fireGlobals, + + transport, + + // Response headers + responseHeaders, + + // Create the final options object s = jQuery.ajaxSetup( {}, options ), + // Callbacks context callbackContext = s.context || s, - // Context for global events - // It's the callbackContext if one was provided in the options - // and if it's a DOM node or a jQuery collection - globalEventContext = callbackContext !== s && - ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? - jQuery( callbackContext ) : jQuery.event, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + // Deferreds deferred = jQuery.Deferred(), completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks statusCode = s.statusCode || {}, - // ifModified key - ifModifiedKey, + // Headers (they are sent all at once) requestHeaders = {}, requestHeadersNames = {}, - // Response headers - responseHeadersString, - responseHeaders, - // transport - transport, - // timeout handle - timeoutTimer, - // Cross-domain detection vars - parts, + // The jqXHR state state = 0, - // To know if global events are to be dispatched - fireGlobals, - // Loop variable - i, + + // Default abort message + strAbort = "canceled", + // Fake xhr jqXHR = { - readyState: 0, - // Caches the header - setRequestHeader: function( name, value ) { - if ( !state ) { - var lname = name.toLowerCase(); - name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; - requestHeaders[ name ] = value; - } - return this; - }, - - // Raw string - getAllResponseHeaders: function() { - return state === 2 ? responseHeadersString : null; - }, - // Builds headers hashtable if needed getResponseHeader: function( key ) { var match; if ( state === 2 ) { if ( !responseHeaders ) { responseHeaders = {}; - while( ( match = rheaders.exec( responseHeadersString ) ) ) { - responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ]; } } match = responseHeaders[ key.toLowerCase() ]; } - return match === undefined ? null : match; + return match == null ? null : match; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + var lname = name.toLowerCase(); + if ( !state ) { + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; }, // Overrides response content-type header @@ -7437,167 +9551,62 @@ jQuery.extend({ return this; }, + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( state < 2 ) { + for ( code in map ) { + + // Lazy-add the new callback in a way that preserves old ones + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } else { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } + } + return this; + }, + // Cancel the request abort: function( statusText ) { - statusText = statusText || "abort"; + var finalText = statusText || strAbort; if ( transport ) { - transport.abort( statusText ); + transport.abort( finalText ); } - done( 0, statusText ); + done( 0, finalText ); return this; } }; - // Callback for when everything is done - // It is defined here because jslint complains if it is declared - // at the end of the function (which would be more logical and readable) - function done( status, nativeStatusText, responses, headers ) { - - // Called once - if ( state === 2 ) { - return; - } - - // State is "done" now - state = 2; - - // Clear timeout if it exists - if ( timeoutTimer ) { - clearTimeout( timeoutTimer ); - } - - // Dereference transport for early garbage collection - // (no matter how long the jqXHR object will be used) - transport = undefined; - - // Cache response headers - responseHeadersString = headers || ""; - - // Set readyState - jqXHR.readyState = status > 0 ? 4 : 0; - - var isSuccess, - success, - error, - statusText = nativeStatusText, - response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, - lastModified, - etag; - - // If successful, handle type chaining - if ( status >= 200 && status < 300 || status === 304 ) { - - // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. - if ( s.ifModified ) { - - if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { - jQuery.lastModified[ ifModifiedKey ] = lastModified; - } - if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { - jQuery.etag[ ifModifiedKey ] = etag; - } - } - - // If not modified - if ( status === 304 ) { - - statusText = "notmodified"; - isSuccess = true; - - // If we have data - } else { - - try { - success = ajaxConvert( s, response ); - statusText = "success"; - isSuccess = true; - } catch(e) { - // We have a parsererror - statusText = "parsererror"; - error = e; - } - } - } else { - // We extract error from statusText - // then normalize statusText and status for non-aborts - error = statusText; - if ( !statusText || status ) { - statusText = "error"; - if ( status < 0 ) { - status = 0; - } - } - } - - // Set data for the fake xhr object - jqXHR.status = status; - jqXHR.statusText = "" + ( nativeStatusText || statusText ); - - // Success/Error - if ( isSuccess ) { - deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); - } else { - deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); - } - - // Status-dependent callbacks - jqXHR.statusCode( statusCode ); - statusCode = undefined; - - if ( fireGlobals ) { - globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), - [ jqXHR, s, isSuccess ? success : error ] ); - } - - // Complete - completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); - - if ( fireGlobals ) { - globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); - // Handle the global AJAX counter - if ( !( --jQuery.active ) ) { - jQuery.event.trigger( "ajaxStop" ); - } - } - } - // Attach deferreds - deferred.promise( jqXHR ); + deferred.promise( jqXHR ).complete = completeDeferred.add; jqXHR.success = jqXHR.done; jqXHR.error = jqXHR.fail; - jqXHR.complete = completeDeferred.add; - - // Status-dependent callbacks - jqXHR.statusCode = function( map ) { - if ( map ) { - var tmp; - if ( state < 2 ) { - for ( tmp in map ) { - statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; - } - } else { - tmp = map[ jqXHR.status ]; - jqXHR.then( tmp, tmp ); - } - } - return this; - }; // Remove hash character (#7531: and string promotion) // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // Handle falsy url in the settings object (#10093: consistency with old signature) // We also use the url parameter if available - s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + s.url = ( ( url || s.url || ajaxLocation ) + "" ) + .replace( rhash, "" ) + .replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; // Extract dataTypes list - s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().match( rnotwhite ) || [ "" ]; - // Determine if a cross-domain request is in order + // A cross-domain request is in order when we have a protocol:host:port mismatch if ( s.crossDomain == null ) { parts = rurl.exec( s.url.toLowerCase() ); s.crossDomain = !!( parts && - ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || - ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != - ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? "80" : "443" ) ) !== + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? "80" : "443" ) ) ) ); } @@ -7611,11 +9620,17 @@ jQuery.extend({ // If request was aborted inside a prefilter, stop there if ( state === 2 ) { - return false; + return jqXHR; } // We can fire global events as of now if asked to - fireGlobals = s.global; + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } // Uppercase the type s.type = s.type.toUpperCase(); @@ -7623,57 +9638,54 @@ jQuery.extend({ // Determine if request has content s.hasContent = !rnoContent.test( s.type ); - // Watch for a new set of requests - if ( fireGlobals && jQuery.active++ === 0 ) { - jQuery.event.trigger( "ajaxStart" ); - } + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + cacheURL = s.url; // More options handling for requests with no content if ( !s.hasContent ) { // If data is available, append data to url if ( s.data ) { - s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + cacheURL = ( s.url += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data ); + // #9682: remove data so that it's not used in an eventual retry delete s.data; } - // Get ifModifiedKey before adding the anti-cache parameter - ifModifiedKey = s.url; - // Add anti-cache in url if needed if ( s.cache === false ) { + s.url = rts.test( cacheURL ) ? - var ts = jQuery.now(), - // try replacing _= if it is there - ret = s.url.replace( rts, "$1_=" + ts ); + // If there is already a '_' parameter, set its value + cacheURL.replace( rts, "$1_=" + nonce++ ) : - // if nothing was replaced, add timestamp to the end - s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + // Otherwise add one to the end + cacheURL + ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + nonce++; } } - // Set the correct header, if data is being sent - if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { - jqXHR.setRequestHeader( "Content-Type", s.contentType ); - } - // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. if ( s.ifModified ) { - ifModifiedKey = ifModifiedKey || s.url; - if ( jQuery.lastModified[ ifModifiedKey ] ) { - jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); } - if ( jQuery.etag[ ifModifiedKey ] ) { - jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); } } + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + // Set the Accepts header for the server, depending on the dataType jqXHR.setRequestHeader( "Accept", - s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? - s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : s.accepts[ "*" ] ); @@ -7683,13 +9695,16 @@ jQuery.extend({ } // Allow custom headers/mimetypes and early abort - if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { - // Abort if not done already - jqXHR.abort(); - return false; + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already and return + return jqXHR.abort(); } + // aborting is no longer a cancellation + strAbort = "abort"; + // Install callbacks on deferreds for ( i in { success: 1, error: 1, complete: 1 } ) { jqXHR[ i ]( s[ i ] ); @@ -7703,13 +9718,20 @@ jQuery.extend({ done( -1, "No Transport" ); } else { jqXHR.readyState = 1; + // Send global event if ( fireGlobals ) { globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); } + + // If request was aborted inside ajaxSend, stop there + if ( state === 2 ) { + return jqXHR; + } + // Timeout if ( s.async && s.timeout > 0 ) { - timeoutTimer = setTimeout( function(){ + timeoutTimer = window.setTimeout( function() { jqXHR.abort( "timeout" ); }, s.timeout ); } @@ -7717,10 +9739,12 @@ jQuery.extend({ try { state = 1; transport.send( requestHeaders, done ); - } catch (e) { + } catch ( e ) { + // Propagate exception as error if not done if ( state < 2 ) { done( -1, e ); + // Simply rethrow otherwise } else { throw e; @@ -7728,494 +9752,480 @@ jQuery.extend({ } } - return jqXHR; - }, + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; - // Serialize an array of form elements or a set of - // key/values into a query string - param: function( a, traditional ) { - var s = [], - add = function( key, value ) { - // If value is a function, invoke it and return its value - value = jQuery.isFunction( value ) ? value() : value; - s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); - }; + // Called once + if ( state === 2 ) { + return; + } - // Set traditional to true for jQuery <= 1.3.2 behavior. - if ( traditional === undefined ) { - traditional = jQuery.ajaxSettings.traditional; - } + // State is "done" now + state = 2; - // If an array was passed in, assume that it is an array of form elements. - if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { - // Serialize the form elements - jQuery.each( a, function() { - add( this.name, this.value ); - }); + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } - } else { - // If traditional, encode the "old" way (the way 1.3.2 or older - // did it), otherwise encode params recursively. - for ( var prefix in a ) { - buildParams( prefix, a[ prefix ], traditional, add ); + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); } - } - // Return the resulting serialization - return s.join( "&" ).replace( r20, "+" ); - } -}); + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); -function buildParams( prefix, obj, traditional, add ) { - if ( jQuery.isArray( obj ) ) { - // Serialize array item. - jQuery.each( obj, function( i, v ) { - if ( traditional || rbracket.test( prefix ) ) { - // Treat each array item as a scalar. - add( prefix, v ); + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } } else { - // If array item is non-scalar (array or object), encode its - // numeric index to resolve deserialization ambiguity issues. - // Note that rack (as of 1.0.0) can't currently deserialize - // nested arrays properly, and attempting to do so may cause - // a server error. Possible fixes are to modify rack's - // deserialization algorithm or to provide an option or flag - // to force array serialization to be shallow. - buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); + + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } } - }); - } else if ( !traditional && jQuery.type( obj ) === "object" ) { - // Serialize object item. - for ( var name in obj ) { - buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); - } + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; - } else { - // Serialize scalar item. - add( prefix, obj ); - } -} + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; -// This is still on the jQuery object... for now -// Want to move this to jQuery.ajax some day -jQuery.extend({ + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } - // Counter for holding the number of active queries - active: 0, + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); - // Last-Modified header cache for next request - lastModified: {}, - etag: {} + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); -}); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } -/* Handles responses to an ajax request: - * - sets all responseXXX fields accordingly - * - finds the right dataType (mediates between content-type and expected dataType) - * - returns the corresponding response - */ -function ajaxHandleResponses( s, jqXHR, responses ) { + return jqXHR; + }, - var contents = s.contents, - dataTypes = s.dataTypes, - responseFields = s.responseFields, - ct, - type, - finalDataType, - firstDataType; + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, - // Fill responseXXX fields - for ( type in responseFields ) { - if ( type in responses ) { - jqXHR[ responseFields[type] ] = responses[ type ]; - } + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); } +} ); - // Remove auto dataType and get content-type in the process - while( dataTypes[ 0 ] === "*" ) { - dataTypes.shift(); - if ( ct === undefined ) { - ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); - } - } +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { - // Check if we're dealing with a known content-type - if ( ct ) { - for ( type in contents ) { - if ( contents[ type ] && contents[ type ].test( ct ) ) { - dataTypes.unshift( type ); - break; - } + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; } - } - // Check to see if we have a response for the expected dataType - if ( dataTypes[ 0 ] in responses ) { - finalDataType = dataTypes[ 0 ]; - } else { - // Try convertible dataTypes - for ( type in responses ) { - if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { - finalDataType = type; - break; - } - if ( !firstDataType ) { - firstDataType = type; - } - } - // Or just use first one - finalDataType = finalDataType || firstDataType; - } + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); - // If we found a dataType - // We add the dataType to the list if needed - // and return the corresponding response - if ( finalDataType ) { - if ( finalDataType !== dataTypes[ 0 ] ) { - dataTypes.unshift( finalDataType ); - } - return responses[ finalDataType ]; - } -} -// Chain conversions given the request and the original response -function ajaxConvert( s, response ) { +jQuery._evalUrl = function( url ) { + return jQuery.ajax( { + url: url, - // Apply the dataFilter if provided - if ( s.dataFilter ) { - response = s.dataFilter( response, s.dataType ); - } + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + "throws": true + } ); +}; - var dataTypes = s.dataTypes, - converters = {}, - i, - key, - length = dataTypes.length, - tmp, - // Current and previous dataTypes - current = dataTypes[ 0 ], - prev, - // Conversion expression - conversion, - // Conversion function - conv, - // Conversion functions (transitive conversion) - conv1, - conv2; - - // For each dataType in the chain - for ( i = 1; i < length; i++ ) { - - // Create converters map - // with lowercased keys - if ( i === 1 ) { - for ( key in s.converters ) { - if ( typeof key === "string" ) { - converters[ key.toLowerCase() ] = s.converters[ key ]; - } - } - } - // Get the dataTypes - prev = current; - current = dataTypes[ i ]; - - // If current is auto dataType, update it to prev - if ( current === "*" ) { - current = prev; - // If no auto and dataTypes are actually different - } else if ( prev !== "*" && prev !== current ) { - - // Get the converter - conversion = prev + " " + current; - conv = converters[ conversion ] || converters[ "* " + current ]; - - // If there is no direct converter, search transitively - if ( !conv ) { - conv2 = undefined; - for ( conv1 in converters ) { - tmp = conv1.split( " " ); - if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { - conv2 = converters[ tmp[1] + " " + current ]; - if ( conv2 ) { - conv1 = converters[ conv1 ]; - if ( conv1 === true ) { - conv = conv2; - } else if ( conv2 === true ) { - conv = conv1; - } - break; - } - } - } - } - // If we found no converter, dispatch an error - if ( !( conv || conv2 ) ) { - jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); - } - // If found converter is not an equivalence - if ( conv !== true ) { - // Convert with 1 or 2 converters accordingly - response = conv ? conv( response ) : conv2( conv1(response) ); - } +jQuery.fn.extend( { + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapAll( html.call( this, i ) ); + } ); } - } - return response; -} + if ( this[ 0 ] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } -var jsc = jQuery.now(), - jsre = /(\=)\?(&|$)|\?\?/i; + wrap.map( function() { + var elem = this; -// Default jsonp settings -jQuery.ajaxSetup({ - jsonp: "callback", - jsonpCallback: function() { - return jQuery.expando + "_" + ( jsc++ ); - } -}); + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } -// Detect, normalize options and install callbacks for jsonp requests -jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + return elem; + } ).append( this ); + } - var inspectData = ( typeof s.data === "string" ) && /^application\/x\-www\-form\-urlencoded/.test( s.contentType ); - - if ( s.dataTypes[ 0 ] === "jsonp" || - s.jsonp !== false && ( jsre.test( s.url ) || - inspectData && jsre.test( s.data ) ) ) { - - var responseContainer, - jsonpCallback = s.jsonpCallback = - jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, - previous = window[ jsonpCallback ], - url = s.url, - data = s.data, - replace = "$1" + jsonpCallback + "$2"; - - if ( s.jsonp !== false ) { - url = url.replace( jsre, replace ); - if ( s.url === url ) { - if ( inspectData ) { - data = data.replace( jsre, replace ); - } - if ( s.data === data ) { - // Add callback manually - url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; - } - } + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); } - s.url = url; - s.data = data; + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); - // Install callback - window[ jsonpCallback ] = function( response ) { - responseContainer = [ response ]; - }; + if ( contents.length ) { + contents.wrapAll( html ); - // Clean-up function - jqXHR.always(function() { - // Set callback back to previous value - window[ jsonpCallback ] = previous; - // Call if it was a function and we have a response - if ( responseContainer && jQuery.isFunction( previous ) ) { - window[ jsonpCallback ]( responseContainer[ 0 ] ); + } else { + self.append( html ); } - }); + } ); + }, - // Use data converter to retrieve json after script execution - s.converters["script json"] = function() { - if ( !responseContainer ) { - jQuery.error( jsonpCallback + " was not called" ); - } - return responseContainer[ 0 ]; - }; + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); - // force json dataType - s.dataTypes[ 0 ] = "json"; + return this.each( function( i ) { + jQuery( this ).wrapAll( isFunction ? html.call( this, i ) : html ); + } ); + }, - // Delegate to script - return "script"; + unwrap: function() { + return this.parent().each( function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + } ).end(); } -}); +} ); +function getDisplay( elem ) { + return elem.style && elem.style.display || jQuery.css( elem, "display" ); +} +function filterHidden( elem ) { -// Install script dataType -jQuery.ajaxSetup({ - accepts: { - script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" - }, - contents: { - script: /javascript|ecmascript/ - }, - converters: { - "text script": function( text ) { - jQuery.globalEval( text ); - return text; + // Disconnected elements are considered hidden + if ( !jQuery.contains( elem.ownerDocument || document, elem ) ) { + return true; + } + while ( elem && elem.nodeType === 1 ) { + if ( getDisplay( elem ) === "none" || elem.type === "hidden" ) { + return true; } + elem = elem.parentNode; } -}); + return false; +} -// Handle cache's special case and global -jQuery.ajaxPrefilter( "script", function( s ) { - if ( s.cache === undefined ) { - s.cache = false; - } - if ( s.crossDomain ) { - s.type = "GET"; - s.global = false; - } -}); +jQuery.expr.filters.hidden = function( elem ) { -// Bind script tag hack transport -jQuery.ajaxTransport( "script", function(s) { + // Support: Opera <= 12.12 + // Opera reports offsetWidths and offsetHeights less than zero on some elements + return support.reliableHiddenOffsets() ? + ( elem.offsetWidth <= 0 && elem.offsetHeight <= 0 && + !elem.getClientRects().length ) : + filterHidden( elem ); +}; - // This transport only deals with cross domain requests - if ( s.crossDomain ) { +jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); +}; - var script, - head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; - return { - send: function( _, callback ) { - script = document.createElement( "script" ); +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; - script.async = "async"; +function buildParams( prefix, obj, traditional, add ) { + var name; - if ( s.scriptCharset ) { - script.charset = s.scriptCharset; - } + if ( jQuery.isArray( obj ) ) { - script.src = s.url; + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { - // Attach handlers for all browsers - script.onload = script.onreadystatechange = function( _, isAbort ) { + // Treat each array item as a scalar. + add( prefix, v ); - if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + } else { - // Handle memory leak in IE - script.onload = script.onreadystatechange = null; + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); - // Remove the script - if ( head && script.parentNode ) { - head.removeChild( script ); - } + } else if ( !traditional && jQuery.type( obj ) === "object" ) { - // Dereference the script - script = undefined; + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } - // Callback if not abort - if ( !isAbort ) { - callback( 200, "success" ); - } - } - }; - // Use insertBefore instead of appendChild to circumvent an IE6 bug. - // This arises when a base node is used (#2709 and #4378). - head.insertBefore( script, head.firstChild ); - }, + } else { - abort: function() { - if ( script ) { - script.onload( 0, 1 ); - } - } + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, value ) { + + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value ); + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; } -}); + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + } else { -var // #5280: Internet Explorer will keep connections alive if we don't abort on unload - xhrOnUnloadAbort = window.ActiveXObject ? function() { - // Abort all pending requests - for ( var key in xhrCallbacks ) { - xhrCallbacks[ key ]( 0, 1 ); + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); } - } : false, - xhrId = 0, - xhrCallbacks; + } -// Functions to create xhrs -function createStandardXHR() { - try { - return new window.XMLHttpRequest(); - } catch( e ) {} -} + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ) + .filter( function() { + var type = this.type; + + // Use .is(":disabled") so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ) + .map( function( i, elem ) { + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); -function createActiveXHR() { - try { - return new window.ActiveXObject( "Microsoft.XMLHTTP" ); - } catch( e ) {} -} // Create the request object // (This is still attached to ajaxSettings for backward compatibility) -jQuery.ajaxSettings.xhr = window.ActiveXObject ? - /* Microsoft failed to properly - * implement the XMLHttpRequest in IE7 (can't request local files), - * so we use the ActiveXObject when it is available - * Additionally XMLHttpRequest can be disabled in IE7/IE8 so - * we need a fallback. - */ +jQuery.ajaxSettings.xhr = window.ActiveXObject !== undefined ? + + // Support: IE6-IE8 function() { - return !this.isLocal && createStandardXHR() || createActiveXHR(); + + // XHR cannot access local files, always use ActiveX for that case + if ( this.isLocal ) { + return createActiveXHR(); + } + + // Support: IE 9-11 + // IE seems to error on cross-domain PATCH requests when ActiveX XHR + // is used. In IE 9+ always use the native XHR. + // Note: this condition won't catch Edge as it doesn't define + // document.documentMode but it also doesn't support ActiveX so it won't + // reach this code. + if ( document.documentMode > 8 ) { + return createStandardXHR(); + } + + // Support: IE<9 + // oldIE XHR does not support non-RFC2616 methods (#13240) + // See http://msdn.microsoft.com/en-us/library/ie/ms536648(v=vs.85).aspx + // and http://www.w3.org/Protocols/rfc2616/rfc2616-sec9.html#sec9 + // Although this check for six methods instead of eight + // since IE also does not support "trace" and "connect" + return /^(get|post|head|put|delete|options)$/i.test( this.type ) && + createStandardXHR() || createActiveXHR(); } : + // For all other browsers, use the standard XMLHttpRequest object createStandardXHR; +var xhrId = 0, + xhrCallbacks = {}, + xhrSupported = jQuery.ajaxSettings.xhr(); + +// Support: IE<10 +// Open requests must be manually aborted on unload (#5280) +// See https://support.microsoft.com/kb/2856746 for more info +if ( window.attachEvent ) { + window.attachEvent( "onunload", function() { + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( undefined, true ); + } + } ); +} + // Determine support properties -(function( xhr ) { - jQuery.extend( jQuery.support, { - ajax: !!xhr, - cors: !!xhr && ( "withCredentials" in xhr ) - }); -})( jQuery.ajaxSettings.xhr() ); +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +xhrSupported = support.ajax = !!xhrSupported; // Create transport if the browser can provide an xhr -if ( jQuery.support.ajax ) { +if ( xhrSupported ) { + + jQuery.ajaxTransport( function( options ) { - jQuery.ajaxTransport(function( s ) { // Cross domain only allowed if supported through XMLHttpRequest - if ( !s.crossDomain || jQuery.support.cors ) { + if ( !options.crossDomain || support.cors ) { var callback; return { send: function( headers, complete ) { - - // Get a new xhr - var xhr = s.xhr(), - handle, - i; + var i, + xhr = options.xhr(), + id = ++xhrId; // Open the socket - // Passing null username, generates a login popup on Opera (#2865) - if ( s.username ) { - xhr.open( s.type, s.url, s.async, s.username, s.password ); - } else { - xhr.open( s.type, s.url, s.async ); - } + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); // Apply custom fields if provided - if ( s.xhrFields ) { - for ( i in s.xhrFields ) { - xhr[ i ] = s.xhrFields[ i ]; + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; } } // Override mime type if needed - if ( s.mimeType && xhr.overrideMimeType ) { - xhr.overrideMimeType( s.mimeType ); + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); } // X-Requested-With header @@ -8223,977 +10233,483 @@ if ( jQuery.support.ajax ) { // akin to a jigsaw puzzle, we simply never set it to be sure. // (it can always be set on a per-request basis or even using ajaxSetup) // For same-domain requests, won't change header if already provided. - if ( !s.crossDomain && !headers["X-Requested-With"] ) { + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { headers[ "X-Requested-With" ] = "XMLHttpRequest"; } - // Need an extra try/catch for cross domain requests in Firefox 3 - try { - for ( i in headers ) { - xhr.setRequestHeader( i, headers[ i ] ); + // Set headers + for ( i in headers ) { + + // Support: IE<9 + // IE's ActiveXObject throws a 'Type Mismatch' exception when setting + // request header to a null-value. + // + // To keep consistent with other XHR implementations, cast the value + // to string and ignore `undefined`. + if ( headers[ i ] !== undefined ) { + xhr.setRequestHeader( i, headers[ i ] + "" ); } - } catch( _ ) {} + } // Do send the request // This may raise an exception which is actually // handled in jQuery.ajax (so no try/catch here) - xhr.send( ( s.hasContent && s.data ) || null ); + xhr.send( ( options.hasContent && options.data ) || null ); // Listener callback = function( _, isAbort ) { + var status, statusText, responses; - var status, - statusText, - responseHeaders, - responses, - xml; - - // Firefox throws exceptions when accessing properties - // of an xhr when a network error occured - // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) - try { - - // Was never called and is aborted or complete - if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { - // Only called once - callback = undefined; + // Clean up + delete xhrCallbacks[ id ]; + callback = undefined; + xhr.onreadystatechange = jQuery.noop; - // Do not keep as active anymore - if ( handle ) { - xhr.onreadystatechange = jQuery.noop; - if ( xhrOnUnloadAbort ) { - delete xhrCallbacks[ handle ]; - } + // Abort manually if needed + if ( isAbort ) { + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + responses = {}; + status = xhr.status; + + // Support: IE<10 + // Accessing binary-data responseText throws an exception + // (#11426) + if ( typeof xhr.responseText === "string" ) { + responses.text = xhr.responseText; } - // If it's an abort - if ( isAbort ) { - // Abort it manually if needed - if ( xhr.readyState !== 4 ) { - xhr.abort(); - } - } else { - status = xhr.status; - responseHeaders = xhr.getAllResponseHeaders(); - responses = {}; - xml = xhr.responseXML; - - // Construct response list - if ( xml && xml.documentElement /* #4958 */ ) { - responses.xml = xml; - } + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch ( e ) { - // When requesting binary data, IE6-9 will throw an exception - // on any attempt to access responseText (#11426) - try { - responses.text = xhr.responseText; - } catch( _ ) { - } + // We normalize with Webkit giving an empty statusText + statusText = ""; + } - // Firefox throws an exception when accessing - // statusText for faulty cross-domain requests - try { - statusText = xhr.statusText; - } catch( e ) { - // We normalize with Webkit giving an empty statusText - statusText = ""; - } + // Filter status for non standard behaviors - // Filter status for non standard behaviors + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && options.isLocal && !options.crossDomain ) { + status = responses.text ? 200 : 404; - // If the request is local and we have data: assume a success - // (success with no data won't get notified, that's the best we - // can do given current implementations) - if ( !status && s.isLocal && !s.crossDomain ) { - status = responses.text ? 200 : 404; - // IE - #1450: sometimes returns 1223 when it should be 204 - } else if ( status === 1223 ) { - status = 204; - } + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; } } - } catch( firefoxAccessException ) { - if ( !isAbort ) { - complete( -1, firefoxAccessException ); - } } // Call complete if needed if ( responses ) { - complete( status, statusText, responses, responseHeaders ); + complete( status, statusText, responses, xhr.getAllResponseHeaders() ); } }; - // if we're in sync mode or it's in cache - // and has been retrieved directly (IE6 & IE7) - // we need to manually fire the callback - if ( !s.async || xhr.readyState === 4 ) { + // Do send the request + // `xhr.send` may raise an exception, but it will be + // handled in jQuery.ajax (so no try/catch here) + if ( !options.async ) { + + // If we're in sync mode we fire the callback callback(); + } else if ( xhr.readyState === 4 ) { + + // (IE6 & IE7) if it's in cache and has been + // retrieved directly we need to fire the callback + window.setTimeout( callback ); } else { - handle = ++xhrId; - if ( xhrOnUnloadAbort ) { - // Create the active xhrs callbacks list if needed - // and attach the unload handler - if ( !xhrCallbacks ) { - xhrCallbacks = {}; - jQuery( window ).unload( xhrOnUnloadAbort ); - } - // Add to list of active xhrs callbacks - xhrCallbacks[ handle ] = callback; - } - xhr.onreadystatechange = callback; + + // Register the callback, but delay it in case `xhr.send` throws + // Add to the list of active xhr callbacks + xhr.onreadystatechange = xhrCallbacks[ id ] = callback; } }, abort: function() { if ( callback ) { - callback(0,1); + callback( undefined, true ); } } }; } - }); + } ); } +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +} +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch ( e ) {} +} -var elemdisplay = {}, - iframe, iframeDoc, - rfxtypes = /^(?:toggle|show|hide)$/, - rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, - timerId, - fxAttrs = [ - // height animations - [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], - // width animations - [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], - // opacity animations - [ "opacity" ] - ], - fxNow; - -jQuery.fn.extend({ - show: function( speed, easing, callback ) { - var elem, display; - - if ( speed || speed === 0 ) { - return this.animate( genFx("show", 3), speed, easing, callback ); - - } else { - for ( var i = 0, j = this.length; i < j; i++ ) { - elem = this[ i ]; - - if ( elem.style ) { - display = elem.style.display; - - // Reset the inline display of this element to learn if it is - // being hidden by cascaded rules or not - if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { - display = elem.style.display = ""; - } - - // Set elements which have been overridden with display: none - // in a stylesheet to whatever the default browser style is - // for such an element - if ( (display === "" && jQuery.css(elem, "display") === "none") || - !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { - jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) ); - } - } - } - - // Set the display of most of the elements in a second loop - // to avoid the constant reflow - for ( i = 0; i < j; i++ ) { - elem = this[ i ]; - - if ( elem.style ) { - display = elem.style.display; - - if ( display === "" || display === "none" ) { - elem.style.display = jQuery._data( elem, "olddisplay" ) || ""; - } - } - } - - return this; - } - }, - - hide: function( speed, easing, callback ) { - if ( speed || speed === 0 ) { - return this.animate( genFx("hide", 3), speed, easing, callback); - - } else { - var elem, display, - i = 0, - j = this.length; - - for ( ; i < j; i++ ) { - elem = this[i]; - if ( elem.style ) { - display = jQuery.css( elem, "display" ); - - if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) { - jQuery._data( elem, "olddisplay", display ); - } - } - } - - // Set the display of the elements in a second loop - // to avoid the constant reflow - for ( i = 0; i < j; i++ ) { - if ( this[i].style ) { - this[i].style.display = "none"; - } - } - - return this; - } - }, - - // Save the old toggle function - _toggle: jQuery.fn.toggle, - - toggle: function( fn, fn2, callback ) { - var bool = typeof fn === "boolean"; - - if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { - this._toggle.apply( this, arguments ); - - } else if ( fn == null || bool ) { - this.each(function() { - var state = bool ? fn : jQuery(this).is(":hidden"); - jQuery(this)[ state ? "show" : "hide" ](); - }); - - } else { - this.animate(genFx("toggle", 3), fn, fn2, callback); - } - return this; - }, - fadeTo: function( speed, to, easing, callback ) { - return this.filter(":hidden").css("opacity", 0).show().end() - .animate({opacity: to}, speed, easing, callback); +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" }, - - animate: function( prop, speed, easing, callback ) { - var optall = jQuery.speed( speed, easing, callback ); - - if ( jQuery.isEmptyObject( prop ) ) { - return this.each( optall.complete, [ false ] ); - } - - // Do not change referenced properties as per-property easing will be lost - prop = jQuery.extend( {}, prop ); - - function doAnimation() { - // XXX 'this' does not always have a nodeName when running the - // test suite - - if ( optall.queue === false ) { - jQuery._mark( this ); - } - - var opt = jQuery.extend( {}, optall ), - isElement = this.nodeType === 1, - hidden = isElement && jQuery(this).is(":hidden"), - name, val, p, e, hooks, replace, - parts, start, end, unit, - method; - - // will store per property easing and be used to determine when an animation is complete - opt.animatedProperties = {}; - - // first pass over propertys to expand / normalize - for ( p in prop ) { - name = jQuery.camelCase( p ); - if ( p !== name ) { - prop[ name ] = prop[ p ]; - delete prop[ p ]; - } - - if ( ( hooks = jQuery.cssHooks[ name ] ) && "expand" in hooks ) { - replace = hooks.expand( prop[ name ] ); - delete prop[ name ]; - - // not quite $.extend, this wont overwrite keys already present. - // also - reusing 'p' from above because we have the correct "name" - for ( p in replace ) { - if ( ! ( p in prop ) ) { - prop[ p ] = replace[ p ]; - } - } - } - } - - for ( name in prop ) { - val = prop[ name ]; - // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) - if ( jQuery.isArray( val ) ) { - opt.animatedProperties[ name ] = val[ 1 ]; - val = prop[ name ] = val[ 0 ]; - } else { - opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; - } - - if ( val === "hide" && hidden || val === "show" && !hidden ) { - return opt.complete.call( this ); - } - - if ( isElement && ( name === "height" || name === "width" ) ) { - // Make sure that nothing sneaks out - // Record all 3 overflow attributes because IE does not - // change the overflow attribute when overflowX and - // overflowY are set to the same value - opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; - - // Set display property to inline-block for height/width - // animations on inline elements that are having width/height animated - if ( jQuery.css( this, "display" ) === "inline" && - jQuery.css( this, "float" ) === "none" ) { - - // inline-level elements accept inline-block; - // block-level elements need to be inline with layout - if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) { - this.style.display = "inline-block"; - - } else { - this.style.zoom = 1; - } - } - } - } - - if ( opt.overflow != null ) { - this.style.overflow = "hidden"; - } - - for ( p in prop ) { - e = new jQuery.fx( this, opt, p ); - val = prop[ p ]; - - if ( rfxtypes.test( val ) ) { - - // Tracks whether to show or hide based on private - // data attached to the element - method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 ); - if ( method ) { - jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" ); - e[ method ](); - } else { - e[ val ](); - } - - } else { - parts = rfxnum.exec( val ); - start = e.cur(); - - if ( parts ) { - end = parseFloat( parts[2] ); - unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); - - // We need to compute starting value - if ( unit !== "px" ) { - jQuery.style( this, p, (end || 1) + unit); - start = ( (end || 1) / e.cur() ) * start; - jQuery.style( this, p, start + unit); - } - - // If a +=/-= token was provided, we're doing a relative animation - if ( parts[1] ) { - end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; - } - - e.custom( start, end, unit ); - - } else { - e.custom( start, val, "" ); - } - } - } - - // For JS strict compliance - return true; - } - - return optall.queue === false ? - this.each( doAnimation ) : - this.queue( optall.queue, doAnimation ); + contents: { + script: /\b(?:java|ecma)script\b/ }, - - stop: function( type, clearQueue, gotoEnd ) { - if ( typeof type !== "string" ) { - gotoEnd = clearQueue; - clearQueue = type; - type = undefined; - } - if ( clearQueue && type !== false ) { - this.queue( type || "fx", [] ); + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; } - - return this.each(function() { - var index, - hadTimers = false, - timers = jQuery.timers, - data = jQuery._data( this ); - - // clear marker counters if we know they won't be - if ( !gotoEnd ) { - jQuery._unmark( true, this ); - } - - function stopQueue( elem, data, index ) { - var hooks = data[ index ]; - jQuery.removeData( elem, index, true ); - hooks.stop( gotoEnd ); - } - - if ( type == null ) { - for ( index in data ) { - if ( data[ index ] && data[ index ].stop && index.indexOf(".run") === index.length - 4 ) { - stopQueue( this, data, index ); - } - } - } else if ( data[ index = type + ".run" ] && data[ index ].stop ){ - stopQueue( this, data, index ); - } - - for ( index = timers.length; index--; ) { - if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { - if ( gotoEnd ) { - - // force the next step to be the last - timers[ index ]( true ); - } else { - timers[ index ].saveState(); - } - hadTimers = true; - timers.splice( index, 1 ); - } - } - - // start the next in the queue if the last step wasn't forced - // timers currently will call their complete callbacks, which will dequeue - // but only if they were gotoEnd - if ( !( gotoEnd && hadTimers ) ) { - jQuery.dequeue( this, type ); - } - }); } +} ); -}); - -// Animations created synchronously will run synchronously -function createFxNow() { - setTimeout( clearFxNow, 0 ); - return ( fxNow = jQuery.now() ); -} - -function clearFxNow() { - fxNow = undefined; -} - -// Generate parameters to create a standard animation -function genFx( type, num ) { - var obj = {}; - - jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() { - obj[ this ] = type; - }); - - return obj; -} - -// Generate shortcuts for custom animations -jQuery.each({ - slideDown: genFx( "show", 1 ), - slideUp: genFx( "hide", 1 ), - slideToggle: genFx( "toggle", 1 ), - fadeIn: { opacity: "show" }, - fadeOut: { opacity: "hide" }, - fadeToggle: { opacity: "toggle" } -}, function( name, props ) { - jQuery.fn[ name ] = function( speed, easing, callback ) { - return this.animate( props, speed, easing, callback ); - }; -}); - -jQuery.extend({ - speed: function( speed, easing, fn ) { - var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { - complete: fn || !fn && easing || - jQuery.isFunction( speed ) && speed, - duration: speed, - easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing - }; - - opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : - opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; - - // normalize opt.queue - true/undefined/null -> "fx" - if ( opt.queue == null || opt.queue === true ) { - opt.queue = "fx"; - } - - // Queueing - opt.old = opt.complete; +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +} ); - opt.complete = function( noUnmark ) { - if ( jQuery.isFunction( opt.old ) ) { - opt.old.call( this ); - } +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { - if ( opt.queue ) { - jQuery.dequeue( this, opt.queue ); - } else if ( noUnmark !== false ) { - jQuery._unmark( this ); - } - }; + // This transport only deals with cross domain requests + if ( s.crossDomain ) { - return opt; - }, + var script, + head = document.head || jQuery( "head" )[ 0 ] || document.documentElement; - easing: { - linear: function( p ) { - return p; - }, - swing: function( p ) { - return ( -Math.cos( p*Math.PI ) / 2 ) + 0.5; - } - }, + return { - timers: [], + send: function( _, callback ) { - fx: function( elem, options, prop ) { - this.options = options; - this.elem = elem; - this.prop = prop; + script = document.createElement( "script" ); - options.orig = options.orig || {}; - } + script.async = true; -}); + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } -jQuery.fx.prototype = { - // Simple function for setting a style value - update: function() { - if ( this.options.step ) { - this.options.step.call( this.elem, this.now, this ); - } + script.src = s.url; - ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this ); - }, + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { - // Get the current size - cur: function() { - if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) { - return this.elem[ this.prop ]; - } + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { - var parsed, - r = jQuery.css( this.elem, this.prop ); - // Empty strings, null, undefined and "auto" are converted to 0, - // complex values such as "rotate(1rad)" are returned as is, - // simple values such as "10px" are parsed to Float. - return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; - }, + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; - // Start an animation from one number to another - custom: function( from, to, unit ) { - var self = this, - fx = jQuery.fx; + // Remove the script + if ( script.parentNode ) { + script.parentNode.removeChild( script ); + } - this.startTime = fxNow || createFxNow(); - this.end = to; - this.now = this.start = from; - this.pos = this.state = 0; - this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + // Dereference the script + script = null; - function t( gotoEnd ) { - return self.step( gotoEnd ); - } + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + + // Circumvent IE6 bugs with base elements (#2709 and #4378) by prepending + // Use native DOM manipulation to avoid our domManip AJAX trickery + head.insertBefore( script, head.firstChild ); + }, - t.queue = this.options.queue; - t.elem = this.elem; - t.saveState = function() { - if ( jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) { - if ( self.options.hide ) { - jQuery._data( self.elem, "fxshow" + self.prop, self.start ); - } else if ( self.options.show ) { - jQuery._data( self.elem, "fxshow" + self.prop, self.end ); + abort: function() { + if ( script ) { + script.onload( undefined, true ); } } }; + } +} ); - if ( t() && jQuery.timers.push(t) && !timerId ) { - timerId = setInterval( fx.tick, fx.interval ); - } - }, - // Simple 'show' function - show: function() { - var dataShow = jQuery._data( this.elem, "fxshow" + this.prop ); - // Remember where we started, so that we can go back to it later - this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop ); - this.options.show = true; - // Begin the animation - // Make sure that we start at a small width/height to avoid any flash of content - if ( dataShow !== undefined ) { - // This show is picking up where a previous hide or show left off - this.custom( this.cur(), dataShow ); - } else { - this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() ); - } +var oldCallbacks = [], + rjsonp = /(=)\?(?=&|$)|\?\?/; - // Start by showing the element - jQuery( this.elem ).show(); - }, +// Default jsonp settings +jQuery.ajaxSetup( { + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +} ); - // Simple 'hide' function - hide: function() { - // Remember where we started, so that we can go back to it later - this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop ); - this.options.hide = true; +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { - // Begin the animation - this.custom( this.cur(), 0 ); - }, + var callbackName, overwritten, responseContainer, + jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ? + "url" : + typeof s.data === "string" && + ( s.contentType || "" ) + .indexOf( "application/x-www-form-urlencoded" ) === 0 && + rjsonp.test( s.data ) && "data" + ); - // Each step of an animation - step: function( gotoEnd ) { - var p, n, complete, - t = fxNow || createFxNow(), - done = true, - elem = this.elem, - options = this.options; + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) { - if ( gotoEnd || t >= options.duration + this.startTime ) { - this.now = this.end; - this.pos = this.state = 1; - this.update(); + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; - options.animatedProperties[ this.prop ] = true; + // Insert callback into url or form data + if ( jsonProp ) { + s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName ); + } else if ( s.jsonp !== false ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } - for ( p in options.animatedProperties ) { - if ( options.animatedProperties[ p ] !== true ) { - done = false; - } + // Use data converter to retrieve json after script execution + s.converters[ "script json" ] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); } + return responseContainer[ 0 ]; + }; - if ( done ) { - // Reset the overflow - if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { - - jQuery.each( [ "", "X", "Y" ], function( index, value ) { - elem.style[ "overflow" + value ] = options.overflow[ index ]; - }); - } - - // Hide the element if the "hide" operation was done - if ( options.hide ) { - jQuery( elem ).hide(); - } + // force json dataType + s.dataTypes[ 0 ] = "json"; - // Reset the properties, if the item has been hidden or shown - if ( options.hide || options.show ) { - for ( p in options.animatedProperties ) { - jQuery.style( elem, p, options.orig[ p ] ); - jQuery.removeData( elem, "fxshow" + p, true ); - // Toggle data is no longer needed - jQuery.removeData( elem, "toggle" + p, true ); - } - } + // Install callback + overwritten = window[ callbackName ]; + window[ callbackName ] = function() { + responseContainer = arguments; + }; - // Execute the complete function - // in the event that the complete function throws an exception - // we must ensure it won't be called twice. #5684 + // Clean-up function (fires after converters) + jqXHR.always( function() { - complete = options.complete; - if ( complete ) { + // If previous value didn't exist - remove it + if ( overwritten === undefined ) { + jQuery( window ).removeProp( callbackName ); - options.complete = false; - complete.call( elem ); - } + // Otherwise restore preexisting value + } else { + window[ callbackName ] = overwritten; } - return false; + // Save back as free + if ( s[ callbackName ] ) { - } else { - // classical easing cannot be used with an Infinity duration - if ( options.duration == Infinity ) { - this.now = t; - } else { - n = t - this.startTime; - this.state = n / options.duration; + // make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; - // Perform the easing function, defaults to swing - this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration ); - this.now = this.start + ( (this.end - this.start) * this.pos ); + // save the callback name for future use + oldCallbacks.push( callbackName ); } - // Perform the next step of the animation - this.update(); - } - - return true; - } -}; - -jQuery.extend( jQuery.fx, { - tick: function() { - var timer, - timers = jQuery.timers, - i = 0; - for ( ; i < timers.length; i++ ) { - timer = timers[ i ]; - // Checks the timer has not already been removed - if ( !timer() && timers[ i ] === timer ) { - timers.splice( i--, 1 ); + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); } - } - if ( !timers.length ) { - jQuery.fx.stop(); - } - }, + responseContainer = overwritten = undefined; + } ); - interval: 13, + // Delegate to script + return "script"; + } +} ); - stop: function() { - clearInterval( timerId ); - timerId = null; - }, - speeds: { - slow: 600, - fast: 200, - // Default speed - _default: 400 - }, - step: { - opacity: function( fx ) { - jQuery.style( fx.elem, "opacity", fx.now ); - }, - _default: function( fx ) { - if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { - fx.elem.style[ fx.prop ] = fx.now + fx.unit; - } else { - fx.elem[ fx.prop ] = fx.now; - } - } +// data: string of html +// context (optional): If specified, the fragment will be created in this context, +// defaults to document +// keepScripts (optional): If true, will include scripts passed in the html string +jQuery.parseHTML = function( data, context, keepScripts ) { + if ( !data || typeof data !== "string" ) { + return null; } -}); - -// Ensure props that can't be negative don't go there on undershoot easing -jQuery.each( fxAttrs.concat.apply( [], fxAttrs ), function( i, prop ) { - // exclude marginTop, marginLeft, marginBottom and marginRight from this list - if ( prop.indexOf( "margin" ) ) { - jQuery.fx.step[ prop ] = function( fx ) { - jQuery.style( fx.elem, prop, Math.max(0, fx.now) + fx.unit ); - }; + if ( typeof context === "boolean" ) { + keepScripts = context; + context = false; } -}); - -if ( jQuery.expr && jQuery.expr.filters ) { - jQuery.expr.filters.animated = function( elem ) { - return jQuery.grep(jQuery.timers, function( fn ) { - return elem === fn.elem; - }).length; - }; -} - -// Try to restore the default display value of an element -function defaultDisplay( nodeName ) { - - if ( !elemdisplay[ nodeName ] ) { + context = context || document; - var body = document.body, - elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), - display = elem.css( "display" ); - elem.remove(); + var parsed = rsingleTag.exec( data ), + scripts = !keepScripts && []; - // If the simple way fails, - // get element's real default display by attaching it to a temp iframe - if ( display === "none" || display === "" ) { - // No iframe to use yet, so create it - if ( !iframe ) { - iframe = document.createElement( "iframe" ); - iframe.frameBorder = iframe.width = iframe.height = 0; - } + // Single tag + if ( parsed ) { + return [ context.createElement( parsed[ 1 ] ) ]; + } - body.appendChild( iframe ); + parsed = buildFragment( [ data ], context, scripts ); - // Create a cacheable copy of the iframe document on first call. - // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML - // document to it; WebKit & Firefox won't allow reusing the iframe document. - if ( !iframeDoc || !iframe.createElement ) { - iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; - iframeDoc.write( ( jQuery.support.boxModel ? "<!doctype html>" : "" ) + "<html><body>" ); - iframeDoc.close(); - } + if ( scripts && scripts.length ) { + jQuery( scripts ).remove(); + } - elem = iframeDoc.createElement( nodeName ); + return jQuery.merge( [], parsed.childNodes ); +}; - iframeDoc.body.appendChild( elem ); - display = jQuery.css( elem, "display" ); - body.removeChild( iframe ); - } +// Keep a copy of the old load method +var _load = jQuery.fn.load; - // Store the correct default display - elemdisplay[ nodeName ] = display; +/** + * Load a url into a page + */ +jQuery.fn.load = function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); } - return elemdisplay[ nodeName ]; -} - - + var selector, type, response, + self = this, + off = url.indexOf( " " ); + if ( off > -1 ) { + selector = jQuery.trim( url.slice( off, url.length ) ); + url = url.slice( 0, off ); + } -var getOffset, - rtable = /^t(?:able|d|h)$/i, - rroot = /^(?:body|html)$/i; + // If it's a function + if ( jQuery.isFunction( params ) ) { -if ( "getBoundingClientRect" in document.documentElement ) { - getOffset = function( elem, doc, docElem, box ) { - try { - box = elem.getBoundingClientRect(); - } catch(e) {} + // We assume that it's the callback + callback = params; + params = undefined; - // Make sure we're not dealing with a disconnected DOM node - if ( !box || !jQuery.contains( docElem, elem ) ) { - return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; - } + // Otherwise, build a param string + } else if ( params && typeof params === "object" ) { + type = "POST"; + } - var body = doc.body, - win = getWindow( doc ), - clientTop = docElem.clientTop || body.clientTop || 0, - clientLeft = docElem.clientLeft || body.clientLeft || 0, - scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, - scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, - top = box.top + scrollTop - clientTop, - left = box.left + scrollLeft - clientLeft; + // If we have elements to modify, make the request + if ( self.length > 0 ) { + jQuery.ajax( { + url: url, - return { top: top, left: left }; - }; + // If "type" variable is undefined, then "GET" method will be used. + // Make value of this field explicit since + // user can override it through ajaxSetup method + type: type || "GET", + dataType: "html", + data: params + } ).done( function( responseText ) { -} else { - getOffset = function( elem, doc, docElem ) { - var computedStyle, - offsetParent = elem.offsetParent, - prevOffsetParent = elem, - body = doc.body, - defaultView = doc.defaultView, - prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, - top = elem.offsetTop, - left = elem.offsetLeft; - - while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { - if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { - break; - } + // Save response for use in complete callback + response = arguments; - computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; - top -= elem.scrollTop; - left -= elem.scrollLeft; + self.html( selector ? - if ( elem === offsetParent ) { - top += elem.offsetTop; - left += elem.offsetLeft; + // If a selector was specified, locate the right elements in a dummy div + // Exclude scripts to avoid IE 'Permission Denied' errors + jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) : - if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { - top += parseFloat( computedStyle.borderTopWidth ) || 0; - left += parseFloat( computedStyle.borderLeftWidth ) || 0; - } + // Otherwise use the full result + responseText ); - prevOffsetParent = offsetParent; - offsetParent = elem.offsetParent; - } + // If the request succeeds, this function gets "data", "status", "jqXHR" + // but they are ignored because response was set above. + // If it fails, this function gets "jqXHR", "status", "error" + } ).always( callback && function( jqXHR, status ) { + self.each( function() { + callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] ); + } ); + } ); + } - if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { - top += parseFloat( computedStyle.borderTopWidth ) || 0; - left += parseFloat( computedStyle.borderLeftWidth ) || 0; - } + return this; +}; - prevComputedStyle = computedStyle; - } - if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { - top += body.offsetTop; - left += body.offsetLeft; - } - if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { - top += Math.max( docElem.scrollTop, body.scrollTop ); - left += Math.max( docElem.scrollLeft, body.scrollLeft ); - } - return { top: top, left: left }; +// Attach a bunch of functions for handling common AJAX events +jQuery.each( [ + "ajaxStart", + "ajaxStop", + "ajaxComplete", + "ajaxError", + "ajaxSuccess", + "ajaxSend" +], function( i, type ) { + jQuery.fn[ type ] = function( fn ) { + return this.on( type, fn ); }; -} - -jQuery.fn.offset = function( options ) { - if ( arguments.length ) { - return options === undefined ? - this : - this.each(function( i ) { - jQuery.offset.setOffset( this, options, i ); - }); - } +} ); - var elem = this[0], - doc = elem && elem.ownerDocument; - if ( !doc ) { - return null; - } - if ( elem === doc.body ) { - return jQuery.offset.bodyOffset( elem ); - } - return getOffset( elem, doc, doc.documentElement ); +jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep( jQuery.timers, function( fn ) { + return elem === fn.elem; + } ).length; }; -jQuery.offset = { - bodyOffset: function( body ) { - var top = body.offsetTop, - left = body.offsetLeft; - if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { - top += parseFloat( jQuery.css(body, "marginTop") ) || 0; - left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; - } - return { top: top, left: left }; - }, +/** + * Gets a window from an element + */ +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + +jQuery.offset = { setOffset: function( elem, options, i ) { - var position = jQuery.css( elem, "position" ); + var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, + position = jQuery.css( elem, "position" ), + curElem = jQuery( elem ), + props = {}; // set position first, in-case top/left are set even on static elem if ( position === "static" ) { elem.style.position = "relative"; } - var curElem = jQuery( elem ), - curOffset = curElem.offset(), - curCSSTop = jQuery.css( elem, "top" ), - curCSSLeft = jQuery.css( elem, "left" ), - calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, - props = {}, curPosition = {}, curTop, curLeft; + curOffset = curElem.offset(); + curCSSTop = jQuery.css( elem, "top" ); + curCSSLeft = jQuery.css( elem, "left" ); + calculatePosition = ( position === "absolute" || position === "fixed" ) && + jQuery.inArray( "auto", [ curCSSTop, curCSSLeft ] ) > -1; - // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + // need to be able to calculate position if either top or left + // is auto and position is either absolute or fixed if ( calculatePosition ) { curPosition = curElem.position(); curTop = curPosition.top; @@ -9204,7 +10720,9 @@ jQuery.offset = { } if ( jQuery.isFunction( options ) ) { - options = options.call( elem, i, curOffset ); + + // Use jQuery.extend here to allow modification of coordinates argument (gh-1848) + options = options.call( elem, i, jQuery.extend( {}, curOffset ) ); } if ( options.top != null ) { @@ -9222,71 +10740,115 @@ jQuery.offset = { } }; +jQuery.fn.extend( { + offset: function( options ) { + if ( arguments.length ) { + return options === undefined ? + this : + this.each( function( i ) { + jQuery.offset.setOffset( this, options, i ); + } ); + } + + var docElem, win, + box = { top: 0, left: 0 }, + elem = this[ 0 ], + doc = elem && elem.ownerDocument; + + if ( !doc ) { + return; + } + + docElem = doc.documentElement; + + // Make sure it's not a disconnected DOM node + if ( !jQuery.contains( docElem, elem ) ) { + return box; + } -jQuery.fn.extend({ + // If we don't have gBCR, just use 0,0 rather than error + // BlackBerry 5, iOS 3 (original iPhone) + if ( typeof elem.getBoundingClientRect !== "undefined" ) { + box = elem.getBoundingClientRect(); + } + win = getWindow( doc ); + return { + top: box.top + ( win.pageYOffset || docElem.scrollTop ) - ( docElem.clientTop || 0 ), + left: box.left + ( win.pageXOffset || docElem.scrollLeft ) - ( docElem.clientLeft || 0 ) + }; + }, position: function() { - if ( !this[0] ) { - return null; + if ( !this[ 0 ] ) { + return; } - var elem = this[0], + var offsetParent, offset, + parentOffset = { top: 0, left: 0 }, + elem = this[ 0 ]; - // Get *real* offsetParent - offsetParent = this.offsetParent(), + // Fixed elements are offset from window (parentOffset = {top:0, left: 0}, + // because it is its only offset parent + if ( jQuery.css( elem, "position" ) === "fixed" ) { - // Get correct offsets - offset = this.offset(), - parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + // we assume that getBoundingClientRect is available when computed position is fixed + offset = elem.getBoundingClientRect(); + } else { - // Subtract element margins - // note: when an element has margin: auto the offsetLeft and marginLeft - // are the same in Safari causing offset.left to incorrectly be 0 - offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; - offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + // Get *real* offsetParent + offsetParent = this.offsetParent(); + + // Get correct offsets + offset = this.offset(); + if ( !jQuery.nodeName( offsetParent[ 0 ], "html" ) ) { + parentOffset = offsetParent.offset(); + } - // Add offsetParent borders - parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; - parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + // Add offsetParent borders + parentOffset.top += jQuery.css( offsetParent[ 0 ], "borderTopWidth", true ); + parentOffset.left += jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true ); + } - // Subtract the two offsets + // Subtract parent offsets and element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 return { - top: offset.top - parentOffset.top, - left: offset.left - parentOffset.left + top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ), + left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true ) }; }, offsetParent: function() { - return this.map(function() { - var offsetParent = this.offsetParent || document.body; - while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + return this.map( function() { + var offsetParent = this.offsetParent; + + while ( offsetParent && ( !jQuery.nodeName( offsetParent, "html" ) && + jQuery.css( offsetParent, "position" ) === "static" ) ) { offsetParent = offsetParent.offsetParent; } - return offsetParent; - }); + return offsetParent || documentElement; + } ); } -}); - +} ); // Create scrollLeft and scrollTop methods -jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { +jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) { var top = /Y/.test( prop ); jQuery.fn[ method ] = function( val ) { - return jQuery.access( this, function( elem, method, val ) { + return access( this, function( elem, method, val ) { var win = getWindow( elem ); if ( val === undefined ) { - return win ? (prop in win) ? win[ prop ] : - jQuery.support.boxModel && win.document.documentElement[ method ] || - win.document.body[ method ] : + return win ? ( prop in win ) ? win[ prop ] : + win.document.documentElement[ method ] : elem[ method ]; } if ( win ) { win.scrollTo( !top ? val : jQuery( win ).scrollLeft(), - top ? val : jQuery( win ).scrollTop() + top ? val : jQuery( win ).scrollTop() ); } else { @@ -9294,111 +10856,156 @@ jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( me } }, method, val, arguments.length, null ); }; -}); +} ); + +// Support: Safari<7-8+, Chrome<37-44+ +// Add the top/left cssHooks using jQuery.fn.position +// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 +// getComputedStyle returns percent when specified for top/left/bottom/right +// rather than make the css module depend on the offset module, we just check for it here +jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition, + function( elem, computed ) { + if ( computed ) { + computed = curCSS( elem, prop ); -function getWindow( elem ) { - return jQuery.isWindow( elem ) ? - elem : - elem.nodeType === 9 ? - elem.defaultView || elem.parentWindow : - false; -} + // if curCSS returns percentage, fallback to offset + return rnumnonpx.test( computed ) ? + jQuery( elem ).position()[ prop ] + "px" : + computed; + } + } + ); +} ); +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, + function( defaultExtra, funcName ) { + // margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); -// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods -jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { - var clientProp = "client" + name, - scrollProp = "scroll" + name, - offsetProp = "offset" + name; - - // innerHeight and innerWidth - jQuery.fn[ "inner" + name ] = function() { - var elem = this[0]; - return elem ? - elem.style ? - parseFloat( jQuery.css( elem, type, "padding" ) ) : - this[ type ]() : - null; - }; + return access( this, function( elem, type, value ) { + var doc; - // outerHeight and outerWidth - jQuery.fn[ "outer" + name ] = function( margin ) { - var elem = this[0]; - return elem ? - elem.style ? - parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : - this[ type ]() : - null; - }; + if ( jQuery.isWindow( elem ) ) { - jQuery.fn[ type ] = function( value ) { - return jQuery.access( this, function( elem, type, value ) { - var doc, docElemProp, orig, ret; - - if ( jQuery.isWindow( elem ) ) { - // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat - doc = elem.document; - docElemProp = doc.documentElement[ clientProp ]; - return jQuery.support.boxModel && docElemProp || - doc.body && doc.body[ clientProp ] || docElemProp; - } - - // Get document width or height - if ( elem.nodeType === 9 ) { - // Either scroll[Width/Height] or offset[Width/Height], whichever is greater - doc = elem.documentElement; - - // when a window > document, IE6 reports a offset[Width/Height] > client[Width/Height] - // so we can't use max, as it'll choose the incorrect offset[Width/Height] - // instead we use the correct client[Width/Height] - // support:IE6 - if ( doc[ clientProp ] >= doc[ scrollProp ] ) { - return doc[ clientProp ]; + // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there + // isn't a whole lot we can do. See pull request at this URL for discussion: + // https://github.com/jquery/jquery/pull/764 + return elem.document.documentElement[ "client" + name ]; } - return Math.max( - elem.body[ scrollProp ], doc[ scrollProp ], - elem.body[ offsetProp ], doc[ offsetProp ] - ); - } + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; - // Get width or height on the element - if ( value === undefined ) { - orig = jQuery.css( elem, type ); - ret = parseFloat( orig ); - return jQuery.isNumeric( ret ) ? ret : orig; - } + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], + // whichever is greatest + // unfortunately, this causes bug #3838 in IE6/8 only, + // but there is currently no good, small way to fix it. + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } - // Set the width or height on the element - jQuery( elem ).css( type, value ); - }, type, value, arguments.length, null ); - }; -}); + return value === undefined ? + + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable, null ); + }; + } ); +} ); + + +jQuery.fn.extend( { + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? + this.off( selector, "**" ) : + this.off( types, selector || "**", fn ); + } +} ); + +// The number of elements contained in the matched element set +jQuery.fn.size = function() { + return this.length; +}; +jQuery.fn.andSelf = jQuery.fn.addBack; -// Expose jQuery to the global object -window.jQuery = window.$ = jQuery; -// Expose jQuery as an AMD module, but only for AMD loaders that -// understand the issues with loading multiple versions of jQuery -// in a page that all might call define(). The loader will indicate -// they have special allowances for multiple jQuery versions by -// specifying define.amd.jQuery = true. Register as a named module, -// since jQuery can be concatenated with other files that may use define, -// but not use a proper concatenation script that understands anonymous -// AMD modules. A named AMD is safest and most robust way to register. -// Lowercase jquery is used because AMD module names are derived from -// file names, and jQuery is normally delivered in a lowercase file name. -// Do this after creating the global so that if an AMD module wants to call -// noConflict to hide this version of jQuery, it will work. -if ( typeof define === "function" && define.amd && define.amd.jQuery ) { - define( "jquery", [], function () { return jQuery; } ); + +// Register as a named AMD module, since jQuery can be concatenated with other +// files that may use define, but not via a proper concatenation script that +// understands anonymous AMD modules. A named AMD is safest and most robust +// way to register. Lowercase jquery is used because AMD module names are +// derived from file names, and jQuery is normally delivered in a lowercase +// file name. Do this after creating the global so that if an AMD module wants +// to call noConflict to hide this version of jQuery, it will work. + +// Note that for maximum portability, libraries that are not jQuery should +// declare themselves as anonymous modules, and avoid setting a global if an +// AMD loader is present. jQuery is a special case. For more information, see +// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon + +if ( typeof define === "function" && define.amd ) { + define( "jquery", [], function() { + return jQuery; + } ); } -})( window ); +var + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$; + +jQuery.noConflict = function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; +}; + +// Expose jQuery and $ identifiers, even in +// AMD (#7102#comment:10, https://github.com/jquery/jquery/pull/557) +// and CommonJS for browser emulators (#13566) +if ( !noGlobal ) { + window.jQuery = window.$ = jQuery; +} + +return jQuery; +})); diff --git a/www/include/common/javascript/jquery/jquery.min.js b/www/include/common/javascript/jquery/jquery.min.js index 16ad06c5acaad09ee4d6e9d7c428506db028aeeb..b2e8ce258fcbdf88f1f712cf76cc70b3c8c93085 100644 --- a/www/include/common/javascript/jquery/jquery.min.js +++ b/www/include/common/javascript/jquery/jquery.min.js @@ -1,4 +1 @@ -/*! jQuery v1.7.2 jquery.com | jquery.org/license */ -(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cu(a){if(!cj[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),b.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write((f.support.boxModel?"<!doctype html>":"")+"<html><body>"),cl.close();d=cl.createElement(a),cl.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ck)}cj[a]=e}return cj[a]}function ct(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function cs(){cq=b}function cr(){setTimeout(cs,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bD.test(a)?d(a,e):b_(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&f.type(b)==="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function bZ(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bS,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bZ(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bZ(a,c,d,e,"*",g));return l}function bY(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bO),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bB(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?1:0,g=4;if(d>0){if(c!=="border")for(;e<g;e+=2)c||(d-=parseFloat(f.css(a,"padding"+bx[e]))||0),c==="margin"?d+=parseFloat(f.css(a,c+bx[e]))||0:d-=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0;return d+"px"}d=by(a,b);if(d<0||d==null)d=a.style[b];if(bt.test(d))return d;d=parseFloat(d)||0;if(c)for(;e<g;e+=2)d+=parseFloat(f.css(a,"padding"+bx[e]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+bx[e]))||0);return d+"px"}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;b.nodeType===1&&(b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase(),c==="object"?b.outerHTML=a.outerHTML:c!=="input"||a.type!=="checkbox"&&a.type!=="radio"?c==="option"?b.selected=a.defaultSelected:c==="input"||c==="textarea"?b.defaultValue=a.defaultValue:c==="script"&&b.text!==a.text&&(b.text=a.text):(a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value)),b.removeAttribute(f.expando),b.removeAttribute("_submit_attached"),b.removeAttribute("_change_attached"))}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c,i[c][d])}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?+d:j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){if(typeof c!="string"||!c)return null;var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h,i){var j,k=d==null,l=0,m=a.length;if(d&&typeof d=="object"){for(l in d)e.access(a,c,l,d[l],1,h,f);g=1}else if(f!==b){j=i===b&&e.isFunction(f),k&&(j?(j=c,c=function(a,b,c){return j.call(e(a),c)}):(c.call(a,f),c=null));if(c)for(;l<m;l++)c(a[l],d,j?f.call(a[l],l,c(a[l],d)):f,i);g=1}return g?a:k?c.call(a):m?c(a[0],d):h},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m,n=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?n(g):h==="function"&&(!a.unique||!p.has(g))&&c.push(g)},o=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,j=!0,m=k||0,k=0,l=c.length;for(;c&&m<l;m++)if(c[m].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}j=!1,c&&(a.once?e===!0?p.disable():c=[]:d&&d.length&&(e=d.shift(),p.fireWith(e[0],e[1])))},p={add:function(){if(c){var a=c.length;n(arguments),j?l=c.length:e&&e!==!0&&(k=a,o(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){j&&f<=l&&(l--,f<=m&&m--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&p.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(j?a.once||d.push([b,c]):(!a.once||!e)&&o(b,c));return this},fire:function(){p.fireWith(this,arguments);return this},fired:function(){return!!i}};return p};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p=c.createElement("div"),q=c.documentElement;p.setAttribute("className","t"),p.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=p.getElementsByTagName("*"),e=p.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=p.getElementsByTagName("input")[0],b={leadingWhitespace:p.firstChild.nodeType===3,tbody:!p.getElementsByTagName("tbody").length,htmlSerialize:!!p.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:p.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,pixelMargin:!0},f.boxModel=b.boxModel=c.compatMode==="CSS1Compat",i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete p.test}catch(r){b.deleteExpando=!1}!p.addEventListener&&p.attachEvent&&p.fireEvent&&(p.attachEvent("onclick",function(){b.noCloneEvent=!1}),p.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),i.setAttribute("name","t"),p.appendChild(i),j=c.createDocumentFragment(),j.appendChild(p.lastChild),b.checkClone=j.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,j.removeChild(i),j.appendChild(p);if(p.attachEvent)for(n in{submit:1,change:1,focusin:1})m="on"+n,o=m in p,o||(p.setAttribute(m,"return;"),o=typeof p[m]=="function"),b[n+"Bubbles"]=o;j.removeChild(p),j=g=h=p=i=null,f(function(){var d,e,g,h,i,j,l,m,n,q,r,s,t,u=c.getElementsByTagName("body")[0];!u||(m=1,t="padding:0;margin:0;border:",r="position:absolute;top:0;left:0;width:1px;height:1px;",s=t+"0;visibility:hidden;",n="style='"+r+t+"5px solid #000;",q="<div "+n+"display:block;'><div style='"+t+"0;display:block;overflow:hidden;'></div></div>"+"<table "+n+"' cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",d=c.createElement("div"),d.style.cssText=s+"width:0;height:0;position:static;top:0;margin-top:"+m+"px",u.insertBefore(d,u.firstChild),p=c.createElement("div"),d.appendChild(p),p.innerHTML="<table><tr><td style='"+t+"0;display:none'></td><td>t</td></tr></table>",k=p.getElementsByTagName("td"),o=k[0].offsetHeight===0,k[0].style.display="",k[1].style.display="none",b.reliableHiddenOffsets=o&&k[0].offsetHeight===0,a.getComputedStyle&&(p.innerHTML="",l=c.createElement("div"),l.style.width="0",l.style.marginRight="0",p.style.width="2px",p.appendChild(l),b.reliableMarginRight=(parseInt((a.getComputedStyle(l,null)||{marginRight:0}).marginRight,10)||0)===0),typeof p.style.zoom!="undefined"&&(p.innerHTML="",p.style.width=p.style.padding="1px",p.style.border=0,p.style.overflow="hidden",p.style.display="inline",p.style.zoom=1,b.inlineBlockNeedsLayout=p.offsetWidth===3,p.style.display="block",p.style.overflow="visible",p.innerHTML="<div style='width:5px;'></div>",b.shrinkWrapBlocks=p.offsetWidth!==3),p.style.cssText=r+s,p.innerHTML=q,e=p.firstChild,g=e.firstChild,i=e.nextSibling.firstChild.firstChild,j={doesNotAddBorder:g.offsetTop!==5,doesAddBorderForTableAndCells:i.offsetTop===5},g.style.position="fixed",g.style.top="20px",j.fixedPosition=g.offsetTop===20||g.offsetTop===15,g.style.position=g.style.top="",e.style.overflow="hidden",e.style.position="relative",j.subtractsBorderForOverflowNotVisible=g.offsetTop===-5,j.doesNotIncludeMarginInBodyOffset=u.offsetTop!==m,a.getComputedStyle&&(p.style.marginTop="1%",b.pixelMargin=(a.getComputedStyle(p,null)||{marginTop:0}).marginTop!=="1%"),typeof d.style.zoom!="undefined"&&(d.style.zoom=1),u.removeChild(d),l=p=d=null,f.extend(b,j))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h,i,j=this[0],k=0,m=null;if(a===b){if(this.length){m=f.data(j);if(j.nodeType===1&&!f._data(j,"parsedAttrs")){g=j.attributes;for(i=g.length;k<i;k++)h=g[k].name,h.indexOf("data-")===0&&(h=f.camelCase(h.substring(5)),l(j,h,m[h]));f._data(j,"parsedAttrs",!0)}}return m}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split(".",2),d[1]=d[1]?"."+d[1]:"",e=d[1]+"!";return f.access(this,function(c){if(c===b){m=this.triggerHandler("getData"+e,[d[0]]),m===b&&j&&(m=f.data(j,a),m=l(j,a,m));return m===b&&d[1]?this.data(d[0]):m}d[1]=c,this.each(function(){var b=f(this);b.triggerHandler("setData"+e,d),f.data(this,a,c),b.triggerHandler("changeData"+e,d)})},null,c,arguments.length>1,null,!1)},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){var d=2;typeof a!="string"&&(c=a,a="fx",d--);if(arguments.length<d)return f.queue(this[0],a);return c===b?this:this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise(c)}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,f.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,f.prop,a,b,arguments.length>1)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.type]||f.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.type]||f.valHooks[g.nodeName.toLowerCase()];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h,i=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;i<g;i++)e=d[i],e&&(c=f.propFix[e]||e,h=u.test(e),h||f.attr(a,e,""),a.removeAttribute(v?e:c),h&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0,coords:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/(?:^|\s)hover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function( -a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")};f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler,g=p.selector),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:g&&G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=f.event.special[c.type]||{},j=[],k,l,m,n,o,p,q,r,s,t,u;g[0]=c,c.delegateTarget=this;if(!i.preDispatch||i.preDispatch.call(this,c)!==!1){if(e&&(!c.button||c.type!=="click")){n=f(this),n.context=this.ownerDocument||this;for(m=c.target;m!=this;m=m.parentNode||this)if(m.disabled!==!0){p={},r=[],n[0]=m;for(k=0;k<e;k++)s=d[k],t=s.selector,p[t]===b&&(p[t]=s.quick?H(m,s.quick):n.is(t)),p[t]&&r.push(s);r.length&&j.push({elem:m,matches:r})}}d.length>e&&j.push({elem:this,matches:d.slice(e)});for(k=0;k<j.length&&!c.isPropagationStopped();k++){q=j[k],c.currentTarget=q.elem;for(l=0;l<q.matches.length&&!c.isImmediatePropagationStopped();l++){s=q.matches[l];if(h||!c.namespace&&!s.namespace||c.namespace_re&&c.namespace_re.test(s.namespace))c.data=s.data,c.handleObj=s,o=((f.event.special[s.origType]||{}).handle||s.handler).apply(q.elem,g),o!==b&&(c.result=o,o===!1&&(c.preventDefault(),c.stopPropagation()))}}i.postDispatch&&i.postDispatch.call(this,c);return c.result}},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){a._submit_bubble=!0}),d._submit_attached=!0)})},postDispatch:function(a){a._submit_bubble&&(delete a._submit_bubble,this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0))},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=d||c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on(a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.origType+"."+e.namespace:e.origType,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9||d===11){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));o.match.globalPOS=p;var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.globalPOS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")[\\s/>]","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){return f.access(this,function(a){return a===b?f.text(this):this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f -.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){return f.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(;d<e;d++)c=this[d]||{},c.nodeType===1&&(f.cleanData(c.getElementsByTagName("*")),c.innerHTML=a);c=0}catch(g){}}c&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,function(a,b){b.src?f.ajax({type:"GET",global:!1,url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)})}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||f.isXMLDoc(a)||!bc.test("<"+a.nodeName+">")?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g,h,i,j=[];b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);for(var k=0,l;(l=a[k])!=null;k++){typeof l=="number"&&(l+="");if(!l)continue;if(typeof l=="string")if(!_.test(l))l=b.createTextNode(l);else{l=l.replace(Y,"<$1></$2>");var m=(Z.exec(l)||["",""])[1].toLowerCase(),n=bg[m]||bg._default,o=n[0],p=b.createElement("div"),q=bh.childNodes,r;b===c?bh.appendChild(p):U(b).appendChild(p),p.innerHTML=n[1]+l+n[2];while(o--)p=p.lastChild;if(!f.support.tbody){var s=$.test(l),t=m==="table"&&!s?p.firstChild&&p.firstChild.childNodes:n[1]==="<table>"&&!s?p.childNodes:[];for(i=t.length-1;i>=0;--i)f.nodeName(t[i],"tbody")&&!t[i].childNodes.length&&t[i].parentNode.removeChild(t[i])}!f.support.leadingWhitespace&&X.test(l)&&p.insertBefore(b.createTextNode(X.exec(l)[0]),p.firstChild),l=p.childNodes,p&&(p.parentNode.removeChild(p),q.length>0&&(r=q[q.length-1],r&&r.parentNode&&r.parentNode.removeChild(r)))}var u;if(!f.support.appendChecked)if(l[0]&&typeof (u=l.length)=="number")for(i=0;i<u;i++)bn(l[i]);else bn(l);l.nodeType?j.push(l):j=f.merge(j,l)}if(d){g=function(a){return!a.type||be.test(a.type)};for(k=0;j[k];k++){h=j[k];if(e&&f.nodeName(h,"script")&&(!h.type||be.test(h.type)))e.push(h.parentNode?h.parentNode.removeChild(h):h);else{if(h.nodeType===1){var v=f.grep(h.getElementsByTagName("script"),g);j.splice.apply(j,[k+1,0].concat(v))}d.appendChild(h)}}}return j},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bp=/alpha\([^)]*\)/i,bq=/opacity=([^)]*)/,br=/([A-Z]|^ms)/g,bs=/^[\-+]?(?:\d*\.)?\d+$/i,bt=/^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,bu=/^([\-+])=([\-+.\de]+)/,bv=/^margin/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Top","Right","Bottom","Left"],by,bz,bA;f.fn.css=function(a,c){return f.access(this,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)},a,c,arguments.length>1)},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=by(a,"opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bu.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(by)return by(a,c)},swap:function(a,b,c){var d={},e,f;for(f in b)d[f]=a.style[f],a.style[f]=b[f];e=c.call(a);for(f in b)a.style[f]=d[f];return e}}),f.curCSS=f.css,c.defaultView&&c.defaultView.getComputedStyle&&(bz=function(a,b){var c,d,e,g,h=a.style;b=b.replace(br,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b))),!f.support.pixelMargin&&e&&bv.test(b)&&bt.test(c)&&(g=h.width,h.width=c,c=e.width,h.width=g);return c}),c.documentElement.currentStyle&&(bA=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f==null&&g&&(e=g[b])&&(f=e),bt.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),by=bz||bA,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth!==0?bB(a,b,d):f.swap(a,bw,function(){return bB(a,b,d)})},set:function(a,b){return bs.test(b)?b+"px":b}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bq.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bp,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bp.test(g)?g.replace(bp,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){return f.swap(a,{display:"inline-block"},function(){return b?by(a,"margin-right"):a.style.marginRight})}})}),f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)}),f.each({margin:"",padding:"",border:"Width"},function(a,b){f.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bx[d]+b]=e[d]||e[d-2]||e[0];return f}}});var bC=/%20/g,bD=/\[\]$/,bE=/\r?\n/g,bF=/#.*$/,bG=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bH=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bI=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bJ=/^(?:GET|HEAD)$/,bK=/^\/\//,bL=/\?/,bM=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bN=/^(?:select|textarea)/i,bO=/\s+/,bP=/([?&])_=[^&]*/,bQ=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bR=f.fn.load,bS={},bT={},bU,bV,bW=["*/"]+["*"];try{bU=e.href}catch(bX){bU=c.createElement("a"),bU.href="",bU=bU.href}bV=bQ.exec(bU.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bR)return bR.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bM,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bN.test(this.nodeName)||bH.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bE,"\r\n")}}):{name:b.name,value:c.replace(bE,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b$(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b$(a,b);return a},ajaxSettings:{url:bU,isLocal:bI.test(bV[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bW},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bY(bS),ajaxTransport:bY(bT),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?ca(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cb(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bG.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bF,"").replace(bK,bV[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bO),d.crossDomain==null&&(r=bQ.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bV[1]&&r[2]==bV[2]&&(r[3]||(r[1]==="http:"?80:443))==(bV[3]||(bV[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bZ(bS,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bJ.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bL.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bP,"$1_="+x);d.url=y+(y===d.url?(bL.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bW+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bZ(bT,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bC,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=typeof b.data=="string"&&/^application\/x\-www\-form\-urlencoded/.test(b.contentType);if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n);try{m.text=h.responseText}catch(a){}try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(ct("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),(e===""&&f.css(d,"display")==="none"||!f.contains(d.ownerDocument.documentElement,d))&&f._data(d,"olddisplay",cu(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(ct("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(ct("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o,p,q;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]);if((k=f.cssHooks[g])&&"expand"in k){l=k.expand(a[g]),delete a[g];for(i in l)i in a||(a[i]=l[i])}}for(g in a){h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cu(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cm.test(h)?(q=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),q?(f._data(this,"toggle"+i,q==="show"?"hide":"show"),j[q]()):j[h]()):(m=cn.exec(h),n=j.cur(),m?(o=parseFloat(m[2]),p=m[3]||(f.cssNumber[i]?"":"px"),p!=="px"&&(f.style(this,i,(o||1)+p),n=(o||1)/j.cur()*n,f.style(this,i,n+p)),m[1]&&(o=(m[1]==="-="?-1:1)*o+n),j.custom(n,o,p)):j.custom(n,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:ct("show",1),slideUp:ct("hide",1),slideToggle:ct("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a){return a},swing:function(a){return-Math.cos(a*Math.PI)/2+.5}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cq||cr(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){f._data(e.elem,"fxshow"+e.prop)===b&&(e.options.hide?f._data(e.elem,"fxshow"+e.prop,e.start):e.options.show&&f._data(e.elem,"fxshow"+e.prop,e.end))},h()&&f.timers.push(h)&&!co&&(co=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cq||cr(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(cp.concat.apply([],cp),function(a,b){b.indexOf("margin")&&(f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)})}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cv,cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?cv=function(a,b,c,d){try{d=a.getBoundingClientRect()}catch(e){}if(!d||!f.contains(c,a))return d?{top:d.top,left:d.left}:{top:0,left:0};var g=b.body,h=cy(b),i=c.clientTop||g.clientTop||0,j=c.clientLeft||g.clientLeft||0,k=h.pageYOffset||f.support.boxModel&&c.scrollTop||g.scrollTop,l=h.pageXOffset||f.support.boxModel&&c.scrollLeft||g.scrollLeft,m=d.top+k-i,n=d.left+l-j;return{top:m,left:n}}:cv=function(a,b,c){var d,e=a.offsetParent,g=a,h=b.body,i=b.defaultView,j=i?i.getComputedStyle(a,null):a.currentStyle,k=a.offsetTop,l=a.offsetLeft;while((a=a.parentNode)&&a!==h&&a!==c){if(f.support.fixedPosition&&j.position==="fixed")break;d=i?i.getComputedStyle(a,null):a.currentStyle,k-=a.scrollTop,l-=a.scrollLeft,a===e&&(k+=a.offsetTop,l+=a.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(a.nodeName))&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),g=e,e=a.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),j=d}if(j.position==="relative"||j.position==="static")k+=h.offsetTop,l+=h.offsetLeft;f.support.fixedPosition&&j.position==="fixed"&&(k+=Math.max(c.scrollTop,h.scrollTop),l+=Math.max(c.scrollLeft,h.scrollLeft));return{top:k,left:l}},f.fn.offset=function(a){if(arguments.length)return a===b?this:this.each(function(b){f.offset.setOffset(this,a,b)});var c=this[0],d=c&&c.ownerDocument;if(!d)return null;if(c===d.body)return f.offset.bodyOffset(c);return cv(c,d,d.documentElement)},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);f.fn[a]=function(e){return f.access(this,function(a,e,g){var h=cy(a);if(g===b)return h?c in h?h[c]:f.support.boxModel&&h.document.documentElement[e]||h.document.body[e]:a[e];h?h.scrollTo(d?f(h).scrollLeft():g,d?g:f(h).scrollTop()):a[e]=g},a,e,arguments.length,null)}}),f.each({Height:"height",Width:"width"},function(a,c){var d="client"+a,e="scroll"+a,g="offset"+a;f.fn["inner"+a]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,c,"padding")):this[c]():null},f.fn["outer"+a]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,c,a?"margin":"border")):this[c]():null},f.fn[c]=function(a){return f.access(this,function(a,c,h){var i,j,k,l;if(f.isWindow(a)){i=a.document,j=i.documentElement[d];return f.support.boxModel&&j||i.body&&i.body[d]||j}if(a.nodeType===9){i=a.documentElement;if(i[d]>=i[e])return i[d];return Math.max(a.body[e],i[e],a.body[g],i[g])}if(h===b){k=f.css(a,c),l=parseFloat(k);return f.isNumeric(l)?l:k}f(a).css(c,h)},c,a,arguments.length,null)}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window); \ No newline at end of file +!function(e,t){"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(e,t){var n=[],r=e.document,i=n.slice,o=n.concat,a=n.push,s=n.indexOf,l={},u=l.toString,c=l.hasOwnProperty,f={},d="1.12.4",p=function(e,t){return new p.fn.init(e,t)},h=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,g=/^-ms-/,m=/-([\da-z])/gi,v=function(e,t){return t.toUpperCase()};function y(e){var t=!!e&&"length"in e&&e.length,n=p.type(e);return"function"!==n&&!p.isWindow(e)&&("array"===n||0===t||"number"==typeof t&&t>0&&t-1 in e)}p.fn=p.prototype={jquery:d,constructor:p,selector:"",length:0,toArray:function(){return i.call(this)},get:function(e){return null!=e?e<0?this[e+this.length]:this[e]:i.call(this)},pushStack:function(e){var t=p.merge(this.constructor(),e);return t.prevObject=this,t.context=this.context,t},each:function(e){return p.each(this,e)},map:function(e){return this.pushStack(p.map(this,function(t,n){return e.call(t,n,t)}))},slice:function(){return this.pushStack(i.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(n>=0&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:a,sort:n.sort,splice:n.splice},p.extend=p.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,l=arguments.length,u=!1;for("boolean"==typeof a&&(u=a,a=arguments[s]||{},s++),"object"==typeof a||p.isFunction(a)||(a={}),s===l&&(a=this,s--);s<l;s++)if(null!=(i=arguments[s]))for(r in i)e=a[r],a!==(n=i[r])&&(u&&n&&(p.isPlainObject(n)||(t=p.isArray(n)))?(t?(t=!1,o=e&&p.isArray(e)?e:[]):o=e&&p.isPlainObject(e)?e:{},a[r]=p.extend(u,o,n)):void 0!==n&&(a[r]=n));return a},p.extend({expando:"jQuery"+(d+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isFunction:function(e){return"function"===p.type(e)},isArray:Array.isArray||function(e){return"array"===p.type(e)},isWindow:function(e){return null!=e&&e==e.window},isNumeric:function(e){var t=e&&e.toString();return!p.isArray(e)&&t-parseFloat(t)+1>=0},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},isPlainObject:function(e){var t;if(!e||"object"!==p.type(e)||e.nodeType||p.isWindow(e))return!1;try{if(e.constructor&&!c.call(e,"constructor")&&!c.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(e){return!1}if(!f.ownFirst)for(t in e)return c.call(e,t);for(t in e);return void 0===t||c.call(e,t)},type:function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?l[u.call(e)]||"object":typeof e},globalEval:function(t){t&&p.trim(t)&&(e.execScript||function(t){e.eval.call(e,t)})(t)},camelCase:function(e){return e.replace(g,"ms-").replace(m,v)},nodeName:function(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()},each:function(e,t){var n,r=0;if(y(e))for(n=e.length;r<n&&!1!==t.call(e[r],r,e[r]);r++);else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},trim:function(e){return null==e?"":(e+"").replace(h,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(y(Object(e))?p.merge(n,"string"==typeof e?[e]:e):a.call(n,e)),n},inArray:function(e,t,n){var r;if(t){if(s)return s.call(t,e,n);for(r=t.length,n=n?n<0?Math.max(0,r+n):n:0;n<r;n++)if(n in t&&t[n]===e)return n}return-1},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;)e[i++]=t[r++];if(n!=n)for(;void 0!==t[r];)e[i++]=t[r++];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,a=0,s=[];if(y(e))for(r=e.length;a<r;a++)null!=(i=t(e[a],a,n))&&s.push(i);else for(a in e)null!=(i=t(e[a],a,n))&&s.push(i);return o.apply([],s)},guid:1,proxy:function(e,t){var n,r,o;if("string"==typeof t&&(o=e[t],t=e,e=o),p.isFunction(e))return n=i.call(arguments,2),(r=function(){return e.apply(t||this,n.concat(i.call(arguments)))}).guid=e.guid=e.guid||p.guid++,r},now:function(){return+new Date},support:f}),"function"==typeof Symbol&&(p.fn[Symbol.iterator]=n[Symbol.iterator]),p.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){l["[object "+t+"]"]=t.toLowerCase()});var x=function(e){var t,n,r,i,o,a,s,l,u,c,f,d,p,h,g,m,v,y,x,b="sizzle"+1*new Date,w=e.document,T=0,C=0,E=oe(),N=oe(),k=oe(),S=function(e,t){return e===t&&(f=!0),0},A=1<<31,D={}.hasOwnProperty,j=[],L=j.pop,H=j.push,q=j.push,_=j.slice,F=function(e,t){for(var n=0,r=e.length;n<r;n++)if(e[n]===t)return n;return-1},M="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",O="[\\x20\\t\\r\\n\\f]",R="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",P="\\["+O+"*("+R+")(?:"+O+"*([*^$|!~]?=)"+O+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+R+"))|)"+O+"*\\]",B=":("+R+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+P+")*)|.*)\\)|)",W=new RegExp(O+"+","g"),I=new RegExp("^"+O+"+|((?:^|[^\\\\])(?:\\\\.)*)"+O+"+$","g"),$=new RegExp("^"+O+"*,"+O+"*"),z=new RegExp("^"+O+"*([>+~]|"+O+")"+O+"*"),X=new RegExp("="+O+"*([^\\]'\"]*?)"+O+"*\\]","g"),U=new RegExp(B),V=new RegExp("^"+R+"$"),Y={ID:new RegExp("^#("+R+")"),CLASS:new RegExp("^\\.("+R+")"),TAG:new RegExp("^("+R+"|[*])"),ATTR:new RegExp("^"+P),PSEUDO:new RegExp("^"+B),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+O+"*(even|odd|(([+-]|)(\\d*)n|)"+O+"*(?:([+-]|)"+O+"*(\\d+)|))"+O+"*\\)|)","i"),bool:new RegExp("^(?:"+M+")$","i"),needsContext:new RegExp("^"+O+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+O+"*((?:-\\d)?\\d*)"+O+"*\\)|)(?=[^-]|$)","i")},J=/^(?:input|select|textarea|button)$/i,G=/^h\d$/i,Q=/^[^{]+\{\s*\[native \w/,K=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,Z=/[+~]/,ee=/'|\\/g,te=new RegExp("\\\\([\\da-f]{1,6}"+O+"?|("+O+")|.)","ig"),ne=function(e,t,n){var r="0x"+t-65536;return r!=r||n?t:r<0?String.fromCharCode(r+65536):String.fromCharCode(r>>10|55296,1023&r|56320)},re=function(){d()};try{q.apply(j=_.call(w.childNodes),w.childNodes),j[w.childNodes.length].nodeType}catch(e){q={apply:j.length?function(e,t){H.apply(e,_.call(t))}:function(e,t){for(var n=e.length,r=0;e[n++]=t[r++];);e.length=n-1}}}function ie(e,t,r,i){var o,s,u,c,f,h,v,y,T=t&&t.ownerDocument,C=t?t.nodeType:9;if(r=r||[],"string"!=typeof e||!e||1!==C&&9!==C&&11!==C)return r;if(!i&&((t?t.ownerDocument||t:w)!==p&&d(t),t=t||p,g)){if(11!==C&&(h=K.exec(e)))if(o=h[1]){if(9===C){if(!(u=t.getElementById(o)))return r;if(u.id===o)return r.push(u),r}else if(T&&(u=T.getElementById(o))&&x(t,u)&&u.id===o)return r.push(u),r}else{if(h[2])return q.apply(r,t.getElementsByTagName(e)),r;if((o=h[3])&&n.getElementsByClassName&&t.getElementsByClassName)return q.apply(r,t.getElementsByClassName(o)),r}if(n.qsa&&!k[e+" "]&&(!m||!m.test(e))){if(1!==C)T=t,y=e;else if("object"!==t.nodeName.toLowerCase()){for((c=t.getAttribute("id"))?c=c.replace(ee,"\\$&"):t.setAttribute("id",c=b),s=(v=a(e)).length,f=V.test(c)?"#"+c:"[id='"+c+"']";s--;)v[s]=f+" "+ge(v[s]);y=v.join(","),T=Z.test(e)&&pe(t.parentNode)||t}if(y)try{return q.apply(r,T.querySelectorAll(y)),r}catch(e){}finally{c===b&&t.removeAttribute("id")}}}return l(e.replace(I,"$1"),t,r,i)}function oe(){var e=[];return function t(n,i){return e.push(n+" ")>r.cacheLength&&delete t[e.shift()],t[n+" "]=i}}function ae(e){return e[b]=!0,e}function se(e){var t=p.createElement("div");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function le(e,t){for(var n=e.split("|"),i=n.length;i--;)r.attrHandle[n[i]]=t}function ue(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&(~t.sourceIndex||A)-(~e.sourceIndex||A);if(r)return r;if(n)for(;n=n.nextSibling;)if(n===t)return-1;return e?1:-1}function ce(e){return function(t){return"input"===t.nodeName.toLowerCase()&&t.type===e}}function fe(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function de(e){return ae(function(t){return t=+t,ae(function(n,r){for(var i,o=e([],n.length,t),a=o.length;a--;)n[i=o[a]]&&(n[i]=!(r[i]=n[i]))})})}function pe(e){return e&&void 0!==e.getElementsByTagName&&e}for(t in n=ie.support={},o=ie.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return!!t&&"HTML"!==t.nodeName},d=ie.setDocument=function(e){var t,i,a=e?e.ownerDocument||e:w;return a!==p&&9===a.nodeType&&a.documentElement?(h=(p=a).documentElement,g=!o(p),(i=p.defaultView)&&i.top!==i&&(i.addEventListener?i.addEventListener("unload",re,!1):i.attachEvent&&i.attachEvent("onunload",re)),n.attributes=se(function(e){return e.className="i",!e.getAttribute("className")}),n.getElementsByTagName=se(function(e){return e.appendChild(p.createComment("")),!e.getElementsByTagName("*").length}),n.getElementsByClassName=Q.test(p.getElementsByClassName),n.getById=se(function(e){return h.appendChild(e).id=b,!p.getElementsByName||!p.getElementsByName(b).length}),n.getById?(r.find.ID=function(e,t){if(void 0!==t.getElementById&&g){var n=t.getElementById(e);return n?[n]:[]}},r.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}}):(delete r.find.ID,r.filter.ID=function(e){var t=e.replace(te,ne);return function(e){var n=void 0!==e.getAttributeNode&&e.getAttributeNode("id");return n&&n.value===t}}),r.find.TAG=n.getElementsByTagName?function(e,t){return void 0!==t.getElementsByTagName?t.getElementsByTagName(e):n.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){for(;n=o[i++];)1===n.nodeType&&r.push(n);return r}return o},r.find.CLASS=n.getElementsByClassName&&function(e,t){if(void 0!==t.getElementsByClassName&&g)return t.getElementsByClassName(e)},v=[],m=[],(n.qsa=Q.test(p.querySelectorAll))&&(se(function(e){h.appendChild(e).innerHTML="<a id='"+b+"'></a><select id='"+b+"-\r\\' msallowcapture=''><option selected=''></option></select>",e.querySelectorAll("[msallowcapture^='']").length&&m.push("[*^$]="+O+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||m.push("\\["+O+"*(?:value|"+M+")"),e.querySelectorAll("[id~="+b+"-]").length||m.push("~="),e.querySelectorAll(":checked").length||m.push(":checked"),e.querySelectorAll("a#"+b+"+*").length||m.push(".#.+[+~]")}),se(function(e){var t=p.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&m.push("name"+O+"*[*^$|!~]?="),e.querySelectorAll(":enabled").length||m.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),m.push(",.*:")})),(n.matchesSelector=Q.test(y=h.matches||h.webkitMatchesSelector||h.mozMatchesSelector||h.oMatchesSelector||h.msMatchesSelector))&&se(function(e){n.disconnectedMatch=y.call(e,"div"),y.call(e,"[s!='']:x"),v.push("!=",B)}),m=m.length&&new RegExp(m.join("|")),v=v.length&&new RegExp(v.join("|")),t=Q.test(h.compareDocumentPosition),x=t||Q.test(h.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)for(;t=t.parentNode;)if(t===e)return!0;return!1},S=t?function(e,t){if(e===t)return f=!0,0;var r=!e.compareDocumentPosition-!t.compareDocumentPosition;return r||(1&(r=(e.ownerDocument||e)===(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!n.sortDetached&&t.compareDocumentPosition(e)===r?e===p||e.ownerDocument===w&&x(w,e)?-1:t===p||t.ownerDocument===w&&x(w,t)?1:c?F(c,e)-F(c,t):0:4&r?-1:1)}:function(e,t){if(e===t)return f=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e===p?-1:t===p?1:i?-1:o?1:c?F(c,e)-F(c,t):0;if(i===o)return ue(e,t);for(n=e;n=n.parentNode;)a.unshift(n);for(n=t;n=n.parentNode;)s.unshift(n);for(;a[r]===s[r];)r++;return r?ue(a[r],s[r]):a[r]===w?-1:s[r]===w?1:0},p):p},ie.matches=function(e,t){return ie(e,null,null,t)},ie.matchesSelector=function(e,t){if((e.ownerDocument||e)!==p&&d(e),t=t.replace(X,"='$1']"),n.matchesSelector&&g&&!k[t+" "]&&(!v||!v.test(t))&&(!m||!m.test(t)))try{var r=y.call(e,t);if(r||n.disconnectedMatch||e.document&&11!==e.document.nodeType)return r}catch(e){}return ie(t,p,null,[e]).length>0},ie.contains=function(e,t){return(e.ownerDocument||e)!==p&&d(e),x(e,t)},ie.attr=function(e,t){(e.ownerDocument||e)!==p&&d(e);var i=r.attrHandle[t.toLowerCase()],o=i&&D.call(r.attrHandle,t.toLowerCase())?i(e,t,!g):void 0;return void 0!==o?o:n.attributes||!g?e.getAttribute(t):(o=e.getAttributeNode(t))&&o.specified?o.value:null},ie.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},ie.uniqueSort=function(e){var t,r=[],i=0,o=0;if(f=!n.detectDuplicates,c=!n.sortStable&&e.slice(0),e.sort(S),f){for(;t=e[o++];)t===e[o]&&(i=r.push(o));for(;i--;)e.splice(r[i],1)}return c=null,e},i=ie.getText=function(e){var t,n="",r=0,o=e.nodeType;if(o){if(1===o||9===o||11===o){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=i(e)}else if(3===o||4===o)return e.nodeValue}else for(;t=e[r++];)n+=i(t);return n},(r=ie.selectors={cacheLength:50,createPseudo:ae,match:Y,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||ie.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&ie.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return Y.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&U.test(n)&&(t=a(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=E[e+" "];return t||(t=new RegExp("(^|"+O+")"+e+"("+O+"|$)"))&&E(e,function(e){return t.test("string"==typeof e.className&&e.className||void 0!==e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=ie.attr(r,e);return null==i?"!="===t:!t||(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i.replace(W," ")+" ").indexOf(n)>-1:"|="===t&&(i===n||i.slice(0,n.length+1)===n+"-"))}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),a="last"!==e.slice(-4),s="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,l){var u,c,f,d,p,h,g=o!==a?"nextSibling":"previousSibling",m=t.parentNode,v=s&&t.nodeName.toLowerCase(),y=!l&&!s,x=!1;if(m){if(o){for(;g;){for(d=t;d=d[g];)if(s?d.nodeName.toLowerCase()===v:1===d.nodeType)return!1;h=g="only"===e&&!h&&"nextSibling"}return!0}if(h=[a?m.firstChild:m.lastChild],a&&y){for(x=(p=(u=(c=(f=(d=m)[b]||(d[b]={}))[d.uniqueID]||(f[d.uniqueID]={}))[e]||[])[0]===T&&u[1])&&u[2],d=p&&m.childNodes[p];d=++p&&d&&d[g]||(x=p=0)||h.pop();)if(1===d.nodeType&&++x&&d===t){c[e]=[T,p,x];break}}else if(y&&(x=p=(u=(c=(f=(d=t)[b]||(d[b]={}))[d.uniqueID]||(f[d.uniqueID]={}))[e]||[])[0]===T&&u[1]),!1===x)for(;(d=++p&&d&&d[g]||(x=p=0)||h.pop())&&((s?d.nodeName.toLowerCase()!==v:1!==d.nodeType)||!++x||(y&&((c=(f=d[b]||(d[b]={}))[d.uniqueID]||(f[d.uniqueID]={}))[e]=[T,x]),d!==t)););return(x-=i)===r||x%r==0&&x/r>=0}}},PSEUDO:function(e,t){var n,i=r.pseudos[e]||r.setFilters[e.toLowerCase()]||ie.error("unsupported pseudo: "+e);return i[b]?i(t):i.length>1?(n=[e,e,"",t],r.setFilters.hasOwnProperty(e.toLowerCase())?ae(function(e,n){for(var r,o=i(e,t),a=o.length;a--;)e[r=F(e,o[a])]=!(n[r]=o[a])}):function(e){return i(e,0,n)}):i}},pseudos:{not:ae(function(e){var t=[],n=[],r=s(e.replace(I,"$1"));return r[b]?ae(function(e,t,n,i){for(var o,a=r(e,null,i,[]),s=e.length;s--;)(o=a[s])&&(e[s]=!(t[s]=o))}):function(e,i,o){return t[0]=e,r(t,null,o,n),t[0]=null,!n.pop()}}),has:ae(function(e){return function(t){return ie(e,t).length>0}}),contains:ae(function(e){return e=e.replace(te,ne),function(t){return(t.textContent||t.innerText||i(t)).indexOf(e)>-1}}),lang:ae(function(e){return V.test(e||"")||ie.error("unsupported lang: "+e),e=e.replace(te,ne).toLowerCase(),function(t){var n;do{if(n=g?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return(n=n.toLowerCase())===e||0===n.indexOf(e+"-")}while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var n=e.location&&e.location.hash;return n&&n.slice(1)===t.id},root:function(e){return e===h},focus:function(e){return e===p.activeElement&&(!p.hasFocus||p.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:function(e){return!1===e.disabled},disabled:function(e){return!0===e.disabled},checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!r.pseudos.empty(e)},header:function(e){return G.test(e.nodeName)},input:function(e){return J.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:de(function(){return[0]}),last:de(function(e,t){return[t-1]}),eq:de(function(e,t,n){return[n<0?n+t:n]}),even:de(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:de(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:de(function(e,t,n){for(var r=n<0?n+t:n;--r>=0;)e.push(r);return e}),gt:de(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=r.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})r.pseudos[t]=ce(t);for(t in{submit:!0,reset:!0})r.pseudos[t]=fe(t);function he(){}function ge(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function me(e,t,n){var r=t.dir,i=n&&"parentNode"===r,o=C++;return t.first?function(t,n,o){for(;t=t[r];)if(1===t.nodeType||i)return e(t,n,o)}:function(t,n,a){var s,l,u,c=[T,o];if(a){for(;t=t[r];)if((1===t.nodeType||i)&&e(t,n,a))return!0}else for(;t=t[r];)if(1===t.nodeType||i){if((s=(l=(u=t[b]||(t[b]={}))[t.uniqueID]||(u[t.uniqueID]={}))[r])&&s[0]===T&&s[1]===o)return c[2]=s[2];if(l[r]=c,c[2]=e(t,n,a))return!0}}}function ve(e){return e.length>1?function(t,n,r){for(var i=e.length;i--;)if(!e[i](t,n,r))return!1;return!0}:e[0]}function ye(e,t,n,r,i){for(var o,a=[],s=0,l=e.length,u=null!=t;s<l;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),u&&t.push(s)));return a}function xe(e,t,n,r,i,o){return r&&!r[b]&&(r=xe(r)),i&&!i[b]&&(i=xe(i,o)),ae(function(o,a,s,l){var u,c,f,d=[],p=[],h=a.length,g=o||function(e,t,n){for(var r=0,i=t.length;r<i;r++)ie(e,t[r],n);return n}(t||"*",s.nodeType?[s]:s,[]),m=!e||!o&&t?g:ye(g,d,e,s,l),v=n?i||(o?e:h||r)?[]:a:m;if(n&&n(m,v,s,l),r)for(u=ye(v,p),r(u,[],s,l),c=u.length;c--;)(f=u[c])&&(v[p[c]]=!(m[p[c]]=f));if(o){if(i||e){if(i){for(u=[],c=v.length;c--;)(f=v[c])&&u.push(m[c]=f);i(null,v=[],u,l)}for(c=v.length;c--;)(f=v[c])&&(u=i?F(o,f):d[c])>-1&&(o[u]=!(a[u]=f))}}else v=ye(v===a?v.splice(h,v.length):v),i?i(null,a,v,l):q.apply(a,v)})}function be(e){for(var t,n,i,o=e.length,a=r.relative[e[0].type],s=a||r.relative[" "],l=a?1:0,c=me(function(e){return e===t},s,!0),f=me(function(e){return F(t,e)>-1},s,!0),d=[function(e,n,r){var i=!a&&(r||n!==u)||((t=n).nodeType?c(e,n,r):f(e,n,r));return t=null,i}];l<o;l++)if(n=r.relative[e[l].type])d=[me(ve(d),n)];else{if((n=r.filter[e[l].type].apply(null,e[l].matches))[b]){for(i=++l;i<o&&!r.relative[e[i].type];i++);return xe(l>1&&ve(d),l>1&&ge(e.slice(0,l-1).concat({value:" "===e[l-2].type?"*":""})).replace(I,"$1"),n,l<i&&be(e.slice(l,i)),i<o&&be(e=e.slice(i)),i<o&&ge(e))}d.push(n)}return ve(d)}return he.prototype=r.filters=r.pseudos,r.setFilters=new he,a=ie.tokenize=function(e,t){var n,i,o,a,s,l,u,c=N[e+" "];if(c)return t?0:c.slice(0);for(s=e,l=[],u=r.preFilter;s;){for(a in n&&!(i=$.exec(s))||(i&&(s=s.slice(i[0].length)||s),l.push(o=[])),n=!1,(i=z.exec(s))&&(n=i.shift(),o.push({value:n,type:i[0].replace(I," ")}),s=s.slice(n.length)),r.filter)!(i=Y[a].exec(s))||u[a]&&!(i=u[a](i))||(n=i.shift(),o.push({value:n,type:a,matches:i}),s=s.slice(n.length));if(!n)break}return t?s.length:s?ie.error(e):N(e,l).slice(0)},s=ie.compile=function(e,t){var n,i,o,s,l,c,f=[],h=[],m=k[e+" "];if(!m){for(t||(t=a(e)),n=t.length;n--;)(m=be(t[n]))[b]?f.push(m):h.push(m);(m=k(e,(i=h,s=(o=f).length>0,l=i.length>0,c=function(e,t,n,a,c){var f,h,m,v=0,y="0",x=e&&[],b=[],w=u,C=e||l&&r.find.TAG("*",c),E=T+=null==w?1:Math.random()||.1,N=C.length;for(c&&(u=t===p||t||c);y!==N&&null!=(f=C[y]);y++){if(l&&f){for(h=0,t||f.ownerDocument===p||(d(f),n=!g);m=i[h++];)if(m(f,t||p,n)){a.push(f);break}c&&(T=E)}s&&((f=!m&&f)&&v--,e&&x.push(f))}if(v+=y,s&&y!==v){for(h=0;m=o[h++];)m(x,b,t,n);if(e){if(v>0)for(;y--;)x[y]||b[y]||(b[y]=L.call(a));b=ye(b)}q.apply(a,b),c&&!e&&b.length>0&&v+o.length>1&&ie.uniqueSort(a)}return c&&(T=E,u=w),x},s?ae(c):c))).selector=e}return m},l=ie.select=function(e,t,i,o){var l,u,c,f,d,p="function"==typeof e&&e,h=!o&&a(e=p.selector||e);if(i=i||[],1===h.length){if((u=h[0]=h[0].slice(0)).length>2&&"ID"===(c=u[0]).type&&n.getById&&9===t.nodeType&&g&&r.relative[u[1].type]){if(!(t=(r.find.ID(c.matches[0].replace(te,ne),t)||[])[0]))return i;p&&(t=t.parentNode),e=e.slice(u.shift().value.length)}for(l=Y.needsContext.test(e)?0:u.length;l--&&(c=u[l],!r.relative[f=c.type]);)if((d=r.find[f])&&(o=d(c.matches[0].replace(te,ne),Z.test(u[0].type)&&pe(t.parentNode)||t))){if(u.splice(l,1),!(e=o.length&&ge(u)))return q.apply(i,o),i;break}}return(p||s(e,h))(o,t,!g,i,!t||Z.test(e)&&pe(t.parentNode)||t),i},n.sortStable=b.split("").sort(S).join("")===b,n.detectDuplicates=!!f,d(),n.sortDetached=se(function(e){return 1&e.compareDocumentPosition(p.createElement("div"))}),se(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||le("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),n.attributes&&se(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||le("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),se(function(e){return null==e.getAttribute("disabled")})||le(M,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),ie}(e);p.find=x,p.expr=x.selectors,p.expr[":"]=p.expr.pseudos,p.uniqueSort=p.unique=x.uniqueSort,p.text=x.getText,p.isXMLDoc=x.isXML,p.contains=x.contains;var b=function(e,t,n){for(var r=[],i=void 0!==n;(e=e[t])&&9!==e.nodeType;)if(1===e.nodeType){if(i&&p(e).is(n))break;r.push(e)}return r},w=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},T=p.expr.match.needsContext,C=/^<([\w-]+)\s*\/?>(?:<\/\1>|)$/,E=/^.[^:#\[\.,]*$/;function N(e,t,n){if(p.isFunction(t))return p.grep(e,function(e,r){return!!t.call(e,r,e)!==n});if(t.nodeType)return p.grep(e,function(e){return e===t!==n});if("string"==typeof t){if(E.test(t))return p.filter(t,e,n);t=p.filter(t,e)}return p.grep(e,function(e){return p.inArray(e,t)>-1!==n})}p.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?p.find.matchesSelector(r,e)?[r]:[]:p.find.matches(e,p.grep(t,function(e){return 1===e.nodeType}))},p.fn.extend({find:function(e){var t,n=[],r=this,i=r.length;if("string"!=typeof e)return this.pushStack(p(e).filter(function(){for(t=0;t<i;t++)if(p.contains(r[t],this))return!0}));for(t=0;t<i;t++)p.find(e,r[t],n);return(n=this.pushStack(i>1?p.unique(n):n)).selector=this.selector?this.selector+" "+e:e,n},filter:function(e){return this.pushStack(N(this,e||[],!1))},not:function(e){return this.pushStack(N(this,e||[],!0))},is:function(e){return!!N(this,"string"==typeof e&&T.test(e)?p(e):e||[],!1).length}});var k,S=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/;(p.fn.init=function(e,t,n){var i,o;if(!e)return this;if(n=n||k,"string"==typeof e){if(!(i="<"===e.charAt(0)&&">"===e.charAt(e.length-1)&&e.length>=3?[null,e,null]:S.exec(e))||!i[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(i[1]){if(t=t instanceof p?t[0]:t,p.merge(this,p.parseHTML(i[1],t&&t.nodeType?t.ownerDocument||t:r,!0)),C.test(i[1])&&p.isPlainObject(t))for(i in t)p.isFunction(this[i])?this[i](t[i]):this.attr(i,t[i]);return this}if((o=r.getElementById(i[2]))&&o.parentNode){if(o.id!==i[2])return k.find(e);this.length=1,this[0]=o}return this.context=r,this.selector=e,this}return e.nodeType?(this.context=this[0]=e,this.length=1,this):p.isFunction(e)?void 0!==n.ready?n.ready(e):e(p):(void 0!==e.selector&&(this.selector=e.selector,this.context=e.context),p.makeArray(e,this))}).prototype=p.fn,k=p(r);var A=/^(?:parents|prev(?:Until|All))/,D={children:!0,contents:!0,next:!0,prev:!0};function j(e,t){do{e=e[t]}while(e&&1!==e.nodeType);return e}p.fn.extend({has:function(e){var t,n=p(e,this),r=n.length;return this.filter(function(){for(t=0;t<r;t++)if(p.contains(this,n[t]))return!0})},closest:function(e,t){for(var n,r=0,i=this.length,o=[],a=T.test(e)||"string"!=typeof e?p(e,t||this.context):0;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?a.index(n)>-1:1===n.nodeType&&p.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(o.length>1?p.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?p.inArray(this[0],p(e)):p.inArray(e.jquery?e[0]:e,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(p.uniqueSort(p.merge(this.get(),p(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),p.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return b(e,"parentNode")},parentsUntil:function(e,t,n){return b(e,"parentNode",n)},next:function(e){return j(e,"nextSibling")},prev:function(e){return j(e,"previousSibling")},nextAll:function(e){return b(e,"nextSibling")},prevAll:function(e){return b(e,"previousSibling")},nextUntil:function(e,t,n){return b(e,"nextSibling",n)},prevUntil:function(e,t,n){return b(e,"previousSibling",n)},siblings:function(e){return w((e.parentNode||{}).firstChild,e)},children:function(e){return w(e.firstChild)},contents:function(e){return p.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:p.merge([],e.childNodes)}},function(e,t){p.fn[e]=function(n,r){var i=p.map(this,t,n);return"Until"!==e.slice(-5)&&(r=n),r&&"string"==typeof r&&(i=p.filter(r,i)),this.length>1&&(D[e]||(i=p.uniqueSort(i)),A.test(e)&&(i=i.reverse())),this.pushStack(i)}});var L,H,q=/\S+/g;function _(){r.addEventListener?(r.removeEventListener("DOMContentLoaded",F),e.removeEventListener("load",F)):(r.detachEvent("onreadystatechange",F),e.detachEvent("onload",F))}function F(){(r.addEventListener||"load"===e.event.type||"complete"===r.readyState)&&(_(),p.ready())}for(H in p.Callbacks=function(e){var t,n;e="string"==typeof e?(t=e,n={},p.each(t.match(q)||[],function(e,t){n[t]=!0}),n):p.extend({},e);var r,i,o,a,s=[],l=[],u=-1,c=function(){for(a=e.once,o=r=!0;l.length;u=-1)for(i=l.shift();++u<s.length;)!1===s[u].apply(i[0],i[1])&&e.stopOnFalse&&(u=s.length,i=!1);e.memory||(i=!1),r=!1,a&&(s=i?[]:"")},f={add:function(){return s&&(i&&!r&&(u=s.length-1,l.push(i)),function t(n){p.each(n,function(n,r){p.isFunction(r)?e.unique&&f.has(r)||s.push(r):r&&r.length&&"string"!==p.type(r)&&t(r)})}(arguments),i&&!r&&c()),this},remove:function(){return p.each(arguments,function(e,t){for(var n;(n=p.inArray(t,s,n))>-1;)s.splice(n,1),n<=u&&u--}),this},has:function(e){return e?p.inArray(e,s)>-1:s.length>0},empty:function(){return s&&(s=[]),this},disable:function(){return a=l=[],s=i="",this},disabled:function(){return!s},lock:function(){return a=!0,i||f.disable(),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],l.push(t),r||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},p.extend({Deferred:function(e){var t=[["resolve","done",p.Callbacks("once memory"),"resolved"],["reject","fail",p.Callbacks("once memory"),"rejected"],["notify","progress",p.Callbacks("memory")]],n="pending",r={state:function(){return n},always:function(){return i.done(arguments).fail(arguments),this},then:function(){var e=arguments;return p.Deferred(function(n){p.each(t,function(t,o){var a=p.isFunction(e[t])&&e[t];i[o[1]](function(){var e=a&&a.apply(this,arguments);e&&p.isFunction(e.promise)?e.promise().progress(n.notify).done(n.resolve).fail(n.reject):n[o[0]+"With"](this===r?n.promise():this,a?[e]:arguments)})}),e=null}).promise()},promise:function(e){return null!=e?p.extend(e,r):r}},i={};return r.pipe=r.then,p.each(t,function(e,o){var a=o[2],s=o[3];r[o[1]]=a.add,s&&a.add(function(){n=s},t[1^e][2].disable,t[2][2].lock),i[o[0]]=function(){return i[o[0]+"With"](this===i?r:this,arguments),this},i[o[0]+"With"]=a.fireWith}),r.promise(i),e&&e.call(i,i),i},when:function(e){var t,n,r,o=0,a=i.call(arguments),s=a.length,l=1!==s||e&&p.isFunction(e.promise)?s:0,u=1===l?e:p.Deferred(),c=function(e,n,r){return function(o){n[e]=this,r[e]=arguments.length>1?i.call(arguments):o,r===t?u.notifyWith(n,r):--l||u.resolveWith(n,r)}};if(s>1)for(t=new Array(s),n=new Array(s),r=new Array(s);o<s;o++)a[o]&&p.isFunction(a[o].promise)?a[o].promise().progress(c(o,n,t)).done(c(o,r,a)).fail(u.reject):--l;return l||u.resolveWith(r,a),u.promise()}}),p.fn.ready=function(e){return p.ready.promise().done(e),this},p.extend({isReady:!1,readyWait:1,holdReady:function(e){e?p.readyWait++:p.ready(!0)},ready:function(e){(!0===e?--p.readyWait:p.isReady)||(p.isReady=!0,!0!==e&&--p.readyWait>0||(L.resolveWith(r,[p]),p.fn.triggerHandler&&(p(r).triggerHandler("ready"),p(r).off("ready"))))}}),p.ready.promise=function(t){if(!L)if(L=p.Deferred(),"complete"===r.readyState||"loading"!==r.readyState&&!r.documentElement.doScroll)e.setTimeout(p.ready);else if(r.addEventListener)r.addEventListener("DOMContentLoaded",F),e.addEventListener("load",F);else{r.attachEvent("onreadystatechange",F),e.attachEvent("onload",F);var n=!1;try{n=null==e.frameElement&&r.documentElement}catch(e){}n&&n.doScroll&&function t(){if(!p.isReady){try{n.doScroll("left")}catch(n){return e.setTimeout(t,50)}_(),p.ready()}}()}return L.promise(t)},p.ready.promise(),p(f))break;f.ownFirst="0"===H,f.inlineBlockNeedsLayout=!1,p(function(){var e,t,n,i;(n=r.getElementsByTagName("body")[0])&&n.style&&(t=r.createElement("div"),(i=r.createElement("div")).style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",n.appendChild(i).appendChild(t),void 0!==t.style.zoom&&(t.style.cssText="display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1",f.inlineBlockNeedsLayout=e=3===t.offsetWidth,e&&(n.style.zoom=1)),n.removeChild(i))}),function(){var e=r.createElement("div");f.deleteExpando=!0;try{delete e.test}catch(e){f.deleteExpando=!1}e=null}();var M,O=function(e){var t=p.noData[(e.nodeName+" ").toLowerCase()],n=+e.nodeType||1;return(1===n||9===n)&&(!t||!0!==t&&e.getAttribute("classid")===t)},R=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,P=/([A-Z])/g;function B(e,t,n){if(void 0===n&&1===e.nodeType){var r="data-"+t.replace(P,"-$1").toLowerCase();if("string"==typeof(n=e.getAttribute(r))){try{n="true"===n||"false"!==n&&("null"===n?null:+n+""===n?+n:R.test(n)?p.parseJSON(n):n)}catch(e){}p.data(e,t,n)}else n=void 0}return n}function W(e){var t;for(t in e)if(("data"!==t||!p.isEmptyObject(e[t]))&&"toJSON"!==t)return!1;return!0}function I(e,t,r,i){if(O(e)){var o,a,s=p.expando,l=e.nodeType,u=l?p.cache:e,c=l?e[s]:e[s]&&s;if(c&&u[c]&&(i||u[c].data)||void 0!==r||"string"!=typeof t)return c||(c=l?e[s]=n.pop()||p.guid++:s),u[c]||(u[c]=l?{}:{toJSON:p.noop}),"object"!=typeof t&&"function"!=typeof t||(i?u[c]=p.extend(u[c],t):u[c].data=p.extend(u[c].data,t)),a=u[c],i||(a.data||(a.data={}),a=a.data),void 0!==r&&(a[p.camelCase(t)]=r),"string"==typeof t?null==(o=a[t])&&(o=a[p.camelCase(t)]):o=a,o}}function $(e,t,n){if(O(e)){var r,i,o=e.nodeType,a=o?p.cache:e,s=o?e[p.expando]:p.expando;if(a[s]){if(t&&(r=n?a[s]:a[s].data)){i=(t=p.isArray(t)?t.concat(p.map(t,p.camelCase)):t in r?[t]:(t=p.camelCase(t))in r?[t]:t.split(" ")).length;for(;i--;)delete r[t[i]];if(n?!W(r):!p.isEmptyObject(r))return}(n||(delete a[s].data,W(a[s])))&&(o?p.cleanData([e],!0):f.deleteExpando||a!=a.window?delete a[s]:a[s]=void 0)}}}p.extend({cache:{},noData:{"applet ":!0,"embed ":!0,"object ":"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"},hasData:function(e){return!!(e=e.nodeType?p.cache[e[p.expando]]:e[p.expando])&&!W(e)},data:function(e,t,n){return I(e,t,n)},removeData:function(e,t){return $(e,t)},_data:function(e,t,n){return I(e,t,n,!0)},_removeData:function(e,t){return $(e,t,!0)}}),p.fn.extend({data:function(e,t){var n,r,i,o=this[0],a=o&&o.attributes;if(void 0===e){if(this.length&&(i=p.data(o),1===o.nodeType&&!p._data(o,"parsedAttrs"))){for(n=a.length;n--;)a[n]&&0===(r=a[n].name).indexOf("data-")&&B(o,r=p.camelCase(r.slice(5)),i[r]);p._data(o,"parsedAttrs",!0)}return i}return"object"==typeof e?this.each(function(){p.data(this,e)}):arguments.length>1?this.each(function(){p.data(this,e,t)}):o?B(o,e,p.data(o,e)):void 0},removeData:function(e){return this.each(function(){p.removeData(this,e)})}}),p.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=p._data(e,t),n&&(!r||p.isArray(n)?r=p._data(e,t,p.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=p.queue(e,t),r=n.length,i=n.shift(),o=p._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){p.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return p._data(e,n)||p._data(e,n,{empty:p.Callbacks("once memory").add(function(){p._removeData(e,t+"queue"),p._removeData(e,n)})})}}),p.fn.extend({queue:function(e,t){var n=2;return"string"!=typeof e&&(t=e,e="fx",n--),arguments.length<n?p.queue(this[0],e):void 0===t?this:this.each(function(){var n=p.queue(this,e,t);p._queueHooks(this,e),"fx"===e&&"inprogress"!==n[0]&&p.dequeue(this,e)})},dequeue:function(e){return this.each(function(){p.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=p.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};for("string"!=typeof e&&(t=e,e=void 0),e=e||"fx";a--;)(n=p._data(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}}),f.shrinkWrapBlocks=function(){return null!=M?M:(M=!1,(t=r.getElementsByTagName("body")[0])&&t.style?(e=r.createElement("div"),(n=r.createElement("div")).style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",t.appendChild(n).appendChild(e),void 0!==e.style.zoom&&(e.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:1px;width:1px;zoom:1",e.appendChild(r.createElement("div")).style.width="5px",M=3!==e.offsetWidth),t.removeChild(n),M):void 0);var e,t,n};var z=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,X=new RegExp("^(?:([+-])=|)("+z+")([a-z%]*)$","i"),U=["Top","Right","Bottom","Left"],V=function(e,t){return e=t||e,"none"===p.css(e,"display")||!p.contains(e.ownerDocument,e)};function Y(e,t,n,r){var i,o=1,a=20,s=r?function(){return r.cur()}:function(){return p.css(e,t,"")},l=s(),u=n&&n[3]||(p.cssNumber[t]?"":"px"),c=(p.cssNumber[t]||"px"!==u&&+l)&&X.exec(p.css(e,t));if(c&&c[3]!==u){u=u||c[3],n=n||[],c=+l||1;do{c/=o=o||".5",p.style(e,t,c+u)}while(o!==(o=s()/l)&&1!==o&&--a)}return n&&(c=+c||+l||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=u,r.start=c,r.end=i)),i}var J,G,Q,K=function(e,t,n,r,i,o,a){var s=0,l=e.length,u=null==n;if("object"===p.type(n))for(s in i=!0,n)K(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,p.isFunction(r)||(a=!0),u&&(a?(t.call(e,r),t=null):(u=t,t=function(e,t,n){return u.call(p(e),n)})),t))for(;s<l;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:u?t.call(e):l?t(e[0],n):o},Z=/^(?:checkbox|radio)$/i,ee=/<([\w:-]+)/,te=/^$|\/(?:java|ecma)script/i,ne=/^\s+/,re="abbr|article|aside|audio|bdi|canvas|data|datalist|details|dialog|figcaption|figure|footer|header|hgroup|main|mark|meter|nav|output|picture|progress|section|summary|template|time|video";function ie(e){var t=re.split("|"),n=e.createDocumentFragment();if(n.createElement)for(;t.length;)n.createElement(t.pop());return n}J=r.createElement("div"),G=r.createDocumentFragment(),Q=r.createElement("input"),J.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",f.leadingWhitespace=3===J.firstChild.nodeType,f.tbody=!J.getElementsByTagName("tbody").length,f.htmlSerialize=!!J.getElementsByTagName("link").length,f.html5Clone="<:nav></:nav>"!==r.createElement("nav").cloneNode(!0).outerHTML,Q.type="checkbox",Q.checked=!0,G.appendChild(Q),f.appendChecked=Q.checked,J.innerHTML="<textarea>x</textarea>",f.noCloneChecked=!!J.cloneNode(!0).lastChild.defaultValue,G.appendChild(J),(Q=r.createElement("input")).setAttribute("type","radio"),Q.setAttribute("checked","checked"),Q.setAttribute("name","t"),J.appendChild(Q),f.checkClone=J.cloneNode(!0).cloneNode(!0).lastChild.checked,f.noCloneEvent=!!J.addEventListener,J[p.expando]=1,f.attributes=!J.getAttribute(p.expando);var oe={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],area:[1,"<map>","</map>"],param:[1,"<object>","</object>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:f.htmlSerialize?[0,"",""]:[1,"X<div>","</div>"]};function ae(e,t){var n,r,i=0,o=void 0!==e.getElementsByTagName?e.getElementsByTagName(t||"*"):void 0!==e.querySelectorAll?e.querySelectorAll(t||"*"):void 0;if(!o)for(o=[],n=e.childNodes||e;null!=(r=n[i]);i++)!t||p.nodeName(r,t)?o.push(r):p.merge(o,ae(r,t));return void 0===t||t&&p.nodeName(e,t)?p.merge([e],o):o}function se(e,t){for(var n,r=0;null!=(n=e[r]);r++)p._data(n,"globalEval",!t||p._data(t[r],"globalEval"))}oe.optgroup=oe.option,oe.tbody=oe.tfoot=oe.colgroup=oe.caption=oe.thead,oe.th=oe.td;var le=/<|&#?\w+;/,ue=/<tbody/i;function ce(e){Z.test(e.type)&&(e.defaultChecked=e.checked)}function fe(e,t,n,r,i){for(var o,a,s,l,u,c,d,h=e.length,g=ie(t),m=[],v=0;v<h;v++)if((a=e[v])||0===a)if("object"===p.type(a))p.merge(m,a.nodeType?[a]:a);else if(le.test(a)){for(l=l||g.appendChild(t.createElement("div")),u=(ee.exec(a)||["",""])[1].toLowerCase(),d=oe[u]||oe._default,l.innerHTML=d[1]+p.htmlPrefilter(a)+d[2],o=d[0];o--;)l=l.lastChild;if(!f.leadingWhitespace&&ne.test(a)&&m.push(t.createTextNode(ne.exec(a)[0])),!f.tbody)for(o=(a="table"!==u||ue.test(a)?"<table>"!==d[1]||ue.test(a)?0:l:l.firstChild)&&a.childNodes.length;o--;)p.nodeName(c=a.childNodes[o],"tbody")&&!c.childNodes.length&&a.removeChild(c);for(p.merge(m,l.childNodes),l.textContent="";l.firstChild;)l.removeChild(l.firstChild);l=g.lastChild}else m.push(t.createTextNode(a));for(l&&g.removeChild(l),f.appendChecked||p.grep(ae(m,"input"),ce),v=0;a=m[v++];)if(r&&p.inArray(a,r)>-1)i&&i.push(a);else if(s=p.contains(a.ownerDocument,a),l=ae(g.appendChild(a),"script"),s&&se(l),n)for(o=0;a=l[o++];)te.test(a.type||"")&&n.push(a);return l=null,g}!function(){var t,n,i=r.createElement("div");for(t in{submit:!0,change:!0,focusin:!0})n="on"+t,(f[t]=n in e)||(i.setAttribute(n,"t"),f[t]=!1===i.attributes[n].expando);i=null}();var de=/^(?:input|select|textarea)$/i,pe=/^key/,he=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,ge=/^(?:focusinfocus|focusoutblur)$/,me=/^([^.]*)(?:\.(.+)|)/;function ve(){return!0}function ye(){return!1}function xe(){try{return r.activeElement}catch(e){}}function be(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)be(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=ye;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return p().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=p.guid++)),e.each(function(){p.event.add(this,t,i,r,n)})}p.event={global:{},add:function(e,t,n,r,i){var o,a,s,l,u,c,f,d,h,g,m,v=p._data(e);if(v){for(n.handler&&(n=(l=n).handler,i=l.selector),n.guid||(n.guid=p.guid++),(a=v.events)||(a=v.events={}),(c=v.handle)||((c=v.handle=function(e){return void 0===p||e&&p.event.triggered===e.type?void 0:p.event.dispatch.apply(c.elem,arguments)}).elem=e),s=(t=(t||"").match(q)||[""]).length;s--;)h=m=(o=me.exec(t[s])||[])[1],g=(o[2]||"").split(".").sort(),h&&(u=p.event.special[h]||{},h=(i?u.delegateType:u.bindType)||h,u=p.event.special[h]||{},f=p.extend({type:h,origType:m,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&p.expr.match.needsContext.test(i),namespace:g.join(".")},l),(d=a[h])||((d=a[h]=[]).delegateCount=0,u.setup&&!1!==u.setup.call(e,r,g,c)||(e.addEventListener?e.addEventListener(h,c,!1):e.attachEvent&&e.attachEvent("on"+h,c))),u.add&&(u.add.call(e,f),f.handler.guid||(f.handler.guid=n.guid)),i?d.splice(d.delegateCount++,0,f):d.push(f),p.event.global[h]=!0);e=null}},remove:function(e,t,n,r,i){var o,a,s,l,u,c,f,d,h,g,m,v=p.hasData(e)&&p._data(e);if(v&&(c=v.events)){for(u=(t=(t||"").match(q)||[""]).length;u--;)if(h=m=(s=me.exec(t[u])||[])[1],g=(s[2]||"").split(".").sort(),h){for(f=p.event.special[h]||{},d=c[h=(r?f.delegateType:f.bindType)||h]||[],s=s[2]&&new RegExp("(^|\\.)"+g.join("\\.(?:.*\\.|)")+"(\\.|$)"),l=o=d.length;o--;)a=d[o],!i&&m!==a.origType||n&&n.guid!==a.guid||s&&!s.test(a.namespace)||r&&r!==a.selector&&("**"!==r||!a.selector)||(d.splice(o,1),a.selector&&d.delegateCount--,f.remove&&f.remove.call(e,a));l&&!d.length&&(f.teardown&&!1!==f.teardown.call(e,g,v.handle)||p.removeEvent(e,h,v.handle),delete c[h])}else for(h in c)p.event.remove(e,h+t[u],n,r,!0);p.isEmptyObject(c)&&(delete v.handle,p._removeData(e,"events"))}},trigger:function(t,n,i,o){var a,s,l,u,f,d,h,g=[i||r],m=c.call(t,"type")?t.type:t,v=c.call(t,"namespace")?t.namespace.split("."):[];if(l=d=i=i||r,3!==i.nodeType&&8!==i.nodeType&&!ge.test(m+p.event.triggered)&&(m.indexOf(".")>-1&&(m=(v=m.split(".")).shift(),v.sort()),s=m.indexOf(":")<0&&"on"+m,(t=t[p.expando]?t:new p.Event(m,"object"==typeof t&&t)).isTrigger=o?2:3,t.namespace=v.join("."),t.rnamespace=t.namespace?new RegExp("(^|\\.)"+v.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,t.result=void 0,t.target||(t.target=i),n=null==n?[t]:p.makeArray(n,[t]),f=p.event.special[m]||{},o||!f.trigger||!1!==f.trigger.apply(i,n))){if(!o&&!f.noBubble&&!p.isWindow(i)){for(u=f.delegateType||m,ge.test(u+m)||(l=l.parentNode);l;l=l.parentNode)g.push(l),d=l;d===(i.ownerDocument||r)&&g.push(d.defaultView||d.parentWindow||e)}for(h=0;(l=g[h++])&&!t.isPropagationStopped();)t.type=h>1?u:f.bindType||m,(a=(p._data(l,"events")||{})[t.type]&&p._data(l,"handle"))&&a.apply(l,n),(a=s&&l[s])&&a.apply&&O(l)&&(t.result=a.apply(l,n),!1===t.result&&t.preventDefault());if(t.type=m,!o&&!t.isDefaultPrevented()&&(!f._default||!1===f._default.apply(g.pop(),n))&&O(i)&&s&&i[m]&&!p.isWindow(i)){(d=i[s])&&(i[s]=null),p.event.triggered=m;try{i[m]()}catch(e){}p.event.triggered=void 0,d&&(i[s]=d)}return t.result}},dispatch:function(e){e=p.event.fix(e);var t,n,r,o,a,s,l=i.call(arguments),u=(p._data(this,"events")||{})[e.type]||[],c=p.event.special[e.type]||{};if(l[0]=e,e.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,e)){for(s=p.event.handlers.call(this,e,u),t=0;(o=s[t++])&&!e.isPropagationStopped();)for(e.currentTarget=o.elem,n=0;(a=o.handlers[n++])&&!e.isImmediatePropagationStopped();)e.rnamespace&&!e.rnamespace.test(a.namespace)||(e.handleObj=a,e.data=a.data,void 0!==(r=((p.event.special[a.origType]||{}).handle||a.handler).apply(o.elem,l))&&!1===(e.result=r)&&(e.preventDefault(),e.stopPropagation()));return c.postDispatch&&c.postDispatch.call(this,e),e.result}},handlers:function(e,t){var n,r,i,o,a=[],s=t.delegateCount,l=e.target;if(s&&l.nodeType&&("click"!==e.type||isNaN(e.button)||e.button<1))for(;l!=this;l=l.parentNode||this)if(1===l.nodeType&&(!0!==l.disabled||"click"!==e.type)){for(r=[],n=0;n<s;n++)void 0===r[i=(o=t[n]).selector+" "]&&(r[i]=o.needsContext?p(i,this).index(l)>-1:p.find(i,this,null,[l]).length),r[i]&&r.push(o);r.length&&a.push({elem:l,handlers:r})}return s<t.length&&a.push({elem:this,handlers:t.slice(s)}),a},fix:function(e){if(e[p.expando])return e;var t,n,i,o=e.type,a=e,s=this.fixHooks[o];for(s||(this.fixHooks[o]=s=he.test(o)?this.mouseHooks:pe.test(o)?this.keyHooks:{}),i=s.props?this.props.concat(s.props):this.props,e=new p.Event(a),t=i.length;t--;)e[n=i[t]]=a[n];return e.target||(e.target=a.srcElement||r),3===e.target.nodeType&&(e.target=e.target.parentNode),e.metaKey=!!e.metaKey,s.filter?s.filter(e,a):e},props:"altKey bubbles cancelable ctrlKey currentTarget detail eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(e,t){return null==e.which&&(e.which=null!=t.charCode?t.charCode:t.keyCode),e}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(e,t){var n,i,o,a=t.button,s=t.fromElement;return null==e.pageX&&null!=t.clientX&&(o=(i=e.target.ownerDocument||r).documentElement,n=i.body,e.pageX=t.clientX+(o&&o.scrollLeft||n&&n.scrollLeft||0)-(o&&o.clientLeft||n&&n.clientLeft||0),e.pageY=t.clientY+(o&&o.scrollTop||n&&n.scrollTop||0)-(o&&o.clientTop||n&&n.clientTop||0)),!e.relatedTarget&&s&&(e.relatedTarget=s===e.target?t.toElement:s),e.which||void 0===a||(e.which=1&a?1:2&a?3:4&a?2:0),e}},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==xe()&&this.focus)try{return this.focus(),!1}catch(e){}},delegateType:"focusin"},blur:{trigger:function(){if(this===xe()&&this.blur)return this.blur(),!1},delegateType:"focusout"},click:{trigger:function(){if(p.nodeName(this,"input")&&"checkbox"===this.type&&this.click)return this.click(),!1},_default:function(e){return p.nodeName(e.target,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}},simulate:function(e,t,n){var r=p.extend(new p.Event,n,{type:e,isSimulated:!0});p.event.trigger(r,null,t),r.isDefaultPrevented()&&n.preventDefault()}},p.removeEvent=r.removeEventListener?function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)}:function(e,t,n){var r="on"+t;e.detachEvent&&(void 0===e[r]&&(e[r]=null),e.detachEvent(r,n))},p.Event=function(e,t){if(!(this instanceof p.Event))return new p.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?ve:ye):this.type=e,t&&p.extend(this,t),this.timeStamp=e&&e.timeStamp||p.now(),this[p.expando]=!0},p.Event.prototype={constructor:p.Event,isDefaultPrevented:ye,isPropagationStopped:ye,isImmediatePropagationStopped:ye,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=ve,e&&(e.preventDefault?e.preventDefault():e.returnValue=!1)},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=ve,e&&!this.isSimulated&&(e.stopPropagation&&e.stopPropagation(),e.cancelBubble=!0)},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=ve,e&&e.stopImmediatePropagation&&e.stopImmediatePropagation(),this.stopPropagation()}},p.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,t){p.event.special[e]={delegateType:t,bindType:t,handle:function(e){var n,r=e.relatedTarget,i=e.handleObj;return r&&(r===this||p.contains(this,r))||(e.type=i.origType,n=i.handler.apply(this,arguments),e.type=t),n}}}),f.submit||(p.event.special.submit={setup:function(){if(p.nodeName(this,"form"))return!1;p.event.add(this,"click._submit keypress._submit",function(e){var t=e.target,n=p.nodeName(t,"input")||p.nodeName(t,"button")?p.prop(t,"form"):void 0;n&&!p._data(n,"submit")&&(p.event.add(n,"submit._submit",function(e){e._submitBubble=!0}),p._data(n,"submit",!0))})},postDispatch:function(e){e._submitBubble&&(delete e._submitBubble,this.parentNode&&!e.isTrigger&&p.event.simulate("submit",this.parentNode,e))},teardown:function(){if(p.nodeName(this,"form"))return!1;p.event.remove(this,"._submit")}}),f.change||(p.event.special.change={setup:function(){if(de.test(this.nodeName))return"checkbox"!==this.type&&"radio"!==this.type||(p.event.add(this,"propertychange._change",function(e){"checked"===e.originalEvent.propertyName&&(this._justChanged=!0)}),p.event.add(this,"click._change",function(e){this._justChanged&&!e.isTrigger&&(this._justChanged=!1),p.event.simulate("change",this,e)})),!1;p.event.add(this,"beforeactivate._change",function(e){var t=e.target;de.test(t.nodeName)&&!p._data(t,"change")&&(p.event.add(t,"change._change",function(e){!this.parentNode||e.isSimulated||e.isTrigger||p.event.simulate("change",this.parentNode,e)}),p._data(t,"change",!0))})},handle:function(e){var t=e.target;if(this!==t||e.isSimulated||e.isTrigger||"radio"!==t.type&&"checkbox"!==t.type)return e.handleObj.handler.apply(this,arguments)},teardown:function(){return p.event.remove(this,"._change"),!de.test(this.nodeName)}}),f.focusin||p.each({focus:"focusin",blur:"focusout"},function(e,t){var n=function(e){p.event.simulate(t,e.target,p.event.fix(e))};p.event.special[t]={setup:function(){var r=this.ownerDocument||this,i=p._data(r,t);i||r.addEventListener(e,n,!0),p._data(r,t,(i||0)+1)},teardown:function(){var r=this.ownerDocument||this,i=p._data(r,t)-1;i?p._data(r,t,i):(r.removeEventListener(e,n,!0),p._removeData(r,t))}}}),p.fn.extend({on:function(e,t,n,r){return be(this,e,t,n,r)},one:function(e,t,n,r){return be(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,p(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=ye),this.each(function(){p.event.remove(this,e,n,t)})},trigger:function(e,t){return this.each(function(){p.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return p.event.trigger(e,t,n,!0)}});var we=/ jQuery\d+="(?:null|\d+)"/g,Te=new RegExp("<(?:"+re+")[\\s/>]","i"),Ce=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi,Ee=/<script|<style|<link/i,Ne=/checked\s*(?:[^=]|=\s*.checked.)/i,ke=/^true\/(.*)/,Se=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,Ae=ie(r).appendChild(r.createElement("div"));function De(e,t){return p.nodeName(e,"table")&&p.nodeName(11!==t.nodeType?t:t.firstChild,"tr")?e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody")):e}function je(e){return e.type=(null!==p.find.attr(e,"type"))+"/"+e.type,e}function Le(e){var t=ke.exec(e.type);return t?e.type=t[1]:e.removeAttribute("type"),e}function He(e,t){if(1===t.nodeType&&p.hasData(e)){var n,r,i,o=p._data(e),a=p._data(t,o),s=o.events;if(s)for(n in delete a.handle,a.events={},s)for(r=0,i=s[n].length;r<i;r++)p.event.add(t,n,s[n][r]);a.data&&(a.data=p.extend({},a.data))}}function qe(e,t){var n,r,i;if(1===t.nodeType){if(n=t.nodeName.toLowerCase(),!f.noCloneEvent&&t[p.expando]){for(r in(i=p._data(t)).events)p.removeEvent(t,r,i.handle);t.removeAttribute(p.expando)}"script"===n&&t.text!==e.text?(je(t).text=e.text,Le(t)):"object"===n?(t.parentNode&&(t.outerHTML=e.outerHTML),f.html5Clone&&e.innerHTML&&!p.trim(t.innerHTML)&&(t.innerHTML=e.innerHTML)):"input"===n&&Z.test(e.type)?(t.defaultChecked=t.checked=e.checked,t.value!==e.value&&(t.value=e.value)):"option"===n?t.defaultSelected=t.selected=e.defaultSelected:"input"!==n&&"textarea"!==n||(t.defaultValue=e.defaultValue)}}function _e(e,t,n,r){t=o.apply([],t);var i,a,s,l,u,c,d=0,h=e.length,g=h-1,m=t[0],v=p.isFunction(m);if(v||h>1&&"string"==typeof m&&!f.checkClone&&Ne.test(m))return e.each(function(i){var o=e.eq(i);v&&(t[0]=m.call(this,i,o.html())),_e(o,t,n,r)});if(h&&(i=(c=fe(t,e[0].ownerDocument,!1,e,r)).firstChild,1===c.childNodes.length&&(c=i),i||r)){for(s=(l=p.map(ae(c,"script"),je)).length;d<h;d++)a=c,d!==g&&(a=p.clone(a,!0,!0),s&&p.merge(l,ae(a,"script"))),n.call(e[d],a,d);if(s)for(u=l[l.length-1].ownerDocument,p.map(l,Le),d=0;d<s;d++)a=l[d],te.test(a.type||"")&&!p._data(a,"globalEval")&&p.contains(u,a)&&(a.src?p._evalUrl&&p._evalUrl(a.src):p.globalEval((a.text||a.textContent||a.innerHTML||"").replace(Se,"")));c=i=null}return e}function Fe(e,t,n){for(var r,i=t?p.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||p.cleanData(ae(r)),r.parentNode&&(n&&p.contains(r.ownerDocument,r)&&se(ae(r,"script")),r.parentNode.removeChild(r));return e}p.extend({htmlPrefilter:function(e){return e.replace(Ce,"<$1></$2>")},clone:function(e,t,n){var r,i,o,a,s,l=p.contains(e.ownerDocument,e);if(f.html5Clone||p.isXMLDoc(e)||!Te.test("<"+e.nodeName+">")?o=e.cloneNode(!0):(Ae.innerHTML=e.outerHTML,Ae.removeChild(o=Ae.firstChild)),!(f.noCloneEvent&&f.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||p.isXMLDoc(e)))for(r=ae(o),s=ae(e),a=0;null!=(i=s[a]);++a)r[a]&&qe(i,r[a]);if(t)if(n)for(s=s||ae(e),r=r||ae(o),a=0;null!=(i=s[a]);a++)He(i,r[a]);else He(e,o);return(r=ae(o,"script")).length>0&&se(r,!l&&ae(e,"script")),r=s=i=null,o},cleanData:function(e,t){for(var r,i,o,a,s=0,l=p.expando,u=p.cache,c=f.attributes,d=p.event.special;null!=(r=e[s]);s++)if((t||O(r))&&(a=(o=r[l])&&u[o])){if(a.events)for(i in a.events)d[i]?p.event.remove(r,i):p.removeEvent(r,i,a.handle);u[o]&&(delete u[o],c||void 0===r.removeAttribute?r[l]=void 0:r.removeAttribute(l),n.push(o))}}}),p.fn.extend({domManip:_e,detach:function(e){return Fe(this,e,!0)},remove:function(e){return Fe(this,e)},text:function(e){return K(this,function(e){return void 0===e?p.text(this):this.empty().append((this[0]&&this[0].ownerDocument||r).createTextNode(e))},null,e,arguments.length)},append:function(){return _e(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||De(this,e).appendChild(e)})},prepend:function(){return _e(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=De(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return _e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return _e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++){for(1===e.nodeType&&p.cleanData(ae(e,!1));e.firstChild;)e.removeChild(e.firstChild);e.options&&p.nodeName(e,"select")&&(e.options.length=0)}return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return p.clone(this,e,t)})},html:function(e){return K(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e)return 1===t.nodeType?t.innerHTML.replace(we,""):void 0;if("string"==typeof e&&!Ee.test(e)&&(f.htmlSerialize||!Te.test(e))&&(f.leadingWhitespace||!ne.test(e))&&!oe[(ee.exec(e)||["",""])[1].toLowerCase()]){e=p.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(p.cleanData(ae(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var e=[];return _e(this,arguments,function(t){var n=this.parentNode;p.inArray(this,e)<0&&(p.cleanData(ae(this)),n&&n.replaceChild(t,this))},e)}}),p.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,t){p.fn[e]=function(e){for(var n,r=0,i=[],o=p(e),s=o.length-1;r<=s;r++)n=r===s?this:this.clone(!0),p(o[r])[t](n),a.apply(i,n.get());return this.pushStack(i)}});var Me,Oe={HTML:"block",BODY:"block"};function Re(e,t){var n=p(t.createElement(e)).appendTo(t.body),r=p.css(n[0],"display");return n.detach(),r}function Pe(e){var t=r,n=Oe[e];return n||("none"!==(n=Re(e,t))&&n||((t=((Me=(Me||p("<iframe frameborder='0' width='0' height='0'/>")).appendTo(t.documentElement))[0].contentWindow||Me[0].contentDocument).document).write(),t.close(),n=Re(e,t),Me.detach()),Oe[e]=n),n}var Be=/^margin/,We=new RegExp("^("+z+")(?!px)[a-z%]+$","i"),Ie=function(e,t,n,r){var i,o,a={};for(o in t)a[o]=e.style[o],e.style[o]=t[o];for(o in i=n.apply(e,r||[]),t)e.style[o]=a[o];return i},$e=r.documentElement;!function(){var t,n,i,o,a,s,l=r.createElement("div"),u=r.createElement("div");function c(){var c,f,d=r.documentElement;d.appendChild(l),u.style.cssText="-webkit-box-sizing:border-box;box-sizing:border-box;position:relative;display:block;margin:auto;border:1px;padding:1px;top:1%;width:50%",t=i=s=!1,n=a=!0,e.getComputedStyle&&(f=e.getComputedStyle(u),t="1%"!==(f||{}).top,s="2px"===(f||{}).marginLeft,i="4px"===(f||{width:"4px"}).width,u.style.marginRight="50%",n="4px"===(f||{marginRight:"4px"}).marginRight,(c=u.appendChild(r.createElement("div"))).style.cssText=u.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:0",c.style.marginRight=c.style.width="0",u.style.width="1px",a=!parseFloat((e.getComputedStyle(c)||{}).marginRight),u.removeChild(c)),u.style.display="none",(o=0===u.getClientRects().length)&&(u.style.display="",u.innerHTML="<table><tr><td></td><td>t</td></tr></table>",u.childNodes[0].style.borderCollapse="separate",(c=u.getElementsByTagName("td"))[0].style.cssText="margin:0;border:0;padding:0;display:none",(o=0===c[0].offsetHeight)&&(c[0].style.display="",c[1].style.display="none",o=0===c[0].offsetHeight)),d.removeChild(l)}u.style&&(u.style.cssText="float:left;opacity:.5",f.opacity="0.5"===u.style.opacity,f.cssFloat=!!u.style.cssFloat,u.style.backgroundClip="content-box",u.cloneNode(!0).style.backgroundClip="",f.clearCloneStyle="content-box"===u.style.backgroundClip,(l=r.createElement("div")).style.cssText="border:0;width:8px;height:0;top:0;left:-9999px;padding:0;margin-top:1px;position:absolute",u.innerHTML="",l.appendChild(u),f.boxSizing=""===u.style.boxSizing||""===u.style.MozBoxSizing||""===u.style.WebkitBoxSizing,p.extend(f,{reliableHiddenOffsets:function(){return null==t&&c(),o},boxSizingReliable:function(){return null==t&&c(),i},pixelMarginRight:function(){return null==t&&c(),n},pixelPosition:function(){return null==t&&c(),t},reliableMarginRight:function(){return null==t&&c(),a},reliableMarginLeft:function(){return null==t&&c(),s}}))}();var ze,Xe,Ue=/^(top|right|bottom|left)$/;function Ve(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}e.getComputedStyle?(ze=function(t){var n=t.ownerDocument.defaultView;return n&&n.opener||(n=e),n.getComputedStyle(t)},Xe=function(e,t,n){var r,i,o,a,s=e.style;return""!==(a=(n=n||ze(e))?n.getPropertyValue(t)||n[t]:void 0)&&void 0!==a||p.contains(e.ownerDocument,e)||(a=p.style(e,t)),n&&!f.pixelMarginRight()&&We.test(a)&&Be.test(t)&&(r=s.width,i=s.minWidth,o=s.maxWidth,s.minWidth=s.maxWidth=s.width=a,a=n.width,s.width=r,s.minWidth=i,s.maxWidth=o),void 0===a?a:a+""}):$e.currentStyle&&(ze=function(e){return e.currentStyle},Xe=function(e,t,n){var r,i,o,a,s=e.style;return null==(a=(n=n||ze(e))?n[t]:void 0)&&s&&s[t]&&(a=s[t]),We.test(a)&&!Ue.test(t)&&(r=s.left,(o=(i=e.runtimeStyle)&&i.left)&&(i.left=e.currentStyle.left),s.left="fontSize"===t?"1em":a,a=s.pixelLeft+"px",s.left=r,o&&(i.left=o)),void 0===a?a:a+""||"auto"});var Ye=/alpha\([^)]*\)/i,Je=/opacity\s*=\s*([^)]*)/i,Ge=/^(none|table(?!-c[ea]).+)/,Qe=new RegExp("^("+z+")(.*)$","i"),Ke={position:"absolute",visibility:"hidden",display:"block"},Ze={letterSpacing:"0",fontWeight:"400"},et=["Webkit","O","Moz","ms"],tt=r.createElement("div").style;function nt(e){if(e in tt)return e;for(var t=e.charAt(0).toUpperCase()+e.slice(1),n=et.length;n--;)if((e=et[n]+t)in tt)return e}function rt(e,t){for(var n,r,i,o=[],a=0,s=e.length;a<s;a++)(r=e[a]).style&&(o[a]=p._data(r,"olddisplay"),n=r.style.display,t?(o[a]||"none"!==n||(r.style.display=""),""===r.style.display&&V(r)&&(o[a]=p._data(r,"olddisplay",Pe(r.nodeName)))):(i=V(r),(n&&"none"!==n||!i)&&p._data(r,"olddisplay",i?n:p.css(r,"display"))));for(a=0;a<s;a++)(r=e[a]).style&&(t&&"none"!==r.style.display&&""!==r.style.display||(r.style.display=t?o[a]||"":"none"));return e}function it(e,t,n){var r=Qe.exec(t);return r?Math.max(0,r[1]-(n||0))+(r[2]||"px"):t}function ot(e,t,n,r,i){for(var o=n===(r?"border":"content")?4:"width"===t?1:0,a=0;o<4;o+=2)"margin"===n&&(a+=p.css(e,n+U[o],!0,i)),r?("content"===n&&(a-=p.css(e,"padding"+U[o],!0,i)),"margin"!==n&&(a-=p.css(e,"border"+U[o]+"Width",!0,i))):(a+=p.css(e,"padding"+U[o],!0,i),"padding"!==n&&(a+=p.css(e,"border"+U[o]+"Width",!0,i)));return a}function at(e,t,n){var r=!0,i="width"===t?e.offsetWidth:e.offsetHeight,o=ze(e),a=f.boxSizing&&"border-box"===p.css(e,"boxSizing",!1,o);if(i<=0||null==i){if(((i=Xe(e,t,o))<0||null==i)&&(i=e.style[t]),We.test(i))return i;r=a&&(f.boxSizingReliable()||i===e.style[t]),i=parseFloat(i)||0}return i+ot(e,t,n||(a?"border":"content"),r,o)+"px"}function st(e,t,n,r,i){return new st.prototype.init(e,t,n,r,i)}p.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Xe(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{float:f.cssFloat?"cssFloat":"styleFloat"},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=p.camelCase(t),l=e.style;if(t=p.cssProps[s]||(p.cssProps[s]=nt(s)||s),a=p.cssHooks[t]||p.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];if("string"===(o=typeof n)&&(i=X.exec(n))&&i[1]&&(n=Y(e,t,i),o="number"),null!=n&&n==n&&("number"===o&&(n+=i&&i[3]||(p.cssNumber[s]?"":"px")),f.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),!(a&&"set"in a&&void 0===(n=a.set(e,n,r)))))try{l[t]=n}catch(e){}}},css:function(e,t,n,r){var i,o,a,s=p.camelCase(t);return t=p.cssProps[s]||(p.cssProps[s]=nt(s)||s),(a=p.cssHooks[t]||p.cssHooks[s])&&"get"in a&&(o=a.get(e,!0,n)),void 0===o&&(o=Xe(e,t,r)),"normal"===o&&t in Ze&&(o=Ze[t]),""===n||n?(i=parseFloat(o),!0===n||isFinite(i)?i||0:o):o}}),p.each(["height","width"],function(e,t){p.cssHooks[t]={get:function(e,n,r){if(n)return Ge.test(p.css(e,"display"))&&0===e.offsetWidth?Ie(e,Ke,function(){return at(e,t,r)}):at(e,t,r)},set:function(e,n,r){var i=r&&ze(e);return it(0,n,r?ot(e,t,r,f.boxSizing&&"border-box"===p.css(e,"boxSizing",!1,i),i):0)}}}),f.opacity||(p.cssHooks.opacity={get:function(e,t){return Je.test((t&&e.currentStyle?e.currentStyle.filter:e.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":t?"1":""},set:function(e,t){var n=e.style,r=e.currentStyle,i=p.isNumeric(t)?"alpha(opacity="+100*t+")":"",o=r&&r.filter||n.filter||"";n.zoom=1,(t>=1||""===t)&&""===p.trim(o.replace(Ye,""))&&n.removeAttribute&&(n.removeAttribute("filter"),""===t||r&&!r.filter)||(n.filter=Ye.test(o)?o.replace(Ye,i):o+" "+i)}}),p.cssHooks.marginRight=Ve(f.reliableMarginRight,function(e,t){if(t)return Ie(e,{display:"inline-block"},Xe,[e,"marginRight"])}),p.cssHooks.marginLeft=Ve(f.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Xe(e,"marginLeft"))||(p.contains(e.ownerDocument,e)?e.getBoundingClientRect().left-Ie(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}):0))+"px"}),p.each({margin:"",padding:"",border:"Width"},function(e,t){p.cssHooks[e+t]={expand:function(n){for(var r=0,i={},o="string"==typeof n?n.split(" "):[n];r<4;r++)i[e+U[r]+t]=o[r]||o[r-2]||o[0];return i}},Be.test(e)||(p.cssHooks[e+t].set=it)}),p.fn.extend({css:function(e,t){return K(this,function(e,t,n){var r,i,o={},a=0;if(p.isArray(t)){for(r=ze(e),i=t.length;a<i;a++)o[t[a]]=p.css(e,t[a],!1,r);return o}return void 0!==n?p.style(e,t,n):p.css(e,t)},e,t,arguments.length>1)},show:function(){return rt(this,!0)},hide:function(){return rt(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){V(this)?p(this).show():p(this).hide()})}}),p.Tween=st,st.prototype={constructor:st,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||p.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(p.cssNumber[n]?"":"px")},cur:function(){var e=st.propHooks[this.prop];return e&&e.get?e.get(this):st.propHooks._default.get(this)},run:function(e){var t,n=st.propHooks[this.prop];return this.options.duration?this.pos=t=p.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):st.propHooks._default.set(this),this}},st.prototype.init.prototype=st.prototype,st.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=p.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){p.fx.step[e.prop]?p.fx.step[e.prop](e):1!==e.elem.nodeType||null==e.elem.style[p.cssProps[e.prop]]&&!p.cssHooks[e.prop]?e.elem[e.prop]=e.now:p.style(e.elem,e.prop,e.now+e.unit)}}},st.propHooks.scrollTop=st.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},p.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},p.fx=st.prototype.init,p.fx.step={};var lt,ut,ct,ft,dt,pt,ht,gt=/^(?:toggle|show|hide)$/,mt=/queueHooks$/;function vt(){return e.setTimeout(function(){lt=void 0}),lt=p.now()}function yt(e,t){var n,r={height:e},i=0;for(t=t?1:0;i<4;i+=2-t)r["margin"+(n=U[i])]=r["padding"+n]=e;return t&&(r.opacity=r.width=e),r}function xt(e,t,n){for(var r,i=(bt.tweeners[t]||[]).concat(bt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function bt(e,t,n){var r,i,o=0,a=bt.prefilters.length,s=p.Deferred().always(function(){delete l.elem}),l=function(){if(i)return!1;for(var t=lt||vt(),n=Math.max(0,u.startTime+u.duration-t),r=1-(n/u.duration||0),o=0,a=u.tweens.length;o<a;o++)u.tweens[o].run(r);return s.notifyWith(e,[u,r,n]),r<1&&a?n:(s.resolveWith(e,[u]),!1)},u=s.promise({elem:e,props:p.extend({},t),opts:p.extend(!0,{specialEasing:{},easing:p.easing._default},n),originalProperties:t,originalOptions:n,startTime:lt||vt(),duration:n.duration,tweens:[],createTween:function(t,n){var r=p.Tween(e,u.opts,t,n,u.opts.specialEasing[t]||u.opts.easing);return u.tweens.push(r),r},stop:function(t){var n=0,r=t?u.tweens.length:0;if(i)return this;for(i=!0;n<r;n++)u.tweens[n].run(1);return t?(s.notifyWith(e,[u,1,0]),s.resolveWith(e,[u,t])):s.rejectWith(e,[u,t]),this}}),c=u.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=p.camelCase(n)],o=e[n],p.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=p.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,u.opts.specialEasing);o<a;o++)if(r=bt.prefilters[o].call(u,e,c,u.opts))return p.isFunction(r.stop)&&(p._queueHooks(u.elem,u.opts.queue).stop=p.proxy(r.stop,r)),r;return p.map(c,xt,u),p.isFunction(u.opts.start)&&u.opts.start.call(e,u),p.fx.timer(p.extend(l,{elem:e,anim:u,queue:u.opts.queue})),u.progress(u.opts.progress).done(u.opts.done,u.opts.complete).fail(u.opts.fail).always(u.opts.always)}p.Animation=p.extend(bt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return Y(n.elem,e,X.exec(t),n),n}]},tweener:function(e,t){p.isFunction(e)?(t=e,e=["*"]):e=e.match(q);for(var n,r=0,i=e.length;r<i;r++)n=e[r],bt.tweeners[n]=bt.tweeners[n]||[],bt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,l,u,c=this,d={},h=e.style,g=e.nodeType&&V(e),m=p._data(e,"fxshow");for(r in n.queue||(null==(s=p._queueHooks(e,"fx")).unqueued&&(s.unqueued=0,l=s.empty.fire,s.empty.fire=function(){s.unqueued||l()}),s.unqueued++,c.always(function(){c.always(function(){s.unqueued--,p.queue(e,"fx").length||s.empty.fire()})})),1===e.nodeType&&("height"in t||"width"in t)&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],"inline"===("none"===(u=p.css(e,"display"))?p._data(e,"olddisplay")||Pe(e.nodeName):u)&&"none"===p.css(e,"float")&&(f.inlineBlockNeedsLayout&&"inline"!==Pe(e.nodeName)?h.zoom=1:h.display="inline-block")),n.overflow&&(h.overflow="hidden",f.shrinkWrapBlocks()||c.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),t)if(i=t[r],gt.exec(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!m||void 0===m[r])continue;g=!0}d[r]=m&&m[r]||p.style(e,r)}else u=void 0;if(p.isEmptyObject(d))"inline"===("none"===u?Pe(e.nodeName):u)&&(h.display=u);else for(r in m?"hidden"in m&&(g=m.hidden):m=p._data(e,"fxshow",{}),o&&(m.hidden=!g),g?p(e).show():c.done(function(){p(e).hide()}),c.done(function(){var t;for(t in p._removeData(e,"fxshow"),d)p.style(e,t,d[t])}),d)a=xt(g?m[r]:0,r,c),r in m||(m[r]=a.start,g&&(a.end=a.start,a.start="width"===r||"height"===r?1:0))}],prefilter:function(e,t){t?bt.prefilters.unshift(e):bt.prefilters.push(e)}}),p.speed=function(e,t,n){var r=e&&"object"==typeof e?p.extend({},e):{complete:n||!n&&t||p.isFunction(e)&&e,duration:e,easing:n&&t||t&&!p.isFunction(t)&&t};return r.duration=p.fx.off?0:"number"==typeof r.duration?r.duration:r.duration in p.fx.speeds?p.fx.speeds[r.duration]:p.fx.speeds._default,null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){p.isFunction(r.old)&&r.old.call(this),r.queue&&p.dequeue(this,r.queue)},r},p.fn.extend({fadeTo:function(e,t,n,r){return this.filter(V).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(e,t,n,r){var i=p.isEmptyObject(e),o=p.speed(t,n,r),a=function(){var t=bt(this,p.extend({},e),o);(i||p._data(this,"finish"))&&t.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(e,t,n){var r=function(e){var t=e.stop;delete e.stop,t(n)};return"string"!=typeof e&&(n=t,t=e,e=void 0),t&&!1!==e&&this.queue(e||"fx",[]),this.each(function(){var t=!0,i=null!=e&&e+"queueHooks",o=p.timers,a=p._data(this);if(i)a[i]&&a[i].stop&&r(a[i]);else for(i in a)a[i]&&a[i].stop&&mt.test(i)&&r(a[i]);for(i=o.length;i--;)o[i].elem!==this||null!=e&&o[i].queue!==e||(o[i].anim.stop(n),t=!1,o.splice(i,1));!t&&n||p.dequeue(this,e)})},finish:function(e){return!1!==e&&(e=e||"fx"),this.each(function(){var t,n=p._data(this),r=n[e+"queue"],i=n[e+"queueHooks"],o=p.timers,a=r?r.length:0;for(n.finish=!0,p.queue(this,e,[]),i&&i.stop&&i.stop.call(this,!0),t=o.length;t--;)o[t].elem===this&&o[t].queue===e&&(o[t].anim.stop(!0),o.splice(t,1));for(t=0;t<a;t++)r[t]&&r[t].finish&&r[t].finish.call(this);delete n.finish})}}),p.each(["toggle","show","hide"],function(e,t){var n=p.fn[t];p.fn[t]=function(e,r,i){return null==e||"boolean"==typeof e?n.apply(this,arguments):this.animate(yt(t,!0),e,r,i)}}),p.each({slideDown:yt("show"),slideUp:yt("hide"),slideToggle:yt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,t){p.fn[e]=function(e,n,r){return this.animate(t,e,n,r)}}),p.timers=[],p.fx.tick=function(){var e,t=p.timers,n=0;for(lt=p.now();n<t.length;n++)(e=t[n])()||t[n]!==e||t.splice(n--,1);t.length||p.fx.stop(),lt=void 0},p.fx.timer=function(e){p.timers.push(e),e()?p.fx.start():p.timers.pop()},p.fx.interval=13,p.fx.start=function(){ut||(ut=e.setInterval(p.fx.tick,p.fx.interval))},p.fx.stop=function(){e.clearInterval(ut),ut=null},p.fx.speeds={slow:600,fast:200,_default:400},p.fn.delay=function(t,n){return t=p.fx&&p.fx.speeds[t]||t,n=n||"fx",this.queue(n,function(n,r){var i=e.setTimeout(n,t);r.stop=function(){e.clearTimeout(i)}})},ft=r.createElement("input"),dt=r.createElement("div"),pt=r.createElement("select"),ht=pt.appendChild(r.createElement("option")),(dt=r.createElement("div")).setAttribute("className","t"),dt.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",ct=dt.getElementsByTagName("a")[0],ft.setAttribute("type","checkbox"),dt.appendChild(ft),(ct=dt.getElementsByTagName("a")[0]).style.cssText="top:1px",f.getSetAttribute="t"!==dt.className,f.style=/top/.test(ct.getAttribute("style")),f.hrefNormalized="/a"===ct.getAttribute("href"),f.checkOn=!!ft.value,f.optSelected=ht.selected,f.enctype=!!r.createElement("form").enctype,pt.disabled=!0,f.optDisabled=!ht.disabled,(ft=r.createElement("input")).setAttribute("value",""),f.input=""===ft.getAttribute("value"),ft.value="t",ft.setAttribute("type","radio"),f.radioValue="t"===ft.value;var wt=/\r/g,Tt=/[\x20\t\r\n\f]+/g;p.fn.extend({val:function(e){var t,n,r,i=this[0];return arguments.length?(r=p.isFunction(e),this.each(function(n){var i;1===this.nodeType&&(null==(i=r?e.call(this,n,p(this).val()):e)?i="":"number"==typeof i?i+="":p.isArray(i)&&(i=p.map(i,function(e){return null==e?"":e+""})),(t=p.valHooks[this.type]||p.valHooks[this.nodeName.toLowerCase()])&&"set"in t&&void 0!==t.set(this,i,"value")||(this.value=i))})):i?(t=p.valHooks[i.type]||p.valHooks[i.nodeName.toLowerCase()])&&"get"in t&&void 0!==(n=t.get(i,"value"))?n:"string"==typeof(n=i.value)?n.replace(wt,""):null==n?"":n:void 0}}),p.extend({valHooks:{option:{get:function(e){var t=p.find.attr(e,"value");return null!=t?t:p.trim(p.text(e)).replace(Tt," ")}},select:{get:function(e){for(var t,n,r=e.options,i=e.selectedIndex,o="select-one"===e.type||i<0,a=o?null:[],s=o?i+1:r.length,l=i<0?s:o?i:0;l<s;l++)if(((n=r[l]).selected||l===i)&&(f.optDisabled?!n.disabled:null===n.getAttribute("disabled"))&&(!n.parentNode.disabled||!p.nodeName(n.parentNode,"optgroup"))){if(t=p(n).val(),o)return t;a.push(t)}return a},set:function(e,t){for(var n,r,i=e.options,o=p.makeArray(t),a=i.length;a--;)if(r=i[a],p.inArray(p.valHooks.option.get(r),o)>-1)try{r.selected=n=!0}catch(e){r.scrollHeight}else r.selected=!1;return n||(e.selectedIndex=-1),i}}}}),p.each(["radio","checkbox"],function(){p.valHooks[this]={set:function(e,t){if(p.isArray(t))return e.checked=p.inArray(p(e).val(),t)>-1}},f.checkOn||(p.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})});var Ct,Et,Nt=p.expr.attrHandle,kt=/^(?:checked|selected)$/i,St=f.getSetAttribute,At=f.input;p.fn.extend({attr:function(e,t){return K(this,p.attr,e,t,arguments.length>1)},removeAttr:function(e){return this.each(function(){p.removeAttr(this,e)})}}),p.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return void 0===e.getAttribute?p.prop(e,t,n):(1===o&&p.isXMLDoc(e)||(t=t.toLowerCase(),i=p.attrHooks[t]||(p.expr.match.bool.test(t)?Et:Ct)),void 0!==n?null===n?void p.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=p.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!f.radioValue&&"radio"===t&&p.nodeName(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r,i=0,o=t&&t.match(q);if(o&&1===e.nodeType)for(;n=o[i++];)r=p.propFix[n]||n,p.expr.match.bool.test(n)?At&&St||!kt.test(n)?e[r]=!1:e[p.camelCase("default-"+n)]=e[r]=!1:p.attr(e,n,""),e.removeAttribute(St?n:r)}}),Et={set:function(e,t,n){return!1===t?p.removeAttr(e,n):At&&St||!kt.test(n)?e.setAttribute(!St&&p.propFix[n]||n,n):e[p.camelCase("default-"+n)]=e[n]=!0,n}},p.each(p.expr.match.bool.source.match(/\w+/g),function(e,t){var n=Nt[t]||p.find.attr;At&&St||!kt.test(t)?Nt[t]=function(e,t,r){var i,o;return r||(o=Nt[t],Nt[t]=i,i=null!=n(e,t,r)?t.toLowerCase():null,Nt[t]=o),i}:Nt[t]=function(e,t,n){if(!n)return e[p.camelCase("default-"+t)]?t.toLowerCase():null}}),At&&St||(p.attrHooks.value={set:function(e,t,n){if(!p.nodeName(e,"input"))return Ct&&Ct.set(e,t,n);e.defaultValue=t}}),St||(Ct={set:function(e,t,n){var r=e.getAttributeNode(n);if(r||e.setAttributeNode(r=e.ownerDocument.createAttribute(n)),r.value=t+="","value"===n||t===e.getAttribute(n))return t}},Nt.id=Nt.name=Nt.coords=function(e,t,n){var r;if(!n)return(r=e.getAttributeNode(t))&&""!==r.value?r.value:null},p.valHooks.button={get:function(e,t){var n=e.getAttributeNode(t);if(n&&n.specified)return n.value},set:Ct.set},p.attrHooks.contenteditable={set:function(e,t,n){Ct.set(e,""!==t&&t,n)}},p.each(["width","height"],function(e,t){p.attrHooks[t]={set:function(e,n){if(""===n)return e.setAttribute(t,"auto"),n}}})),f.style||(p.attrHooks.style={get:function(e){return e.style.cssText||void 0},set:function(e,t){return e.style.cssText=t+""}});var Dt=/^(?:input|select|textarea|button|object)$/i,jt=/^(?:a|area)$/i;p.fn.extend({prop:function(e,t){return K(this,p.prop,e,t,arguments.length>1)},removeProp:function(e){return e=p.propFix[e]||e,this.each(function(){try{this[e]=void 0,delete this[e]}catch(e){}})}}),p.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&p.isXMLDoc(e)||(t=p.propFix[t]||t,i=p.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=p.find.attr(e,"tabindex");return t?parseInt(t,10):Dt.test(e.nodeName)||jt.test(e.nodeName)&&e.href?0:-1}}},propFix:{for:"htmlFor",class:"className"}}),f.hrefNormalized||p.each(["href","src"],function(e,t){p.propHooks[t]={get:function(e){return e.getAttribute(t,4)}}}),f.optSelected||(p.propHooks.selected={get:function(e){var t=e.parentNode;return t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex),null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),p.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){p.propFix[this.toLowerCase()]=this}),f.enctype||(p.propFix.enctype="encoding");var Lt=/[\t\r\n\f]/g;function Ht(e){return p.attr(e,"class")||""}p.fn.extend({addClass:function(e){var t,n,r,i,o,a,s,l=0;if(p.isFunction(e))return this.each(function(t){p(this).addClass(e.call(this,t,Ht(this)))});if("string"==typeof e&&e)for(t=e.match(q)||[];n=this[l++];)if(i=Ht(n),r=1===n.nodeType&&(" "+i+" ").replace(Lt," ")){for(a=0;o=t[a++];)r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=p.trim(r))&&p.attr(n,"class",s)}return this},removeClass:function(e){var t,n,r,i,o,a,s,l=0;if(p.isFunction(e))return this.each(function(t){p(this).removeClass(e.call(this,t,Ht(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof e&&e)for(t=e.match(q)||[];n=this[l++];)if(i=Ht(n),r=1===n.nodeType&&(" "+i+" ").replace(Lt," ")){for(a=0;o=t[a++];)for(;r.indexOf(" "+o+" ")>-1;)r=r.replace(" "+o+" "," ");i!==(s=p.trim(r))&&p.attr(n,"class",s)}return this},toggleClass:function(e,t){var n=typeof e;return"boolean"==typeof t&&"string"===n?t?this.addClass(e):this.removeClass(e):p.isFunction(e)?this.each(function(n){p(this).toggleClass(e.call(this,n,Ht(this),t),t)}):this.each(function(){var t,r,i,o;if("string"===n)for(r=0,i=p(this),o=e.match(q)||[];t=o[r++];)i.hasClass(t)?i.removeClass(t):i.addClass(t);else void 0!==e&&"boolean"!==n||((t=Ht(this))&&p._data(this,"__className__",t),p.attr(this,"class",t||!1===e?"":p._data(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;for(t=" "+e+" ";n=this[r++];)if(1===n.nodeType&&(" "+Ht(n)+" ").replace(Lt," ").indexOf(t)>-1)return!0;return!1}}),p.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(e,t){p.fn[t]=function(e,n){return arguments.length>0?this.on(t,null,e,n):this.trigger(t)}}),p.fn.extend({hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}});var qt=e.location,_t=p.now(),Ft=/\?/,Mt=/(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;p.parseJSON=function(t){if(e.JSON&&e.JSON.parse)return e.JSON.parse(t+"");var n,r=null,i=p.trim(t+"");return i&&!p.trim(i.replace(Mt,function(e,t,i,o){return n&&t&&(r=0),0===r?e:(n=i||t,r+=!o-!i,"")}))?Function("return "+i)():p.error("Invalid JSON: "+t)},p.parseXML=function(t){var n,r;if(!t||"string"!=typeof t)return null;try{e.DOMParser?(r=new e.DOMParser,n=r.parseFromString(t,"text/xml")):((n=new e.ActiveXObject("Microsoft.XMLDOM")).async="false",n.loadXML(t))}catch(e){n=void 0}return n&&n.documentElement&&!n.getElementsByTagName("parsererror").length||p.error("Invalid XML: "+t),n};var Ot=/#.*$/,Rt=/([?&])_=[^&]*/,Pt=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,Bt=/^(?:GET|HEAD)$/,Wt=/^\/\//,It=/^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,$t={},zt={},Xt="*/".concat("*"),Ut=qt.href,Vt=It.exec(Ut.toLowerCase())||[];function Yt(e){return function(t,n){"string"!=typeof t&&(n=t,t="*");var r,i=0,o=t.toLowerCase().match(q)||[];if(p.isFunction(n))for(;r=o[i++];)"+"===r.charAt(0)?(r=r.slice(1)||"*",(e[r]=e[r]||[]).unshift(n)):(e[r]=e[r]||[]).push(n)}}function Jt(e,t,n,r){var i={},o=e===zt;function a(s){var l;return i[s]=!0,p.each(e[s]||[],function(e,s){var u=s(t,n,r);return"string"!=typeof u||o||i[u]?o?!(l=u):void 0:(t.dataTypes.unshift(u),a(u),!1)}),l}return a(t.dataTypes[0])||!i["*"]&&a("*")}function Gt(e,t){var n,r,i=p.ajaxSettings.flatOptions||{};for(r in t)void 0!==t[r]&&((i[r]?e:n||(n={}))[r]=t[r]);return n&&p.extend(!0,e,n),e}p.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Ut,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Vt[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Xt,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":p.parseJSON,"text xml":p.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?Gt(Gt(e,p.ajaxSettings),t):Gt(p.ajaxSettings,e)},ajaxPrefilter:Yt($t),ajaxTransport:Yt(zt),ajax:function(t,n){"object"==typeof t&&(n=t,t=void 0),n=n||{};var r,i,o,a,s,l,u,c,f=p.ajaxSetup({},n),d=f.context||f,h=f.context&&(d.nodeType||d.jquery)?p(d):p.event,g=p.Deferred(),m=p.Callbacks("once memory"),v=f.statusCode||{},y={},x={},b=0,w="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(2===b){if(!c)for(c={};t=Pt.exec(a);)c[t[1].toLowerCase()]=t[2];t=c[e.toLowerCase()]}return null==t?null:t},getAllResponseHeaders:function(){return 2===b?a:null},setRequestHeader:function(e,t){var n=e.toLowerCase();return b||(e=x[n]=x[n]||e,y[e]=t),this},overrideMimeType:function(e){return b||(f.mimeType=e),this},statusCode:function(e){var t;if(e)if(b<2)for(t in e)v[t]=[v[t],e[t]];else T.always(e[T.status]);return this},abort:function(e){var t=e||w;return u&&u.abort(t),C(0,t),this}};if(g.promise(T).complete=m.add,T.success=T.done,T.error=T.fail,f.url=((t||f.url||Ut)+"").replace(Ot,"").replace(Wt,Vt[1]+"//"),f.type=n.method||n.type||f.method||f.type,f.dataTypes=p.trim(f.dataType||"*").toLowerCase().match(q)||[""],null==f.crossDomain&&(r=It.exec(f.url.toLowerCase()),f.crossDomain=!(!r||r[1]===Vt[1]&&r[2]===Vt[2]&&(r[3]||("http:"===r[1]?"80":"443"))===(Vt[3]||("http:"===Vt[1]?"80":"443")))),f.data&&f.processData&&"string"!=typeof f.data&&(f.data=p.param(f.data,f.traditional)),Jt($t,f,n,T),2===b)return T;for(i in(l=p.event&&f.global)&&0==p.active++&&p.event.trigger("ajaxStart"),f.type=f.type.toUpperCase(),f.hasContent=!Bt.test(f.type),o=f.url,f.hasContent||(f.data&&(o=f.url+=(Ft.test(o)?"&":"?")+f.data,delete f.data),!1===f.cache&&(f.url=Rt.test(o)?o.replace(Rt,"$1_="+_t++):o+(Ft.test(o)?"&":"?")+"_="+_t++)),f.ifModified&&(p.lastModified[o]&&T.setRequestHeader("If-Modified-Since",p.lastModified[o]),p.etag[o]&&T.setRequestHeader("If-None-Match",p.etag[o])),(f.data&&f.hasContent&&!1!==f.contentType||n.contentType)&&T.setRequestHeader("Content-Type",f.contentType),T.setRequestHeader("Accept",f.dataTypes[0]&&f.accepts[f.dataTypes[0]]?f.accepts[f.dataTypes[0]]+("*"!==f.dataTypes[0]?", "+Xt+"; q=0.01":""):f.accepts["*"]),f.headers)T.setRequestHeader(i,f.headers[i]);if(f.beforeSend&&(!1===f.beforeSend.call(d,T,f)||2===b))return T.abort();for(i in w="abort",{success:1,error:1,complete:1})T[i](f[i]);if(u=Jt(zt,f,n,T)){if(T.readyState=1,l&&h.trigger("ajaxSend",[T,f]),2===b)return T;f.async&&f.timeout>0&&(s=e.setTimeout(function(){T.abort("timeout")},f.timeout));try{b=1,u.send(y,C)}catch(e){if(!(b<2))throw e;C(-1,e)}}else C(-1,"No Transport");function C(t,n,r,i){var c,y,x,w,C,E=n;2!==b&&(b=2,s&&e.clearTimeout(s),u=void 0,a=i||"",T.readyState=t>0?4:0,c=t>=200&&t<300||304===t,r&&(w=function(e,t,n){for(var r,i,o,a,s=e.contents,l=e.dataTypes;"*"===l[0];)l.shift(),void 0===i&&(i=e.mimeType||t.getResponseHeader("Content-Type"));if(i)for(a in s)if(s[a]&&s[a].test(i)){l.unshift(a);break}if(l[0]in n)o=l[0];else{for(a in n){if(!l[0]||e.converters[a+" "+l[0]]){o=a;break}r||(r=a)}o=o||r}if(o)return o!==l[0]&&l.unshift(o),n[o]}(f,T,r)),w=function(e,t,n,r){var i,o,a,s,l,u={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)u[a.toLowerCase()]=e.converters[a];for(o=c.shift();o;)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!l&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),l=o,o=c.shift())if("*"===o)o=l;else if("*"!==l&&l!==o){if(!(a=u[l+" "+o]||u["* "+o]))for(i in u)if((s=i.split(" "))[1]===o&&(a=u[l+" "+s[0]]||u["* "+s[0]])){!0===a?a=u[i]:!0!==u[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e.throws)t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+l+" to "+o}}}return{state:"success",data:t}}(f,w,T,c),c?(f.ifModified&&((C=T.getResponseHeader("Last-Modified"))&&(p.lastModified[o]=C),(C=T.getResponseHeader("etag"))&&(p.etag[o]=C)),204===t||"HEAD"===f.type?E="nocontent":304===t?E="notmodified":(E=w.state,y=w.data,c=!(x=w.error))):(x=E,!t&&E||(E="error",t<0&&(t=0))),T.status=t,T.statusText=(n||E)+"",c?g.resolveWith(d,[y,E,T]):g.rejectWith(d,[T,E,x]),T.statusCode(v),v=void 0,l&&h.trigger(c?"ajaxSuccess":"ajaxError",[T,f,c?y:x]),m.fireWith(d,[T,E]),l&&(h.trigger("ajaxComplete",[T,f]),--p.active||p.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return p.get(e,t,n,"json")},getScript:function(e,t){return p.get(e,void 0,t,"script")}}),p.each(["get","post"],function(e,t){p[t]=function(e,n,r,i){return p.isFunction(n)&&(i=i||r,r=n,n=void 0),p.ajax(p.extend({url:e,type:t,dataType:i,data:n,success:r},p.isPlainObject(e)&&e))}}),p._evalUrl=function(e){return p.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,throws:!0})},p.fn.extend({wrapAll:function(e){if(p.isFunction(e))return this.each(function(t){p(this).wrapAll(e.call(this,t))});if(this[0]){var t=p(e,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){for(var e=this;e.firstChild&&1===e.firstChild.nodeType;)e=e.firstChild;return e}).append(this)}return this},wrapInner:function(e){return p.isFunction(e)?this.each(function(t){p(this).wrapInner(e.call(this,t))}):this.each(function(){var t=p(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=p.isFunction(e);return this.each(function(n){p(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(){return this.parent().each(function(){p.nodeName(this,"body")||p(this).replaceWith(this.childNodes)}).end()}}),p.expr.filters.hidden=function(e){return f.reliableHiddenOffsets()?e.offsetWidth<=0&&e.offsetHeight<=0&&!e.getClientRects().length:function(e){if(!p.contains(e.ownerDocument||r,e))return!0;for(;e&&1===e.nodeType;){if("none"===((t=e).style&&t.style.display||p.css(t,"display"))||"hidden"===e.type)return!0;e=e.parentNode}var t;return!1}(e)},p.expr.filters.visible=function(e){return!p.expr.filters.hidden(e)};var Qt=/%20/g,Kt=/\[\]$/,Zt=/\r?\n/g,en=/^(?:submit|button|image|reset|file)$/i,tn=/^(?:input|select|textarea|keygen)/i;function nn(e,t,n,r){var i;if(p.isArray(t))p.each(t,function(t,i){n||Kt.test(e)?r(e,i):nn(e+"["+("object"==typeof i&&null!=i?t:"")+"]",i,n,r)});else if(n||"object"!==p.type(t))r(e,t);else for(i in t)nn(e+"["+i+"]",t[i],n,r)}p.param=function(e,t){var n,r=[],i=function(e,t){t=p.isFunction(t)?t():null==t?"":t,r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(t)};if(void 0===t&&(t=p.ajaxSettings&&p.ajaxSettings.traditional),p.isArray(e)||e.jquery&&!p.isPlainObject(e))p.each(e,function(){i(this.name,this.value)});else for(n in e)nn(n,e[n],t,i);return r.join("&").replace(Qt,"+")},p.fn.extend({serialize:function(){return p.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=p.prop(this,"elements");return e?p.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!p(this).is(":disabled")&&tn.test(this.nodeName)&&!en.test(e)&&(this.checked||!Z.test(e))}).map(function(e,t){var n=p(this).val();return null==n?null:p.isArray(n)?p.map(n,function(e){return{name:t.name,value:e.replace(Zt,"\r\n")}}):{name:t.name,value:n.replace(Zt,"\r\n")}}).get()}}),p.ajaxSettings.xhr=void 0!==e.ActiveXObject?function(){return this.isLocal?ln():r.documentMode>8?sn():/^(get|post|head|put|delete|options)$/i.test(this.type)&&sn()||ln()}:sn;var rn=0,on={},an=p.ajaxSettings.xhr();function sn(){try{return new e.XMLHttpRequest}catch(e){}}function ln(){try{return new e.ActiveXObject("Microsoft.XMLHTTP")}catch(e){}}e.attachEvent&&e.attachEvent("onunload",function(){for(var e in on)on[e](void 0,!0)}),f.cors=!!an&&"withCredentials"in an,(an=f.ajax=!!an)&&p.ajaxTransport(function(t){var n;if(!t.crossDomain||f.cors)return{send:function(r,i){var o,a=t.xhr(),s=++rn;if(a.open(t.type,t.url,t.async,t.username,t.password),t.xhrFields)for(o in t.xhrFields)a[o]=t.xhrFields[o];for(o in t.mimeType&&a.overrideMimeType&&a.overrideMimeType(t.mimeType),t.crossDomain||r["X-Requested-With"]||(r["X-Requested-With"]="XMLHttpRequest"),r)void 0!==r[o]&&a.setRequestHeader(o,r[o]+"");a.send(t.hasContent&&t.data||null),n=function(e,r){var o,l,u;if(n&&(r||4===a.readyState))if(delete on[s],n=void 0,a.onreadystatechange=p.noop,r)4!==a.readyState&&a.abort();else{u={},o=a.status,"string"==typeof a.responseText&&(u.text=a.responseText);try{l=a.statusText}catch(e){l=""}o||!t.isLocal||t.crossDomain?1223===o&&(o=204):o=u.text?200:404}u&&i(o,l,u,a.getAllResponseHeaders())},t.async?4===a.readyState?e.setTimeout(n):a.onreadystatechange=on[s]=n:n()},abort:function(){n&&n(void 0,!0)}}}),p.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return p.globalEval(e),e}}}),p.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET",e.global=!1)}),p.ajaxTransport("script",function(e){if(e.crossDomain){var t,n=r.head||p("head")[0]||r.documentElement;return{send:function(i,o){(t=r.createElement("script")).async=!0,e.scriptCharset&&(t.charset=e.scriptCharset),t.src=e.url,t.onload=t.onreadystatechange=function(e,n){(n||!t.readyState||/loaded|complete/.test(t.readyState))&&(t.onload=t.onreadystatechange=null,t.parentNode&&t.parentNode.removeChild(t),t=null,n||o(200,"success"))},n.insertBefore(t,n.firstChild)},abort:function(){t&&t.onload(void 0,!0)}}}});var un=[],cn=/(=)\?(?=&|$)|\?\?/;p.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=un.pop()||p.expando+"_"+_t++;return this[e]=!0,e}}),p.ajaxPrefilter("json jsonp",function(t,n,r){var i,o,a,s=!1!==t.jsonp&&(cn.test(t.url)?"url":"string"==typeof t.data&&0===(t.contentType||"").indexOf("application/x-www-form-urlencoded")&&cn.test(t.data)&&"data");if(s||"jsonp"===t.dataTypes[0])return i=t.jsonpCallback=p.isFunction(t.jsonpCallback)?t.jsonpCallback():t.jsonpCallback,s?t[s]=t[s].replace(cn,"$1"+i):!1!==t.jsonp&&(t.url+=(Ft.test(t.url)?"&":"?")+t.jsonp+"="+i),t.converters["script json"]=function(){return a||p.error(i+" was not called"),a[0]},t.dataTypes[0]="json",o=e[i],e[i]=function(){a=arguments},r.always(function(){void 0===o?p(e).removeProp(i):e[i]=o,t[i]&&(t.jsonpCallback=n.jsonpCallback,un.push(i)),a&&p.isFunction(o)&&o(a[0]),a=o=void 0}),"script"}),p.parseHTML=function(e,t,n){if(!e||"string"!=typeof e)return null;"boolean"==typeof t&&(n=t,t=!1),t=t||r;var i=C.exec(e),o=!n&&[];return i?[t.createElement(i[1])]:(i=fe([e],t,o),o&&o.length&&p(o).remove(),p.merge([],i.childNodes))};var fn=p.fn.load;function dn(e){return p.isWindow(e)?e:9===e.nodeType&&(e.defaultView||e.parentWindow)}p.fn.load=function(e,t,n){if("string"!=typeof e&&fn)return fn.apply(this,arguments);var r,i,o,a=this,s=e.indexOf(" ");return s>-1&&(r=p.trim(e.slice(s,e.length)),e=e.slice(0,s)),p.isFunction(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),a.length>0&&p.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?p("<div>").append(p.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},p.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){p.fn[t]=function(e){return this.on(t,e)}}),p.expr.filters.animated=function(e){return p.grep(p.timers,function(t){return e===t.elem}).length},p.offset={setOffset:function(e,t,n){var r,i,o,a,s,l,u=p.css(e,"position"),c=p(e),f={};"static"===u&&(e.style.position="relative"),s=c.offset(),o=p.css(e,"top"),l=p.css(e,"left"),("absolute"===u||"fixed"===u)&&p.inArray("auto",[o,l])>-1?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(l)||0),p.isFunction(t)&&(t=t.call(e,n,p.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},p.fn.extend({offset:function(e){if(arguments.length)return void 0===e?this:this.each(function(t){p.offset.setOffset(this,e,t)});var t,n,r={top:0,left:0},i=this[0],o=i&&i.ownerDocument;return o?(t=o.documentElement,p.contains(t,i)?(void 0!==i.getBoundingClientRect&&(r=i.getBoundingClientRect()),n=dn(o),{top:r.top+(n.pageYOffset||t.scrollTop)-(t.clientTop||0),left:r.left+(n.pageXOffset||t.scrollLeft)-(t.clientLeft||0)}):r):void 0},position:function(){if(this[0]){var e,t,n={top:0,left:0},r=this[0];return"fixed"===p.css(r,"position")?t=r.getBoundingClientRect():(e=this.offsetParent(),t=this.offset(),p.nodeName(e[0],"html")||(n=e.offset()),n.top+=p.css(e[0],"borderTopWidth",!0),n.left+=p.css(e[0],"borderLeftWidth",!0)),{top:t.top-n.top-p.css(r,"marginTop",!0),left:t.left-n.left-p.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){for(var e=this.offsetParent;e&&!p.nodeName(e,"html")&&"static"===p.css(e,"position");)e=e.offsetParent;return e||$e})}}),p.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(e,t){var n=/Y/.test(t);p.fn[e]=function(r){return K(this,function(e,r,i){var o=dn(e);if(void 0===i)return o?t in o?o[t]:o.document.documentElement[r]:e[r];o?o.scrollTo(n?p(o).scrollLeft():i,n?i:p(o).scrollTop()):e[r]=i},e,r,arguments.length,null)}}),p.each(["top","left"],function(e,t){p.cssHooks[t]=Ve(f.pixelPosition,function(e,n){if(n)return n=Xe(e,t),We.test(n)?p(e).position()[t]+"px":n})}),p.each({Height:"height",Width:"width"},function(e,t){p.each({padding:"inner"+e,content:t,"":"outer"+e},function(n,r){p.fn[r]=function(r,i){var o=arguments.length&&(n||"boolean"!=typeof r),a=n||(!0===r||!0===i?"margin":"border");return K(this,function(t,n,r){var i;return p.isWindow(t)?t.document.documentElement["client"+e]:9===t.nodeType?(i=t.documentElement,Math.max(t.body["scroll"+e],i["scroll"+e],t.body["offset"+e],i["offset"+e],i["client"+e])):void 0===r?p.css(t,n,a):p.style(t,n,r,a)},t,o?r:void 0,o,null)}})}),p.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)}}),p.fn.size=function(){return this.length},p.fn.andSelf=p.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return p});var pn=e.jQuery,hn=e.$;return p.noConflict=function(t){return e.$===p&&(e.$=hn),t&&e.jQuery===p&&(e.jQuery=pn),p},t||(e.jQuery=e.$=p),p}); \ No newline at end of file diff --git a/www/include/common/javascript/jquery/jquery.ui.widget.js b/www/include/common/javascript/jquery/jquery.ui.widget.js index 9da8673a58baeca0b340b655a09978ec607428b1..a4131b2548ba272dbb575c5bf38b497c2d143a8e 100644 --- a/www/include/common/javascript/jquery/jquery.ui.widget.js +++ b/www/include/common/javascript/jquery/jquery.ui.widget.js @@ -1,282 +1,748 @@ -/* - * jQuery UI Widget 1.8.18+amd - * https://github.com/blueimp/jQuery-File-Upload - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ - -(function (factory) { - if (typeof define === "function" && define.amd) { - // Register as an anonymous AMD module: - define(["jquery"], factory); +/*! jQuery UI - v1.12.1 - 2018-02-10 + * http://jqueryui.com + * Includes: widget.js + * Copyright jQuery Foundation and other contributors; Licensed MIT */ + +(function( factory ) { + if ( typeof define === "function" && define.amd ) { + + // AMD. Register as an anonymous module. + define([ "jquery" ], factory ); + } else { + + // Browser globals + factory( jQuery ); + } +}(function( $ ) { + + $.ui = $.ui || {}; + + var version = $.ui.version = "1.12.1"; + + + /*! + * jQuery UI Widget 1.12.1 + * http://jqueryui.com + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + + //>>label: Widget + //>>group: Core + //>>description: Provides a factory for creating stateful widgets with a common API. + //>>docs: http://api.jqueryui.com/jQuery.widget/ + //>>demos: http://jqueryui.com/widget/ + + + + var widgetUuid = 0; + var widgetSlice = Array.prototype.slice; + + $.cleanData = ( function( orig ) { + return function( elems ) { + var events, elem, i; + for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) { + try { + + // Only trigger remove when necessary to save time + events = $._data( elem, "events" ); + if ( events && events.remove ) { + $( elem ).triggerHandler( "remove" ); + } + + // Http://bugs.jquery.com/ticket/8235 + } catch ( e ) {} + } + orig( elems ); + }; + } )( $.cleanData ); + + $.widget = function( name, base, prototype ) { + var existingConstructor, constructor, basePrototype; + + // ProxiedPrototype allows the provided prototype to remain unmodified + // so that it can be used as a mixin for multiple widgets (#8876) + var proxiedPrototype = {}; + + var namespace = name.split( "." )[ 0 ]; + name = name.split( "." )[ 1 ]; + var fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + if ( $.isArray( prototype ) ) { + prototype = $.extend.apply( null, [ {} ].concat( prototype ) ); + } + + // Create selector for plugin + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + + // Allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // Allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + // Extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + + // Copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + + // Track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + } ); + + basePrototype = new base(); + + // We need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( !$.isFunction( value ) ) { + proxiedPrototype[ prop ] = value; + return; + } + proxiedPrototype[ prop ] = ( function() { + function _super() { + return base.prototype[ prop ].apply( this, arguments ); + } + + function _superApply( args ) { + return base.prototype[ prop ].apply( this, args ); + } + + return function() { + var __super = this._super; + var __superApply = this._superApply; + var returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + } )(); + } ); + constructor.prototype = $.widget.extend( basePrototype, { + + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name + }, proxiedPrototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + widgetFullName: fullName + } ); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // Redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, + child._proto ); + } ); + + // Remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; } else { - // Browser globals: - factory(jQuery); + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); + + return constructor; + }; + + $.widget.extend = function( target ) { + var input = widgetSlice.call( arguments, 1 ); + var inputIndex = 0; + var inputLength = input.length; + var key; + var value; + + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; + }; + + $.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string"; + var args = widgetSlice.call( arguments, 1 ); + var returnValue = this; + + if ( isMethodCall ) { + + // If this is an empty collection, we need to have the instance method + // return undefined instead of the jQuery instance + if ( !this.length && options === "instance" ) { + returnValue = undefined; + } else { + this.each( function() { + var methodValue; + var instance = $.data( this, fullName ); + + if ( options === "instance" ) { + returnValue = instance; + return false; + } + + if ( !instance ) { + return $.error( "cannot call methods on " + name + + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + + if ( !$.isFunction( instance[ options ] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + + " widget instance" ); + } + + methodValue = instance[ options ].apply( instance, args ); + + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + } ); + } + } else { + + // Allow multiple hashes to be passed on init + if ( args.length ) { + options = $.widget.extend.apply( null, [ options ].concat( args ) ); + } + + this.each( function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} ); + if ( instance._init ) { + instance._init(); + } + } else { + $.data( this, fullName, new object( options, this ) ); + } + } ); + } + + return returnValue; + }; + }; + + $.Widget = function( /* options, element */ ) {}; + $.Widget._childConstructors = []; + + $.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "<div>", + + options: { + classes: {}, + disabled: false, + + // Callbacks + create: null + }, + + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = widgetUuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + this.classesElementLookup = {}; + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + } ); + this.document = $( element.style ? + + // Element within the document + element.ownerDocument : + + // Element is window or document + element.document || element ); + this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow ); + } + + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this._create(); + + if ( this.options.disabled ) { + this._setOptionDisabled( this.options.disabled ); + } + + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + + _getCreateOptions: function() { + return {}; + }, + + _getCreateEventData: $.noop, + + _create: $.noop, + + _init: $.noop, + + destroy: function() { + var that = this; + + this._destroy(); + $.each( this.classesElementLookup, function( key, value ) { + that._removeClass( value, key ); + } ); + + // We can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .off( this.eventNamespace ) + .removeData( this.widgetFullName ); + this.widget() + .off( this.eventNamespace ) + .removeAttr( "aria-disabled" ); + + // Clean up events and states + this.bindings.off( this.eventNamespace ); + }, + + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + var parts; + var curOption; + var i; + + if ( arguments.length === 0 ) { + + // Don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + + // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( arguments.length === 1 ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( arguments.length === 1 ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + + _setOption: function( key, value ) { + if ( key === "classes" ) { + this._setOptionClasses( value ); + } + + this.options[ key ] = value; + + if ( key === "disabled" ) { + this._setOptionDisabled( value ); + } + + return this; + }, + + _setOptionClasses: function( value ) { + var classKey, elements, currentElements; + + for ( classKey in value ) { + currentElements = this.classesElementLookup[ classKey ]; + if ( value[ classKey ] === this.options.classes[ classKey ] || + !currentElements || + !currentElements.length ) { + continue; + } + + // We are doing this to create a new jQuery object because the _removeClass() call + // on the next line is going to destroy the reference to the current elements being + // tracked. We need to save a copy of this collection so that we can add the new classes + // below. + elements = $( currentElements.get() ); + this._removeClass( currentElements, classKey ); + + // We don't use _addClass() here, because that uses this.options.classes + // for generating the string of classes. We want to use the value passed in from + // _setOption(), this is the new value of the classes option which was passed to + // _setOption(). We pass this value directly to _classes(). + elements.addClass( this._classes( { + element: elements, + keys: classKey, + classes: value, + add: true + } ) ); + } + }, + + _setOptionDisabled: function( value ) { + this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value ); + + // If the widget is becoming disabled, then nothing is interactive + if ( value ) { + this._removeClass( this.hoverable, null, "ui-state-hover" ); + this._removeClass( this.focusable, null, "ui-state-focus" ); + } + }, + + enable: function() { + return this._setOptions( { disabled: false } ); + }, + + disable: function() { + return this._setOptions( { disabled: true } ); + }, + + _classes: function( options ) { + var full = []; + var that = this; + + options = $.extend( { + element: this.element, + classes: this.options.classes || {} + }, options ); + + function processClassString( classes, checkOption ) { + var current, i; + for ( i = 0; i < classes.length; i++ ) { + current = that.classesElementLookup[ classes[ i ] ] || $(); + if ( options.add ) { + current = $( $.unique( current.get().concat( options.element.get() ) ) ); + } else { + current = $( current.not( options.element ).get() ); + } + that.classesElementLookup[ classes[ i ] ] = current; + full.push( classes[ i ] ); + if ( checkOption && options.classes[ classes[ i ] ] ) { + full.push( options.classes[ classes[ i ] ] ); + } + } + } + + this._on( options.element, { + "remove": "_untrackClassesElement" + } ); + + if ( options.keys ) { + processClassString( options.keys.match( /\S+/g ) || [], true ); + } + if ( options.extra ) { + processClassString( options.extra.match( /\S+/g ) || [] ); + } + + return full.join( " " ); + }, + + _untrackClassesElement: function( event ) { + var that = this; + $.each( that.classesElementLookup, function( key, value ) { + if ( $.inArray( event.target, value ) !== -1 ) { + that.classesElementLookup[ key ] = $( value.not( event.target ).get() ); + } + } ); + }, + + _removeClass: function( element, keys, extra ) { + return this._toggleClass( element, keys, extra, false ); + }, + + _addClass: function( element, keys, extra ) { + return this._toggleClass( element, keys, extra, true ); + }, + + _toggleClass: function( element, keys, extra, add ) { + add = ( typeof add === "boolean" ) ? add : extra; + var shift = ( typeof element === "string" || element === null ), + options = { + extra: shift ? keys : extra, + keys: shift ? element : keys, + element: shift ? this.element : element, + add: add + }; + options.element.toggleClass( this._classes( options ), add ); + return this; + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement; + var instance = this; + + // No suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // No element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + + // Allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // Copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^([\w:-]*)\s*(.*)$/ ); + var eventName = match[ 1 ] + instance.eventNamespace; + var selector = match[ 2 ]; + + if ( selector ) { + delegateElement.on( eventName, selector, handlerProxy ); + } else { + element.on( eventName, handlerProxy ); + } + } ); + }, + + _off: function( element, eventName ) { + eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) + + this.eventNamespace; + element.off( eventName ).off( eventName ); + + // Clear the stack to avoid memory leaks (#10056) + this.bindings = $( this.bindings.not( element ).get() ); + this.focusable = $( this.focusable.not( element ).get() ); + this.hoverable = $( this.hoverable.not( element ).get() ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + this._addClass( $( event.currentTarget ), null, "ui-state-hover" ); + }, + mouseleave: function( event ) { + this._removeClass( $( event.currentTarget ), null, "ui-state-hover" ); + } + } ); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + this._addClass( $( event.currentTarget ), null, "ui-state-focus" ); + }, + focusout: function( event ) { + this._removeClass( $( event.currentTarget ), null, "ui-state-focus" ); + } + } ); + }, + + _trigger: function( type, event, data ) { + var prop, orig; + var callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + + // The original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // Copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); } -}(function( $, undefined ) { - -// jQuery 1.4+ -if ( $.cleanData ) { - var _cleanData = $.cleanData; - $.cleanData = function( elems ) { - for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { - try { - $( elem ).triggerHandler( "remove" ); - // http://bugs.jquery.com/ticket/8235 - } catch( e ) {} - } - _cleanData( elems ); - }; -} else { - var _remove = $.fn.remove; - $.fn.remove = function( selector, keepData ) { - return this.each(function() { - if ( !keepData ) { - if ( !selector || $.filter( selector, [ this ] ).length ) { - $( "*", this ).add( [ this ] ).each(function() { - try { - $( this ).triggerHandler( "remove" ); - // http://bugs.jquery.com/ticket/8235 - } catch( e ) {} - }); - } - } - return _remove.call( $(this), selector, keepData ); - }); - }; -} - -$.widget = function( name, base, prototype ) { - var namespace = name.split( "." )[ 0 ], - fullName; - name = name.split( "." )[ 1 ]; - fullName = namespace + "-" + name; - - if ( !prototype ) { - prototype = base; - base = $.Widget; - } - - // create selector for plugin - $.expr[ ":" ][ fullName ] = function( elem ) { - return !!$.data( elem, name ); - }; - - $[ namespace ] = $[ namespace ] || {}; - $[ namespace ][ name ] = function( options, element ) { - // allow instantiation without initializing for simple inheritance - if ( arguments.length ) { - this._createWidget( options, element ); - } - }; - - var basePrototype = new base(); - // we need to make the options hash a property directly on the new instance - // otherwise we'll modify the options hash on the prototype that we're - // inheriting from -// $.each( basePrototype, function( key, val ) { -// if ( $.isPlainObject(val) ) { -// basePrototype[ key ] = $.extend( {}, val ); -// } -// }); - basePrototype.options = $.extend( true, {}, basePrototype.options ); - $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { - namespace: namespace, - widgetName: name, - widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, - widgetBaseClass: fullName - }, prototype ); - - $.widget.bridge( name, $[ namespace ][ name ] ); -}; - -$.widget.bridge = function( name, object ) { - $.fn[ name ] = function( options ) { - var isMethodCall = typeof options === "string", - args = Array.prototype.slice.call( arguments, 1 ), - returnValue = this; - - // allow multiple hashes to be passed on init - options = !isMethodCall && args.length ? - $.extend.apply( null, [ true, options ].concat(args) ) : - options; - - // prevent calls to internal methods - if ( isMethodCall && options.charAt( 0 ) === "_" ) { - return returnValue; - } - - if ( isMethodCall ) { - this.each(function() { - var instance = $.data( this, name ), - methodValue = instance && $.isFunction( instance[options] ) ? - instance[ options ].apply( instance, args ) : - instance; - // TODO: add this back in 1.9 and use $.error() (see #5972) -// if ( !instance ) { -// throw "cannot call methods on " + name + " prior to initialization; " + -// "attempted to call method '" + options + "'"; -// } -// if ( !$.isFunction( instance[options] ) ) { -// throw "no such method '" + options + "' for " + name + " widget instance"; -// } -// var methodValue = instance[ options ].apply( instance, args ); - if ( methodValue !== instance && methodValue !== undefined ) { - returnValue = methodValue; - return false; - } - }); - } else { - this.each(function() { - var instance = $.data( this, name ); - if ( instance ) { - instance.option( options || {} )._init(); - } else { - $.data( this, name, new object( options, this ) ); - } - }); - } - - return returnValue; - }; -}; - -$.Widget = function( options, element ) { - // allow instantiation without initializing for simple inheritance - if ( arguments.length ) { - this._createWidget( options, element ); - } -}; - -$.Widget.prototype = { - widgetName: "widget", - widgetEventPrefix: "", - options: { - disabled: false - }, - _createWidget: function( options, element ) { - // $.widget.bridge stores the plugin instance, but we do it anyway - // so that it's stored even before the _create function runs - $.data( element, this.widgetName, this ); - this.element = $( element ); - this.options = $.extend( true, {}, - this.options, - this._getCreateOptions(), - options ); - - var self = this; - this.element.bind( "remove." + this.widgetName, function() { - self.destroy(); - }); - - this._create(); - this._trigger( "create" ); - this._init(); - }, - _getCreateOptions: function() { - return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; - }, - _create: function() {}, - _init: function() {}, - - destroy: function() { - this.element - .unbind( "." + this.widgetName ) - .removeData( this.widgetName ); - this.widget() - .unbind( "." + this.widgetName ) - .removeAttr( "aria-disabled" ) - .removeClass( - this.widgetBaseClass + "-disabled " + - "ui-state-disabled" ); - }, - - widget: function() { - return this.element; - }, - - option: function( key, value ) { - var options = key; - - if ( arguments.length === 0 ) { - // don't return a reference to the internal hash - return $.extend( {}, this.options ); - } - - if (typeof key === "string" ) { - if ( value === undefined ) { - return this.options[ key ]; - } - options = {}; - options[ key ] = value; - } - - this._setOptions( options ); - - return this; - }, - _setOptions: function( options ) { - var self = this; - $.each( options, function( key, value ) { - self._setOption( key, value ); - }); - - return this; - }, - _setOption: function( key, value ) { - this.options[ key ] = value; - - if ( key === "disabled" ) { - this.widget() - [ value ? "addClass" : "removeClass"]( - this.widgetBaseClass + "-disabled" + " " + - "ui-state-disabled" ) - .attr( "aria-disabled", value ); - } - - return this; - }, - - enable: function() { - return this._setOption( "disabled", false ); - }, - disable: function() { - return this._setOption( "disabled", true ); - }, - - _trigger: function( type, event, data ) { - var prop, orig, - callback = this.options[ type ]; - - data = data || {}; - event = $.Event( event ); - event.type = ( type === this.widgetEventPrefix ? - type : - this.widgetEventPrefix + type ).toLowerCase(); - // the original event may come from any element - // so we need to reset the target on the new event - event.target = this.element[ 0 ]; - - // copy original event properties over to the new event - orig = event.originalEvent; - if ( orig ) { - for ( prop in orig ) { - if ( !( prop in event ) ) { - event[ prop ] = orig[ prop ]; - } - } - } - - this.element.trigger( event, data ); - - return !( $.isFunction(callback) && - callback.call( this.element[0], event, data ) === false || - event.isDefaultPrevented() ); - } -}; + }; + + $.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + + var hasOptions; + var effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + + if ( options.delay ) { + element.delay( options.delay ); + } + + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue( function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + } ); + } + }; + } ); + + var widget = $.widget; + + + })); diff --git a/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js b/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js index b5f6e8382bf94820344ae6dd660b1f11fe47ff47..b5109a262ef2fa86034017777fdba58c17d95033 100644 --- a/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js +++ b/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js @@ -1,4 +1,6 @@ -// ColorBox v1.3.17.1 - a full featured, light-weight, customizable lightbox based on jQuery 1.3+ -// Copyright (c) 2011 Jack Moore - jack@colorpowered.com -// Licensed under the MIT license: http://www.opensource.org/licenses/mit-license.php -(function(a,b,c){function bc(b){if(!T){O=b,_(a.extend(J,a.data(O,e))),x=a(O),P=0,J.rel!=="nofollow"&&(x=a("."+X).filter(function(){var b=a.data(this,e).rel||this.rel;return b===J.rel}),P=x.index(O),P===-1&&(x=x.add(O),P=x.length-1));if(!R){R=S=!0,q.show();if(J.returnFocus)try{O.blur(),a(O).one(k,function(){try{this.focus()}catch(a){}})}catch(c){}p.css({opacity:+J.opacity,cursor:J.overlayClose?"pointer":"auto"}).show(),J.w=Z(J.initialWidth,"x"),J.h=Z(J.initialHeight,"y"),W.position(0),n&&y.bind("resize."+o+" scroll."+o,function(){p.css({width:y.width(),height:y.height(),top:y.scrollTop(),left:y.scrollLeft()})}).trigger("resize."+o),ba(g,J.onOpen),I.add(C).hide(),H.html(J.close).show()}W.load(!0)}}function bb(){var a,b=f+"Slideshow_",c="click."+f,d,e,g;J.slideshow&&x[1]?(d=function(){E.text(J.slideshowStop).unbind(c).bind(i,function(){if(P<x.length-1||J.loop)a=setTimeout(W.next,J.slideshowSpeed)}).bind(h,function(){clearTimeout(a)}).one(c+" "+j,e),q.removeClass(b+"off").addClass(b+"on"),a=setTimeout(W.next,J.slideshowSpeed)},e=function(){clearTimeout(a),E.text(J.slideshowStart).unbind([i,h,j,c].join(" ")).one(c,d),q.removeClass(b+"on").addClass(b+"off")},J.slideshowAuto?d():e()):q.removeClass(b+"off "+b+"on")}function ba(b,c){c&&c.call(O),a.event.trigger(b)}function _(b){for(var c in b)a.isFunction(b[c])&&c.substring(0,2)!=="on"&&(b[c]=b[c].call(O));b.rel=b.rel||O.rel||"nofollow",b.href=b.href||a(O).attr("href"),b.title=b.title||O.title,typeof b.href=="string"&&(b.href=a.trim(b.href))}function $(a){return J.photo||/\.(gif|png|jpg|jpeg|bmp)(?:\?([^#]*))?(?:#(\.*))?$/i.test(a)}function Z(a,b){b=b==="x"?y.width():y.height();return typeof a=="string"?Math.round(/%/.test(a)?b/100*parseInt(a,10):parseInt(a,10)):a}function Y(c,d){var e=b.createElement("div");c&&(e.id=f+c),e.style.cssText=d||"";return a(e)}var d={transition:"elastic",speed:300,width:!1,initialWidth:"600",innerWidth:!1,maxWidth:!1,height:!1,initialHeight:"450",innerHeight:!1,maxHeight:!1,scalePhotos:!0,scrolling:!0,inline:!1,html:!1,iframe:!1,fastIframe:!0,photo:!1,href:!1,title:!1,rel:!1,opacity:.9,preloading:!0,current:"image {current} of {total}",previous:"previous",next:"next",close:"close",open:!1,returnFocus:!0,loop:!0,slideshow:!1,slideshowAuto:!0,slideshowSpeed:2500,slideshowStart:"start slideshow",slideshowStop:"stop slideshow",onOpen:!1,onLoad:!1,onComplete:!1,onCleanup:!1,onClosed:!1,overlayClose:!0,escKey:!0,arrowKey:!0,top:!1,bottom:!1,left:!1,right:!1,fixed:!1,data:!1},e="colorbox",f="cbox",g=f+"_open",h=f+"_load",i=f+"_complete",j=f+"_cleanup",k=f+"_closed",l=f+"_purge",m=a.browser.msie&&!a.support.opacity,n=m&&a.browser.version<7,o=f+"_IE6",p,q,r,s,t,u,v,w,x,y,z,A,B,C,D,E,F,G,H,I,J={},K,L,M,N,O,P,Q,R,S,T,U,V,W,X=f+"Element";W=a.fn[e]=a[e]=function(b,c){var f=this,g;if(!f[0]&&f.selector)return f;b=b||{},c&&(b.onComplete=c);if(!f[0]||f.selector===undefined)f=a("<a/>"),b.open=!0;f.each(function(){a.data(this,e,a.extend({},a.data(this,e)||d,b)),a(this).addClass(X)}),g=b.open,a.isFunction(g)&&(g=g.call(f)),g&&bc(f[0]);return f},W.init=function(){y=a(c),q=Y().attr({id:e,"class":m?f+(n?"IE6":"IE"):""}),p=Y("Overlay",n?"position:absolute":"").hide(),r=Y("Wrapper"),s=Y("Content").append(z=Y("LoadedContent","width:0; height:0; overflow:hidden"),B=Y("LoadingOverlay").add(Y("LoadingGraphic")),C=Y("Title"),D=Y("Current"),F=Y("Next"),G=Y("Previous"),E=Y("Slideshow").bind(g,bb),H=Y("Close")),r.append(Y().append(Y("TopLeft"),t=Y("TopCenter"),Y("TopRight")),Y(!1,"clear:left").append(u=Y("MiddleLeft"),s,v=Y("MiddleRight")),Y(!1,"clear:left").append(Y("BottomLeft"),w=Y("BottomCenter"),Y("BottomRight"))).children().children().css({"float":"left"}),A=Y(!1,"position:absolute; width:9999px; visibility:hidden; display:none"),a("body").prepend(p,q.append(r,A)),s.children().hover(function(){a(this).addClass("hover")},function(){a(this).removeClass("hover")}).addClass("hover"),K=t.height()+w.height()+s.outerHeight(!0)-s.height(),L=u.width()+v.width()+s.outerWidth(!0)-s.width(),M=z.outerHeight(!0),N=z.outerWidth(!0),q.css({"padding-bottom":K,"padding-right":L}).hide(),F.click(function(){W.next()}),G.click(function(){W.prev()}),H.click(function(){W.close()}),I=F.add(G).add(D).add(E),s.children().removeClass("hover"),p.click(function(){J.overlayClose&&W.close()}),a(b).bind("keydown."+f,function(a){var b=a.keyCode;R&&J.escKey&&b===27&&(a.preventDefault(),W.close()),R&&J.arrowKey&&x[1]&&(b===37?(a.preventDefault(),G.click()):b===39&&(a.preventDefault(),F.click()))})},W.remove=function(){q.add(p).remove(),a("."+X).removeData(e).removeClass(X)},W.position=function(a,c){function g(a){t[0].style.width=w[0].style.width=s[0].style.width=a.style.width,B[0].style.height=B[1].style.height=s[0].style.height=u[0].style.height=v[0].style.height=a.style.height}var d,e=0,f=0;q.hide(),J.fixed&&!n?q.css({position:"fixed"}):(e=y.scrollTop(),f=y.scrollLeft(),q.css({position:"absolute"})),J.right!==!1?f+=Math.max(y.width()-J.w-N-L-Z(J.right,"x"),0):J.left!==!1?f+=Z(J.left,"x"):f+=Math.max(y.width()-J.w-N-L,0)/2,J.bottom!==!1?e+=Math.max(b.documentElement.clientHeight-J.h-M-K-Z(J.bottom,"y"),0):J.top!==!1?e+=Z(J.top,"y"):e+=Math.max(b.documentElement.clientHeight-J.h-M-K,0)/2,q.show(),d=q.width()===J.w+N&&q.height()===J.h+M?0:a,r[0].style.width=r[0].style.height="9999px",q.dequeue().animate({width:J.w+N,height:J.h+M,top:e,left:f},{duration:d,complete:function(){g(this),S=!1,r[0].style.width=J.w+N+L+"px",r[0].style.height=J.h+M+K+"px",c&&c()},step:function(){g(this)}})},W.resize=function(a){if(R){a=a||{},a.width&&(J.w=Z(a.width,"x")-N-L),a.innerWidth&&(J.w=Z(a.innerWidth,"x")),z.css({width:J.w}),a.height&&(J.h=Z(a.height,"y")-M-K),a.innerHeight&&(J.h=Z(a.innerHeight,"y"));if(!a.innerHeight&&!a.height){var b=z.wrapInner("<div style='overflow:auto'></div>").children();J.h=b.height(),b.replaceWith(b.children())}z.css({height:J.h}),W.position(J.transition==="none"?0:J.speed)}},W.prep=function(b){function h(b){W.position(b,function(){function o(){m&&q[0].style.removeAttribute("filter")}var b,d,g,h,j=x.length,k,n;!R||(n=function(){clearTimeout(V),B.hide(),ba(i,J.onComplete)},m&&Q&&z.fadeIn(100),C.html(J.title).add(z).show(),j>1?(typeof J.current=="string"&&D.html(J.current.replace(/\{current\}/,P+1).replace(/\{total\}/,j)).show(),F[J.loop||P<j-1?"show":"hide"]().html(J.next),G[J.loop||P?"show":"hide"]().html(J.previous),b=P?x[P-1]:x[j-1],g=P<j-1?x[P+1]:x[0],J.slideshow&&E.show(),J.preloading&&(h=a.data(g,e).href||g.href,d=a.data(b,e).href||b.href,h=a.isFunction(h)?h.call(g):h,d=a.isFunction(d)?d.call(b):d,$(h)&&(a("<img/>")[0].src=h),$(d)&&(a("<img/>")[0].src=d))):I.hide(),J.iframe?(k=a("<iframe/>").addClass(f+"Iframe")[0],J.fastIframe?n():a(k).one("load",n),k.name=f+ +(new Date),k.src=J.href,J.scrolling||(k.scrolling="no"),m&&(k.frameBorder=0,k.allowTransparency="true"),a(k).appendTo(z).one(l,function(){k.src="//about:blank"})):n(),J.transition==="fade"?q.fadeTo(c,1,o):o(),y.bind("resize."+f,function(){W.position(0)}))})}function g(){J.h=J.h||z.height(),J.h=J.mh&&J.mh<J.h?J.mh:J.h;return J.h}function d(){J.w=J.w||z.width(),J.w=J.mw&&J.mw<J.w?J.mw:J.w;return J.w}if(!!R){var c=J.transition==="none"?0:J.speed;y.unbind("resize."+f),z.remove(),z=Y("LoadedContent").html(b),z.hide().appendTo(A.show()).css({width:d(),overflow:J.scrolling?"auto":"hidden"}).css({height:g()}).prependTo(s),A.hide(),a(Q).css({"float":"none"}),n&&a("select").not(q.find("select")).filter(function(){return this.style.visibility!=="hidden"}).css({visibility:"hidden"}).one(j,function(){this.style.visibility="inherit"}),J.transition==="fade"?q.fadeTo(c,0,function(){h(0)}):h(c)}},W.load=function(b){var c,d,g=W.prep;S=!0,Q=!1,O=x[P],b||_(a.extend(J,a.data(O,e))),ba(l),ba(h,J.onLoad),J.h=J.height?Z(J.height,"y")-M-K:J.innerHeight&&Z(J.innerHeight,"y"),J.w=J.width?Z(J.width,"x")-N-L:J.innerWidth&&Z(J.innerWidth,"x"),J.mw=J.w,J.mh=J.h,J.maxWidth&&(J.mw=Z(J.maxWidth,"x")-N-L,J.mw=J.w&&J.w<J.mw?J.w:J.mw),J.maxHeight&&(J.mh=Z(J.maxHeight,"y")-M-K,J.mh=J.h&&J.h<J.mh?J.h:J.mh),c=J.href,V=setTimeout(function(){B.show()},100),J.inline?(Y().hide().insertBefore(a(c)[0]).one(l,function(){a(this).replaceWith(z.children())}),g(a(c))):J.iframe?g(" "):J.html?g(J.html):$(c)?(a(Q=new Image).addClass(f+"Photo").error(function(){J.title=!1,g(Y("Error").text("This image could not be loaded"))}).load(function(){var a;Q.onload=null,J.scalePhotos&&(d=function(){Q.height-=Q.height*a,Q.width-=Q.width*a},J.mw&&Q.width>J.mw&&(a=(Q.width-J.mw)/Q.width,d()),J.mh&&Q.height>J.mh&&(a=(Q.height-J.mh)/Q.height,d())),J.h&&(Q.style.marginTop=Math.max(J.h-Q.height,0)/2+"px"),x[1]&&(P<x.length-1||J.loop)&&(Q.style.cursor="pointer",Q.onclick=function(){W.next()}),m&&(Q.style.msInterpolationMode="bicubic"),setTimeout(function(){g(Q)},1)}),setTimeout(function(){Q.src=c},1)):c&&A.load(c,J.data,function(b,c,d){g(c==="error"?Y("Error").text("Request unsuccessful: "+d.statusText):a(this).contents())})},W.next=function(){!S&&x[1]&&(P<x.length-1||J.loop)&&(P=P<x.length-1?P+1:0,W.load())},W.prev=function(){!S&&x[1]&&(P||J.loop)&&(P=P?P-1:x.length-1,W.load())},W.close=function(){R&&!T&&(T=!0,R=!1,ba(j,J.onCleanup),y.unbind("."+f+" ."+o),p.fadeTo(200,0),q.stop().fadeTo(300,0,function(){q.add(p).css({opacity:1,cursor:"auto"}).hide(),ba(l),z.remove(),setTimeout(function(){T=!1,ba(k,J.onClosed)},1)}))},W.element=function(){return a(O)},W.settings=d,U=function(a){a.button!==0&&typeof a.button!="undefined"||a.ctrlKey||a.shiftKey||a.altKey||(a.preventDefault(),bc(this))},a.fn.delegate?a(b).delegate("."+X,"click",U):a("."+X).live("click",U),a(W.init)})(jQuery,document,this) \ No newline at end of file +/*! + Colorbox 1.6.4 + license: MIT + http://www.jacklmoore.com/colorbox +*/ +(function(t,e,i){function n(i,n,o){var r=e.createElement(i);return n&&(r.id=Z+n),o&&(r.style.cssText=o),t(r)}function o(){return i.innerHeight?i.innerHeight:t(i).height()}function r(e,i){i!==Object(i)&&(i={}),this.cache={},this.el=e,this.value=function(e){var n;return void 0===this.cache[e]&&(n=t(this.el).attr("data-cbox-"+e),void 0!==n?this.cache[e]=n:void 0!==i[e]?this.cache[e]=i[e]:void 0!==X[e]&&(this.cache[e]=X[e])),this.cache[e]},this.get=function(e){var i=this.value(e);return t.isFunction(i)?i.call(this.el,this):i}}function h(t){var e=W.length,i=(A+t)%e;return 0>i?e+i:i}function a(t,e){return Math.round((/%/.test(t)?("x"===e?E.width():o())/100:1)*parseInt(t,10))}function s(t,e){return t.get("photo")||t.get("photoRegex").test(e)}function l(t,e){return t.get("retinaUrl")&&i.devicePixelRatio>1?e.replace(t.get("photoRegex"),t.get("retinaSuffix")):e}function d(t){"contains"in x[0]&&!x[0].contains(t.target)&&t.target!==v[0]&&(t.stopPropagation(),x.focus())}function c(t){c.str!==t&&(x.add(v).removeClass(c.str).addClass(t),c.str=t)}function g(e){A=0,e&&e!==!1&&"nofollow"!==e?(W=t("."+te).filter(function(){var i=t.data(this,Y),n=new r(this,i);return n.get("rel")===e}),A=W.index(_.el),-1===A&&(W=W.add(_.el),A=W.length-1)):W=t(_.el)}function u(i){t(e).trigger(i),ae.triggerHandler(i)}function f(i){var o;if(!G){if(o=t(i).data(Y),_=new r(i,o),g(_.get("rel")),!U){U=$=!0,c(_.get("className")),x.css({visibility:"hidden",display:"block",opacity:""}),I=n(se,"LoadedContent","width:0; height:0; overflow:hidden; visibility:hidden"),b.css({width:"",height:""}).append(I),j=T.height()+k.height()+b.outerHeight(!0)-b.height(),D=C.width()+H.width()+b.outerWidth(!0)-b.width(),N=I.outerHeight(!0),z=I.outerWidth(!0);var h=a(_.get("initialWidth"),"x"),s=a(_.get("initialHeight"),"y"),l=_.get("maxWidth"),f=_.get("maxHeight");_.w=Math.max((l!==!1?Math.min(h,a(l,"x")):h)-z-D,0),_.h=Math.max((f!==!1?Math.min(s,a(f,"y")):s)-N-j,0),I.css({width:"",height:_.h}),J.position(),u(ee),_.get("onOpen"),O.add(F).hide(),x.focus(),_.get("trapFocus")&&e.addEventListener&&(e.addEventListener("focus",d,!0),ae.one(re,function(){e.removeEventListener("focus",d,!0)})),_.get("returnFocus")&&ae.one(re,function(){t(_.el).focus()})}var p=parseFloat(_.get("opacity"));v.css({opacity:p===p?p:"",cursor:_.get("overlayClose")?"pointer":"",visibility:"visible"}).show(),_.get("closeButton")?B.html(_.get("close")).appendTo(b):B.appendTo("<div/>"),w()}}function p(){x||(V=!1,E=t(i),x=n(se).attr({id:Y,"class":t.support.opacity===!1?Z+"IE":"",role:"dialog",tabindex:"-1"}).hide(),v=n(se,"Overlay").hide(),L=t([n(se,"LoadingOverlay")[0],n(se,"LoadingGraphic")[0]]),y=n(se,"Wrapper"),b=n(se,"Content").append(F=n(se,"Title"),R=n(se,"Current"),P=t('<button type="button"/>').attr({id:Z+"Previous"}),K=t('<button type="button"/>').attr({id:Z+"Next"}),S=t('<button type="button"/>').attr({id:Z+"Slideshow"}),L),B=t('<button type="button"/>').attr({id:Z+"Close"}),y.append(n(se).append(n(se,"TopLeft"),T=n(se,"TopCenter"),n(se,"TopRight")),n(se,!1,"clear:left").append(C=n(se,"MiddleLeft"),b,H=n(se,"MiddleRight")),n(se,!1,"clear:left").append(n(se,"BottomLeft"),k=n(se,"BottomCenter"),n(se,"BottomRight"))).find("div div").css({"float":"left"}),M=n(se,!1,"position:absolute; width:9999px; visibility:hidden; display:none; max-width:none;"),O=K.add(P).add(R).add(S)),e.body&&!x.parent().length&&t(e.body).append(v,x.append(y,M))}function m(){function i(t){t.which>1||t.shiftKey||t.altKey||t.metaKey||t.ctrlKey||(t.preventDefault(),f(this))}return x?(V||(V=!0,K.click(function(){J.next()}),P.click(function(){J.prev()}),B.click(function(){J.close()}),v.click(function(){_.get("overlayClose")&&J.close()}),t(e).bind("keydown."+Z,function(t){var e=t.keyCode;U&&_.get("escKey")&&27===e&&(t.preventDefault(),J.close()),U&&_.get("arrowKey")&&W[1]&&!t.altKey&&(37===e?(t.preventDefault(),P.click()):39===e&&(t.preventDefault(),K.click()))}),t.isFunction(t.fn.on)?t(e).on("click."+Z,"."+te,i):t("."+te).live("click."+Z,i)),!0):!1}function w(){var e,o,r,h=J.prep,d=++le;if($=!0,q=!1,u(he),u(ie),_.get("onLoad"),_.h=_.get("height")?a(_.get("height"),"y")-N-j:_.get("innerHeight")&&a(_.get("innerHeight"),"y"),_.w=_.get("width")?a(_.get("width"),"x")-z-D:_.get("innerWidth")&&a(_.get("innerWidth"),"x"),_.mw=_.w,_.mh=_.h,_.get("maxWidth")&&(_.mw=a(_.get("maxWidth"),"x")-z-D,_.mw=_.w&&_.w<_.mw?_.w:_.mw),_.get("maxHeight")&&(_.mh=a(_.get("maxHeight"),"y")-N-j,_.mh=_.h&&_.h<_.mh?_.h:_.mh),e=_.get("href"),Q=setTimeout(function(){L.show()},100),_.get("inline")){var c=t(e).eq(0);r=t("<div>").hide().insertBefore(c),ae.one(he,function(){r.replaceWith(c)}),h(c)}else _.get("iframe")?h(" "):_.get("html")?h(_.get("html")):s(_,e)?(e=l(_,e),q=_.get("createImg"),t(q).addClass(Z+"Photo").bind("error."+Z,function(){h(n(se,"Error").html(_.get("imgError")))}).one("load",function(){d===le&&setTimeout(function(){var e;_.get("retinaImage")&&i.devicePixelRatio>1&&(q.height=q.height/i.devicePixelRatio,q.width=q.width/i.devicePixelRatio),_.get("scalePhotos")&&(o=function(){q.height-=q.height*e,q.width-=q.width*e},_.mw&&q.width>_.mw&&(e=(q.width-_.mw)/q.width,o()),_.mh&&q.height>_.mh&&(e=(q.height-_.mh)/q.height,o())),_.h&&(q.style.marginTop=Math.max(_.mh-q.height,0)/2+"px"),W[1]&&(_.get("loop")||W[A+1])&&(q.style.cursor="pointer",t(q).bind("click."+Z,function(){J.next()})),q.style.width=q.width+"px",q.style.height=q.height+"px",h(q)},1)}),q.src=e):e&&M.load(e,_.get("data"),function(e,i){d===le&&h("error"===i?n(se,"Error").html(_.get("xhrError")):t(this).contents())})}var v,x,y,b,T,C,H,k,W,E,I,M,L,F,R,S,K,P,B,O,_,j,D,N,z,A,q,U,$,G,Q,J,V,X={html:!1,photo:!1,iframe:!1,inline:!1,transition:"elastic",speed:300,fadeOut:300,width:!1,initialWidth:"600",innerWidth:!1,maxWidth:!1,height:!1,initialHeight:"450",innerHeight:!1,maxHeight:!1,scalePhotos:!0,scrolling:!0,opacity:.9,preloading:!0,className:!1,overlayClose:!0,escKey:!0,arrowKey:!0,top:!1,bottom:!1,left:!1,right:!1,fixed:!1,data:void 0,closeButton:!0,fastIframe:!0,open:!1,reposition:!0,loop:!0,slideshow:!1,slideshowAuto:!0,slideshowSpeed:2500,slideshowStart:"start slideshow",slideshowStop:"stop slideshow",photoRegex:/\.(gif|png|jp(e|g|eg)|bmp|ico|webp|jxr|svg)((#|\?).*)?$/i,retinaImage:!1,retinaUrl:!1,retinaSuffix:"@2x.$1",current:"image {current} of {total}",previous:"previous",next:"next",close:"close",xhrError:"This content failed to load.",imgError:"This image failed to load.",returnFocus:!0,trapFocus:!0,onOpen:!1,onLoad:!1,onComplete:!1,onCleanup:!1,onClosed:!1,rel:function(){return this.rel},href:function(){return t(this).attr("href")},title:function(){return this.title},createImg:function(){var e=new Image,i=t(this).data("cbox-img-attrs");return"object"==typeof i&&t.each(i,function(t,i){e[t]=i}),e},createIframe:function(){var i=e.createElement("iframe"),n=t(this).data("cbox-iframe-attrs");return"object"==typeof n&&t.each(n,function(t,e){i[t]=e}),"frameBorder"in i&&(i.frameBorder=0),"allowTransparency"in i&&(i.allowTransparency="true"),i.name=(new Date).getTime(),i.allowFullscreen=!0,i}},Y="colorbox",Z="cbox",te=Z+"Element",ee=Z+"_open",ie=Z+"_load",ne=Z+"_complete",oe=Z+"_cleanup",re=Z+"_closed",he=Z+"_purge",ae=t("<a/>"),se="div",le=0,de={},ce=function(){function t(){clearTimeout(h)}function e(){(_.get("loop")||W[A+1])&&(t(),h=setTimeout(J.next,_.get("slideshowSpeed")))}function i(){S.html(_.get("slideshowStop")).unbind(s).one(s,n),ae.bind(ne,e).bind(ie,t),x.removeClass(a+"off").addClass(a+"on")}function n(){t(),ae.unbind(ne,e).unbind(ie,t),S.html(_.get("slideshowStart")).unbind(s).one(s,function(){J.next(),i()}),x.removeClass(a+"on").addClass(a+"off")}function o(){r=!1,S.hide(),t(),ae.unbind(ne,e).unbind(ie,t),x.removeClass(a+"off "+a+"on")}var r,h,a=Z+"Slideshow_",s="click."+Z;return function(){r?_.get("slideshow")||(ae.unbind(oe,o),o()):_.get("slideshow")&&W[1]&&(r=!0,ae.one(oe,o),_.get("slideshowAuto")?i():n(),S.show())}}();t[Y]||(t(p),J=t.fn[Y]=t[Y]=function(e,i){var n,o=this;return e=e||{},t.isFunction(o)&&(o=t("<a/>"),e.open=!0),o[0]?(p(),m()&&(i&&(e.onComplete=i),o.each(function(){var i=t.data(this,Y)||{};t.data(this,Y,t.extend(i,e))}).addClass(te),n=new r(o[0],e),n.get("open")&&f(o[0])),o):o},J.position=function(e,i){function n(){T[0].style.width=k[0].style.width=b[0].style.width=parseInt(x[0].style.width,10)-D+"px",b[0].style.height=C[0].style.height=H[0].style.height=parseInt(x[0].style.height,10)-j+"px"}var r,h,s,l=0,d=0,c=x.offset();if(E.unbind("resize."+Z),x.css({top:-9e4,left:-9e4}),h=E.scrollTop(),s=E.scrollLeft(),_.get("fixed")?(c.top-=h,c.left-=s,x.css({position:"fixed"})):(l=h,d=s,x.css({position:"absolute"})),d+=_.get("right")!==!1?Math.max(E.width()-_.w-z-D-a(_.get("right"),"x"),0):_.get("left")!==!1?a(_.get("left"),"x"):Math.round(Math.max(E.width()-_.w-z-D,0)/2),l+=_.get("bottom")!==!1?Math.max(o()-_.h-N-j-a(_.get("bottom"),"y"),0):_.get("top")!==!1?a(_.get("top"),"y"):Math.round(Math.max(o()-_.h-N-j,0)/2),x.css({top:c.top,left:c.left,visibility:"visible"}),y[0].style.width=y[0].style.height="9999px",r={width:_.w+z+D,height:_.h+N+j,top:l,left:d},e){var g=0;t.each(r,function(t){return r[t]!==de[t]?(g=e,void 0):void 0}),e=g}de=r,e||x.css(r),x.dequeue().animate(r,{duration:e||0,complete:function(){n(),$=!1,y[0].style.width=_.w+z+D+"px",y[0].style.height=_.h+N+j+"px",_.get("reposition")&&setTimeout(function(){E.bind("resize."+Z,J.position)},1),t.isFunction(i)&&i()},step:n})},J.resize=function(t){var e;U&&(t=t||{},t.width&&(_.w=a(t.width,"x")-z-D),t.innerWidth&&(_.w=a(t.innerWidth,"x")),I.css({width:_.w}),t.height&&(_.h=a(t.height,"y")-N-j),t.innerHeight&&(_.h=a(t.innerHeight,"y")),t.innerHeight||t.height||(e=I.scrollTop(),I.css({height:"auto"}),_.h=I.height()),I.css({height:_.h}),e&&I.scrollTop(e),J.position("none"===_.get("transition")?0:_.get("speed")))},J.prep=function(i){function o(){return _.w=_.w||I.width(),_.w=_.mw&&_.mw<_.w?_.mw:_.w,_.w}function a(){return _.h=_.h||I.height(),_.h=_.mh&&_.mh<_.h?_.mh:_.h,_.h}if(U){var d,g="none"===_.get("transition")?0:_.get("speed");I.remove(),I=n(se,"LoadedContent").append(i),I.hide().appendTo(M.show()).css({width:o(),overflow:_.get("scrolling")?"auto":"hidden"}).css({height:a()}).prependTo(b),M.hide(),t(q).css({"float":"none"}),c(_.get("className")),d=function(){function i(){t.support.opacity===!1&&x[0].style.removeAttribute("filter")}var n,o,a=W.length;U&&(o=function(){clearTimeout(Q),L.hide(),u(ne),_.get("onComplete")},F.html(_.get("title")).show(),I.show(),a>1?("string"==typeof _.get("current")&&R.html(_.get("current").replace("{current}",A+1).replace("{total}",a)).show(),K[_.get("loop")||a-1>A?"show":"hide"]().html(_.get("next")),P[_.get("loop")||A?"show":"hide"]().html(_.get("previous")),ce(),_.get("preloading")&&t.each([h(-1),h(1)],function(){var i,n=W[this],o=new r(n,t.data(n,Y)),h=o.get("href");h&&s(o,h)&&(h=l(o,h),i=e.createElement("img"),i.src=h)})):O.hide(),_.get("iframe")?(n=_.get("createIframe"),_.get("scrolling")||(n.scrolling="no"),t(n).attr({src:_.get("href"),"class":Z+"Iframe"}).one("load",o).appendTo(I),ae.one(he,function(){n.src="//about:blank"}),_.get("fastIframe")&&t(n).trigger("load")):o(),"fade"===_.get("transition")?x.fadeTo(g,1,i):i())},"fade"===_.get("transition")?x.fadeTo(g,0,function(){J.position(0,d)}):J.position(g,d)}},J.next=function(){!$&&W[1]&&(_.get("loop")||W[A+1])&&(A=h(1),f(W[A]))},J.prev=function(){!$&&W[1]&&(_.get("loop")||A)&&(A=h(-1),f(W[A]))},J.close=function(){U&&!G&&(G=!0,U=!1,u(oe),_.get("onCleanup"),E.unbind("."+Z),v.fadeTo(_.get("fadeOut")||0,0),x.stop().fadeTo(_.get("fadeOut")||0,0,function(){x.hide(),v.hide(),u(he),I.remove(),setTimeout(function(){G=!1,u(re),_.get("onClosed")},1)}))},J.remove=function(){x&&(x.stop(),t[Y].close(),x.stop(!1,!0).remove(),v.remove(),G=!1,x=null,t("."+te).removeData(Y).removeClass(te),t(e).unbind("click."+Z).unbind("keydown."+Z))},J.element=function(){return t(_.el)},J.settings=X)})(jQuery,document,window); \ No newline at end of file diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js new file mode 100644 index 0000000000000000000000000000000000000000..a25377619816983c9a736f7472c671f004b00d80 --- /dev/null +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js @@ -0,0 +1,113 @@ +/* + * jQuery File Upload Audio Preview Plugin + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2013, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * https://opensource.org/licenses/MIT + */ + +/* jshint nomen:false */ +/* global define, require, window, document */ + +;(function (factory) { + 'use strict'; + if (typeof define === 'function' && define.amd) { + // Register as an anonymous AMD module: + define([ + 'jquery', + 'load-image', + './jquery.fileupload-process' + ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('blueimp-load-image/js/load-image'), + require('./jquery.fileupload-process') + ); + } else { + // Browser globals: + factory( + window.jQuery, + window.loadImage + ); + } +}(function ($, loadImage) { + 'use strict'; + + // Prepend to the default processQueue: + $.blueimp.fileupload.prototype.options.processQueue.unshift( + { + action: 'loadAudio', + // Use the action as prefix for the "@" options: + prefix: true, + fileTypes: '@', + maxFileSize: '@', + disabled: '@disableAudioPreview' + }, + { + action: 'setAudio', + name: '@audioPreviewName', + disabled: '@disableAudioPreview' + } + ); + + // The File Upload Audio Preview plugin extends the fileupload widget + // with audio preview functionality: + $.widget('blueimp.fileupload', $.blueimp.fileupload, { + + options: { + // The regular expression for the types of audio files to load, + // matched against the file type: + loadAudioFileTypes: /^audio\/.*$/ + }, + + _audioElement: document.createElement('audio'), + + processActions: { + + // Loads the audio file given via data.files and data.index + // as audio element if the browser supports playing it. + // Accepts the options fileTypes (regular expression) + // and maxFileSize (integer) to limit the files to load: + loadAudio: function (data, options) { + if (options.disabled) { + return data; + } + var file = data.files[data.index], + url, + audio; + if (this._audioElement.canPlayType && + this._audioElement.canPlayType(file.type) && + ($.type(options.maxFileSize) !== 'number' || + file.size <= options.maxFileSize) && + (!options.fileTypes || + options.fileTypes.test(file.type))) { + url = loadImage.createObjectURL(file); + if (url) { + audio = this._audioElement.cloneNode(false); + audio.src = url; + audio.controls = true; + data.audio = audio; + return data; + } + } + return data; + }, + + // Sets the audio element as a property of the file object: + setAudio: function (data, options) { + if (data.audio && !options.disabled) { + data.files[data.index][options.name || 'preview'] = data.audio; + } + return data; + } + + } + + }); + +})); diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js new file mode 100644 index 0000000000000000000000000000000000000000..65fc6d7b8c2d3a661b8926e48c8a080444436928 --- /dev/null +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js @@ -0,0 +1,326 @@ +/* + * jQuery File Upload Image Preview & Resize Plugin + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2013, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * https://opensource.org/licenses/MIT + */ + +/* jshint nomen:false */ +/* global define, require, window, Blob */ + +;(function (factory) { + 'use strict'; + if (typeof define === 'function' && define.amd) { + // Register as an anonymous AMD module: + define([ + 'jquery', + 'load-image', + 'load-image-meta', + 'load-image-scale', + 'load-image-exif', + 'canvas-to-blob', + './jquery.fileupload-process' + ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('blueimp-load-image/js/load-image'), + require('blueimp-load-image/js/load-image-meta'), + require('blueimp-load-image/js/load-image-scale'), + require('blueimp-load-image/js/load-image-exif'), + require('blueimp-canvas-to-blob'), + require('./jquery.fileupload-process') + ); + } else { + // Browser globals: + factory( + window.jQuery, + window.loadImage + ); + } +}(function ($, loadImage) { + 'use strict'; + + // Prepend to the default processQueue: + $.blueimp.fileupload.prototype.options.processQueue.unshift( + { + action: 'loadImageMetaData', + disableImageHead: '@', + disableExif: '@', + disableExifThumbnail: '@', + disableExifSub: '@', + disableExifGps: '@', + disabled: '@disableImageMetaDataLoad' + }, + { + action: 'loadImage', + // Use the action as prefix for the "@" options: + prefix: true, + fileTypes: '@', + maxFileSize: '@', + noRevoke: '@', + disabled: '@disableImageLoad' + }, + { + action: 'resizeImage', + // Use "image" as prefix for the "@" options: + prefix: 'image', + maxWidth: '@', + maxHeight: '@', + minWidth: '@', + minHeight: '@', + crop: '@', + orientation: '@', + forceResize: '@', + disabled: '@disableImageResize' + }, + { + action: 'saveImage', + quality: '@imageQuality', + type: '@imageType', + disabled: '@disableImageResize' + }, + { + action: 'saveImageMetaData', + disabled: '@disableImageMetaDataSave' + }, + { + action: 'resizeImage', + // Use "preview" as prefix for the "@" options: + prefix: 'preview', + maxWidth: '@', + maxHeight: '@', + minWidth: '@', + minHeight: '@', + crop: '@', + orientation: '@', + thumbnail: '@', + canvas: '@', + disabled: '@disableImagePreview' + }, + { + action: 'setImage', + name: '@imagePreviewName', + disabled: '@disableImagePreview' + }, + { + action: 'deleteImageReferences', + disabled: '@disableImageReferencesDeletion' + } + ); + + // The File Upload Resize plugin extends the fileupload widget + // with image resize functionality: + $.widget('blueimp.fileupload', $.blueimp.fileupload, { + + options: { + // The regular expression for the types of images to load: + // matched against the file type: + loadImageFileTypes: /^image\/(gif|jpeg|png|svg\+xml)$/, + // The maximum file size of images to load: + loadImageMaxFileSize: 10000000, // 10MB + // The maximum width of resized images: + imageMaxWidth: 1920, + // The maximum height of resized images: + imageMaxHeight: 1080, + // Defines the image orientation (1-8) or takes the orientation + // value from Exif data if set to true: + imageOrientation: false, + // Define if resized images should be cropped or only scaled: + imageCrop: false, + // Disable the resize image functionality by default: + disableImageResize: true, + // The maximum width of the preview images: + previewMaxWidth: 80, + // The maximum height of the preview images: + previewMaxHeight: 80, + // Defines the preview orientation (1-8) or takes the orientation + // value from Exif data if set to true: + previewOrientation: true, + // Create the preview using the Exif data thumbnail: + previewThumbnail: true, + // Define if preview images should be cropped or only scaled: + previewCrop: false, + // Define if preview images should be resized as canvas elements: + previewCanvas: true + }, + + processActions: { + + // Loads the image given via data.files and data.index + // as img element, if the browser supports the File API. + // Accepts the options fileTypes (regular expression) + // and maxFileSize (integer) to limit the files to load: + loadImage: function (data, options) { + if (options.disabled) { + return data; + } + var that = this, + file = data.files[data.index], + dfd = $.Deferred(); + if (($.type(options.maxFileSize) === 'number' && + file.size > options.maxFileSize) || + (options.fileTypes && + !options.fileTypes.test(file.type)) || + !loadImage( + file, + function (img) { + if (img.src) { + data.img = img; + } + dfd.resolveWith(that, [data]); + }, + options + )) { + return data; + } + return dfd.promise(); + }, + + // Resizes the image given as data.canvas or data.img + // and updates data.canvas or data.img with the resized image. + // Also stores the resized image as preview property. + // Accepts the options maxWidth, maxHeight, minWidth, + // minHeight, canvas and crop: + resizeImage: function (data, options) { + if (options.disabled || !(data.canvas || data.img)) { + return data; + } + options = $.extend({canvas: true}, options); + var that = this, + dfd = $.Deferred(), + img = (options.canvas && data.canvas) || data.img, + resolve = function (newImg) { + if (newImg && (newImg.width !== img.width || + newImg.height !== img.height || + options.forceResize)) { + data[newImg.getContext ? 'canvas' : 'img'] = newImg; + } + data.preview = newImg; + dfd.resolveWith(that, [data]); + }, + thumbnail; + if (data.exif) { + if (options.orientation === true) { + options.orientation = data.exif.get('Orientation'); + } + if (options.thumbnail) { + thumbnail = data.exif.get('Thumbnail'); + if (thumbnail) { + loadImage(thumbnail, resolve, options); + return dfd.promise(); + } + } + // Prevent orienting the same image twice: + if (data.orientation) { + delete options.orientation; + } else { + data.orientation = options.orientation; + } + } + if (img) { + resolve(loadImage.scale(img, options)); + return dfd.promise(); + } + return data; + }, + + // Saves the processed image given as data.canvas + // inplace at data.index of data.files: + saveImage: function (data, options) { + if (!data.canvas || options.disabled) { + return data; + } + var that = this, + file = data.files[data.index], + dfd = $.Deferred(); + if (data.canvas.toBlob) { + data.canvas.toBlob( + function (blob) { + if (!blob.name) { + if (file.type === blob.type) { + blob.name = file.name; + } else if (file.name) { + blob.name = file.name.replace( + /\.\w+$/, + '.' + blob.type.substr(6) + ); + } + } + // Don't restore invalid meta data: + if (file.type !== blob.type) { + delete data.imageHead; + } + // Store the created blob at the position + // of the original file in the files list: + data.files[data.index] = blob; + dfd.resolveWith(that, [data]); + }, + options.type || file.type, + options.quality + ); + } else { + return data; + } + return dfd.promise(); + }, + + loadImageMetaData: function (data, options) { + if (options.disabled) { + return data; + } + var that = this, + dfd = $.Deferred(); + loadImage.parseMetaData(data.files[data.index], function (result) { + $.extend(data, result); + dfd.resolveWith(that, [data]); + }, options); + return dfd.promise(); + }, + + saveImageMetaData: function (data, options) { + if (!(data.imageHead && data.canvas && + data.canvas.toBlob && !options.disabled)) { + return data; + } + var file = data.files[data.index], + blob = new Blob([ + data.imageHead, + // Resized images always have a head size of 20 bytes, + // including the JPEG marker and a minimal JFIF header: + this._blobSlice.call(file, 20) + ], {type: file.type}); + blob.name = file.name; + data.files[data.index] = blob; + return data; + }, + + // Sets the resized version of the image as a property of the + // file object, must be called after "saveImage": + setImage: function (data, options) { + if (data.preview && !options.disabled) { + data.files[data.index][options.name || 'preview'] = data.preview; + } + return data; + }, + + deleteImageReferences: function (data, options) { + if (!options.disabled) { + delete data.img; + delete data.canvas; + delete data.preview; + delete data.imageHead; + } + return data; + } + + } + + }); + +})); diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js new file mode 100644 index 0000000000000000000000000000000000000000..638f0d26b44c472fc0a1a9ff7d1ff4a58d2e9fb7 --- /dev/null +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js @@ -0,0 +1,178 @@ +/* + * jQuery File Upload Processing Plugin + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2012, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * https://opensource.org/licenses/MIT + */ + +/* jshint nomen:false */ +/* global define, require, window */ + +;(function (factory) { + 'use strict'; + if (typeof define === 'function' && define.amd) { + // Register as an anonymous AMD module: + define([ + 'jquery', + './jquery.fileupload' + ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('./jquery.fileupload') + ); + } else { + // Browser globals: + factory( + window.jQuery + ); + } +}(function ($) { + 'use strict'; + + var originalAdd = $.blueimp.fileupload.prototype.options.add; + + // The File Upload Processing plugin extends the fileupload widget + // with file processing functionality: + $.widget('blueimp.fileupload', $.blueimp.fileupload, { + + options: { + // The list of processing actions: + processQueue: [ + /* + { + action: 'log', + type: 'debug' + } + */ + ], + add: function (e, data) { + var $this = $(this); + data.process(function () { + return $this.fileupload('process', data); + }); + originalAdd.call(this, e, data); + } + }, + + processActions: { + /* + log: function (data, options) { + console[options.type]( + 'Processing "' + data.files[data.index].name + '"' + ); + } + */ + }, + + _processFile: function (data, originalData) { + var that = this, + dfd = $.Deferred().resolveWith(that, [data]), + chain = dfd.promise(); + this._trigger('process', null, data); + $.each(data.processQueue, function (i, settings) { + var func = function (data) { + if (originalData.errorThrown) { + return $.Deferred() + .rejectWith(that, [originalData]).promise(); + } + return that.processActions[settings.action].call( + that, + data, + settings + ); + }; + chain = chain.then(func, settings.always && func); + }); + chain + .done(function () { + that._trigger('processdone', null, data); + that._trigger('processalways', null, data); + }) + .fail(function () { + that._trigger('processfail', null, data); + that._trigger('processalways', null, data); + }); + return chain; + }, + + // Replaces the settings of each processQueue item that + // are strings starting with an "@", using the remaining + // substring as key for the option map, + // e.g. "@autoUpload" is replaced with options.autoUpload: + _transformProcessQueue: function (options) { + var processQueue = []; + $.each(options.processQueue, function () { + var settings = {}, + action = this.action, + prefix = this.prefix === true ? action : this.prefix; + $.each(this, function (key, value) { + if ($.type(value) === 'string' && + value.charAt(0) === '@') { + settings[key] = options[ + value.slice(1) || (prefix ? prefix + + key.charAt(0).toUpperCase() + key.slice(1) : key) + ]; + } else { + settings[key] = value; + } + + }); + processQueue.push(settings); + }); + options.processQueue = processQueue; + }, + + // Returns the number of files currently in the processsing queue: + processing: function () { + return this._processing; + }, + + // Processes the files given as files property of the data parameter, + // returns a Promise object that allows to bind callbacks: + process: function (data) { + var that = this, + options = $.extend({}, this.options, data); + if (options.processQueue && options.processQueue.length) { + this._transformProcessQueue(options); + if (this._processing === 0) { + this._trigger('processstart'); + } + $.each(data.files, function (index) { + var opts = index ? $.extend({}, options) : options, + func = function () { + if (data.errorThrown) { + return $.Deferred() + .rejectWith(that, [data]).promise(); + } + return that._processFile(opts, data); + }; + opts.index = index; + that._processing += 1; + that._processingQueue = that._processingQueue.then(func, func) + .always(function () { + that._processing -= 1; + if (that._processing === 0) { + that._trigger('processstop'); + } + }); + }); + } + return this._processingQueue; + }, + + _create: function () { + this._super(); + this._processing = 0; + this._processingQueue = $.Deferred().resolveWith(this) + .promise(); + } + + }); + +})); diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js index e330fe16a361abdcdbe4d31d142025e13897a806..5058084b4ddfa242ad73d1a3f15debe69685bb85 100644 --- a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js @@ -1,71 +1,64 @@ /* - * jQuery File Upload User Interface Plugin 6.9.1 + * jQuery File Upload User Interface Plugin * https://github.com/blueimp/jQuery-File-Upload * * Copyright 2010, Sebastian Tschan * https://blueimp.net * * Licensed under the MIT license: - * http://www.opensource.org/licenses/MIT + * https://opensource.org/licenses/MIT */ -/*jslint nomen: true, unparam: true, regexp: true */ -/*global define, window, document, URL, webkitURL, FileReader */ +/* jshint nomen:false */ +/* global define, require, window */ -(function (factory) { +;(function (factory) { 'use strict'; if (typeof define === 'function' && define.amd) { // Register as an anonymous AMD module: define([ 'jquery', - 'tmpl', - 'load-image', - './jquery.fileupload-fp' + 'blueimp-tmpl', + './jquery.fileupload-image', + './jquery.fileupload-audio', + './jquery.fileupload-video', + './jquery.fileupload-validate' ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('blueimp-tmpl'), + require('./jquery.fileupload-image'), + require('./jquery.fileupload-audio'), + require('./jquery.fileupload-video'), + require('./jquery.fileupload-validate') + ); } else { // Browser globals: factory( window.jQuery, - window.tmpl, - window.loadImage + window.tmpl ); } -}(function ($, tmpl, loadImage) { +}(function ($, tmpl) { 'use strict'; - // The UI version extends the FP (file processing) version or the basic - // file upload widget and adds complete user interface interaction: - var parentWidget = ($.blueimpFP || $.blueimp).fileupload; - $.widget('blueimpUI.fileupload', parentWidget, { + $.blueimp.fileupload.prototype._specialOptions.push( + 'filesContainer', + 'uploadTemplateId', + 'downloadTemplateId' + ); + + // The UI version extends the file upload widget + // and adds complete user interface interaction: + $.widget('blueimp.fileupload', $.blueimp.fileupload, { options: { // By default, files added to the widget are uploaded as soon // as the user clicks on the start buttons. To enable automatic // uploads, set the following option to true: autoUpload: false, - // The following option limits the number of files that are - // allowed to be uploaded using this widget: - maxNumberOfFiles: undefined, - // The maximum allowed file size: - maxFileSize: undefined, - // The minimum allowed file size: - minFileSize: undefined, - // The regular expression for allowed file types, matches - // against either file type or file name: - acceptFileTypes: /.+$/i, - // The regular expression to define for which files a preview - // image is shown, matched against the file type: - previewSourceFileTypes: /^image\/(gif|jpeg|png)$/, - // The maximum file size of images that are to be displayed as preview: - previewSourceMaxFileSize: 5000000, // 5MB - // The maximum width of the preview images: - previewMaxWidth: 80, - // The maximum height of the preview images: - previewMaxHeight: 80, - // By default, preview images are displayed as canvas elements - // if supported by the browser. Set the following option to false - // to always display preview images as img elements: - previewAsCanvas: true, // The ID of the upload template: uploadTemplateId: 'template-upload', // The ID of the download template: @@ -80,45 +73,79 @@ // option of the $.ajax upload requests: dataType: 'json', + // Error and info messages: + messages: { + unknownError: 'Unknown error' + }, + + // Function returning the current number of files, + // used by the maxNumberOfFiles validation: + getNumberOfFiles: function () { + return this.filesContainer.children() + .not('.processing').length; + }, + + // Callback to retrieve the list of files from the server response: + getFilesFromResponse: function (data) { + if (data.result && $.isArray(data.result.files)) { + return data.result.files; + } + return []; + }, + // The add callback is invoked as soon as files are added to the fileupload // widget (via file input selection, drag & drop or add API call). // See the basic file upload widget for more information: add: function (e, data) { - var that = $(this).data('fileupload'), - options = that.options, - files = data.files; - $(this).fileupload('process', data).done(function () { - that._adjustMaxNumberOfFiles(-files.length); - data.isAdjusted = true; - data.files.valid = data.isValidated = that._validate(files); - data.context = that._renderUpload(files).data('data', data); - options.filesContainer[ - options.prependFiles ? 'prepend' : 'append' - ](data.context); - that._renderPreviews(files, data.context); - that._forceReflow(data.context); - that._transition(data.context).done( - function () { - if ((that._trigger('added', e, data) !== false) && - (options.autoUpload || data.autoUpload) && - data.autoUpload !== false && data.isValidated) { - data.submit(); + if (e.isDefaultPrevented()) { + return false; + } + var $this = $(this), + that = $this.data('blueimp-fileupload') || + $this.data('fileupload'), + options = that.options; + data.context = that._renderUpload(data.files) + .data('data', data) + .addClass('processing'); + options.filesContainer[ + options.prependFiles ? 'prepend' : 'append' + ](data.context); + that._forceReflow(data.context); + that._transition(data.context); + data.process(function () { + return $this.fileupload('process', data); + }).always(function () { + data.context.each(function (index) { + $(this).find('.size').text( + that._formatFileSize(data.files[index].size) + ); + }).removeClass('processing'); + that._renderPreviews(data); + }).done(function () { + data.context.find('.start').prop('disabled', false); + if ((that._trigger('added', e, data) !== false) && + (options.autoUpload || data.autoUpload) && + data.autoUpload !== false) { + data.submit(); + } + }).fail(function () { + if (data.files.error) { + data.context.each(function (index) { + var error = data.files[index].error; + if (error) { + $(this).find('.error').text(error); } - } - ); + }); + } }); }, // Callback for the start of each file upload request: send: function (e, data) { - var that = $(this).data('fileupload'); - if (!data.isValidated) { - if (!data.isAdjusted) { - that._adjustMaxNumberOfFiles(-data.files.length); - } - if (!that._validate(data.files)) { - return false; - } + if (e.isDefaultPrevented()) { + return false; } + var that = $(this).data('blueimp-fileupload') || + $(this).data('fileupload'); if (data.context && data.dataType && data.dataType.substr(0, 6) === 'iframe') { // Iframe Transport does not support progress events. @@ -129,7 +156,7 @@ !$.support.transition && 'progress-animated' ) .attr('aria-valuenow', 100) - .find('.bar').css( + .children().first().css( 'width', '100%' ); @@ -138,54 +165,70 @@ }, // Callback for successful uploads: done: function (e, data) { - var that = $(this).data('fileupload'), - template; + if (e.isDefaultPrevented()) { + return false; + } + var that = $(this).data('blueimp-fileupload') || + $(this).data('fileupload'), + getFilesFromResponse = data.getFilesFromResponse || + that.options.getFilesFromResponse, + files = getFilesFromResponse(data), + template, + deferred; if (data.context) { data.context.each(function (index) { - var file = ($.isArray(data.result) && - data.result[index]) || {error: 'emptyResult'}; - if (file.error) { - that._adjustMaxNumberOfFiles(1); - } + var file = files[index] || + {error: 'Empty file upload result'}; + deferred = that._addFinishedDeferreds(); that._transition($(this)).done( function () { var node = $(this); template = that._renderDownload([file]) - .css('height', node.height()) .replaceAll(node); that._forceReflow(template); that._transition(template).done( function () { data.context = $(this); that._trigger('completed', e, data); + that._trigger('finished', e, data); + deferred.resolve(); } ); } ); }); } else { - template = that._renderDownload(data.result) - .appendTo(that.options.filesContainer); + template = that._renderDownload(files)[ + that.options.prependFiles ? 'prependTo' : 'appendTo' + ](that.options.filesContainer); that._forceReflow(template); + deferred = that._addFinishedDeferreds(); that._transition(template).done( function () { data.context = $(this); that._trigger('completed', e, data); + that._trigger('finished', e, data); + deferred.resolve(); } ); } }, // Callback for failed (abort or error) uploads: fail: function (e, data) { - var that = $(this).data('fileupload'), - template; - that._adjustMaxNumberOfFiles(data.files.length); + if (e.isDefaultPrevented()) { + return false; + } + var that = $(this).data('blueimp-fileupload') || + $(this).data('fileupload'), + template, + deferred; if (data.context) { data.context.each(function (index) { if (data.errorThrown !== 'abort') { var file = data.files[index]; file.error = file.error || data.errorThrown || - true; + data.i18n('unknownError'); + deferred = that._addFinishedDeferreds(); that._transition($(this)).done( function () { var node = $(this); @@ -196,70 +239,94 @@ function () { data.context = $(this); that._trigger('failed', e, data); + that._trigger('finished', e, data); + deferred.resolve(); } ); } ); } else { + deferred = that._addFinishedDeferreds(); that._transition($(this)).done( function () { $(this).remove(); that._trigger('failed', e, data); + that._trigger('finished', e, data); + deferred.resolve(); } ); } }); } else if (data.errorThrown !== 'abort') { - that._adjustMaxNumberOfFiles(-data.files.length); - data.context = that._renderUpload(data.files) - .appendTo(that.options.filesContainer) + data.context = that._renderUpload(data.files)[ + that.options.prependFiles ? 'prependTo' : 'appendTo' + ](that.options.filesContainer) .data('data', data); that._forceReflow(data.context); + deferred = that._addFinishedDeferreds(); that._transition(data.context).done( function () { data.context = $(this); that._trigger('failed', e, data); + that._trigger('finished', e, data); + deferred.resolve(); } ); } else { that._trigger('failed', e, data); + that._trigger('finished', e, data); + that._addFinishedDeferreds().resolve(); } }, // Callback for upload progress events: progress: function (e, data) { + if (e.isDefaultPrevented()) { + return false; + } + var progress = Math.floor(data.loaded / data.total * 100); if (data.context) { - var progress = parseInt(data.loaded / data.total * 100, 10); - data.context.find('.progress') - .attr('aria-valuenow', progress) - .find('.bar').css( - 'width', - progress + '%' - ); + data.context.each(function () { + $(this).find('.progress') + .attr('aria-valuenow', progress) + .children().first().css( + 'width', + progress + '%' + ); + }); } }, // Callback for global upload progress events: progressall: function (e, data) { + if (e.isDefaultPrevented()) { + return false; + } var $this = $(this), - progress = parseInt(data.loaded / data.total * 100, 10), + progress = Math.floor(data.loaded / data.total * 100), globalProgressNode = $this.find('.fileupload-progress'), extendedProgressNode = globalProgressNode .find('.progress-extended'); if (extendedProgressNode.length) { extendedProgressNode.html( - $this.data('fileupload')._renderExtendedProgress(data) + ($this.data('blueimp-fileupload') || $this.data('fileupload')) + ._renderExtendedProgress(data) ); } globalProgressNode .find('.progress') .attr('aria-valuenow', progress) - .find('.bar').css( + .children().first().css( 'width', progress + '%' ); }, // Callback for uploads start, equivalent to the global ajaxStart event: start: function (e) { - var that = $(this).data('fileupload'); + if (e.isDefaultPrevented()) { + return false; + } + var that = $(this).data('blueimp-fileupload') || + $(this).data('fileupload'); + that._resetFinishedDeferreds(); that._transition($(this).find('.fileupload-progress')).done( function () { that._trigger('started', e); @@ -268,33 +335,80 @@ }, // Callback for uploads stop, equivalent to the global ajaxStop event: stop: function (e) { - var that = $(this).data('fileupload'); + if (e.isDefaultPrevented()) { + return false; + } + var that = $(this).data('blueimp-fileupload') || + $(this).data('fileupload'), + deferred = that._addFinishedDeferreds(); + $.when.apply($, that._getFinishedDeferreds()) + .done(function () { + that._trigger('stopped', e); + }); that._transition($(this).find('.fileupload-progress')).done( function () { $(this).find('.progress') .attr('aria-valuenow', '0') - .find('.bar').css('width', '0%'); + .children().first().css('width', '0%'); $(this).find('.progress-extended').html(' '); - that._trigger('stopped', e); + deferred.resolve(); } ); }, + processstart: function (e) { + if (e.isDefaultPrevented()) { + return false; + } + $(this).addClass('fileupload-processing'); + }, + processstop: function (e) { + if (e.isDefaultPrevented()) { + return false; + } + $(this).removeClass('fileupload-processing'); + }, // Callback for file deletion: destroy: function (e, data) { - var that = $(this).data('fileupload'); + if (e.isDefaultPrevented()) { + return false; + } + var that = $(this).data('blueimp-fileupload') || + $(this).data('fileupload'), + removeNode = function () { + that._transition(data.context).done( + function () { + $(this).remove(); + that._trigger('destroyed', e, data); + } + ); + }; if (data.url) { - $.ajax(data); - that._adjustMaxNumberOfFiles(1); + data.dataType = data.dataType || that.options.dataType; + $.ajax(data).done(removeNode).fail(function () { + that._trigger('destroyfailed', e, data); + }); + } else { + removeNode(); } - that._transition(data.context).done( - function () { - $(this).remove(); - that._trigger('destroyed', e, data); - } - ); } }, + _resetFinishedDeferreds: function () { + this._finishedUploads = []; + }, + + _addFinishedDeferreds: function (deferred) { + if (!deferred) { + deferred = $.Deferred(); + } + this._finishedUploads.push(deferred); + return deferred; + }, + + _getFinishedDeferreds: function () { + return this._finishedUploads; + }, + // Link handler, that allows to download files // by drag & drop of the links to the desktop: _enableDragToDesktop: function () { @@ -308,21 +422,10 @@ 'DownloadURL', [type, name, url].join(':') ); - } catch (err) {} + } catch (ignore) {} }); }, - _adjustMaxNumberOfFiles: function (operand) { - if (typeof this.options.maxNumberOfFiles === 'number') { - this.options.maxNumberOfFiles += operand; - if (this.options.maxNumberOfFiles < 1) { - this._disableFileInputButton(); - } else { - this._enableFileInputButton(); - } - } - }, - _formatFileSize: function (bytes) { if (typeof bytes !== 'number') { return ''; @@ -349,12 +452,12 @@ if (bits >= 1000) { return (bits / 1000).toFixed(2) + ' kbit/s'; } - return bits + ' bit/s'; + return bits.toFixed(2) + ' bit/s'; }, _formatTime: function (seconds) { var date = new Date(seconds * 1000), - days = parseInt(seconds / 86400, 10); + days = Math.floor(seconds / 86400); days = days ? days + 'd ' : ''; return days + ('0' + date.getUTCHours()).slice(-2) + ':' + @@ -378,46 +481,6 @@ this._formatFileSize(data.total); }, - _hasError: function (file) { - if (file.error) { - return file.error; - } - // The number of added files is subtracted from - // maxNumberOfFiles before validation, so we check if - // maxNumberOfFiles is below 0 (instead of below 1): - if (this.options.maxNumberOfFiles < 0) { - return 'maxNumberOfFiles'; - } - // Files are accepted if either the file type or the file name - // matches against the acceptFileTypes regular expression, as - // only browsers with support for the File API report the type: - if (!(this.options.acceptFileTypes.test(file.type) || - this.options.acceptFileTypes.test(file.name))) { - return 'acceptFileTypes'; - } - if (this.options.maxFileSize && - file.size > this.options.maxFileSize) { - return 'maxFileSize'; - } - if (typeof file.size === 'number' && - file.size < this.options.minFileSize) { - return 'minFileSize'; - } - return null; - }, - - _validate: function (files) { - var that = this, - valid = !!files.length; - $.each(files, function (index, file) { - file.error = that._hasError(file); - if (file.error) { - valid = false; - } - }); - return valid; - }, - _renderTemplate: function (func, files) { if (!func) { return $(); @@ -433,53 +496,10 @@ return $(this.options.templatesContainer).html(result).children(); }, - _renderPreview: function (file, node) { - var that = this, - options = this.options, - dfd = $.Deferred(); - return ((loadImage && loadImage( - file, - function (img) { - node.append(img); - that._forceReflow(node); - that._transition(node).done(function () { - dfd.resolveWith(node); - }); - if (!$.contains(document.body, node[0])) { - // If the element is not part of the DOM, - // transition events are not triggered, - // so we have to resolve manually: - dfd.resolveWith(node); - } - }, - { - maxWidth: options.previewMaxWidth, - maxHeight: options.previewMaxHeight, - canvas: options.previewAsCanvas - } - )) || dfd.resolveWith(node)) && dfd; - }, - - _renderPreviews: function (files, nodes) { - var that = this, - options = this.options; - nodes.find('.preview span').each(function (index, element) { - var file = files[index]; - if (options.previewSourceFileTypes.test(file.type) && - ($.type(options.previewSourceMaxFileSize) !== 'number' || - file.size < options.previewSourceMaxFileSize)) { - that._processingQueue = that._processingQueue.pipe(function () { - var dfd = $.Deferred(); - that._renderPreview(file, $(element)).done( - function () { - dfd.resolveWith(that); - } - ); - return dfd.promise(); - }); - } + _renderPreviews: function (data) { + data.context.find('.preview').each(function (index, elm) { + $(elm).append(data.files[index].preview); }); - return this._processingQueue; }, _renderUpload: function (files) { @@ -498,35 +518,36 @@ _startHandler: function (e) { e.preventDefault(); - var button = $(this), + var button = $(e.currentTarget), template = button.closest('.template-upload'), data = template.data('data'); - if (data && data.submit && !data.jqXHR && data.submit()) { - button.prop('disabled', true); + button.prop('disabled', true); + if (data && data.submit) { + data.submit(); } }, _cancelHandler: function (e) { e.preventDefault(); - var template = $(this).closest('.template-upload'), + var template = $(e.currentTarget) + .closest('.template-upload,.template-download'), data = template.data('data') || {}; - if (!data.jqXHR) { - data.errorThrown = 'abort'; - e.data.fileupload._trigger('fail', e, data); + data.context = data.context || template; + if (data.abort) { + data.abort(); } else { - data.jqXHR.abort(); + data.errorThrown = 'abort'; + this._trigger('fail', e, data); } }, _deleteHandler: function (e) { e.preventDefault(); - var button = $(this); - e.data.fileupload._trigger('destroy', e, { + var button = $(e.currentTarget); + this._trigger('destroy', e, $.extend({ context: button.closest('.template-download'), - url: button.attr('data-url'), - type: button.attr('data-type') || 'DELETE', - dataType: e.data.fileupload.options.dataType - }); + type: 'DELETE' + }, button.data())); }, _forceReflow: function (node) { @@ -536,7 +557,7 @@ _transition: function (node) { var dfd = $.Deferred(); - if ($.support.transition && node.hasClass('fade')) { + if ($.support.transition && node.hasClass('fade') && node.is(':visible')) { node.bind( $.support.transition.end, function (e) { @@ -557,75 +578,65 @@ _initButtonBarEventHandlers: function () { var fileUploadButtonBar = this.element.find('.fileupload-buttonbar'), - filesList = this.options.filesContainer, - ns = this.options.namespace; - fileUploadButtonBar.find('.start') - .bind('click.' + ns, function (e) { + filesList = this.options.filesContainer; + this._on(fileUploadButtonBar.find('.start'), { + click: function (e) { e.preventDefault(); - filesList.find('.start button').click(); - }); - fileUploadButtonBar.find('.cancel') - .bind('click.' + ns, function (e) { + filesList.find('.start').click(); + } + }); + this._on(fileUploadButtonBar.find('.cancel'), { + click: function (e) { e.preventDefault(); - filesList.find('.cancel button').click(); - }); - fileUploadButtonBar.find('.delete') - .bind('click.' + ns, function (e) { + filesList.find('.cancel').click(); + } + }); + this._on(fileUploadButtonBar.find('.delete'), { + click: function (e) { e.preventDefault(); - filesList.find('.delete input:checked') - .siblings('button').click(); + filesList.find('.toggle:checked') + .closest('.template-download') + .find('.delete').click(); fileUploadButtonBar.find('.toggle') .prop('checked', false); - }); - fileUploadButtonBar.find('.toggle') - .bind('change.' + ns, function (e) { - filesList.find('.delete input').prop( + } + }); + this._on(fileUploadButtonBar.find('.toggle'), { + change: function (e) { + filesList.find('.toggle').prop( 'checked', - $(this).is(':checked') + $(e.currentTarget).is(':checked') ); - }); + } + }); }, _destroyButtonBarEventHandlers: function () { - this.element.find('.fileupload-buttonbar button') - .unbind('click.' + this.options.namespace); - this.element.find('.fileupload-buttonbar .toggle') - .unbind('change.' + this.options.namespace); + this._off( + this.element.find('.fileupload-buttonbar') + .find('.start, .cancel, .delete'), + 'click' + ); + this._off( + this.element.find('.fileupload-buttonbar .toggle'), + 'change.' + ); }, _initEventHandlers: function () { - parentWidget.prototype._initEventHandlers.call(this); - var eventData = {fileupload: this}; - this.options.filesContainer - .delegate( - '.start button', - 'click.' + this.options.namespace, - eventData, - this._startHandler - ) - .delegate( - '.cancel button', - 'click.' + this.options.namespace, - eventData, - this._cancelHandler - ) - .delegate( - '.delete button', - 'click.' + this.options.namespace, - eventData, - this._deleteHandler - ); + this._super(); + this._on(this.options.filesContainer, { + 'click .start': this._startHandler, + 'click .cancel': this._cancelHandler, + 'click .delete': this._deleteHandler + }); this._initButtonBarEventHandlers(); }, _destroyEventHandlers: function () { - var options = this.options; this._destroyButtonBarEventHandlers(); - options.filesContainer - .undelegate('.start button', 'click.' + options.namespace) - .undelegate('.cancel button', 'click.' + options.namespace) - .undelegate('.delete button', 'click.' + options.namespace); - parentWidget.prototype._destroyEventHandlers.call(this); + this._off(this.options.filesContainer, 'click'); + this._super(); }, _enableFileInputButton: function () { @@ -642,7 +653,7 @@ _initTemplates: function () { var options = this.options; - options.templatesContainer = document.createElement( + options.templatesContainer = this.document[0].createElement( options.filesContainer.prop('nodeName') ); if (tmpl) { @@ -665,36 +676,37 @@ }, _initSpecialOptions: function () { - parentWidget.prototype._initSpecialOptions.call(this); + this._super(); this._initFilesContainer(); this._initTemplates(); }, _create: function () { - parentWidget.prototype._create.call(this); - this._refreshOptionsList.push( - 'filesContainer', - 'uploadTemplateId', - 'downloadTemplateId' - ); - if (!$.blueimpFP) { - this._processingQueue = $.Deferred().resolveWith(this).promise(); - this.process = function () { - return this._processingQueue; - }; + this._super(); + this._resetFinishedDeferreds(); + if (!$.support.fileInput) { + this._disableFileInputButton(); } }, enable: function () { - parentWidget.prototype.enable.call(this); - this.element.find('input, button').prop('disabled', false); - this._enableFileInputButton(); + var wasDisabled = false; + if (this.options.disabled) { + wasDisabled = true; + } + this._super(); + if (wasDisabled) { + this.element.find('input, button').prop('disabled', false); + this._enableFileInputButton(); + } }, disable: function () { - this.element.find('input, button').prop('disabled', true); - this._disableFileInputButton(); - parentWidget.prototype.disable.call(this); + if (!this.options.disabled) { + this.element.find('input, button').prop('disabled', true); + this._disableFileInputButton(); + } + this._super(); } }); diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js new file mode 100644 index 0000000000000000000000000000000000000000..eebeb373371c1a3cb9e48db6d77615092d89e0b9 --- /dev/null +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js @@ -0,0 +1,125 @@ +/* + * jQuery File Upload Validation Plugin + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2013, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * https://opensource.org/licenses/MIT + */ + +/* global define, require, window */ + +;(function (factory) { + 'use strict'; + if (typeof define === 'function' && define.amd) { + // Register as an anonymous AMD module: + define([ + 'jquery', + './jquery.fileupload-process' + ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('./jquery.fileupload-process') + ); + } else { + // Browser globals: + factory( + window.jQuery + ); + } +}(function ($) { + 'use strict'; + + // Append to the default processQueue: + $.blueimp.fileupload.prototype.options.processQueue.push( + { + action: 'validate', + // Always trigger this action, + // even if the previous action was rejected: + always: true, + // Options taken from the global options map: + acceptFileTypes: '@', + maxFileSize: '@', + minFileSize: '@', + maxNumberOfFiles: '@', + disabled: '@disableValidation' + } + ); + + // The File Upload Validation plugin extends the fileupload widget + // with file validation functionality: + $.widget('blueimp.fileupload', $.blueimp.fileupload, { + + options: { + /* + // The regular expression for allowed file types, matches + // against either file type or file name: + acceptFileTypes: /(\.|\/)(gif|jpe?g|png)$/i, + // The maximum allowed file size in bytes: + maxFileSize: 10000000, // 10 MB + // The minimum allowed file size in bytes: + minFileSize: undefined, // No minimal file size + // The limit of files to be uploaded: + maxNumberOfFiles: 10, + */ + + // Function returning the current number of files, + // has to be overriden for maxNumberOfFiles validation: + getNumberOfFiles: $.noop, + + // Error and info messages: + messages: { + maxNumberOfFiles: 'Maximum number of files exceeded', + acceptFileTypes: 'File type not allowed', + maxFileSize: 'File is too large', + minFileSize: 'File is too small' + } + }, + + processActions: { + + validate: function (data, options) { + if (options.disabled) { + return data; + } + var dfd = $.Deferred(), + settings = this.options, + file = data.files[data.index], + fileSize; + if (options.minFileSize || options.maxFileSize) { + fileSize = file.size; + } + if ($.type(options.maxNumberOfFiles) === 'number' && + (settings.getNumberOfFiles() || 0) + data.files.length > + options.maxNumberOfFiles) { + file.error = settings.i18n('maxNumberOfFiles'); + } else if (options.acceptFileTypes && + !(options.acceptFileTypes.test(file.type) || + options.acceptFileTypes.test(file.name))) { + file.error = settings.i18n('acceptFileTypes'); + } else if (fileSize > options.maxFileSize) { + file.error = settings.i18n('maxFileSize'); + } else if ($.type(fileSize) === 'number' && + fileSize < options.minFileSize) { + file.error = settings.i18n('minFileSize'); + } else { + delete file.error; + } + if (file.error || data.files.error) { + data.files.error = true; + dfd.rejectWith(this, [data]); + } else { + dfd.resolveWith(this, [data]); + } + return dfd.promise(); + } + + } + + }); + +})); diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js new file mode 100644 index 0000000000000000000000000000000000000000..aedcec2ba5416077676745478d8926b453515978 --- /dev/null +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js @@ -0,0 +1,113 @@ +/* + * jQuery File Upload Video Preview Plugin + * https://github.com/blueimp/jQuery-File-Upload + * + * Copyright 2013, Sebastian Tschan + * https://blueimp.net + * + * Licensed under the MIT license: + * https://opensource.org/licenses/MIT + */ + +/* jshint nomen:false */ +/* global define, require, window, document */ + +;(function (factory) { + 'use strict'; + if (typeof define === 'function' && define.amd) { + // Register as an anonymous AMD module: + define([ + 'jquery', + 'load-image', + './jquery.fileupload-process' + ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('blueimp-load-image/js/load-image'), + require('./jquery.fileupload-process') + ); + } else { + // Browser globals: + factory( + window.jQuery, + window.loadImage + ); + } +}(function ($, loadImage) { + 'use strict'; + + // Prepend to the default processQueue: + $.blueimp.fileupload.prototype.options.processQueue.unshift( + { + action: 'loadVideo', + // Use the action as prefix for the "@" options: + prefix: true, + fileTypes: '@', + maxFileSize: '@', + disabled: '@disableVideoPreview' + }, + { + action: 'setVideo', + name: '@videoPreviewName', + disabled: '@disableVideoPreview' + } + ); + + // The File Upload Video Preview plugin extends the fileupload widget + // with video preview functionality: + $.widget('blueimp.fileupload', $.blueimp.fileupload, { + + options: { + // The regular expression for the types of video files to load, + // matched against the file type: + loadVideoFileTypes: /^video\/.*$/ + }, + + _videoElement: document.createElement('video'), + + processActions: { + + // Loads the video file given via data.files and data.index + // as video element if the browser supports playing it. + // Accepts the options fileTypes (regular expression) + // and maxFileSize (integer) to limit the files to load: + loadVideo: function (data, options) { + if (options.disabled) { + return data; + } + var file = data.files[data.index], + url, + video; + if (this._videoElement.canPlayType && + this._videoElement.canPlayType(file.type) && + ($.type(options.maxFileSize) !== 'number' || + file.size <= options.maxFileSize) && + (!options.fileTypes || + options.fileTypes.test(file.type))) { + url = loadImage.createObjectURL(file); + if (url) { + video = this._videoElement.cloneNode(false); + video.src = url; + video.controls = true; + data.video = video; + return data; + } + } + return data; + }, + + // Sets the video element as a property of the file object: + setVideo: function (data, options) { + if (data.video && !options.disabled) { + data.files[data.index][options.name || 'preview'] = data.video; + } + return data; + } + + } + + }); + +})); diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js index c1bc9220fc52923d26aab8d830b4ec7002225630..629f57a258f7f7853fa275fe6fbc19c698713426 100644 --- a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js @@ -1,25 +1,31 @@ /* - * jQuery File Upload Plugin 5.12 + * jQuery File Upload Plugin * https://github.com/blueimp/jQuery-File-Upload * * Copyright 2010, Sebastian Tschan * https://blueimp.net * * Licensed under the MIT license: - * http://www.opensource.org/licenses/MIT + * https://opensource.org/licenses/MIT */ -/*jslint nomen: true, unparam: true, regexp: true */ -/*global define, window, document, Blob, FormData, location */ +/* jshint nomen:false */ +/* global define, require, window, document, location, Blob, FormData */ -(function (factory) { +;(function (factory) { 'use strict'; if (typeof define === 'function' && define.amd) { // Register as an anonymous AMD module: define([ 'jquery', - 'jquery.ui.widget' + 'jquery-ui/ui/widget' ], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory( + require('jquery'), + require('./vendor/jquery.ui.widget') + ); } else { // Browser globals: factory(window.jQuery); @@ -27,12 +33,49 @@ }(function ($) { 'use strict'; + // Detect file input support, based on + // http://viljamis.com/blog/2012/file-upload-support-on-mobile/ + $.support.fileInput = !(new RegExp( + // Handle devices which give false positives for the feature detection: + '(Android (1\\.[0156]|2\\.[01]))' + + '|(Windows Phone (OS 7|8\\.0))|(XBLWP)|(ZuneWP)|(WPDesktop)' + + '|(w(eb)?OSBrowser)|(webOS)' + + '|(Kindle/(1\\.0|2\\.[05]|3\\.0))' + ).test(window.navigator.userAgent) || + // Feature detection for all other devices: + $('<input type="file"/>').prop('disabled')); + // The FileReader API is not actually used, but works as feature detection, - // as e.g. Safari supports XHR file uploads via the FormData API, - // but not non-multipart XHR file uploads: - $.support.xhrFileUpload = !!(window.XMLHttpRequestUpload && window.FileReader); + // as some Safari versions (5?) support XHR file uploads via the FormData API, + // but not non-multipart XHR file uploads. + // window.XMLHttpRequestUpload is not available on IE10, so we check for + // window.ProgressEvent instead to detect XHR2 file upload capability: + $.support.xhrFileUpload = !!(window.ProgressEvent && window.FileReader); $.support.xhrFormDataFileUpload = !!window.FormData; + // Detect support for Blob slicing (required for chunked uploads): + $.support.blobSlice = window.Blob && (Blob.prototype.slice || + Blob.prototype.webkitSlice || Blob.prototype.mozSlice); + + // Helper function to create drag handlers for dragover/dragenter/dragleave: + function getDragHandler(type) { + var isDragOver = type === 'dragover'; + return function (e) { + e.dataTransfer = e.originalEvent && e.originalEvent.dataTransfer; + var dataTransfer = e.dataTransfer; + if (dataTransfer && $.inArray('Files', dataTransfer.types) !== -1 && + this._trigger( + type, + $.Event(type, {delegatedEvent: e}) + ) !== false) { + e.preventDefault(); + if (isDragOver) { + dataTransfer.dropEffect = 'copy'; + } + } + }; + } + // The fileupload widget listens for change events on file input fields defined // via fileInput setting and paste or drop events of the given dropZone. // In addition to the default jQuery Widget methods, the fileupload widget @@ -44,17 +87,16 @@ $.widget('blueimp.fileupload', { options: { - // The namespace used for event handler binding on the dropZone and - // fileInput collections. - // If not set, the name of the widget ("fileupload") is used. - namespace: undefined, - // The drop target collection, by the default the complete document. - // Set to null or an empty collection to disable drag & drop support: + // The drop target element(s), by the default the complete document. + // Set to null to disable drag & drop support: dropZone: $(document), - // The file input field collection, that is listened for change events. + // The paste target element(s), by the default undefined. + // Set to a DOM node or jQuery object to enable file pasting: + pasteZone: undefined, + // The file input field(s), that are listened to for change events. // If undefined, it is set to the file input fields inside // of the widget element on plugin initialization. - // Set to null or an empty collection to disable the change listener. + // Set to null to disable the change listener. fileInput: undefined, // By default, the file input field is replaced with a clone after // each input field change event. This is required for iframe transport @@ -73,6 +115,14 @@ // To limit the number of files uploaded with one XHR request, // set the following option to an integer greater than 0: limitMultiFileUploads: undefined, + // The following option limits the number of files uploaded with one + // XHR request to keep the request size under or equal to the defined + // limit in bytes: + limitMultiFileUploadSize: undefined, + // Multipart file uploads add a number of bytes to each uploaded file, + // therefore the following option adds an overhead for each file used + // in the limitMultiFileUploadSize configuration: + limitMultiFileUploadSizeOverhead: 512, // Set the following option to true to issue all file upload requests // in a sequential order: sequentialUploads: false, @@ -113,6 +163,25 @@ progressInterval: 100, // Interval in milliseconds to calculate progress bitrate: bitrateInterval: 500, + // By default, uploads are started automatically when adding files: + autoUpload: true, + + // Error and info messages: + messages: { + uploadedBytes: 'Uploaded bytes exceed file size' + }, + + // Translation function, gets the message key to be translated + // and an object with context specific data as arguments: + i18n: function (message, context) { + message = this.messages[message] || message.toString(); + if (context) { + $.each(context, function (key, value) { + message = message.replace('{' + key + '}', value); + }); + } + return message; + }, // Additional form data to be sent along with the file uploads can be set // using this option, which accepts an array of objects with name and @@ -126,66 +195,109 @@ // The add callback is invoked as soon as files are added to the fileupload // widget (via file input selection, drag & drop, paste or add API call). // If the singleFileUploads option is enabled, this callback will be - // called once for each file in the selection for XHR file uplaods, else + // called once for each file in the selection for XHR file uploads, else // once for each file selection. + // // The upload starts when the submit method is invoked on the data parameter. // The data object contains a files property holding the added files - // and allows to override plugin options as well as define ajax settings. + // and allows you to override plugin options as well as define ajax settings. + // // Listeners for this callback can also be bound the following way: // .bind('fileuploadadd', func); + // // data.submit() returns a Promise object and allows to attach additional // handlers using jQuery's Deferred callbacks: // data.submit().done(func).fail(func).always(func); add: function (e, data) { - data.submit(); + if (e.isDefaultPrevented()) { + return false; + } + if (data.autoUpload || (data.autoUpload !== false && + $(this).fileupload('option', 'autoUpload'))) { + data.process().done(function () { + data.submit(); + }); + } }, // Other callbacks: + // Callback for the submit event of each file upload: // submit: function (e, data) {}, // .bind('fileuploadsubmit', func); + // Callback for the start of each file upload request: // send: function (e, data) {}, // .bind('fileuploadsend', func); + // Callback for successful uploads: // done: function (e, data) {}, // .bind('fileuploaddone', func); + // Callback for failed (abort or error) uploads: // fail: function (e, data) {}, // .bind('fileuploadfail', func); + // Callback for completed (success, abort or error) requests: // always: function (e, data) {}, // .bind('fileuploadalways', func); + // Callback for upload progress events: // progress: function (e, data) {}, // .bind('fileuploadprogress', func); + // Callback for global upload progress events: // progressall: function (e, data) {}, // .bind('fileuploadprogressall', func); + // Callback for uploads start, equivalent to the global ajaxStart event: // start: function (e) {}, // .bind('fileuploadstart', func); + // Callback for uploads stop, equivalent to the global ajaxStop event: // stop: function (e) {}, // .bind('fileuploadstop', func); - // Callback for change events of the fileInput collection: + + // Callback for change events of the fileInput(s): // change: function (e, data) {}, // .bind('fileuploadchange', func); - // Callback for paste events to the dropZone collection: + + // Callback for paste events to the pasteZone(s): // paste: function (e, data) {}, // .bind('fileuploadpaste', func); - // Callback for drop events of the dropZone collection: + + // Callback for drop events of the dropZone(s): // drop: function (e, data) {}, // .bind('fileuploaddrop', func); - // Callback for dragover events of the dropZone collection: + + // Callback for dragover events of the dropZone(s): // dragover: function (e) {}, // .bind('fileuploaddragover', func); + // Callback for the start of each chunk upload request: + // chunksend: function (e, data) {}, // .bind('fileuploadchunksend', func); + + // Callback for successful chunk uploads: + // chunkdone: function (e, data) {}, // .bind('fileuploadchunkdone', func); + + // Callback for failed (abort or error) chunk uploads: + // chunkfail: function (e, data) {}, // .bind('fileuploadchunkfail', func); + + // Callback for completed (success, abort or error) chunk upload requests: + // chunkalways: function (e, data) {}, // .bind('fileuploadchunkalways', func); + // The plugin options are used as settings object for the ajax calls. // The following are jQuery ajax settings required for the file uploads: processData: false, contentType: false, - cache: false + cache: false, + timeout: 0 }, - // A list of options that require a refresh after assigning a new value: - _refreshOptionsList: [ - 'namespace', - 'dropZone', + // A list of options that require reinitializing event listeners and/or + // special initialization code: + _specialOptions: [ 'fileInput', + 'dropZone', + 'pasteZone', 'multipart', 'forceIframeTransport' ], + _blobSlice: $.support.blobSlice && function () { + var slice = this.slice || this.webkitSlice || this.mozSlice; + return slice.apply(this, arguments); + }, + _BitrateTimer: function () { - this.timestamp = +(new Date()); + this.timestamp = ((Date.now) ? Date.now() : (new Date()).getTime()); this.loaded = 0; this.bitrate = 0; this.getBitrate = function (now, loaded, interval) { @@ -207,13 +319,13 @@ _getFormData: function (options) { var formData; - if (typeof options.formData === 'function') { + if ($.type(options.formData) === 'function') { return options.formData(options.form); } - if ($.isArray(options.formData)) { + if ($.isArray(options.formData)) { return options.formData; } - if (options.formData) { + if ($.type(options.formData) === 'object') { formData = []; $.each(options.formData, function (name, value) { formData.push({name: name, value: value}); @@ -231,10 +343,35 @@ return total; }, + _initProgressObject: function (obj) { + var progress = { + loaded: 0, + total: 0, + bitrate: 0 + }; + if (obj._progress) { + $.extend(obj._progress, progress); + } else { + obj._progress = progress; + } + }, + + _initResponseObject: function (obj) { + var prop; + if (obj._response) { + for (prop in obj._response) { + if (obj._response.hasOwnProperty(prop)) { + delete obj._response[prop]; + } + } + } else { + obj._response = {}; + } + }, + _onProgress: function (e, data) { if (e.lengthComputable) { - var now = +(new Date()), - total, + var now = ((Date.now) ? Date.now() : (new Date()).getTime()), loaded; if (data._time && data.progressInterval && (now - data._time < data.progressInterval) && @@ -242,16 +379,19 @@ return; } data._time = now; - total = data.total || this._getTotal(data.files); - loaded = parseInt( - e.loaded / e.total * (data.chunkSize || total), - 10 + loaded = Math.floor( + e.loaded / e.total * (data.chunkSize || data._progress.total) ) + (data.uploadedBytes || 0); - this._loaded += loaded - (data.loaded || data.uploadedBytes || 0); - data.lengthComputable = true; - data.loaded = loaded; - data.total = total; - data.bitrate = data._bitrateTimer.getBitrate( + // Add the difference from the previously loaded state + // to the global loaded counter: + this._progress.loaded += (loaded - data._progress.loaded); + this._progress.bitrate = this._bitrateTimer.getBitrate( + now, + this._progress.loaded, + data.bitrateInterval + ); + data._progress.loaded = data.loaded = loaded; + data._progress.bitrate = data.bitrate = data._bitrateTimer.getBitrate( now, loaded, data.bitrateInterval @@ -259,19 +399,18 @@ // Trigger a custom progress event with a total data property set // to the file size(s) of the current upload and a loaded data // property calculated accordingly: - this._trigger('progress', e, data); + this._trigger( + 'progress', + $.Event('progress', {delegatedEvent: e}), + data + ); // Trigger a global progress event for all current file uploads, // including ajax calls queued for sequential file uploads: - this._trigger('progressall', e, { - lengthComputable: true, - loaded: this._loaded, - total: this._total, - bitrate: this._bitrateTimer.getBitrate( - now, - this._loaded, - data.bitrateInterval - ) - }); + this._trigger( + 'progressall', + $.Event('progressall', {delegatedEvent: e}), + this._progress + ); } }, @@ -295,35 +434,31 @@ } }, + _isInstanceOf: function (type, obj) { + // Cross-frame instanceof check + return Object.prototype.toString.call(obj) === '[object ' + type + ']'; + }, + _initXHRData: function (options) { - var formData, + var that = this, + formData, file = options.files[0], // Ignore non-multipart setting if not supported: multipart = options.multipart || !$.support.xhrFileUpload, - paramName = options.paramName[0]; - if (!multipart || options.blob) { - // For non-multipart uploads and chunked uploads, - // file meta data is not part of the request body, - // so we transmit this data as part of the HTTP headers. - // For cross domain requests, these headers must be allowed - // via Access-Control-Allow-Headers or removed using - // the beforeSend callback: - options.headers = $.extend(options.headers, { - 'X-File-Name': file.name, - 'X-File-Type': file.type, - 'X-File-Size': file.size - }); - if (!options.blob) { - // Non-chunked non-multipart upload: - options.contentType = file.type; - options.data = file; - } else if (!multipart) { - // Chunked non-multipart upload: - options.contentType = 'application/octet-stream'; - options.data = options.blob; - } + paramName = $.type(options.paramName) === 'array' ? + options.paramName[0] : options.paramName; + options.headers = $.extend({}, options.headers); + if (options.contentRange) { + options.headers['Content-Range'] = options.contentRange; + } + if (!multipart || options.blob || !this._isInstanceOf('File', file)) { + options.headers['Content-Disposition'] = 'attachment; filename="' + + encodeURI(file.uploadName || file.name) + '"'; } - if (multipart && $.support.xhrFormDataFileUpload) { + if (!multipart) { + options.contentType = file.type || 'application/octet-stream'; + options.data = options.blob || file; + } else if ($.support.xhrFormDataFileUpload) { if (options.postMessage) { // window.postMessage does not allow sending FormData // objects, so we just add the File/Blob objects to @@ -338,13 +473,14 @@ } else { $.each(options.files, function (index, file) { formData.push({ - name: options.paramName[index] || paramName, + name: ($.type(options.paramName) === 'array' && + options.paramName[index]) || paramName, value: file }); }); } } else { - if (options.formData instanceof FormData) { + if (that._isInstanceOf('FormData', options.formData)) { formData = options.formData; } else { formData = new FormData(); @@ -353,17 +489,22 @@ }); } if (options.blob) { - formData.append(paramName, options.blob, file.name); + formData.append( + paramName, + options.blob, + file.uploadName || file.name + ); } else { $.each(options.files, function (index, file) { - // File objects are also Blob instances. // This check allows the tests to run with // dummy objects: - if (file instanceof Blob) { + if (that._isInstanceOf('File', file) || + that._isInstanceOf('Blob', file)) { formData.append( - options.paramName[index] || paramName, + ($.type(options.paramName) === 'array' && + options.paramName[index]) || paramName, file, - file.name + file.uploadName || file.name ); } }); @@ -376,13 +517,13 @@ }, _initIframeSettings: function (options) { + var targetHost = $('<a></a>').prop('href', options.url).prop('host'); // Setting the dataType to iframe enables the iframe transport: options.dataType = 'iframe ' + (options.dataType || ''); // The iframe transport accepts a serialized array as form data: options.formData = this._getFormData(options); // Add redirect url to form data on cross-domain uploads: - if (options.redirect && $('<a></a>').prop('href', options.url) - .prop('host') !== location.host) { + if (options.redirect && targetHost && targetHost !== location.host) { options.formData.push({ name: options.redirectParamName || 'redirect', value: options.redirect @@ -404,7 +545,7 @@ options.dataType = 'postmessage ' + (options.dataType || ''); } } else { - this._initIframeSettings(options, 'iframe'); + this._initIframeSettings(options); } }, @@ -436,17 +577,28 @@ // associated form, if available: if (!options.form || !options.form.length) { options.form = $(options.fileInput.prop('form')); + // If the given file input doesn't have an associated form, + // use the default widget file input's form: + if (!options.form.length) { + options.form = $(this.options.fileInput.prop('form')); + } } options.paramName = this._getParamName(options); if (!options.url) { options.url = options.form.prop('action') || location.href; } // The HTTP request method must be "POST" or "PUT": - options.type = (options.type || options.form.prop('method') || '') - .toUpperCase(); - if (options.type !== 'POST' && options.type !== 'PUT') { + options.type = (options.type || + ($.type(options.form.prop('method')) === 'string' && + options.form.prop('method')) || '' + ).toUpperCase(); + if (options.type !== 'POST' && options.type !== 'PUT' && + options.type !== 'PATCH') { options.type = 'POST'; } + if (!options.formAcceptCharset) { + options.formAcceptCharset = options.form.attr('accept-charset'); + } }, _getAJAXSettings: function (data) { @@ -456,6 +608,21 @@ return options; }, + // jQuery 1.6 doesn't provide .state(), + // while jQuery 1.8+ removed .isRejected() and .isResolved(): + _getDeferredState: function (deferred) { + if (deferred.state) { + return deferred.state(); + } + if (deferred.isResolved()) { + return 'resolved'; + } + if (deferred.isRejected()) { + return 'rejected'; + } + return 'pending'; + }, + // Maps jqXHR callbacks to the equivalent // methods of the given Promise object: _enhancePromise: function (promise) { @@ -480,25 +647,94 @@ return this._enhancePromise(promise); }, + // Adds convenience methods to the data callback argument: + _addConvenienceMethods: function (e, data) { + var that = this, + getPromise = function (args) { + return $.Deferred().resolveWith(that, args).promise(); + }; + data.process = function (resolveFunc, rejectFunc) { + if (resolveFunc || rejectFunc) { + data._processQueue = this._processQueue = + (this._processQueue || getPromise([this])).then( + function () { + if (data.errorThrown) { + return $.Deferred() + .rejectWith(that, [data]).promise(); + } + return getPromise(arguments); + } + ).then(resolveFunc, rejectFunc); + } + return this._processQueue || getPromise([this]); + }; + data.submit = function () { + if (this.state() !== 'pending') { + data.jqXHR = this.jqXHR = + (that._trigger( + 'submit', + $.Event('submit', {delegatedEvent: e}), + this + ) !== false) && that._onSend(e, this); + } + return this.jqXHR || that._getXHRPromise(); + }; + data.abort = function () { + if (this.jqXHR) { + return this.jqXHR.abort(); + } + this.errorThrown = 'abort'; + that._trigger('fail', null, this); + return that._getXHRPromise(false); + }; + data.state = function () { + if (this.jqXHR) { + return that._getDeferredState(this.jqXHR); + } + if (this._processQueue) { + return that._getDeferredState(this._processQueue); + } + }; + data.processing = function () { + return !this.jqXHR && this._processQueue && that + ._getDeferredState(this._processQueue) === 'pending'; + }; + data.progress = function () { + return this._progress; + }; + data.response = function () { + return this._response; + }; + }, + + // Parses the Range header from the server response + // and returns the uploaded bytes: + _getUploadedBytes: function (jqXHR) { + var range = jqXHR.getResponseHeader('Range'), + parts = range && range.split('-'), + upperBytesPos = parts && parts.length > 1 && + parseInt(parts[1], 10); + return upperBytesPos && upperBytesPos + 1; + }, + // Uploads a file in multiple, sequential requests // by splitting the file up in multiple blob chunks. // If the second parameter is true, only tests if the file // should be uploaded in chunks, but does not invoke any // upload requests: _chunkedUpload: function (options, testOnly) { + options.uploadedBytes = options.uploadedBytes || 0; var that = this, file = options.files[0], fs = file.size, - ub = options.uploadedBytes = options.uploadedBytes || 0, + ub = options.uploadedBytes, mcs = options.maxChunkSize || fs, - // Use the Blob methods with the slice implementation - // according to the W3C Blob API specification: - slice = file.webkitSlice || file.mozSlice || file.slice, - upload, - n, + slice = this._blobSlice, + dfd = $.Deferred(), + promise = dfd.promise(), jqXHR, - pipe; - if (!(this._isXHRUpload(options) && slice && (ub || mcs < fs)) || + upload; + if (!(this._isXHRUpload(options) && slice && (ub || ($.type(mcs) === 'function' ? mcs(options) : mcs) < fs)) || options.data) { return false; } @@ -506,62 +742,84 @@ return true; } if (ub >= fs) { - file.error = 'uploadedBytes'; + file.error = options.i18n('uploadedBytes'); return this._getXHRPromise( false, options.context, [null, 'error', file.error] ); } - // n is the number of blobs to upload, - // calculated via filesize, uploaded bytes and max chunk size: - n = Math.ceil((fs - ub) / mcs); - // The chunk upload method accepting the chunk number as parameter: - upload = function (i) { - if (!i) { - return that._getXHRPromise(true, options.context); - } - // Upload the blobs in sequential order: - return upload(i -= 1).pipe(function () { - // Clone the options object for each chunk upload: - var o = $.extend({}, options); - o.blob = slice.call( - file, - ub + i * mcs, - ub + (i + 1) * mcs - ); - // Store the current chunk size, as the blob itself - // will be dereferenced after data processing: - o.chunkSize = o.blob.size; - // Process the upload data (the blob and potential form data): - that._initXHRData(o); - // Add progress listeners for this chunk upload: - that._initProgressListener(o); - jqXHR = ($.ajax(o) || that._getXHRPromise(false, o.context)) - .done(function () { - // Create a progress event if upload is done and - // no progress event has been invoked for this chunk: - if (!o.loaded) { - that._onProgress($.Event('progress', { - lengthComputable: true, - loaded: o.chunkSize, - total: o.chunkSize - }), o); - } - options.uploadedBytes = o.uploadedBytes += - o.chunkSize; - }); - return jqXHR; - }); + // The chunk upload method: + upload = function () { + // Clone the options object for each chunk upload: + var o = $.extend({}, options), + currentLoaded = o._progress.loaded; + o.blob = slice.call( + file, + ub, + ub + ($.type(mcs) === 'function' ? mcs(o) : mcs), + file.type + ); + // Store the current chunk size, as the blob itself + // will be dereferenced after data processing: + o.chunkSize = o.blob.size; + // Expose the chunk bytes position range: + o.contentRange = 'bytes ' + ub + '-' + + (ub + o.chunkSize - 1) + '/' + fs; + // Process the upload data (the blob and potential form data): + that._initXHRData(o); + // Add progress listeners for this chunk upload: + that._initProgressListener(o); + jqXHR = ((that._trigger('chunksend', null, o) !== false && $.ajax(o)) || + that._getXHRPromise(false, o.context)) + .done(function (result, textStatus, jqXHR) { + ub = that._getUploadedBytes(jqXHR) || + (ub + o.chunkSize); + // Create a progress event if no final progress event + // with loaded equaling total has been triggered + // for this chunk: + if (currentLoaded + o.chunkSize - o._progress.loaded) { + that._onProgress($.Event('progress', { + lengthComputable: true, + loaded: ub - o.uploadedBytes, + total: ub - o.uploadedBytes + }), o); + } + options.uploadedBytes = o.uploadedBytes = ub; + o.result = result; + o.textStatus = textStatus; + o.jqXHR = jqXHR; + that._trigger('chunkdone', null, o); + that._trigger('chunkalways', null, o); + if (ub < fs) { + // File upload not yet complete, + // continue with the next chunk: + upload(); + } else { + dfd.resolveWith( + o.context, + [result, textStatus, jqXHR] + ); + } + }) + .fail(function (jqXHR, textStatus, errorThrown) { + o.jqXHR = jqXHR; + o.textStatus = textStatus; + o.errorThrown = errorThrown; + that._trigger('chunkfail', null, o); + that._trigger('chunkalways', null, o); + dfd.rejectWith( + o.context, + [jqXHR, textStatus, errorThrown] + ); + }); }; - // Return the piped Promise object, enhanced with an abort method, - // which is delegated to the jqXHR object of the current upload, - // and jqXHR callbacks mapped to the equivalent Promise methods: - pipe = upload(n); - pipe.abort = function () { + this._enhancePromise(promise); + promise.abort = function () { return jqXHR.abort(); }; - return this._enhancePromise(pipe); + upload(); + return promise; }, _beforeSend: function (e, data) { @@ -572,102 +830,115 @@ this._trigger('start'); // Set timer for global bitrate progress calculation: this._bitrateTimer = new this._BitrateTimer(); + // Reset the global progress values: + this._progress.loaded = this._progress.total = 0; + this._progress.bitrate = 0; } + // Make sure the container objects for the .response() and + // .progress() methods on the data object are available + // and reset to their initial state: + this._initResponseObject(data); + this._initProgressObject(data); + data._progress.loaded = data.loaded = data.uploadedBytes || 0; + data._progress.total = data.total = this._getTotal(data.files) || 1; + data._progress.bitrate = data.bitrate = 0; this._active += 1; // Initialize the global progress values: - this._loaded += data.uploadedBytes || 0; - this._total += this._getTotal(data.files); + this._progress.loaded += data.loaded; + this._progress.total += data.total; }, _onDone: function (result, textStatus, jqXHR, options) { - if (!this._isXHRUpload(options)) { - // Create a progress event for each iframe load: + var total = options._progress.total, + response = options._response; + if (options._progress.loaded < total) { + // Create a progress event if no final progress event + // with loaded equaling total has been triggered: this._onProgress($.Event('progress', { lengthComputable: true, - loaded: 1, - total: 1 + loaded: total, + total: total }), options); } - options.result = result; - options.textStatus = textStatus; - options.jqXHR = jqXHR; + response.result = options.result = result; + response.textStatus = options.textStatus = textStatus; + response.jqXHR = options.jqXHR = jqXHR; this._trigger('done', null, options); }, _onFail: function (jqXHR, textStatus, errorThrown, options) { - options.jqXHR = jqXHR; - options.textStatus = textStatus; - options.errorThrown = errorThrown; - this._trigger('fail', null, options); + var response = options._response; if (options.recalculateProgress) { // Remove the failed (error or abort) file upload from // the global progress calculation: - this._loaded -= options.loaded || options.uploadedBytes || 0; - this._total -= options.total || this._getTotal(options.files); + this._progress.loaded -= options._progress.loaded; + this._progress.total -= options._progress.total; } + response.jqXHR = options.jqXHR = jqXHR; + response.textStatus = options.textStatus = textStatus; + response.errorThrown = options.errorThrown = errorThrown; + this._trigger('fail', null, options); }, _onAlways: function (jqXHRorResult, textStatus, jqXHRorError, options) { - this._active -= 1; - options.textStatus = textStatus; - if (jqXHRorError && jqXHRorError.always) { - options.jqXHR = jqXHRorError; - options.result = jqXHRorResult; - } else { - options.jqXHR = jqXHRorResult; - options.errorThrown = jqXHRorError; - } + // jqXHRorResult, textStatus and jqXHRorError are added to the + // options object via done and fail callbacks this._trigger('always', null, options); - if (this._active === 0) { - // The stop callback is triggered when all uploads have - // been completed, equivalent to the global ajaxStop event: - this._trigger('stop'); - // Reset the global progress values: - this._loaded = this._total = 0; - this._bitrateTimer = null; - } }, _onSend: function (e, data) { + if (!data.submit) { + this._addConvenienceMethods(e, data); + } var that = this, jqXHR, + aborted, slot, pipe, options = that._getAJAXSettings(data), - send = function (resolve, args) { + send = function () { that._sending += 1; // Set timer for bitrate progress calculation: options._bitrateTimer = new that._BitrateTimer(); jqXHR = jqXHR || ( - (resolve !== false && - that._trigger('send', e, options) !== false && - (that._chunkedUpload(options) || $.ajax(options))) || - that._getXHRPromise(false, options.context, args) + ((aborted || that._trigger( + 'send', + $.Event('send', {delegatedEvent: e}), + options + ) === false) && + that._getXHRPromise(false, options.context, aborted)) || + that._chunkedUpload(options) || $.ajax(options) ).done(function (result, textStatus, jqXHR) { that._onDone(result, textStatus, jqXHR, options); }).fail(function (jqXHR, textStatus, errorThrown) { that._onFail(jqXHR, textStatus, errorThrown, options); }).always(function (jqXHRorResult, textStatus, jqXHRorError) { - that._sending -= 1; that._onAlways( jqXHRorResult, textStatus, jqXHRorError, options ); + that._sending -= 1; + that._active -= 1; if (options.limitConcurrentUploads && options.limitConcurrentUploads > that._sending) { // Start the next queued upload, // that has not been aborted: var nextSlot = that._slots.shift(); while (nextSlot) { - if (!nextSlot.isRejected()) { + if (that._getDeferredState(nextSlot) === 'pending') { nextSlot.resolve(); break; } nextSlot = that._slots.shift(); } } + if (that._active === 0) { + // The stop callback is triggered when all uploads have + // been completed, equivalent to the global ajaxStop event: + that._trigger('stop'); + } }); return jqXHR; }; @@ -678,20 +949,21 @@ if (this.options.limitConcurrentUploads > 1) { slot = $.Deferred(); this._slots.push(slot); - pipe = slot.pipe(send); + pipe = slot.then(send); } else { - pipe = (this._sequence = this._sequence.pipe(send, send)); + this._sequence = this._sequence.then(send, send); + pipe = this._sequence; } // Return the piped Promise object, enhanced with an abort method, // which is delegated to the jqXHR object of the current upload, // and jqXHR callbacks mapped to the equivalent Promise methods: pipe.abort = function () { - var args = [undefined, 'abort', 'abort']; + aborted = [undefined, 'abort', 'abort']; if (!jqXHR) { if (slot) { - slot.rejectWith(args); + slot.rejectWith(options.context, aborted); } - return send(false, args); + return send(); } return jqXHR.abort(); }; @@ -704,64 +976,97 @@ var that = this, result = true, options = $.extend({}, this.options, data), + files = data.files, + filesLength = files.length, limit = options.limitMultiFileUploads, + limitSize = options.limitMultiFileUploadSize, + overhead = options.limitMultiFileUploadSizeOverhead, + batchSize = 0, paramName = this._getParamName(options), paramNameSet, paramNameSlice, fileSet, - i; - if (!(options.singleFileUploads || limit) || + i, + j = 0; + if (!filesLength) { + return false; + } + if (limitSize && files[0].size === undefined) { + limitSize = undefined; + } + if (!(options.singleFileUploads || limit || limitSize) || !this._isXHRUpload(options)) { - fileSet = [data.files]; + fileSet = [files]; paramNameSet = [paramName]; - } else if (!options.singleFileUploads && limit) { + } else if (!(options.singleFileUploads || limitSize) && limit) { fileSet = []; paramNameSet = []; - for (i = 0; i < data.files.length; i += limit) { - fileSet.push(data.files.slice(i, i + limit)); + for (i = 0; i < filesLength; i += limit) { + fileSet.push(files.slice(i, i + limit)); paramNameSlice = paramName.slice(i, i + limit); if (!paramNameSlice.length) { paramNameSlice = paramName; } paramNameSet.push(paramNameSlice); } + } else if (!options.singleFileUploads && limitSize) { + fileSet = []; + paramNameSet = []; + for (i = 0; i < filesLength; i = i + 1) { + batchSize += files[i].size + overhead; + if (i + 1 === filesLength || + ((batchSize + files[i + 1].size + overhead) > limitSize) || + (limit && i + 1 - j >= limit)) { + fileSet.push(files.slice(j, i + 1)); + paramNameSlice = paramName.slice(j, i + 1); + if (!paramNameSlice.length) { + paramNameSlice = paramName; + } + paramNameSet.push(paramNameSlice); + j = i + 1; + batchSize = 0; + } + } } else { paramNameSet = paramName; } - data.originalFiles = data.files; - $.each(fileSet || data.files, function (index, element) { + data.originalFiles = files; + $.each(fileSet || files, function (index, element) { var newData = $.extend({}, data); newData.files = fileSet ? element : [element]; newData.paramName = paramNameSet[index]; - newData.submit = function () { - newData.jqXHR = this.jqXHR = - (that._trigger('submit', e, this) !== false) && - that._onSend(e, this); - return this.jqXHR; - }; - return (result = that._trigger('add', e, newData)); + that._initResponseObject(newData); + that._initProgressObject(newData); + that._addConvenienceMethods(e, newData); + result = that._trigger( + 'add', + $.Event('add', {delegatedEvent: e}), + newData + ); + return result; }); return result; }, - // File Normalization for Gecko 1.9.1 (Firefox 3.5) support: - _normalizeFile: function (index, file) { - if (file.name === undefined && file.size === undefined) { - file.name = file.fileName; - file.size = file.fileSize; - } - }, - - _replaceFileInput: function (input) { - var inputClone = input.clone(true); + _replaceFileInput: function (data) { + var input = data.fileInput, + inputClone = input.clone(true), + restoreFocus = input.is(document.activeElement); + // Add a reference for the new cloned file input to the data argument: + data.fileInputClone = inputClone; $('<form></form>').append(inputClone)[0].reset(); // Detaching allows to insert the fileInput on another form // without loosing the file input value: input.after(inputClone).detach(); + // If the fileInput had focus before it was detached, + // restore focus to the inputClone. + if (restoreFocus) { + inputClone.focus(); + } // Avoid memory leaks with the detached file input: $.cleanData(input.unbind('remove')); // Replace the original file input element in the fileInput - // collection with the clone, which has been copied including + // elements set with the clone, which has been copied including // event handlers: this.options.fileInput = this.options.fileInput.map(function (i, el) { if (el === input[0]) { @@ -776,113 +1081,252 @@ } }, - _getFileInputFiles: function (fileInput) { + _handleFileTreeEntry: function (entry, path) { + var that = this, + dfd = $.Deferred(), + entries = [], + dirReader, + errorHandler = function (e) { + if (e && !e.entry) { + e.entry = entry; + } + // Since $.when returns immediately if one + // Deferred is rejected, we use resolve instead. + // This allows valid files and invalid items + // to be returned together in one set: + dfd.resolve([e]); + }, + successHandler = function (entries) { + that._handleFileTreeEntries( + entries, + path + entry.name + '/' + ).done(function (files) { + dfd.resolve(files); + }).fail(errorHandler); + }, + readEntries = function () { + dirReader.readEntries(function (results) { + if (!results.length) { + successHandler(entries); + } else { + entries = entries.concat(results); + readEntries(); + } + }, errorHandler); + }; + path = path || ''; + if (entry.isFile) { + if (entry._file) { + // Workaround for Chrome bug #149735 + entry._file.relativePath = path; + dfd.resolve(entry._file); + } else { + entry.file(function (file) { + file.relativePath = path; + dfd.resolve(file); + }, errorHandler); + } + } else if (entry.isDirectory) { + dirReader = entry.createReader(); + readEntries(); + } else { + // Return an empty list for file system items + // other than files or directories: + dfd.resolve([]); + } + return dfd.promise(); + }, + + _handleFileTreeEntries: function (entries, path) { + var that = this; + return $.when.apply( + $, + $.map(entries, function (entry) { + return that._handleFileTreeEntry(entry, path); + }) + ).then(function () { + return Array.prototype.concat.apply( + [], + arguments + ); + }); + }, + + _getDroppedFiles: function (dataTransfer) { + dataTransfer = dataTransfer || {}; + var items = dataTransfer.items; + if (items && items.length && (items[0].webkitGetAsEntry || + items[0].getAsEntry)) { + return this._handleFileTreeEntries( + $.map(items, function (item) { + var entry; + if (item.webkitGetAsEntry) { + entry = item.webkitGetAsEntry(); + if (entry) { + // Workaround for Chrome bug #149735: + entry._file = item.getAsFile(); + } + return entry; + } + return item.getAsEntry(); + }) + ); + } + return $.Deferred().resolve( + $.makeArray(dataTransfer.files) + ).promise(); + }, + + _getSingleFileInputFiles: function (fileInput) { fileInput = $(fileInput); - var files = $.each($.makeArray(fileInput.prop('files')), this._normalizeFile), + var entries = fileInput.prop('webkitEntries') || + fileInput.prop('entries'), + files, value; + if (entries && entries.length) { + return this._handleFileTreeEntries(entries); + } + files = $.makeArray(fileInput.prop('files')); if (!files.length) { value = fileInput.prop('value'); if (!value) { - return []; + return $.Deferred().resolve([]).promise(); } // If the files property is not available, the browser does not // support the File API and we add a pseudo File object with // the input value as name with path information removed: files = [{name: value.replace(/^.*\\/, '')}]; + } else if (files[0].name === undefined && files[0].fileName) { + // File normalization for Safari 4 and Firefox 3: + $.each(files, function (index, file) { + file.name = file.fileName; + file.size = file.fileSize; + }); } - return files; + return $.Deferred().resolve(files).promise(); + }, + + _getFileInputFiles: function (fileInput) { + if (!(fileInput instanceof $) || fileInput.length === 1) { + return this._getSingleFileInputFiles(fileInput); + } + return $.when.apply( + $, + $.map(fileInput, this._getSingleFileInputFiles) + ).then(function () { + return Array.prototype.concat.apply( + [], + arguments + ); + }); }, _onChange: function (e) { - var that = e.data.fileupload, + var that = this, data = { fileInput: $(e.target), form: $(e.target.form) }; - data.files = that._getFileInputFiles(data.fileInput); - if (that.options.replaceFileInput) { - that._replaceFileInput(data.fileInput); - } - if (that._trigger('change', e, data) === false || - that._onAdd(e, data) === false) { - return false; - } + this._getFileInputFiles(data.fileInput).always(function (files) { + data.files = files; + if (that.options.replaceFileInput) { + that._replaceFileInput(data); + } + if (that._trigger( + 'change', + $.Event('change', {delegatedEvent: e}), + data + ) !== false) { + that._onAdd(e, data); + } + }); }, _onPaste: function (e) { - var that = e.data.fileupload, - cbd = e.originalEvent.clipboardData, - items = (cbd && cbd.items) || [], + var items = e.originalEvent && e.originalEvent.clipboardData && + e.originalEvent.clipboardData.items, data = {files: []}; - $.each(items, function (index, item) { - var file = item.getAsFile && item.getAsFile(); - if (file) { - data.files.push(file); + if (items && items.length) { + $.each(items, function (index, item) { + var file = item.getAsFile && item.getAsFile(); + if (file) { + data.files.push(file); + } + }); + if (this._trigger( + 'paste', + $.Event('paste', {delegatedEvent: e}), + data + ) !== false) { + this._onAdd(e, data); } - }); - if (that._trigger('paste', e, data) === false || - that._onAdd(e, data) === false) { - return false; } }, _onDrop: function (e) { - var that = e.data.fileupload, - dataTransfer = e.dataTransfer = e.originalEvent.dataTransfer, - data = { - files: $.each( - $.makeArray(dataTransfer && dataTransfer.files), - that._normalizeFile - ) - }; - if (that._trigger('drop', e, data) === false || - that._onAdd(e, data) === false) { - return false; + e.dataTransfer = e.originalEvent && e.originalEvent.dataTransfer; + var that = this, + dataTransfer = e.dataTransfer, + data = {}; + if (dataTransfer && dataTransfer.files && dataTransfer.files.length) { + e.preventDefault(); + this._getDroppedFiles(dataTransfer).always(function (files) { + data.files = files; + if (that._trigger( + 'drop', + $.Event('drop', {delegatedEvent: e}), + data + ) !== false) { + that._onAdd(e, data); + } + }); } - e.preventDefault(); }, - _onDragOver: function (e) { - var that = e.data.fileupload, - dataTransfer = e.dataTransfer = e.originalEvent.dataTransfer; - if (that._trigger('dragover', e) === false) { - return false; - } - if (dataTransfer) { - dataTransfer.dropEffect = 'copy'; - } - e.preventDefault(); - }, + _onDragOver: getDragHandler('dragover'), + + _onDragEnter: getDragHandler('dragenter'), + + _onDragLeave: getDragHandler('dragleave'), _initEventHandlers: function () { - var ns = this.options.namespace; if (this._isXHRUpload(this.options)) { - this.options.dropZone - .bind('dragover.' + ns, {fileupload: this}, this._onDragOver) - .bind('drop.' + ns, {fileupload: this}, this._onDrop) - .bind('paste.' + ns, {fileupload: this}, this._onPaste); + this._on(this.options.dropZone, { + dragover: this._onDragOver, + drop: this._onDrop, + // event.preventDefault() on dragenter is required for IE10+: + dragenter: this._onDragEnter, + // dragleave is not required, but added for completeness: + dragleave: this._onDragLeave + }); + this._on(this.options.pasteZone, { + paste: this._onPaste + }); + } + if ($.support.fileInput) { + this._on(this.options.fileInput, { + change: this._onChange + }); } - this.options.fileInput - .bind('change.' + ns, {fileupload: this}, this._onChange); }, _destroyEventHandlers: function () { - var ns = this.options.namespace; - this.options.dropZone - .unbind('dragover.' + ns, this._onDragOver) - .unbind('drop.' + ns, this._onDrop) - .unbind('paste.' + ns, this._onPaste); - this.options.fileInput - .unbind('change.' + ns, this._onChange); + this._off(this.options.dropZone, 'dragenter dragleave dragover drop'); + this._off(this.options.pasteZone, 'paste'); + this._off(this.options.fileInput, 'change'); + }, + + _destroy: function () { + this._destroyEventHandlers(); }, _setOption: function (key, value) { - var refresh = $.inArray(key, this._refreshOptionsList) !== -1; - if (refresh) { + var reinit = $.inArray(key, this._specialOptions) !== -1; + if (reinit) { this._destroyEventHandlers(); } - $.Widget.prototype._setOption.call(this, key, value); - if (refresh) { + this._super(key, value); + if (reinit) { this._initSpecialOptions(); this._initEventHandlers(); } @@ -891,41 +1335,78 @@ _initSpecialOptions: function () { var options = this.options; if (options.fileInput === undefined) { - options.fileInput = this.element.is('input:file') ? - this.element : this.element.find('input:file'); + options.fileInput = this.element.is('input[type="file"]') ? + this.element : this.element.find('input[type="file"]'); } else if (!(options.fileInput instanceof $)) { options.fileInput = $(options.fileInput); } if (!(options.dropZone instanceof $)) { options.dropZone = $(options.dropZone); } + if (!(options.pasteZone instanceof $)) { + options.pasteZone = $(options.pasteZone); + } }, - _create: function () { - var options = this.options; + _getRegExp: function (str) { + var parts = str.split('/'), + modifiers = parts.pop(); + parts.shift(); + return new RegExp(parts.join('/'), modifiers); + }, + + _isRegExpOption: function (key, value) { + return key !== 'url' && $.type(value) === 'string' && + /^\/.*\/[igm]{0,3}$/.test(value); + }, + + _initDataAttributes: function () { + var that = this, + options = this.options, + data = this.element.data(); // Initialize options set via HTML5 data-attributes: - $.extend(options, $(this.element[0].cloneNode(false)).data()); - options.namespace = options.namespace || this.widgetName; + $.each( + this.element[0].attributes, + function (index, attr) { + var key = attr.name.toLowerCase(), + value; + if (/^data-/.test(key)) { + // Convert hyphen-ated key to camelCase: + key = key.slice(5).replace(/-[a-z]/g, function (str) { + return str.charAt(1).toUpperCase(); + }); + value = data[key]; + if (that._isRegExpOption(key, value)) { + value = that._getRegExp(value); + } + options[key] = value; + } + } + ); + }, + + _create: function () { + this._initDataAttributes(); this._initSpecialOptions(); this._slots = []; this._sequence = this._getXHRPromise(true); - this._sending = this._active = this._loaded = this._total = 0; + this._sending = this._active = 0; + this._initProgressObject(this); this._initEventHandlers(); }, - destroy: function () { - this._destroyEventHandlers(); - $.Widget.prototype.destroy.call(this); - }, - - enable: function () { - $.Widget.prototype.enable.call(this); - this._initEventHandlers(); + // This method is exposed to the widget API and allows to query + // the number of active uploads: + active: function () { + return this._active; }, - disable: function () { - this._destroyEventHandlers(); - $.Widget.prototype.disable.call(this); + // This method is exposed to the widget API and allows to query + // the widget upload progress. + // It returns an object with loaded, total and bitrate properties + // for the running uploads: + progress: function () { + return this._progress; }, // This method is exposed to the widget API and allows adding files @@ -933,29 +1414,66 @@ // must have a files property and can contain additional options: // .fileupload('add', {files: filesList}); add: function (data) { + var that = this; if (!data || this.options.disabled) { return; } if (data.fileInput && !data.files) { - data.files = this._getFileInputFiles(data.fileInput); + this._getFileInputFiles(data.fileInput).always(function (files) { + data.files = files; + that._onAdd(null, data); + }); } else { - data.files = $.each($.makeArray(data.files), this._normalizeFile); + data.files = $.makeArray(data.files); + this._onAdd(null, data); } - this._onAdd(null, data); }, // This method is exposed to the widget API and allows sending files // using the fileupload API. The data parameter accepts an object which - // must have a files property and can contain additional options: + // must have a files or fileInput property and can contain additional options: // .fileupload('send', {files: filesList}); // The method returns a Promise object for the file upload call. send: function (data) { if (data && !this.options.disabled) { if (data.fileInput && !data.files) { - data.files = this._getFileInputFiles(data.fileInput); - } else { - data.files = $.each($.makeArray(data.files), this._normalizeFile); + var that = this, + dfd = $.Deferred(), + promise = dfd.promise(), + jqXHR, + aborted; + promise.abort = function () { + aborted = true; + if (jqXHR) { + return jqXHR.abort(); + } + dfd.reject(null, 'abort', 'abort'); + return promise; + }; + this._getFileInputFiles(data.fileInput).always( + function (files) { + if (aborted) { + return; + } + if (!files.length) { + dfd.reject(); + return; + } + data.files = files; + jqXHR = that._onSend(null, data); + jqXHR.then( + function (result, textStatus, jqXHR) { + dfd.resolve(result, textStatus, jqXHR); + }, + function (jqXHR, textStatus, errorThrown) { + dfd.reject(jqXHR, textStatus, errorThrown); + } + ); + } + ); + return this._enhancePromise(promise); } + data.files = $.makeArray(data.files); if (data.files.length) { return this._onSend(null, data); } diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js index 04a5662308503950cbf58a17f1dab415f6935b78..8d25c46415bf740195209d6291222e609324ae66 100644 --- a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js +++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js @@ -1,22 +1,24 @@ /* - * jQuery Iframe Transport Plugin 1.4 + * jQuery Iframe Transport Plugin * https://github.com/blueimp/jQuery-File-Upload * * Copyright 2011, Sebastian Tschan * https://blueimp.net * * Licensed under the MIT license: - * http://www.opensource.org/licenses/MIT + * https://opensource.org/licenses/MIT */ -/*jslint unparam: true, nomen: true */ -/*global define, window, document */ +/* global define, require, window, document, JSON */ -(function (factory) { +;(function (factory) { 'use strict'; if (typeof define === 'function' && define.amd) { // Register as an anonymous AMD module: define(['jquery'], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS: + factory(require('jquery')); } else { // Browser globals: factory(window.jQuery); @@ -25,9 +27,16 @@ 'use strict'; // Helper variable to create unique names for the transport iframes: - var counter = 0; + var counter = 0, + jsonAPI = $, + jsonParse = 'parseJSON'; - // The iframe transport accepts three additional options: + if ('JSON' in window && 'parse' in JSON) { + jsonAPI = JSON; + jsonParse = 'parse'; + } + + // The iframe transport accepts four additional options: // options.fileInput: a jQuery collection of file input fields // options.paramName: the parameter name for the file form data, // overrides the name property of the file input field(s), @@ -35,21 +44,41 @@ // options.formData: an array of objects with name and value properties, // equivalent to the return data of .serializeArray(), e.g.: // [{name: 'a', value: 1}, {name: 'b', value: 2}] + // options.initialIframeSrc: the URL of the initial iframe src, + // by default set to "javascript:false;" $.ajaxTransport('iframe', function (options) { - if (options.async && (options.type === 'POST' || options.type === 'GET')) { - var form, - iframe; + if (options.async) { + // javascript:false as initial iframe src + // prevents warning popups on HTTPS in IE6: + /*jshint scripturl: true */ + var initialIframeSrc = options.initialIframeSrc || 'javascript:false;', + /*jshint scripturl: false */ + form, + iframe, + addParamChar; return { send: function (_, completeCallback) { form = $('<form style="display:none;"></form>'); - // javascript:false as initial iframe src - // prevents warning popups on HTTPS in IE6. + form.attr('accept-charset', options.formAcceptCharset); + addParamChar = /\?/.test(options.url) ? '&' : '?'; + // XDomainRequest only supports GET and POST: + if (options.type === 'DELETE') { + options.url = options.url + addParamChar + '_method=DELETE'; + options.type = 'POST'; + } else if (options.type === 'PUT') { + options.url = options.url + addParamChar + '_method=PUT'; + options.type = 'POST'; + } else if (options.type === 'PATCH') { + options.url = options.url + addParamChar + '_method=PATCH'; + options.type = 'POST'; + } // IE versions below IE8 cannot set the name property of // elements that have already been added to the DOM, // so we set the name along with the iframe HTML markup: + counter += 1; iframe = $( - '<iframe src="javascript:false;" name="iframe-transport-' + - (counter += 1) + '"></iframe>' + '<iframe src="' + initialIframeSrc + + '" name="iframe-transport-' + counter + '"></iframe>' ).bind('load', function () { var fileInputClones, paramNames = $.isArray(options.paramName) ? @@ -80,9 +109,14 @@ ); // Fix for IE endless progress bar activity bug // (happens on form submits to iframe targets): - $('<iframe src="javascript:false;"></iframe>') + $('<iframe src="' + initialIframeSrc + '"></iframe>') .appendTo(form); - form.remove(); + window.setTimeout(function () { + // Removing the form in a setTimeout call + // allows Chrome's developer tools to display + // the response result + form.remove(); + }, 0); }); form .prop('target', iframe.prop('name')) @@ -118,6 +152,8 @@ .prop('enctype', 'multipart/form-data') // enctype must be set as encoding for IE: .prop('encoding', 'multipart/form-data'); + // Remove the HTML5 form attribute from the input(s): + options.fileInput.removeAttr('form'); } form.submit(); // Insert the file input fields at their original location @@ -125,7 +161,10 @@ if (fileInputClones && fileInputClones.length) { options.fileInput.each(function (index, input) { var clone = $(fileInputClones[index]); - $(input).prop('name', clone.prop('name')); + // Restore the original name and form properties: + $(input) + .prop('name', clone.prop('name')) + .attr('form', clone.attr('form')); clone.replaceWith(input); }); } @@ -139,7 +178,7 @@ // concat is used to avoid the "Script URL" JSLint error: iframe .unbind('load') - .prop('src', 'javascript'.concat(':false;')); + .prop('src', initialIframeSrc); } if (form) { form.remove(); @@ -150,20 +189,34 @@ }); // The iframe transport returns the iframe content document as response. - // The following adds converters from iframe to text, json, html, and script: + // The following adds converters from iframe to text, json, html, xml + // and script. + // Please note that the Content-Type for JSON responses has to be text/plain + // or text/html, if the browser doesn't include application/json in the + // Accept header, else IE will show a download dialog. + // The Content-Type for XML responses on the other hand has to be always + // application/xml or text/xml, so IE properly parses the XML response. + // See also + // https://github.com/blueimp/jQuery-File-Upload/wiki/Setup#content-type-negotiation $.ajaxSetup({ converters: { 'iframe text': function (iframe) { - return $(iframe[0].body).text(); + return iframe && $(iframe[0].body).text(); }, 'iframe json': function (iframe) { - return $.parseJSON($(iframe[0].body).text()); + return iframe && jsonAPI[jsonParse]($(iframe[0].body).text()); }, 'iframe html': function (iframe) { - return $(iframe[0].body).html(); + return iframe && $(iframe[0].body).html(); + }, + 'iframe xml': function (iframe) { + var xmlDoc = iframe && iframe[0]; + return xmlDoc && $.isXMLDoc(xmlDoc) ? xmlDoc : + $.parseXML((xmlDoc.XMLDocument && xmlDoc.XMLDocument.xml) || + $(xmlDoc.body).html()); }, 'iframe script': function (iframe) { - return $.globalEval($(iframe[0].body).text()); + return iframe && $.globalEval($(iframe[0].body).text()); } } }); diff --git a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css index 018e7bd0eba77cb317738ca024e0e509c7f37774..8867fc6f1bc6bdc8f594a574c7cbfd59e0e60980 100644 --- a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css +++ b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css @@ -1 +1 @@ -/*!* qTip2 - Pretty powerful tooltips * http://craigsworks.com/projects/qtip2/ * * Version:nightly * Copyright 2009-2010 Craig Michael Thompson - http://craigsworks.com * * Dual licensed under MIT or GPLv2 licenses * http://en.wikipedia.org/wiki/MIT_License * http://en.wikipedia.org/wiki/GNU_General_Public_License * * Date:Sun Jul 15 16:44:57.0000000000 2012 */ .ui-tooltip,.qtip{position:absolute;left:-28000px;top:-28000px;display:none;max-width:280px;min-width:50px;font-size:10.5px;line-height:12px;border-width:1px;border-style:solid;}.ui-tooltip-fluid{display:block;visibility:hidden;position:static!important;float:left!important;}.ui-tooltip-content{position:relative;padding:5px 9px;overflow:hidden;text-align:left;word-wrap:break-word;overflow:hidden;}.ui-tooltip-titlebar{position:relative;min-height:14px;padding:5px 35px 5px 10px;overflow:hidden;border-width:0 0 1px;font-weight:bold;}.ui-tooltip-titlebar+.ui-tooltip-content{border-top-width:0!important;}/*!Default close button class */ .ui-tooltip-titlebar .ui-state-default{position:absolute;right:4px;top:50%;margin-top:-9px;cursor:pointer;outline:medium none;border-width:1px;border-style:solid;}* html .ui-tooltip-titlebar .ui-state-default{top:16px;}.ui-tooltip-titlebar .ui-icon,.ui-tooltip-icon .ui-icon{display:block;text-indent:-1000em;}.ui-tooltip-icon,.ui-tooltip-icon .ui-icon{-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px;text-decoration:none;}.ui-tooltip-icon .ui-icon{width:18px;height:14px;text-align:center;text-indent:0;font:normal bold 10px/13px Tahoma,sans-serif;color:inherit;background:transparent none no-repeat -100em -100em;}/*!Default tooltip style */ .ui-tooltip-default{border-color:#F1D031;background-color:#FFFFA3;color:#555;}.ui-tooltip-default .ui-tooltip-titlebar{background-color:#FFEF93;}.ui-tooltip-default .ui-tooltip-icon{border-color:#CCC;background:#F1F1F1;color:#777;}.ui-tooltip-default .ui-tooltip-titlebar .ui-state-hover{border-color:#AAA;color:#111;}#qtip-overlay{position:fixed;left:-10000em;top:-10000em;}#qtip-overlay.blurs{cursor:pointer;}#qtip-overlay div{position:absolute;left:0;top:0;width:100%;height:100%;background-color:black;opacity:.7;filter:alpha(opacity=70);-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=70)";}.ui-tooltip .ui-tooltip-tip{margin:0 auto;overflow:hidden;z-index:10;}.ui-tooltip .ui-tooltip-tip,.ui-tooltip .ui-tooltip-tip *{position:absolute;line-height:.1px!important;font-size:.1px!important;color:#123456;background:transparent;border:0 dashed transparent;}.ui-tooltip .ui-tooltip-tip canvas{top:0;left:0;}/*!Light tooltip style */ .ui-tooltip-light{background-color:white;border-color:#E2E2E2;color:#454545;}.ui-tooltip-light .ui-tooltip-titlebar{background-color:#f1f1f1;}/*!Dark tooltip style */ .ui-tooltip-dark{background-color:#505050;border-color:#303030;color:#f3f3f3;}.ui-tooltip-dark .ui-tooltip-titlebar{background-color:#404040;}.ui-tooltip-dark .ui-tooltip-icon{border-color:#444;}.ui-tooltip-dark .ui-tooltip-titlebar .ui-state-hover{border-color:#303030;}/*!Cream tooltip style */ .ui-tooltip-cream{background-color:#FBF7AA;border-color:#F9E98E;color:#A27D35;}.ui-tooltip-cream .ui-tooltip-titlebar{background-color:#F0DE7D;}.ui-tooltip-cream .ui-state-default .ui-tooltip-icon{background-position:-82px 0;}/*!Red tooltip style */ .ui-tooltip-red{background-color:#F78B83;border-color:#D95252;color:#912323;}.ui-tooltip-red .ui-tooltip-titlebar{background-color:#F06D65;}.ui-tooltip-red .ui-state-default .ui-tooltip-icon{background-position:-102px 0;}.ui-tooltip-red .ui-tooltip-icon{border-color:#D95252;}.ui-tooltip-red .ui-tooltip-titlebar .ui-state-hover{border-color:#D95252;}/*!Green tooltip style */ .ui-tooltip-green{background-color:#CAED9E;border-color:#90D93F;color:#3F6219;}.ui-tooltip-green .ui-tooltip-titlebar{background-color:#B0DE78;}.ui-tooltip-green .ui-state-default .ui-tooltip-icon{background-position:-42px 0;}/*!Blue tooltip style */ .ui-tooltip-blue{background-color:#E5F6FE;border-color:#ADD9ED;color:#5E99BD;}.ui-tooltip-blue .ui-tooltip-titlebar{background-color:#D0E9F5;}.ui-tooltip-blue .ui-state-default .ui-tooltip-icon{background-position:-2px 0;}/*!Add shadows to your tooltips in:FF3+,Chrome 2+,Opera 10.6+,IE9+,Safari 2+*/ .ui-tooltip-shadow{-webkit-box-shadow:1px 1px 3px 1px rgba(0,0,0,0.15);-moz-box-shadow:1px 1px 3px 1px rgba(0,0,0,0.15);box-shadow:1px 1px 3px 1px rgba(0,0,0,0.15);}/*!Add rounded corners to your tooltips in:FF3+,Chrome 2+,Opera 10.6+,IE9+,Safari 2+*/ .ui-tooltip-rounded,.ui-tooltip-tipsy,.ui-tooltip-bootstrap{-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px;}/*!Youtube tooltip style */ .ui-tooltip-youtube{-moz-border-radius:2px;-webkit-border-radius:2px;border-radius:2px;-webkit-box-shadow:0 0 3px #333;-moz-box-shadow:0 0 3px #333;box-shadow:0 0 3px #333;color:white;border-width:0;background:#4A4A4A;background-image:-moz-linear-gradient(top,#4A4A4A 0,black 100%);background-image:-ms-linear-gradient(top,#4A4A4A 0,black 100%);background-image:-o-linear-gradient(top,#4A4A4A 0,black 100%);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#4A4A4A),color-stop(100%,black));background-image:-webkit-linear-gradient(top,#4A4A4A 0,black 100%);background-image:linear-gradient(to bottom,#4A4A4A 0,black 100%);}.ui-tooltip-youtube .ui-tooltip-titlebar{background-color:#4A4A4A;background-color:rgba(0,0,0,0);}.ui-tooltip-youtube .ui-tooltip-content{padding:.75em;font:12px arial,sans-serif;filter:progid:DXImageTransform.Microsoft.Gradient(GradientType=0,StartColorStr=#4a4a4a,EndColorStr=#000000);-ms-filter:"progid:DXImageTransform.Microsoft.Gradient(GradientType=0,StartColorStr=#4a4a4a,EndColorStr=#000000);";}.ui-tooltip-youtube .ui-tooltip-icon{border-color:#222;}.ui-tooltip-youtube .ui-tooltip-titlebar .ui-state-hover{border-color:#303030;}.ui-tooltip-jtools{background:#232323;background:rgba(0,0,0,0.7);background-image:-moz-linear-gradient(top,#717171,#232323);background-image:-webkit-gradient(linear,left top,left bottom,from(#717171),to(#232323));border:2px solid #ddd;border:2px solid rgba(241,241,241,1);-moz-border-radius:2px;-webkit-border-radius:2px;border-radius:2px;-webkit-box-shadow:0 0 12px #333;-moz-box-shadow:0 0 12px #333;box-shadow:0 0 12px #333;}.ui-tooltip-jtools .ui-tooltip-titlebar{background-color:transparent;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr=#717171,endColorstr=#4A4A4A);-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#717171,endColorstr=#4A4A4A)";}.ui-tooltip-jtools .ui-tooltip-content{filter:progid:DXImageTransform.Microsoft.gradient(startColorstr=#4A4A4A,endColorstr=#232323);-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#4A4A4A,endColorstr=#232323)";}.ui-tooltip-jtools .ui-tooltip-titlebar,.ui-tooltip-jtools .ui-tooltip-content{background:transparent;color:white;border:0 dashed transparent;}.ui-tooltip-jtools .ui-tooltip-icon{border-color:#555;}.ui-tooltip-jtools .ui-tooltip-titlebar .ui-state-hover{border-color:#333;}.ui-tooltip-cluetip{-webkit-box-shadow:4px 4px 5px rgba(0,0,0,0.4);-moz-box-shadow:4px 4px 5px rgba(0,0,0,0.4);box-shadow:4px 4px 5px rgba(0,0,0,0.4);background-color:#D9D9C2;color:#111;border:0 dashed transparent;}.ui-tooltip-cluetip .ui-tooltip-titlebar{background-color:#87876A;color:white;border:0 dashed transparent;}.ui-tooltip-cluetip .ui-tooltip-icon{border-color:#808064;}.ui-tooltip-cluetip .ui-tooltip-titlebar .ui-state-hover{border-color:#696952;color:#696952;}.ui-tooltip-tipsy{background:black;background:rgba(0,0,0,.87);color:white;border:0 solid transparent;font-size:11px;font-family:'Lucida Grande',sans-serif;font-weight:bold;line-height:16px;text-shadow:0 1px black;}.ui-tooltip-tipsy .ui-tooltip-titlebar{padding:6px 35px 0 10;background-color:transparent;}.ui-tooltip-tipsy .ui-tooltip-content{padding:6px 10;}.ui-tooltip-tipsy .ui-tooltip-icon{border-color:#222;text-shadow:none;}.ui-tooltip-tipsy .ui-tooltip-titlebar .ui-state-hover{border-color:#303030;}.ui-tooltip-tipped{border:3px solid #959FA9;-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px;background-color:#F9F9F9;color:#454545;font-weight:normal;font-family:serif;}.ui-tooltip-tipped .ui-tooltip-titlebar{border-bottom-width:0;color:white;background:#3A79B8;background-image:-moz-linear-gradient(top,#3A79B8,#2E629D);background-image:-webkit-gradient(linear,left top,left bottom,from(#3A79B8),to(#2E629D));filter:progid:DXImageTransform.Microsoft.gradient(startColorstr=#3A79B8,endColorstr=#2E629D);-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#3A79B8,endColorstr=#2E629D)";}.ui-tooltip-tipped .ui-tooltip-icon{border:2px solid #285589;background:#285589;}.ui-tooltip-tipped .ui-tooltip-icon .ui-icon{background-color:#FBFBFB;color:#555;}.ui-tooltip-bootstrap{font-size:13px;line-height:18px;color:#333;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);*border-right-width:2px;*border-bottom-width:2px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,0.2);-moz-box-shadow:0 5px 10px rgba(0,0,0,0.2);box-shadow:0 5px 10px rgba(0,0,0,0.2);-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box;}.ui-tooltip-bootstrap .ui-tooltip-titlebar{font-size:18px;line-height:22px;border-bottom:1px solid #ccc;background-color:transparent;}.ui-tooltip-bootstrap .ui-tooltip-titlebar .ui-state-default{right:9px;top:49%;border-style:none;}.ui-tooltip-bootstrap .ui-tooltip-icon{background:white;}.ui-tooltip-bootstrap .ui-tooltip-icon .ui-icon{width:auto;height:auto;float:right;font-size:20px;font-weight:bold;line-height:18px;color:#000;text-shadow:0 1px 0 #fff;opacity:.2;filter:alpha(opacity=20);}.ui-tooltip-bootstrap .ui-tooltip-icon .ui-icon:hover{color:#000;text-decoration:none;cursor:pointer;opacity:.4;filter:alpha(opacity=40);}.ui-tooltip:not(.ie9haxors) div.ui-tooltip-content,.ui-tooltip:not(.ie9haxors) div.ui-tooltip-titlebar{filter:none;-ms-filter:none;} \ No newline at end of file +.qtip{position:absolute;left:-28000px;top:-28000px;display:none;max-width:280px;min-width:50px;font-size:10.5px;line-height:12px;direction:ltr;box-shadow:none;padding:0}.qtip-content,.qtip-titlebar{position:relative;overflow:hidden}.qtip-content{padding:5px 9px;text-align:left;word-wrap:break-word}.qtip-titlebar{padding:5px 35px 5px 10px;border-width:0 0 1px;font-weight:700}.qtip-titlebar+.qtip-content{border-top-width:0!important}.qtip-close{position:absolute;right:-9px;top:-9px;z-index:11;cursor:pointer;outline:0;border:1px solid transparent}.qtip-titlebar .qtip-close{right:4px;top:50%;margin-top:-9px}* html .qtip-titlebar .qtip-close{top:16px}.qtip-icon .ui-icon,.qtip-titlebar .ui-icon{display:block;text-indent:-1000em;direction:ltr}.qtip-icon,.qtip-icon .ui-icon{-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px;text-decoration:none}.qtip-icon .ui-icon{width:18px;height:14px;line-height:14px;text-align:center;text-indent:0;font:normal 700 10px/13px Tahoma,sans-serif;color:inherit;background:-100em -100em no-repeat}.qtip-default{border:1px solid #F1D031;background-color:#FFFFA3;color:#555}.qtip-default .qtip-titlebar{background-color:#FFEF93}.qtip-default .qtip-icon{border-color:#CCC;background:#F1F1F1;color:#777}.qtip-default .qtip-titlebar .qtip-close{border-color:#AAA;color:#111} \ No newline at end of file diff --git a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js index 4c35809daacf1083d29093bab9231893fde3f424..f552227f9734f1b54d4929fb431f65e04e2ac168 100644 --- a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js +++ b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js @@ -1,13 +1,4 @@ -/*! -* qTip2 - Pretty powerful tooltips -* http://craigsworks.com/projects/qtip2/ -* -* Version: nightly -* Copyright 2009-2010 Craig Michael Thompson - http://craigsworks.com -* -* Dual licensed under MIT or GPLv2 licenses -* http://en.wikipedia.org/wiki/MIT_License -* http://en.wikipedia.org/wiki/GNU_General_Public_License -* -* Date: Sun Jul 15 16:44:57.0000000000 2012 -*//*jslint browser: true, onevar: true, undef: true, nomen: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: true *//*global window: false, jQuery: false, console: false, define: false */(function(a){typeof define==="function"&&define.amd?define(["jquery"],a):jQuery&&!jQuery.fn.qtip&&a(jQuery)})(function(a){function P(b){var c=this,d=b.elements,e=d.tooltip,f=".bgiframe-"+b.id;a.extend(c,{init:function(){d.bgiframe=a('<iframe class="ui-tooltip-bgiframe" frameborder="0" tabindex="-1" src="javascript:\'\';" style="display:block; position:absolute; z-index:-1; filter:alpha(opacity=0); -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";"></iframe>'),d.bgiframe.appendTo(e),e.bind("tooltipmove"+f,c.adjust)},adjust:function(){var a=b.get("dimensions"),c=b.plugins.tip,f=d.tip,g,h;h=parseInt(e.css("border-left-width"),10)||0,h={left:-h,top:-h},c&&f&&(g=c.corner.precedance==="x"?["width","left"]:["height","top"],h[g[1]]-=f[g[0]]()),d.bgiframe.css(h).css(a)},destroy:function(){d.bgiframe.remove(),e.unbind(f)}}),c.init()}function O(o,p){function I(a){var b=a.precedance===g,c=x[b?h:i],d=x[b?i:h],e=a.string().indexOf(n)>-1,f=c*(e?.5:1),j=Math.pow,k=Math.round,l,m,o,p=Math.sqrt(j(f,2)+j(d,2)),q=[z/f*p,z/d*p];q[2]=Math.sqrt(j(q[0],2)-j(z,2)),q[3]=Math.sqrt(j(q[1],2)-j(z,2)),l=p+q[2]+q[3]+(e?0:q[0]),m=l/p,o=[k(m*d),k(m*c)];return{height:o[b?0:1],width:o[b?1:0]}}function H(b){var c=u.titlebar&&b.y===j,d=c?u.titlebar:u.content,e=a.browser.mozilla,f=e?"-moz-":a.browser.webkit?"-webkit-":"",g=b.y+(e?"":"-")+b.x,h=f+(e?"border-radius-"+g:"border-"+g+"-radius");return parseInt(d.css(h),10)||parseInt(v.css(h),10)||0}function G(a,b,c){b=b?b:a[a.precedance];var d=v.hasClass(C),e=u.titlebar&&a.y===j,f=e?u.titlebar:u.tooltip,g="border-"+b+"-width",h;v.addClass(C),h=parseInt(f.css(g),10),h=(c?h||parseInt(v.css(g),10):h)||0,v.toggleClass(C,d);return h}function F(a,d,h,i){if(u.tip){var p=r.corner.clone(),s=h.adjusted,v=o.options.position.adjust.method.split(" "),x=v[0],y=v[1]||v[0],z={left:c,top:c,x:0,y:0},A,B={},C;r.corner.fixed!==b&&(x===q&&p.precedance===f&&s.left&&p.y!==n?p.precedance=p.precedance===f?g:f:x!==q&&s.left&&(p.x=p.x===n?s.left>0?k:m:p.x===k?m:k),y===q&&p.precedance===g&&s.top&&p.x!==n?p.precedance=p.precedance===g?f:g:y!==q&&s.top&&(p.y=p.y===n?s.top>0?j:l:p.y===j?l:j),p.string()!==w.corner.string()&&(w.top!==s.top||w.left!==s.left)&&r.update(p,c)),A=r.position(p,s),A[p.x]+=G(p,p.x,b),A[p.y]+=G(p,p.y,b),A.right!==e&&(A.left=-A.right),A.bottom!==e&&(A.top=-A.bottom),A.user=Math.max(0,t.offset);if(z.left=x===q&&!!s.left)p.x===n?B["margin-left"]=z.x=A["margin-left"]-s.left:(C=A.right!==e?[s.left,-A.left]:[-s.left,A.left],(z.x=Math.max(C[0],C[1]))>C[0]&&(h.left-=s.left,z.left=c),B[A.right!==e?m:k]=z.x);if(z.top=y===q&&!!s.top)p.y===n?B["margin-top"]=z.y=A["margin-top"]-s.top:(C=A.bottom!==e?[s.top,-A.top]:[-s.top,A.top],(z.y=Math.max(C[0],C[1]))>C[0]&&(h.top-=s.top,z.top=c),B[A.bottom!==e?l:j]=z.y);u.tip.css(B).toggle(!(z.x&&z.y||p.x===n&&z.y||p.y===n&&z.x)),h.left-=A.left.charAt?A.user:x!==q||z.top||!z.left&&!z.top?A.left:0,h.top-=A.top.charAt?A.user:y!==q||z.left||!z.left&&!z.top?A.top:0,w.left=s.left,w.top=s.top,w.corner=p.clone()}}function E(){x.width=t.width,x.height=t.height}function D(){x.width=t.height,x.height=t.width}var r=this,t=o.options.style.tip,u=o.elements,v=u.tooltip,w={top:0,left:0},x={width:t.width,height:t.height},y={},z=t.border||0,A=".qtip-tip",B=!!(a("<canvas />")[0]||{}).getContext;r.mimic=r.corner=d,r.border=z,r.offset=t.offset,r.size=x,o.checks.tip={"^position.my|style.tip.(corner|mimic|border)$":function(){r.init()||r.destroy(),o.reposition()},"^style.tip.(height|width)$":function(){x={width:t.width,height:t.height},r.create(),r.update(),o.reposition()},"^content.title.text|style.(classes|widget)$":function(){u.tip&&u.tip.length&&r.update()}},a.extend(r,{init:function(){var b=r.detectCorner()&&(B||a.browser.msie);b&&(r.create(),r.update(),v.unbind(A).bind("tooltipmove"+A,F));return b},detectCorner:function(){var a=t.corner,d=o.options.position,e=d.at,f=d.my.string?d.my.string():d.my;if(a===c||f===c&&e===c)return c;a===b?r.corner=new s.Corner(f):a.string||(r.corner=new s.Corner(a),r.corner.fixed=b),w.corner=new s.Corner(r.corner.string());return r.corner.string()!=="centercenter"},detectColours:function(b){var c,d,e,f=u.tip.css("cssText",""),g=b||r.corner,h=g[g.precedance],i="border-"+h+"-color",k="border"+h.charAt(0)+h.substr(1)+"Color",l=/rgba?\(0, 0, 0(, 0)?\)|transparent|#123456/i,m="background-color",o="transparent",p=" !important",q=u.titlebar&&(g.y===j||g.y===n&&f.position().top+x.height/2+t.offset<u.titlebar.outerHeight(1)),s=q?u.titlebar:u.tooltip;v.addClass(C),y.fill=d=f.css(m),y.border=e=f[0].style[k]||f.css(i)||v.css(i);if(!d||l.test(d))y.fill=s.css(m)||o,l.test(y.fill)&&(y.fill=v.css(m)||d);if(!e||l.test(e)||e===a(document.body).css("color")){y.border=s.css(i)||o;if(l.test(y.border)||y.border===s.css("color"))y.border=v.css(i)||v.css(k)||e}a("*",f).add(f).css("cssText",m+":"+o+p+";border:0"+p+";"),v.removeClass(C)},create:function(){var b=x.width,c=x.height,d;u.tip&&u.tip.remove(),u.tip=a("<div />",{"class":"ui-tooltip-tip"}).css({width:b,height:c}).prependTo(v),B?a("<canvas />").appendTo(u.tip)[0].getContext("2d").save():(d='<vml:shape coordorigin="0,0" style="display:inline-block; position:absolute; behavior:url(#default#VML);"></vml:shape>',u.tip.html(d+d),a("*",u.tip).bind("click mousedown",function(a){a.stopPropagation()}))},update:function(e,h){var i=u.tip,o=i.children(),p=x.width,q=x.height,A="px solid ",C="px dashed transparent",F=t.mimic,H=Math.round,J,K,L,M,O;e||(e=w.corner||r.corner),F===c?F=e:(F=new s.Corner(F),F.precedance=e.precedance,F.x==="inherit"?F.x=e.x:F.y==="inherit"?F.y=e.y:F.x===F.y&&(F[e.precedance]=e[e.precedance])),J=F.precedance,e.precedance===f?D():E(),u.tip.css({width:p=x.width,height:q=x.height}),r.detectColours(e),y.border!=="transparent"?(z=G(e,d,b),t.border===0&&z>0&&(y.fill=y.border),r.border=z=t.border!==b?t.border:z):r.border=z=0,L=N(F,p,q),r.size=O=I(e),i.css(O),e.precedance===g?M=[H(F.x===k?z:F.x===m?O.width-p-z:(O.width-p)/2),H(F.y===j?O.height-q:0)]:M=[H(F.x===k?O.width-p:0),H(F.y===j?z:F.y===l?O.height-q-z:(O.height-q)/2)],B?(o.attr(O),K=o[0].getContext("2d"),K.restore(),K.save(),K.clearRect(0,0,3e3,3e3),K.fillStyle=y.fill,K.strokeStyle=y.border,K.lineWidth=z*2,K.lineJoin="miter",K.miterLimit=100,K.translate(M[0],M[1]),K.beginPath(),K.moveTo(L[0][0],L[0][1]),K.lineTo(L[1][0],L[1][1]),K.lineTo(L[2][0],L[2][1]),K.closePath(),z&&(v.css("background-clip")==="border-box"&&(K.strokeStyle=y.fill,K.stroke()),K.strokeStyle=y.border,K.stroke()),K.fill()):(L="m"+L[0][0]+","+L[0][1]+" l"+L[1][0]+","+L[1][1]+" "+L[2][0]+","+L[2][1]+" xe",M[2]=z&&/^(r|b)/i.test(e.string())?parseFloat(a.browser.version,10)===8?2:1:0,o.css({antialias:""+(F.string().indexOf(n)>-1),left:M[0]-M[2]*Number(J===f),top:M[1]-M[2]*Number(J===g),width:p+z,height:q+z}).each(function(b){var c=a(this);c[c.prop?"prop":"attr"]({coordsize:p+z+" "+(q+z),path:L,fillcolor:y.fill,filled:!!b,stroked:!b}).css({display:z||b?"block":"none"}),!b&&c.html()===""&&c.html('<vml:stroke weight="'+z*2+'px" color="'+y.border+'" miterlimit="1000" joinstyle="miter" style="behavior:url(#default#VML); display:inline-block;" />')})),h!==c&&r.position(e)},position:function(b){var d=u.tip,e={},l=Math.max(0,t.offset),m,o,p;if(t.corner===c||!d)return c;b=b||r.corner,m=b.precedance,o=I(b),p=[b.x,b.y],m===f&&p.reverse(),a.each(p,function(a,c){var d,f;c===n?(d=m===g?k:j,e[d]="50%",e["margin-"+d]=-Math.round(o[m===g?h:i]/2)+l):(d=G(b,c),f=H(b),e[c]=a?0:l+(f>d?f:-d))}),e[b[m]]-=o[m===f?h:i],d.css({top:"",bottom:"",left:"",right:"",margin:""}).css(e);return e},destroy:function(){u.tip&&u.tip.remove(),u.tip=!1,v.unbind(A)}}),r.init()}function N(a,b,c){var d=Math.ceil(b/2),e=Math.ceil(c/2),f={bottomright:[[0,0],[b,c],[b,0]],bottomleft:[[0,0],[b,0],[0,c]],topright:[[0,c],[b,0],[b,c]],topleft:[[0,0],[0,c],[b,c]],topcenter:[[0,c],[d,0],[b,c]],bottomcenter:[[0,0],[b,0],[d,c]],rightcenter:[[0,0],[b,e],[0,c]],leftcenter:[[b,0],[b,c],[0,e]]};f.lefttop=f.bottomright,f.righttop=f.bottomleft,f.leftbottom=f.topright,f.rightbottom=f.topleft;return f[a.string()]}function M(d){function t(b){var d=a(b.target),e=d.closest(".qtip"),f;f=e.length<1?c:parseInt(e[0].style.zIndex,10)>parseInt(h[0].style.zIndex,10),!f&&a(b.target).closest(y)[0]!==h[0]&&r(d)}function r(a){o.length<1&&a.length?a.not("body").blur():o.first().focus()}function q(){o=a(n,h).not("[disabled]").map(function(){return typeof this.focus==="function"?this:null})}var e=this,f=d.options.show.modal,g=d.elements,h=g.tooltip,i="#qtip-overlay",j=".qtipmodal",k=j+d.id,l="is-modal-qtip",m=a(document.body),n=s.modal.focusable.join(","),o={},p;d.checks.modal={"^show.modal.(on|blur)$":function(){e.init(),g.overlay.toggle(h.is(":visible"))},"^content.text$":q},a.extend(e,{init:function(){if(!f.on)return e;p=e.create(),h.attr(l,b).css("z-index",s.modal.zindex+a(y+"["+l+"]").length).unbind(j).unbind(k).bind("tooltipshow"+j+" tooltiphide"+j,function(b,c,d){var f=b.originalEvent;if(b.target===h[0])if(f&&b.type==="tooltiphide"&&/mouse(leave|enter)/.test(f.type)&&a(f.relatedTarget).closest(p[0]).length)try{b.preventDefault()}catch(g){}else(!f||f&&!f.solo)&&e[b.type.replace("tooltip","")](b,d)}).bind("tooltipfocus"+j,function(b){if(!b.isDefaultPrevented()&&b.target===h[0]){var c=a(y).filter("["+l+"]"),d=s.modal.zindex+c.length,e=parseInt(h[0].style.zIndex,10);p[0].style.zIndex=d-2,c.each(function(){this.style.zIndex>e&&(this.style.zIndex-=1)}),c.end().filter("."+A).qtip("blur",b.originalEvent),h.addClass(A)[0].style.zIndex=d;try{b.preventDefault()}catch(f){}}}).bind("tooltiphide"+j,function(b){b.target===h[0]&&a("["+l+"]").filter(":visible").not(h).last().qtip("focus",b)}),f.escape&&a(document).unbind(k).bind("keydown"+k,function(a){a.keyCode===27&&h.hasClass(A)&&d.hide(a)}),f.blur&&g.overlay.unbind(k).bind("click"+k,function(a){h.hasClass(A)&&d.hide(a)}),q();return e},create:function(){function d(){p.css({height:a(window).height(),width:a(window).width()})}var b=a(i);if(b.length)return g.overlay=b.insertAfter(a(y).last());p=g.overlay=a("<div />",{id:i.substr(1),html:"<div></div>",mousedown:function(){return c}}).hide().insertAfter(a(y).last()),a(window).unbind(j).bind("resize"+j,d),d();return p},toggle:function(d,g,i){if(d&&d.isDefaultPrevented())return e;var j=f.effect,n=g?"show":"hide",o=p.is(":visible"),q=a("["+l+"]").filter(":visible").not(h),s;p||(p=e.create());if(p.is(":animated")&&o===g||!g&&q.length)return e;g?(p.css({left:0,top:0}),p.toggleClass("blurs",f.blur),f.stealfocus!==c&&(m.bind("focusin"+k,t),r(a("body *")))):m.unbind("focusin"+k),p.stop(b,c),a.isFunction(j)?j.call(p,g):j===c?p[n]():p.fadeTo(parseInt(i,10)||90,g?1:0,function(){g||a(this).hide()}),g||p.queue(function(a){p.css({left:"",top:""}),a()});return e},show:function(a,c){return e.toggle(a,b,c)},hide:function(a,b){return e.toggle(a,c,b)},destroy:function(){var b=p;b&&(b=a("["+l+"]").not(h).length<1,b?(g.overlay.remove(),a(document).unbind(j)):g.overlay.unbind(j+d.id),m.undelegate("*","focusin"+k));return h.removeAttr(l).unbind(j)}}),e.init()}function L(d){var e=this,f=d.elements.tooltip,g=d.options.content.ajax,h=r.defaults.content.ajax,i=".qtip-ajax",j=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,k=b,l=c,m;d.checks.ajax={"^content.ajax":function(a,b,c){b==="ajax"&&(g=c),b==="once"?e.init():g&&g.url?e.load():f.unbind(i)}},a.extend(e,{init:function(){g&&g.url&&f.unbind(i)[g.once?"one":"bind"]("tooltipshow"+i,e.load);return e},load:function(f){function t(a,b,c){!d.destroyed&&a.status!==0&&d.set("content.text",b+": "+c)}function s(b,c,e){var f;d.destroyed||(o&&(b=a("<div/>").append(b.replace(j,"")).find(o)),(f=h.success||g.success)&&a.isFunction(f)?f.call(g.context||d,b,c,e):d.set("content.text",b))}function r(){var e;d.destroyed||(k=c,p&&(l=b,d.show(f.originalEvent)),(e=h.complete||g.complete)&&a.isFunction(e)&&e.apply(g.context||d,arguments))}if(l)l=c;else{var i=g.url.indexOf(" "),n=g.url,o,p=!g.loading&&k;if(p)try{f.preventDefault()}catch(q){}else if(f&&f.isDefaultPrevented())return e;m&&m.abort&&m.abort(),i>-1&&(o=n.substr(i),n=n.substr(0,i)),m=a.ajax(a.extend({error:h.error||t,context:d},g,{url:n,success:s,complete:r}))}},destroy:function(){m&&m.abort&&m.abort(),d.destroyed=b}}),e.init()}function K(e,f){var g,h,i,j,k,l=a(this),m=a(document.body),n=this===document?m:l,o=l.metadata?l.metadata(f.metadata):d,p=f.metadata.type==="html5"&&o?o[f.metadata.name]:d,q=l.data(f.metadata.name||"qtipopts");try{q=typeof q==="string"?(new Function("return "+q))():q}catch(t){H("Unable to parse HTML5 attribute data: "+q)}j=a.extend(b,{},r.defaults,f,typeof q==="object"?I(q):d,I(p||o)),h=j.position,j.id=e;if("boolean"===typeof j.content.text){i=l.attr(j.content.attr);if(j.content.attr!==c&&i)j.content.text=i;else{H("Unable to locate content for tooltip! Aborting render of tooltip on element: ",l);return c}}h.container.length||(h.container=m),h.target===c&&(h.target=n),j.show.target===c&&(j.show.target=n),j.show.solo===b&&(j.show.solo=h.container.closest("body")),j.hide.target===c&&(j.hide.target=n),j.position.viewport===b&&(j.position.viewport=h.container),h.container=h.container.eq(0),h.at=new s.Corner(h.at),h.my=new s.Corner(h.my);if(a.data(this,"qtip"))if(j.overwrite)l.qtip("destroy");else if(j.overwrite===c)return c;j.suppress&&(k=a.attr(this,"title"))&&a(this).removeAttr("title").attr(F,k).attr("title",""),g=new J(l,j,e,!!i),a.data(this,"qtip",g),l.bind("remove.qtip-"+e+" removeqtip.qtip-"+e,function(){g.destroy()});return g}function J(f,g,o,p){function X(){var b=[g.show.target[0],g.hide.target[0],q.rendered&&M.tooltip[0],g.position.container[0],g.position.viewport[0],window,document];q.rendered?a([]).pushStack(a.grep(b,function(a){return typeof a==="object"})).unbind(L):g.show.target.unbind(L+"-create")}function W(){function m(a){q.rendered&&K[0].offsetWidth>0&&q.reposition(a)}function l(a){if(K.hasClass(x))return c;clearTimeout(q.timers.inactive),q.timers.inactive=setTimeout(function(){q.hide(a)},g.hide.inactive)}function k(b){if(K.hasClass(x)||H||J)return c;var f=a(b.relatedTarget||b.target),h=f.closest(y)[0]===K[0],i=f[0]===e.show[0];clearTimeout(q.timers.show),clearTimeout(q.timers.hide);if(d.target==="mouse"&&h||g.hide.fixed&&(/mouse(out|leave|move)/.test(b.type)&&(h||i)))try{b.preventDefault(),b.stopImmediatePropagation()}catch(j){}else g.hide.delay>0?q.timers.hide=setTimeout(function(){q.hide(b)},g.hide.delay):q.hide(b)}function j(a){if(K.hasClass(x))return c;clearTimeout(q.timers.show),clearTimeout(q.timers.hide);var d=function(){q.toggle(b,a)};g.show.delay>0?q.timers.show=setTimeout(d,g.show.delay):d()}var d=g.position,e={show:g.show.target,hide:g.hide.target,viewport:a(d.viewport),document:a(document),body:a(document.body),window:a(window)},h={show:a.trim(""+g.show.event).split(" "),hide:a.trim(""+g.hide.event).split(" ")},i=a.browser.msie&&parseInt(a.browser.version,10)===6;K.bind("mouseenter"+L+" mouseleave"+L,function(a){var b=a.type==="mouseenter";b&&q.focus(a),K.toggleClass(B,b)}),/mouse(out|leave)/i.test(g.hide.event)&&(g.hide.leave==="window"&&e.window.bind("mouseleave"+L+" blur"+L,function(a){!/select|option/.test(a.target.nodeName)&&!a.relatedTarget&&q.hide(a)})),g.hide.fixed?(e.hide=e.hide.add(K),K.bind("mouseover"+L,function(){K.hasClass(x)||clearTimeout(q.timers.hide)})):/mouse(over|enter)/i.test(g.show.event)&&e.hide.bind("mouseleave"+L,function(a){clearTimeout(q.timers.show)}),(""+g.hide.event).indexOf("unfocus")>-1&&d.container.closest("html").bind("mousedown"+L,function(b){var c=a(b.target),d=q.rendered&&!K.hasClass(x)&&K[0].offsetWidth>0,e=c.parents(y).filter(K[0]).length>0;c[0]!==f[0]&&c[0]!==K[0]&&!e&&!f.has(c[0]).length&&!c.attr("disabled")&&q.hide(b)}),"number"===typeof g.hide.inactive&&(e.show.bind("qtip-"+o+"-inactive",l),a.each(r.inactiveEvents,function(a,b){e.hide.add(M.tooltip).bind(b+L+"-inactive",l)})),a.each(h.hide,function(b,c){var d=a.inArray(c,h.show),f=a(e.hide);d>-1&&f.add(e.show).length===f.length||c==="unfocus"?(e.show.bind(c+L,function(a){K[0].offsetWidth>0?k(a):j(a)}),delete h.show[d]):e.hide.bind(c+L,k)}),a.each(h.show,function(a,b){e.show.bind(b+L,j)}),"number"===typeof g.hide.distance&&e.show.add(K).bind("mousemove"+L,function(a){var b=N.origin||{},c=g.hide.distance,d=Math.abs;(d(a.pageX-b.pageX)>=c||d(a.pageY-b.pageY)>=c)&&q.hide(a)}),d.target==="mouse"&&(e.show.bind("mousemove"+L,function(a){t={pageX:a.pageX,pageY:a.pageY,type:"mousemove"}}),d.adjust.mouse&&(g.hide.event&&(K.bind("mouseleave"+L,function(a){(a.relatedTarget||a.target)!==e.show[0]&&q.hide(a)}),M.target.bind("mouseenter"+L+" mouseleave"+L,function(a){N.onTarget=a.type==="mouseenter"})),e.document.bind("mousemove"+L,function(a){q.rendered&&N.onTarget&&!K.hasClass(x)&&K[0].offsetWidth>0&&q.reposition(a||t)}))),(d.adjust.resize||e.viewport.length)&&(a.event.special.resize?e.viewport:e.window).bind("resize"+L,m),(e.viewport.length||i&&K.css("position")==="fixed")&&e.viewport.bind("scroll"+L,m)}function V(b,d){function h(b){function i(e){e&&(delete h[e.src],clearTimeout(q.timers.img[e.src]),a(e).unbind(L)),a.isEmptyObject(h)&&(q.redraw(),d!==c&&q.reposition(N.event),b())}var f,h={};if((f=g.find("img[src]:not([height]):not([width])")).length===0)return i();f.each(function(b,c){if(h[c.src]===e){var d=0,f=3;(function g(){if(c.height||c.width||d>f)return i(c);d+=1,q.timers.img[c.src]=setTimeout(g,700)})(),a(c).bind("error"+L+" load"+L,function(){i(this)}),h[c.src]=c}})}var g=M.content;if(!q.rendered||!b)return c;a.isFunction(b)&&(b=b.call(f,N.event,q)||""),b.jquery&&b.length>0?g.empty().append(b.css({display:"block"})):g.html(b),q.rendered<0?K.queue("fx",h):(J=0,h(a.noop));return q}function U(b,d){var e=M.title;if(!q.rendered||!b)return c;a.isFunction(b)&&(b=b.call(f,N.event,q));if(b===c||!b&&b!=="")return Q(c);b.jquery&&b.length>0?e.empty().append(b.css({display:"block"})):e.html(b),q.redraw(),d!==c&&q.rendered&&K[0].offsetWidth>0&&q.reposition(N.event)}function T(a){var b=M.button,d=M.title;if(!q.rendered)return c;a?(d||S(),R()):b.remove()}function S(){var c=E+"-title";M.titlebar&&Q(),M.titlebar=a("<div />",{"class":v+"-titlebar "+(g.style.widget?"ui-widget-header":"")}).append(M.title=a("<div />",{id:c,"class":v+"-title","aria-atomic":b})).insertBefore(M.content).delegate(".ui-tooltip-close","mousedown keydown mouseup keyup mouseout",function(b){a(this).toggleClass("ui-state-active ui-state-focus",b.type.substr(-4)==="down")}).delegate(".ui-tooltip-close","mouseover mouseout",function(b){a(this).toggleClass("ui-state-hover",b.type==="mouseover")}),g.content.title.button?R():q.rendered&&q.redraw()}function R(){var b=g.content.title.button,d=typeof b==="string",e=d?b:"Close tooltip";M.button&&M.button.remove(),b.jquery?M.button=b:M.button=a("<a />",{"class":"ui-state-default ui-tooltip-close "+(g.style.widget?"":v+"-icon"),title:e,"aria-label":e}).prepend(a("<span />",{"class":"ui-icon ui-icon-close",html:"×"})),M.button.appendTo(M.titlebar).attr("role","button").click(function(a){K.hasClass(x)||q.hide(a);return c}),q.redraw()}function Q(a){M.title&&(M.titlebar.remove(),M.titlebar=M.title=M.button=d,a!==c&&q.reposition())}function P(){var a=g.style.widget;K.toggleClass(w,a).toggleClass(z,g.style.def&&!a),M.content.toggleClass(w+"-content",a),M.titlebar&&M.titlebar.toggleClass(w+"-header",a),M.button&&M.button.toggleClass(v+"-icon",!a)}function O(a){var b=0,c,d=g,e=a.split(".");while(d=d[e[b++]])b<e.length&&(c=d);return[c||g,e.pop()]}var q=this,D=document.body,E=v+"-"+o,H=0,J=0,K=a(),L=".qtip-"+o,M,N;q.id=o,q.destroyed=q.rendered=c,q.elements=M={target:f},q.timers={img:{}},q.options=g,q.checks={},q.plugins={},q.cache=N={event:{},target:a(),disabled:c,attr:p,onTarget:c,lastClass:""},q.checks.builtin={"^id$":function(d,e,f){var g=f===b?r.nextid:f,h=v+"-"+g;g!==c&&g.length>0&&!a("#"+h).length&&(K[0].id=h,M.content[0].id=h+"-content",M.title[0].id=h+"-title")},"^content.text$":function(a,b,c){V(c)},"^content.title.text$":function(a,b,c){if(!c)return Q();!M.title&&c&&S(),U(c)},"^content.title.button$":function(a,b,c){T(c)},"^position.(my|at)$":function(a,b,c){"string"===typeof c&&(a[b]=new s.Corner(c))},"^position.container$":function(a,b,c){q.rendered&&K.appendTo(c)},"^show.ready$":function(){q.rendered?q.toggle(b):q.render(1)},"^style.classes$":function(a,b,c){K.attr("class",v+" qtip ui-helper-reset "+c)},"^style.widget|content.title":P,"^events.(render|show|move|hide|focus|blur)$":function(b,c,d){K[(a.isFunction(d)?"":"un")+"bind"]("tooltip"+c,d)},"^(show|hide|position).(event|target|fixed|inactive|leave|distance|viewport|adjust)":function(){var a=g.position;K.attr("tracking",a.target==="mouse"&&a.adjust.mouse),X(),W()}},a.extend(q,{render:function(d){if(q.rendered)return q;var e=g.content.text,h=g.content.title.text,i=g.position,j=a.Event("tooltiprender");a.attr(f[0],"aria-describedby",E),K=M.tooltip=a("<div/>",{id:E,"class":v+" qtip ui-helper-reset "+z+" "+g.style.classes+" "+v+"-pos-"+g.position.my.abbrev(),width:g.style.width||"",height:g.style.height||"",tracking:i.target==="mouse"&&i.adjust.mouse,role:"alert","aria-live":"polite","aria-atomic":c,"aria-describedby":E+"-content","aria-hidden":b}).toggleClass(x,N.disabled).data("qtip",q).appendTo(g.position.container).append(M.content=a("<div />",{"class":v+"-content",id:E+"-content","aria-atomic":b})),q.rendered=-1,H=J=1,h&&(S(),a.isFunction(h)||U(h,c)),a.isFunction(e)||V(e,c),q.rendered=b,P(),a.each(g.events,function(b,c){a.isFunction(c)&&K.bind(b==="toggle"?"tooltipshow tooltiphide":"tooltip"+b,c)}),a.each(s,function(){this.initialize==="render"&&this(q)}),W(),K.queue("fx",function(a){j.originalEvent=N.event,K.trigger(j,[q]),H=J=0,q.redraw(),(g.show.ready||d)&&q.toggle(b,N.event,c),a()});return q},get:function(a){var b,c;switch(a.toLowerCase()){case"dimensions":b={height:K.outerHeight(),width:K.outerWidth()};break;case"offset":b=s.offset(K,g.position.container);break;default:c=O(a.toLowerCase()),b=c[0][c[1]],b=b.precedance?b.string():b}return b},set:function(e,f){function n(a,b){var c,d,e;for(c in l)for(d in l[c])if(e=(new RegExp(d,"i")).exec(a))b.push(e),l[c][d].apply(q,b)}var h=/^position\.(my|at|adjust|target|container)|style|content|show\.ready/i,i=/^content\.(title|attr)|style/i,j=c,k=c,l=q.checks,m;"string"===typeof e?(m=e,e={},e[m]=f):e=a.extend(b,{},e),a.each(e,function(b,c){var d=O(b.toLowerCase()),f;f=d[0][d[1]],d[0][d[1]]="object"===typeof c&&c.nodeType?a(c):c,e[b]=[d[0],d[1],c,f],j=h.test(b)||j,k=i.test(b)||k}),I(g),H=J=1,a.each(e,n),H=J=0,q.rendered&&K[0].offsetWidth>0&&(j&&q.reposition(g.position.target==="mouse"?d:N.event),k&&q.redraw());return q},toggle:function(e,f){function u(){e?(a.browser.msie&&K[0].style.removeAttribute("filter"),K.css("overflow",""),"string"===typeof i.autofocus&&a(i.autofocus,K).focus(),i.target.trigger("qtip-"+o+"-inactive")):K.css({display:"",visibility:"",opacity:"",left:"",top:""}),s=a.Event("tooltip"+(e?"visible":"hidden")),s.originalEvent=f?N.event:d,K.trigger(s,[q])}if(!q.rendered)return e?q.render(1):q;var h=e?"show":"hide",i=g[h],j=g[e?"hide":"show"],k=g.position,l=g.content,m=K[0].offsetWidth>0,n=e||i.target.length===1,p=!f||i.target.length<2||N.target[0]===f.target,r,s;(typeof e).search("boolean|number")&&(e=!m);if(!K.is(":animated")&&m===e&&p)return q;if(f){if(/over|enter/.test(f.type)&&/out|leave/.test(N.event.type)&&g.show.target.add(f.target).length===g.show.target.length&&K.has(f.relatedTarget).length)return q;N.event=a.extend({},f)}s=a.Event("tooltip"+h),s.originalEvent=f?N.event:d,K.trigger(s,[q,90]);if(s.isDefaultPrevented())return q;a.attr(K[0],"aria-hidden",!e),e?(N.origin=a.extend({},t),q.focus(f),a.isFunction(l.text)&&V(l.text,c),a.isFunction(l.title.text)&&U(l.title.text,c),!G&&k.target==="mouse"&&k.adjust.mouse&&(a(document).bind("mousemove.qtip",function(a){t={pageX:a.pageX,pageY:a.pageY,type:"mousemove"}}),G=b),q.reposition(f,arguments[2]),(s.solo=!!i.solo)&&a(y,i.solo).not(K).qtip("hide",s)):(clearTimeout(q.timers.show),delete N.origin,G&&!a(y+'[tracking="true"]:visible',i.solo).not(K).length&&(a(document).unbind("mousemove.qtip"),G=c),q.blur(f)),i.effect===c||n===c?(K[h](),u.call(K)):a.isFunction(i.effect)?(K.stop(1,1),i.effect.call(K,q),K.queue("fx",function(a){u(),a()})):K.fadeTo(90,e?1:0,u),e&&i.target.trigger("qtip-"+o+"-inactive");return q},show:function(a){return q.toggle(b,a)},hide:function(a){return q.toggle(c,a)},focus:function(b){if(!q.rendered)return q;var c=a(y),d=parseInt(K[0].style.zIndex,10),e=r.zindex+c.length,f=a.extend({},b),g,h;K.hasClass(A)||(h=a.Event("tooltipfocus"),h.originalEvent=f,K.trigger(h,[q,e]),h.isDefaultPrevented()||(d!==e&&(c.each(function(){this.style.zIndex>d&&(this.style.zIndex=this.style.zIndex-1)}),c.filter("."+A).qtip("blur",f)),K.addClass(A)[0].style.zIndex=e));return q},blur:function(b){var c=a.extend({},b),d;K.removeClass(A),d=a.Event("tooltipblur"),d.originalEvent=c,K.trigger(d,[q]);return q},reposition:function(b,d){if(!q.rendered||H)return q;H=1;var e=g.position.target,f=g.position,h=f.my,i=f.at,o=f.adjust,p=o.method.split(" "),r=K.outerWidth(),u=K.outerHeight(),v=0,w=0,x=a.Event("tooltipmove"),y=K.css("position")==="fixed",z=f.viewport,A={left:0,top:0},B=f.container,C=K[0].offsetWidth>0,D,E,F;if(a.isArray(e)&&e.length===2)i={x:k,y:j},A={left:e[0],top:e[1]};else if(e==="mouse"&&(b&&b.pageX||N.event.pageX))i={x:k,y:j},b=(b&&(b.type==="resize"||b.type==="scroll")?N.event:b&&b.pageX&&b.type==="mousemove"?b:t&&t.pageX&&(o.mouse||!b||!b.pageX)?{pageX:t.pageX,pageY:t.pageY}:!o.mouse&&N.origin&&N.origin.pageX&&g.show.distance?N.origin:b)||b||N.event||t||{},A={top:b.pageY,left:b.pageX};else{e==="event"&&b&&b.target&&b.type!=="scroll"&&b.type!=="resize"?N.target=a(b.target):e!=="event"&&(N.target=a(e.jquery?e:M.target)),e=N.target,e=a(e).eq(0);if(e.length===0)return q;e[0]===document||e[0]===window?(v=s.iOS?window.innerWidth:e.width(),w=s.iOS?window.innerHeight:e.height(),e[0]===window&&(A={top:(z||e).scrollTop(),left:(z||e).scrollLeft()})):s.imagemap&&e.is("area")?D=s.imagemap(q,e,i,s.viewport?p:c):s.svg&&typeof e[0].xmlbase==="string"?D=s.svg(q,e,i,s.viewport?p:c):(v=e.outerWidth(),w=e.outerHeight(),A=s.offset(e,B)),D&&(v=D.width,w=D.height,E=D.offset,A=D.position);if(s.iOS>3.1&&s.iOS<4.1||s.iOS>=4.3&&s.iOS<4.33||!s.iOS&&y)F=a(window),A.left-=F.scrollLeft(),A.top-=F.scrollTop();A.left+=i.x===m?v:i.x===n?v/2:0,A.top+=i.y===l?w:i.y===n?w/2:0}A.left+=o.x+(h.x===m?-r:h.x===n?-r/2:0),A.top+=o.y+(h.y===l?-u:h.y===n?-u/2:0),s.viewport?(A.adjusted=s.viewport(q,A,f,v,w,r,u),E&&A.adjusted.left&&(A.left+=E.left),E&&A.adjusted.top&&(A.top+=E.top)):A.adjusted={left:0,top:0},x.originalEvent=a.extend({},b),K.trigger(x,[q,A,z.elem||z]);if(x.isDefaultPrevented())return q;delete A.adjusted,d===c||!C||isNaN(A.left)||isNaN(A.top)||e==="mouse"||!a.isFunction(f.effect)?K.css(A):a.isFunction(f.effect)&&(f.effect.call(K,q,a.extend({},A)),K.queue(function(b){a(this).css({opacity:"",height:""}),a.browser.msie&&this.style.removeAttribute("filter"),b()})),H=0;return q},redraw:function(){if(q.rendered<1||J)return q;var a=g.position.container,b,c,d,e;J=1,g.style.height&&K.css(i,g.style.height),g.style.width?K.css(h,g.style.width):(K.css(h,"").addClass(C),c=K.width()+1,d=K.css("max-width")||"",e=K.css("min-width")||"",b=(d+e).indexOf("%")>-1?a.width()/100:0,d=(d.indexOf("%")>-1?b:1)*parseInt(d,10)||c,e=(e.indexOf("%")>-1?b:1)*parseInt(e,10)||0,c=d+e?Math.min(Math.max(c,e),d):c,K.css(h,Math.round(c)).removeClass(C)),J=0;return q},disable:function(b){"boolean"!==typeof b&&(b=!K.hasClass(x)&&!N.disabled),q.rendered?(K.toggleClass(x,b),a.attr(K[0],"aria-disabled",b)):N.disabled=!!b;return q},enable:function(){return q.disable(c)},destroy:function(){var c=f[0],d=a.attr(c,F),e=f.data("qtip");q.destroyed=b,q.rendered&&(K.stop(1,0).remove(),a.each(q.plugins,function(){this.destroy&&this.destroy()})),clearTimeout(q.timers.show),clearTimeout(q.timers.hide),X();if(!e||q===e)a.removeData(c,"qtip"),g.suppress&&d&&(a.attr(c,"title",d),f.removeAttr(F)),f.removeAttr("aria-describedby");f.unbind(".qtip-"+o),delete u[q.id];return f}})}function I(b){var e;if(!b||"object"!==typeof b)return c;if(b.metadata===d||"object"!==typeof b.metadata)b.metadata={type:b.metadata};if("content"in b){if(b.content===d||"object"!==typeof b.content||b.content.jquery)b.content={text:b.content};e=b.content.text||c,!a.isFunction(e)&&(!e&&!e.attr||e.length<1||"object"===typeof e&&!e.jquery)&&(b.content.text=c);if("title"in b.content){if(b.content.title===d||"object"!==typeof b.content.title)b.content.title={text:b.content.title};e=b.content.title.text||c,!a.isFunction(e)&&(!e&&!e.attr||e.length<1||"object"===typeof e&&!e.jquery)&&(b.content.title.text=c)}}if("position"in b)if(b.position===d||"object"!==typeof b.position)b.position={my:b.position,at:b.position};if("show"in b)if(b.show===d||"object"!==typeof b.show)b.show.jquery?b.show={target:b.show}:b.show={event:b.show};if("hide"in b)if(b.hide===d||"object"!==typeof b.hide)b.hide.jquery?b.hide={target:b.hide}:b.hide={event:b.hide};if("style"in b)if(b.style===d||"object"!==typeof b.style)b.style={classes:b.style};a.each(s,function(){this.sanitize&&this.sanitize(b)});return b}function H(){H.history=H.history||[],H.history.push(arguments);if("object"===typeof console){var a=console[console.warn?"warn":"log"],b=Array.prototype.slice.call(arguments),c;typeof arguments[0]==="string"&&(b[0]="qTip2: "+b[0]),c=a.apply?a.apply(console,b):a(b)}}"use strict";var b=!0,c=!1,d=null,e,f="x",g="y",h="width",i="height",j="top",k="left",l="bottom",m="right",n="center",o="flip",p="flipinvert",q="shift",r,s,t,u={},v="ui-tooltip",w="ui-widget",x="ui-state-disabled",y="div.qtip."+v,z=v+"-default",A=v+"-focus",B=v+"-hover",C=v+"-fluid",D="-31000px",E="_replacedByqTip",F="oldtitle",G;r=a.fn.qtip=function(f,g,h){var i=(""+f).toLowerCase(),j=d,k=a.makeArray(arguments).slice(1),l=k[k.length-1],m=this[0]?a.data(this[0],"qtip"):d;if(!arguments.length&&m||i==="api")return m;if("string"===typeof f){this.each(function(){var d=a.data(this,"qtip");if(!d)return b;l&&l.timeStamp&&(d.cache.event=l);if(i!=="option"&&i!=="options"||!g)d[i]&&d[i].apply(d[i],k);else if(a.isPlainObject(g)||h!==e)d.set(g,h);else{j=d.get(g);return c}});return j!==d?j:this}if("object"===typeof f||!arguments.length){m=I(a.extend(b,{},f));return r.bind.call(this,m,l)}},r.bind=function(d,f){return this.each(function(g){function n(b){function d(){l.render(typeof b==="object"||h.show.ready),i.show.add(i.hide).unbind(k)}if(l.cache.disabled)return c;l.cache.event=a.extend({},b),l.cache.target=b?a(b.target):[e],h.show.delay>0?(clearTimeout(l.timers.show),l.timers.show=setTimeout(d,h.show.delay),j.show!==j.hide&&i.hide.bind(j.hide,function(){clearTimeout(l.timers.show)})):d()}var h,i,j,k,l,m;m=a.isArray(d.id)?d.id[g]:d.id,m=!m||m===c||m.length<1||u[m]?r.nextid++:u[m]=m,k=".qtip-"+m+"-create",l=K.call(this,m,d);if(l===c)return b;h=l.options,a.each(s,function(){this.initialize==="initialize"&&this(l)}),i={show:h.show.target,hide:h.hide.target},j={show:a.trim(""+h.show.event).replace(/ /g,k+" ")+k,hide:a.trim(""+h.hide.event).replace(/ /g,k+" ")+k},/mouse(over|enter)/i.test(j.show)&&!/mouse(out|leave)/i.test(j.hide)&&(j.hide+=" mouseleave"+k),i.show.bind("mousemove"+k,function(a){t={pageX:a.pageX,pageY:a.pageY,type:"mousemove"},l.cache.onTarget=b}),i.show.bind(j.show,n),(h.show.ready||h.prerender)&&n(f)})},s=r.plugins={Corner:function(a){a=(""+a).replace(/([A-Z])/," $1").replace(/middle/gi,n).toLowerCase(),this.x=(a.match(/left|right/i)||a.match(/center/)||["inherit"])[0].toLowerCase(),this.y=(a.match(/top|bottom|center/i)||["inherit"])[0].toLowerCase();var b=a.charAt(0);this.precedance=b==="t"||b==="b"?g:f,this.string=function(){return this.precedance===g?this.y+this.x:this.x+this.y},this.abbrev=function(){var a=this.x.substr(0,1),b=this.y.substr(0,1);return a===b?a:this.precedance===g?b+a:a+b},this.invertx=function(a){this.x=this.x===k?m:this.x===m?k:a||this.x},this.inverty=function(a){this.y=this.y===j?l:this.y===l?j:a||this.y},this.clone=function(){return{x:this.x,y:this.y,precedance:this.precedance,string:this.string,abbrev:this.abbrev,clone:this.clone,invertx:this.invertx,inverty:this.inverty}}},offset:function(b,c){function j(a,b){d.left+=b*a.scrollLeft(),d.top+=b*a.scrollTop()}var d=b.offset(),e=b.closest("body")[0],f=c,g,h,i;if(f){do f.css("position")!=="static"&&(h=f.position(),d.left-=h.left+(parseInt(f.css("borderLeftWidth"),10)||0)+(parseInt(f.css("marginLeft"),10)||0),d.top-=h.top+(parseInt(f.css("borderTopWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0),!g&&(i=f.css("overflow"))!=="hidden"&&i!=="visible"&&(g=f));while((f=a(f[0].offsetParent)).length);g&&g[0]!==e&&j(g,1)}return d},iOS:parseFloat((""+(/CPU.*OS ([0-9_]{1,5})|(CPU like).*AppleWebKit.*Mobile/i.exec(navigator.userAgent)||[0,""])[1]).replace("undefined","3_2").replace("_",".").replace("_",""))||c,fn:{attr:function(b,c){if(this.length){var d=this[0],e="title",f=a.data(d,"qtip");if(b===e&&f&&"object"===typeof f&&f.options.suppress){if(arguments.length<2)return a.attr(d,F);f&&f.options.content.attr===e&&f.cache.attr&&f.set("content.text",c);return this.attr(F,c)}}return a.fn["attr"+E].apply(this,arguments)},clone:function(b){var c=a([]),d="title",e=a.fn["clone"+E].apply(this,arguments);b||e.filter("["+F+"]").attr("title",function(){return a.attr(this,F)}).removeAttr(F);return e}}},a.each(s.fn,function(c,d){if(!d||a.fn[c+E])return b;var e=a.fn[c+E]=a.fn[c];a.fn[c]=function(){return d.apply(this,arguments)||e.apply(this,arguments)}}),a.ui||(a["cleanData"+E]=a.cleanData,a.cleanData=function(b){for(var c=0,d;(d=b[c])!==e;c++)try{a(d).triggerHandler("removeqtip")}catch(f){}a["cleanData"+E](b)}),r.version="nightly",r.nextid=0,r.inactiveEvents="click dblclick mousedown mouseup mousemove mouseleave mouseenter".split(" "),r.zindex=15e3,r.defaults={prerender:c,id:c,overwrite:b,suppress:b,content:{text:b,attr:"title",title:{text:c,button:c}},position:{my:"top left",at:"bottom right",target:c,container:c,viewport:c,adjust:{x:0,y:0,mouse:b,resize:b,method:"flip flip"},effect:function(b,d,e){a(this).animate(d,{duration:200,queue:c})}},show:{target:c,event:"mouseenter",effect:b,delay:90,solo:c,ready:c,autofocus:c},hide:{target:c,event:"mouseleave",effect:b,delay:0,fixed:c,inactive:c,leave:"window",distance:c},style:{classes:"",widget:c,width:c,height:c,def:b},events:{render:d,move:d,show:d,hide:d,toggle:d,visible:d,hidden:d,focus:d,blur:d}},s.ajax=function(a){var b=a.plugins.ajax;return"object"===typeof b?b:a.plugins.ajax=new L(a)},s.ajax.initialize="render",s.ajax.sanitize=function(a){var b=a.content,c;b&&"ajax"in b&&(c=b.ajax,typeof c!=="object"&&(c=a.content.ajax={url:c}),"boolean"!==typeof c.once&&c.once&&(c.once=!!c.once))},a.extend(b,r.defaults,{content:{ajax:{loading:b,once:b}}}),s.viewport=function(a,b,c,d,o,r,s){function K(a,c,d,f,g,h,i,j,k){var l=b[g],m=w[a],o=x[a],r=d===q,s=-D.offset[g]+C.offset[g]+C["scroll"+g],t=m===g?k:m===h?-k:-k/2,u=o===g?j:o===h?-j:-j/2,v=F&&F.size?F.size[i]||0:0,y=F&&F.corner&&F.corner.precedance===a&&!r?v:0,z=s-l+y,A=l+k-C[i]-s+y,B=t-(w.precedance===a||m===w[c]?u:0)-(o===n?j/2:0);r?(y=F&&F.corner&&F.corner.precedance===c?v:0,B=(m===g?1:-1)*t-y,b[g]+=z>0?z:A>0?-A:0,b[g]=Math.max(-D.offset[g]+C.offset[g]+(y&&F.corner[a]===n?F.offset:0),l-B,Math.min(Math.max(-D.offset[g]+C.offset[g]+C[i],l+B),b[g]))):(f*=d===p?2:0,z>0&&(m!==g||A>0)?(b[g]-=B+f,I["invert"+a](g)):A>0&&(m!==h||z>0)&&(b[g]-=(m===n?-B:B)+f,I["invert"+a](h)),b[g]<s&&-b[g]>A&&(b[g]=l,I=e));return b[g]-l}var t=c.target,u=a.elements.tooltip,w=c.my,x=c.at,y=c.adjust,z=y.method.split(" "),A=z[0],B=z[1]||z[0],C=c.viewport,D=c.container,E=a.cache,F=a.plugins.tip,G={left:0,top:0},H,I,J;if(!C.jquery||t[0]===window||t[0]===document.body||y.method==="none")return G;H=u.css("position")==="fixed",C={elem:C,height:C[(C[0]===window?"h":"outerH")+"eight"](),width:C[(C[0]===window?"w":"outerW")+"idth"](),scrollleft:H?0:C.scrollLeft(),scrolltop:H?0:C.scrollTop(),offset:C.offset()||{left:0,top:0}},D={elem:D,scrollLeft:D.scrollLeft(),scrollTop:D.scrollTop(),offset:D.offset()||{left:0,top:0}};if(A!=="shift"||B!=="shift")I=w.clone();G={left:A!=="none"?K(f,g,A,y.x,k,m,h,d,r):0,top:B!=="none"?K(g,f,B,y.y,j,l,i,o,s):0},I&&E.lastClass!==(J=v+"-pos-"+I.abbrev())&&u.removeClass(a.cache.lastClass).addClass(a.cache.lastClass=J);return G},s.modal=function(a){var b=a.plugins.modal;return"object"===typeof b?b:a.plugins.modal=new M(a)},s.modal.initialize="render",s.modal.sanitize=function(a){a.show&&(typeof a.show.modal!=="object"?a.show.modal={on:!!a.show.modal}:typeof a.show.modal.on==="undefined"&&(a.show.modal.on=b))},s.modal.zindex=r.zindex+1e3,s.modal.focusable=["a[href]","area[href]","input","select","textarea","button","iframe","object","embed","[tabindex]","[contenteditable]"],a.extend(b,r.defaults,{show:{modal:{on:c,effect:b,blur:b,stealfocus:b,escape:b}}}),s.imagemap=function(b,c,d,e){function v(a,b,c){var d=0,e=1,f=1,g=0,h=0,i=a.width,o=a.height;while(i>0&&o>0&&e>0&&f>0){i=Math.floor(i/2),o=Math.floor(o/2),c.x===k?e=i:c.x===m?e=a.width-i:e+=Math.floor(i/2),c.y===j?f=o:c.y===l?f=a.height-o:f+=Math.floor(o/2),d=b.length;while(d--){if(b.length<2)break;g=b[d][0]-a.position.left,h=b[d][1]-a.position.top,(c.x===k&&g>=e||c.x===m&&g<=e||c.x===n&&(g<e||g>a.width-e)||c.y===j&&h>=f||c.y===l&&h<=f||c.y===n&&(h<f||h>a.height-f))&&b.splice(d,1)}}return{left:b[0][0],top:b[0][1]}}c.jquery||(c=a(c));var f=b.cache.areas={},g=(c[0].shape||c.attr("shape")).toLowerCase(),h=c[0].coords||c.attr("coords"),i=h.split(","),o=[],p=a('img[usemap="#'+c.parent("map").attr("name")+'"]'),q=p.offset(),r={width:0,height:0,position:{top:1e10,right:0,bottom:0,left:1e10}},s=0,t=0,u;q.left+=Math.ceil((p.outerWidth()-p.width())/2),q.top+=Math.ceil((p.outerHeight()-p.height())/2);if(g==="poly"){s=i.length;while(s--)t=[parseInt(i[--s],10),parseInt(i[s+1],10)],t[0]>r.position.right&&(r.position.right=t[0]),t[0]<r.position.left&&(r.position.left=t[0]),t[1]>r.position.bottom&&(r.position.bottom=t[1]),t[1]<r.position.top&&(r.position.top=t[1]),o.push(t)}else{s=-1;while(s++<i.length)o.push(parseInt(i[s],10))}switch(g){case"rect":r={width:Math.abs(o[2]-o[0]),height:Math.abs(o[3]-o[1]),position:{left:Math.min(o[0],o[2]),top:Math.min(o[1],o[3])}};break;case"circle":r={width:o[2]+2,height:o[2]+2,position:{left:o[0],top:o[1]}};break;case"poly":r.width=Math.abs(r.position.right-r.position.left),r.height=Math.abs(r.position.bottom-r.position.top),d.abbrev()==="c"?r.position={left:r.position.left+r.width/2,top:r.position.top+r.height/2}:(f[d+h]||(r.position=v(r,o.slice(),d),e&&(e[0]==="flip"||e[1]==="flip")&&(r.offset=v(r,o.slice(),{x:d.x===k?m:d.x===m?k:n,y:d.y===j?l:d.y===l?j:n}),r.offset.left-=r.position.left,r.offset.top-=r.position.top),f[d+h]=r),r=f[d+h]),r.width=r.height=0}r.position.left+=q.left,r.position.top+=q.top;return r},s.tip=function(a){var b=a.plugins.tip;return"object"===typeof b?b:a.plugins.tip=new O(a)},s.tip.initialize="render",s.tip.sanitize=function(a){var c=a.style,d;c&&"tip"in c&&(d=a.style.tip,typeof d!=="object"&&(a.style.tip={corner:d}),/string|boolean/i.test(typeof d.corner)||(d.corner=b),typeof d.width!=="number"&&delete d.width,typeof d.height!=="number"&&delete d.height,typeof d.border!=="number"&&d.border!==b&&delete d.border,typeof d.offset!=="number"&&delete d.offset)},a.extend(b,r.defaults,{style:{tip:{corner:b,mimic:c,width:6,height:6,border:b,offset:0}}}),s.svg=function(b,c,d,e){var f=a(document),g=c[0],h={width:0,height:0,position:{top:1e10,left:1e10}},i,j,k,l,m;while(!g.getBBox)g=g.parentNode;if(g.getBBox&&g.parentNode){i=g.getBBox(),j=g.getScreenCTM(),k=g.farthestViewportElement||g;if(!k.createSVGPoint)return h;l=k.createSVGPoint(),l.x=i.x,l.y=i.y,m=l.matrixTransform(j),h.position.left=m.x,h.position.top=m.y,l.x+=i.width,l.y+=i.height,m=l.matrixTransform(j),h.width=m.x-h.position.left,h.height=m.y-h.position.top,h.position.left+=f.scrollLeft(),h.position.top+=f.scrollTop()}return h},s.bgiframe=function(b){var d=a.browser,e=b.plugins.bgiframe;if(a("select, object").length<1||(!d.msie||(""+d.version).charAt(0)!=="6"))return c;return"object"===typeof e?e:b.plugins.bgiframe=new P(b)},s.bgiframe.initialize="render"}) \ No newline at end of file +/* qtip2 v3.0.3 | Plugins: None | Styles: core | qtip2.com | Licensed MIT | Sun Aug 27 2017 15:28:58 */ + +!function(a,b,c){!function(a){"use strict";"function"==typeof define&&define.amd?define(["jquery"],a):jQuery&&!jQuery.fn.qtip&&a(jQuery)}(function(d){"use strict";function e(a,b,c,e){this.id=c,this.target=a,this.tooltip=z,this.elements={target:a},this._id=I+"-"+c,this.timers={img:{}},this.options=b,this.plugins={},this.cache={event:{},target:d(),disabled:y,attr:e,onTooltip:y,lastClass:""},this.rendered=this.destroyed=this.disabled=this.waiting=this.hiddenDuringWait=this.positioning=this.triggering=y}function f(a){return a===z||"object"!==d.type(a)}function g(a){return!(d.isFunction(a)||a&&a.attr||a.length||"object"===d.type(a)&&(a.jquery||a.then))}function h(a){var b,c,e,h;return f(a)?y:(f(a.metadata)&&(a.metadata={type:a.metadata}),"content"in a&&(b=a.content,f(b)||b.jquery||b.done?(c=g(b)?y:b,b=a.content={text:c}):c=b.text,"ajax"in b&&(e=b.ajax,h=e&&e.once!==y,delete b.ajax,b.text=function(a,b){var f=c||d(this).attr(b.options.content.attr)||"Loading...",g=d.ajax(d.extend({},e,{context:b})).then(e.success,z,e.error).then(function(a){return a&&h&&b.set("content.text",a),a},function(a,c,d){b.destroyed||0===a.status||b.set("content.text",c+": "+d)});return h?f:(b.set("content.text",f),g)}),"title"in b&&(d.isPlainObject(b.title)&&(b.button=b.title.button,b.title=b.title.text),g(b.title||y)&&(b.title=y))),"position"in a&&f(a.position)&&(a.position={my:a.position,at:a.position}),"show"in a&&f(a.show)&&(a.show=a.show.jquery?{target:a.show}:a.show===x?{ready:x}:{event:a.show}),"hide"in a&&f(a.hide)&&(a.hide=a.hide.jquery?{target:a.hide}:{event:a.hide}),"style"in a&&f(a.style)&&(a.style={classes:a.style}),d.each(H,function(){this.sanitize&&this.sanitize(a)}),a)}function i(a,b){for(var c,d=0,e=a,f=b.split(".");e=e[f[d++]];)d<f.length&&(c=e);return[c||a,f.pop()]}function j(a,b){var c,d,e;for(c in this.checks)if(this.checks.hasOwnProperty(c))for(d in this.checks[c])this.checks[c].hasOwnProperty(d)&&(e=new RegExp(d,"i").exec(a))&&(b.push(e),("builtin"===c||this.plugins[c])&&this.checks[c][d].apply(this.plugins[c]||this,b))}function k(a){return L.concat("").join(a?"-"+a+" ":" ")}function l(a,b){return b>0?setTimeout(d.proxy(a,this),b):void a.call(this)}function m(a){this.tooltip.hasClass(S)||(clearTimeout(this.timers.show),clearTimeout(this.timers.hide),this.timers.show=l.call(this,function(){this.toggle(x,a)},this.options.show.delay))}function n(a){if(!this.tooltip.hasClass(S)&&!this.destroyed){var b=d(a.relatedTarget),c=b.closest(M)[0]===this.tooltip[0],e=b[0]===this.options.show.target[0];if(clearTimeout(this.timers.show),clearTimeout(this.timers.hide),this!==b[0]&&"mouse"===this.options.position.target&&c||this.options.hide.fixed&&/mouse(out|leave|move)/.test(a.type)&&(c||e))try{a.preventDefault(),a.stopImmediatePropagation()}catch(f){}else this.timers.hide=l.call(this,function(){this.toggle(y,a)},this.options.hide.delay,this)}}function o(a){!this.tooltip.hasClass(S)&&this.options.hide.inactive&&(clearTimeout(this.timers.inactive),this.timers.inactive=l.call(this,function(){this.hide(a)},this.options.hide.inactive))}function p(a){this.rendered&&this.tooltip[0].offsetWidth>0&&this.reposition(a)}function q(a,c,e){d(b.body).delegate(a,(c.split?c:c.join("."+I+" "))+"."+I,function(){var a=s.api[d.attr(this,K)];a&&!a.disabled&&e.apply(a,arguments)})}function r(a,c,f){var g,i,j,k,l,m=d(b.body),n=a[0]===b?m:a,o=a.metadata?a.metadata(f.metadata):z,p="html5"===f.metadata.type&&o?o[f.metadata.name]:z,q=a.data(f.metadata.name||"qtipopts");try{q="string"==typeof q?d.parseJSON(q):q}catch(r){}if(k=d.extend(x,{},s.defaults,f,"object"==typeof q?h(q):z,h(p||o)),i=k.position,k.id=c,"boolean"==typeof k.content.text){if(j=a.attr(k.content.attr),k.content.attr===y||!j)return y;k.content.text=j}if(i.container.length||(i.container=m),i.target===y&&(i.target=n),k.show.target===y&&(k.show.target=n),k.show.solo===x&&(k.show.solo=i.container.closest("body")),k.hide.target===y&&(k.hide.target=n),k.position.viewport===x&&(k.position.viewport=i.container),i.container=i.container.eq(0),i.at=new u(i.at,x),i.my=new u(i.my),a.data(I))if(k.overwrite)a.qtip("destroy",!0);else if(k.overwrite===y)return y;return a.attr(J,c),k.suppress&&(l=a.attr("title"))&&a.removeAttr("title").attr(U,l).attr("title",""),g=new e(a,k,c,!!j),a.data(I,g),g}var s,t,u,v,w,x=!0,y=!1,z=null,A="x",B="y",C="top",D="left",E="bottom",F="right",G="center",H={},I="qtip",J="data-hasqtip",K="data-qtip-id",L=["ui-widget","ui-tooltip"],M="."+I,N="click dblclick mousedown mouseup mousemove mouseleave mouseenter".split(" "),O=I+"-fixed",P=I+"-default",Q=I+"-focus",R=I+"-hover",S=I+"-disabled",T="_replacedByqTip",U="oldtitle",V={ie:function(){var a,c;for(a=4,c=b.createElement("div");(c.innerHTML="<!--[if gt IE "+a+"]><i></i><![endif]-->")&&c.getElementsByTagName("i")[0];a+=1);return a>4?a:NaN}(),iOS:parseFloat((""+(/CPU.*OS ([0-9_]{1,5})|(CPU like).*AppleWebKit.*Mobile/i.exec(navigator.userAgent)||[0,""])[1]).replace("undefined","3_2").replace("_",".").replace("_",""))||y};t=e.prototype,t._when=function(a){return d.when.apply(d,a)},t.render=function(a){if(this.rendered||this.destroyed)return this;var b=this,c=this.options,e=this.cache,f=this.elements,g=c.content.text,h=c.content.title,i=c.content.button,j=c.position,k=[];return d.attr(this.target[0],"aria-describedby",this._id),e.posClass=this._createPosClass((this.position={my:j.my,at:j.at}).my),this.tooltip=f.tooltip=d("<div/>",{id:this._id,"class":[I,P,c.style.classes,e.posClass].join(" "),width:c.style.width||"",height:c.style.height||"",tracking:"mouse"===j.target&&j.adjust.mouse,role:"alert","aria-live":"polite","aria-atomic":y,"aria-describedby":this._id+"-content","aria-hidden":x}).toggleClass(S,this.disabled).attr(K,this.id).data(I,this).appendTo(j.container).append(f.content=d("<div />",{"class":I+"-content",id:this._id+"-content","aria-atomic":x})),this.rendered=-1,this.positioning=x,h&&(this._createTitle(),d.isFunction(h)||k.push(this._updateTitle(h,y))),i&&this._createButton(),d.isFunction(g)||k.push(this._updateContent(g,y)),this.rendered=x,this._setWidget(),d.each(H,function(a){var c;"render"===this.initialize&&(c=this(b))&&(b.plugins[a]=c)}),this._unassignEvents(),this._assignEvents(),this._when(k).then(function(){b._trigger("render"),b.positioning=y,b.hiddenDuringWait||!c.show.ready&&!a||b.toggle(x,e.event,y),b.hiddenDuringWait=y}),s.api[this.id]=this,this},t.destroy=function(a){function b(){if(!this.destroyed){this.destroyed=x;var a,b=this.target,c=b.attr(U);this.rendered&&this.tooltip.stop(1,0).find("*").remove().end().remove(),d.each(this.plugins,function(){this.destroy&&this.destroy()});for(a in this.timers)this.timers.hasOwnProperty(a)&&clearTimeout(this.timers[a]);b.removeData(I).removeAttr(K).removeAttr(J).removeAttr("aria-describedby"),this.options.suppress&&c&&b.attr("title",c).removeAttr(U),this._unassignEvents(),this.options=this.elements=this.cache=this.timers=this.plugins=this.mouse=z,delete s.api[this.id]}}return this.destroyed?this.target:(a===x&&"hide"!==this.triggering||!this.rendered?b.call(this):(this.tooltip.one("tooltiphidden",d.proxy(b,this)),!this.triggering&&this.hide()),this.target)},v=t.checks={builtin:{"^id$":function(a,b,c,e){var f=c===x?s.nextid:c,g=I+"-"+f;f!==y&&f.length>0&&!d("#"+g).length?(this._id=g,this.rendered&&(this.tooltip[0].id=this._id,this.elements.content[0].id=this._id+"-content",this.elements.title[0].id=this._id+"-title")):a[b]=e},"^prerender":function(a,b,c){c&&!this.rendered&&this.render(this.options.show.ready)},"^content.text$":function(a,b,c){this._updateContent(c)},"^content.attr$":function(a,b,c,d){this.options.content.text===this.target.attr(d)&&this._updateContent(this.target.attr(c))},"^content.title$":function(a,b,c){return c?(c&&!this.elements.title&&this._createTitle(),void this._updateTitle(c)):this._removeTitle()},"^content.button$":function(a,b,c){this._updateButton(c)},"^content.title.(text|button)$":function(a,b,c){this.set("content."+b,c)},"^position.(my|at)$":function(a,b,c){"string"==typeof c&&(this.position[b]=a[b]=new u(c,"at"===b))},"^position.container$":function(a,b,c){this.rendered&&this.tooltip.appendTo(c)},"^show.ready$":function(a,b,c){c&&(!this.rendered&&this.render(x)||this.toggle(x))},"^style.classes$":function(a,b,c,d){this.rendered&&this.tooltip.removeClass(d).addClass(c)},"^style.(width|height)":function(a,b,c){this.rendered&&this.tooltip.css(b,c)},"^style.widget|content.title":function(){this.rendered&&this._setWidget()},"^style.def":function(a,b,c){this.rendered&&this.tooltip.toggleClass(P,!!c)},"^events.(render|show|move|hide|focus|blur)$":function(a,b,c){this.rendered&&this.tooltip[(d.isFunction(c)?"":"un")+"bind"]("tooltip"+b,c)},"^(show|hide|position).(event|target|fixed|inactive|leave|distance|viewport|adjust)":function(){if(this.rendered){var a=this.options.position;this.tooltip.attr("tracking","mouse"===a.target&&a.adjust.mouse),this._unassignEvents(),this._assignEvents()}}}},t.get=function(a){if(this.destroyed)return this;var b=i(this.options,a.toLowerCase()),c=b[0][b[1]];return c.precedance?c.string():c};var W=/^position\.(my|at|adjust|target|container|viewport)|style|content|show\.ready/i,X=/^prerender|show\.ready/i;t.set=function(a,b){if(this.destroyed)return this;var c,e=this.rendered,f=y,g=this.options;return"string"==typeof a?(c=a,a={},a[c]=b):a=d.extend({},a),d.each(a,function(b,c){if(e&&X.test(b))return void delete a[b];var h,j=i(g,b.toLowerCase());h=j[0][j[1]],j[0][j[1]]=c&&c.nodeType?d(c):c,f=W.test(b)||f,a[b]=[j[0],j[1],c,h]}),h(g),this.positioning=x,d.each(a,d.proxy(j,this)),this.positioning=y,this.rendered&&this.tooltip[0].offsetWidth>0&&f&&this.reposition("mouse"===g.position.target?z:this.cache.event),this},t._update=function(a,b){var c=this,e=this.cache;return this.rendered&&a?(d.isFunction(a)&&(a=a.call(this.elements.target,e.event,this)||""),d.isFunction(a.then)?(e.waiting=x,a.then(function(a){return e.waiting=y,c._update(a,b)},z,function(a){return c._update(a,b)})):a===y||!a&&""!==a?y:(a.jquery&&a.length>0?b.empty().append(a.css({display:"block",visibility:"visible"})):b.html(a),this._waitForContent(b).then(function(a){c.rendered&&c.tooltip[0].offsetWidth>0&&c.reposition(e.event,!a.length)}))):y},t._waitForContent=function(a){var b=this.cache;return b.waiting=x,(d.fn.imagesLoaded?a.imagesLoaded():(new d.Deferred).resolve([])).done(function(){b.waiting=y}).promise()},t._updateContent=function(a,b){this._update(a,this.elements.content,b)},t._updateTitle=function(a,b){this._update(a,this.elements.title,b)===y&&this._removeTitle(y)},t._createTitle=function(){var a=this.elements,b=this._id+"-title";a.titlebar&&this._removeTitle(),a.titlebar=d("<div />",{"class":I+"-titlebar "+(this.options.style.widget?k("header"):"")}).append(a.title=d("<div />",{id:b,"class":I+"-title","aria-atomic":x})).insertBefore(a.content).delegate(".qtip-close","mousedown keydown mouseup keyup mouseout",function(a){d(this).toggleClass("ui-state-active ui-state-focus","down"===a.type.substr(-4))}).delegate(".qtip-close","mouseover mouseout",function(a){d(this).toggleClass("ui-state-hover","mouseover"===a.type)}),this.options.content.button&&this._createButton()},t._removeTitle=function(a){var b=this.elements;b.title&&(b.titlebar.remove(),b.titlebar=b.title=b.button=z,a!==y&&this.reposition())},t._createPosClass=function(a){return I+"-pos-"+(a||this.options.position.my).abbrev()},t.reposition=function(c,e){if(!this.rendered||this.positioning||this.destroyed)return this;this.positioning=x;var f,g,h,i,j=this.cache,k=this.tooltip,l=this.options.position,m=l.target,n=l.my,o=l.at,p=l.viewport,q=l.container,r=l.adjust,s=r.method.split(" "),t=k.outerWidth(y),u=k.outerHeight(y),v=0,w=0,z=k.css("position"),A={left:0,top:0},B=k[0].offsetWidth>0,I=c&&"scroll"===c.type,J=d(a),K=q[0].ownerDocument,L=this.mouse;if(d.isArray(m)&&2===m.length)o={x:D,y:C},A={left:m[0],top:m[1]};else if("mouse"===m)o={x:D,y:C},(!r.mouse||this.options.hide.distance)&&j.origin&&j.origin.pageX?c=j.origin:!c||c&&("resize"===c.type||"scroll"===c.type)?c=j.event:L&&L.pageX&&(c=L),"static"!==z&&(A=q.offset()),K.body.offsetWidth!==(a.innerWidth||K.documentElement.clientWidth)&&(g=d(b.body).offset()),A={left:c.pageX-A.left+(g&&g.left||0),top:c.pageY-A.top+(g&&g.top||0)},r.mouse&&I&&L&&(A.left-=(L.scrollX||0)-J.scrollLeft(),A.top-=(L.scrollY||0)-J.scrollTop());else{if("event"===m?c&&c.target&&"scroll"!==c.type&&"resize"!==c.type?j.target=d(c.target):c.target||(j.target=this.elements.target):"event"!==m&&(j.target=d(m.jquery?m:this.elements.target)),m=j.target,m=d(m).eq(0),0===m.length)return this;m[0]===b||m[0]===a?(v=V.iOS?a.innerWidth:m.width(),w=V.iOS?a.innerHeight:m.height(),m[0]===a&&(A={top:(p||m).scrollTop(),left:(p||m).scrollLeft()})):H.imagemap&&m.is("area")?f=H.imagemap(this,m,o,H.viewport?s:y):H.svg&&m&&m[0].ownerSVGElement?f=H.svg(this,m,o,H.viewport?s:y):(v=m.outerWidth(y),w=m.outerHeight(y),A=m.offset()),f&&(v=f.width,w=f.height,g=f.offset,A=f.position),A=this.reposition.offset(m,A,q),(V.iOS>3.1&&V.iOS<4.1||V.iOS>=4.3&&V.iOS<4.33||!V.iOS&&"fixed"===z)&&(A.left-=J.scrollLeft(),A.top-=J.scrollTop()),(!f||f&&f.adjustable!==y)&&(A.left+=o.x===F?v:o.x===G?v/2:0,A.top+=o.y===E?w:o.y===G?w/2:0)}return A.left+=r.x+(n.x===F?-t:n.x===G?-t/2:0),A.top+=r.y+(n.y===E?-u:n.y===G?-u/2:0),H.viewport?(h=A.adjusted=H.viewport(this,A,l,v,w,t,u),g&&h.left&&(A.left+=g.left),g&&h.top&&(A.top+=g.top),h.my&&(this.position.my=h.my)):A.adjusted={left:0,top:0},j.posClass!==(i=this._createPosClass(this.position.my))&&(j.posClass=i,k.removeClass(j.posClass).addClass(i)),this._trigger("move",[A,p.elem||p],c)?(delete A.adjusted,e===y||!B||isNaN(A.left)||isNaN(A.top)||"mouse"===m||!d.isFunction(l.effect)?k.css(A):d.isFunction(l.effect)&&(l.effect.call(k,this,d.extend({},A)),k.queue(function(a){d(this).css({opacity:"",height:""}),V.ie&&this.style.removeAttribute("filter"),a()})),this.positioning=y,this):this},t.reposition.offset=function(a,c,e){function f(a,b){c.left+=b*a.scrollLeft(),c.top+=b*a.scrollTop()}if(!e[0])return c;var g,h,i,j,k=d(a[0].ownerDocument),l=!!V.ie&&"CSS1Compat"!==b.compatMode,m=e[0];do"static"!==(h=d.css(m,"position"))&&("fixed"===h?(i=m.getBoundingClientRect(),f(k,-1)):(i=d(m).position(),i.left+=parseFloat(d.css(m,"borderLeftWidth"))||0,i.top+=parseFloat(d.css(m,"borderTopWidth"))||0),c.left-=i.left+(parseFloat(d.css(m,"marginLeft"))||0),c.top-=i.top+(parseFloat(d.css(m,"marginTop"))||0),g||"hidden"===(j=d.css(m,"overflow"))||"visible"===j||(g=d(m)));while(m=m.offsetParent);return g&&(g[0]!==k[0]||l)&&f(g,1),c};var Y=(u=t.reposition.Corner=function(a,b){a=(""+a).replace(/([A-Z])/," $1").replace(/middle/gi,G).toLowerCase(),this.x=(a.match(/left|right/i)||a.match(/center/)||["inherit"])[0].toLowerCase(),this.y=(a.match(/top|bottom|center/i)||["inherit"])[0].toLowerCase(),this.forceY=!!b;var c=a.charAt(0);this.precedance="t"===c||"b"===c?B:A}).prototype;Y.invert=function(a,b){this[a]=this[a]===D?F:this[a]===F?D:b||this[a]},Y.string=function(a){var b=this.x,c=this.y,d=b!==c?"center"===b||"center"!==c&&(this.precedance===B||this.forceY)?[c,b]:[b,c]:[b];return a!==!1?d.join(" "):d},Y.abbrev=function(){var a=this.string(!1);return a[0].charAt(0)+(a[1]&&a[1].charAt(0)||"")},Y.clone=function(){return new u(this.string(),this.forceY)},t.toggle=function(a,c){var e=this.cache,f=this.options,g=this.tooltip;if(c){if(/over|enter/.test(c.type)&&e.event&&/out|leave/.test(e.event.type)&&f.show.target.add(c.target).length===f.show.target.length&&g.has(c.relatedTarget).length)return this;e.event=d.event.fix(c)}if(this.waiting&&!a&&(this.hiddenDuringWait=x),!this.rendered)return a?this.render(1):this;if(this.destroyed||this.disabled)return this;var h,i,j,k=a?"show":"hide",l=this.options[k],m=this.options.position,n=this.options.content,o=this.tooltip.css("width"),p=this.tooltip.is(":visible"),q=a||1===l.target.length,r=!c||l.target.length<2||e.target[0]===c.target;return(typeof a).search("boolean|number")&&(a=!p),h=!g.is(":animated")&&p===a&&r,i=h?z:!!this._trigger(k,[90]),this.destroyed?this:(i!==y&&a&&this.focus(c),!i||h?this:(d.attr(g[0],"aria-hidden",!a),a?(this.mouse&&(e.origin=d.event.fix(this.mouse)),d.isFunction(n.text)&&this._updateContent(n.text,y),d.isFunction(n.title)&&this._updateTitle(n.title,y),!w&&"mouse"===m.target&&m.adjust.mouse&&(d(b).bind("mousemove."+I,this._storeMouse),w=x),o||g.css("width",g.outerWidth(y)),this.reposition(c,arguments[2]),o||g.css("width",""),l.solo&&("string"==typeof l.solo?d(l.solo):d(M,l.solo)).not(g).not(l.target).qtip("hide",new d.Event("tooltipsolo"))):(clearTimeout(this.timers.show),delete e.origin,w&&!d(M+'[tracking="true"]:visible',l.solo).not(g).length&&(d(b).unbind("mousemove."+I),w=y),this.blur(c)),j=d.proxy(function(){a?(V.ie&&g[0].style.removeAttribute("filter"),g.css("overflow",""),"string"==typeof l.autofocus&&d(this.options.show.autofocus,g).focus(),this.options.show.target.trigger("qtip-"+this.id+"-inactive")):g.css({display:"",visibility:"",opacity:"",left:"",top:""}),this._trigger(a?"visible":"hidden")},this),l.effect===y||q===y?(g[k](),j()):d.isFunction(l.effect)?(g.stop(1,1),l.effect.call(g,this),g.queue("fx",function(a){j(),a()})):g.fadeTo(90,a?1:0,j),a&&l.target.trigger("qtip-"+this.id+"-inactive"),this))},t.show=function(a){return this.toggle(x,a)},t.hide=function(a){return this.toggle(y,a)},t.focus=function(a){if(!this.rendered||this.destroyed)return this;var b=d(M),c=this.tooltip,e=parseInt(c[0].style.zIndex,10),f=s.zindex+b.length;return c.hasClass(Q)||this._trigger("focus",[f],a)&&(e!==f&&(b.each(function(){this.style.zIndex>e&&(this.style.zIndex=this.style.zIndex-1)}),b.filter("."+Q).qtip("blur",a)),c.addClass(Q)[0].style.zIndex=f),this},t.blur=function(a){return!this.rendered||this.destroyed?this:(this.tooltip.removeClass(Q),this._trigger("blur",[this.tooltip.css("zIndex")],a),this)},t.disable=function(a){return this.destroyed?this:("toggle"===a?a=!(this.rendered?this.tooltip.hasClass(S):this.disabled):"boolean"!=typeof a&&(a=x),this.rendered&&this.tooltip.toggleClass(S,a).attr("aria-disabled",a),this.disabled=!!a,this)},t.enable=function(){return this.disable(y)},t._createButton=function(){var a=this,b=this.elements,c=b.tooltip,e=this.options.content.button,f="string"==typeof e,g=f?e:"Close tooltip";b.button&&b.button.remove(),e.jquery?b.button=e:b.button=d("<a />",{"class":"qtip-close "+(this.options.style.widget?"":I+"-icon"),title:g,"aria-label":g}).prepend(d("<span />",{"class":"ui-icon ui-icon-close",html:"×"})),b.button.appendTo(b.titlebar||c).attr("role","button").click(function(b){return c.hasClass(S)||a.hide(b),y})},t._updateButton=function(a){if(!this.rendered)return y;var b=this.elements.button;a?this._createButton():b.remove()},t._setWidget=function(){var a=this.options.style.widget,b=this.elements,c=b.tooltip,d=c.hasClass(S);c.removeClass(S),S=a?"ui-state-disabled":"qtip-disabled",c.toggleClass(S,d),c.toggleClass("ui-helper-reset "+k(),a).toggleClass(P,this.options.style.def&&!a),b.content&&b.content.toggleClass(k("content"),a),b.titlebar&&b.titlebar.toggleClass(k("header"),a),b.button&&b.button.toggleClass(I+"-icon",!a)},t._storeMouse=function(a){return(this.mouse=d.event.fix(a)).type="mousemove",this},t._bind=function(a,b,c,e,f){if(a&&c&&b.length){var g="."+this._id+(e?"-"+e:"");return d(a).bind((b.split?b:b.join(g+" "))+g,d.proxy(c,f||this)),this}},t._unbind=function(a,b){return a&&d(a).unbind("."+this._id+(b?"-"+b:"")),this},t._trigger=function(a,b,c){var e=new d.Event("tooltip"+a);return e.originalEvent=c&&d.extend({},c)||this.cache.event||z,this.triggering=a,this.tooltip.trigger(e,[this].concat(b||[])),this.triggering=y,!e.isDefaultPrevented()},t._bindEvents=function(a,b,c,e,f,g){var h=c.filter(e).add(e.filter(c)),i=[];h.length&&(d.each(b,function(b,c){var e=d.inArray(c,a);e>-1&&i.push(a.splice(e,1)[0])}),i.length&&(this._bind(h,i,function(a){var b=this.rendered?this.tooltip[0].offsetWidth>0:!1;(b?g:f).call(this,a)}),c=c.not(h),e=e.not(h))),this._bind(c,a,f),this._bind(e,b,g)},t._assignInitialEvents=function(a){function b(a){return this.disabled||this.destroyed?y:(this.cache.event=a&&d.event.fix(a),this.cache.target=a&&d(a.target),clearTimeout(this.timers.show),void(this.timers.show=l.call(this,function(){this.render("object"==typeof a||c.show.ready)},c.prerender?0:c.show.delay)))}var c=this.options,e=c.show.target,f=c.hide.target,g=c.show.event?d.trim(""+c.show.event).split(" "):[],h=c.hide.event?d.trim(""+c.hide.event).split(" "):[];this._bind(this.elements.target,["remove","removeqtip"],function(){this.destroy(!0)},"destroy"),/mouse(over|enter)/i.test(c.show.event)&&!/mouse(out|leave)/i.test(c.hide.event)&&h.push("mouseleave"),this._bind(e,"mousemove",function(a){this._storeMouse(a),this.cache.onTarget=x}),this._bindEvents(g,h,e,f,b,function(){return this.timers?void clearTimeout(this.timers.show):y}),(c.show.ready||c.prerender)&&b.call(this,a)},t._assignEvents=function(){var c=this,e=this.options,f=e.position,g=this.tooltip,h=e.show.target,i=e.hide.target,j=f.container,k=f.viewport,l=d(b),q=d(a),r=e.show.event?d.trim(""+e.show.event).split(" "):[],t=e.hide.event?d.trim(""+e.hide.event).split(" "):[];d.each(e.events,function(a,b){c._bind(g,"toggle"===a?["tooltipshow","tooltiphide"]:["tooltip"+a],b,null,g)}),/mouse(out|leave)/i.test(e.hide.event)&&"window"===e.hide.leave&&this._bind(l,["mouseout","blur"],function(a){/select|option/.test(a.target.nodeName)||a.relatedTarget||this.hide(a)}),e.hide.fixed?i=i.add(g.addClass(O)):/mouse(over|enter)/i.test(e.show.event)&&this._bind(i,"mouseleave",function(){clearTimeout(this.timers.show)}),(""+e.hide.event).indexOf("unfocus")>-1&&this._bind(j.closest("html"),["mousedown","touchstart"],function(a){var b=d(a.target),c=this.rendered&&!this.tooltip.hasClass(S)&&this.tooltip[0].offsetWidth>0,e=b.parents(M).filter(this.tooltip[0]).length>0;b[0]===this.target[0]||b[0]===this.tooltip[0]||e||this.target.has(b[0]).length||!c||this.hide(a)}),"number"==typeof e.hide.inactive&&(this._bind(h,"qtip-"+this.id+"-inactive",o,"inactive"),this._bind(i.add(g),s.inactiveEvents,o)),this._bindEvents(r,t,h,i,m,n),this._bind(h.add(g),"mousemove",function(a){if("number"==typeof e.hide.distance){var b=this.cache.origin||{},c=this.options.hide.distance,d=Math.abs;(d(a.pageX-b.pageX)>=c||d(a.pageY-b.pageY)>=c)&&this.hide(a)}this._storeMouse(a)}),"mouse"===f.target&&f.adjust.mouse&&(e.hide.event&&this._bind(h,["mouseenter","mouseleave"],function(a){return this.cache?void(this.cache.onTarget="mouseenter"===a.type):y}),this._bind(l,"mousemove",function(a){this.rendered&&this.cache.onTarget&&!this.tooltip.hasClass(S)&&this.tooltip[0].offsetWidth>0&&this.reposition(a)})),(f.adjust.resize||k.length)&&this._bind(d.event.special.resize?k:q,"resize",p),f.adjust.scroll&&this._bind(q.add(f.container),"scroll",p)},t._unassignEvents=function(){var c=this.options,e=c.show.target,f=c.hide.target,g=d.grep([this.elements.target[0],this.rendered&&this.tooltip[0],c.position.container[0],c.position.viewport[0],c.position.container.closest("html")[0],a,b],function(a){return"object"==typeof a});e&&e.toArray&&(g=g.concat(e.toArray())),f&&f.toArray&&(g=g.concat(f.toArray())),this._unbind(g)._unbind(g,"destroy")._unbind(g,"inactive")},d(function(){q(M,["mouseenter","mouseleave"],function(a){var b="mouseenter"===a.type,c=d(a.currentTarget),e=d(a.relatedTarget||a.target),f=this.options;b?(this.focus(a),c.hasClass(O)&&!c.hasClass(S)&&clearTimeout(this.timers.hide)):"mouse"===f.position.target&&f.position.adjust.mouse&&f.hide.event&&f.show.target&&!e.closest(f.show.target[0]).length&&this.hide(a),c.toggleClass(R,b)}),q("["+K+"]",N,o)}),s=d.fn.qtip=function(a,b,e){var f=(""+a).toLowerCase(),g=z,i=d.makeArray(arguments).slice(1),j=i[i.length-1],k=this[0]?d.data(this[0],I):z;return!arguments.length&&k||"api"===f?k:"string"==typeof a?(this.each(function(){var a=d.data(this,I);if(!a)return x;if(j&&j.timeStamp&&(a.cache.event=j),!b||"option"!==f&&"options"!==f)a[f]&&a[f].apply(a,i);else{if(e===c&&!d.isPlainObject(b))return g=a.get(b),y;a.set(b,e)}}),g!==z?g:this):"object"!=typeof a&&arguments.length?void 0:(k=h(d.extend(x,{},a)),this.each(function(a){var b,c;return c=d.isArray(k.id)?k.id[a]:k.id,c=!c||c===y||c.length<1||s.api[c]?s.nextid++:c,b=r(d(this),c,k),b===y?x:(s.api[c]=b,d.each(H,function(){"initialize"===this.initialize&&this(b)}),void b._assignInitialEvents(j))}))},d.qtip=e,s.api={},d.each({attr:function(a,b){if(this.length){var c=this[0],e="title",f=d.data(c,"qtip");if(a===e&&f&&f.options&&"object"==typeof f&&"object"==typeof f.options&&f.options.suppress)return arguments.length<2?d.attr(c,U):(f&&f.options.content.attr===e&&f.cache.attr&&f.set("content.text",b),this.attr(U,b))}return d.fn["attr"+T].apply(this,arguments)},clone:function(a){var b=d.fn["clone"+T].apply(this,arguments);return a||b.filter("["+U+"]").attr("title",function(){return d.attr(this,U)}).removeAttr(U),b}},function(a,b){if(!b||d.fn[a+T])return x;var c=d.fn[a+T]=d.fn[a];d.fn[a]=function(){return b.apply(this,arguments)||c.apply(this,arguments)}}),d.ui||(d["cleanData"+T]=d.cleanData,d.cleanData=function(a){for(var b,c=0;(b=d(a[c])).length;c++)if(b.attr(J))try{b.triggerHandler("removeqtip")}catch(e){}d["cleanData"+T].apply(this,arguments)}),s.version="3.0.3",s.nextid=0,s.inactiveEvents=N,s.zindex=15e3,s.defaults={prerender:y,id:y,overwrite:x,suppress:x,content:{text:x,attr:"title",title:y,button:y},position:{my:"top left",at:"bottom right",target:y,container:y,viewport:y,adjust:{x:0,y:0,mouse:x,scroll:x,resize:x,method:"flipinvert flipinvert"},effect:function(a,b){d(this).animate(b,{duration:200,queue:y})}},show:{target:y,event:"mouseenter",effect:x,delay:90,solo:y,ready:y,autofocus:y},hide:{target:y,event:"mouseleave",effect:x,delay:0,fixed:y,inactive:y,leave:"window",distance:y},style:{classes:"",widget:y,width:y,height:y,def:x},events:{render:z,move:z,show:z,hide:z,toggle:z,visible:z,hidden:z,focus:z,blur:z}}})}(window,document); +//# sourceMappingURL=jquery.qtip.min.map \ No newline at end of file diff --git a/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js b/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js index c6bb63383a86be51a31c3e7c1a1187e386a263b6..1f9a823bcea0c66ef9e9f0ddf11fa9f49f9894f6 100644 --- a/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js +++ b/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js @@ -61,6 +61,7 @@ */ function clickOnAdd(event) { + ////console.log('clickOnAdd'); event.preventDefault(); addForm(); } @@ -70,6 +71,7 @@ */ function clickOnAddN(event) { + ////console.log('clickOnAddN'); event.preventDefault(); if (addNInput.value !== '') { addNForms(addNInput.attr('value')); @@ -139,13 +141,15 @@ } function getOrSetTemplate(element, attrname){ - //var template=element.attr(attrname+"template"); - //if(template) { - // return unescape(template); - //} - var att=element.attr(attrname); + var template=element.prop(attrname+"template"); + //console.log(template); + if(template) { + return unescape(template); + } + var att=element.prop(attrname); + //console.log(att); // Hide index occurrences inside the template (todo: better escaping method) - element.attr(attrname+"template", escape(att)); + element.prop(attrname+"template", escape(att)); return att; } @@ -158,24 +162,21 @@ var that = $(this) ,idTemplateAttr = getOrSetTemplate(that,"id") ,nameTemplateAttr = getOrSetTemplate(that, "name") - ,idAttr = that.attr("id") - ,nameAttr = that.attr("name") + ,idAttr = that.prop("id") + ,nameAttr = that.prop("name") /* Normalize field name attributes */ - if(typeof(newNameAttr)=='string'){ - newNameAttr = nameTemplateAttr.replace(options.indexFormat, index); - that.attr("name", newNameAttr); - } + + var newNameAttr = nameTemplateAttr.replace(options.indexFormat, index); + that.attr("name", newNameAttr); /* Normalize field id attributes */ - if(typeof(newIdAttr)=='string'){ - newIdAttr = idTemplateAttr.replace(options.indexFormat, index); + var newIdAttr = idTemplateAttr.replace(options.indexFormat, index); - form.find("label[for='"+idAttr+"']").each(function(){ - $(this).attr("for", newIdAttr); - }); - that.attr("id", newIdAttr); - } + form.find("label[for='"+idAttr+"']").each(function(){ + $(this).attr("for", newIdAttr); + }); + that.attr("id", newIdAttr); }); } @@ -290,15 +291,21 @@ function normalizeForm(form, index) { + + if (typeof index == 'undefined') { index=getIndex(); + //console.log(index+' index in normalizeForm'); } + var formcount=getFormsCount(); + + //console.log(formcount+' formcount in normalizeForm'); var idTemplate=getOrSetTemplate(form, "id"); // Normalize form id - if (form.attr("id")) { - form.attr("id", idTemplate + index); + if (form.prop("id")) { + form.prop("id", idTemplate + index); } @@ -377,6 +384,7 @@ if (canAddForm() && newForm) { newForm = normalizeForm(newForm); + // Remove current control var removeCurrentBtn = newForm.find(options.removeCurrentSelector).first(); @@ -384,6 +392,7 @@ removeCurrentBtn.click(clickOnRemoveCurrent); removeCurrentBtn.data('removableClone', newForm); + // Index newForm.data('formIndex', getIndex()); @@ -499,12 +508,13 @@ } if (canRemoveAllForms()) { - var count = forms.length; - for (i = 0; i < count; i++) { - if (forms[i]) { - removeForm(forms[i]); + var x = []; + forms.forEach(function(form) { + if (form) { + removeForm(form); } - } + }); + forms.length=0; if (normalize) { normalizeAll(); } @@ -705,11 +715,9 @@ { if (forms.length > 0) { var count = 0; - var num = forms.length; - var i = 0; - - for (i = 0; i < forms.length; i++) { - if (forms[i]) { + var x = []; + for (x in forms) { + if (forms[x] ) { count++; } } @@ -745,9 +753,10 @@ var count = 0; var index = false; - for (x=0; x < forms.length; x++) { + for (x in forms) { if (forms[x]) { count++; + // get index for position if (position == count) { index = x; } @@ -929,14 +938,19 @@ var form = ''; + // Position if (typeof(index) == 'number') { +//console.log('fillData index: '+index); // Correction of index to position index++; // Need more forms? + var $count=getFormsCount(); + ////console.log('forms count:'+$count); if ((index) > getFormsCount()) { + addForm(); } @@ -963,24 +977,21 @@ // For each element, try to get the correct field or fields $.each(data, function(index, value) { - - var formId = source.attr('id'); + //console.log('formData: '+JSON.stringify(form.data)); + var formId = source.prop('id'); var formIndex = form.data('formIndex'); - - - var iFormat = '#index#'; - if (typeof(options.indexFormat) != 'undefined' && options.indexFormat){ - iFormat = options.indexFormat; - } + //console.log('formId: '+formId+' formIndex '+formIndex); // Replace form Id and form Index with current values - if (index.indexOf('#form#') != -1 || index.indexOf(iFormat) != -1) { - index = index.replace('#form#', formId); - index = index.replace(iFormat, formIndex); + if (index.indexOf('#form#') != -1 || index.indexOf('#index#') != -1) { + index = index.replace('#form#', formId); + index = index.replace('#index#', formIndex); } else { - index = formId + '_' + formIndex + '_' + index; + index = formId + '_' + formIndex + '_' + index; } + + //console.log('index: '+index); /** * Search for field (by id, by name, etc) @@ -988,7 +999,7 @@ // Search by id var field = form.find(':input[id="' + index + '"]'); - + // Search by name if (field.length == 0) { @@ -998,10 +1009,6 @@ if (field.length == 0) { // Search by name array format field = form.find(':input[name="' + index + '[]"]'); - if (field.length == 0) { - //console.log(':input[name="' + index + '[.*?]"]'); - field = form.find(':input[name^="' + index + '["][name$=.+\]]'); - } } } @@ -1009,7 +1016,7 @@ // Field was found if (field.length > 0) { - + //console.log('field is found'); // Multiple values? var mv = false; if (typeof(value) == 'object') { @@ -1021,7 +1028,7 @@ if (field.length > 1) { mf = true; } - + ////console.log('mv'+mv+'mf'+mf); if (mf) { if (mv) { @@ -1077,8 +1084,9 @@ function fillFormField(field, value) { var type = field.prop('type'); + //console.log('type: '+type); // hidden, text, password - if (type == 'text' || type == 'hidden' || type == 'password') { + if (type == 'text' || type == 'hidden' || type == 'password' || type == 'number' || type == 'date' || type == 'tel') { field.attr('value', value); return true; } @@ -1095,8 +1103,8 @@ // select-one, select-multiple else if (type == 'select-one' || type == 'select-multiple') { field.find("option").each(function() { - if($(this).text() == value || $(this).attr("value") == value) { - $(this).attr("selected", "selected"); + if($(this).text() == value || $(this).prop("value") == value) { + $(this).prop("selected", "selected"); } }); return true; @@ -1366,6 +1374,8 @@ inject: function(data) { // Loop over each data using a Proxy (function , context) + // //console.log('data for fillData: '+JSON.stringify(data)); + // //console.log('Source for fillData: '+JSON.stringify(source)); $.each(data, $.proxy( fillData, source )); } diff --git a/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js b/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js index 08aa798ad01fdfa088a4b9157b510709db366ec7..b8053baaa12b1c260d14e8c24b997c945ac595b1 100644 --- a/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js +++ b/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js @@ -1,9 +1,7 @@ /* - ### jQuery XML to JSON Plugin v1.1 - 2008-07-01 ### + ### jQuery XML to JSON Plugin v1.3 - 2013-02-18 ### * http://www.fyneworks.com/ - diego@fyneworks.com - * Dual licensed under the MIT and GPL licenses: - * http://www.opensource.org/licenses/mit-license.php - * http://www.gnu.org/licenses/gpl.html + * Licensed under http://en.wikipedia.org/wiki/MIT_License ### Website: http://www.fyneworks.com/jquery/xml-to-json/ *//* @@ -101,7 +99,8 @@ };//node.attributes if(obj){ obj = $.extend( (txt!='' ? new String(txt) : {}),/* {text:txt},*/ obj || {}/*, att || {}*/); - txt = (obj.text) ? (typeof(obj.text)=='object' ? obj.text : [obj.text || '']).concat([txt]) : txt; + //txt = (obj.text) ? (typeof(obj.text)=='object' ? obj.text : [obj.text || '']).concat([txt]) : txt; + txt = (obj.text) ? ([obj.text || '']).concat([txt]) : txt; if(txt) obj.text = txt; txt = ''; }; @@ -170,16 +169,23 @@ text2xml: function(str) { // NOTE: I'd like to use jQuery for this, but jQuery makes all tags uppercase //return $(xml)[0]; + + /* prior to jquery 1.9 */ + /* var out; try{ - var xml = ($.browser.msie)?new ActiveXObject("Microsoft.XMLDOM"):new DOMParser(); + var xml = ((!$.support.opacity && !$.support.style))?new ActiveXObject("Microsoft.XMLDOM"):new DOMParser(); xml.async = false; }catch(e){ throw new Error("XML Parser could not be instantiated") }; try{ - if($.browser.msie) out = (xml.loadXML(str))?xml:false; + if((!$.support.opacity && !$.support.style)) out = (xml.loadXML(str))?xml:false; else out = xml.parseFromString(str, "text/xml"); }catch(e){ throw new Error("Error parsing XML string") }; return out; + */ + + /* jquery 1.9+ */ + return $.parseXML(str); } }); // extend $ diff --git a/www/include/core/header/htmlHeader.php b/www/include/core/header/htmlHeader.php index 8d703944f162df82adaf83399a4c3813bfe35366..9f007d194602ea7bfddd37ad9f2095f7d8014239 100644 --- a/www/include/core/header/htmlHeader.php +++ b/www/include/core/header/htmlHeader.php @@ -86,6 +86,7 @@ print "<?xml version=\"1.0\" encoding=\"utf-8\"?>\n"; <script type="text/javascript" src="./include/common/javascript/jquery/plugins/select2/js/select2.full.min.js"></script> <script type="text/javascript" src="./include/common/javascript/centreon/centreon-select2.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/jquery-ui.js"></script> + <script type="text/javascript" src="./include/common/javascript/jquery/jquery-ui-tabs-rotate.js"></script> <script type="text/javascript">jQuery.noConflict();</script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/jeditable/jquery.jeditable-min.js"></script> diff --git a/www/include/home/customViews/index.ihtml b/www/include/home/customViews/index.ihtml index 331dfbb757aae413831531ac6b232be6a2347607..f559591c75bc3be44de7c336723d14a26213d290 100644 --- a/www/include/home/customViews/index.ihtml +++ b/www/include/home/customViews/index.ihtml @@ -207,8 +207,8 @@ <div class="toggle_wrapper inactive" id="rotationTabs"> <div id='rotation_timer'></div> <div id='timer_value'></div> - <div class="button_group_center"> - <input type='button' value='{t}Apply{/t}' class="btc bt_success" onClick='submitRotation();'/> + <div class="button_group button_group_center"> + <input type='button' value='{t}Apply{/t}' class="btc bt_success bt_widget" onClick='submitRotation();'/> </div> </div> </div> @@ -224,8 +224,7 @@ {t}No view available. To create a new view, please click "Add view" button.{/t} </h4> </div> - <ul class="tabs_header"> - </ul> + <ul class="tabs_header"></ul> </div> </div> <div hidden> @@ -253,6 +252,10 @@ </div> <script> {literal} + +var rotationTimeout; +var rotationTimer = {/literal}{$rotationTimer}{literal}; + /* Display or hide the information for add a new view */ function infoEmptyTab() { if (jQuery('#tabs .tabs_header > li').length > 0) { @@ -313,7 +316,7 @@ function deleteTab(viewId) { }); if (jQuery('#tabs .tabs_header > li').length > 0) { - jQuery('#tabs').tabs('select', 1); + jQuery('#tabs').tabs('option', 'active', 1); } infoEmptyTab(); @@ -370,7 +373,7 @@ function submitAddView() { public: (jQuery('#formAddView input[name="public"]:checked').length ? true : false), nbCols: jQuery('#formAddView input[name="layout[layout]"]:checked').val() }); - jQuery("#tabs").tabs('select', getTabPos(viewId)); + jQuery("#tabs").tabs('option', 'active', getTabPos(viewId)); jQuery('#formAddView').parents('.toggle_wrapper').hide(); }else{ jQuery('#formAddView').parents('.toggle_wrapper').hide(); @@ -441,7 +444,7 @@ function submitAddWidget() { /* Delete action */ function submitDeleteView() { var viewId = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ).data('cvId'); jQuery.ajax({ type: "POST", @@ -465,7 +468,7 @@ function submitDeleteView() { /* Set default action */ function submitSetDefaultView() { var viewId = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ).data('cvId'); jQuery.ajax({ type: "POST", @@ -493,7 +496,7 @@ function submitRotation() { var view = response.getElementsByTagName('custom_view_id'); var error = response.getElementsByTagName('error'); if (typeof(view) != 'undefined') { - jQuery("#tabs").tabs('rotate', (rotationTimer * 1000)); + jQuery("#tabs").tabs('rotate', (rotationTimer * 1000), true); jQuery('#rotation_timer').parents('.toggle_wrapper').hide(); } else if (typeof(err) != 'undefined') { var errorMsg = err.item(0).firstChild.data; @@ -506,7 +509,7 @@ function submitRotation() { function submitShareView() { var viewId = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ).data('cvId'); var lockedUsers = jQuery("#formShareView").find('select[name="locked_user_id[]"]').val(); lockedUsers = (lockedUsers == null) ? [] : lockedUsers.filter(function (elem) {return elem !== '';}); @@ -608,7 +611,7 @@ function toggleEdit(show) { function removeUserFromView(user_id) { var viewId = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ).data('cvId'); jQuery.ajax({ type: "POST", @@ -638,7 +641,7 @@ function removeUserFromView(user_id) { function removeUsergroupFromView(usergroup_id) { var viewId = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ).data('cvId'); jQuery.ajax({ type: "POST", @@ -667,10 +670,11 @@ function removeUsergroupFromView(usergroup_id) { } jQuery(function () { + jQuery('#tabs').tabs(); toggleEdit(defaultShow); /* Initialize buttons */ - jQuery('.addView').button({ icons : { primary: 'ui-icon-plus'}}).on('click', function () { + jQuery('.addView').button({icon: "ui-icon-plus"}).on('click', function () { //reset select2 jQuery("#formAddView #viewLoad").empty().append($('<option>')); //reset add view form @@ -691,7 +695,7 @@ jQuery(function () { jQuery('.shareView').button({ icons : { primary: 'ui-icon-folder-open'}}).on('click', function () { /* Get default information for a share view */ var viewId = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ).data('cvId'); jQuery("#locked_user_id option").remove(); jQuery("#unlocked_user_id option").remove(); @@ -758,7 +762,6 @@ jQuery(function () { /* Initialize tabs */ jQuery(".ui-tabs-panel").css('overflow', 'auto'); - var rotationTimer = {/literal}{$rotationTimer}{literal}; jQuery("#rotation_timer").slider({ value: rotationTimer, min: 0, @@ -774,7 +777,7 @@ jQuery(function () { /* Add event for close all form */ jQuery(document).on('click', function (e) { - /* + /* * if were are in dropdown selection or popin select all. */ if (jQuery(e.target).parents('.cntn').length === 0 && @@ -787,7 +790,7 @@ jQuery(function () { jQuery('.editView').on('click', function () { var tabActive = jQuery( - jQuery('#tabs .ui-tabs-selected.ui-state-active')[0] + jQuery('#tabs .ui-tabs-tab.ui-state-active')[0] ); jQuery('#formEditView input[name="custom_view_id"]').val(tabActive.data('cvId')); @@ -841,21 +844,21 @@ jQuery(function () { method: 'get', methodType: 'json', success: function (data) { - jQuery.each(data.tabs, function (idx, tab) { - addTab(tab, true); - }); + if (data.tabs.length > 0) { + jQuery('#tabs').tabs("destroy"); + + jQuery.each(data.tabs, function (idx, tab) { + addTab(tab, true); + }); + jQuery("#tabs").tabs({ - ajaxOptions: { async: true }, - select: function() { - jQuery('.viewBody').empty(); - }, - selected: -1 + active: getTabPos(data.current) }); + jQuery("#tabs").tabs('rotate', (rotationTimer * 1000), true); } - jQuery("#tabs").tabs('select', getTabPos(data.current)); + infoEmptyTab(); - jQuery("#tabs").tabs('rotate', (rotationTimer * 1000)); } }); diff --git a/www/include/monitoring/recurrentDowntime/formDowntime.html b/www/include/monitoring/recurrentDowntime/formDowntime.html index 7fa65818f28b6234558882dbd2ddfe2b50b27c10..6ccf0871a720bbf8a035ca9b721075d2b05b6ba5 100644 --- a/www/include/monitoring/recurrentDowntime/formDowntime.html +++ b/www/include/monitoring/recurrentDowntime/formDowntime.html @@ -16,17 +16,7 @@ jQuery(function(){ }); }; - jQuery("#tabs_periods").tabs({ - closable: true, - add: function(event, ui) { - jQuery(this).tabs('select',ui.index); - removetab(jQuery(this), ui.index); - }, - show: function(event, ui) { - //load function to close selected tabs - removetab(jQuery(this), ui.index); - } - }); + jQuery("#tabs_periods").tabs(); if ($$('input[name="dt_id"]')[0].value) { jQuery.ajax({ @@ -48,12 +38,17 @@ jQuery(function(){ function addPeriods() { periods++; - jQuery("#ul_tabs").after("<div id=\"p_"+periods+"\"></div>"); - jQuery("#p_"+periods).load('./main.php?p={/literal}{$p}{literal}&min=1&iframe=1&period=' + periods); + var ulTabs = jQuery("#ul_tabs"); + + ulTabs.after("<div id=\"p_" + periods + "\"></div>"); + jQuery("#p_" + periods).load('./main.php?p={/literal}{$p}{literal}&min=1&iframe=1&period=' + periods); var href = "#p_"+periods; var title = '{/literal}{$period}{literal} ' + periods; - jQuery("#tabs_periods").tabs( 'add' , href , title+' '); + + jQuery('<li><a href="' + href + '">' + title + '</a>').appendTo(ulTabs); + jQuery("#tabs_periods").tabs("refresh"); + jQuery("#tabs_periods").tabs("option", "active", (periods - 1)); return false; } diff --git a/www/include/options/oreon/modules/listModules.ihtml b/www/include/options/oreon/modules/listModules.ihtml index 072e0224b2c8c96defdb712dbf9b54f190cbe1c5..ef644aaadfd28c8f5fd5b91feadafa7ea610ad17 100644 --- a/www/include/options/oreon/modules/listModules.ihtml +++ b/www/include/options/oreon/modules/listModules.ihtml @@ -6,6 +6,7 @@ <script type="text/javascript" src="./include/common/javascript/jquery/jquery.ui.widget.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js"></script> +<script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.xdr-transport.js"></script> <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.postmessage-transport.js"></script> @@ -54,10 +55,9 @@ {if $elemArr[elem].RowMenu_link_delete} <a id="action{$elemArr[elem].RowMenu_name}" href="{$elemArr[elem].RowMenu_link_delete}" onclick="return confirm('{t}Do you confirm the deletion?{/t}')"><img src='./img/icons/delete.png' class='ico-16 margin_right' title='{t}Uninstall Module{/t}' alt='{t}Uninstall Module{/t}'></a> {/if} - </td> </tr> - {/section} + {/section} </table> <link rel="stylesheet" type="text/css" href="./include/common/javascript/jquery/plugins/qtip/jquery-qtip.css" /> @@ -75,7 +75,7 @@ { mydata: 1, mydata2: 2 - }, + }, success: function(data, textStatus, jqXHR) { var myResponse = jQuery.xml2json(data); @@ -88,7 +88,7 @@ }); }); } - + function displayResults(moduleList) { for (var i = 0; i < moduleList.length; i++) { module = moduleList[i];