From e6450bac448a299930a545d8785918a38f85112d Mon Sep 17 00:00:00 2001
From: Kevin Duret <duret.kevin@gmail.com>
Date: Thu, 5 Apr 2018 13:45:06 +0200
Subject: [PATCH]  enh(libs): update jquery ui libs +fix compat (#6181)

* enh(libs): update jquery ui libs + begin fix of custom views

* enh(libs): add jquery rotate lib

* fix(style): fi some styles on custom view page

* enh(libs): update jquery upload lib

* enh(lib): update jquery lib to 1.12 + fix custom views page

* fix(form): fix recurrent downtime form (timepicker)

* fix(front): fix first custom view creation

* fix(front): fix actions on custom views

* fix(lib): fix sheepIt library

* fix(liv): retrieve live function in jquery lib

* enh(refacto): refacto massive change host acceptance test

* enh(test): improve acceptance test on trap configuration
---
 .../bootstrap/MassiveChangeHostsContext.php   |    52 +-
 .../TrapsSNMPConfigurationContext.php         |     8 +-
 .../images/ui-icons_444444_256x240.png        |   Bin 0 -> 6992 bytes
 .../images/ui-icons_555555_256x240.png        |   Bin 0 -> 6988 bytes
 .../images/ui-icons_777620_256x240.png        |   Bin 0 -> 4549 bytes
 .../images/ui-icons_777777_256x240.png        |   Bin 0 -> 6999 bytes
 .../images/ui-icons_cc0000_256x240.png        |   Bin 0 -> 4549 bytes
 .../images/ui-icons_ffffff_256x240.png        |   Bin 4369 -> 6299 bytes
 .../jquery-ui/jquery-ui-centreon.css          |    22 +-
 www/Themes/Centreon-2/jquery-ui/jquery-ui.css |  1466 +-
 www/Themes/Centreon-2/style.css               |     5 +
 .../javascript/centreon/macroPasswordField.js |     6 +-
 .../jquery/jquery-ui-tabs-rotate.js           |    76 +
 .../common/javascript/jquery/jquery-ui.js     | 19373 +++++++++++++++-
 .../common/javascript/jquery/jquery.js        | 15335 ++++++------
 .../common/javascript/jquery/jquery.min.js    |     5 +-
 .../javascript/jquery/jquery.ui.widget.js     |  1022 +-
 .../plugins/colorbox/jquery.colorbox-min.js   |    10 +-
 .../fileUpload/jquery.fileupload-audio.js     |   113 +
 .../fileUpload/jquery.fileupload-image.js     |   326 +
 .../fileUpload/jquery.fileupload-process.js   |   178 +
 .../fileUpload/jquery.fileupload-ui.js        |   598 +-
 .../fileUpload/jquery.fileupload-validate.js  |   125 +
 .../fileUpload/jquery.fileupload-video.js     |   113 +
 .../plugins/fileUpload/jquery.fileupload.js   |  1132 +-
 .../fileUpload/jquery.iframe-transport.js     |    99 +-
 .../jquery/plugins/qtip/jquery-qtip.css       |     2 +-
 .../jquery/plugins/qtip/jquery-qtip.js        |    17 +-
 .../sheepit/jquery.sheepItPlugin.min.js       |   118 +-
 .../plugins/xml2json/jquery.xml2json.js       |    20 +-
 www/include/core/header/htmlHeader.php        |     1 +
 www/include/home/customViews/index.ihtml      |    57 +-
 .../recurrentDowntime/formDowntime.html       |    23 +-
 .../options/oreon/modules/listModules.ihtml   |     8 +-
 34 files changed, 31291 insertions(+), 9019 deletions(-)
 create mode 100644 www/Themes/Centreon-2/jquery-ui/images/ui-icons_444444_256x240.png
 create mode 100644 www/Themes/Centreon-2/jquery-ui/images/ui-icons_555555_256x240.png
 create mode 100644 www/Themes/Centreon-2/jquery-ui/images/ui-icons_777620_256x240.png
 create mode 100644 www/Themes/Centreon-2/jquery-ui/images/ui-icons_777777_256x240.png
 create mode 100644 www/Themes/Centreon-2/jquery-ui/images/ui-icons_cc0000_256x240.png
 create mode 100644 www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js
 create mode 100644 www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js
 create mode 100644 www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js
 create mode 100644 www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js
 create mode 100644 www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js
 create mode 100644 www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js

diff --git a/features/bootstrap/MassiveChangeHostsContext.php b/features/bootstrap/MassiveChangeHostsContext.php
index 11a3f2d42a..625e8ff39f 100644
--- a/features/bootstrap/MassiveChangeHostsContext.php
+++ b/features/bootstrap/MassiveChangeHostsContext.php
@@ -313,34 +313,32 @@ class MassiveChangeHostsContext extends CentreonContext
      */
     public function allSelectedHostsAreUpdatedWithTheSameValues()
     {
-        $this->tableau = array();
-        try {
-            $this->spin(
-                function ($context) {
-                    $this->currentPage = new HostConfigurationListingPage($this);
-                    $this->currentPage = $this->currentPage->inspect($this->updatedHost1['name']);
-                    $object = $this->currentPage->getProperties();
-                    foreach ($this->updatedHost1 as $key => $value) {
-                        if ($value != $object[$key]) {
-                            $this->tableau[] = $key . '1';
-                        }
-                    }
-                    $this->currentPage = new HostConfigurationListingPage($this);
-                    $this->currentPage = $this->currentPage->inspect($this->updatedHost2['name']);
-                    $object = $this->currentPage->getProperties();
-                    foreach ($this->updatedHost2 as $key => $value) {
-                        if ($value != $object[$key]) {
-                            $this->tableau[] = $key . '2';
+        foreach (array($this->updatedHost1, $this->updatedHost2) as $hostProperties) {
+            $this->notUpdatedProperties = array();
+
+            $this->currentPage = new HostConfigurationListingPage($this);
+            $this->currentPage = $this->currentPage->inspect($hostProperties['name']);
+
+            try {
+                $this->spin(
+                    function ($context) use ($hostProperties) {
+                        $object = $context->currentPage->getProperties();
+                        foreach ($hostProperties as $key => $value) {
+                            if ($value != $object[$key]) {
+                                $context->notUpdatedProperties[] = $key;
+                            }
                         }
-                    }
-                    return count($this->tableau) == 0;
-                },
-                "Some properties are not being updated : ",
-                5
-            );
-        } catch (\Exception $e) {
-            $this->tableau = array_unique($this->tableau);
-            throw new \Exception("Some properties are not being updated : " . implode(',', $this->tableau));
+                        return count($context->notUpdatedProperties) == 0;
+                    },
+                    'Some properties have not been updated',
+                    5
+                );
+            } catch (\Exception $e) {
+                throw new \Exception(
+                    "Some properties have not been update on host " . $hostProperties['name'] . " : " .
+                    implode(',', array_unique($this->notUpdatedProperties))
+                );
+            }
         }
     }
 }
diff --git a/features/bootstrap/TrapsSNMPConfigurationContext.php b/features/bootstrap/TrapsSNMPConfigurationContext.php
index ab8b3ab6fd..3812c6b9d3 100644
--- a/features/bootstrap/TrapsSNMPConfigurationContext.php
+++ b/features/bootstrap/TrapsSNMPConfigurationContext.php
@@ -147,15 +147,13 @@ class TrapsSNMPConfigurationContext extends CentreonContext
      */
     public function theTrapDefinitionIsSavedWithItsPropertiesEspeciallyTheContentOfRegexpField()
     {
-
-
-
         $this->tableau = array();
+
+        $this->currentPage = new SnmpTrapsConfigurationListingPage($this);
+        $this->currentPage = $this->currentPage->inspect($this->updatedProperties['name']);
         try {
             $this->spin(
                 function ($context) {
-                    $this->currentPage = new SnmpTrapsConfigurationListingPage($this);
-                    $this->currentPage = $this->currentPage->inspect($this->updatedProperties['name']);
                     $object = $this->currentPage->getProperties();
                     foreach ($this->updatedProperties as $key => $value) {
                         if ($key != 'rule' && $value != $object[$key]) {
diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_444444_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_444444_256x240.png
new file mode 100644
index 0000000000000000000000000000000000000000..19f664d970194372c3228494e34ac01d611a4d45
GIT binary patch
literal 6992
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn!oa}bI<Lrqfq{W3$=lt9!R5BivfT^}
z44efXk;M!Q3?5+Yb~4+Jfk7(Q)5S5Q;?~=_)j6r|wa4w#H+x^Zsj|0i+6l4HZ;G?*
zLf+oJ!4b6dR4MmaHIIaR*OgkKn<k&obK(_P8RV*^y3pxww+gH4Tep<Gu1uN&5ASvy
zYO~7`x#F~8bKKIU0aMt6Hil09w(F%lo9e?a{hw!9rpG;>Q(e3M{ml2Ls^8o0ul!&4
zdA8-}**|?h<k`&XVQ$uIIG*s3b-}|AObW?O6FMEmlk^|5Ivin%J`gt9Wx;hOgCGBl
z9V0BCi5YbIu}qr69)DcUNsM7L6VK&(wHv?s?dl|++b!fxK5d<tv{lOG&HX;t15-Y6
zyyOUEs9MONp1owk5#L{ll~+2s85wUMFk@^~d}>uHW5x2)$|30J68RSbP75ntTwbzF
zeWbqEXZn8K_Z!k~#s+V@S}3o0nIVn!1y`{A7Jm7_cWPp@f>&NQ_jR5yqsZ3QIEBM&
zJ<F`>i7WZjdZV_!zY%Qk-M9GWSt|qYo6FL_iJsce$|Cmd<!m*N|Dmn6t+~nPO`gxq
zv=5a%GR3{^Z>Y(EjO3=Zfl2FS+1X<o6c2yP@OgXZVK|dCpFRU`yLdy}VQz=RkU+Um
zP{EjC@u#k#=8og^`u@N)`-a<n46_Z>4(*UXFsFI0ZRt1W8)qK|-gNi!IQ5pjU~|LF
z*#YMlc%Ci4z9sj~_NDu#{=Tx@&S*Dd*KbCp7vYB|2dGugo|o7Cc9Z;p5Ub*M-+rXE
z6y7@d+{57>|AJq7$+tbZR~)|ad->@)hT#9j+Oy+ooL=WO8(F^PPGJ)8`2S@?cf-2Q
z*ejpQ_UNAO(an9cDz!V~({j77f}6y@-I9^v+f%4^W7V2@(&;?!_F7haP)?R@&U@T*
zuugHs#}7;p&+K6^k%?oFg8Ma}`@FKugD8i;n}e60uHO*%WuM6*1#f{U?|{1^DgBlW
zvraoZaJWV9@2+pyz_e6n)w4wH`Xj#%%;<`>Saqyyb))wRp+bHS#+<9=me-f}%UhUC
z@D_Dy-g$j#O=F{4{j}4{3vWaph;iP`&^ql#!s{bJKaVON*!pYNU8`?yTvZDmI4|CM
z->mDJrsIrbd{aUU%R}`%zh9cJXma6fX8Km+a^{Uw7^lo-Y2({_T<nyq)#|T>=Fiyp
zR?e1qGAZw>m_e!I^eu050~SoL<UJEI$6Len>>8%GLOFhimnGc|*|L`XW>NV}m$25@
zBX3JqvZR_c%zm}T{4}r3R-gT+BqT)FMDJ>Jp0Ub+|MD}&0LkwQ)Gj<Qcp>!W`5)~g
zU$q;tCIwLFeR_D|NaU*r3E$c8`R~}$(CxY<%I5aXjO#I8ioy*~p3Ljs{XL8Kf^~@Z
z>9C^hVg@^Bon2EXyfpcA`{ysEGgjPTN?bRk;a9<mpFH!sU8|iwt|?bq;C=e6Y0JJp
zdAbWuCo7fjDO(isW(}JeZ^-+Ms)r5hYRoPioxAHT$F_4bH{JG=s^%<tc_VhmZSQx_
zCdB0$YHTt)aWR+uwDGeQ=hWMRPNg+(JeMFVa(K#ImRGA4`s0t<i7ffJI;%-%oz{O{
zSIsY}D`r>!4E?S%Z5?k+=?1>ZUHM^Cgd41Q6Y~GH<Sz40-BhybX?!@#m!1B{uB5Pp
z8y}ofKOst(nfL0HqOzL1bu4i+(x=?!Psn1ZWJ+GOZ)d?Wtyz}@R;S(nwlt|RmciHb
z#yQIgH}vK<N&CFH>$iSyp|<K%mIHgA-(KHiAbPGWxg+_i*Y(4$48Eo(_@=W@%g$b<
z?0M6MV>a7?JAxJU@eLiEuX{a}+3O8lTFM0;UNiw^Kv1Y7(rjGvglBKKPP}K|a4=<k
z(aK*gzSZUX1NWCSrf#f0@ha{Pe?rsAq<2Mn`WtWfTFDq(UHtB$*5{8O4pjZQdM+Wh
zCioSz(>5UuvD2xV+cWsi_UVW1{(JlFopmRb68#l>^8fSdY%F~iclqJP3!SgxF55O%
z@h!MrlCUj2)!BKfFL&Vijrp@L{Wjnz-1?POb>6B^p-=PeZ`w>b!Qx;hGHttuySV=A
z@60y@CfxkAN_N4yLsv>219juK3zXK>d|{l)&~a^xmQl{;V>f%(mbxEzxS){5t60Cv
z>B}<l)kPDw9>4H{vykJ2kD?Z<oaT>=-P5IRAN$LocPwmoHHY!0y$r8(MV~D@&!)Jy
ze4<K9z$C4<6}uKL(+`Md-p(UhVmNKpp&a9v897@kuNTaI@$%92j|NHiuBPwzIaaH1
z(|85zf<G!JRb%vf*6L}7lm|XkVk-4EPx+wTX!K2y`}IMzG7l8wht(O@CPu2{vVCHD
zkapT^W{#8kDm|C(ck}ji@!sM;bYa1q-4*7+XDWI>m3X!+N#zN@np)c?xQlTQUkana
z`k>k2yC=upU9?)H(I8eMbpGA$kpC4@i&l5euUY*p<ZeyV&c+ig4rSltT+;Zj@ATp4
zNc#3(<FnD~ZysOY8{}D7&wjG*T>QPj3I0dV*19~NaD!=+nsN1>ZIPRVzJ<#lFQ0S9
zRO?%J>gnnBH_uGF=>CH1hm{A5LT1$EX_^B1z5$E>P1UgatN47LeshhW)5ezQ%oR(f
z^ja~ka!=zGneFpF;Yi)<*4JBwtg2L)5)<VnN;F-K`}y?Kms4wNm;;{aDr6_!oo91<
zs*l>Q3a__Jj*k2+PVZJVp4c<rqfGwc#6@SK8!CgRo;^A9Z256NuhPn19+~;71?BP=
z4R*v!BuXn)F@Kg>z$aDl?LO<_X9|amGy4r|wlVbEwjxz85~_?dyuziH{hIX8k?;8b
zw%k`S%o7>T9OK=7D(C4GyTpxOZVMEJ-O>%1))~BJ`TgrtH!jcWJnk6xT&?WpQ?<D8
zt^-rHemS1}s?b-iYL~8Bjl%cybDU2teNj<yqBe#tY7Ix@=I~87zx<RDH}On={%V@V
z>PR24iTsA=xtX{V8$Sm<UibWv|K`9Zz3Bm=yB_b+_-l92`_lWvcaEqfAJEI)ciw-C
z?t*iNpZUh{30njo5r{l}`_&A+x$2W@BpXc6YTfB_a=13bv0c@d@z|yO-K@8a`WGL!
znwZ?l5#6%J+j5PuZs&oLzP#hzPA?Y;J$syQbWAWoON=GfGBL`r&_4X?`oo(Sbu8CZ
zW!fNF-*wyIh*CV;zVqt}XMQXAQyC`xXoBK5CjAW=3(kA$X*^SjW!<3I(Xi_K^YhQe
zB#S!2FTcO8eY&9KHRq0F0jI2aO*XTc%zn)5s`Zq`Ch>p%XZ}Zzb97!u3H`9!-D*%I
zsKh8?zGT^J^MuO`A7Zqa6pL+^b4=`TnD|#PYUlZ+mw5)$ww&$X$^1hqH}wy%hpR_y
z)60lpUvaiIb;^nV-y5oRH@vP1JNhq)xhXQxwf1?c>e*$CLV^y5>mJ>?==aI*iQQ+5
zGyIS9&9zpz?{J#!yWp(oy`UM)Pjpv?+A`b_-K%><{zL1b%^iQeWf=D{P2hR(ZhfQc
zx98dwyw?kOlVcW#P6{tJ4QE~@w=E~p-sgi%@tKcv(yX70+&*J;y6kA>KZ*S^|E0C3
z<Tq^>{G^q8OGe>I?lIk^m!+P`i~cLI=;7TaFhAU;yXBuw{-bV&GaJMNSM9$jw%Q`C
z_p`0D$85G43DS@D?O&VmPqTBKP-Fa=+Gn#hUa96TlAO3k{oW}xj`ysyxA0nbz0&w`
zcb4LnYOA=e*Wzc-2Ys8(;xOl=*i^rXf9ub2Us|tpM(d&t`;4$X&!#S9-edZGX8xj#
zy21%x4{0Zud5X<{vOIH}r<{%IAJL5mHhtI|#bF!g<r<Ul-yl}PkoC{555HN@x~$sI
z;dt<0+%maDgS7XL_h@XcpTTk<SwTWIy1|_lwVYqv>i_9vkzfjAhNaAzYlojc^ELO;
z)O~fiNq6^;Y4+Y4e`lY)C|+E0b<yMuUHg0NRtMrEZY_6SUbH**`0<|>*CU<I8lSKE
z<Xpp>b1_vaBK*zS_@{jptgjTqERJ;@O8RRdJ%@GLjHJLt(|3P1-}v_Q!{tBy{+M{Z
zmEE~?{t3Bx4{{Xut+w6A>%wince#2ZQ$pOW_Y4;jrxxxyU~%`)Z!6th2ZZ`JpNI^Y
zH@{+9bYuRf*=^V6_KQyzi+C&=$e{Gi{o0mA94#9chu40-d5vrF=N9>AhIVI??;Jlo
zi)~g?b7UBoneE3H%eC02zrMZy=<Xe7H2-zpzwpB%qqucK!{pYf`+E2!Ug&?6YPVRo
zME&f32A%0S2U~VcnRVOsSJFX_{YzpZ=ccx@>Rs?PyVLRPL5gMR+?QT`QAhSNWu1Pg
zoAZ(RU$6Y9rekUrN3DuuF3c)<{osA2`t*$A&gdWRxhpbs_vS7+ojuJcF8Gb8*Mu+o
zQdLW1vP|!u<Nli0EiF5bp@v1Gzx}wF^-Y-vYqreVcWz5!bUUB*n+r=%_kAn4ZvT0A
z&D_d;hk_EF*;U@eC$7>zec=5wO~22fexF&N9_yXWaQWwn7CC`}snhB@4$tb<|19+Q
zbN0`<Gya}@c`|S1&I5mIyng-Fe5c=Hc`DHAz+s)u2Yz;VKax>sso+}>^x&JKf`arz
zC)K~PIfdHypUthAT`sof8t3n;d*fr=!_R6eu^Y!GI(yCgr)qa#a?J$wp9=BMdXBZa
zNC)&jl>Do8&*0M4kDE7|AKJXrwnH}Ta+K@W$?1%1=Y;8=WAqXK)$vIE;-_m4wdY?O
z9cS%3wkmqRd_eolLlWxT4Kx21x#mVIl}+*g-=ciyH1D0$rhg>URc@)+ckRzTHebEU
z>->%SxZr17D>yu|rlo)AGjS2Qd7tUQ>;r3$yt18MZ}M&Z$%~()9NrxL>1M9Xb+K#q
z{y%jyRy?Zurk>Bp8IsTVcxCsjB-t~QkEEph7f*iq>H@P9^Y2jA5X(zlE)HMWKFH~P
zRFq>E`>E~sxm>7pUh2EWr;F_JmN6dD?F^OJp%R+lDS50+wR`3F^`H41S?&dH_&@)F
z>#mf`=Y_d;{juhseR+n}7gp`xiE7`aB98PaJgVGt?EPm|2D#;@v%3WNnYn-NSoiF~
z<d3iW-S=N?+%xMP=QGAGr5E3sO=Rwgp>z%Uo^d*)n7z}`n0sYP^<-x&tLXc7pFMQA
z4xHS==ojX<eph|Nt_;B<y?=FnyH`Ivc!O<YltAPCq^ZVp9=_c(_x(rh))|4XYjpmp
z-Yb!LDDqzQiCCWElf84aj+pOWf8u@GiTCLmmvR-;xGPV5S)%kZ`+=uf<YWED)Tos=
zH_zzk);{^~P1XGLnP%Y@CzmA!s-CKxx!Xc~{r1<_5BGmGIy&``^2_hnf38f@Et$DI
za^cyj7P6IV@8$9Nzp0L0s(5qHHz}<(&39uu6z*zlURUr`+DPw+$Jv`R*>0rtO6q;E
zi+ZEscZf&s^Z~WcIg5-|sAa$9{2i)xeeuWTw?zI5*PYVa{b$Pcsb7}wWawFL_IK+g
zQwvA)y+VsuuurNDu#(+%*eNGF^mg=Ni>aCyvL0?XJgGAIPxvQ=%M6OeF%M+8H!hj|
zee;V=;(>1bFY+`53WEf^r?y$C&xn}5bG5_y+m}Dts=VeoUa@h)Z{-@122-mAR~#O7
z9*<qhcHz0ak=XkkQo+jvG8^=csO=2rn*LfvDuK&lb;&c?OV1cS7%SM`Qj2C*{&s)q
z7ZH(X`$CPsy_j{MHT=@%Lhe(Huk<{s_s{zKXkPoDsNa+S=xpWRb7FDp5BbMRC+|4!
zT~+U~lj(hz^2_J_jq}4>erPagpV@fGu$7PFWZzOT>nkE3?jJaBaX|lr4Zmx@EAIwp
z?Yv!~R-)T#5_ukOdw6n6voCW^pS{oi=iiT>d=qZ?K}BA$uC^(hXXk1bomY$V89vMk
zV}7xRqg7_|y!Jgo7Z?`(>&U5o`i#Mx`9J4@{!Q1;UWuD6W^Hp;XLX54^rB6Y>u){Z
z{v$+G>BL{-;84q)V`on9>-M-I|FR>xGHj9BoB4@z9B$UH{~#&$sNVJ4VYSnD*lk=)
zE^8#U%l_*(FP!>`<^PtW2aj!yIej|jbm_<cX)DgL-G0VkUeqAHqfxqH_GE#Z0s=qx
zcf?J)<(&CDy5l~R-sY7V4IO{)Khe8)Zmr90B^Q@B@y1K)XQu9B{WGcQFT?!g-uB4H
zfxC1XoVXp9q=nuP*tStde~$gUZvN}(|Ia^l+7cu?@y|KuJ8FyX87=<M6L3w+;>2|a
z<EWD0qyKfbKU?$cVww5xIOQ!*`<KnImPuBh=O=e!XG`PmpL+Hw(YL)69joFL?9bYq
zS-(*(|K#jv@x{^J>7vydsnctJ3b?k{dHrX-C!_O7*M`Mr!ONqcdp65-hj#ye`kYHi
z%}JGEk@?}eH`VJH^ci^FKj$#Y34z+?aST#@dl=4S{cXK}^5>OFCHGzkT}_sEoX4`x
zfICKGPxB%9&oA#xuKsyu0r&er`9*9Nvfuwj`aO5LJ9CqL^upg;g1FZROWje~CzCy)
zZ)?mqf$IL!gR}Ns-&gmWEs$YaL*X$^xz`qpdsbIjv9h_Zb$@(5)O)2>7q7H|y!pR9
zX7hAgdgZvneMKT|*8beLej+d9@}E*SFK)2jp<>#jR`#&7R&~QtiyfNEmTH>%cg}go
z8J*XDbkpg~<};c54(7&OTJqr8g}Y&gYg>JoUH0x1U2mwLdFXcDy;!3oy_eoEvio_-
z(?0agbn}W8=dZipHaV93om=Zy=DdgMHit8PxegSpIsaBxi1Edd$MxphBF~1&wEnmK
zcX=Uqj+WZY&P&%f-WL_WaWO87`TmL8w1S(bEm(6l9Ax|QGHMm0f+UlRvByOfrPcea
zx(uui@19&eYh&#By4~8(1R@?VZPr;F_F#D>Tf^<0OMDZRQ}gUvDnzdyTXBX-iT8qM
z{dN}P<ZoXLQ)8}P?n~{H7tr{&N##5L%&PxQ&vySQnVI*hb-Bm>BX4D%mFY>=<oa6%
zy7@5QP^*0Z@HN+~_fO6(NY{L6+I(+LPWZnvb?$8fW>qKHyg%wB#9ltW`W}nXk`5M!
z+Vk^PJbU+Sv*jyWn}r>h6R%p-&Hg5Q;}IXbTM$D`f%N8&+gvK9aCdcv7+;8B{2<|3
zk)41tR0T;IpI$`l`T5?MUBIk^NkD7u2M@)nQq?013a&k3*`0i6^@WY^Qf`z_Fm-4T
zT`jO;BB#IiY^V0CH!fXB+^XQT>4&b?i|!yVEkT_h`!%K{Omubrd*|l+O{+8G72a!G
z9FpSKoSyRaUW>D4oJXCnebyd^7att%R4fw_vy5Kg9<K1>(P>kI-v%5!Cef!jOI^ZP
zt`;}&t-iK<Pw7V?x9(aKk$JOBeI_;Wg_?$hbUoU>OY?2@3f6>P$;YARtkxJF=ILZR
zQRSgvV>-Kfl1RyhqxYqIT<-S=h%{{N>YZ~Wd*dk{N4-{4rnHEqsUG)rpRam4xmIAs
zO5<ZYluXwYBp(WJn#cU&*gu_?e{PKr+bgH^PdFQTD)_tV9#eyUzSV4EvseBW0F5N<
z7rFr++Jl6b6lgTeJ&wUAJ>S+%U?#(sr0|vIMT?JJuS-d<4siZ@W4Z^+0$1}=zT%#B
zlTPNQRZL-jVHKk>(R{kjvvt}LcanFtvz>IhU@7*)L|*ZUqnuL6F6X`rNv(ZXXXacC
zE&R9rjmF0NCH%Zfj2RbGCkG#3u4y*ayL|1A-`+Fo6|JFGv$%a07ih&_P2Onz)p^gc
zg-!NvC%mql`kJ-<b=I%dQT4wBbItz+SHAfkpim@M%d~?-pnBqdkJ-Yla#x;-oYpDm
zvD~He!DHo|dvof7@BgdK{j+>ujoiBK|Mz-s$<^x`$Xz~e`#E;vbq2vJQVN_qkMTT@
zxUkDPEW06oYF+*I1&4lnf4`t`iNSi!#Y8(h6I=h;re}La7>m~wOj*vW{w6fy(e9o1
zrK`QZUr?CI;`Ti;r)c8$%Wk#F4%?&?*hJC-H-7Iw(YNzrdqwV@=8xSESmk6+aVy*W
zV%RUg;NgdDsKco#ObNUB7wG*plk<GpUvPWg<=?UU9WQGuRdR2*%N{U2uh{r{e%1ch
z<{4F~E=&dL^{W@`oxc9q{a2TA`_z8>zAyjF=DWTzgX4tF|L)_<&S~uHJaPHG=lW@T
z)!pm&Pq6D+{ytoF{X%xpNAm-Zg<m}%R=@Gj)5rN9?3YVE`j%`I$yztX<zDETTasJO
zPR)6y@Gb8F=S$D`m&!Zy{o|kV-8QXj_|*^@@u*y5Nzju2f(-R*bN4@asX1@Cdixa@
z#tCm<A7#4n;^dCmy~kg%T{E3v``2OSEN$jDFK4qZsQb<G@^jXg*_Ck#_5Lgm68@^N
z>{0v^FSjsMd4{5#`}#>v3N>M!@>WN-&OB+Cvf%ES)Xu-Qj_cbSDj(QfZEyIc6&JrR
ziR)^}4$WF~-lWR`yZ+=q+jQigTt-8NP{wZl1HE<T8_pE{@m<obpR(}LOJSy~ZpS^`
zJ*S_R7n^6N7MSy8)!WHe^w;>*$0hBzx<09c<-wwm1{QJA`z}vj&i9r6u-Wq0^wuwd
zHh(v1Rr1=d5%|BzXy2;3ZNIvo>Py?d-?K_bcEXhXv$RzUuNF2;|G|H6`r<o>gI|8%
z^+o=J{hf)6@1K7Dz31NhU%a#8m?ttENWFIBVeH4t?mvUWmK2n}JpWNPZn^CLU()Zy
zZ)_I-Qg=Q7!k1GYq@ASr@_BPCkg`}ibo4_}s`-w-zr5crch(cv4s85#d!129?5^V%
z7Fw`eNxr+zw6)6Ce8t?R_Le;iHzanPUN>>xj`Rx$k2%cMf6tQW8oj@rt&&lKS(*8`
zgz+V1e%Y#)8RkAS^lBJ?w{i7P(%@rE77d!1JUe*B_4-_<CxJqrR4$nPyS}uVN7jXL
z!^&%k%d0~g;yJRgxol%SYr-LYj;~Cc7_P*pbI(*tS@r(uyoBzP`<`E7IKgBf`JY#6
z+dbKh_0<=S%CMeb+93L$S8Ut8w>R%Q@5pMH(0M4{vZb{?%jM10?!-fN_Utb>Q<5);
zF-FhYy|ugksli(jt;GLJChmLtoMCU14ucx6!OTr+Ked;)T<7-haxzg|vR=q==HEJj
z7mRJ5%oX4G8P-WHuzMqJF(vtbi`pD_%^g_{dmB7=uekC4IfJdkdQ*q}WpCBI?Ek+E
z6yC&;bG-g=yTj*~fx^G9i#@m~{KtNGMO-EKOb%lP1_sp<*NBpo#FA92<f7EXl2isG
z14A=i19M$N;}AmwD<eZIQ%h|F11kdqX~xcO6b-rgDVb@N$QleRt&Gg9OidsfKA&A6
zz`(#D39=zLKdq!Zu_%?nF(p4KRlzeiF+DXXH8G{K@MNkDXu{0X)z4*}Q$iB}0-P*&

literal 0
HcmV?d00001

diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_555555_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_555555_256x240.png
new file mode 100644
index 0000000000000000000000000000000000000000..e965f6d97c6e39e711dbba68889a7d1f3d95eb45
GIT binary patch
literal 6988
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn!oa}bI<Lrqfq{W3$=lt9A#`I;n<oPU
z180FpWHAE+g9jM9oy@jlV35l6ba4!+xb=2!eNL)->2dq=&ED5`d;a3lowzpSru?GJ
z?p3wY)=eSNPj~933acdLyROs<-84BPwq=&X5--t}E@q;y;#D*?vdo*lig7MsIJ8@^
zwe{bIzyR)p=c=YobGrDfJtQY|X>H!G_GYsu-}--NKfCv{^nLC5_czP;X}_<2KksMl
zxj8ef)1Uc#V6>UlW819Pa6I85>w<?Lm=uzGCTw&RPqKc<>TpEj^?|C%E(@+R8T|NX
z>=t49%*vq8k7d#n_W0v+PGSt3nRqVOtKIn3Z&xSr+-@0f@@ebDq^(jeZ|--v9+>h;
z?~>pmhA&Qxeb+q{J7<46{Aq=-I1`gu11}Sk^QqET79|{)N*k7RdD>r4Y;pSB(Q%1W
z>!^R#OuhQ(dx>W^?Ov9%`Z1r=GR8Ap7etrYWysqty5p;3vOH*g{;W0y!>3hMX(t4x
z#BrK@R|=LtBegZ_{>J4A?`A*SG`lom+9u!gZ#1UVb93mtxoqw`;ooYmYA)$x^D@s_
zU#?qa)uH)b>f7Oaa?8zs6c#RalQfe^k3D@)<>|re8{1!OWq4C^MR2|>=YF9Z1r>}L
z7JC>>Wa1d4`1Bcg+r=B&4s$yke)ygF$z#4<e{S~}{bsyV#&V;_F!|VDhG#Nw-mKg#
ze;|*q|J1(KElcjyF_?4D*va{oN9uY_x$o^`b<wY0@AR*IwL8t+q0rueW$#91&eToY
zU%uRSL+>}E&r;*(dHwlr63ge-yyH6Yn=#~mYK}!FW2r>-|B{>h39st&QZIM=XWY#V
zP+KnB=)=JDa=u)d;04o--BtHGwx`bAxUM&LYmT7rzbni4b)Px-)VyVeAm5(CV-f4u
z%sb9=>_IHoe)$FAh2<K5oB|F*qWc1d7w?PBbGJCKwc%I#a<A$2`Fmf~X0|v^Q`j<X
z!7j}ca>Wd$)7u*adbZVx|7S>K^@<ERdpPW0$Ja(f(cJ|hy>G*qrw6D$dN+~j#;W&4
z>-^>I3o;a@YqhWyulN4R#O(V|XS(|gIoZuy8+Nv(F>>i{Jb0~h>8EbzhU~AUyG!5n
zihOZ6*zT6SKUZXJaFao=tj5ZucdKG1y<4j9oUvf`<#So-@7R(wnKi6Ad1R~lb*FTf
zguQ;8cZOFc$lUOR>fKek39p*;GH>5r;Gq9mYQ{>7=>b`@B3W;#-k8(odvw>zjA;H%
zPv04JuHo9<ar<Qu=cx<^^Q)2h)1)o3X4XwLG|-CJUc%gN5Sl2r>@4#Fqjzz>3l1h;
zP`z>TXL!f!a3*P#Gyu*nknnqQcwy(}D+dq0<KHvCAd^wNJ7a6bw#^sU?VRGI#&Gha
zt$6wSt5OTfS4^9>_DP;@LXqk0$j8ULj!)x%{_?d!*iP0%F`A5D9|nAuv=i_CHsev`
zdl!f4(`ILL)c(91<uLtt#Jh^O5i4&*^5#gbxOef(A;#FBISab2OK%J2%r#EkKG)=%
z(2GkOcNc7*e&?*>-djllDY+9C-{zZ^ekO3PKhM%BXW5eH9<<VE)3oNi67DFszpGZm
z<8k;^mdKdUf3LfOUYrgv|Nd$9yGWf_=^d{UWRHp7U!$SUP%3rc-XG4}KGRR7ybL+L
ze;vn*V)_1+Cpp%oHEI4=*s8`RwMz5pn;*OWa_liUud!YJz!ip1EXP7>iy!)gnk-ce
zJG<|#_fe+Z470K}Oe|K|7-+?6KI6vjiE-7B!@N#$HdLSA9xs`wHRtUyf#a*Du50gR
zn3Xj_R*zrj`n3@ENt-GK%y=7iDu38pCa`g{VcK59%<Bi`c?2KIx>T6(qGw0e1=l5(
zSng)}^qVoq;O6R>Rd!*Q@7>M6q92<O`9^NjF7fZoGZHq<*gfa8w@%q(K6an4E2?*#
zs<E-zAXmTDI70mXlwS=K?(+*s>0VkVRvi3?;cip+?VYicZ7<&2vT)+Tn?ZRi7Cigg
zy8809`Eq7U?F?2tXV~S-o>m=t?1$EDu|;g#@@HTAZNO2u^((9Dyj7n<xjWvbd=5|&
zX1Ey;aZgD$cF&so{0YtuX{T40HCS;6UuSjQT65Rw%Eylv*;AMlqAssGvEi&#y7{(i
zp}ma@9Ir?@{R?S*;j16^R3W>6;YHy`0uy@AXtBy^{>a!pT}t}cUk1HnVY{n2jF}#5
z<YfQK5x7(>?&-v)x-zL_m2}oGrmdz0cLN;7lUHi_l$h@Ju9;oVyL*!9&VZGV6OZg!
zeZFpH&u@oKxdGe`KRqXT?}(F#jtyGzZqXrEmRHmAPCN)_N`2!XcC8s!)*+?yHh+ew
z!<#&A@jPKYaCTa*(ajdWkk}5fySbI3(p%(P7CKs%f6QAp<D%5lmy<X=PfM&@b@~_2
z?iXwytR}D?*yEKO_tvkfw0m6;%b}8mA+=@tL4Ox#cC1sY`?PjeaOr2xXKbJ#yIU<d
z(>CV0k*z|<&HXFSoL+NF`Re|YD;~bdnY7!gzS7;%PSpInV6Sr$_la3&-h8~3cGBxc
ze67s=5~J%YZs<?bjsKTo9PM`BHT=MJM<oW&%U%Ch3j|%CzdiTMwU_*s-)khFbPIH;
z#`rs{F3q_j7+`CZz2HVl6}$4cX#JS=Q!iXp7Ubam+;K!;&9_tf)0c<mJ(X@S%4gh`
z+xty>rq7p)Q*N;~HOX<b+zDl#SZP1;jol$-*O}WHJ}=XnJ=u8n`@XYNUVW01w6ODj
z@Xl^gV!?icLuM{t*q&KB$eMh3v!A=|tYb_1C9~uoIgE0*xsd9Vjk8%2lwvbyyzu^2
zeN+Cw^tP47ye>=zvgUV$E>8`vI+OHryW*2ITcQ`}2&+eU?q9Ew?0-e5fA5}yxj7q;
z=I&W2(#V<pvj4~x<ykggN}_#!IJ}#0**?X4;^Gq%+IRA7i4b8*U!QXM<!4E~j7jIt
zT|HYIwt0q*l6=xMaaOTIGS8PDi#^#oKV>URtlq*^CGI=4{@R`LzV!a@onunU2gGvg
zPQ1P)7VtdrvzlHz=N!$Xjx|qnOMRxF6ZYK4b6``NXkMVA!fBs{hxaUFP=2|6EmLme
z@{7r>CpNmYlsbhikqMhI#U;VWef#580lQYT{QQyKQy?&-gVizIZ$?PKo%5kzUw>Gm
z@hH=)lVQ!#`H#$aHlCQ?D8DH+X4zf&`gvE|ZlrhE9`BxGb|IZ*A=k`_C87sbDKM?N
zH{X7Kbjk_4IPd-Um*^aJ%u{;MuyD$EiHtPf4720xT_LA9D-Qj;|49DG@tYCXwyJz^
z-o};qM9GE8Aj`w|dj5fBj1PW>usEev#0e@1HY)vA-cmIG=%u?kI+?TQ7npx2y>;rx
z>Iq#FcCk#}xNMdVPsCrhL;vn4yNEGf|GB2??@>0E&5OEzojdI{%a>V2siE!fk)4a@
zK9N0J`)uR<@W=VvwN|k2bee6t;H>Dquo=uxbXSJjGTac|t9wNLL+hc<9e+Q|u<YZS
z!1LhU`bO7p&$TNWm}L@Ln4?rHZLb&GE_jv5E%xoO#ChYxJm<5w75i;CXmU9xWX|*c
z52ruwpXl`S*pAi-*E24s@hfhZ*gnNCYev1tkIRYnW;dK_;y&sK{o1^zRiDY=Xpzf`
ze{Ruh9(9<W<L6P#l}hO0?fCt#ZP8D4m0eyeb%x((<}X??eM@JW%cgl1*4YYs#MfLj
zd!w;x@q_JIZ2|9JR%ot^H?jA=nJ>gps1_Y!<@)WvrM}nxE`!xBpJft)KF$hn<NNUK
zPWryiML&<mg>kKKxTz9ZGim;^n`)IGQXj7GuoP=~f7R*5#~`goOuyS-9_rwHaJ}We
zewJF$Usn#UZ{Ll+ax@!O%RgLo=3k-^Lw{p}`AsGptplJ&7QEoO5&MH>zJ|D?Si`i#
z2Xky=^6r%!Zn?C`PV>g5?);yZTQ2Q?Df73aZ(UT0(AuZ&zZ}?qaC`qQc@dJgUHYel
z{9`xo6_IH(ed{{bH|p;4Vbbo}`_uc5?0Sc}i4za&Xz5(@-+U@EVIHTS_m`sbe`?!m
zE&r(8@1F0r^6tdwU!89ra-I`=wENcM+YVbkT&}JXQe#M4`j?MEcACUe?w(6$_piUa
zi2KZEljWA&r#=gxFJ$^*wm&iB?#&9r%)Zn(K~{yN`V?R7E(Zzgs;lPnbJrSJ`Tt0q
z_vo<A(Ze?DG8b@$%}m>va9Oy&ZdFmi&V7Ha_sl*m^L+k~(%$}Nvv3Yhi?E27r(ZNQ
z{u8=><G7%zZRS7AgoP>GYFB<<xubW<U%cnT=TlR!W{S;x%yc*9aBl{m-?ZTH8Ec-b
zaJ{3wV4KXnlUDYR?pI6|H#IxR88+i#)3qhh?Dgk&?{JyzednZoma}X2%UtEyxXn`v
zeK&?{I9~cKHswm-%Bv;T`d4=A=9N}3eGo8^;_ufr+iZCtGSjrS)${N+K3TJyOT4H1
zzJ0i^{#p4?waqnCe;#V%^SH79giHLi#`@X%#go<-PSV#f&%47m<D9$NmxhMdTfWr3
zxt>!qbE?Gr_|xx?yz%$*FY`XjD)(^mrT6}yJQU9;@?B(<OK-G1=N=>UoI&wOF~d}*
z?fi_4H#x+$UcOJ8D_k?Z{A29B&<#=QZ^FOV70Sk%F7J>zQ_{+-S@~=F4~Fv}9Opf3
zu4xUH5*NyKFl|f!^7_ZjiR=32_wE&(clxd4n+;R0X|0-X!=3STOI9JD0-vI*;JG9I
zi=M7+{59`-Y8$sqSLpUS`vrWHTMhlh7>s{E?YgziB}Z%iKTh__39~CFF#nNUu5!!5
zzHk59qx0RXz0TjLj|+bGw1UGUYg+n;WhO2nH}5k&xP5>#>Fd1H_ENv6Kh3D*RrvO(
zX7Oyn){LWP<Lm5wLJDnvPu||ZvTA$7#VfA98~L7jCK+w|-@UP<^abO>#=onCR>@?#
zDlMpDuHc{kL%^ST`A==XPvt_T(^%z}op!RzTgG@qw=-12LO(PiPV!ipYWK?T>kHZy
zn94=o{CD5!H9hB7Wr*YS`sazoQo-$Z>8bWUPve-oZ-}_q^k@IEi)VU}xhp2Pr9x)L
z>EorQ?DF05^)|nH`JP-Y@i*WO5OLfuzu@7AZO~2*H2<0SGbn8?ba#BYWZ9kDGM6si
z{8cu?Jt>f(Zz*rVnxd+!f0?hic26k&_`Ud6EN}lYvyP=r9Dmfj=R6X5|3LOnL%imZ
zo~Y-GKk9#6_L$>%rMzN!k-Fmh#}$hEZq~ZinLF3nJ5S8xHjF*tyi8rxGoHDB<1wRp
zPMr&0XXhPtiHY(2mVW)W4)>OwhYYWYbZZ5k<GyozXT{#w{c?3PrfaSfk@MNV|DeBU
z_Cju((@MGPj=VgP{k5#PBI*8XE#8yQwq6fNlzsEeiRGo+Owm^D`x62c-LlS|GdUo2
z+NZGb`{ktILZP$|5e(O6r1DO6G>y#mzp>tEr(Bo))nzZP|J01m`51gJ;L`l3Oa`-V
zeVOik{ei~aFJ3*1<UGDPzASm6R=ja-Xl_35;}A86)vfu7a|)0BT>r#z8KYC$jsup@
zl041dr(aCfU(_Ra;ckG!qZta*w0KMX3^wW&#5c~{zWiym$2Cd5;;j>Y3)iqTq*^Vw
z;_#^Rxb9N63(w_^gx>Fv3S1_T*`RksZD%;w^w%m<2}~BNOP<MIO5^{aHbE|T^4dnh
z-|vH~xVVb%uac}TIs3jz`{m6YmQNW<<(KS@KU-IL-nnk=U&(tuZ<)g@HwpY-9HTPR
zdPVrx@0#HcVhaua{^9)axl2HvF=3*lnB|%ajEXlmUP)@7#qdwMVzTWYCjA1nDxItb
z->AaNx))b&c*>p3v7Og{nM{t<gW^AlzijvG`=#ygYCK-y@#Cw+dWoWN&WJ1S^=t=B
z*Roxx6y&nhvE{E^x`5H;ui(vZr_M6wvHufpkWXJbd*xm;U9-w*nbTfqY;#F9j@x=Z
z|Kmz6mkGbqm#r#_=$<*fR(#?H`%8lA6@H7<-po&$;&8Km{fEqFkLq2&9hTy@;hCd2
zD^q0SNwxpSqj&gKHq~Exl<=4>??GzbgJVDHjYHC#bBi0IZyr8-=gipyZ#_G5I6D5s
zyXbqqUAX1%*`xW4(<6gT9FF|UFP4A*faT&g4ne`+(|KRUr!~H3*uNyf{=oByXNA)$
zC+QV0xWFW^GEy|GHCM-->v@0rqr+cs{x{w!ur|b9W&dY^?I%}kKciuzJY_2z-zU=x
zJz{r5KH4AeoO9LY*1NR(*)7}tTofsud^qRW<&(CS(+vvj?>`SU+p<<fXvuTdPnXa9
z-7|S=h4(#`|FdpKS*^X{thxKm>2?jPFTua`KRini%zw=Dq0m=<Uh0(Ah&54v^zFk1
z3<b3q1@=mQOTJ&s3L2Q0mCpTP!UJe7eZra$^;-Xr+_~k`mV9=bzCzBL<C99k#LNdy
z4`oIE&G3IZ&*sE(_SlO4Ujn8FPVV^bUu-1)YTlH;H@WUEpAwbOdf|cE$EOj^C2O8;
zYQIsphU40ox8J_rHt%3E;O{Z=`WSIsGd1SwWljT&EL)L!y-2UCfjKuCZtnP)zV%~{
zV$PR<9a)P`Jn}sIUA8xe!{X%ilYMP>&#JCWG}*}Q|3<q}_vk@i$&-ejl@H6pK255O
z6Fe`LG>z5olkU4mlhjzv+uv=IdZ&>hrSR(O+KS%FIN^I`pWp3K%$rgt{`KT^zh5hp
z_U}39T)WTi)-pq>-SGhz{Xg->J(r$yWeEe%@n3hoDGE0D+59U{o_)3CXyA|gkL_i5
z9hj9gX{JW4?C;pZM&Gwf%|5KXlg>7MZ;$W+t<`Is=C4~S#URA!;r4V*`|V?yrqejr
zteLHqlh$!#U&!pg2EL~YK3<L8d7ejad)Itbqiuc;tluS_yF3`IUcR4}kalLC-O`@b
zRkt>t`N+(4G;Z3He~QAtpPSr&x}3WtSl`C=m+HOKb@xuIHm`rnseWqRMTV1W6Q#2L
z{FK|ba=|~pcRW?oChgOIdG_SDd->&?61Wo=x34jhKhG3qV*GcNc_WXe5@W#q&D*t1
z4*soCbFXbUul1-T!bq#&avf9joree3i7<%YIa;zuS8(2wrX;1SJSJfbHf5@NOgB9I
zzyukOKnz(`mgwC3Q$B;4L)wLrV`^B%5`n$DgpvX*vLlbam&jF^+a)$hv26{bl}==<
zL$6Oo)GZM!oukv*_`F#KCmnsirKv8;%Tu+9^}l$l(41#m7S_FcQ-1U67UcjLrd3>y
zLiv+5r*ZLKQB3L7G~<1_`)N$9hj8-bStk`2HvX;5+7MmRSjBfC@nqHX?RxiwE@th&
z;qLr!<;+S?E~}9Ax{HS$OW#~!3}D>Kpkti6=Tu~S>arP1Sqn51&)Nvgn|0RKlgsMH
zqkR6diKYuQ7*2~yTXtSg>Rfqf+k{l6Wf6-~J?`s1U-fiyt-y+v!N+zenXV~FJ`~`z
zPd{O%@v&v5cQp+D7~EeWxNtIG*wdBPLieO*xVNh^cb~l?%K_?j#dGGMkL)SyGc4P@
zU2eC)OolB<;VZWntv+_WE+xG>#QE!ui5@HqT+MBR%V(^cbTW5Y#iahrr8@$Y^7Sm|
z?q2uci`ivc6A!VbbB4#4S9DBpw{%`n(k`>`sFLhz<C}|CKl+n@GcalYOF1bQrVEQs
zOC4|Q|ExQ0r%!aT^;f3;k6hj*CgL;P9)|2&<(^dj>i3Rg`<m?EPMBTMJDa8bb=I%!
zsQO=mx!V7NE8lz%P$&|s71_ZdP(5+K$Lz(ea#x;NaGxohA-U_!N0*gz?#-$TzW=Y*
z`OorwHF9}9|L=9(lB;Jnkh<({`#E;vbq2vJQVN_q&xkyqae0?>Saw7F)Vlip3l9DE
z{(eE>62okr%ZX-oCbr(QQ_uE_FdFL=b)@sEzX_f3{P)iLt8aUKzo0Oa#qE3In!<_I
znTz)sD%|EZVCCAp;>Pdto07Nga(}$F!~L=NL2etXDdKJwUl{A`9S%RtW#okqo3bu=
zc!K3XnY=^nuUMOjm*xlT$a-VG_x@LDlf6olwlmzWWhi}VW?uYv+4tRb&C9~wR2aU0
z*v@t9_m8MQYxV9v%h+`POWpPS3tyx<+8WM$-d~aPYRaS89X5X(zhvEHFZxp5`X$h2
zZ}`+bZE_(U^<I+kq4v>#kA9lozh6t%=kihWi${Z2><kjB4BzPZaJo;ps7r}Jwf%?4
zm!9u0m3QX*$MXc5)iwNTh>UntuCXL&$$vqH`n9?HpS&!LTcF;4#f5Rg+t){#ZoD|T
zV|MTHS8UfzC)oaVm^n+E`OVAOtPARXv%LJA_2qV@V?w<@OG5r%6_!6fKla-=t#&hT
zw&{ygZFTsuM##RTBind#?Fon7b59HXu5OCsXWV?Cauq-0*U&xtYL1GmT3HbMD^Kdk
zvV|o-@1INU{A+uG;iAfgGWiDSzjX<Xtv_aah{vCBI(qp$SBSK%vaD*XUVTKxuPH7Y
zFRtF^AGCji(O=fizprAvm4q6)gBXQkLTZF3F0WV1J#hZXi+I6H?jOHsuX<woWrNe7
z?o&Tj{kr)|f7<?>KYKo}+En5Y^e=1Olq03@St>gJKlp2Tin+$}Z`|~M%KzGT7k^>@
z`Dfe3-?950FJ~(VG3+>FG<%PA-7l5;Q;S5_>HV$TcU*eQ<M{f+%1qVUn(w{;#XBob
zvd-D#@WZu@DDe*~qFj<E{C@iKu;=#`3^%1LCe_^zYFp?1UBXJFy`gH&?M=%9)<0+4
z8vJ3x1aSsw=Iu9(E(w3<vAQ9VvHO_qnvB=qFDU3UC?}*m;81p}da}^DU*K~a=jB%Y
zg!=&x1BH$%CM<E%D#|J5`uc0VZ-b4O(>#`2$Nujs>0j8a!C-dP>P<;M*9UG#tPU$%
z$I$bWbzz)?Si`T^If}w9K413UNnT@o?|Y0CLnOno$NL=*U)!zxEuUxCjNOcz7}gxG
zZ*E;%Uj6O6z&a^~lr<m1`4S(_mlCZ0nlxj>{qu}fOgAOA_#N2wEbr~3cuOCvR<9fO
zc}wztSURj%;BN3_?peOZ^WQ1Whf@ztUL?@V`Es?3PuhNYma2xtOAPb=GB>PdTfzUE
zmG9{d`(>QZ1G&~oC0Hk1($o6(+tPvmLN@P(^|8A<FP*Qiy3(S<ApP<F2gM6DRacIj
z+saz;h2=m0fzp`WWr}+P85kH;OI#yLQW8s2t&)pU6H8JVj0_CTbPddP4UIz#4Xlg|
ztxPSo4GgRd45S%5yHPac=BH$)RU&IJu(UEVvobY-X!v|~fdB&ogCxj?;QX|b^2DN4
k2FH~Aq*MjZ+{E<Mpwz^a%EFVWHlWEePgg&ebxsLQ0Lh9dOaK4?

literal 0
HcmV?d00001

diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777620_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777620_256x240.png
new file mode 100644
index 0000000000000000000000000000000000000000..9785948a293a095a65e34ffb775dfc252bb11c7b
GIT binary patch
literal 4549
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn%)r2K!_(_00|O&pfKP~Pd6~i}f`>q;
zo_i+)14Cp<kY6x^q<}FCN5KB3nfgkhg$`*6Qo=@Ocol8LoIJc0<f4?-4TE)BP1+j{
zXPr2I%)(V>&yIaHtG6!gS+!!V{3gx6jPn9j-gB`rG50S@n&P!!eeV4^?#cG~^%FCG
zI>dcsU|?WO@^*J&=wOxgU|?Y2EbxddW?*0du{{{vPG;LNFz}~%x;TbZ+<F_!oqT(n
zAlpfgRWD~uirwigynN%elylEiZ?1m5YhCZHoZMYYUJ8}RzW@J!B4f?Ng7)@^QzE&K
zC+oiE5I9h4(@@T!!7V5#Xvm~8;ms~i>ud6E=N#TYQ+;sV{vgkaGlzwobOc0vm@=w+
zN~X?wpv<s_=|hOaIemM+ETJn*mW-Ua{S*DxD=0V2JExs6b26i3!rSeuA9z0J;hJ<i
zewS|XqqAE=4Y;5AE)ky*-SM5PnEQiCLIwAR$%kgWP;QvZd&b3Psj#q29nX!1e($~9
z7xYa2#3nr7@v<+#1q_aK6uzAIpzrU37T0Wtx!+snIc}C_tUILj;Vk<GPQ}Py3#LR!
z9pFfi%qTOC@rhua!r))B(o5b*BI)h+?KdXp%nbCjS>Am>L}3aGkD2TN-H01G*E+75
z&EWSqbE(EQ>$+Hi>!ZxV|34Y-IhR?nwG`fc&m;&1yPfTi+rOB_cKW?+#TOlhA4OUv
zC+_a9t+8gv4p?CFLH^;Zi75{v&s;t@HEsQY+YH{T_SZ#o+BHR3Y4>CvSj{|%qwh#t
zV3?dGV@#*?mGg&FIRp==Hyl{+_@l&MEcl?6`OM8mn=do%{S#SS;d|nCW6N15j>pq3
z|5cM(x3IhFpk3ZgXO@3o96FyAIechh(PBtkdwK4z*Sim>&X?ck>jn-RmpdU}?oYdQ
z`K*V|?u&O_Z~eLOASiUfuRPuxE12qS&R+}D<#l+;r0<ve;OfdV?;fzMIsJRj#5Eq}
zf2aMJru9HudX2c~N97NnRPxuRZmxc$s<6R4CgSXw;|<gIA2GTsJfqIw&`mX&JiZNE
zi<2C6WVX3HelwAGqa*X1m0@k3FTd1u^X~9ZXW1b3;n~cWTe@30H<%x&<TUq6W86HO
z;q@)6_=V+h4A)pa#5v0ttM&coSV|necb3tn|LB31$c6;%FN{nl6g+}%ZV;JuaN*bJ
zbrbDx-s56#oXzr{k^8~S<F@h}UO!J(0t2_+(|fy%-CJ$6vMrN$_qpz{crk77;(rJF
zAG|nU#g>-4_-oN3!?Qeo6W6}^A--=H^Nqa1%jIjXsoDCsv&YnWvn6nGEC2c;#PrSR
zx6p&SeY<@=)z~-W+8vHrpZ4}EEBo1<53FimvzR<w*4=PKi0|{V>PMRM@}lRmP2&1@
zW`ir2kT-Ya4(=N+2XD9QF1^Sp_<o+KHscoW9NRsYn`h1PNw_%kXU%@qxg6W_`Z*K-
zuyAk+-jjdU!`JP1Qdqh1h3OVf4U_*5=G*UT+wty~D=6Y(@|T4FaZ4+-KCnH;b??LY
zMgM0^V_I`sXW93uY~jp`s;yP7if&sa4sFxp7Fn+m8tf5hkaDbCGem5`XYSWR7Rm)W
zciAewIBmb~{kQkU83hI{p`MCqT@m+Lj=46Z{+ug3MQEl_!+$RCH*I~Yx#H5^;x`U3
zMbs4^cXOR^nCV4bYumevFV2^wBr}{$oV(C->(mQ|2R1pTnLJy6JH_KifAR_UpTWDG
z5`Hc*cu<~Nme6qd;#;MQ)eHDfa&W%r*8AlS^1>aRlvDmE%+A+mD-~w1xaOPsI4wB7
z?>o~x={KS4CV3z2QA@A0%j=X;5Z~^>_@bv)^Bs4)kMPmAQcqgkR4p{RG>g8SI?txK
zG}`3(?)lP%f!R9@zT`&xq;A`^HGaAI+Ide5W;)mzN-0DbIDWqs)%xndov>u-C8Dkq
z!xUQ1@GuE5FYqZ@lzqpTV}h%^*OqlACSnhw-mmMr%<7j=RPx0xfoa<5rT;m38aV|R
znZEHdIj-#E^KcUK@wn<R`9m`6bk+kR7vw_=ZP^&I7F>Mv_|unU-vbxffA2Tq*irnP
z@3!3gX(t)I8ZP~J_G!orQuxa57udDz?}NUk%S?PzUm4h5`OFZR`CpfDRgKBfFwy1Q
zQ(_;yi@n1-%_)xQ=e>Cormm0oXt?zM+g|>=EGkbLY$mC+b8;m<c=F_kE!%;GDGsmt
zIW_8|m`*tg2o}W8t^HqD{9uI?OMi#e3l=|yY8Ph#Cc8tQg+Cw7{Ta7|V}a<QW}y{_
zE?*A5pms_}!FrD0)7kHsmcCJYu*IoX;pD?+n|Q~*`GQWd9&$fQe;)efr@<)f#2_JN
zaQ#;`M@IMW9V~`BJ-r#WHoV#3QrtO%C#z>}(?#{qd-ifa@%_8=GLr@4LcNB|s|`0~
z7;k4uNvq8*oGQ=oo|C<UwI#1PwEEdI8J}hOcMpj2@l<ig*xEaAYDj7v`8FZ7TS&IX
z_SnLgyIM9oug_fickL^AP{C<fWK;9P-~XWXdftTFzdR<qEchN+IlJmgN9l&U$8LO%
znz#LV*t(Pdj%^ayulQDT&v#SFT-nLapSJaWJ#TdOfKTPb^q(TE)|*a#-g|B0=Ael$
zANOa4?@4r+x5goCmd|;$@O2N46_wgX@p3&qv-Is=+t54bKAP6@e3<cKz06YKwfjGv
zz5T*`qji$Toc8;tt~2HZsI4z<`y`#+Y_d&Yzwq-%-!1l?T{=N}lfl!+Ck-cs{ubvB
zXI@zLEqkY-MM~kOjol%;`>yu5O2-y5d06l~I{A0``FD5SFT2g$@}6h=aqk225BfiS
zRbR89=x=9FGry#?f6=So+lt<vS^n*poSBjods@MU2{Ivv;*66wKUZ2H$2x&k=D_@i
z3-cyik@vmXs{26yk?_ZG+odI5IuE8q9MIg@&?;DcLN0(eD7VJ@)$c8n>~f_e*gjj7
zF_^Mt{5`~Cv-AH&=AWBh$5+3a(I9dva=F_-=^C~8dUtEJ9=o_x?}a6oPX8PJsIj?0
zZI^d1o8WIjiDw%8lUG_8K5}((aFbB`wcT3DhiSr}pX%jl<^Mjq>dKoPeVebQe`d9M
zg!qb79lN?Usj0u;)-0dO;JDx$$I?T#nw%+<eh1!7s1*;0?rB-=z2co;*XPqsFU~Xn
z5P7XXuTHal|Ig|E(M&1-{cWEcyFSkmFjbGdsbc?;`NbCViMjU~9#0kzsjre2xw=em
zZp=E4J9@W1H%?7Z5Dyn{ZD+Xup%Gl7mo;e4n-R87X3i#?^Iwm9-;0XSbFFw^cVRiJ
z=9;I!rS8u<&#-fr{Gssp+P|hXjkAgue9>35U-RzZWc7mlt4k*T6+2tvY<&O1sV@%F
zdjj`sw%;uIbtvJ$|EEccIw_HsU1p9(8<ySs(fMu9zm*^K-*&BAzNvwgJMUJ>rVwwt
zD+gDfQ;t3E!)9GoxWVhf!Kp<(*FPNE6#Y$HXhDo_N!z8pe@uBDgg>0!etv%a@7}!g
zAr2c4Xj@NVNIuOmWpZG~VP~yXE4xB|-<mnA-;u>8IJ<Pmp{+@GT^V@wckWWz8+G@x
z*jByNwe?xg+Am%Ee*1F#sU?y{;fYRWDKnl=f4xA1dBuU?W5rC-2WtAhuYSIIDwn<~
zV^DqLvI82AO(HgQA31XSo4HxTm-XusjM-|~ehYorbT&Zb*w2DD>JL2XY=Z24HyLfv
zoTI?4aPjr#^!D>%1=qxWIBm__X3MmKwI=-3*)=h1_lFt8Pq#4izut1vyQ-!pM<5{n
z=Bx9aN1lIb&#8#8KHhNEtCYcpW8VzF^k^BDlM)|dZP~8yX#C|?mWf^YZQhH^*Vzl&
zBm!7v7bdQsxhM0>?;nqUwM%pq^UO$FeU&S024j`<oo}%ZHqM%H_3grix2x=~3x^f4
zOtD{?#?WJb_W0jt410N}i3J`qWIGVTD4ejnt(HT<<8=1_9Uqx>s#(qohDDw34(Xk8
ze)g4md(SiLO9h{<2=t!p<NGr8Y+LWUx&!YDzr4CCC?w9_wfaltX^C8e+m@1of`S*h
zgZEhf`uaVq<LAGx>!eK;?lJ7iY?YrC_`N;WJlo(-=&O5cTd!Z0b>EvU9dSr#{s;MP
zW94nzKj%b#+W#j0!m^6ROe>DD+{<FRx6QKScEV?6E?>^*ss-#Tc)Uyf<Eu{Zce%4x
zWM8+|@^$Rl{$Bhdw=|ff&8Pm!`*bd5Zt7KD&juOB5RSjcR@})sETi8O`s?-6qld2C
z-&R^aQEx-t`zN=pl@AxSvxuDis&|J)WXWmfIm<10U*{_;nEEWclVN9gD6_eNXWHqf
z1@qR0-SB0wXMd?*YR-1_o|wTKg$OB!uNQn)9@h3fpgm>f2l0l>)%}cz-LgwARIfU^
z+(Ov0(;(r)<==V=M;e?T1Zl@?eXvMSe?wmh&w-$gfA2oG=Dk)Qa(UB-Psd}oCHia@
z1(n2tg427LY96IBryZGi^95(8-HqFee>J=BsbOjeNDv5Ew$#Ge(EIA_iH@yjdTrJl
z?L2(D>Bl)%@3x}W90w*JE+3{<Teh8j`gG!}i#%+M7ITFinqBQA6Y`G9wlM6GoFNq8
zSAV5f=l_|4*{^wKG|Y5ezTsHgj<f&eHwZE^M;&lu;mKh<+{Y+lEziuhkNd;VKH2-M
zZVh*TF@l|DF8%NMiFMYO{&W3!S-hn@xJonK{6%%q)#4=|f*a?hpXi=Gja@_PeoNhd
z$MDLMh{OL?7@6Msg{?Uw!TjZ9(BAm{vu(_l6zCoCZ?!n?AHCi`#U<M=ezoXK8UH8#
zyKANU&i;Ml#TGno#r2dW?{dT5&$hoDt`XmGE4TiE!h%0pTb^wAS!e5^;CZFd%`Qa$
z@84>zSUFEVcQ1!bMxp0Fx>gq^=DzWBW2p&TX!^15(+dOb_l?|Jp1ZOw4z`$S#j&HT
zIf1XBuB@;9Z<du)`;rY${}))AJ;{IawX#@s{;d9vj*gBOyuWH3JeJK~vFlXq>(|=t
z4)ggrPL@c=hVRU-t$q67YrEKb^NBCrPOU4t{_EE%#|zJy@4aG@`swtuO?+!i?o!>$
z@mq}oA}uc8fAwYixnHamm#_BuP14Kw&02TwAo~ST2W|7#jw;h1kC@i;wSW3tGA&+z
z;_XWxU(NihFY#8;{{NrN2DgLlChpN>JjUL=rs_Rwra_*-Y5f^a|NgWzBviY6emx<4
z>c88{361-j&p9=`%@=QN`WmfsB%SfqZMU!sjSU6j0r&S^J$l4Bmc@ysYWEa{pDT4F
zBewo*UT~g0f^BP>z?EhR*(D99-Z@^i^0@Ttr9$>H^FKRMuChm2b}Y<KuFYQ@`_!PV
zEajI~5SWqrd)KAdr=XDO=-}YbI{xs|lZ(xN{vX&-!^_EF&-j#ETjLK4$1i{W<Gru6
zIS(oeH!Y|vKKbPS{a)FNOnHAK3NFJtX1CpnN^Ke+=y{yjm0#j};y=5Tv5;WKYc`e(
zuWP4%x!=YbP`iH0zh$gbZr?sVy}6<6?b$2W9|X*;%{|_*rg5eHzDHC4g&$}873DDX
z|EpK`uQRRN^RM<j6W`zUZzTj8uKj;?!{GwcE{B(Q|G2sI$oyyDa-eHgQ_gM)1_lPz
z64!{5l*E!$tK_28#FA77BLhP-T?2DnL*o!b11lp#D^p8t0|P4q18K(2ZWIl<`6-!c
zmB<<lEUk>ptV~TH8a|(0Ai%)DAPKS|I6tkVJh3R1!7(L2DOJHUH!(dmC^a#qvhZZ8
Q4QQ0c)78&qol`;+00^5nQ2+n{

literal 0
HcmV?d00001

diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777777_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_777777_256x240.png
new file mode 100644
index 0000000000000000000000000000000000000000..323c4564a74caa26eca81548d184610bcaedfb1d
GIT binary patch
literal 6999
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn!oa}bI<Lrqfq{W3$=lt9p*-cy@wE&L
z44efXk;M!Q3?5+Yb~4+JfkCRo)5S5Q;?~=_)j6r|wa4w#H*>$vnH1;jozkuKTfkR-
z)i*UWub|wiueVL{op9h@S5WAx6!nX{I7}UubajQCTI}?<TZPs2t=oosN{v&RKIFM1
zF65VH-74^AO?YN-&=$`LU29iu`EK_2uuJ8fe}!?z&(FM`Q@sBD*7G%MUl+gsdG^fA
znfLSSjMM9k_jB4cx=-Gie?#(vgx($o6PY-M6dwU2!#6%}RQ51*%t#Qvku!<oOEg2<
z{W>)c?c;Y?)Gl^9O#1ZU^bPkDObKBPiNDgD*8Y9*xc%d0^(~1x=ly0xtYs1Wy*)|L
zVCkOrk`@hyzX1)CO@llhslDA`^Xf=zLxXNYcf)}RMRSe%WQ-U$XdYP6#N=JI>)Ycd
zop&nHQ-caRUk7m&pDI0NQFMakz#4|w#H{9T@06={&1_v3@@lJZu(-;y82|G<5>1zk
z8x<v@0y^e3MlPL}-?&cG<qRj!$FJx8BvxNjjy$!@=$+M+dhQLH0kv0IUdD&s2)<#o
z&FAyxv#}Fqe43YN|K@#h)zz7|^>ePCI4m|fC+p_yB{qMIz6t&nYq;BI^=Py9!*nKT
zK79t>cJYR`!`u#sAF?iZ_<`v{K?P%m#h<E%nmdWl>)Qj<Y#VNOG0ZkhJG4XYz#kUt
z>Q`&nH_Se~c+Y!HMa}JU2hK93t#h(%Rx`aHdwJW&`_q1<y<6p9dwva@#yWNb@%+<~
zELRMSHN5Yp<QRtT)Bb&R<!v9|*|Xm7miko1Q2p_ai-YX3dv>wcm}j^g(9Pd<C0BM%
zciXMf6D$f7{(afd-LS4JHtKBH9-Y%YzPWE!Rd#253Y}kd`0T;7?wOgk4zV|aZ*+;5
zgmmVcv8Ait5B}z~Uv5EsVY%iXmjD$1K;m8s?A>^=dF~cRb~gN~Uheh0zJBiu=9Mjp
z&lI*iQ%DM$YI7@@Z{d?7ae=0b*WN#pS6Jhq*}dxghNt#D%d31>-e_H%m9t%FM~jwV
z`FxQBVKvihYk&P{bY|TtqG*!yujFKW!h)06i_UXgUYop4%3%5h9fyUgW;diZPO0C>
zU7))!Z)@M)NlkVd6~fGK_GZkLX~}%!;3+zPU6t3RJzpw0cuR_JMZP?9*5OPlLn?dY
zLg&{TTZ<;1%gVjeyR*^xl^Wa5CDB{ie0(pc=2pv!yhx2>HWqy@<mGF;+F>`#?8_Tg
zMwpA{W;<?MzMDsB^&!1SWxJ*{8%Z7TExjiFl&vo+EufO8hwGZ|-2;j~p)+=87PGJD
z*&Q#OQ6W*rSN8d{_K~l~jaX9yDD*x(yKp4()rW-d>~<bIt~7MJZi%wFeJ|ts@+nS*
z#VfjZf6o%VU?1XrdRp;zDTAG}&aNpGUYdM*_UA9DGgibfC+baas48Aj$v?l_wc4q0
zeZA5G@6%^ZTkQVlnJ%b4=8{+a)@9|5NX{Io75A=vIm8xQS-he`H=6O858JuI+zV@0
z7k=eUh<_^((d(%7E6vBh#K+Klo0UPfLhz|bj*qLH?4~beZ~VnI;kSP9$JJeqV%Lu`
z#EM=KbpHABY5LvG5xcAkt{$}V(b^Xo=*RFXq+#!`w?Z+sw)5t^f2Fjb{#S~R@0a#j
zoXeiiHl3jRH0SrOTJAjt=QOs<9SC9k#BeO6rudnUtI1MDv9tT$cpqgF7k%|=MP0${
zC%Lz;pZzDwB`0!<qoMlrc6rIfQ*+)P5jehRs$P3H!z`}}xq9Y?3-4KIc;39jIos;M
z9kCyOyA+<SDn6NV^~bZnKffm34!(71p4g+fZ&q7_ziUo?^s84<X-_jp|FVN<8FCN9
z7wN+$>ERA_whg>$)l<DMs%PEW&EETKC%4YzyUJl@Q#WVW`h3%xUR!zc<Lb$L(mr2T
z?B025kFCvyy!x%i5#sl!{F*Q!o?k#p_tHAC;^03FcU!t|?~9#mdogb7!ifiOhUBeS
zkakVLxOwB0yd^FUwrmEn3i@%MUFU2#Vy?I<;rAxZz5LAr;nDE{kJi1~nZ>yAZH}C0
z3X_5~*Xigbi<_tCc8h)CIFVC%)hr-A@zt&cE55~S7bvZ%;bEA`&~a^xmQl{;V>f%(
zmWC!PWC(0+o3MVBz~9WHtJF{2N>2IGa)UL+c5{{IC6^eJzfCNcs~E(SSKqa5k!;*3
zzAd!&8t2Qs-71RBlR^xSc<h`L9?fjd%UWWo<0yJ8Cui#XCCgiOXhcrto@yoM<{~z2
zY1fpAiTnK+PVrBQIrR1LjaQSLzM8V?DFv99E3?@PYb1+r+8_r?(s2xs0s&h78CEe}
zkecdwDNRA2A#YpG<dbS8i(WZxdGYSV>KhyWD)jK2+Sy%he6;8K3IFLX9#O{%LSwI`
z-*8rMxZbG4@GLUxb58lCRna9=l?0XvFMYMQdg3d2f9Dd@kCXGS&RI3P+`wF5Cc}w$
z_qtEKd1y8LC8Oh+fAc;?rd^d=`A_a~+uqG5FJC=BJzV5TaAC3hMGKW}4Qo!Fkz1cT
zZB5JHtG_?ao4nKQXq{pH&p+zjH;sPDSuyS76JqpO74~PnlSgd*y>0iRm)k#C{`|9o
zd`rNYhiOt;C!c~98D%esNZn<cd-IUS^kngnf{$tTe*GH^`aF0JX088IRQKy?*gi&$
z&teJD*D~xUoph1+Um2^Q@uJb8V%I8VqxI^O?z&ej0m;XOq!t&YeZG6qd!^p`iH(o<
zvb=kzEXDSnSve=xr9MH9`HCa+_kX(+uE@AlsJ%6CJ1_QN<6>BS0t)VGPljceX11+t
zT(W<D^T+!uc;{v-2sPZ?@hEJ@+BugFi+S(oRZL%Ul__<m#nGr=wZ4+otEN@Fd0v{A
zGCMc#N$FA!pUC2RlVx&OZJhnLA8p}(_V0|p$4-$NrB#1^?_k*yA;y%xK4tUEzn15+
zC!PCtRkz5^c&3h$eA2w<EMkY4o-a8Sd%AUg+Fq8}a|^Y~-FGVewL8{*>3#E^6Ku%`
z%yQ!%EWafcV88f=jt{#F`#BLqm$1*<jFtsI?^KCrN(eRP-o8d)LTK8B#K6go8^7Ex
zYut83_{B!IClN}A)D*KX316Er%_YIgef#6C3A;7gfBul}Ddd>Z#p*cSe@0lqo$sN%
zS)bQvJj(RyWXL%ZUMSf%<Ei%n?i}gmnf%AD8{ZOO=h-M;(RZ2c*Bpfq#o|fpm?Feo
z9IpQQ{JXfD$MS&o%kQtJR9YM<Wr@i>@pLZRtVrfrXFoP7O)X-Yx8c9}Pxg;x*QS^1
za_%`$rr0y5)q~*}@5-0AcyE|6*i7znI3aUh!%0OcAf>(~>|NBEyI+sZ+4hsOoZ<e0
zwLSa!R&uN?HjvF;_0p-`G(+Xh|JY+Gf(5eYSKWwT<6xk@YQ@_<OP1U;aZqB)xZ(e&
zWJ~j&<ek}a>^}qlyk%qkDlk2BGvk(>XKr&RH|$Z}x{94)_oD5sKWg`d>=55rKhgQX
zb%sfNcmA4gIPtHBas9Kbb!k1Tw|aeAyJzZlrd49wQWEWbKJXNu`Ph?Y`CKIWjM3?^
zqlNz@_DlTl75!v>(3-Qd)hzd$;3vPwlP+cQe&*+vm*q=p);%IF`dw+E{o&{z(hO-4
zy&PBXXLP&DY(Dn0QE`bcv(E<B!rS+QLjF&23GX~`{`tC}T3u0|vol;&UU!ynU_4ZP
zkS+Ic*CH#fy4`6UUuX4+KmO$Uc=MFMYK#Kzn_QO$r~IG)an6_39GksN`WcsruCGje
z!SMb>?B`ICUj1*I!zx(Mu$_D~_m9C@vlGqhIp!;gMF{N+=U#Zcdu0dr8~<mFZj8YP
z)^qKjf0<_qTepD7oA>Fj1ly9o*_{%d`FF7jgPilhxJ|4TAq~)C2h!}?u>FIkU8r7@
z4ufuc@6D<mbN0M!(_HFW8?_--{QjqO&ZYZr%KR<qTQ{pjXzf#Xb_ez!#om8QUWBaM
zp8Zp0{*x&06_w9s`qy==Z`9r8!<^l<^{4h7!SfEbM~vJf!XnnpPnc_bKq+|6v=>j$
z{qfEDUGyV!pZxvapz89xSL&PE)h&WM-e>jaGhaO7|No`u42BuguURvcL?q79Gw?J2
zzt68*Z^H@UInQ`BzWdvp<$PfMXV=2A=Z{Y=VGXN{6lv)AJJEEl22<jj7oqXB+jbtx
zuz%=YF{l57#rKaL%bJ!&q)&U=<m-Ru*UGA<-h+ya_n(I86$<}9vOcp$X3I_=j{_eM
z`NX@i^L!Dn>}8e-y)^k%Ji|1vYY9%VK4;%5{Vh4jv46#!$hoOAS<hYe6}!{%>_LiE
zY41y~zNjNxnX*nl%+2}a{I6I3<D6q^7DuIu=Uksv^7_I1ovqzlcAm)nv)C-eWcod`
zOHVDmCD&_S<5KmAx<6@>mEP4^c~4ubwjSl>D`&9d>N$QlxjW8`%|iL?vh{|!5!V(v
z_shlZ`m$yA?te4yKa4)}*;I_1+e#tvzfmyrOtycz`wn^TJLkD?Nz9Hy<%C=EGcPbR
zt-ExIzaU`qht#;FnmWDx!kg`H+TPSP727f2-+RCP*}ts@?Up|56)mb_7UG4TGR!Rk
z{fr@8ckZ#Wq}ax+SaScAn)(m9?H_FOG$Ymue_I{B-=cq=RIm$Q+O9)QQ*8d8u9=|z
zQ^5a|;=WUwz1*E<3tk;I{uR0>amnh(>9zSS%ZsxGtk*1A+I333pDD_6ZIldiN32I+
zi}6R}IdXjqpO(&iY}1~6b!|NVio+!f`zNy=I8(QC!8TPv+oyN!p9y>~vi)9UT7OEj
z)9hsb<9z9lUnAmQO8!2d`Du?-Iiu&vPdx8DV_hcx)n(YnJVzny{m$p^wf|Si=&olx
z5;kXjiSZ(VwL5;DUf<rywJyE>lh_1@uVM!CcCFBycF@Mdr|Mh1;j?vowhAU2;-@-K
zRbK1C5|YpG{-KimGtLJl^(Q_5`7JuP`ABU^<f-FlO&WHnY~*4VU&^GTb@)bKis9CO
zruTF^4(#Us_CGmhp|{x|n`H}5@Bh5PvUjC({Dw{PX+`TBUB9pho_}mw*RRj~fh9IB
zxTS(6;>7V%Q+E0O_<9?*UcM(+OX3aq14JD6%Pn~LVH;|f$HbpOX>*~w<I5$>?nujC
zx_I+f*-ZDOK!(2Mq6K@3s;>TJzT(<FVe`lDn{S2k@*gwnnA*hghfRCVBa!!yV*fP6
zYaQvydj9yM{>LScIm|!WIpsYzbGmojxAjNbchR3$d47K7aoweRB<G=|k*%i3FR6+-
zykS4N6FS4PzUinvdgN7Pu=?Kf$VF#U`!+9}5z;wt&ym<Uz0Yrd{ru3qqVti@!-Zdd
zzuvQI26yZu&1sp%mVWN@R&SquSon8bc&3Nh`MqsiuM^D0l{~~xt<jA6+1A5t7*t%g
zjL|G2we9ns`C_(5{boE&=Dd+Gk2i$vYRWp>#Qmq9R9Wm><$KZoY3R0_&qCwEFU@~s
zV=(X5mvHat4<zn>@#tA3=W)&PWl2VV>y2xxwry`K)Cyj3_0ap2NuFvy*FSMv#_06S
z;(Vl7lBfCl^ozD}E|RtjtQR^QDRk5cm3p-%Au0CJIwsqE|I^zitTB{%==Jbr|0hF+
zu$K)%%$?S9+owu7{QomyW5v;{GmKh2m`fDRPVSAdh*7`D5PU##sqy;>X1^QE8%wfh
z=kWI2sGoi*IAF%_u(LN7udWl1@%w&ESHpV6ZiU>xS>L*|<vta^_5YNXCBNfPa_bNI
z=S(MWINGkRcd%rB-{t)BtNMZST23`Q4XMu}o^?2}x1`(->gLVj`jP*@_uI!}o72u0
za|4;bWE>6M?zH^SB>f)6J7P97=OtWbh=0I;>HW{rLZjcIJT~XtTjTjZZ+iGri?RFG
z3u%Tu%dRq5={qU9FZr#gFK*JX!d~fi+)l#-XAjgfeR#a4%y{edWv>0pXQa0FC3%LJ
zJqrE(N9_G7CzhS|#-U$ZdS_JLEEnYbtt?yEv|Kgo&_BszoKxO@H=3WS_)mM2yjjE}
zy9bJkCb|jQR{fFBf2j48?_Xwjb8q&Jw&^?CvLF9XTk(zU_Av(Y4gIfo&U@WBd$K^J
zxWLc-9dVOxDQEtU?zqpSw{hW$hK|4YAL`vZ%DE_2P)X_AdZ|nMj|kmot#dqB*Py@Q
zl=7NS60u?q3t1I{HfycnJ{{2~_D%l$(b=yz|1aJtur|b9W&dY^=_glAKciuzJY_2z
z-)GYcJz{r5KH8t{oO9JC>RnoVc8l5nivpXE3s!wBD2hL)%5&%J=RX~~xw@?^FY6lr
z7<^XPe<*5?O8%_+v%0!-L)R>v68r6`vxw|3&A;Lm#Tz=de-`-AuuSy4@wp(KFx`LC
z=WBM%;F!wLagT?6<GY<qpf=;#&8!t3utwx3CWF;q#p~3c2YFwzT<jgvAInlHu;YwQ
z!M+cCT=hrNi^|_U-F*1m9{1V~sRt={ex+N^<StD=^)ILGow1kh2DglY$v=YDI9gq+
zx#|4I<{C@(FTdZvWF=e}BUp|}F5j{C@f4$VuilAB$ZVDCTdzGWrc{L6EWvKwpUPaD
zXbx#xk-k|Pn<}C{*M=*<X7c;QyJ>A=c|qVR3Eww|WPkf4cyBBWcH86|G;hb;>3dS<
z1s~bmIwQSva?R}9J6CufJiBoB+Lqm1Gub+#YPIJj$6aaJK6lUVj1K9g_g(jXUOG80
z^v!hfiWT3lyPq~Wmi(Pt>zC)glm0)|)J-)R78}}cFZN(rApHIR-5Y79(Hq78egCo8
zS^P!-kCE`w^~w9S&t1MOm&JVlT&(eqHK}u$u0^KHvX$su6_~)`a7jB|_s%u{)f>GM
zQt$dC8af~OHuct<_Q<HV=Jk2!V~uyr(W+}Zal?vL^iFz@h7#k8CHteBW*YAPy~AkT
ztGwez$M`u!vLh#bZufZ;f1zgjd%cUkdq0T06tC20uhbXk-M4M|9F1x>W|ie_nJYei
zwXN}X{QLHf+!r0y+UQHOC%;{L|6R&Ku|sbBk?DqVtZOpeeueroNd~$wEwD?^k6qEU
z`)5pF761J3BQG~3g*;gHm1WzG#f`R_40=1}-mHjJvN=|H)M1rm#u|o-H=Y&Q30MYo
zKD~(8^YgtCyMS2-lYrLR4<3rYN>z?*C^%-+ec$kwgO#YRiZV|mb4kQTu12YuAGU1K
zEQ#pU<&_QNQc~%@pUL`n%alo8EZqO}xhyTtW;*}8bMyVCRhi)nZm@=kHmSt*ONMcY
zUQtYGm8@#}a(7-#tcP&&<XI;b7dHN_%-RrM(pbfFA@OL{wC#HLxGv`Gzv1TmaNW#G
zPcEyF^ty|O9ZTO_;|pNi%CN>L+2&MaduZAW#Z?O=6VKTQyqk5_)|1QX#-sN<-zJzY
z&|p|Cs%_bMJ*jo(p-mG)nbIN_rh43edouL1`fr7R;PjqC*Q|(#M_MMf)WjXo;+I@~
ztz^-G7l&&WxwZJ+ik!OqomWM6f}Cs^kB(Vzxgsd<)TwQNkLQ8-aST#@dl+VXyI1wb
zF@@<uSM1Vz2Y998e@~qI){*yWa=4OUgV@~?|GR>_ywtYOd}t`Q;B~<QmwPcqR^>4V
zU&=14&Y0lCGB>sH{D(j%xhINFORb-9=uUeXG54fctmyOl(|tnhzTYn>2sMbsn(g4M
zXvp7uO7+&P%PXf>%$OdzaIxh96Rzc-LT$x%2iqUWmeKfenQv!b_zu5<9qX3uU-Wgk
z{KajL`%fkBZ)cjg`9<;p)`lD1e^_tHXm43yX1?(VllzRtr<wYvRb9G$DgV{w{p&mJ
zUmbq_@YavdW>>!b$Zq&J!|vV8_g#C~Iu=}G@H`QkW^uadn(U@1=0BUh{QlX*C9iYW
zx!HsHOT^N{HG49v=9#UYC9KKxEaI7gzhv2s)f-NH-g*DEwb%Cx3X&{t&l7VB8u>4{
z)h0P?lS*I{NekTg_5DWME!E;D8wIClepcALrSY@P3Yo|3mrMgL9qm7^*AUNtp`aof
zbr98val>5pfa!JC{mZ_%i>{Mm_mwaC+2*^x<B9HpGC7CXU1!hUS@5!1@BW6DQw2E>
z%>A>r>6_g?x%$=K+bw6wnABc)Ds8rxZIPbB=Rf*+v#pl?P*d{XuRd34m%97^h6#3E
zyX6B^*DqujeKbGlSoqZQVReT8pFUpiEq%G<qi>0!c-FcpF84xn0)D7o4wV#?J#vq?
zCT`c|{a<1q-M%dDJf&BD!My~rX+LDSR*Jl==Qt3b`C5Nxwea~%(|?8qGNk;jGGsQZ
zy7WHn@5WtCrJ^bR_5sVDonol|mBzRt-rlilztrEfd7?M&i!<Jcx94Qc=lFkGc}o_H
z@sYPLLW2ZyWkVme^A+Z%ZQ_^CFfaB@s*k_$UN1q;!u_k>f_+`rpRb?cWGb5Hb>Fx7
zhRKw7Kfy}mO&m-(w#;RJ;I>~nB1!X~+NGo7n*s{Ie`dPscHG0=bNXj_v3GWQfjM7R
zeVsf-e~nLlSknGqD^&$K53p)7bLwgA>pXGUetOu0=S5%EbG=-=<9BH2C#k9k#eb}+
zHK9Lqo{E2tH><l>85(J&pjmGk?)7MuFoXUl`91dTJKNVUx&Qi7{fYkt?tOLo@plY=
zEjVqSQ^o7T#4tT#>G8E6?;iglJZ)(~>C5vUYU7s6{{NNzPW;AZ;V+KU^KX1P^?}<-
ziZ7ox#{!zszyr<VkVdAWRP!Bve|g_s?yM)S9oYEg_BNxE*j>j@EWE*bCHd|))7C28
z>-pBNjXyCZBtI~_?N;?@o+G<7bMEmS?V`DV<)oglCh+v|$RwZf=(j0(A(#|rkZARR
z^$oX{jn|?ZtUaL~u6?<F3*&xo<(%N|d7{}N`hWcNcZNj*tOu4wxzBwU$XKVe0=*yr
zx$pQp(FRU?#Vh<Lm;&nO>85l|SlRfzy2)3K{ofQe2eF2eKa6v3M3o=;w>B}oSl>ac
z;p`9Nm>W^s)9d9Qu3~gj<C<T@!Cjx_^5$xH;-NZwwinzf$rscZXV2Qa_4O~Nd1YKv
zH`HJ9xc@1+q0Ui^VKUncpUBBIr!*gKJv4WbfG@|()h<41``@$tY6!f<Fz>H(!)mq_
z{J$Cbp5Cxu$oV{wYn@brdcq|=t#7{#9po?M^BSxO-Q9WVe7tRzlUT#rAI4Q2CgJ_F
zZtUI0(7*4&f5tG+Gy%ON5jO?~2GtVRh?11Vl2ohYqSVBaR0bmhLo;0ib6rE@5JLki
zBSR}wOKk%KD+2>*#?EdO4Y~O#nQ4{C8VoG0jLfV|O&}URpIsopz`!60vLQG>t)x7$
nD3!r6B|j-u!8128JvAsbF{QHbWU37V0|SGntDnm{r-UW|`Hd6-

literal 0
HcmV?d00001

diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_cc0000_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_cc0000_256x240.png
new file mode 100644
index 0000000000000000000000000000000000000000..45ac7787cd2bb4d6c3eea7e6e4a893034ddf75d8
GIT binary patch
literal 4549
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn%)r2K!_(_00|O&pfKQ0)83u+?1P_7p
zSBuUwFfc@x1o;IsND3IUa0KjcnyIf8TIi6LASG;chF8%>%*n%BK`u&J-7r|E)ug@Q
zaMp?Q$1GfB_UzbKvwG{&o>eQ>%5T#A%Q!Dk<vkZ06LbHfq$yqt*5}@z<DP7vUq3P9
zr$gLF1_lPkByV>Yh7ML)4+aJX&H|6fVg?2V5Zi;n?PRtc0|S4Gr;B4q#jUro+{w4M
z39_B^SoLzoq}ZL_!pk>aOF8#U_2%l=yVmvI%E{fe<fTw~?EC-!Co<MNENE|!I3<$%
zc(U$m4uJ!;HVx$r8r*_{f`&{g6W;9Nw7w?qcFy7bGt~#z?GN&-ICEIYNk>4$hbg1F
zr)27^2g(d<m_CF!oYS}G%M!Z6WXZ^x+dt87y@GPXymQ(KGbb}jCcNFg`hn+j9<E8Z
z<9F#6KRUZ5)PVb$?-KDD(H-Bpin%|SBvf#3n0#o~3+0Bnyk}f&mI@2Y)bZSC==a{s
zeL>IUPi(^T9WVO=T)^N+N8!tP5BmNtXmQPUnESnDp5ta|#=1jVAI`FG;8cwKwO~qw
z)B%nJ$&51N7@r8%DGdH4E4}26B$D24-+p6q&dfkho8{dHL=>j5@R-RS(2cl}bFJf=
z*$jS<GnZ;?v#yIJxIW4({Qr~To^zQMTT9{H_e_FNu-n=Gxc!S+Y^UGLR(#Q6_)(-)
za^mjp+8S$y?0^L(ALJjtnwat+^33IfQ`6QTxXs|bYJXicr(IKom3B|&fz`~DIQovX
z1%}C4GRAaDUpap`l|%4=dc%SBjz3EL#exr7na|v8wD~gA-anDW6}~5KH@2L0;&?pm
z@?SNnbql+z4%+42bY}VY#i8>_k;8{37A=OvwU_7adcFIA>U{ZqzHZ>Kak&%n<^Hr=
zm(P0W?7n!{_12#Y4}wA${L16Kv4W}I=KQrVU0#QmO!|Jg53a5}^X>u5n$y4cOkCqp
z{&(7sX<84orPqjyepLSONhN=6>gMW4stOy-V<OI;Io>dR{}H3R!ZYd&4&79f$>ZCw
zwK&O9M`oML<2Ms|H##!ESsB*m`SMFmH}4Mrbe0WbAD+#8xuv_6bA$PTN=|dHG{()d
z8D8JAieFeB$8e3+L!7gWv0C4Mj-|xmduJJK`i~xHiEK#F{=&#~Lct^G<_3{j2N!;g
zUN_PH<~=U<#@Q_I8Mz<KJZ>w$;q~)mB`|R7J-xTP*uB+8E88-8cc1GHix<=OF8+6*
z|G|s%RcvXwi@z2vGCa%UH*xKoAL9FVG2h55yj;HKnwqVDJ9|v6H(LT1xALzqLQLO`
zehWRQ+qc{2Q;mH?uHE67^=WUvva+Au`M|37HH*o^W!()&g!n!$tA3<8FE4s7+a#`k
zXEwNU33+oz?%=-Ra`1M$?$V2#g74>vYBO%}&avHdxp~$spM;Auf7a|*oy)N;ub(sV
z4+{sU;63?gJ$&7MCxw+8Uzl#;)G+z~V7~pXwjJ+&xq>1tCVxrzAGfqZ>jT?kT=zbV
zU-W;*G^RDDb(Vdf$`;P7sM=cPs_3>=;?OodZjtpGp}`)31}VqNHABP}eCB>FWT9N3
zbC<2+i_`Y&-hX>voKaxV66&d#))jG|<(O+j>d(2tQ-o#;HT>uDe$&>cnkz2tEq>zw
zQ$$_yaW~fqhnZf~wYI&x_~Lv?N;1RA#JLMSw@$racwm!bn#r^Ew^KZR^e3Ni{~5g7
zDdFc5g9qiQWeE+JFTPc}SiOM%BnRh<ZoOabATQj}Njc?z!t8u~wo+mCifg{9kJEzV
z`@S>HlYSGrZj$%W9<}s3ySz>r1@Y}3j4yg>HQ#Z!`v@O>EA^zsP1Qo9OS9<Psq<`#
zOQTJm@18GR7?{1o;7e|_PwKW!TjQ6TububAV5Wnep_D>|f#dgEQLV2I+zCsTULxu`
zF-)Q53=fk4^8%leMcH?ZIVQNudu>@~Vj}h+>ixQ|%dCD0MI~SC5}2l)UizPtr;$^D
zk?9*RljF)hJ`X1$ACIdJlRqT0PG>zJazQ?{(3XuMYr(}wk3W4$_C0Ws{r7$&jvd9%
z`EJX-pLUYbtKrgrXP<`5Ace2&et})f{yykyy3E8k^_79`mCp>3ng4YeSJjvt4HI3?
zJtg+RyVyId)12a%e%_lmVe0yLkA_SCzwPC}%cAn6!Df<5J11A-gC|dp*s>j1nBwrN
zpHrhgis_W2fM7xV+}i(j#Sd0UvGjLXy<qWUsCID{V6r>(S@`qO+@EnfI2MQ=Y8F~?
z=<?;@3u>oy6s+g?J)QlIY3Uoa2V0zK6;3{EwuyJ_n=j}T>mm1}^yi^pej1FzP7D%a
z2G@U8b7XY?-oawH)6<(_Yr~rjF2$WQc(QutHeFQzyk{@>6W_l(FEd#%F4SwdyxMR>
zhVgcml(gF1!m08M?>X5!SX=U%L#v-Xlkr)WfA@eWA5Rr`jIF%`r-r1)k#7@HyM<(H
zY>zE`xvOQf^ZLxCf7iZ}2Nj%#MK(1r{QVDFujfs;{mWy*%YyHLm9wj^bd+wmd+f&N
zsCnC;hpjvL@7N}R{fcij_k1^%%$1$&{ApY7*Yiea5BOA0O#dmuYQ5>?=e^e^ZVsCG
z@^ODw_?|?Ed21ZPX8D{~3t#u(SW&5M6ff7)GfUs@wGF*<?xSff&xaW=*2^pvUc3L(
z+1oG7H(DoY%xS-W>N;ayfZF=vwolU8%_iFf_6t9M^xb0L*`*VtHyJ#Ae9~}I=x=fE
zaOQ<&-?DcaTBH<i+SnbkyYFg`t8{E3lZOS*qmzG^pMQ7P{j%H4E$?}@ANM{W|DgZV
zSM@auivD)?H1kVJ`xm|Xy{+i&ndRSp$(bohv8NSmm>?5!D9$)}^K+#Ia;y_rWe&`L
zxG-<R6?xyAt-25N9|?a9w_RG|rSo7)!~xBX4XuLJC*%TngK}%UU;W-P$u3tqg6*?K
z8G|WX#@|CMHaq`cWd6D7b$s=!84V(*BA2`Ulde&VuXndr>#>VF^<G$V>GZ$hj~bgB
z)OLCIvI+hclz67WKY68v;UiZk2R8||U)!yfe3&Nu`Kex>R{rm!tFFA+(YN_(`e#<F
zM~JUT)v>EvlbZVbZO!tj42}!FaV$M#tI3%%>387Wgj(@{=$@9<-Yeeub$veF^x{18
z50TgU^XfF)_y3&kAI+5V-{1DRvFr030aNwJn=1AnnO|%%pO|}};qhegkoqcVk*mw}
z=Ekh!xTAOLbK}$m1@UkJ*LH^c9~!|WdRc?!ycuEZWaezLIsf&z_r0hHJ=co&br+Vi
zYOZ<uTk8I-^9(y@$sY=jul;LU(>SYm!54i+`!(+lPF63-zq(}dU$L_#&c^pIociJ*
zy(e(LX8X;OUxyM7{C}FHsFM<D*=6Qvv|-u3AD!R!{9E}!|83X0<(nE<x$|z7YzpzV
zyK->#Ipx^nK5W)ig&Vvs9GqIzbN$1iP0`=Pg%-r<mb6{k`^S{mLHNVj?dRv$|L)B@
zAL6j_fVTA%hUC*6Qzi#y9Cp@PwX!SZ_pO<;`W;zpg0o9^9NL<6*Oh@+f9Echy-{~B
zi*40QU0a{^to_op@3$|<pIRbW6rSj0mNMh{^w$eCm{%MKK32>WeW0fA`|9Vbr*i3=
zG6vN*E<2#{*d$^@_mLyFznPmgd|AIP!I-Uv?YGc}O=kl{j{PinqyE67&L+s-cazZu
z%{dC(3Kw5*PH#USR&Y)1htt-)ZMIA+SZl&hom~^Nc7K>b{B#RL|LZL$y{l?!as&e6
zZ@xO;dF1)0_MD0c>*Ebqy-FEuIQGr(OOKXeIVtfW)|TxGkH%kaWtrHO-{!rze4V|Z
zO(K9*c46ZBnR_z7{QmLySGz<<G0%*&)mOQ~W-wMs-}x5%VB@SASKlsNc)QB(x^P$#
z%M|;SX$(E~XOI7V#;})nnpof=L$(7UjKT@K+iE!!JWgl--|>-Ir<&!gU|7`Y?vUOo
z=VxE3xA#1=zEtq(ia_tlKE5wg&$jixt2^+n@XM>Kf<of#U8}!To|ecpxNRvZC@6T5
zJ9v-vudm;;I)489x=z|u;U2@D%vSkXf#2I>&9e>eguc4Bw)Of|S@*r!(h-M*=6{gy
zHdfxY{c}#_r~Pl@FD$EA%(UVd%e^e7d)q8KZYO+J=JMr?u3Espg2%hmKfdbpewRCI
zMfP=TEnml;?eE1ea!Z3r+I;Gtyiez1=B8fd^=yz~4B_~DY{i|N!!r6kp}$@~J$mTM
z{cWY?6ZJOKy?=7sTKRBMJB!HKuX=Y_M3$Upp0nJ7_jSIqf~n84I~jI{hccTRc&43x
zS}<>2*bQF>d-j+5rRHo$?}-__QHYRo_<F%-<za2#1KLwoeh_cCT;0!j*e$!{LiMVn
z%PoX0I}H*(T>h=6aHPTcL6COL)(49O^*8jD@Ei!*`1kH}Yu;=1A(uCO_;fsWTcXcq
zQBX-NC^)@`spe5CbJ~%KH(zje+TFOl_*b+0o*JfxfCPbnWlJrb4ZW|<p6J+mrq^b@
z(ayuSn|_>Q^=>O_&2eDz;qqZxwPoAcr%xxoy2!)EXfapVq1n|=G9mAnYzxC4$r(Zc
ze)U&+b^f0znEje(M#D_k<r|K*?Kt~ieuE$*bJPJh7M>i&!+ne**7D43`?x>+?32CE
z>eg`g7bDnd=F<P3pIB#o=|9(xm&IGkgR3;t&0ka(T`gYnA-Hi~`ibu8)7Ukn?zhza
zcMPvAi8%aUg^}s4U)Y*663kyt2JMaCKikG^NrB!G|5l6R{?Y6GQ(Us`;#Z5#l<|M!
zzq?kt@9f_<UTnehR$Nb6@-8>*{cQWo;TrJ`w{q(rC@lDswdKi%pLMn#3Z7RQ-Rwg2
z|NgDkik0)^bN6z{WE6V-qic0xV(uG1H<p^fg{B|-KD{u|e&5Kw<+&@{;$VxJRvbIZ
zniKd6>dN}s|7KY^wJ+K5^nZb+*^~SyUn`4M=g;cz=;-Kp!TYPm!DHF%6}wKwzJ9IU
z?l7O9<7A0+Z1~RX+S;cNzP5|4H=p>@?bN!W>%V@Ta=h@I`Q9rgsh>_i+r+oV<Sx~{
z9KY2lAkyOU{a0VMpZmpHartVW-z2?^->h}_4zgbmb<j3%?Wi*S@rY?XU;C%eCDY>d
zC*HpF@zu<~`Vwyi?f?JTY;Zf+ZsHzI#$)W=YpUL}W*X!PoYtS=^zTngLqfI7=hqX$
zr~bRGoY1(h`J7Y3+kElXrmxXDN75Nz-F6GR(AZEQ9&mr()uTt8V_BS7s&-FN__<O?
zGGgn`<^|{3BiOd430!HGkX_Pn>Yd|NE00URUMgfSGyk(A<tlrWWyiw&<l6kju}=-!
z%2Iw=1%Vl<zjs}VeF_Shjt&m~tm6+aJ-OKY=l_8XHN2b*_KZ)twKe{*aQyP;Ki>OF
zoAaQuaMOay;*(GA-|v;Z$dva-qTn*TV|LrEsMMzMfu6^SUHK)xC;qcb84C$!yk=v$
z@Va*Dm-}t30k!L={9DF4<@W8<)0-R0-k!a3{XxLo+T7y}YZ_PD?|U@$U-)shUr`QI
z|G#>5|2osUJ^yOoGx7ah|5iev;oARKHykc7?Q(c|_m7)PkIaAeEeE=0HRbG<U|?WS
zEpd$~Nl7e8wMs5ZO)N=eFfuSS(={;HH8c(}G_W!<v@*5SHZZU<Fpy^K>_*X$o1c=I
zR*9^^z|zXd%*xaRqT%z|1p*8V43Z!lg7ec#$`gxH85~pclTsBta}(23gHjVyDhp4h
R+JHuBJYD@<);T3K0RXf(BMATi

literal 0
HcmV?d00001

diff --git a/www/Themes/Centreon-2/jquery-ui/images/ui-icons_ffffff_256x240.png b/www/Themes/Centreon-2/jquery-ui/images/ui-icons_ffffff_256x240.png
index 42f8f992c727ddaa617da224a522e463df690387..fe41d2d0fdd40f87538d2312fa537a799994e55b 100644
GIT binary patch
literal 6299
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn!oa}bI<Lrqfq{W3$=lt9;eUJonf(k5
z44efXk;M!Q3?5+Yb~4+JfkAwSr;B4q#jUrou^p<%OaE2v-If*>xBNI$t98z%)sa1q
z78n@sV%{j%^iGXK^ELb3*Z?`6#@*8-)EOVIk@t1bZamSQD7!%+d&$kC4-#Y!c`2&Z
zc^FAwYf*5!CE9f3*a>_7nTit(y5iLmx+k~)TfNGzbk(lk_jcNc#v2#Ee;Zu->UmA*
z-Pq-;tQ1{ZdW0{Zb2w5W$SGi<#8~ph;f1fY@bOL$22tBL%s2QunI5Yh_;TByKlgpM
z@#po2+!~!ee>rX8_JU=CwSyKv=elpn{r;7&Y_lc8Z?y{Eo~mH{-_eiJ^E1;|K`q8(
z7a7-;T?ja$dn>WHq?234qk!Q71E-K<@pPkeGLtqLin!|BYUE|PvdZ0cnR=$^{*2UZ
zUt%+ZkMH@NRW`M-FW@Uf5&H}7mAt$3<s)BB;!M@Oduv$<XOL<6>-01p&&SqkJ4HQn
zH+Zeey<M0+;r6mQ<vaP;nC$*FbEi`=(}@Ku!+rUGujN#WZ{j+8S^u$wVII>N>#7^^
zDxY_OJp0Ha;Xwxrhs;EVMr9#|0v9HhK97b2V3`^Q<9Ay=*PqESl0T5|)^J+#vhZ`}
z6Pi2DUQV@ZxGg*HY3)LfOF4E8^VxmYIqhx?)4g9?y8F!gOZ)O`Zf(^+lhg34rh(_%
z#ScnTp5$*n9lNpi8MDXE$-(8vr#tR^_o!HL!Fl!v`(9goc*Xj|;N7>E#_|qX^>vk-
zFSpOx%sXp|iFn3io=Gz6HrvTNC{17eU(-wO?m?zy@s_dAnSHGPAMbg=$0t*$pn>dU
zB}OK96$h|?)R)g~oXPB4IA#Cuh|I@-=D!iERhnvWR%U`R``cK@cQb-DcGht!IDGl~
z`whQ?u8QwPGv4rj#+TI>iJ4p8I`&Pw(SHS7p??Nr%u#<Eu7v*i6(JM+1w9JB{dl4;
znDQ%qvk6z{Znh^vr&yHSa}HeX*!pMnbcXwnZl}H8p{*(D%<jKP{Zgsu+eyq?$?9uD
zeCK*E&4~MEGeKc`Y53B~vm0lfX33}$_K;h9T=Z1?+_$%O%r6w?e><tM=F7IVj4L^R
zy(qix=zH&p;f7a_YMeeA?c^>oj=1*lRnp&G8R6VTOWzd>-xSO1+Wj<&&!@cLg+Jrx
zxpm#gPguw+6daj&033TrK>>~07v0X?XM>irf3JHmxy7INM}^Dnqs41`zxgf|)M66h
zUR<-SIzOE8v9opTx;ekEHf*_?^R)N1Y2VzRn%#%v+TvbIDJV~8_;GaMCm}!i{<3~c
zb33jZB|md{6VLCD=e=?1h2-h%>fWSq)q<}Mcc(48F81P;^Fh1YD|b&zxGmQ4>+F)k
z=LeP@-`l#|`gxu7rO$TTcV!AYzl(~9lWdQk?=dUwW@1ipg!)$lU(N^djGoOq>MSR$
zzMx+F{Z?J|uXQ){n0CB&Fk3L2!KhJ(CF7e&K&XRsf9RqY54KMJrn&S!Tj;*q_nbXe
zu77sv5!bo*3JOc(k34zL7&B}2Ug;%Y&!*`~pJSh(<*>hTVwZlppVp!!&bqUzZ;7Wf
znKLdGl97=1kTJRTfc@ki_NUqTe~LPnO=qx=H?`c}F=2gEY|`&g{dm6p*#+M<b0^LF
zroXlDKJ$i-&x|2o=H&ZCS%7kkg@}v=dVnX~nX&n}R<T_J_oV%&mcQ8B_wSwO;_7!o
z#}mHyOx<fI@6hzb@Vlg{j!oHWIc}e~FLv$lij$jXF@66o-kfgz%=tpA8Wl{V-`%Zy
z-Q4@?(uuPC|KDUY*i`!GYL_MPE}yrx(t7F9#ZOef>c8CBu%CT{uhoRVp;wnKJiDZI
z&C?yreQ$m@Q26od*Ce*|oh3WJ+|{0)F7)g-(<-f;Uu=1wg(jJFM0@<5=CE5lfBStW
zC!@uy+do{_c`I0OW<?dl)xaBS+3U<Xcg$TIyS}gUQu7DfmVYN(CH%FY1zo7_mo(g8
z$7!Kqe6;jIB>Q~d?~e)<&ar>^_-*(0_6dP!SsyG9IT0Ek+wx|2w}|58wjfiN+nlDt
zjPH3>vf1A~*4cWOrSI^~SLWFp-}Wv$@2kSV?wEdThh4|J1X<(Drt;#TV3gtFLo1IA
zt64nKPe*TiVZiy|`RQpfW=~YNwt5s+==eXne2+ab?LyA(iurGs2(KwQabA&Y(vqYd
z+oG?9M=UUJC~x#*sGJfd_f{{ew99!KQwZObPubr$t*c+kQ<%{iUz5Fk<*r-5f9%bw
zI~XYFaR1%jzEkpfw~cHaC(ZuPY^J+2`~0qd{2P?k%+(Ege))R3$c(5z+xj{9js|SF
z|Ei4hXpHpipJ#Vkr0GBUr8{@6_nCrc-vlp3pKETiQq^(1>!bE2Sn`jW%MJCZGg&tI
zo_tXJ;+CDG`j4i)O#8T3iMy=`O}n3P<nJ}^``5j0JdtEwQ6?W~(eyL+=hr_!_LwO#
zF>JSQxPR*FuK0U<oqJWz=E*%3*tPA*>lnuGd`^vr{<jMLT65#o?;VNzyI-*Vf2-Vd
zXw6yn8B=~L>&!4^a*;7kJ1;I!xCW_o*AZg;wN!n9z2IN<jZ@^$-rH_<`2>f-8SOmr
z!`EiTl~w$TRk(8@joZXDNxu5&cU!Zv{ld0>kHRZN+$|0*{vqn!xX<`|_Rf;CliFh6
zb#dCH%M@`PyTi9=waEfTUQbuiZC3Uw5qw(q+qdq>;)ts*>shh>r2DKb{%XH^pH%Vf
zyt7vF<8_{&LTiOD3h4@7w9@4?J+M5mJ;eE+km-?a<&vibSSP<{WOx^$R($8!^g@1z
zuG>#{TJK0meJrk{+;#ft_QkW_sO?kSvfnmE+B@Y2d!oO0B7d|OKSPdWk@>ywqUldB
z^wi6rt`KmL|K7Wy%C1q@?a}PndiwLHZ*2R1`u);nO$^^Z`<F_!&3anRP}ibdxb1w<
zzskc>j}|+<(XQaX-SlVDGp~J10t^q|=3?FUVVk1rif-edqHXd=^-sN@pYZvEf?Xra
z@|Ku5k(6cblcs;xU*IR9dzK?^#((|~=U=^i6;<{k;DfTv)k7~LPjGBd%GkVB`oL9Y
zhWx1_3NeSGeL9+$N<XK2^q#MJR~LKcCEGvgdX5M38xJ0<m)6ic@;pKN{mL)*UReap
z_}{-_P4I#5b<>RN_cAf=Tzu-*IseF+tJyU)7`lH>T+a8}_g>}W%SVLj=G9xD_K-ia
z`^JG<2I&fM{)hj0c3N_;d}|b3?*5+Zqvappw=rq|^dC4f{AXY|%6jL&;fB1r%?-;7
zxR!6|3BKm{iP5HkouNSY&9cLP9QgAe3h6!6Jza9nj?dtT0K4w{&(l9f|J)dJI-Wn>
z;RmbPhDKq9IfBcl<VE(>`~BRU$f>u(sixa<`ow>1c5Uw&81x?asb&0kiPnF#$@m<9
z>x6Z33)-0#@_)1YeEn`}>E3wX!0xQpsi>1|o2-@g&aaU8&iH4^pIUk8Lp_W1Wd8&n
z7x>e1bN-X3r{A6T`n<S?$49n5@SXdN>83wVUpp@PJNZm6ryZLZzvtEEy5hCZ1SeE?
z6x+Tqt>t0sU9<E%=fY_duE*Q3@Lk!w`7z%+<{z?8zgJI_UU{;KVNQ6|uOC~}XPmn-
z#dOd5t#wC!G8{~vSi>l&D*$fmL0b$FI(wSJXSrVBoY3?jYDO;m)V`i|{bIERa$j|y
ze%$&lUs|evue0;M+!H$;)vreHGh?)5__K6z9h=0Kb=xoh;M&)8xi3Ju$3UxIvviVB
z;QU`MQ?9WImSt+nyX|m$ZIaUNnD>NP@OH`J38&}fe15U{;dT*!Gr@~u)&fB?Uw^!7
zoTGEbYVGA;El*r$<OCd_!m~nRg7?{nv+h{A+-})ZqPh6Do}l1e(d_LKK2jGgnH>EW
z%<o@#^{Vh!sov(oB7uwZpVo)36}_@Nhso>yBKc_|F>Go~f2|we3BI`BG2h5>%RKLE
ztd=f6Gouz=7OM>Wt1M-@?jY0cH8s1%s%QJwd$=fjt)A#|RW`;#^ZSOYS&PL=*D<`e
ztYP~7!?3Pl{$ty2{|)`NF^8nXrss+O5v~)zf0%7wyZQ(HYXLVSezj>_Kdw{yXVWwF
zH3o-#8BYAa{`!5u@1xE0a|^FM=3%JeJm6JV>GP5Cl-z?h!&&#1OZQeYY;E5Bl_9+I
zg?`5i(QU0?I&WOFUnln<pYuyBQ*HOO8DHc}zc94QEV^@#xo69rnbR8@C%xurc6<7J
zmD+Eu;O6HqVr)x|JL~*fs=oF&Gt6Ijf64iaKmV-n{P{Jq(2Qw`%aov5@%p|$%R64&
z{(1lY)hDh$bFP2z`nSXR-0}76_TDVqr^x729;<a_!kes1=Vo(V@sHi+;_P&CA)~O9
zn#0}r>qq{ieN18c@M-gx*s2+2FB5-N|JtG$zxHWf?wU`h{%nxj)fpU^H~HS#d=}rI
z9bMV~^P-s!6b8)ey<%*W|6pI}zSIzd?;;bXxjyGiQcq|*F0=EsQv2aQc6#5Nm^78E
zyX?;7|JnA^xvER?K&aH!$G_Cxo2{smKXt#^Yx1<z&$C5ttn!S#yerjGFz|fh9KBBy
zFaKG0{6H7eO4V=0PrpCU+PKzs!g}ip+4sL#dtP)fE~tKUyhV`V!L&-NbL<>47sWw6
z7-*{Ika;MmP%O<aadJV8S=ANi{#^5;mb+Jnac+nUJ5ZHfYqC|#!|}$+{qGN$t$rA_
zZ$-&=x5oR&_4FPa*|qvVZ2wWBn-*pr{yF~Uyrr-9J)iwUhr|B?r+{7e*{GVz-(87s
z57xbyu-l0zJ5xg0;n~enrCUoCd0$S@TF!3%K#@0Xg0ai*<SEay=gNkh+~B-GHe0Xj
z;e_Hh0oPZ4`XOO0w#)gj4g1V_jFb1(%B=qov}9VM!A~Di>#Z+N9+UdL)12Ms=M{<9
zN6Sqe%)ItEyR?TX`%Pvz8X-2{E%Do{&Fdb{vba{+Waq@G`bE&{pj3*7!Xn3)m!B7@
z3p;#mpP@b7DBolMn#Wd*3(hWDA*^tDS8U(OA{Gnh)jtmkB+LkZ%xC@hxGO_ZSmW&-
zMSn_Nk9`fW?wVs<uk}jZ>r`^D=ie&1?CJ7BOLM+Yc=UiX!GHcK$?!dFTD5bWndT;Q
zGPE+(%-`fUdrRamZAqp#PePCT|12_$;k)Q_O8CUn;K@<-rjIobADB=-yW`rY<`-6r
z69abT?EKQ{SFUux`RC2{Q~%T6Ec!1cbkWkAKVkiTJHfdNjkkEEXH4!`m-_tbch;H)
z5%Z5f|A=|sE0p)!xn=f_=u=BK#Jx+NwDzL;N8dk%KmY#zVe30h%XnUc_E*EgHIKbd
zt)KqUSn=zcX=gsIXZRt&@WDH+S@KYq+4)m72ahV>syuX_XQy5K3$=YYXKtO^_TjwR
z>34>=e+tX7e~4#j_#cuL{yKp_)5H1J(wloYb)w|wA2UCFZT`b`g4^eB|9xdu{pK9&
z=QpmDzt9T2$5$><`R(U~r*7xxWF&99fBc2v<NbH)P4=@(1kE?goNU&avAK>jVEsn3
z&*%RIABfd@cC6^Calw)e&bPOm^;_;FXT4a!ol&T6X8QFk#kQ?{H5o^2!mVfBWftH)
zeb|ZNewc+W(+T%gTYl|MsXDv)+QVS0=zp8%J)IDwm8U*A>dyJg=_}N)2nkO4%@ezA
zial$}|FgL-Ua=Tz8i_2;db!2Ot$agQ`v;*0@sIXvN?JtkoVlMi;Zgm^>|3*WW4?Pd
z?3?*i<(chv2Nj109OuOa7AiuzynK@xoL|>H6fa!8XW<^zyiO@Y{|j;=dBTDhbDuFj
z>)zTvLErCbqP|?R-4*%sQ;yXh<0uQPuF@%(7`VgTrTW^Fx>uG8%>4q#>)&X8xj(xq
zPtBp>cF2!8XY3xBPGeYa$n~^w!7YQ9tAAuX@0?y8qZm`PXm8PujQ**=pVs&Fy?Sjt
ztMRMdfwpBV42`inBF*df&JVbL?Gsx`tAyai%UfLhqfLKI&2!|O5c{8d{pNe@FIcCq
zN}Qc@`cTN{_ePT(f1Zq2i#g_)_rpY;Nxk0c|F<m*68$}r8#xUWgjX^C;XF`&Z`ZQw
z9`|(}>Bjr@8G|-`Hw@|9aQ*LB(KjqFgfGgyy(stdhv>5>2HFSy+?&F%Zm~ho-9IyL
z=02O>Dwoih&$Rm6e670Yr+DJiIX{%TEnLmMK{kv3$np9AY#U}b6;~9vt``5K8TLzL
z@r6*!vXxhUl`{87wZHf!GNE<mu8YU~8*Hx~$P%@QpKO<J`q;rEV3GUndygynS(O|1
zTmSIn`S|?j_w^5X|GeIE++cajw)af40+0M;XjHCZW`=d;q5W4ErWq0qQQpr5v=}>X
znmMv3#;k9dA(qGS-i*D0u`JsAx$rR!*^BE8q?T7P`*;fKZ_SdpkoS&5>cYAOj4d^l
zllAUjGuc{rolmCuEOY-2SKb?2&s;qiKL2cs5aX4KuUT?a3fX>gRYx|@W!Uz^j%C7<
zO^cW7#ZFL6j8^=aDXYhnqPC{)b&!D9<DDiqI1>8bt2qP<-(LEMji<QsgLz|l0ptCQ
zLff6q+&da_=H6jVJ!2DiE>58Qkgmy%2VM0x5i0o(y-&Mq_#ap??O_j?>)2vl;h7UZ
zW%K?YbM#mE>utM}{{83MCB>aDcufostV>9Wv}y-6+zV9<&;~f#JsE=HbmRmXw3wFs
z3|pCAcx}`5I<u0Jvr4@)yhT_%3M2CPK6CIzD(637+Sevt_~N4zXK_X1ZHdM^c4?I@
zyp_Fg1un)5cD!&s_3h}^Ub*Fu;tpM1vFCO9|A?m_H^{UGcD@tj_@cziQPQ82zx>|9
z;whG?!K;Jnmfu=hWBv8=&-ptqzs;Ov7Nh?}<<#_3`<GthTX>*vGDE{>hI=dwdsrAM
zgrzOwZ=Wh*p1q?}yMkqUL5KE^dn;D|Typ89%8Gu6dYk{=2lV$_&HZ01^yk?pdG-yH
zPKS$S@2Q(~qJ~kEuQ0yy;ziq>1lQY~+a0=`?;K=(^MEV*<dpXz@%PvM+rIVw|HL;_
ztusOX2;bm+b<s<~kF$5A?ECPhR&?9+Q#YQSe(_#x{dx0QTWsW}E&jlk_WtmWe)Eqy
zW(W39Ts(`nfHC3DqO8~P8%(!!cb}5o)0h3T`GNEfv3N0gu17Tu2Lx*wkw?J-1rL0+
zYgqS5y>Rc8_~Vn0>&-9uxlA{|J7)RoT87xC>vEr|=|Y5RQ{=@vok5C=uDea1Jk5Vs
z&E;w37Mr{eJl*8%F-36C=`-e{%l@?5<TZ)&{M_7CXOKSs>6Pdwp4~sD-~18tGv;ad
z=leGQZhK4-*!E*m%vsj_sck3NnpRz0u;iQf^kPZPC!7t>8TYK4D>=Vz{*S!BSslwh
z3V+}}v*KWW(3UGt>zNpSWM}^sO*j9@cWje~uWG|Ty;oIiF+~qp_wYTa+@lt@VQtf$
zU&3Lt*E8PvmC97Ie*O}h`+ol{?ggH)7h{_9W}VZ)_EZ0#DWvx+ILG$gb8}u)v#rx#
zt}r%llf7t4|KoXS|28Jvncg7S5S>xa`QqNu+n>X)Us%UI{mbvK3hU%fP5bwF$MTu=
zJhl#H!auaMtEc`{J2{`dK-m0q{;EHvs$z!e@!?DKEL|)kcFwC`HMcf&@{T9Dua|4c
zZ=JS(@yz-DTQ!?1cxHb~ezD}~+~bU5^$KaXm;)zID_3K9;kheLYrmiWwWhME@k^qY
z{t+|oFwFe9<g|Hi<!NO<4o;bi(h?YhFA4=K&Mnw=Iq>+J)5=i}-`Vu0-|xF|A@-@D
zar-aT1+!oF&5_!*_0E#bZ5+I6j4^CBhbC&oADeiI|H?z71y-tE%v-;Fb&p68N{|%b
z-O-a8Sl5y|QGuoMkjuM;8<f^r%Nf6#-tbf`>dTEyZFz66yDsQxyKrB8foE1?daT?<
zCXj<3IRt=*A>m~gcv#hNKg)}wj0+1L)E&MTnmNh0{5$gb?qRzy^?6<l7dSV}`tK{f
z?%Ld${}XQAjA41fa^w8}W!&Mf`<}@w*Hkk&t^anN=gcY<v6+=`O?1x4zh^wgRO@!Z
zPUy|%ylE{zv)gpn2ekeScm3(Ohh0LvgvrD9Kvw3gN9!Zi_k>#qs|WgDJRj&|UcZN<
zhjH^2W|z<YjQeaI%6HtqfAP#8TkjnmZXez<_Av*&KQz<+9&-=lua*gNd>3Y)JU8`|
z-~B&5FFGugH44tG*H=i=`BC3wAFxckeESIo1_sp<*NBpo#FA92<f7EXl2isG14A=i
z19M$N;}AmwD<eZIQ%h|F11kdqX~xcO6b-rgDVb@N$QleRt&Gg9OidsfKA&A6z`(#D
v39=zLKdq!Zu_%?nF(p4KRlzeiF+DXXH8G{K@MNkDXzsz&)z4*}Q$iB}(6++N

literal 4369
zcmeAS@N?(olHy`uVBq!ia0y~yU}RumVEDkn%)r2K!_(_00|Ud`0G|-oKmY!W9JGPE
zeh&i!gI`IIUoeA&fDsEv!2af$dP*S$4rvKeLT7mtY{Z;AyyT+P41#o8P1+j|XPrEM
z+`>g>@6MXlTbK5(T)SE0?|hZ_Tx?AJi<71<T%U7)uA5z6-NcNHOCEn282DQ~T^vIy
z=DdyVO}f2JknN<$s;4cJbgMJpM0s1Kf1Z?+eLZjOEZvotOFXZCz4yP6t%0S`UO~Zi
zlgjNMDc*KWD(~#%4q7uznR@EPi5tu!0dJyO=PqKnQOtHNY<)w9qR0%!;L6=C2K+3{
zuG<Z2J$7p9eh_=`Oss@EyWwsA|2wO^3;3t7h{VVTojbokq2axrw7^u?ZgY->`?+Qb
zXin$R3bU^J5|DcD5wBCl1|h9a!aBApRc%YzT|{o|V{Z|7%e+WVW{tuxhNE5^_uhWb
zd}+tc-3<F%w$+Q@uzXjoFl8bbY&^c>qesE<LV<9HBcGIv)Y%w6u*|<LEYB~%?DXqJ
z^iq`t4GIn+53XkJ^0=!1<YCgyrIx?UCMzzik9h1+nBd~N<hWMQIfiKsYkAo{_`?+E
ztKPgN^q8@Ak@ba7S3Vqkcln{xqL05GGk)T_nJGWvSnPi86exJZ_nP(J$qOcxf3^zu
zoAN7s>6iM#*%_3?zEj3QV~WMBJ0iE8Q`)~BU3KB^!u2|L96}l$GWYzwAeh9`SyX6{
z*qFl?q4-5)8~c=B8)O%(FX;T1x=V-i^?h5DB$051J=IINOgF4Odu&ZcY25*h`h!w|
z;$3kLjgLPYi`=q(x9FvqQft!xC#G@{&LYwdUh)&?_U&+PU$x{{L&(c@@0rZ^)c-P@
z2@ao$h4CBzZMtH5m}jMfP7&wPg(p|8a{0Vkb3+L8$C`Qmb6Q0lo^tv7=?Y$*dFt;;
zPL}20mri;#;qP1aPtkb}Z*BxJ?pZi9;){r9E_3(YZVkrHtq&KvDV%bcV!!c&t-(E^
z1snyXJ`-nHr^~5adgx$wZhOlYajq6`X7&WBQ-7K5F6`f};E<tkb@9_bLf*mxVGVhL
zqC!WN5|=5h?&togDv;A8?V!h4)~TZ3_#rgz%QXQWcX9R;R*dY*33C$`Oj2klZCVpj
z;=NK(=3d<cnWNo@qZZu#X(|)4XMd;awd^-vD-Nui-+%H12;9iN^CmWiP3ukI%>#0?
zd37$ece7r4?bNo)#Dx2ne}wnh8rH7LrgQ1dI}ZwI#|!%|(GX+)opWKI>pVXHmS2rr
z3Or#dze5b2BEEiQoWz*4NVluT-a+9?+UKiI_allPd{b3-xU|!eDQ1`FmWMmNbZXlg
zoSc#$evV-a<NA22sQ2LV#T*$LmtspiPrQj+CHYx!VeOscM<w&mU0;^ZvoF}VnN!Jn
z@%iuUr)CQ5dUNq$Qtcg~xk~ppa0>8Gzo}WBq%v{uGBL)b$K)S9b}ttwzq_vo1a|j+
zns)yLQ)2s^dr3<7K4^Y>e>udVU{<SJd}@)IfLGat6)Tt?e&ai+l>6e|+BLqq2j{1l
ze|}{)<w8Zn`t>cRH<&S9UTV#9;!Ugm`s?2&zv&T3u=6fr35YrJO>9Fv%Z{6`<4SuB
zRVUx}7yT8|<hyC@3%!lCJ6WcEU<i~qe#Y_YW5YH*X}=qr*`GYFWmqjJvru#I^bd9o
z-&ub@`KSA+yfI;V|EuYV%|8UD9~RrMU0kX1xZw%osS?@tAJaAO_^nB*cXM-dJNDNp
z^-)XK&tLp(Qv7*-@?8tV@=SWJ{?HNJdC*Z<>+8&jkB_v@9cMOWlUU8Z#O~(ffbRBH
z?$26ZC30_THs+MO`c;6n`dhwJ2XD8UjmVcNKGEFEkKFT1*6W_R_VBhlnYI##6Br&d
z20C=6G_Bvt%XPNRbH!0T&(*JY<s9IU6l4-$PKYUa5N)Ht^1@j@vt*%(1^<DcCMR{-
zn2QcD^7Qp<A7D9?w)w`Ji5uCPoF+6lJ1Iz9zR2e5(a4!8vZQ6c#Ft729>&@kZMW?X
zoIG1pvE*at-M>eK3u>x<SUVkfe7s-O`eD+>()Ha%Og(?+Co`?^ZrnEimxM{l0ycT+
zFI5L78p^i0*U2o{^zXi4LSKK|jai3(GQaYEa8kI2^UM@G)?a&XFWj`=U**7!{~z9b
zu4Cfb=9sV9wU}wCK|xg&*WOwNnM}4Ve`hfKzATtv?dWn~=gr@L?&MnJSshGH<GbZ3
z<WOwB>!8pFR=N2zeB@t!-__4>PeCSX0h_*_-htgKJ~X__u(*={PiRAtJ)=19E#9LN
ze#akM_IxyUdLeX4x-LKd#yv*$gaaH5j~IpX>suP$75MAUIL&Ltw1YjwUF@9*r=*X(
z^_S!3QoYCT#wNVEB`?gh!D&*%71f5*v+Xv#(<)~P*|PUtfv*h1{FQPB{2q7Nq-)hm
zc$R(I{_b3yVaGLf|H98j%<2b>0#=`0xN4c0_K_+Xof6M*b@iH5nY=6iK&iaP_W0)X
zkDr3h<O<J-_WQIg_-Dy?@9NpVE_LQ^y8HCT<gj@qzs(k&e0XV7P<_I$D;IyyI=9X5
zhFb0IZ%&+{PbDR0YJ4iP`BHeIF|4xa0&9_@me&5eH`WU<SEVzXU3O8Py^)i3`n1`f
zFGdE;PFVNm-P@%P%bL!=EN*yyrcPL6Zq;w!oO`MJYf5);oDumGxL+=@RjYQMcF6oQ
zyqlOCeofvLRDbN}+X(JtC2g(wJbn{$zRdUgEy9wKyx*;auieH^+gi8w#f_eblABXi
z8kQbj5I1LkO=($QTd&sJ`*jD@T@S=RSpUoP5ZkLuhLa0FEi8V_s5L)`^>)HN|8tYR
z&9fBz%B);ra#hCUP^0ul%NNQE-m>mlbN=7`2Q$MxZuhsnxg_^t>aVE3clkAA4fuB?
z$Q2y4S+Mo~+=EiH{8pXLkF36La>;ydliAGUJDF$L9k@MR?ZMHX;_bggx9#t}V#ug^
zBT!wvp7s8#>-KYUZXLe9W2&~=;-c!mSv&kD3P0GidmaCRXC{9%d2XFPoUp==@p*So
zgWg{5+xORYEMQUi`RDcV#mE2uSvR%+&O^TGlb3&aqglwg#Yk+v{r62D|K{y6_Gn1D
zAbsXX!uwi*8w%g2uRZinFJYR*$FFR%jlcSrzbPn;H2j^)6rc3_>go5T-_3viOV#!}
z`!(L}n|Rx{yBe=t8bgGe|LE{NIDF5Cua?=zXI|0opSc01-MeZw&K0b9(Y2J_uqV0o
zcUOgii(}FPa9WW~=wM&wtHCb5@s;_WEf@S;UEbH(l*MqW>U{albbppUW9zK>hYNlj
z=KmlY^jz>>eI1*A+<}{SPUh@wmCh@8%scmtdC5uX{@KS2r1;{6*>>z*EogA{xYXht
zVH0L<x!(D|PP~q1`~Pj>i=-9&2BIf@!_O_tx+$Og>DB8O7dBox**9M%hpVP2mFY3-
zo@bAFyH2bYNO02K(!TNTzcNw1%ojhO^#<kNtEg?`dZjt<=0lbVs>%uMi!U^_2bnsH
z$};X+CE4%Dvd5^nbjQKg#J&9t52QGXBP)$}Kex?FOwF(Nd~H6z?$g(`dQuAuMA>p2
z+3wyy*Sv@;LCAmZdCfPBlR4wo+s!-gTlJFj!Z&RbmSd97PdY`U==B};t@?Mm>}<zt
z=6zc)pZ~CJb-?wMdW%lsf;Inb%<R|Qu(%=MH<4Z7uU5s^S1+#0=<R0SXLhUC%$?zT
zgZ$bzZcn3r?`?eCdQ|i7UEyW^FHfH2R9x^g=V)+m@!!jW7cw@#c+32(xR~*Q--oXS
z7Pk`AIkxZ{eABmKKK5_clEuY~-><x1`;kLWkolRz@fEj=o6XPdTkd~*e%L!UmtVgc
z5>4lyPwbOqD3iYPCHBEi$r)dNeYlcqIP(Xi_Fd*z^Dh}QJURTg@`c%l+Y7#ObkDPM
zxL;~&z$o-u@Ib(=;{SJ!GB%nvEnzmaJ@#72b~$^&-$e>qjfcF$*rrNeT79Rf_v+(@
zyN`d|-JPuBCoj3qguPeeSH#XDBV}dfWL=(*uU>4P?<4;C^38KwZra^r-t)d?e(d_+
zpZQF0>CKZUp1<W#Wbtvs_xIS-3=UiWQ5QI~LX>Tp@QlcR=`XuxAF7`0U@89N0q2hk
zR}&JQHTqWAswTZ^%zt2X=8UcE+O~Unb3QFG{K1(ur(Moz{-pdBdxKTP@}zz~exN*e
zuISm^$qaXyXNdf=&7AYf;Gl5wsax-ti}&6=@$bT=yP1|pztvvJm-lSF$;Y|k?$33F
zk3-sL#eQN4SJgZGt(`-o^Yo3@XR%ecV?I>$bER#*`AsP{f5Ub4QlSe^R&SkK(v@9(
zpv>CwHN#nF<7;i@^BT%m1l7yOD}Ub@v729j=blEz^6!_r^$S(E2@AdW87{qpd&R$_
z9J7y~k-n2r@b*Y{yyrK@h_0W<)svQ={H323A$ITICU4nqnOl^ULEv#)ptH}O%mW>)
zMkOy_@IH9ZaLTlQ%{Ctf11=86ZEKE*z6#8|=fOJJ$hz`U$SeQ+Y%%NWizMFg+}xJ%
z^{`kF)2vN?>D5(RD)%rcGEDbos@TM_Xp`Xf=d8JJ>>Z^w7|VVv4!u;@v*BDWtIq+A
z1mS#r#k^1d*_Uj{<&WrU(5*gD_M4$^?svxMecTNSDaXqjZ4cx<ZUATh-@QMIQ_5wZ
z){FkB>bsWrO5^D#xmy2qm3<<0YcGE0dHgH)0V9|A><{nlBSP<4>pZBR#n2k2t}XnV
zo2{WfY`)riX|EkYudYYMK3u+5e7V))rRT3#IkTxV|GlhxzfE}8yt^kHo;FtUelyv#
z_EzcV>Hm0omnVeXp3Gh@!1!(T#V+OVf2#r<0%!30*%|5o|69E*CSSAf+Z2Y^j8fr0
zdS=%pHX2v>94P0t5|0nOXWjG0wxH|Uo);-49Lo>OF};gXw_w|`YtNy(b;dFegM$KY
z%PzcScI^GvpOy96^Jkq0wPGWr|NLy2az;FGt=9Tm_jVO=fw|K!!no-d9_C2S)L#-4
z8n<<C=~I;-pBd%<FwUvTO*;HKEN|MSTc673^2CJgeJWq`v;E#TQJ2$ayZplZo<0-!
zSJ^Icz?@<38@@%iZa#ROZDT!WmHuhhT6<SHt>c^1ANni&T5-Sbckheze{=LL_p_~&
zGn;Yh*{i*2T*<92wW>T_*V9>4z6QSA?mo}_TYg`I<}bco42%oUhw^xBlm9Sb2K$VB
z>6y$r{tmx{4DRm}4b*u1>A(|_Mgi-2Nndxak(^Qfb@GGr>?~HM*ExUr^^^x4c>2%J
z^oHlBZ<Xrar)BMHH|=Dzvh2*gf9%@c-gR2bH@<a9yX%k@YT29HzUg(_rPZe-AwY0T
z<Kf<u)%@T7GhhBBtHSVz<;L{swcp;RxHUZb|D|C6#Tr#bmlQXF9oy|@{{6kX*8N*U
z^?mj`-*-EJTBB}m$Cd@&ndhOflS^pTRq<V7Z~imCHRhUnp_G&9$IpGf-|`PJ@7TNj
zRNX7avdZ1H3v)$(msi=`F#jq#^?javfaQ;(W8vBV-+pW?wOz1s{f3&=Z{n{r=k5Lb
z`W|c5oBf+>9hmO@yZxBilRtv>Sl;*96E{BpVSn;jv5dS;X#i-%!_(EzWt~$(695H*
B%d`Lh

diff --git a/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css b/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css
index 02afc50591..cb996859e1 100644
--- a/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css
+++ b/www/Themes/Centreon-2/jquery-ui/jquery-ui-centreon.css
@@ -10,7 +10,25 @@
 .portlet-header .ui-icon { float: right; cursor: pointer}
 .ui-sortable-placeholder { border: 1px dotted black; visibility: visible !important; height: 50px !important; }
 .ui-sortable-placeholder { visibility: hidden; }
-.portlet-content { 
+
+.ui-button, .ui-button:hover, .ui-button:focus {
+    padding: .2em 1em .2em .2em;
+    color: #ffffff;
+    font-weight: bold;
+    font-family: segoe ui, Arial, sans-serif;
+    font-size: 1.1em;
+}
+.ui-button .ui-icon {
+    background-image: url(images/ui-icons_ffffff_256x240.png);
+}
+.ui-button:hover .ui-icon {
+    background-image: url(images/ui-icons_ffffff_256x240.png);
+}
+.ui-button:focus .ui-icon {
+    background-image: url(images/ui-icons_ffffff_256x240.png);
+}
+
+.portlet-content {
 	padding: 0.2em;
 	width: 100%;
 	border: none;
@@ -37,7 +55,7 @@ iframe {
 
 .ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 0.4em; background: none; }
 .ui-tabs .ui-tabs-nav li a { float: left; padding: .4em 1em 0.4em .4em; text-decoration: none; background: #009fdf;}
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text;  background: none; }
+.ui-tabs .ui-tabs-nav li.ui-state-active a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text;  background: none; }
 
 
 .ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .2em 1em .2em 2.1em; }
diff --git a/www/Themes/Centreon-2/jquery-ui/jquery-ui.css b/www/Themes/Centreon-2/jquery-ui/jquery-ui.css
index 784635969e..45721b175e 100644
--- a/www/Themes/Centreon-2/jquery-ui/jquery-ui.css
+++ b/www/Themes/Centreon-2/jquery-ui/jquery-ui.css
@@ -1,119 +1,1114 @@
-/*
- * jQuery UI CSS Framework 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Theming/API
- */
+/*! jQuery UI - v1.12.1 - 2018-03-18
+* http://jqueryui.com
+* Includes: draggable.css, core.css, resizable.css, selectable.css, sortable.css, accordion.css, autocomplete.css, menu.css, button.css, controlgroup.css, checkboxradio.css, datepicker.css, dialog.css, progressbar.css, selectmenu.css, slider.css, spinner.css, tabs.css, tooltip.css, theme.css
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?scope=&folderName=base&cornerRadiusShadow=8px&offsetLeftShadow=0px&offsetTopShadow=0px&thicknessShadow=5px&opacityShadow=30&bgImgOpacityShadow=0&bgTextureShadow=flat&bgColorShadow=666666&opacityOverlay=30&bgImgOpacityOverlay=0&bgTextureOverlay=flat&bgColorOverlay=aaaaaa&iconColorError=cc0000&fcError=5f3f3f&borderColorError=f1a899&bgTextureError=flat&bgColorError=fddfdf&iconColorHighlight=777620&fcHighlight=777620&borderColorHighlight=dad55e&bgTextureHighlight=flat&bgColorHighlight=fffa90&iconColorActive=ffffff&fcActive=ffffff&borderColorActive=003eff&bgTextureActive=flat&bgColorActive=007fff&iconColorHover=555555&fcHover=2b2b2b&borderColorHover=cccccc&bgTextureHover=flat&bgColorHover=ededed&iconColorDefault=777777&fcDefault=454545&borderColorDefault=c5c5c5&bgTextureDefault=flat&bgColorDefault=f6f6f6&iconColorContent=444444&fcContent=333333&borderColorContent=dddddd&bgTextureContent=flat&bgColorContent=ffffff&iconColorHeader=444444&fcHeader=333333&borderColorHeader=dddddd&bgTextureHeader=flat&bgColorHeader=e9e9e9&cornerRadius=3px&fwDefault=normal&fsDefault=1em&ffDefault=Arial%2CHelvetica%2Csans-serif
+* Copyright jQuery Foundation and other contributors; Licensed MIT */
 
+.ui-draggable-handle {
+	-ms-touch-action: none;
+	touch-action: none;
+}
 /* Layout helpers
 ----------------------------------*/
-.ui-helper-hidden { display: none; }
-.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
-.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
-.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
-.ui-helper-clearfix { display: inline-block; }
-/* required comment for clearfix to work in Opera \*/
-* html .ui-helper-clearfix { height:1%; }
-.ui-helper-clearfix { display:block; }
-/* end clearfix */
-.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+.ui-helper-hidden {
+	display: none;
+}
+.ui-helper-hidden-accessible {
+	border: 0;
+	clip: rect(0 0 0 0);
+	height: 1px;
+	margin: -1px;
+	overflow: hidden;
+	padding: 0;
+	position: absolute;
+	width: 1px;
+}
+.ui-helper-reset {
+	margin: 0;
+	padding: 0;
+	border: 0;
+	outline: 0;
+	line-height: 1.3;
+	text-decoration: none;
+	font-size: 100%;
+	list-style: none;
+}
+.ui-helper-clearfix:before,
+.ui-helper-clearfix:after {
+	content: "";
+	display: table;
+	border-collapse: collapse;
+}
+.ui-helper-clearfix:after {
+	clear: both;
+}
+.ui-helper-zfix {
+	width: 100%;
+	height: 100%;
+	top: 0;
+	left: 0;
+	position: absolute;
+	opacity: 0;
+	filter:Alpha(Opacity=0); /* support: IE8 */
+}
+
+.ui-front {
+	z-index: 100;
+}
 
 
 /* Interaction Cues
 ----------------------------------*/
-.ui-state-disabled { cursor: default !important; }
+.ui-state-disabled {
+	cursor: default !important;
+	pointer-events: none;
+}
 
 
 /* Icons
 ----------------------------------*/
+.ui-icon {
+	display: inline-block;
+	vertical-align: middle;
+	margin-top: -.25em;
+	position: relative;
+	text-indent: -99999px;
+	overflow: hidden;
+	background-repeat: no-repeat;
+}
 
-/* states and images */
-.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
-
+.ui-widget-icon-block {
+	left: 50%;
+	margin-left: -8px;
+	display: block;
+}
 
 /* Misc visuals
 ----------------------------------*/
 
 /* Overlays */
-.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+.ui-widget-overlay {
+	position: fixed;
+	top: 0;
+	left: 0;
+	width: 100%;
+	height: 100%;
+}
+.ui-resizable {
+	position: relative;
+}
+.ui-resizable-handle {
+	position: absolute;
+	font-size: 0.1px;
+	display: block;
+	-ms-touch-action: none;
+	touch-action: none;
+}
+.ui-resizable-disabled .ui-resizable-handle,
+.ui-resizable-autohide .ui-resizable-handle {
+	display: none;
+}
+.ui-resizable-n {
+	cursor: n-resize;
+	height: 7px;
+	width: 100%;
+	top: -5px;
+	left: 0;
+}
+.ui-resizable-s {
+	cursor: s-resize;
+	height: 7px;
+	width: 100%;
+	bottom: -5px;
+	left: 0;
+}
+.ui-resizable-e {
+	cursor: e-resize;
+	width: 7px;
+	right: -5px;
+	top: 0;
+	height: 100%;
+}
+.ui-resizable-w {
+	cursor: w-resize;
+	width: 7px;
+	left: -5px;
+	top: 0;
+	height: 100%;
+}
+.ui-resizable-se {
+	cursor: se-resize;
+	width: 12px;
+	height: 12px;
+	right: 1px;
+	bottom: 1px;
+}
+.ui-resizable-sw {
+	cursor: sw-resize;
+	width: 9px;
+	height: 9px;
+	left: -5px;
+	bottom: -5px;
+}
+.ui-resizable-nw {
+	cursor: nw-resize;
+	width: 9px;
+	height: 9px;
+	left: -5px;
+	top: -5px;
+}
+.ui-resizable-ne {
+	cursor: ne-resize;
+	width: 9px;
+	height: 9px;
+	right: -5px;
+	top: -5px;
+}
+.ui-selectable {
+	-ms-touch-action: none;
+	touch-action: none;
+}
+.ui-selectable-helper {
+	position: absolute;
+	z-index: 100;
+	border: 1px dotted black;
+}
+.ui-sortable-handle {
+	-ms-touch-action: none;
+	touch-action: none;
+}
+.ui-accordion .ui-accordion-header {
+	display: block;
+	cursor: pointer;
+	position: relative;
+	margin: 2px 0 0 0;
+	padding: .5em .5em .5em .7em;
+	font-size: 100%;
+}
+.ui-accordion .ui-accordion-content {
+	padding: 1em 2.2em;
+	border-top: 0;
+	overflow: auto;
+}
+.ui-autocomplete {
+	position: absolute;
+	top: 0;
+	left: 0;
+	cursor: default;
+}
+.ui-menu {
+	list-style: none;
+	padding: 0;
+	margin: 0;
+	display: block;
+	outline: 0;
+}
+.ui-menu .ui-menu {
+	position: absolute;
+}
+.ui-menu .ui-menu-item {
+	margin: 0;
+	cursor: pointer;
+	/* support: IE10, see #8844 */
+	list-style-image: url("data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7");
+}
+.ui-menu .ui-menu-item-wrapper {
+	position: relative;
+	padding: 3px 1em 3px .4em;
+}
+.ui-menu .ui-menu-divider {
+	margin: 5px 0;
+	height: 0;
+	font-size: 0;
+	line-height: 0;
+	border-width: 1px 0 0 0;
+}
+.ui-menu .ui-state-focus,
+.ui-menu .ui-state-active {
+	margin: -1px;
+}
+
+/* icon support */
+.ui-menu-icons {
+	position: relative;
+}
+.ui-menu-icons .ui-menu-item-wrapper {
+	padding-left: 2em;
+}
+
+/* left-aligned */
+.ui-menu .ui-icon {
+	position: absolute;
+	top: 0;
+	bottom: 0;
+	left: .2em;
+	margin: auto 0;
+}
+
+/* right-aligned */
+.ui-menu .ui-menu-icon {
+	left: auto;
+	right: 0;
+}
+.ui-button {
+	padding: .4em 1em;
+	display: inline-block;
+	position: relative;
+	line-height: normal;
+	margin-right: .1em;
+	cursor: pointer;
+	vertical-align: middle;
+	text-align: center;
+	-webkit-user-select: none;
+	-moz-user-select: none;
+	-ms-user-select: none;
+	user-select: none;
+
+	/* Support: IE <= 11 */
+	overflow: visible;
+}
+
+.ui-button,
+.ui-button:link,
+.ui-button:visited,
+.ui-button:hover,
+.ui-button:active {
+	text-decoration: none;
+}
+
+/* to make room for the icon, a width needs to be set here */
+.ui-button-icon-only {
+	width: 2em;
+	box-sizing: border-box;
+	text-indent: -9999px;
+	white-space: nowrap;
+}
+
+/* no icon support for input elements */
+input.ui-button.ui-button-icon-only {
+	text-indent: 0;
+}
+
+/* button icon element(s) */
+.ui-button-icon-only .ui-icon {
+	position: absolute;
+	top: 50%;
+	left: 50%;
+	margin-top: -8px;
+	margin-left: -8px;
+}
+
+.ui-button.ui-icon-notext .ui-icon {
+	padding: 0;
+	width: 2.1em;
+	height: 2.1em;
+	text-indent: -9999px;
+	white-space: nowrap;
+
+}
+
+input.ui-button.ui-icon-notext .ui-icon {
+	width: auto;
+	height: auto;
+	text-indent: 0;
+	white-space: normal;
+	padding: .4em 1em;
+}
+
+/* workarounds */
+/* Support: Firefox 5 - 40 */
+input.ui-button::-moz-focus-inner,
+button.ui-button::-moz-focus-inner {
+	border: 0;
+	padding: 0;
+}
+.ui-controlgroup {
+	vertical-align: middle;
+	display: inline-block;
+}
+.ui-controlgroup > .ui-controlgroup-item {
+	float: left;
+	margin-left: 0;
+	margin-right: 0;
+}
+.ui-controlgroup > .ui-controlgroup-item:focus,
+.ui-controlgroup > .ui-controlgroup-item.ui-visual-focus {
+	z-index: 9999;
+}
+.ui-controlgroup-vertical > .ui-controlgroup-item {
+	display: block;
+	float: none;
+	width: 100%;
+	margin-top: 0;
+	margin-bottom: 0;
+	text-align: left;
+}
+.ui-controlgroup-vertical .ui-controlgroup-item {
+	box-sizing: border-box;
+}
+.ui-controlgroup .ui-controlgroup-label {
+	padding: .4em 1em;
+}
+.ui-controlgroup .ui-controlgroup-label span {
+	font-size: 80%;
+}
+.ui-controlgroup-horizontal .ui-controlgroup-label + .ui-controlgroup-item {
+	border-left: none;
+}
+.ui-controlgroup-vertical .ui-controlgroup-label + .ui-controlgroup-item {
+	border-top: none;
+}
+.ui-controlgroup-horizontal .ui-controlgroup-label.ui-widget-content {
+	border-right: none;
+}
+.ui-controlgroup-vertical .ui-controlgroup-label.ui-widget-content {
+	border-bottom: none;
+}
+
+/* Spinner specific style fixes */
+.ui-controlgroup-vertical .ui-spinner-input {
+
+	/* Support: IE8 only, Android < 4.4 only */
+	width: 75%;
+	width: calc( 100% - 2.4em );
+}
+.ui-controlgroup-vertical .ui-spinner .ui-spinner-up {
+	border-top-style: solid;
+}
+
+.ui-checkboxradio-label .ui-icon-background {
+	box-shadow: inset 1px 1px 1px #ccc;
+	border-radius: .12em;
+	border: none;
+}
+.ui-checkboxradio-radio-label .ui-icon-background {
+	width: 16px;
+	height: 16px;
+	border-radius: 1em;
+	overflow: visible;
+	border: none;
+}
+.ui-checkboxradio-radio-label.ui-checkboxradio-checked .ui-icon,
+.ui-checkboxradio-radio-label.ui-checkboxradio-checked:hover .ui-icon {
+	background-image: none;
+	width: 8px;
+	height: 8px;
+	border-width: 4px;
+	border-style: solid;
+}
+.ui-checkboxradio-disabled {
+	pointer-events: none;
+}
+.ui-datepicker {
+	width: 17em;
+	padding: .2em .2em 0;
+	display: none;
+}
+.ui-datepicker .ui-datepicker-header {
+	position: relative;
+	padding: .2em 0;
+}
+.ui-datepicker .ui-datepicker-prev,
+.ui-datepicker .ui-datepicker-next {
+	position: absolute;
+	top: 2px;
+	width: 1.8em;
+	height: 1.8em;
+}
+.ui-datepicker .ui-datepicker-prev-hover,
+.ui-datepicker .ui-datepicker-next-hover {
+	top: 1px;
+}
+.ui-datepicker .ui-datepicker-prev {
+	left: 2px;
+}
+.ui-datepicker .ui-datepicker-next {
+	right: 2px;
+}
+.ui-datepicker .ui-datepicker-prev-hover {
+	left: 1px;
+}
+.ui-datepicker .ui-datepicker-next-hover {
+	right: 1px;
+}
+.ui-datepicker .ui-datepicker-prev span,
+.ui-datepicker .ui-datepicker-next span {
+	display: block;
+	position: absolute;
+	left: 50%;
+	margin-left: -8px;
+	top: 50%;
+	margin-top: -8px;
+}
+.ui-datepicker .ui-datepicker-title {
+	margin: 0 2.3em;
+	line-height: 1.8em;
+	text-align: center;
+}
+.ui-datepicker .ui-datepicker-title select {
+	font-size: 1em;
+	margin: 1px 0;
+}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year {
+	width: 45%;
+}
+.ui-datepicker table {
+	width: 100%;
+	font-size: .9em;
+	border-collapse: collapse;
+	margin: 0 0 .4em;
+}
+.ui-datepicker th {
+	padding: .7em .3em;
+	text-align: center;
+	font-weight: bold;
+	border: 0;
+}
+.ui-datepicker td {
+	border: 0;
+	padding: 1px;
+}
+.ui-datepicker td span,
+.ui-datepicker td a {
+	display: block;
+	padding: .2em;
+	text-align: right;
+	text-decoration: none;
+}
+.ui-datepicker .ui-datepicker-buttonpane {
+	background-image: none;
+	margin: .7em 0 0 0;
+	padding: 0 .2em;
+	border-left: 0;
+	border-right: 0;
+	border-bottom: 0;
+}
+.ui-datepicker .ui-datepicker-buttonpane button {
+	float: right;
+	margin: .5em .2em .4em;
+	cursor: pointer;
+	padding: .2em .6em .3em .6em;
+	width: auto;
+	overflow: visible;
+}
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current {
+	float: left;
+}
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi {
+	width: auto;
+}
+.ui-datepicker-multi .ui-datepicker-group {
+	float: left;
+}
+.ui-datepicker-multi .ui-datepicker-group table {
+	width: 95%;
+	margin: 0 auto .4em;
+}
+.ui-datepicker-multi-2 .ui-datepicker-group {
+	width: 50%;
+}
+.ui-datepicker-multi-3 .ui-datepicker-group {
+	width: 33.3%;
+}
+.ui-datepicker-multi-4 .ui-datepicker-group {
+	width: 25%;
+}
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header,
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header {
+	border-left-width: 0;
+}
+.ui-datepicker-multi .ui-datepicker-buttonpane {
+	clear: left;
+}
+.ui-datepicker-row-break {
+	clear: both;
+	width: 100%;
+	font-size: 0;
+}
+
+/* RTL support */
+.ui-datepicker-rtl {
+	direction: rtl;
+}
+.ui-datepicker-rtl .ui-datepicker-prev {
+	right: 2px;
+	left: auto;
+}
+.ui-datepicker-rtl .ui-datepicker-next {
+	left: 2px;
+	right: auto;
+}
+.ui-datepicker-rtl .ui-datepicker-prev:hover {
+	right: 1px;
+	left: auto;
+}
+.ui-datepicker-rtl .ui-datepicker-next:hover {
+	left: 1px;
+	right: auto;
+}
+.ui-datepicker-rtl .ui-datepicker-buttonpane {
+	clear: right;
+}
+.ui-datepicker-rtl .ui-datepicker-buttonpane button {
+	float: left;
+}
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current,
+.ui-datepicker-rtl .ui-datepicker-group {
+	float: right;
+}
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header,
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header {
+	border-right-width: 0;
+	border-left-width: 1px;
+}
 
+/* Icons */
+.ui-datepicker .ui-icon {
+	display: block;
+	text-indent: -99999px;
+	overflow: hidden;
+	background-repeat: no-repeat;
+	left: .5em;
+	top: .3em;
+}
+.ui-dialog {
+	position: absolute;
+	top: 0;
+	left: 0;
+	padding: .2em;
+	outline: 0;
+}
+.ui-dialog .ui-dialog-titlebar {
+	padding: .4em 1em;
+	position: relative;
+}
+.ui-dialog .ui-dialog-title {
+	float: left;
+	margin: .1em 0;
+	white-space: nowrap;
+	width: 90%;
+	overflow: hidden;
+	text-overflow: ellipsis;
+}
+.ui-dialog .ui-dialog-titlebar-close {
+	position: absolute;
+	right: .3em;
+	top: 50%;
+	width: 20px;
+	margin: -10px 0 0 0;
+	padding: 1px;
+	height: 20px;
+}
+.ui-dialog .ui-dialog-content {
+	position: relative;
+	border: 0;
+	padding: .5em 1em;
+	background: none;
+	overflow: auto;
+}
+.ui-dialog .ui-dialog-buttonpane {
+	text-align: left;
+	border-width: 1px 0 0 0;
+	background-image: none;
+	margin-top: .5em;
+	padding: .3em 1em .5em .4em;
+}
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset {
+	float: right;
+}
+.ui-dialog .ui-dialog-buttonpane button {
+	margin: .5em .4em .5em 0;
+	cursor: pointer;
+}
+.ui-dialog .ui-resizable-n {
+	height: 2px;
+	top: 0;
+}
+.ui-dialog .ui-resizable-e {
+	width: 2px;
+	right: 0;
+}
+.ui-dialog .ui-resizable-s {
+	height: 2px;
+	bottom: 0;
+}
+.ui-dialog .ui-resizable-w {
+	width: 2px;
+	left: 0;
+}
+.ui-dialog .ui-resizable-se,
+.ui-dialog .ui-resizable-sw,
+.ui-dialog .ui-resizable-ne,
+.ui-dialog .ui-resizable-nw {
+	width: 7px;
+	height: 7px;
+}
+.ui-dialog .ui-resizable-se {
+	right: 0;
+	bottom: 0;
+}
+.ui-dialog .ui-resizable-sw {
+	left: 0;
+	bottom: 0;
+}
+.ui-dialog .ui-resizable-ne {
+	right: 0;
+	top: 0;
+}
+.ui-dialog .ui-resizable-nw {
+	left: 0;
+	top: 0;
+}
+.ui-draggable .ui-dialog-titlebar {
+	cursor: move;
+}
+.ui-progressbar {
+	height: 2em;
+	text-align: left;
+	overflow: hidden;
+}
+.ui-progressbar .ui-progressbar-value {
+	margin: -1px;
+	height: 100%;
+}
+.ui-progressbar .ui-progressbar-overlay {
+	background: url("data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw==");
+	height: 100%;
+	filter: alpha(opacity=25); /* support: IE8 */
+	opacity: 0.25;
+}
+.ui-progressbar-indeterminate .ui-progressbar-value {
+	background-image: none;
+}
+.ui-selectmenu-menu {
+	padding: 0;
+	margin: 0;
+	position: absolute;
+	top: 0;
+	left: 0;
+	display: none;
+}
+.ui-selectmenu-menu .ui-menu {
+	overflow: auto;
+	overflow-x: hidden;
+	padding-bottom: 1px;
+}
+.ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup {
+	font-size: 1em;
+	font-weight: bold;
+	line-height: 1.5;
+	padding: 2px 0.4em;
+	margin: 0.5em 0 0 0;
+	height: auto;
+	border: 0;
+}
+.ui-selectmenu-open {
+	display: block;
+}
+.ui-selectmenu-text {
+	display: block;
+	margin-right: 20px;
+	overflow: hidden;
+	text-overflow: ellipsis;
+}
+.ui-selectmenu-button.ui-button {
+	text-align: left;
+	white-space: nowrap;
+	width: 14em;
+}
+.ui-selectmenu-icon.ui-icon {
+	float: right;
+	margin-top: 0;
+}
+.ui-slider {
+	position: relative;
+	text-align: left;
+}
+.ui-slider .ui-slider-handle {
+	position: absolute;
+	z-index: 2;
+	width: 1.2em;
+	height: 1.2em;
+	cursor: default;
+	-ms-touch-action: none;
+	touch-action: none;
+}
+.ui-slider .ui-slider-range {
+	position: absolute;
+	z-index: 1;
+	font-size: .7em;
+	display: block;
+	border: 0;
+	background-position: 0 0;
+}
 
-/*
- * jQuery UI CSS Framework 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Theming/API
- *
- * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=segoe%20ui,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=6px&bgColorHeader=ece8da&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=100&borderColorHeader=d4ccb0&fcHeader=433f38&iconColorHeader=847e71&bgColorContent=f5f3e5&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=dfd9c3&fcContent=312e25&iconColorContent=808080&bgColorDefault=459e00&bgTextureDefault=04_highlight_hard.png&bgImgOpacityDefault=15&borderColorDefault=327E04&fcDefault=ffffff&iconColorDefault=eeeeee&bgColorHover=67b021&bgTextureHover=03_highlight_soft.png&bgImgOpacityHover=25&borderColorHover=327E04&fcHover=ffffff&iconColorHover=ffffff&bgColorActive=fafaf4&bgTextureActive=04_highlight_hard.png&bgImgOpacityActive=100&borderColorActive=d4ccb0&fcActive=459e00&iconColorActive=8DC262&bgColorHighlight=fcf0ba&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=e8e1b5&fcHighlight=363636&iconColorHighlight=8DC262&bgColorError=ffedad&bgTextureError=03_highlight_soft.png&bgImgOpacityError=95&borderColorError=e3a345&fcError=cd5c0a&iconColorError=cd0a0a&bgColorOverlay=2b2922&bgTextureOverlay=05_inset_soft.png&bgImgOpacityOverlay=15&opacityOverlay=90&bgColorShadow=cccccc&bgTextureShadow=04_highlight_hard.png&bgImgOpacityShadow=95&opacityShadow=20&thicknessShadow=12px&offsetTopShadow=-12px&offsetLeftShadow=-12px&cornerRadiusShadow=10px
- */
+/* support: IE8 - See #6727 */
+.ui-slider.ui-state-disabled .ui-slider-handle,
+.ui-slider.ui-state-disabled .ui-slider-range {
+	filter: inherit;
+}
 
+.ui-slider-horizontal {
+	height: .8em;
+}
+.ui-slider-horizontal .ui-slider-handle {
+	top: -.3em;
+	margin-left: -.6em;
+}
+.ui-slider-horizontal .ui-slider-range {
+	top: 0;
+	height: 100%;
+}
+.ui-slider-horizontal .ui-slider-range-min {
+	left: 0;
+}
+.ui-slider-horizontal .ui-slider-range-max {
+	right: 0;
+}
+
+.ui-slider-vertical {
+	width: .8em;
+	height: 100px;
+}
+.ui-slider-vertical .ui-slider-handle {
+	left: -.3em;
+	margin-left: 0;
+	margin-bottom: -.6em;
+}
+.ui-slider-vertical .ui-slider-range {
+	left: 0;
+	width: 100%;
+}
+.ui-slider-vertical .ui-slider-range-min {
+	bottom: 0;
+}
+.ui-slider-vertical .ui-slider-range-max {
+	top: 0;
+}
+.ui-spinner {
+	position: relative;
+	display: inline-block;
+	overflow: hidden;
+	padding: 0;
+	vertical-align: middle;
+}
+.ui-spinner-input {
+	border: none;
+	background: none;
+	color: inherit;
+	padding: .222em 0;
+	margin: .2em 0;
+	vertical-align: middle;
+	margin-left: .4em;
+	margin-right: 2em;
+}
+.ui-spinner-button {
+	width: 1.6em;
+	height: 50%;
+	font-size: .5em;
+	padding: 0;
+	margin: 0;
+	text-align: center;
+	position: absolute;
+	cursor: default;
+	display: block;
+	overflow: hidden;
+	right: 0;
+}
+/* more specificity required here to override default borders */
+.ui-spinner a.ui-spinner-button {
+	border-top-style: none;
+	border-bottom-style: none;
+	border-right-style: none;
+}
+.ui-spinner-up {
+	top: 0;
+}
+.ui-spinner-down {
+	bottom: 0;
+}
+.ui-tabs {
+	position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+	padding: .2em;
+}
+.ui-tabs .ui-tabs-nav {
+	margin: 0;
+	padding: .2em .2em 0;
+}
+.ui-tabs .ui-tabs-nav li {
+	list-style: none;
+	float: left;
+	position: relative;
+	top: 0;
+	margin: 1px .2em 0 0;
+	border-bottom-width: 0;
+	padding: 0;
+	white-space: nowrap;
+}
+.ui-tabs .ui-tabs-nav .ui-tabs-anchor {
+	float: left;
+	padding: .5em 1em;
+	text-decoration: none;
+}
+.ui-tabs .ui-tabs-nav li.ui-tabs-active {
+	margin-bottom: -1px;
+	padding-bottom: 1px;
+}
+.ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor,
+.ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor,
+.ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor {
+	cursor: text;
+}
+.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor {
+	cursor: pointer;
+}
+.ui-tabs .ui-tabs-panel {
+	display: block;
+	border-width: 0;
+	padding: 1em 1.4em;
+	background: none;
+}
+.ui-tooltip {
+	padding: 8px;
+	position: absolute;
+	z-index: 9999;
+	max-width: 300px;
+}
+body .ui-tooltip {
+	border-width: 2px;
+}
 
 /* Component containers
 ----------------------------------*/
-.ui-widget { font-family: segoe ui, Arial, sans-serif; font-size: 1.1em; }
-.ui-widget .ui-widget { font-size: 1em; }
-.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: segoe ui, Arial, sans-serif; font-size: 1em; }
-.ui-widget-content { border: 1px solid #dfd9c3; background: #f5f3e5 url(images/ui-bg_highlight-hard_100_f5f3e5_1x100.png) 50% top repeat-x; color: #312e25; }
-.ui-widget-content a { color: #312e25; }
-.ui-widget-header { border: 1px solid #d4ccb0; background: #ece8da url(images/ui-bg_gloss-wave_100_ece8da_500x100.png) 50% 50% repeat-x; color: #433f38; font-weight: bold; }
-.ui-widget-header a { color: #433f38; }
+.ui-widget {
+	font-family: Arial,Helvetica,sans-serif;
+	font-size: 1em;
+}
+.ui-widget .ui-widget {
+	font-size: 1em;
+}
+.ui-widget input,
+.ui-widget select,
+.ui-widget textarea,
+.ui-widget button {
+	font-family: Arial,Helvetica,sans-serif;
+	font-size: 1em;
+}
+.ui-widget.ui-widget-content {
+	border: 1px solid #c5c5c5;
+}
+.ui-widget-content {
+	border: 1px solid #dddddd;
+	background: #ffffff;
+	color: #333333;
+}
+.ui-widget-content a {
+	color: #333333;
+}
+.ui-widget-header {
+	border: 1px solid #dddddd;
+	background: #e9e9e9;
+	color: #333333;
+	font-weight: bold;
+}
+.ui-widget-header a {
+	color: #333333;
+}
 
 /* Interaction states
 ----------------------------------*/
-.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #327e04; background: #459e00 url(images/ui-bg_highlight-hard_15_459e00_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; }
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #ffffff; text-decoration: none; }
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #327e04; background: #67b021 url(images/ui-bg_highlight-soft_25_67b021_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #ffffff; }
-.ui-state-hover a, .ui-state-hover a:hover { color: #ffffff; text-decoration: none; }
-.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #d4ccb0; background: #fafaf4 url(images/ui-bg_highlight-hard_100_fafaf4_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #459e00; }
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #459e00; text-decoration: none; }
-.ui-widget :active { outline: none; }
+.ui-state-default,
+.ui-widget-content .ui-state-default,
+.ui-widget-header .ui-state-default,
+.ui-button,
+
+/* We use html here because we need a greater specificity to make sure disabled
+works properly when clicked or hovered */
+html .ui-button.ui-state-disabled:hover,
+html .ui-button.ui-state-disabled:active {
+	border: 1px solid #c5c5c5;
+	background: #f6f6f6;
+	font-weight: normal;
+	color: #454545;
+}
+.ui-state-default a,
+.ui-state-default a:link,
+.ui-state-default a:visited,
+a.ui-button,
+a:link.ui-button,
+a:visited.ui-button,
+.ui-button {
+	color: #454545;
+	text-decoration: none;
+}
+.ui-state-hover,
+.ui-widget-content .ui-state-hover,
+.ui-widget-header .ui-state-hover,
+.ui-state-focus,
+.ui-widget-content .ui-state-focus,
+.ui-widget-header .ui-state-focus,
+.ui-button:hover,
+.ui-button:focus {
+	border: 1px solid #cccccc;
+	background: #ededed;
+	font-weight: normal;
+	color: #2b2b2b;
+}
+.ui-state-hover a,
+.ui-state-hover a:hover,
+.ui-state-hover a:link,
+.ui-state-hover a:visited,
+.ui-state-focus a,
+.ui-state-focus a:hover,
+.ui-state-focus a:link,
+.ui-state-focus a:visited,
+a.ui-button:hover,
+a.ui-button:focus {
+	color: #2b2b2b;
+	text-decoration: none;
+}
+
+.ui-visual-focus {
+	box-shadow: 0 0 3px 1px rgb(94, 158, 214);
+}
+.ui-state-active,
+.ui-widget-content .ui-state-active,
+.ui-widget-header .ui-state-active,
+a.ui-button:active,
+.ui-button:active,
+.ui-button.ui-state-active:hover {
+	border: 1px solid #003eff;
+	background: #007fff;
+	font-weight: normal;
+	color: #ffffff;
+}
+.ui-icon-background,
+.ui-state-active .ui-icon-background {
+	border: #003eff;
+	background-color: #ffffff;
+}
+.ui-state-active a,
+.ui-state-active a:link,
+.ui-state-active a:visited {
+	color: #ffffff;
+	text-decoration: none;
+}
 
 /* Interaction Cues
 ----------------------------------*/
-.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #e8e1b5; background: #fcf0ba url(images/ui-bg_glass_55_fcf0ba_1x400.png) 50% 50% repeat-x; color: #363636; }
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
-.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #e3a345; background: #ffedad url(images/ui-bg_highlight-soft_95_ffedad_1x100.png) 50% top repeat-x; color: #cd5c0a; }
-.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd5c0a; }
-.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd5c0a; }
-.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
-.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+.ui-state-highlight,
+.ui-widget-content .ui-state-highlight,
+.ui-widget-header .ui-state-highlight {
+	border: 1px solid #dad55e;
+	background: #fffa90;
+	color: #777620;
+}
+.ui-state-checked {
+	border: 1px solid #dad55e;
+	background: #fffa90;
+}
+.ui-state-highlight a,
+.ui-widget-content .ui-state-highlight a,
+.ui-widget-header .ui-state-highlight a {
+	color: #777620;
+}
+.ui-state-error,
+.ui-widget-content .ui-state-error,
+.ui-widget-header .ui-state-error {
+	border: 1px solid #f1a899;
+	background: #fddfdf;
+	color: #5f3f3f;
+}
+.ui-state-error a,
+.ui-widget-content .ui-state-error a,
+.ui-widget-header .ui-state-error a {
+	color: #5f3f3f;
+}
+.ui-state-error-text,
+.ui-widget-content .ui-state-error-text,
+.ui-widget-header .ui-state-error-text {
+	color: #5f3f3f;
+}
+.ui-priority-primary,
+.ui-widget-content .ui-priority-primary,
+.ui-widget-header .ui-priority-primary {
+	font-weight: bold;
+}
+.ui-priority-secondary,
+.ui-widget-content .ui-priority-secondary,
+.ui-widget-header .ui-priority-secondary {
+	opacity: .7;
+	filter:Alpha(Opacity=70); /* support: IE8 */
+	font-weight: normal;
+}
+.ui-state-disabled,
+.ui-widget-content .ui-state-disabled,
+.ui-widget-header .ui-state-disabled {
+	opacity: .35;
+	filter:Alpha(Opacity=35); /* support: IE8 */
+	background-image: none;
+}
+.ui-state-disabled .ui-icon {
+	filter:Alpha(Opacity=35); /* support: IE8 - See #6059 */
+}
 
 /* Icons
 ----------------------------------*/
 
 /* states and images */
-.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_808080_256x240.png); }
-.ui-widget-content .ui-icon {background-image: url(images/ui-icons_808080_256x240.png); }
-.ui-widget-header .ui-icon {background-image: url(images/ui-icons_847e71_256x240.png); }
-.ui-state-default .ui-icon { background-image: url(images/ui-icons_eeeeee_256x240.png); }
-.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
-.ui-state-active .ui-icon {background-image: url(images/ui-icons_8dc262_256x240.png); }
-.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_8dc262_256x240.png); }
-.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+.ui-icon {
+	width: 16px;
+	height: 16px;
+}
+.ui-icon,
+.ui-widget-content .ui-icon {
+	background-image: url("images/ui-icons_444444_256x240.png");
+}
+.ui-widget-header .ui-icon {
+	background-image: url("images/ui-icons_444444_256x240.png");
+}
+.ui-state-hover .ui-icon,
+.ui-state-focus .ui-icon,
+.ui-button:hover .ui-icon,
+.ui-button:focus .ui-icon {
+	background-image: url("images/ui-icons_555555_256x240.png");
+}
+.ui-state-active .ui-icon,
+.ui-button:active .ui-icon {
+	background-image: url("images/ui-icons_ffffff_256x240.png");
+}
+.ui-state-highlight .ui-icon,
+.ui-button .ui-state-highlight.ui-icon {
+	background-image: url("images/ui-icons_777620_256x240.png");
+}
+.ui-state-error .ui-icon,
+.ui-state-error-text .ui-icon {
+	background-image: url("images/ui-icons_cc0000_256x240.png");
+}
+.ui-button .ui-icon {
+	background-image: url("images/ui-icons_777777_256x240.png");
+}
 
 /* positioning */
-.ui-icon-carat-1-n { background-position: 0 0; }
-.ui-icon-carat-1-ne { background-position: -16px 0; }
-.ui-icon-carat-1-e { background-position: -32px 0; }
-.ui-icon-carat-1-se { background-position: -48px 0; }
-.ui-icon-carat-1-s { background-position: -64px 0; }
-.ui-icon-carat-1-sw { background-position: -80px 0; }
-.ui-icon-carat-1-w { background-position: -96px 0; }
-.ui-icon-carat-1-nw { background-position: -112px 0; }
-.ui-icon-carat-2-n-s { background-position: -128px 0; }
-.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-blank { background-position: 16px 16px; }
+.ui-icon-caret-1-n { background-position: 0 0; }
+.ui-icon-caret-1-ne { background-position: -16px 0; }
+.ui-icon-caret-1-e { background-position: -32px 0; }
+.ui-icon-caret-1-se { background-position: -48px 0; }
+.ui-icon-caret-1-s { background-position: -65px 0; }
+.ui-icon-caret-1-sw { background-position: -80px 0; }
+.ui-icon-caret-1-w { background-position: -96px 0; }
+.ui-icon-caret-1-nw { background-position: -112px 0; }
+.ui-icon-caret-2-n-s { background-position: -128px 0; }
+.ui-icon-caret-2-e-w { background-position: -144px 0; }
 .ui-icon-triangle-1-n { background-position: 0 -16px; }
 .ui-icon-triangle-1-ne { background-position: -16px -16px; }
 .ui-icon-triangle-1-e { background-position: -32px -16px; }
 .ui-icon-triangle-1-se { background-position: -48px -16px; }
-.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-s { background-position: -65px -16px; }
 .ui-icon-triangle-1-sw { background-position: -80px -16px; }
 .ui-icon-triangle-1-w { background-position: -96px -16px; }
 .ui-icon-triangle-1-nw { background-position: -112px -16px; }
@@ -123,7 +1118,7 @@
 .ui-icon-arrow-1-ne { background-position: -16px -32px; }
 .ui-icon-arrow-1-e { background-position: -32px -32px; }
 .ui-icon-arrow-1-se { background-position: -48px -32px; }
-.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-s { background-position: -65px -32px; }
 .ui-icon-arrow-1-sw { background-position: -80px -32px; }
 .ui-icon-arrow-1-w { background-position: -96px -32px; }
 .ui-icon-arrow-1-nw { background-position: -112px -32px; }
@@ -135,7 +1130,7 @@
 .ui-icon-arrowstop-1-e { background-position: -208px -32px; }
 .ui-icon-arrowstop-1-s { background-position: -224px -32px; }
 .ui-icon-arrowstop-1-w { background-position: -240px -32px; }
-.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-n { background-position: 1px -48px; }
 .ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
 .ui-icon-arrowthick-1-e { background-position: -32px -48px; }
 .ui-icon-arrowthick-1-se { background-position: -48px -48px; }
@@ -225,8 +1220,8 @@
 .ui-icon-help { background-position: -48px -144px; }
 .ui-icon-check { background-position: -64px -144px; }
 .ui-icon-bullet { background-position: -80px -144px; }
-.ui-icon-radio-off { background-position: -96px -144px; }
-.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-radio-on { background-position: -96px -144px; }
+.ui-icon-radio-off { background-position: -112px -144px; }
 .ui-icon-pin-w { background-position: -128px -144px; }
 .ui-icon-pin-s { background-position: -144px -144px; }
 .ui-icon-play { background-position: 0 -160px; }
@@ -280,289 +1275,38 @@
 ----------------------------------*/
 
 /* Corner radius */
-.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 6px; -webkit-border-top-left-radius: 6px; -khtml-border-top-left-radius: 6px; border-top-left-radius: 6px; }
-.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 6px; -webkit-border-top-right-radius: 6px; -khtml-border-top-right-radius: 6px; border-top-right-radius: 6px; }
-.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 6px; -webkit-border-bottom-left-radius: 6px; -khtml-border-bottom-left-radius: 6px; border-bottom-left-radius: 6px; }
-.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 6px; -webkit-border-bottom-right-radius: 6px; -khtml-border-bottom-right-radius: 6px; border-bottom-right-radius: 6px; }
-
-/* Overlays */
-.ui-widget-overlay { background: #2b2922 url(images/ui-bg_inset-soft_15_2b2922_1x100.png) 50% bottom repeat-x; opacity: .90;filter:Alpha(Opacity=90); }
-.ui-widget-shadow { margin: -12px 0 0 -12px; padding: 12px; background: #cccccc url(images/ui-bg_highlight-hard_95_cccccc_1x100.png) 50% top repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 10px; -khtml-border-radius: 10px; -webkit-border-radius: 10px; border-radius: 10px; }/*
- * jQuery UI Resizable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Resizable#theming
- */
-.ui-resizable { position: relative;}
-.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; }
-.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
-.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
-.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
-.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
-.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
-.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
-.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
-.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
-.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
- * jQuery UI Selectable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Selectable#theming
- */
-.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
-/*
- * jQuery UI Accordion 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Accordion#theming
- */
-/* IE/Win - Fix animation bug - #4615 */
-.ui-accordion { width: 100%; }
-.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
-.ui-accordion .ui-accordion-li-fix { display: inline; }
-.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
-.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
-.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
-.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
-.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
-.ui-accordion .ui-accordion-content-active { display: block; }
-/*
- * jQuery UI Autocomplete 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Autocomplete#theming
- */
-.ui-autocomplete { position: absolute; cursor: default; }	
-
-/* workarounds */
-* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
-
-/*
- * jQuery UI Menu 1.8.14
- *
- * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Menu#theming
- */
-.ui-menu {
-	list-style:none;
-	padding: 2px;
-	margin: 0;
-	display:block;
-	float: left;
+.ui-corner-all,
+.ui-corner-top,
+.ui-corner-left,
+.ui-corner-tl {
+	border-top-left-radius: 3px;
 }
-.ui-menu .ui-menu {
-	margin-top: -3px;
+.ui-corner-all,
+.ui-corner-top,
+.ui-corner-right,
+.ui-corner-tr {
+	border-top-right-radius: 3px;
 }
-.ui-menu .ui-menu-item {
-	margin:0;
-	padding: 0;
-	zoom: 1;
-	float: left;
-	clear: left;
-	width: 100%;
-}
-.ui-menu .ui-menu-item a {
-	text-decoration:none;
-	display:block;
-	padding:.2em .4em;
-	line-height:1.5;
-	zoom:1;
+.ui-corner-all,
+.ui-corner-bottom,
+.ui-corner-left,
+.ui-corner-bl {
+	border-bottom-left-radius: 3px;
 }
-.ui-menu .ui-menu-item a.ui-state-hover,
-.ui-menu .ui-menu-item a.ui-state-active {
-	font-weight: normal;
-	margin: -1px;
+.ui-corner-all,
+.ui-corner-bottom,
+.ui-corner-right,
+.ui-corner-br {
+	border-bottom-right-radius: 3px;
 }
-/*
- * jQuery UI Button 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Button#theming
- */
-.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
-.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
-button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
-.ui-button-icons-only { width: 3.4em; } 
-button.ui-button-icons-only { width: 3.7em; } 
-
-/*button text element */
-.ui-button .ui-button-text { display: block; line-height: 1.4;  }
-.ui-button-text-only .ui-button-text { padding: .4em 1em; }
-.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
-.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
-.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
-.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
-/* no icon support for input elements, provide padding by default */
-input.ui-button { padding: .4em 1em; }
-
-/*button icon element(s) */
-.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
-.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
-.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
-.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
-.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
-
-/*button sets*/
-.ui-buttonset { margin-right: 7px; }
-.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
 
-/* workarounds */
-button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
-/*
- * jQuery UI Dialog 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Dialog#theming
- */
-.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
-.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative;  }
-.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } 
-.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
-.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
-.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
-.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
-.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
-.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
-.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
-.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
-.ui-draggable .ui-dialog-titlebar { cursor: move; }
-/*
- * jQuery UI Slider 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Slider#theming
- */
-.ui-slider { position: relative; text-align: left; }
-.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
-.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
-
-.ui-slider-horizontal { height: .8em; }
-.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
-.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
-.ui-slider-horizontal .ui-slider-range-min { left: 0; }
-.ui-slider-horizontal .ui-slider-range-max { right: 0; }
-
-.ui-slider-vertical { width: .8em; height: 100px; }
-.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
-.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
-.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
-.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
- * jQuery UI Tabs 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Tabs#theming
- */
-.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
-.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
-.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
-.ui-tabs .ui-tabs-nav li a { float: left; padding: .4em 1em 0.4em .4em; text-decoration: none; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
-.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
-.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
-.ui-tabs .ui-tabs-hide { display: none !important; }
-/*
- * jQuery UI Datepicker 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Datepicker#theming
- */
-.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
-.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
-.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
-.ui-datepicker .ui-datepicker-prev { left:2px; }
-.ui-datepicker .ui-datepicker-next { right:2px; }
-.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
-.ui-datepicker .ui-datepicker-next-hover { right:1px; }
-.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px;  }
-.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
-.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
-.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
-.ui-datepicker select.ui-datepicker-month, 
-.ui-datepicker select.ui-datepicker-year { width: 49%;}
-.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
-.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0;  }
-.ui-datepicker td { border: 0; padding: 1px; }
-.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
-.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
-.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
-
-/* with multiple calendars */
-.ui-datepicker.ui-datepicker-multi { width:auto; }
-.ui-datepicker-multi .ui-datepicker-group { float:left; }
-.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
-.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
-.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
-.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
-.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
-.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
-
-/* RTL support */
-.ui-datepicker-rtl { direction: rtl; }
-.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-
-/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
-.ui-datepicker-cover {
-    display: none; /*sorry for IE5*/
-    display/**/: block; /*sorry for IE5*/
-    position: absolute; /*must have*/
-    z-index: -1; /*must have*/
-    filter: mask(); /*must have*/
-    top: -4px; /*must have*/
-    left: -4px; /*must have*/
-    width: 200px; /*must have*/
-    height: 200px; /*must have*/
-}/*
- * jQuery UI Progressbar 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Progressbar#theming
- */
-.ui-progressbar { height:2em; text-align: left; }
-.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
+/* Overlays */
+.ui-widget-overlay {
+	background: #aaaaaa;
+	opacity: .3;
+	filter: Alpha(Opacity=30); /* support: IE8 */
+}
+.ui-widget-shadow {
+	-webkit-box-shadow: 0px 0px 5px #666666;
+	box-shadow: 0px 0px 5px #666666;
+}
diff --git a/www/Themes/Centreon-2/style.css b/www/Themes/Centreon-2/style.css
index e0accae0ff..a666cc1c13 100644
--- a/www/Themes/Centreon-2/style.css
+++ b/www/Themes/Centreon-2/style.css
@@ -1003,6 +1003,11 @@ div.menuLeft {
     background: #fff !important;
 }
 
+.ui-state-default a {
+    color: #ffffff !important;
+    font-weight: bold;
+}
+
 .ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited {
     color: #00a499 !important;
 }
diff --git a/www/include/common/javascript/centreon/macroPasswordField.js b/www/include/common/javascript/centreon/macroPasswordField.js
index abe03df4cc..9b0af0bbcc 100644
--- a/www/include/common/javascript/centreon/macroPasswordField.js
+++ b/www/include/common/javascript/centreon/macroPasswordField.js
@@ -1,5 +1,5 @@
 /*
- * Copyright 2005-2015 Centreon
+ * Copyright 2005-2018 Centreon
  * Centreon is developped by : Julien Mathis and Romain Le Merlus under
  * GPL Licence 2.0.
  *
@@ -41,12 +41,12 @@ jQuery(function() {
 function change_macro_input_type(box, must_disable) {
     var tmp = box.id.split('_');
     var macro_dom_id = tmp[1];
-    var input = jQuery("#macroValue_" + macro_dom_id);
+    var input = jQuery("#macroValue_" + macro_dom_id.replace(/(#)/g, "\\$1"));
 
     if (must_disable === true) {
         jQuery(box).parent().hide();
     }
-    
+
     if (typeof input[0] != 'undefined') {
         if (box.checked) {
             input[0].type = 'password';
diff --git a/www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js b/www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js
new file mode 100644
index 0000000000..71a6e71921
--- /dev/null
+++ b/www/include/common/javascript/jquery/jquery-ui-tabs-rotate.js
@@ -0,0 +1,76 @@
+;(function($){
+	$.extend( $.ui.tabs.prototype, {
+		rotation: null,
+		rotationDelay: null,
+		continuing: null,
+		rotate: function( ms, continuing ) {
+			var self = this,
+				o = this.options;
+
+			if((ms > 1 || self.rotationDelay === null) && ms !== undefined){//only set rotationDelay if this is the first time through or if not immediately moving on from an unpause
+				self.rotationDelay = ms;
+			}
+
+			if(continuing !== undefined){
+				self.continuing = continuing;
+			}
+
+			var rotate = self._rotate || ( self._rotate = function( e ) {
+				clearTimeout( self.rotation );
+				self.rotation = setTimeout(function() {
+					var t = o.active;
+					self.option( "active",  ++t < self.anchors.length ? t : 0 );
+				}, ms );
+
+				if ( e ) {
+					e.stopPropagation();
+				}
+			});
+
+			var stop = self._unrotate || ( self._unrotate = !continuing
+				? function(e) {
+					if (e.clientX) { // in case of a true click
+						self.rotate(null);
+					}
+				}
+				: function( e ) {
+					t = o.active;
+					rotate();
+				});
+
+			// start rotation
+			if ( ms ) {
+				this.element.bind( "tabsactivate", rotate );
+				this.anchors.bind( o.event + ".tabs", $.proxy(self.unpause, self) );
+				rotate();
+			// stop rotation
+			} else {
+				clearTimeout( self.rotation );
+				this.element.unbind( "tabsactivate", rotate );
+				this.anchors.unbind( o.event + ".tabs", $.proxy(self.pause, self) );
+				delete this._rotate;
+				delete this._unrotate;
+			}
+
+			//rotate immediately and then have normal rotation delay
+			if(ms === 1){
+				//set ms back to what it was originally set to
+				ms = self.rotationDelay;
+			}
+
+			return this;
+		},
+		pause: function() {
+			var self = this,
+				o = this.options;
+
+			self.rotate(0);
+		},
+		unpause: function(){
+			var self = this,
+				o = this.options;
+
+			self.rotate(1, self.continuing);
+		}
+	});
+})(jQuery);
diff --git a/www/include/common/javascript/jquery/jquery-ui.js b/www/include/common/javascript/jquery/jquery-ui.js
index f9e4f1e840..e54edf070a 100644
--- a/www/include/common/javascript/jquery/jquery-ui.js
+++ b/www/include/common/javascript/jquery/jquery-ui.js
@@ -1,789 +1,18706 @@
+/*! jQuery UI - v1.12.1 - 2018-03-18
+* http://jqueryui.com
+* Includes: widget.js, position.js, data.js, disable-selection.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/draggable.js, widgets/droppable.js, widgets/resizable.js, widgets/selectable.js, widgets/sortable.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/selectmenu.js, widgets/slider.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js
+* Copyright jQuery Foundation and other contributors; Licensed MIT */
+
+(function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define([ "jquery" ], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}(function( $ ) {
+
+$.ui = $.ui || {};
+
+var version = $.ui.version = "1.12.1";
+
+
 /*!
- * jQuery UI 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI
- */
-(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14",
-keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();
-b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,
-"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",
-function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,
-outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b);
-return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=
-0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
-;/*!
- * jQuery UI Widget 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
-(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
-a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
-e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
-this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
-widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
-enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
-;/*!
- * jQuery UI Mouse 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Mouse
- *
- * Depends:
- *	jquery.ui.widget.js
- */
-(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
-this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!==
-false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&&
-!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
-false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
-;/*
- * jQuery UI Position 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Position
- */
-(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
-left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
-k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
-m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
-d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
-a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
-g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
-;/*
- * jQuery UI Draggable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Draggables
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.mouse.js
- *	jquery.ui.widget.js
- */
-(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
-"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
-this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper=
-this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});
-this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true},
-_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=
-false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,
-10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||
-!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&
-a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
-this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
-10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),
-10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,
-(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!=
-"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),
-10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+
-this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&
-!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left;
-if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/
-b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<
-526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,
-c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.14"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});
-h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=
-false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);
-this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;
-c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&
-this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=
-a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!=
-"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<
-c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
-width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&&
-o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t=
-p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&&
-(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
-10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
-;/*
- * jQuery UI Droppable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Droppables
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.widget.js
- *	jquery.ui.mouse.js
- *	jquery.ui.draggable.js
- */
-(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
-a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
-this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
-this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
-d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
-a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.14"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
-switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
-i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
-"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
-a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parentsUntil("body").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=
-!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parentsUntil("body").unbind("scroll.droppable");
-a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery);
-;/*
- * jQuery UI Resizable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Resizables
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.mouse.js
- *	jquery.ui.widget.js
- */
-(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
-_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
-top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
-this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
-nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
-String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
-this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
-var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=
-false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});
-this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff=
-{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];
-if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},
-_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,
-{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight:
-Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width=
-b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&&
-a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=
-null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||
-0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+
-a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+
-c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);
-b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),
-10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-
-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?
-e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=
-e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,
-step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=
-e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;
-var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:
-a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-
-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,
-f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,
-display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=
-e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=
-d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
-;/*
- * jQuery UI Selectable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Selectables
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.mouse.js
- *	jquery.ui.widget.js
- */
-(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
-selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
-c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
-c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
-this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
-a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
-!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
-e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.14"})})(jQuery);
-;/*
- * jQuery UI Sortable 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Sortables
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.mouse.js
- *	jquery.ui.widget.js
- */
-(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable");
-this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a===
-"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&
-!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,
-left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
-this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
-document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
-return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<
-b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-
-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,
-a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
-e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
-c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
-this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
-dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
-toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||
-this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();
-var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},
-_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
-if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
-this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),
-this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&
-this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=
-this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=
-d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||
-0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",
-a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-
-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=
-this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==
-""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=
-this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a=
-{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),
-10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?
-document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
-10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=
-this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&
-this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();
-var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-
-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-
-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],
-this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]=
-"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",
-f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,
-this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",
-a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},
-_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.14"})})(jQuery);
-;/*
- * jQuery UI Accordion 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Accordion
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.widget.js
- */
-(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
-a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
-if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
-function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
-this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
-this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
-b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
-a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
-c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
-if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
-if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
-e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
-e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
-"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14",
-animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
-f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
-paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
-;/*
- * jQuery UI Autocomplete 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Autocomplete
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.widget.js
- *	jquery.ui.position.js
- */
-(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
-false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
-a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
-this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
-a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
-d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
-b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
-this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
-this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
-b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
-d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
-"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
-(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
--1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
-this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,
-this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
-this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
-this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
-;/*
- * jQuery UI Button 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Button
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.widget.js
- */
-(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!==
-"boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover");
-this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g=
-false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed",true);
-var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE||
-d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type===
-"radio"){var a=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element},
-widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active  ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title");
-b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true):
-b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
-c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only":
-"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")===
-"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");
-b.Widget.prototype.destroy.call(this)}})})(jQuery);
-;/*
- * jQuery UI Dialog 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.widget.js
- *  jquery.ui.button.js
- *	jquery.ui.draggable.js
- *	jquery.ui.mouse.js
- *	jquery.ui.position.js
- *	jquery.ui.resizable.js
- */
-(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
-position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
-b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
-h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",
-e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
-a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
-b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=
-1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
-f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,
-function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
-handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,
-originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",
-f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):
-[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);
-if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):
-e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=
-this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-
-b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),
-create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
-height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
-b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=
-a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
-;/*
- * jQuery UI Slider 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.mouse.js
- *	jquery.ui.widget.js
- */
-(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=a.values&&a.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+
-this.orientation+" ui-widget ui-widget-content ui-corner-all"+(a.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(a.range){if(a.range===true){if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>");
-this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle",
-g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length?
-(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i-
-m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
-return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false;
-this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a=
-this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a=
-this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);
-c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c<f))c=f;if(c!==this.values(a)){f=this.values();f[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:f});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],value:c});
-b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
-this._trimAlignValue(b);this._refreshValue();this._change(null,0)}else return this._value()},values:function(b,a){var c,f,e;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):
-this.value();else return this._values()},_setOption:function(b,a){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
-this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
-return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
-_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate);
-if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
-1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery);
-;/*
- * jQuery UI Tabs 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Tabs
- *
- * Depends:
- *	jquery.ui.core.js
- *	jquery.ui.widget.js
- */
-(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
-e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
-d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
-(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
-this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
-this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
-if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
-this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
-g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
-function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
-this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
--1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
-d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
-d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
-e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
-j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
-if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
-this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
-load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
-"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
-url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&
-a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
-;/*
- * jQuery UI Datepicker 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- *	jquery.ui.core.js
- */
-(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
-"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
-"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
-minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout",function(b){b=
-d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover");
-b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults,
-a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,
-selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=
-h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=
-this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,
-"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",
-function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);
-a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",
-this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",
-this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=
-b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",
-cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},
-_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,
-"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,
-b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);
-c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);
-c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||
-a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=
-d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);
-d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=
-d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c=
-{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");
-if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);
-J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");
-a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||
-c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+
-i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=
-this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",
-left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&
-d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=
-b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=
-!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);
-a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));
-d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%
-100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1<a.length&&a.charAt(B+1)==p)&&B++;return p},m=function(p){var D=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+=
-p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s=function(){if(b.charAt(q)!=a.charAt(B))throw"Unexpected literal at position "+q;q++},q=0,B=0;B<a.length;B++)if(k)if(a.charAt(B)=="'"&&!o("'"))k=false;
-else s();else switch(a.charAt(B)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q);
-if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",
-TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<
-n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h,
-c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+=
-"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=
-f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=
-(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,
-l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
-a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
-b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
-this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+
-(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+
-(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+A+'.datepicker._hideDatepicker();">'+this._get(a,
-"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B=
-this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O="";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":
-"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":
-"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+
-this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()==P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+
-this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+A+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?"&#xa0;":L?'<span class="ui-state-default">'+r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+
-r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),
-l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+
-n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?"&#xa0;":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):
-g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?"&#xa0;":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c==
-"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");
-if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
-c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
-"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
-function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,
-[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery);
-;/*
- * jQuery UI Progressbar 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Progressbar
- *
- * Depends:
- *   jquery.ui.core.js
- *   jquery.ui.widget.js
- */
-(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
-this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
-this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery);
-;/*
- * jQuery UI Effects 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/
- */
-jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
-16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
-a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
-a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
-"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
-0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
-211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
-d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})};
-f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this,
-[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b=
-0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});
-c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c,
-a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);
-a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%",
-"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*
-((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=
-e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=
-e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/
-h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*
-h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,
-e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
-;/*
- * jQuery UI Effects Blind 1.8.14
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Blind
- *
- * Depends:
- *	jquery.effects.core.js
- */
-(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
-g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
-;/*
- * jQuery UI Effects Bounce 1.8.14
+ * jQuery UI Widget 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Widget
+//>>group: Core
+//>>description: Provides a factory for creating stateful widgets with a common API.
+//>>docs: http://api.jqueryui.com/jQuery.widget/
+//>>demos: http://jqueryui.com/widget/
+
+
+
+var widgetUuid = 0;
+var widgetSlice = Array.prototype.slice;
+
+$.cleanData = ( function( orig ) {
+	return function( elems ) {
+		var events, elem, i;
+		for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) {
+			try {
+
+				// Only trigger remove when necessary to save time
+				events = $._data( elem, "events" );
+				if ( events && events.remove ) {
+					$( elem ).triggerHandler( "remove" );
+				}
+
+			// Http://bugs.jquery.com/ticket/8235
+			} catch ( e ) {}
+		}
+		orig( elems );
+	};
+} )( $.cleanData );
+
+$.widget = function( name, base, prototype ) {
+	var existingConstructor, constructor, basePrototype;
+
+	// ProxiedPrototype allows the provided prototype to remain unmodified
+	// so that it can be used as a mixin for multiple widgets (#8876)
+	var proxiedPrototype = {};
+
+	var namespace = name.split( "." )[ 0 ];
+	name = name.split( "." )[ 1 ];
+	var fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	if ( $.isArray( prototype ) ) {
+		prototype = $.extend.apply( null, [ {} ].concat( prototype ) );
+	}
+
+	// Create selector for plugin
+	$.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
+		return !!$.data( elem, fullName );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	existingConstructor = $[ namespace ][ name ];
+	constructor = $[ namespace ][ name ] = function( options, element ) {
+
+		// Allow instantiation without "new" keyword
+		if ( !this._createWidget ) {
+			return new constructor( options, element );
+		}
+
+		// Allow instantiation without initializing for simple inheritance
+		// must use "new" keyword (the code above always passes args)
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	// Extend with the existing constructor to carry over any static properties
+	$.extend( constructor, existingConstructor, {
+		version: prototype.version,
+
+		// Copy the object used to create the prototype in case we need to
+		// redefine the widget later
+		_proto: $.extend( {}, prototype ),
+
+		// Track widgets that inherit from this widget in case this widget is
+		// redefined after a widget inherits from it
+		_childConstructors: []
+	} );
+
+	basePrototype = new base();
+
+	// We need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+	basePrototype.options = $.widget.extend( {}, basePrototype.options );
+	$.each( prototype, function( prop, value ) {
+		if ( !$.isFunction( value ) ) {
+			proxiedPrototype[ prop ] = value;
+			return;
+		}
+		proxiedPrototype[ prop ] = ( function() {
+			function _super() {
+				return base.prototype[ prop ].apply( this, arguments );
+			}
+
+			function _superApply( args ) {
+				return base.prototype[ prop ].apply( this, args );
+			}
+
+			return function() {
+				var __super = this._super;
+				var __superApply = this._superApply;
+				var returnValue;
+
+				this._super = _super;
+				this._superApply = _superApply;
+
+				returnValue = value.apply( this, arguments );
+
+				this._super = __super;
+				this._superApply = __superApply;
+
+				return returnValue;
+			};
+		} )();
+	} );
+	constructor.prototype = $.widget.extend( basePrototype, {
+
+		// TODO: remove support for widgetEventPrefix
+		// always use the name + a colon as the prefix, e.g., draggable:start
+		// don't prefix for widgets that aren't DOM-based
+		widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name
+	}, proxiedPrototype, {
+		constructor: constructor,
+		namespace: namespace,
+		widgetName: name,
+		widgetFullName: fullName
+	} );
+
+	// If this widget is being redefined then we need to find all widgets that
+	// are inheriting from it and redefine all of them so that they inherit from
+	// the new version of this widget. We're essentially trying to replace one
+	// level in the prototype chain.
+	if ( existingConstructor ) {
+		$.each( existingConstructor._childConstructors, function( i, child ) {
+			var childPrototype = child.prototype;
+
+			// Redefine the child widget using the same prototype that was
+			// originally used, but inherit from the new version of the base
+			$.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor,
+				child._proto );
+		} );
+
+		// Remove the list of existing child constructors from the old constructor
+		// so the old child constructors can be garbage collected
+		delete existingConstructor._childConstructors;
+	} else {
+		base._childConstructors.push( constructor );
+	}
+
+	$.widget.bridge( name, constructor );
+
+	return constructor;
+};
+
+$.widget.extend = function( target ) {
+	var input = widgetSlice.call( arguments, 1 );
+	var inputIndex = 0;
+	var inputLength = input.length;
+	var key;
+	var value;
+
+	for ( ; inputIndex < inputLength; inputIndex++ ) {
+		for ( key in input[ inputIndex ] ) {
+			value = input[ inputIndex ][ key ];
+			if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
+
+				// Clone objects
+				if ( $.isPlainObject( value ) ) {
+					target[ key ] = $.isPlainObject( target[ key ] ) ?
+						$.widget.extend( {}, target[ key ], value ) :
+
+						// Don't extend strings, arrays, etc. with objects
+						$.widget.extend( {}, value );
+
+				// Copy everything else by reference
+				} else {
+					target[ key ] = value;
+				}
+			}
+		}
+	}
+	return target;
+};
+
+$.widget.bridge = function( name, object ) {
+	var fullName = object.prototype.widgetFullName || name;
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string";
+		var args = widgetSlice.call( arguments, 1 );
+		var returnValue = this;
+
+		if ( isMethodCall ) {
+
+			// If this is an empty collection, we need to have the instance method
+			// return undefined instead of the jQuery instance
+			if ( !this.length && options === "instance" ) {
+				returnValue = undefined;
+			} else {
+				this.each( function() {
+					var methodValue;
+					var instance = $.data( this, fullName );
+
+					if ( options === "instance" ) {
+						returnValue = instance;
+						return false;
+					}
+
+					if ( !instance ) {
+						return $.error( "cannot call methods on " + name +
+							" prior to initialization; " +
+							"attempted to call method '" + options + "'" );
+					}
+
+					if ( !$.isFunction( instance[ options ] ) || options.charAt( 0 ) === "_" ) {
+						return $.error( "no such method '" + options + "' for " + name +
+							" widget instance" );
+					}
+
+					methodValue = instance[ options ].apply( instance, args );
+
+					if ( methodValue !== instance && methodValue !== undefined ) {
+						returnValue = methodValue && methodValue.jquery ?
+							returnValue.pushStack( methodValue.get() ) :
+							methodValue;
+						return false;
+					}
+				} );
+			}
+		} else {
+
+			// Allow multiple hashes to be passed on init
+			if ( args.length ) {
+				options = $.widget.extend.apply( null, [ options ].concat( args ) );
+			}
+
+			this.each( function() {
+				var instance = $.data( this, fullName );
+				if ( instance ) {
+					instance.option( options || {} );
+					if ( instance._init ) {
+						instance._init();
+					}
+				} else {
+					$.data( this, fullName, new object( options, this ) );
+				}
+			} );
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( /* options, element */ ) {};
+$.Widget._childConstructors = [];
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	defaultElement: "<div>",
+
+	options: {
+		classes: {},
+		disabled: false,
+
+		// Callbacks
+		create: null
+	},
+
+	_createWidget: function( options, element ) {
+		element = $( element || this.defaultElement || this )[ 0 ];
+		this.element = $( element );
+		this.uuid = widgetUuid++;
+		this.eventNamespace = "." + this.widgetName + this.uuid;
+
+		this.bindings = $();
+		this.hoverable = $();
+		this.focusable = $();
+		this.classesElementLookup = {};
+
+		if ( element !== this ) {
+			$.data( element, this.widgetFullName, this );
+			this._on( true, this.element, {
+				remove: function( event ) {
+					if ( event.target === element ) {
+						this.destroy();
+					}
+				}
+			} );
+			this.document = $( element.style ?
+
+				// Element within the document
+				element.ownerDocument :
+
+				// Element is window or document
+				element.document || element );
+			this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow );
+		}
+
+		this.options = $.widget.extend( {},
+			this.options,
+			this._getCreateOptions(),
+			options );
+
+		this._create();
+
+		if ( this.options.disabled ) {
+			this._setOptionDisabled( this.options.disabled );
+		}
+
+		this._trigger( "create", null, this._getCreateEventData() );
+		this._init();
+	},
+
+	_getCreateOptions: function() {
+		return {};
+	},
+
+	_getCreateEventData: $.noop,
+
+	_create: $.noop,
+
+	_init: $.noop,
+
+	destroy: function() {
+		var that = this;
+
+		this._destroy();
+		$.each( this.classesElementLookup, function( key, value ) {
+			that._removeClass( value, key );
+		} );
+
+		// We can probably remove the unbind calls in 2.0
+		// all event bindings should go through this._on()
+		this.element
+			.off( this.eventNamespace )
+			.removeData( this.widgetFullName );
+		this.widget()
+			.off( this.eventNamespace )
+			.removeAttr( "aria-disabled" );
+
+		// Clean up events and states
+		this.bindings.off( this.eventNamespace );
+	},
+
+	_destroy: $.noop,
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key;
+		var parts;
+		var curOption;
+		var i;
+
+		if ( arguments.length === 0 ) {
+
+			// Don't return a reference to the internal hash
+			return $.widget.extend( {}, this.options );
+		}
+
+		if ( typeof key === "string" ) {
+
+			// Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
+			options = {};
+			parts = key.split( "." );
+			key = parts.shift();
+			if ( parts.length ) {
+				curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
+				for ( i = 0; i < parts.length - 1; i++ ) {
+					curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
+					curOption = curOption[ parts[ i ] ];
+				}
+				key = parts.pop();
+				if ( arguments.length === 1 ) {
+					return curOption[ key ] === undefined ? null : curOption[ key ];
+				}
+				curOption[ key ] = value;
+			} else {
+				if ( arguments.length === 1 ) {
+					return this.options[ key ] === undefined ? null : this.options[ key ];
+				}
+				options[ key ] = value;
+			}
+		}
+
+		this._setOptions( options );
+
+		return this;
+	},
+
+	_setOptions: function( options ) {
+		var key;
+
+		for ( key in options ) {
+			this._setOption( key, options[ key ] );
+		}
+
+		return this;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "classes" ) {
+			this._setOptionClasses( value );
+		}
+
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this._setOptionDisabled( value );
+		}
+
+		return this;
+	},
+
+	_setOptionClasses: function( value ) {
+		var classKey, elements, currentElements;
+
+		for ( classKey in value ) {
+			currentElements = this.classesElementLookup[ classKey ];
+			if ( value[ classKey ] === this.options.classes[ classKey ] ||
+					!currentElements ||
+					!currentElements.length ) {
+				continue;
+			}
+
+			// We are doing this to create a new jQuery object because the _removeClass() call
+			// on the next line is going to destroy the reference to the current elements being
+			// tracked. We need to save a copy of this collection so that we can add the new classes
+			// below.
+			elements = $( currentElements.get() );
+			this._removeClass( currentElements, classKey );
+
+			// We don't use _addClass() here, because that uses this.options.classes
+			// for generating the string of classes. We want to use the value passed in from
+			// _setOption(), this is the new value of the classes option which was passed to
+			// _setOption(). We pass this value directly to _classes().
+			elements.addClass( this._classes( {
+				element: elements,
+				keys: classKey,
+				classes: value,
+				add: true
+			} ) );
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value );
+
+		// If the widget is becoming disabled, then nothing is interactive
+		if ( value ) {
+			this._removeClass( this.hoverable, null, "ui-state-hover" );
+			this._removeClass( this.focusable, null, "ui-state-focus" );
+		}
+	},
+
+	enable: function() {
+		return this._setOptions( { disabled: false } );
+	},
+
+	disable: function() {
+		return this._setOptions( { disabled: true } );
+	},
+
+	_classes: function( options ) {
+		var full = [];
+		var that = this;
+
+		options = $.extend( {
+			element: this.element,
+			classes: this.options.classes || {}
+		}, options );
+
+		function processClassString( classes, checkOption ) {
+			var current, i;
+			for ( i = 0; i < classes.length; i++ ) {
+				current = that.classesElementLookup[ classes[ i ] ] || $();
+				if ( options.add ) {
+					current = $( $.unique( current.get().concat( options.element.get() ) ) );
+				} else {
+					current = $( current.not( options.element ).get() );
+				}
+				that.classesElementLookup[ classes[ i ] ] = current;
+				full.push( classes[ i ] );
+				if ( checkOption && options.classes[ classes[ i ] ] ) {
+					full.push( options.classes[ classes[ i ] ] );
+				}
+			}
+		}
+
+		this._on( options.element, {
+			"remove": "_untrackClassesElement"
+		} );
+
+		if ( options.keys ) {
+			processClassString( options.keys.match( /\S+/g ) || [], true );
+		}
+		if ( options.extra ) {
+			processClassString( options.extra.match( /\S+/g ) || [] );
+		}
+
+		return full.join( " " );
+	},
+
+	_untrackClassesElement: function( event ) {
+		var that = this;
+		$.each( that.classesElementLookup, function( key, value ) {
+			if ( $.inArray( event.target, value ) !== -1 ) {
+				that.classesElementLookup[ key ] = $( value.not( event.target ).get() );
+			}
+		} );
+	},
+
+	_removeClass: function( element, keys, extra ) {
+		return this._toggleClass( element, keys, extra, false );
+	},
+
+	_addClass: function( element, keys, extra ) {
+		return this._toggleClass( element, keys, extra, true );
+	},
+
+	_toggleClass: function( element, keys, extra, add ) {
+		add = ( typeof add === "boolean" ) ? add : extra;
+		var shift = ( typeof element === "string" || element === null ),
+			options = {
+				extra: shift ? keys : extra,
+				keys: shift ? element : keys,
+				element: shift ? this.element : element,
+				add: add
+			};
+		options.element.toggleClass( this._classes( options ), add );
+		return this;
+	},
+
+	_on: function( suppressDisabledCheck, element, handlers ) {
+		var delegateElement;
+		var instance = this;
+
+		// No suppressDisabledCheck flag, shuffle arguments
+		if ( typeof suppressDisabledCheck !== "boolean" ) {
+			handlers = element;
+			element = suppressDisabledCheck;
+			suppressDisabledCheck = false;
+		}
+
+		// No element argument, shuffle and use this.element
+		if ( !handlers ) {
+			handlers = element;
+			element = this.element;
+			delegateElement = this.widget();
+		} else {
+			element = delegateElement = $( element );
+			this.bindings = this.bindings.add( element );
+		}
+
+		$.each( handlers, function( event, handler ) {
+			function handlerProxy() {
+
+				// Allow widgets to customize the disabled handling
+				// - disabled as an array instead of boolean
+				// - disabled class as method for disabling individual parts
+				if ( !suppressDisabledCheck &&
+						( instance.options.disabled === true ||
+						$( this ).hasClass( "ui-state-disabled" ) ) ) {
+					return;
+				}
+				return ( typeof handler === "string" ? instance[ handler ] : handler )
+					.apply( instance, arguments );
+			}
+
+			// Copy the guid so direct unbinding works
+			if ( typeof handler !== "string" ) {
+				handlerProxy.guid = handler.guid =
+					handler.guid || handlerProxy.guid || $.guid++;
+			}
+
+			var match = event.match( /^([\w:-]*)\s*(.*)$/ );
+			var eventName = match[ 1 ] + instance.eventNamespace;
+			var selector = match[ 2 ];
+
+			if ( selector ) {
+				delegateElement.on( eventName, selector, handlerProxy );
+			} else {
+				element.on( eventName, handlerProxy );
+			}
+		} );
+	},
+
+	_off: function( element, eventName ) {
+		eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) +
+			this.eventNamespace;
+		element.off( eventName ).off( eventName );
+
+		// Clear the stack to avoid memory leaks (#10056)
+		this.bindings = $( this.bindings.not( element ).get() );
+		this.focusable = $( this.focusable.not( element ).get() );
+		this.hoverable = $( this.hoverable.not( element ).get() );
+	},
+
+	_delay: function( handler, delay ) {
+		function handlerProxy() {
+			return ( typeof handler === "string" ? instance[ handler ] : handler )
+				.apply( instance, arguments );
+		}
+		var instance = this;
+		return setTimeout( handlerProxy, delay || 0 );
+	},
+
+	_hoverable: function( element ) {
+		this.hoverable = this.hoverable.add( element );
+		this._on( element, {
+			mouseenter: function( event ) {
+				this._addClass( $( event.currentTarget ), null, "ui-state-hover" );
+			},
+			mouseleave: function( event ) {
+				this._removeClass( $( event.currentTarget ), null, "ui-state-hover" );
+			}
+		} );
+	},
+
+	_focusable: function( element ) {
+		this.focusable = this.focusable.add( element );
+		this._on( element, {
+			focusin: function( event ) {
+				this._addClass( $( event.currentTarget ), null, "ui-state-focus" );
+			},
+			focusout: function( event ) {
+				this._removeClass( $( event.currentTarget ), null, "ui-state-focus" );
+			}
+		} );
+	},
+
+	_trigger: function( type, event, data ) {
+		var prop, orig;
+		var callback = this.options[ type ];
+
+		data = data || {};
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+
+		// The original event may come from any element
+		// so we need to reset the target on the new event
+		event.target = this.element[ 0 ];
+
+		// Copy original event properties over to the new event
+		orig = event.originalEvent;
+		if ( orig ) {
+			for ( prop in orig ) {
+				if ( !( prop in event ) ) {
+					event[ prop ] = orig[ prop ];
+				}
+			}
+		}
+
+		this.element.trigger( event, data );
+		return !( $.isFunction( callback ) &&
+			callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
+	$.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
+		if ( typeof options === "string" ) {
+			options = { effect: options };
+		}
+
+		var hasOptions;
+		var effectName = !options ?
+			method :
+			options === true || typeof options === "number" ?
+				defaultEffect :
+				options.effect || defaultEffect;
+
+		options = options || {};
+		if ( typeof options === "number" ) {
+			options = { duration: options };
+		}
+
+		hasOptions = !$.isEmptyObject( options );
+		options.complete = callback;
+
+		if ( options.delay ) {
+			element.delay( options.delay );
+		}
+
+		if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) {
+			element[ method ]( options );
+		} else if ( effectName !== method && element[ effectName ] ) {
+			element[ effectName ]( options.duration, options.easing, callback );
+		} else {
+			element.queue( function( next ) {
+				$( this )[ method ]();
+				if ( callback ) {
+					callback.call( element[ 0 ] );
+				}
+				next();
+			} );
+		}
+	};
+} );
+
+var widget = $.widget;
+
+
+/*!
+ * jQuery UI Position 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/position/
+ */
+
+//>>label: Position
+//>>group: Core
+//>>description: Positions elements relative to other elements.
+//>>docs: http://api.jqueryui.com/position/
+//>>demos: http://jqueryui.com/position/
+
+
+( function() {
+var cachedScrollbarWidth,
+	max = Math.max,
+	abs = Math.abs,
+	rhorizontal = /left|center|right/,
+	rvertical = /top|center|bottom/,
+	roffset = /[\+\-]\d+(\.[\d]+)?%?/,
+	rposition = /^\w+/,
+	rpercent = /%$/,
+	_position = $.fn.position;
+
+function getOffsets( offsets, width, height ) {
+	return [
+		parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ),
+		parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 )
+	];
+}
+
+function parseCss( element, property ) {
+	return parseInt( $.css( element, property ), 10 ) || 0;
+}
+
+function getDimensions( elem ) {
+	var raw = elem[ 0 ];
+	if ( raw.nodeType === 9 ) {
+		return {
+			width: elem.width(),
+			height: elem.height(),
+			offset: { top: 0, left: 0 }
+		};
+	}
+	if ( $.isWindow( raw ) ) {
+		return {
+			width: elem.width(),
+			height: elem.height(),
+			offset: { top: elem.scrollTop(), left: elem.scrollLeft() }
+		};
+	}
+	if ( raw.preventDefault ) {
+		return {
+			width: 0,
+			height: 0,
+			offset: { top: raw.pageY, left: raw.pageX }
+		};
+	}
+	return {
+		width: elem.outerWidth(),
+		height: elem.outerHeight(),
+		offset: elem.offset()
+	};
+}
+
+$.position = {
+	scrollbarWidth: function() {
+		if ( cachedScrollbarWidth !== undefined ) {
+			return cachedScrollbarWidth;
+		}
+		var w1, w2,
+			div = $( "<div " +
+				"style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" +
+				"<div style='height:100px;width:auto;'></div></div>" ),
+			innerDiv = div.children()[ 0 ];
+
+		$( "body" ).append( div );
+		w1 = innerDiv.offsetWidth;
+		div.css( "overflow", "scroll" );
+
+		w2 = innerDiv.offsetWidth;
+
+		if ( w1 === w2 ) {
+			w2 = div[ 0 ].clientWidth;
+		}
+
+		div.remove();
+
+		return ( cachedScrollbarWidth = w1 - w2 );
+	},
+	getScrollInfo: function( within ) {
+		var overflowX = within.isWindow || within.isDocument ? "" :
+				within.element.css( "overflow-x" ),
+			overflowY = within.isWindow || within.isDocument ? "" :
+				within.element.css( "overflow-y" ),
+			hasOverflowX = overflowX === "scroll" ||
+				( overflowX === "auto" && within.width < within.element[ 0 ].scrollWidth ),
+			hasOverflowY = overflowY === "scroll" ||
+				( overflowY === "auto" && within.height < within.element[ 0 ].scrollHeight );
+		return {
+			width: hasOverflowY ? $.position.scrollbarWidth() : 0,
+			height: hasOverflowX ? $.position.scrollbarWidth() : 0
+		};
+	},
+	getWithinInfo: function( element ) {
+		var withinElement = $( element || window ),
+			isWindow = $.isWindow( withinElement[ 0 ] ),
+			isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9,
+			hasOffset = !isWindow && !isDocument;
+		return {
+			element: withinElement,
+			isWindow: isWindow,
+			isDocument: isDocument,
+			offset: hasOffset ? $( element ).offset() : { left: 0, top: 0 },
+			scrollLeft: withinElement.scrollLeft(),
+			scrollTop: withinElement.scrollTop(),
+			width: withinElement.outerWidth(),
+			height: withinElement.outerHeight()
+		};
+	}
+};
+
+$.fn.position = function( options ) {
+	if ( !options || !options.of ) {
+		return _position.apply( this, arguments );
+	}
+
+	// Make a copy, we don't want to modify arguments
+	options = $.extend( {}, options );
+
+	var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
+		target = $( options.of ),
+		within = $.position.getWithinInfo( options.within ),
+		scrollInfo = $.position.getScrollInfo( within ),
+		collision = ( options.collision || "flip" ).split( " " ),
+		offsets = {};
+
+	dimensions = getDimensions( target );
+	if ( target[ 0 ].preventDefault ) {
+
+		// Force left top to allow flipping
+		options.at = "left top";
+	}
+	targetWidth = dimensions.width;
+	targetHeight = dimensions.height;
+	targetOffset = dimensions.offset;
+
+	// Clone to reuse original targetOffset later
+	basePosition = $.extend( {}, targetOffset );
+
+	// Force my and at to have valid horizontal and vertical positions
+	// if a value is missing or invalid, it will be converted to center
+	$.each( [ "my", "at" ], function() {
+		var pos = ( options[ this ] || "" ).split( " " ),
+			horizontalOffset,
+			verticalOffset;
+
+		if ( pos.length === 1 ) {
+			pos = rhorizontal.test( pos[ 0 ] ) ?
+				pos.concat( [ "center" ] ) :
+				rvertical.test( pos[ 0 ] ) ?
+					[ "center" ].concat( pos ) :
+					[ "center", "center" ];
+		}
+		pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center";
+		pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center";
+
+		// Calculate offsets
+		horizontalOffset = roffset.exec( pos[ 0 ] );
+		verticalOffset = roffset.exec( pos[ 1 ] );
+		offsets[ this ] = [
+			horizontalOffset ? horizontalOffset[ 0 ] : 0,
+			verticalOffset ? verticalOffset[ 0 ] : 0
+		];
+
+		// Reduce to just the positions without the offsets
+		options[ this ] = [
+			rposition.exec( pos[ 0 ] )[ 0 ],
+			rposition.exec( pos[ 1 ] )[ 0 ]
+		];
+	} );
+
+	// Normalize collision option
+	if ( collision.length === 1 ) {
+		collision[ 1 ] = collision[ 0 ];
+	}
+
+	if ( options.at[ 0 ] === "right" ) {
+		basePosition.left += targetWidth;
+	} else if ( options.at[ 0 ] === "center" ) {
+		basePosition.left += targetWidth / 2;
+	}
+
+	if ( options.at[ 1 ] === "bottom" ) {
+		basePosition.top += targetHeight;
+	} else if ( options.at[ 1 ] === "center" ) {
+		basePosition.top += targetHeight / 2;
+	}
+
+	atOffset = getOffsets( offsets.at, targetWidth, targetHeight );
+	basePosition.left += atOffset[ 0 ];
+	basePosition.top += atOffset[ 1 ];
+
+	return this.each( function() {
+		var collisionPosition, using,
+			elem = $( this ),
+			elemWidth = elem.outerWidth(),
+			elemHeight = elem.outerHeight(),
+			marginLeft = parseCss( this, "marginLeft" ),
+			marginTop = parseCss( this, "marginTop" ),
+			collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) +
+				scrollInfo.width,
+			collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) +
+				scrollInfo.height,
+			position = $.extend( {}, basePosition ),
+			myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() );
+
+		if ( options.my[ 0 ] === "right" ) {
+			position.left -= elemWidth;
+		} else if ( options.my[ 0 ] === "center" ) {
+			position.left -= elemWidth / 2;
+		}
+
+		if ( options.my[ 1 ] === "bottom" ) {
+			position.top -= elemHeight;
+		} else if ( options.my[ 1 ] === "center" ) {
+			position.top -= elemHeight / 2;
+		}
+
+		position.left += myOffset[ 0 ];
+		position.top += myOffset[ 1 ];
+
+		collisionPosition = {
+			marginLeft: marginLeft,
+			marginTop: marginTop
+		};
+
+		$.each( [ "left", "top" ], function( i, dir ) {
+			if ( $.ui.position[ collision[ i ] ] ) {
+				$.ui.position[ collision[ i ] ][ dir ]( position, {
+					targetWidth: targetWidth,
+					targetHeight: targetHeight,
+					elemWidth: elemWidth,
+					elemHeight: elemHeight,
+					collisionPosition: collisionPosition,
+					collisionWidth: collisionWidth,
+					collisionHeight: collisionHeight,
+					offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ],
+					my: options.my,
+					at: options.at,
+					within: within,
+					elem: elem
+				} );
+			}
+		} );
+
+		if ( options.using ) {
+
+			// Adds feedback as second argument to using callback, if present
+			using = function( props ) {
+				var left = targetOffset.left - position.left,
+					right = left + targetWidth - elemWidth,
+					top = targetOffset.top - position.top,
+					bottom = top + targetHeight - elemHeight,
+					feedback = {
+						target: {
+							element: target,
+							left: targetOffset.left,
+							top: targetOffset.top,
+							width: targetWidth,
+							height: targetHeight
+						},
+						element: {
+							element: elem,
+							left: position.left,
+							top: position.top,
+							width: elemWidth,
+							height: elemHeight
+						},
+						horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
+						vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
+					};
+				if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) {
+					feedback.horizontal = "center";
+				}
+				if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) {
+					feedback.vertical = "middle";
+				}
+				if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) {
+					feedback.important = "horizontal";
+				} else {
+					feedback.important = "vertical";
+				}
+				options.using.call( this, props, feedback );
+			};
+		}
+
+		elem.offset( $.extend( position, { using: using } ) );
+	} );
+};
+
+$.ui.position = {
+	fit: {
+		left: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
+				outerWidth = within.width,
+				collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+				overLeft = withinOffset - collisionPosLeft,
+				overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
+				newOverRight;
+
+			// Element is wider than within
+			if ( data.collisionWidth > outerWidth ) {
+
+				// Element is initially over the left side of within
+				if ( overLeft > 0 && overRight <= 0 ) {
+					newOverRight = position.left + overLeft + data.collisionWidth - outerWidth -
+						withinOffset;
+					position.left += overLeft - newOverRight;
+
+				// Element is initially over right side of within
+				} else if ( overRight > 0 && overLeft <= 0 ) {
+					position.left = withinOffset;
+
+				// Element is initially over both left and right sides of within
+				} else {
+					if ( overLeft > overRight ) {
+						position.left = withinOffset + outerWidth - data.collisionWidth;
+					} else {
+						position.left = withinOffset;
+					}
+				}
+
+			// Too far left -> align with left edge
+			} else if ( overLeft > 0 ) {
+				position.left += overLeft;
+
+			// Too far right -> align with right edge
+			} else if ( overRight > 0 ) {
+				position.left -= overRight;
+
+			// Adjust based on position and margin
+			} else {
+				position.left = max( position.left - collisionPosLeft, position.left );
+			}
+		},
+		top: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
+				outerHeight = data.within.height,
+				collisionPosTop = position.top - data.collisionPosition.marginTop,
+				overTop = withinOffset - collisionPosTop,
+				overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
+				newOverBottom;
+
+			// Element is taller than within
+			if ( data.collisionHeight > outerHeight ) {
+
+				// Element is initially over the top of within
+				if ( overTop > 0 && overBottom <= 0 ) {
+					newOverBottom = position.top + overTop + data.collisionHeight - outerHeight -
+						withinOffset;
+					position.top += overTop - newOverBottom;
+
+				// Element is initially over bottom of within
+				} else if ( overBottom > 0 && overTop <= 0 ) {
+					position.top = withinOffset;
+
+				// Element is initially over both top and bottom of within
+				} else {
+					if ( overTop > overBottom ) {
+						position.top = withinOffset + outerHeight - data.collisionHeight;
+					} else {
+						position.top = withinOffset;
+					}
+				}
+
+			// Too far up -> align with top
+			} else if ( overTop > 0 ) {
+				position.top += overTop;
+
+			// Too far down -> align with bottom edge
+			} else if ( overBottom > 0 ) {
+				position.top -= overBottom;
+
+			// Adjust based on position and margin
+			} else {
+				position.top = max( position.top - collisionPosTop, position.top );
+			}
+		}
+	},
+	flip: {
+		left: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.offset.left + within.scrollLeft,
+				outerWidth = within.width,
+				offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
+				collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+				overLeft = collisionPosLeft - offsetLeft,
+				overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
+				myOffset = data.my[ 0 ] === "left" ?
+					-data.elemWidth :
+					data.my[ 0 ] === "right" ?
+						data.elemWidth :
+						0,
+				atOffset = data.at[ 0 ] === "left" ?
+					data.targetWidth :
+					data.at[ 0 ] === "right" ?
+						-data.targetWidth :
+						0,
+				offset = -2 * data.offset[ 0 ],
+				newOverRight,
+				newOverLeft;
+
+			if ( overLeft < 0 ) {
+				newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth -
+					outerWidth - withinOffset;
+				if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) {
+					position.left += myOffset + atOffset + offset;
+				}
+			} else if ( overRight > 0 ) {
+				newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset +
+					atOffset + offset - offsetLeft;
+				if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) {
+					position.left += myOffset + atOffset + offset;
+				}
+			}
+		},
+		top: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.offset.top + within.scrollTop,
+				outerHeight = within.height,
+				offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
+				collisionPosTop = position.top - data.collisionPosition.marginTop,
+				overTop = collisionPosTop - offsetTop,
+				overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
+				top = data.my[ 1 ] === "top",
+				myOffset = top ?
+					-data.elemHeight :
+					data.my[ 1 ] === "bottom" ?
+						data.elemHeight :
+						0,
+				atOffset = data.at[ 1 ] === "top" ?
+					data.targetHeight :
+					data.at[ 1 ] === "bottom" ?
+						-data.targetHeight :
+						0,
+				offset = -2 * data.offset[ 1 ],
+				newOverTop,
+				newOverBottom;
+			if ( overTop < 0 ) {
+				newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight -
+					outerHeight - withinOffset;
+				if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) {
+					position.top += myOffset + atOffset + offset;
+				}
+			} else if ( overBottom > 0 ) {
+				newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset +
+					offset - offsetTop;
+				if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) {
+					position.top += myOffset + atOffset + offset;
+				}
+			}
+		}
+	},
+	flipfit: {
+		left: function() {
+			$.ui.position.flip.left.apply( this, arguments );
+			$.ui.position.fit.left.apply( this, arguments );
+		},
+		top: function() {
+			$.ui.position.flip.top.apply( this, arguments );
+			$.ui.position.fit.top.apply( this, arguments );
+		}
+	}
+};
+
+} )();
+
+var position = $.ui.position;
+
+
+/*!
+ * jQuery UI :data 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: :data Selector
+//>>group: Core
+//>>description: Selects elements which have data stored under the specified key.
+//>>docs: http://api.jqueryui.com/data-selector/
+
+
+var data = $.extend( $.expr[ ":" ], {
+	data: $.expr.createPseudo ?
+		$.expr.createPseudo( function( dataName ) {
+			return function( elem ) {
+				return !!$.data( elem, dataName );
+			};
+		} ) :
+
+		// Support: jQuery <1.8
+		function( elem, i, match ) {
+			return !!$.data( elem, match[ 3 ] );
+		}
+} );
+
+/*!
+ * jQuery UI Disable Selection 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: disableSelection
+//>>group: Core
+//>>description: Disable selection of text content within the set of matched elements.
+//>>docs: http://api.jqueryui.com/disableSelection/
+
+// This file is deprecated
+
+
+var disableSelection = $.fn.extend( {
+	disableSelection: ( function() {
+		var eventType = "onselectstart" in document.createElement( "div" ) ?
+			"selectstart" :
+			"mousedown";
+
+		return function() {
+			return this.on( eventType + ".ui-disableSelection", function( event ) {
+				event.preventDefault();
+			} );
+		};
+	} )(),
+
+	enableSelection: function() {
+		return this.off( ".ui-disableSelection" );
+	}
+} );
+
+
+/*!
+ * jQuery UI Focusable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: :focusable Selector
+//>>group: Core
+//>>description: Selects elements which can be focused.
+//>>docs: http://api.jqueryui.com/focusable-selector/
+
+
+
+// Selectors
+$.ui.focusable = function( element, hasTabindex ) {
+	var map, mapName, img, focusableIfVisible, fieldset,
+		nodeName = element.nodeName.toLowerCase();
+
+	if ( "area" === nodeName ) {
+		map = element.parentNode;
+		mapName = map.name;
+		if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+			return false;
+		}
+		img = $( "img[usemap='#" + mapName + "']" );
+		return img.length > 0 && img.is( ":visible" );
+	}
+
+	if ( /^(input|select|textarea|button|object)$/.test( nodeName ) ) {
+		focusableIfVisible = !element.disabled;
+
+		if ( focusableIfVisible ) {
+
+			// Form controls within a disabled fieldset are disabled.
+			// However, controls within the fieldset's legend do not get disabled.
+			// Since controls generally aren't placed inside legends, we skip
+			// this portion of the check.
+			fieldset = $( element ).closest( "fieldset" )[ 0 ];
+			if ( fieldset ) {
+				focusableIfVisible = !fieldset.disabled;
+			}
+		}
+	} else if ( "a" === nodeName ) {
+		focusableIfVisible = element.href || hasTabindex;
+	} else {
+		focusableIfVisible = hasTabindex;
+	}
+
+	return focusableIfVisible && $( element ).is( ":visible" ) && visible( $( element ) );
+};
+
+// Support: IE 8 only
+// IE 8 doesn't resolve inherit to visible/hidden for computed values
+function visible( element ) {
+	var visibility = element.css( "visibility" );
+	while ( visibility === "inherit" ) {
+		element = element.parent();
+		visibility = element.css( "visibility" );
+	}
+	return visibility !== "hidden";
+}
+
+$.extend( $.expr[ ":" ], {
+	focusable: function( element ) {
+		return $.ui.focusable( element, $.attr( element, "tabindex" ) != null );
+	}
+} );
+
+var focusable = $.ui.focusable;
+
+
+
+
+// Support: IE8 Only
+// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop
+// with a string, so we need to find the proper form.
+var form = $.fn.form = function() {
+	return typeof this[ 0 ].form === "string" ? this.closest( "form" ) : $( this[ 0 ].form );
+};
+
+
+/*!
+ * jQuery UI Form Reset Mixin 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Form Reset Mixin
+//>>group: Core
+//>>description: Refresh input widgets when their form is reset
+//>>docs: http://api.jqueryui.com/form-reset-mixin/
+
+
+
+var formResetMixin = $.ui.formResetMixin = {
+	_formResetHandler: function() {
+		var form = $( this );
+
+		// Wait for the form reset to actually happen before refreshing
+		setTimeout( function() {
+			var instances = form.data( "ui-form-reset-instances" );
+			$.each( instances, function() {
+				this.refresh();
+			} );
+		} );
+	},
+
+	_bindFormResetHandler: function() {
+		this.form = this.element.form();
+		if ( !this.form.length ) {
+			return;
+		}
+
+		var instances = this.form.data( "ui-form-reset-instances" ) || [];
+		if ( !instances.length ) {
+
+			// We don't use _on() here because we use a single event handler per form
+			this.form.on( "reset.ui-form-reset", this._formResetHandler );
+		}
+		instances.push( this );
+		this.form.data( "ui-form-reset-instances", instances );
+	},
+
+	_unbindFormResetHandler: function() {
+		if ( !this.form.length ) {
+			return;
+		}
+
+		var instances = this.form.data( "ui-form-reset-instances" );
+		instances.splice( $.inArray( this, instances ), 1 );
+		if ( instances.length ) {
+			this.form.data( "ui-form-reset-instances", instances );
+		} else {
+			this.form
+				.removeData( "ui-form-reset-instances" )
+				.off( "reset.ui-form-reset" );
+		}
+	}
+};
+
+
+/*!
+ * jQuery UI Support for jQuery core 1.7.x 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ */
+
+//>>label: jQuery 1.7 Support
+//>>group: Core
+//>>description: Support version 1.7.x of jQuery core
+
+
+
+// Support: jQuery 1.7 only
+// Not a great way to check versions, but since we only support 1.7+ and only
+// need to detect <1.8, this is a simple check that should suffice. Checking
+// for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0
+// and we'll never reach 1.70.0 (if we do, we certainly won't be supporting
+// 1.7 anymore). See #11197 for why we're not using feature detection.
+if ( $.fn.jquery.substring( 0, 3 ) === "1.7" ) {
+
+	// Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight()
+	// Unlike jQuery Core 1.8+, these only support numeric values to set the
+	// dimensions in pixels
+	$.each( [ "Width", "Height" ], function( i, name ) {
+		var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+			type = name.toLowerCase(),
+			orig = {
+				innerWidth: $.fn.innerWidth,
+				innerHeight: $.fn.innerHeight,
+				outerWidth: $.fn.outerWidth,
+				outerHeight: $.fn.outerHeight
+			};
+
+		function reduce( elem, size, border, margin ) {
+			$.each( side, function() {
+				size -= parseFloat( $.css( elem, "padding" + this ) ) || 0;
+				if ( border ) {
+					size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0;
+				}
+				if ( margin ) {
+					size -= parseFloat( $.css( elem, "margin" + this ) ) || 0;
+				}
+			} );
+			return size;
+		}
+
+		$.fn[ "inner" + name ] = function( size ) {
+			if ( size === undefined ) {
+				return orig[ "inner" + name ].call( this );
+			}
+
+			return this.each( function() {
+				$( this ).css( type, reduce( this, size ) + "px" );
+			} );
+		};
+
+		$.fn[ "outer" + name ] = function( size, margin ) {
+			if ( typeof size !== "number" ) {
+				return orig[ "outer" + name ].call( this, size );
+			}
+
+			return this.each( function() {
+				$( this ).css( type, reduce( this, size, true, margin ) + "px" );
+			} );
+		};
+	} );
+
+	$.fn.addBack = function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	};
+}
+
+;
+/*!
+ * jQuery UI Keycode 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Keycode
+//>>group: Core
+//>>description: Provide keycodes as keynames
+//>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/
+
+
+var keycode = $.ui.keyCode = {
+	BACKSPACE: 8,
+	COMMA: 188,
+	DELETE: 46,
+	DOWN: 40,
+	END: 35,
+	ENTER: 13,
+	ESCAPE: 27,
+	HOME: 36,
+	LEFT: 37,
+	PAGE_DOWN: 34,
+	PAGE_UP: 33,
+	PERIOD: 190,
+	RIGHT: 39,
+	SPACE: 32,
+	TAB: 9,
+	UP: 38
+};
+
+
+
+
+// Internal use only
+var escapeSelector = $.ui.escapeSelector = ( function() {
+	var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g;
+	return function( selector ) {
+		return selector.replace( selectorEscape, "\\$1" );
+	};
+} )();
+
+
+/*!
+ * jQuery UI Labels 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: labels
+//>>group: Core
+//>>description: Find all the labels associated with a given input
+//>>docs: http://api.jqueryui.com/labels/
+
+
+
+var labels = $.fn.labels = function() {
+	var ancestor, selector, id, labels, ancestors;
+
+	// Check control.labels first
+	if ( this[ 0 ].labels && this[ 0 ].labels.length ) {
+		return this.pushStack( this[ 0 ].labels );
+	}
+
+	// Support: IE <= 11, FF <= 37, Android <= 2.3 only
+	// Above browsers do not support control.labels. Everything below is to support them
+	// as well as document fragments. control.labels does not work on document fragments
+	labels = this.eq( 0 ).parents( "label" );
+
+	// Look for the label based on the id
+	id = this.attr( "id" );
+	if ( id ) {
+
+		// We don't search against the document in case the element
+		// is disconnected from the DOM
+		ancestor = this.eq( 0 ).parents().last();
+
+		// Get a full set of top level ancestors
+		ancestors = ancestor.add( ancestor.length ? ancestor.siblings() : this.siblings() );
+
+		// Create a selector for the label based on the id
+		selector = "label[for='" + $.ui.escapeSelector( id ) + "']";
+
+		labels = labels.add( ancestors.find( selector ).addBack( selector ) );
+
+	}
+
+	// Return whatever we have found for labels
+	return this.pushStack( labels );
+};
+
+
+/*!
+ * jQuery UI Scroll Parent 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: scrollParent
+//>>group: Core
+//>>description: Get the closest ancestor element that is scrollable.
+//>>docs: http://api.jqueryui.com/scrollParent/
+
+
+
+var scrollParent = $.fn.scrollParent = function( includeHidden ) {
+	var position = this.css( "position" ),
+		excludeStaticParent = position === "absolute",
+		overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
+		scrollParent = this.parents().filter( function() {
+			var parent = $( this );
+			if ( excludeStaticParent && parent.css( "position" ) === "static" ) {
+				return false;
+			}
+			return overflowRegex.test( parent.css( "overflow" ) + parent.css( "overflow-y" ) +
+				parent.css( "overflow-x" ) );
+		} ).eq( 0 );
+
+	return position === "fixed" || !scrollParent.length ?
+		$( this[ 0 ].ownerDocument || document ) :
+		scrollParent;
+};
+
+
+/*!
+ * jQuery UI Tabbable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: :tabbable Selector
+//>>group: Core
+//>>description: Selects elements which can be tabbed to.
+//>>docs: http://api.jqueryui.com/tabbable-selector/
+
+
+
+var tabbable = $.extend( $.expr[ ":" ], {
+	tabbable: function( element ) {
+		var tabIndex = $.attr( element, "tabindex" ),
+			hasTabindex = tabIndex != null;
+		return ( !hasTabindex || tabIndex >= 0 ) && $.ui.focusable( element, hasTabindex );
+	}
+} );
+
+
+/*!
+ * jQuery UI Unique ID 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Bounce
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: uniqueId
+//>>group: Core
+//>>description: Functions to generate and remove uniqueId's
+//>>docs: http://api.jqueryui.com/uniqueId/
+
+
+
+var uniqueId = $.fn.extend( {
+	uniqueId: ( function() {
+		var uuid = 0;
+
+		return function() {
+			return this.each( function() {
+				if ( !this.id ) {
+					this.id = "ui-id-" + ( ++uuid );
+				}
+			} );
+		};
+	} )(),
+
+	removeUniqueId: function() {
+		return this.each( function() {
+			if ( /^ui-id-\d+$/.test( this.id ) ) {
+				$( this ).removeAttr( "id" );
+			}
+		} );
+	}
+} );
+
+
+
+
+// This file is deprecated
+var ie = $.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() );
+
+/*!
+ * jQuery UI Mouse 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
-3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
-b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
-;/*
- * jQuery UI Effects Clip 1.8.14
+
+//>>label: Mouse
+//>>group: Widgets
+//>>description: Abstracts mouse-based interactions to assist in creating certain widgets.
+//>>docs: http://api.jqueryui.com/mouse/
+
+
+
+var mouseHandled = false;
+$( document ).on( "mouseup", function() {
+	mouseHandled = false;
+} );
+
+var widgetsMouse = $.widget( "ui.mouse", {
+	version: "1.12.1",
+	options: {
+		cancel: "input, textarea, button, select, option",
+		distance: 1,
+		delay: 0
+	},
+	_mouseInit: function() {
+		var that = this;
+
+		this.element
+			.on( "mousedown." + this.widgetName, function( event ) {
+				return that._mouseDown( event );
+			} )
+			.on( "click." + this.widgetName, function( event ) {
+				if ( true === $.data( event.target, that.widgetName + ".preventClickEvent" ) ) {
+					$.removeData( event.target, that.widgetName + ".preventClickEvent" );
+					event.stopImmediatePropagation();
+					return false;
+				}
+			} );
+
+		this.started = false;
+	},
+
+	// TODO: make sure destroying one instance of mouse doesn't mess with
+	// other instances of mouse
+	_mouseDestroy: function() {
+		this.element.off( "." + this.widgetName );
+		if ( this._mouseMoveDelegate ) {
+			this.document
+				.off( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+				.off( "mouseup." + this.widgetName, this._mouseUpDelegate );
+		}
+	},
+
+	_mouseDown: function( event ) {
+
+		// don't let more than one widget handle mouseStart
+		if ( mouseHandled ) {
+			return;
+		}
+
+		this._mouseMoved = false;
+
+		// We may have missed mouseup (out of window)
+		( this._mouseStarted && this._mouseUp( event ) );
+
+		this._mouseDownEvent = event;
+
+		var that = this,
+			btnIsLeft = ( event.which === 1 ),
+
+			// event.target.nodeName works around a bug in IE 8 with
+			// disabled inputs (#7620)
+			elIsCancel = ( typeof this.options.cancel === "string" && event.target.nodeName ?
+				$( event.target ).closest( this.options.cancel ).length : false );
+		if ( !btnIsLeft || elIsCancel || !this._mouseCapture( event ) ) {
+			return true;
+		}
+
+		this.mouseDelayMet = !this.options.delay;
+		if ( !this.mouseDelayMet ) {
+			this._mouseDelayTimer = setTimeout( function() {
+				that.mouseDelayMet = true;
+			}, this.options.delay );
+		}
+
+		if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) {
+			this._mouseStarted = ( this._mouseStart( event ) !== false );
+			if ( !this._mouseStarted ) {
+				event.preventDefault();
+				return true;
+			}
+		}
+
+		// Click event may never have fired (Gecko & Opera)
+		if ( true === $.data( event.target, this.widgetName + ".preventClickEvent" ) ) {
+			$.removeData( event.target, this.widgetName + ".preventClickEvent" );
+		}
+
+		// These delegates are required to keep context
+		this._mouseMoveDelegate = function( event ) {
+			return that._mouseMove( event );
+		};
+		this._mouseUpDelegate = function( event ) {
+			return that._mouseUp( event );
+		};
+
+		this.document
+			.on( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+			.on( "mouseup." + this.widgetName, this._mouseUpDelegate );
+
+		event.preventDefault();
+
+		mouseHandled = true;
+		return true;
+	},
+
+	_mouseMove: function( event ) {
+
+		// Only check for mouseups outside the document if you've moved inside the document
+		// at least once. This prevents the firing of mouseup in the case of IE<9, which will
+		// fire a mousemove event if content is placed under the cursor. See #7778
+		// Support: IE <9
+		if ( this._mouseMoved ) {
+
+			// IE mouseup check - mouseup happened when mouse was out of window
+			if ( $.ui.ie && ( !document.documentMode || document.documentMode < 9 ) &&
+					!event.button ) {
+				return this._mouseUp( event );
+
+			// Iframe mouseup check - mouseup occurred in another document
+			} else if ( !event.which ) {
+
+				// Support: Safari <=8 - 9
+				// Safari sets which to 0 if you press any of the following keys
+				// during a drag (#14461)
+				if ( event.originalEvent.altKey || event.originalEvent.ctrlKey ||
+						event.originalEvent.metaKey || event.originalEvent.shiftKey ) {
+					this.ignoreMissingWhich = true;
+				} else if ( !this.ignoreMissingWhich ) {
+					return this._mouseUp( event );
+				}
+			}
+		}
+
+		if ( event.which || event.button ) {
+			this._mouseMoved = true;
+		}
+
+		if ( this._mouseStarted ) {
+			this._mouseDrag( event );
+			return event.preventDefault();
+		}
+
+		if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) {
+			this._mouseStarted =
+				( this._mouseStart( this._mouseDownEvent, event ) !== false );
+			( this._mouseStarted ? this._mouseDrag( event ) : this._mouseUp( event ) );
+		}
+
+		return !this._mouseStarted;
+	},
+
+	_mouseUp: function( event ) {
+		this.document
+			.off( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+			.off( "mouseup." + this.widgetName, this._mouseUpDelegate );
+
+		if ( this._mouseStarted ) {
+			this._mouseStarted = false;
+
+			if ( event.target === this._mouseDownEvent.target ) {
+				$.data( event.target, this.widgetName + ".preventClickEvent", true );
+			}
+
+			this._mouseStop( event );
+		}
+
+		if ( this._mouseDelayTimer ) {
+			clearTimeout( this._mouseDelayTimer );
+			delete this._mouseDelayTimer;
+		}
+
+		this.ignoreMissingWhich = false;
+		mouseHandled = false;
+		event.preventDefault();
+	},
+
+	_mouseDistanceMet: function( event ) {
+		return ( Math.max(
+				Math.abs( this._mouseDownEvent.pageX - event.pageX ),
+				Math.abs( this._mouseDownEvent.pageY - event.pageY )
+			) >= this.options.distance
+		);
+	},
+
+	_mouseDelayMet: function( /* event */ ) {
+		return this.mouseDelayMet;
+	},
+
+	// These are placeholder methods, to be overriden by extending plugin
+	_mouseStart: function( /* event */ ) {},
+	_mouseDrag: function( /* event */ ) {},
+	_mouseStop: function( /* event */ ) {},
+	_mouseCapture: function( /* event */ ) { return true; }
+} );
+
+
+
+
+// $.ui.plugin is deprecated. Use $.widget() extensions instead.
+var plugin = $.ui.plugin = {
+	add: function( module, option, set ) {
+		var i,
+			proto = $.ui[ module ].prototype;
+		for ( i in set ) {
+			proto.plugins[ i ] = proto.plugins[ i ] || [];
+			proto.plugins[ i ].push( [ option, set[ i ] ] );
+		}
+	},
+	call: function( instance, name, args, allowDisconnected ) {
+		var i,
+			set = instance.plugins[ name ];
+
+		if ( !set ) {
+			return;
+		}
+
+		if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode ||
+				instance.element[ 0 ].parentNode.nodeType === 11 ) ) {
+			return;
+		}
+
+		for ( i = 0; i < set.length; i++ ) {
+			if ( instance.options[ set[ i ][ 0 ] ] ) {
+				set[ i ][ 1 ].apply( instance.element, args );
+			}
+		}
+	}
+};
+
+
+
+var safeActiveElement = $.ui.safeActiveElement = function( document ) {
+	var activeElement;
+
+	// Support: IE 9 only
+	// IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
+	try {
+		activeElement = document.activeElement;
+	} catch ( error ) {
+		activeElement = document.body;
+	}
+
+	// Support: IE 9 - 11 only
+	// IE may return null instead of an element
+	// Interestingly, this only seems to occur when NOT in an iframe
+	if ( !activeElement ) {
+		activeElement = document.body;
+	}
+
+	// Support: IE 11 only
+	// IE11 returns a seemingly empty object in some cases when accessing
+	// document.activeElement from an <iframe>
+	if ( !activeElement.nodeName ) {
+		activeElement = document.body;
+	}
+
+	return activeElement;
+};
+
+
+
+var safeBlur = $.ui.safeBlur = function( element ) {
+
+	// Support: IE9 - 10 only
+	// If the <body> is blurred, IE will switch windows, see #9420
+	if ( element && element.nodeName.toLowerCase() !== "body" ) {
+		$( element ).trigger( "blur" );
+	}
+};
+
+
+/*!
+ * jQuery UI Draggable 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Draggable
+//>>group: Interactions
+//>>description: Enables dragging functionality for any element.
+//>>docs: http://api.jqueryui.com/draggable/
+//>>demos: http://jqueryui.com/draggable/
+//>>css.structure: ../../themes/base/draggable.css
+
+
+
+$.widget( "ui.draggable", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "drag",
+	options: {
+		addClasses: true,
+		appendTo: "parent",
+		axis: false,
+		connectToSortable: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		iframeFix: false,
+		opacity: false,
+		refreshPositions: false,
+		revert: false,
+		revertDuration: 500,
+		scope: "default",
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		snap: false,
+		snapMode: "both",
+		snapTolerance: 20,
+		stack: false,
+		zIndex: false,
+
+		// Callbacks
+		drag: null,
+		start: null,
+		stop: null
+	},
+	_create: function() {
+
+		if ( this.options.helper === "original" ) {
+			this._setPositionRelative();
+		}
+		if ( this.options.addClasses ) {
+			this._addClass( "ui-draggable" );
+		}
+		this._setHandleClassName();
+
+		this._mouseInit();
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+		if ( key === "handle" ) {
+			this._removeHandleClassName();
+			this._setHandleClassName();
+		}
+	},
+
+	_destroy: function() {
+		if ( ( this.helper || this.element ).is( ".ui-draggable-dragging" ) ) {
+			this.destroyOnClear = true;
+			return;
+		}
+		this._removeHandleClassName();
+		this._mouseDestroy();
+	},
+
+	_mouseCapture: function( event ) {
+		var o = this.options;
+
+		// Among others, prevent a drag on a resizable-handle
+		if ( this.helper || o.disabled ||
+				$( event.target ).closest( ".ui-resizable-handle" ).length > 0 ) {
+			return false;
+		}
+
+		//Quit if we're not on a valid handle
+		this.handle = this._getHandle( event );
+		if ( !this.handle ) {
+			return false;
+		}
+
+		this._blurActiveElement( event );
+
+		this._blockFrames( o.iframeFix === true ? "iframe" : o.iframeFix );
+
+		return true;
+
+	},
+
+	_blockFrames: function( selector ) {
+		this.iframeBlocks = this.document.find( selector ).map( function() {
+			var iframe = $( this );
+
+			return $( "<div>" )
+				.css( "position", "absolute" )
+				.appendTo( iframe.parent() )
+				.outerWidth( iframe.outerWidth() )
+				.outerHeight( iframe.outerHeight() )
+				.offset( iframe.offset() )[ 0 ];
+		} );
+	},
+
+	_unblockFrames: function() {
+		if ( this.iframeBlocks ) {
+			this.iframeBlocks.remove();
+			delete this.iframeBlocks;
+		}
+	},
+
+	_blurActiveElement: function( event ) {
+		var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ),
+			target = $( event.target );
+
+		// Don't blur if the event occurred on an element that is within
+		// the currently focused element
+		// See #10527, #12472
+		if ( target.closest( activeElement ).length ) {
+			return;
+		}
+
+		// Blur any element that currently has focus, see #4261
+		$.ui.safeBlur( activeElement );
+	},
+
+	_mouseStart: function( event ) {
+
+		var o = this.options;
+
+		//Create and append the visible helper
+		this.helper = this._createHelper( event );
+
+		this._addClass( this.helper, "ui-draggable-dragging" );
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		//If ddmanager is used for droppables, set the global draggable
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.current = this;
+		}
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Store the helper's css position
+		this.cssPosition = this.helper.css( "position" );
+		this.scrollParent = this.helper.scrollParent( true );
+		this.offsetParent = this.helper.offsetParent();
+		this.hasFixedAncestor = this.helper.parents().filter( function() {
+				return $( this ).css( "position" ) === "fixed";
+			} ).length > 0;
+
+		//The element's absolute position on the page minus margins
+		this.positionAbs = this.element.offset();
+		this._refreshOffsets( event );
+
+		//Generate the original position
+		this.originalPosition = this.position = this._generatePosition( event, false );
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+		( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) );
+
+		//Set a containment if given in the options
+		this._setContainment();
+
+		//Trigger event + callbacks
+		if ( this._trigger( "start", event ) === false ) {
+			this._clear();
+			return false;
+		}
+
+		//Recache the helper size
+		this._cacheHelperProportions();
+
+		//Prepare the droppable offsets
+		if ( $.ui.ddmanager && !o.dropBehaviour ) {
+			$.ui.ddmanager.prepareOffsets( this, event );
+		}
+
+		// Execute the drag once - this causes the helper not to be visible before getting its
+		// correct position
+		this._mouseDrag( event, true );
+
+		// If the ddmanager is used for droppables, inform the manager that dragging has started
+		// (see #5003)
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.dragStart( this, event );
+		}
+
+		return true;
+	},
+
+	_refreshOffsets: function( event ) {
+		this.offset = {
+			top: this.positionAbs.top - this.margins.top,
+			left: this.positionAbs.left - this.margins.left,
+			scroll: false,
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset()
+		};
+
+		this.offset.click = {
+			left: event.pageX - this.offset.left,
+			top: event.pageY - this.offset.top
+		};
+	},
+
+	_mouseDrag: function( event, noPropagation ) {
+
+		// reset any necessary cached properties (see #5009)
+		if ( this.hasFixedAncestor ) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		//Compute the helpers position
+		this.position = this._generatePosition( event, true );
+		this.positionAbs = this._convertPositionTo( "absolute" );
+
+		//Call plugins and callbacks and use the resulting position if something is returned
+		if ( !noPropagation ) {
+			var ui = this._uiHash();
+			if ( this._trigger( "drag", event, ui ) === false ) {
+				this._mouseUp( new $.Event( "mouseup", event ) );
+				return false;
+			}
+			this.position = ui.position;
+		}
+
+		this.helper[ 0 ].style.left = this.position.left + "px";
+		this.helper[ 0 ].style.top = this.position.top + "px";
+
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.drag( this, event );
+		}
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+
+		//If we are using droppables, inform the manager about the drop
+		var that = this,
+			dropped = false;
+		if ( $.ui.ddmanager && !this.options.dropBehaviour ) {
+			dropped = $.ui.ddmanager.drop( this, event );
+		}
+
+		//if a drop comes from outside (a sortable)
+		if ( this.dropped ) {
+			dropped = this.dropped;
+			this.dropped = false;
+		}
+
+		if ( ( this.options.revert === "invalid" && !dropped ) ||
+				( this.options.revert === "valid" && dropped ) ||
+				this.options.revert === true || ( $.isFunction( this.options.revert ) &&
+				this.options.revert.call( this.element, dropped ) )
+		) {
+			$( this.helper ).animate(
+				this.originalPosition,
+				parseInt( this.options.revertDuration, 10 ),
+				function() {
+					if ( that._trigger( "stop", event ) !== false ) {
+						that._clear();
+					}
+				}
+			);
+		} else {
+			if ( this._trigger( "stop", event ) !== false ) {
+				this._clear();
+			}
+		}
+
+		return false;
+	},
+
+	_mouseUp: function( event ) {
+		this._unblockFrames();
+
+		// If the ddmanager is used for droppables, inform the manager that dragging has stopped
+		// (see #5003)
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.dragStop( this, event );
+		}
+
+		// Only need to focus if the event occurred on the draggable itself, see #10527
+		if ( this.handleElement.is( event.target ) ) {
+
+			// The interaction is over; whether or not the click resulted in a drag,
+			// focus the element
+			this.element.trigger( "focus" );
+		}
+
+		return $.ui.mouse.prototype._mouseUp.call( this, event );
+	},
+
+	cancel: function() {
+
+		if ( this.helper.is( ".ui-draggable-dragging" ) ) {
+			this._mouseUp( new $.Event( "mouseup", { target: this.element[ 0 ] } ) );
+		} else {
+			this._clear();
+		}
+
+		return this;
+
+	},
+
+	_getHandle: function( event ) {
+		return this.options.handle ?
+			!!$( event.target ).closest( this.element.find( this.options.handle ) ).length :
+			true;
+	},
+
+	_setHandleClassName: function() {
+		this.handleElement = this.options.handle ?
+			this.element.find( this.options.handle ) : this.element;
+		this._addClass( this.handleElement, "ui-draggable-handle" );
+	},
+
+	_removeHandleClassName: function() {
+		this._removeClass( this.handleElement, "ui-draggable-handle" );
+	},
+
+	_createHelper: function( event ) {
+
+		var o = this.options,
+			helperIsFunction = $.isFunction( o.helper ),
+			helper = helperIsFunction ?
+				$( o.helper.apply( this.element[ 0 ], [ event ] ) ) :
+				( o.helper === "clone" ?
+					this.element.clone().removeAttr( "id" ) :
+					this.element );
+
+		if ( !helper.parents( "body" ).length ) {
+			helper.appendTo( ( o.appendTo === "parent" ?
+				this.element[ 0 ].parentNode :
+				o.appendTo ) );
+		}
+
+		// Http://bugs.jqueryui.com/ticket/9446
+		// a helper function can return the original element
+		// which wouldn't have been set to relative in _create
+		if ( helperIsFunction && helper[ 0 ] === this.element[ 0 ] ) {
+			this._setPositionRelative();
+		}
+
+		if ( helper[ 0 ] !== this.element[ 0 ] &&
+				!( /(fixed|absolute)/ ).test( helper.css( "position" ) ) ) {
+			helper.css( "position", "absolute" );
+		}
+
+		return helper;
+
+	},
+
+	_setPositionRelative: function() {
+		if ( !( /^(?:r|a|f)/ ).test( this.element.css( "position" ) ) ) {
+			this.element[ 0 ].style.position = "relative";
+		}
+	},
+
+	_adjustOffsetFromHelper: function( obj ) {
+		if ( typeof obj === "string" ) {
+			obj = obj.split( " " );
+		}
+		if ( $.isArray( obj ) ) {
+			obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 };
+		}
+		if ( "left" in obj ) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ( "right" in obj ) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ( "top" in obj ) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ( "bottom" in obj ) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_isRootNode: function( element ) {
+		return ( /(html|body)/i ).test( element.tagName ) || element === this.document[ 0 ];
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		var po = this.offsetParent.offset(),
+			document = this.document[ 0 ];
+
+		// This is a special case where we need to modify a offset calculated on start, since the
+		// following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the
+		// next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
+		// the document, which means that the scroll is included in the initial calculation of the
+		// offset of the parent, and never recalculated upon drag
+		if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== document &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if ( this._isRootNode( this.offsetParent[ 0 ] ) ) {
+			po = { top: 0, left: 0 };
+		}
+
+		return {
+			top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ),
+			left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 )
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+		if ( this.cssPosition !== "relative" ) {
+			return { top: 0, left: 0 };
+		}
+
+		var p = this.element.position(),
+			scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] );
+
+		return {
+			top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) +
+				( !scrollIsRootNode ? this.scrollParent.scrollTop() : 0 ),
+			left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) +
+				( !scrollIsRootNode ? this.scrollParent.scrollLeft() : 0 )
+		};
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: ( parseInt( this.element.css( "marginLeft" ), 10 ) || 0 ),
+			top: ( parseInt( this.element.css( "marginTop" ), 10 ) || 0 ),
+			right: ( parseInt( this.element.css( "marginRight" ), 10 ) || 0 ),
+			bottom: ( parseInt( this.element.css( "marginBottom" ), 10 ) || 0 )
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var isUserScrollable, c, ce,
+			o = this.options,
+			document = this.document[ 0 ];
+
+		this.relativeContainer = null;
+
+		if ( !o.containment ) {
+			this.containment = null;
+			return;
+		}
+
+		if ( o.containment === "window" ) {
+			this.containment = [
+				$( window ).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+				$( window ).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+				$( window ).scrollLeft() + $( window ).width() -
+					this.helperProportions.width - this.margins.left,
+				$( window ).scrollTop() +
+					( $( window ).height() || document.body.parentNode.scrollHeight ) -
+					this.helperProportions.height - this.margins.top
+			];
+			return;
+		}
+
+		if ( o.containment === "document" ) {
+			this.containment = [
+				0,
+				0,
+				$( document ).width() - this.helperProportions.width - this.margins.left,
+				( $( document ).height() || document.body.parentNode.scrollHeight ) -
+					this.helperProportions.height - this.margins.top
+			];
+			return;
+		}
+
+		if ( o.containment.constructor === Array ) {
+			this.containment = o.containment;
+			return;
+		}
+
+		if ( o.containment === "parent" ) {
+			o.containment = this.helper[ 0 ].parentNode;
+		}
+
+		c = $( o.containment );
+		ce = c[ 0 ];
+
+		if ( !ce ) {
+			return;
+		}
+
+		isUserScrollable = /(scroll|auto)/.test( c.css( "overflow" ) );
+
+		this.containment = [
+			( parseInt( c.css( "borderLeftWidth" ), 10 ) || 0 ) +
+				( parseInt( c.css( "paddingLeft" ), 10 ) || 0 ),
+			( parseInt( c.css( "borderTopWidth" ), 10 ) || 0 ) +
+				( parseInt( c.css( "paddingTop" ), 10 ) || 0 ),
+			( isUserScrollable ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) -
+				( parseInt( c.css( "borderRightWidth" ), 10 ) || 0 ) -
+				( parseInt( c.css( "paddingRight" ), 10 ) || 0 ) -
+				this.helperProportions.width -
+				this.margins.left -
+				this.margins.right,
+			( isUserScrollable ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) -
+				( parseInt( c.css( "borderBottomWidth" ), 10 ) || 0 ) -
+				( parseInt( c.css( "paddingBottom" ), 10 ) || 0 ) -
+				this.helperProportions.height -
+				this.margins.top -
+				this.margins.bottom
+		];
+		this.relativeContainer = c;
+	},
+
+	_convertPositionTo: function( d, pos ) {
+
+		if ( !pos ) {
+			pos = this.position;
+		}
+
+		var mod = d === "absolute" ? 1 : -1,
+			scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] );
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pos.top	+
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top * mod -
+				( ( this.cssPosition === "fixed" ?
+					-this.offset.scroll.top :
+					( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) * mod )
+			),
+			left: (
+
+				// The absolute mouse position
+				pos.left +
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left * mod	-
+				( ( this.cssPosition === "fixed" ?
+					-this.offset.scroll.left :
+					( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) * mod )
+			)
+		};
+
+	},
+
+	_generatePosition: function( event, constrainPosition ) {
+
+		var containment, co, top, left,
+			o = this.options,
+			scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ),
+			pageX = event.pageX,
+			pageY = event.pageY;
+
+		// Cache the scroll
+		if ( !scrollIsRootNode || !this.offset.scroll ) {
+			this.offset.scroll = {
+				top: this.scrollParent.scrollTop(),
+				left: this.scrollParent.scrollLeft()
+			};
+		}
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		// If we are not dragging yet, we won't check for options
+		if ( constrainPosition ) {
+			if ( this.containment ) {
+				if ( this.relativeContainer ) {
+					co = this.relativeContainer.offset();
+					containment = [
+						this.containment[ 0 ] + co.left,
+						this.containment[ 1 ] + co.top,
+						this.containment[ 2 ] + co.left,
+						this.containment[ 3 ] + co.top
+					];
+				} else {
+					containment = this.containment;
+				}
+
+				if ( event.pageX - this.offset.click.left < containment[ 0 ] ) {
+					pageX = containment[ 0 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top < containment[ 1 ] ) {
+					pageY = containment[ 1 ] + this.offset.click.top;
+				}
+				if ( event.pageX - this.offset.click.left > containment[ 2 ] ) {
+					pageX = containment[ 2 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top > containment[ 3 ] ) {
+					pageY = containment[ 3 ] + this.offset.click.top;
+				}
+			}
+
+			if ( o.grid ) {
+
+				//Check for grid elements set to 0 to prevent divide by 0 error causing invalid
+				// argument errors in IE (see ticket #6950)
+				top = o.grid[ 1 ] ? this.originalPageY + Math.round( ( pageY -
+					this.originalPageY ) / o.grid[ 1 ] ) * o.grid[ 1 ] : this.originalPageY;
+				pageY = containment ? ( ( top - this.offset.click.top >= containment[ 1 ] ||
+					top - this.offset.click.top > containment[ 3 ] ) ?
+						top :
+						( ( top - this.offset.click.top >= containment[ 1 ] ) ?
+							top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : top;
+
+				left = o.grid[ 0 ] ? this.originalPageX +
+					Math.round( ( pageX - this.originalPageX ) / o.grid[ 0 ] ) * o.grid[ 0 ] :
+					this.originalPageX;
+				pageX = containment ? ( ( left - this.offset.click.left >= containment[ 0 ] ||
+					left - this.offset.click.left > containment[ 2 ] ) ?
+						left :
+						( ( left - this.offset.click.left >= containment[ 0 ] ) ?
+							left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : left;
+			}
+
+			if ( o.axis === "y" ) {
+				pageX = this.originalPageX;
+			}
+
+			if ( o.axis === "x" ) {
+				pageY = this.originalPageY;
+			}
+		}
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pageY -
+
+				// Click offset (relative to the element)
+				this.offset.click.top -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top +
+				( this.cssPosition === "fixed" ?
+					-this.offset.scroll.top :
+					( scrollIsRootNode ? 0 : this.offset.scroll.top ) )
+			),
+			left: (
+
+				// The absolute mouse position
+				pageX -
+
+				// Click offset (relative to the element)
+				this.offset.click.left -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left +
+				( this.cssPosition === "fixed" ?
+					-this.offset.scroll.left :
+					( scrollIsRootNode ? 0 : this.offset.scroll.left ) )
+			)
+		};
+
+	},
+
+	_clear: function() {
+		this._removeClass( this.helper, "ui-draggable-dragging" );
+		if ( this.helper[ 0 ] !== this.element[ 0 ] && !this.cancelHelperRemoval ) {
+			this.helper.remove();
+		}
+		this.helper = null;
+		this.cancelHelperRemoval = false;
+		if ( this.destroyOnClear ) {
+			this.destroy();
+		}
+	},
+
+	// From now on bulk stuff - mainly helpers
+
+	_trigger: function( type, event, ui ) {
+		ui = ui || this._uiHash();
+		$.ui.plugin.call( this, type, [ event, ui, this ], true );
+
+		// Absolute position and offset (see #6884 ) have to be recalculated after plugins
+		if ( /^(drag|start|stop)/.test( type ) ) {
+			this.positionAbs = this._convertPositionTo( "absolute" );
+			ui.offset = this.positionAbs;
+		}
+		return $.Widget.prototype._trigger.call( this, type, event, ui );
+	},
+
+	plugins: {},
+
+	_uiHash: function() {
+		return {
+			helper: this.helper,
+			position: this.position,
+			originalPosition: this.originalPosition,
+			offset: this.positionAbs
+		};
+	}
+
+} );
+
+$.ui.plugin.add( "draggable", "connectToSortable", {
+	start: function( event, ui, draggable ) {
+		var uiSortable = $.extend( {}, ui, {
+			item: draggable.element
+		} );
+
+		draggable.sortables = [];
+		$( draggable.options.connectToSortable ).each( function() {
+			var sortable = $( this ).sortable( "instance" );
+
+			if ( sortable && !sortable.options.disabled ) {
+				draggable.sortables.push( sortable );
+
+				// RefreshPositions is called at drag start to refresh the containerCache
+				// which is used in drag. This ensures it's initialized and synchronized
+				// with any changes that might have happened on the page since initialization.
+				sortable.refreshPositions();
+				sortable._trigger( "activate", event, uiSortable );
+			}
+		} );
+	},
+	stop: function( event, ui, draggable ) {
+		var uiSortable = $.extend( {}, ui, {
+			item: draggable.element
+		} );
+
+		draggable.cancelHelperRemoval = false;
+
+		$.each( draggable.sortables, function() {
+			var sortable = this;
+
+			if ( sortable.isOver ) {
+				sortable.isOver = 0;
+
+				// Allow this sortable to handle removing the helper
+				draggable.cancelHelperRemoval = true;
+				sortable.cancelHelperRemoval = false;
+
+				// Use _storedCSS To restore properties in the sortable,
+				// as this also handles revert (#9675) since the draggable
+				// may have modified them in unexpected ways (#8809)
+				sortable._storedCSS = {
+					position: sortable.placeholder.css( "position" ),
+					top: sortable.placeholder.css( "top" ),
+					left: sortable.placeholder.css( "left" )
+				};
+
+				sortable._mouseStop( event );
+
+				// Once drag has ended, the sortable should return to using
+				// its original helper, not the shared helper from draggable
+				sortable.options.helper = sortable.options._helper;
+			} else {
+
+				// Prevent this Sortable from removing the helper.
+				// However, don't set the draggable to remove the helper
+				// either as another connected Sortable may yet handle the removal.
+				sortable.cancelHelperRemoval = true;
+
+				sortable._trigger( "deactivate", event, uiSortable );
+			}
+		} );
+	},
+	drag: function( event, ui, draggable ) {
+		$.each( draggable.sortables, function() {
+			var innermostIntersecting = false,
+				sortable = this;
+
+			// Copy over variables that sortable's _intersectsWith uses
+			sortable.positionAbs = draggable.positionAbs;
+			sortable.helperProportions = draggable.helperProportions;
+			sortable.offset.click = draggable.offset.click;
+
+			if ( sortable._intersectsWith( sortable.containerCache ) ) {
+				innermostIntersecting = true;
+
+				$.each( draggable.sortables, function() {
+
+					// Copy over variables that sortable's _intersectsWith uses
+					this.positionAbs = draggable.positionAbs;
+					this.helperProportions = draggable.helperProportions;
+					this.offset.click = draggable.offset.click;
+
+					if ( this !== sortable &&
+							this._intersectsWith( this.containerCache ) &&
+							$.contains( sortable.element[ 0 ], this.element[ 0 ] ) ) {
+						innermostIntersecting = false;
+					}
+
+					return innermostIntersecting;
+				} );
+			}
+
+			if ( innermostIntersecting ) {
+
+				// If it intersects, we use a little isOver variable and set it once,
+				// so that the move-in stuff gets fired only once.
+				if ( !sortable.isOver ) {
+					sortable.isOver = 1;
+
+					// Store draggable's parent in case we need to reappend to it later.
+					draggable._parent = ui.helper.parent();
+
+					sortable.currentItem = ui.helper
+						.appendTo( sortable.element )
+						.data( "ui-sortable-item", true );
+
+					// Store helper option to later restore it
+					sortable.options._helper = sortable.options.helper;
+
+					sortable.options.helper = function() {
+						return ui.helper[ 0 ];
+					};
+
+					// Fire the start events of the sortable with our passed browser event,
+					// and our own helper (so it doesn't create a new one)
+					event.target = sortable.currentItem[ 0 ];
+					sortable._mouseCapture( event, true );
+					sortable._mouseStart( event, true, true );
+
+					// Because the browser event is way off the new appended portlet,
+					// modify necessary variables to reflect the changes
+					sortable.offset.click.top = draggable.offset.click.top;
+					sortable.offset.click.left = draggable.offset.click.left;
+					sortable.offset.parent.left -= draggable.offset.parent.left -
+						sortable.offset.parent.left;
+					sortable.offset.parent.top -= draggable.offset.parent.top -
+						sortable.offset.parent.top;
+
+					draggable._trigger( "toSortable", event );
+
+					// Inform draggable that the helper is in a valid drop zone,
+					// used solely in the revert option to handle "valid/invalid".
+					draggable.dropped = sortable.element;
+
+					// Need to refreshPositions of all sortables in the case that
+					// adding to one sortable changes the location of the other sortables (#9675)
+					$.each( draggable.sortables, function() {
+						this.refreshPositions();
+					} );
+
+					// Hack so receive/update callbacks work (mostly)
+					draggable.currentItem = draggable.element;
+					sortable.fromOutside = draggable;
+				}
+
+				if ( sortable.currentItem ) {
+					sortable._mouseDrag( event );
+
+					// Copy the sortable's position because the draggable's can potentially reflect
+					// a relative position, while sortable is always absolute, which the dragged
+					// element has now become. (#8809)
+					ui.position = sortable.position;
+				}
+			} else {
+
+				// If it doesn't intersect with the sortable, and it intersected before,
+				// we fake the drag stop of the sortable, but make sure it doesn't remove
+				// the helper by using cancelHelperRemoval.
+				if ( sortable.isOver ) {
+
+					sortable.isOver = 0;
+					sortable.cancelHelperRemoval = true;
+
+					// Calling sortable's mouseStop would trigger a revert,
+					// so revert must be temporarily false until after mouseStop is called.
+					sortable.options._revert = sortable.options.revert;
+					sortable.options.revert = false;
+
+					sortable._trigger( "out", event, sortable._uiHash( sortable ) );
+					sortable._mouseStop( event, true );
+
+					// Restore sortable behaviors that were modfied
+					// when the draggable entered the sortable area (#9481)
+					sortable.options.revert = sortable.options._revert;
+					sortable.options.helper = sortable.options._helper;
+
+					if ( sortable.placeholder ) {
+						sortable.placeholder.remove();
+					}
+
+					// Restore and recalculate the draggable's offset considering the sortable
+					// may have modified them in unexpected ways. (#8809, #10669)
+					ui.helper.appendTo( draggable._parent );
+					draggable._refreshOffsets( event );
+					ui.position = draggable._generatePosition( event, true );
+
+					draggable._trigger( "fromSortable", event );
+
+					// Inform draggable that the helper is no longer in a valid drop zone
+					draggable.dropped = false;
+
+					// Need to refreshPositions of all sortables just in case removing
+					// from one sortable changes the location of other sortables (#9675)
+					$.each( draggable.sortables, function() {
+						this.refreshPositions();
+					} );
+				}
+			}
+		} );
+	}
+} );
+
+$.ui.plugin.add( "draggable", "cursor", {
+	start: function( event, ui, instance ) {
+		var t = $( "body" ),
+			o = instance.options;
+
+		if ( t.css( "cursor" ) ) {
+			o._cursor = t.css( "cursor" );
+		}
+		t.css( "cursor", o.cursor );
+	},
+	stop: function( event, ui, instance ) {
+		var o = instance.options;
+		if ( o._cursor ) {
+			$( "body" ).css( "cursor", o._cursor );
+		}
+	}
+} );
+
+$.ui.plugin.add( "draggable", "opacity", {
+	start: function( event, ui, instance ) {
+		var t = $( ui.helper ),
+			o = instance.options;
+		if ( t.css( "opacity" ) ) {
+			o._opacity = t.css( "opacity" );
+		}
+		t.css( "opacity", o.opacity );
+	},
+	stop: function( event, ui, instance ) {
+		var o = instance.options;
+		if ( o._opacity ) {
+			$( ui.helper ).css( "opacity", o._opacity );
+		}
+	}
+} );
+
+$.ui.plugin.add( "draggable", "scroll", {
+	start: function( event, ui, i ) {
+		if ( !i.scrollParentNotHidden ) {
+			i.scrollParentNotHidden = i.helper.scrollParent( false );
+		}
+
+		if ( i.scrollParentNotHidden[ 0 ] !== i.document[ 0 ] &&
+				i.scrollParentNotHidden[ 0 ].tagName !== "HTML" ) {
+			i.overflowOffset = i.scrollParentNotHidden.offset();
+		}
+	},
+	drag: function( event, ui, i  ) {
+
+		var o = i.options,
+			scrolled = false,
+			scrollParent = i.scrollParentNotHidden[ 0 ],
+			document = i.document[ 0 ];
+
+		if ( scrollParent !== document && scrollParent.tagName !== "HTML" ) {
+			if ( !o.axis || o.axis !== "x" ) {
+				if ( ( i.overflowOffset.top + scrollParent.offsetHeight ) - event.pageY <
+						o.scrollSensitivity ) {
+					scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed;
+				} else if ( event.pageY - i.overflowOffset.top < o.scrollSensitivity ) {
+					scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed;
+				}
+			}
+
+			if ( !o.axis || o.axis !== "y" ) {
+				if ( ( i.overflowOffset.left + scrollParent.offsetWidth ) - event.pageX <
+						o.scrollSensitivity ) {
+					scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed;
+				} else if ( event.pageX - i.overflowOffset.left < o.scrollSensitivity ) {
+					scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed;
+				}
+			}
+
+		} else {
+
+			if ( !o.axis || o.axis !== "x" ) {
+				if ( event.pageY - $( document ).scrollTop() < o.scrollSensitivity ) {
+					scrolled = $( document ).scrollTop( $( document ).scrollTop() - o.scrollSpeed );
+				} else if ( $( window ).height() - ( event.pageY - $( document ).scrollTop() ) <
+						o.scrollSensitivity ) {
+					scrolled = $( document ).scrollTop( $( document ).scrollTop() + o.scrollSpeed );
+				}
+			}
+
+			if ( !o.axis || o.axis !== "y" ) {
+				if ( event.pageX - $( document ).scrollLeft() < o.scrollSensitivity ) {
+					scrolled = $( document ).scrollLeft(
+						$( document ).scrollLeft() - o.scrollSpeed
+					);
+				} else if ( $( window ).width() - ( event.pageX - $( document ).scrollLeft() ) <
+						o.scrollSensitivity ) {
+					scrolled = $( document ).scrollLeft(
+						$( document ).scrollLeft() + o.scrollSpeed
+					);
+				}
+			}
+
+		}
+
+		if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) {
+			$.ui.ddmanager.prepareOffsets( i, event );
+		}
+
+	}
+} );
+
+$.ui.plugin.add( "draggable", "snap", {
+	start: function( event, ui, i ) {
+
+		var o = i.options;
+
+		i.snapElements = [];
+
+		$( o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap )
+			.each( function() {
+				var $t = $( this ),
+					$o = $t.offset();
+				if ( this !== i.element[ 0 ] ) {
+					i.snapElements.push( {
+						item: this,
+						width: $t.outerWidth(), height: $t.outerHeight(),
+						top: $o.top, left: $o.left
+					} );
+				}
+			} );
+
+	},
+	drag: function( event, ui, inst ) {
+
+		var ts, bs, ls, rs, l, r, t, b, i, first,
+			o = inst.options,
+			d = o.snapTolerance,
+			x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+		for ( i = inst.snapElements.length - 1; i >= 0; i-- ) {
+
+			l = inst.snapElements[ i ].left - inst.margins.left;
+			r = l + inst.snapElements[ i ].width;
+			t = inst.snapElements[ i ].top - inst.margins.top;
+			b = t + inst.snapElements[ i ].height;
+
+			if ( x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d ||
+					!$.contains( inst.snapElements[ i ].item.ownerDocument,
+					inst.snapElements[ i ].item ) ) {
+				if ( inst.snapElements[ i ].snapping ) {
+					( inst.options.snap.release &&
+						inst.options.snap.release.call(
+							inst.element,
+							event,
+							$.extend( inst._uiHash(), { snapItem: inst.snapElements[ i ].item } )
+						) );
+				}
+				inst.snapElements[ i ].snapping = false;
+				continue;
+			}
+
+			if ( o.snapMode !== "inner" ) {
+				ts = Math.abs( t - y2 ) <= d;
+				bs = Math.abs( b - y1 ) <= d;
+				ls = Math.abs( l - x2 ) <= d;
+				rs = Math.abs( r - x1 ) <= d;
+				if ( ts ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: t - inst.helperProportions.height,
+						left: 0
+					} ).top;
+				}
+				if ( bs ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: b,
+						left: 0
+					} ).top;
+				}
+				if ( ls ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: l - inst.helperProportions.width
+					} ).left;
+				}
+				if ( rs ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: r
+					} ).left;
+				}
+			}
+
+			first = ( ts || bs || ls || rs );
+
+			if ( o.snapMode !== "outer" ) {
+				ts = Math.abs( t - y1 ) <= d;
+				bs = Math.abs( b - y2 ) <= d;
+				ls = Math.abs( l - x1 ) <= d;
+				rs = Math.abs( r - x2 ) <= d;
+				if ( ts ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: t,
+						left: 0
+					} ).top;
+				}
+				if ( bs ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: b - inst.helperProportions.height,
+						left: 0
+					} ).top;
+				}
+				if ( ls ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: l
+					} ).left;
+				}
+				if ( rs ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: r - inst.helperProportions.width
+					} ).left;
+				}
+			}
+
+			if ( !inst.snapElements[ i ].snapping && ( ts || bs || ls || rs || first ) ) {
+				( inst.options.snap.snap &&
+					inst.options.snap.snap.call(
+						inst.element,
+						event,
+						$.extend( inst._uiHash(), {
+							snapItem: inst.snapElements[ i ].item
+						} ) ) );
+			}
+			inst.snapElements[ i ].snapping = ( ts || bs || ls || rs || first );
+
+		}
+
+	}
+} );
+
+$.ui.plugin.add( "draggable", "stack", {
+	start: function( event, ui, instance ) {
+		var min,
+			o = instance.options,
+			group = $.makeArray( $( o.stack ) ).sort( function( a, b ) {
+				return ( parseInt( $( a ).css( "zIndex" ), 10 ) || 0 ) -
+					( parseInt( $( b ).css( "zIndex" ), 10 ) || 0 );
+			} );
+
+		if ( !group.length ) { return; }
+
+		min = parseInt( $( group[ 0 ] ).css( "zIndex" ), 10 ) || 0;
+		$( group ).each( function( i ) {
+			$( this ).css( "zIndex", min + i );
+		} );
+		this.css( "zIndex", ( min + group.length ) );
+	}
+} );
+
+$.ui.plugin.add( "draggable", "zIndex", {
+	start: function( event, ui, instance ) {
+		var t = $( ui.helper ),
+			o = instance.options;
+
+		if ( t.css( "zIndex" ) ) {
+			o._zIndex = t.css( "zIndex" );
+		}
+		t.css( "zIndex", o.zIndex );
+	},
+	stop: function( event, ui, instance ) {
+		var o = instance.options;
+
+		if ( o._zIndex ) {
+			$( ui.helper ).css( "zIndex", o._zIndex );
+		}
+	}
+} );
+
+var widgetsDraggable = $.ui.draggable;
+
+
+/*!
+ * jQuery UI Droppable 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Clip
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Droppable
+//>>group: Interactions
+//>>description: Enables drop targets for draggable elements.
+//>>docs: http://api.jqueryui.com/droppable/
+//>>demos: http://jqueryui.com/droppable/
+
+
+
+$.widget( "ui.droppable", {
+	version: "1.12.1",
+	widgetEventPrefix: "drop",
+	options: {
+		accept: "*",
+		addClasses: true,
+		greedy: false,
+		scope: "default",
+		tolerance: "intersect",
+
+		// Callbacks
+		activate: null,
+		deactivate: null,
+		drop: null,
+		out: null,
+		over: null
+	},
+	_create: function() {
+
+		var proportions,
+			o = this.options,
+			accept = o.accept;
+
+		this.isover = false;
+		this.isout = true;
+
+		this.accept = $.isFunction( accept ) ? accept : function( d ) {
+			return d.is( accept );
+		};
+
+		this.proportions = function( /* valueToWrite */ ) {
+			if ( arguments.length ) {
+
+				// Store the droppable's proportions
+				proportions = arguments[ 0 ];
+			} else {
+
+				// Retrieve or derive the droppable's proportions
+				return proportions ?
+					proportions :
+					proportions = {
+						width: this.element[ 0 ].offsetWidth,
+						height: this.element[ 0 ].offsetHeight
+					};
+			}
+		};
+
+		this._addToManager( o.scope );
+
+		o.addClasses && this._addClass( "ui-droppable" );
+
+	},
+
+	_addToManager: function( scope ) {
+
+		// Add the reference and positions to the manager
+		$.ui.ddmanager.droppables[ scope ] = $.ui.ddmanager.droppables[ scope ] || [];
+		$.ui.ddmanager.droppables[ scope ].push( this );
+	},
+
+	_splice: function( drop ) {
+		var i = 0;
+		for ( ; i < drop.length; i++ ) {
+			if ( drop[ i ] === this ) {
+				drop.splice( i, 1 );
+			}
+		}
+	},
+
+	_destroy: function() {
+		var drop = $.ui.ddmanager.droppables[ this.options.scope ];
+
+		this._splice( drop );
+	},
+
+	_setOption: function( key, value ) {
+
+		if ( key === "accept" ) {
+			this.accept = $.isFunction( value ) ? value : function( d ) {
+				return d.is( value );
+			};
+		} else if ( key === "scope" ) {
+			var drop = $.ui.ddmanager.droppables[ this.options.scope ];
+
+			this._splice( drop );
+			this._addToManager( value );
+		}
+
+		this._super( key, value );
+	},
+
+	_activate: function( event ) {
+		var draggable = $.ui.ddmanager.current;
+
+		this._addActiveClass();
+		if ( draggable ) {
+			this._trigger( "activate", event, this.ui( draggable ) );
+		}
+	},
+
+	_deactivate: function( event ) {
+		var draggable = $.ui.ddmanager.current;
+
+		this._removeActiveClass();
+		if ( draggable ) {
+			this._trigger( "deactivate", event, this.ui( draggable ) );
+		}
+	},
+
+	_over: function( event ) {
+
+		var draggable = $.ui.ddmanager.current;
+
+		// Bail if draggable and droppable are same element
+		if ( !draggable || ( draggable.currentItem ||
+				draggable.element )[ 0 ] === this.element[ 0 ] ) {
+			return;
+		}
+
+		if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem ||
+				draggable.element ) ) ) {
+			this._addHoverClass();
+			this._trigger( "over", event, this.ui( draggable ) );
+		}
+
+	},
+
+	_out: function( event ) {
+
+		var draggable = $.ui.ddmanager.current;
+
+		// Bail if draggable and droppable are same element
+		if ( !draggable || ( draggable.currentItem ||
+				draggable.element )[ 0 ] === this.element[ 0 ] ) {
+			return;
+		}
+
+		if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem ||
+				draggable.element ) ) ) {
+			this._removeHoverClass();
+			this._trigger( "out", event, this.ui( draggable ) );
+		}
+
+	},
+
+	_drop: function( event, custom ) {
+
+		var draggable = custom || $.ui.ddmanager.current,
+			childrenIntersection = false;
+
+		// Bail if draggable and droppable are same element
+		if ( !draggable || ( draggable.currentItem ||
+				draggable.element )[ 0 ] === this.element[ 0 ] ) {
+			return false;
+		}
+
+		this.element
+			.find( ":data(ui-droppable)" )
+			.not( ".ui-draggable-dragging" )
+			.each( function() {
+				var inst = $( this ).droppable( "instance" );
+				if (
+					inst.options.greedy &&
+					!inst.options.disabled &&
+					inst.options.scope === draggable.options.scope &&
+					inst.accept.call(
+						inst.element[ 0 ], ( draggable.currentItem || draggable.element )
+					) &&
+					intersect(
+						draggable,
+						$.extend( inst, { offset: inst.element.offset() } ),
+						inst.options.tolerance, event
+					)
+				) {
+					childrenIntersection = true;
+					return false; }
+			} );
+		if ( childrenIntersection ) {
+			return false;
+		}
+
+		if ( this.accept.call( this.element[ 0 ],
+				( draggable.currentItem || draggable.element ) ) ) {
+			this._removeActiveClass();
+			this._removeHoverClass();
+
+			this._trigger( "drop", event, this.ui( draggable ) );
+			return this.element;
+		}
+
+		return false;
+
+	},
+
+	ui: function( c ) {
+		return {
+			draggable: ( c.currentItem || c.element ),
+			helper: c.helper,
+			position: c.position,
+			offset: c.positionAbs
+		};
+	},
+
+	// Extension points just to make backcompat sane and avoid duplicating logic
+	// TODO: Remove in 1.13 along with call to it below
+	_addHoverClass: function() {
+		this._addClass( "ui-droppable-hover" );
+	},
+
+	_removeHoverClass: function() {
+		this._removeClass( "ui-droppable-hover" );
+	},
+
+	_addActiveClass: function() {
+		this._addClass( "ui-droppable-active" );
+	},
+
+	_removeActiveClass: function() {
+		this._removeClass( "ui-droppable-active" );
+	}
+} );
+
+var intersect = $.ui.intersect = ( function() {
+	function isOverAxis( x, reference, size ) {
+		return ( x >= reference ) && ( x < ( reference + size ) );
+	}
+
+	return function( draggable, droppable, toleranceMode, event ) {
+
+		if ( !droppable.offset ) {
+			return false;
+		}
+
+		var x1 = ( draggable.positionAbs ||
+				draggable.position.absolute ).left + draggable.margins.left,
+			y1 = ( draggable.positionAbs ||
+				draggable.position.absolute ).top + draggable.margins.top,
+			x2 = x1 + draggable.helperProportions.width,
+			y2 = y1 + draggable.helperProportions.height,
+			l = droppable.offset.left,
+			t = droppable.offset.top,
+			r = l + droppable.proportions().width,
+			b = t + droppable.proportions().height;
+
+		switch ( toleranceMode ) {
+		case "fit":
+			return ( l <= x1 && x2 <= r && t <= y1 && y2 <= b );
+		case "intersect":
+			return ( l < x1 + ( draggable.helperProportions.width / 2 ) && // Right Half
+				x2 - ( draggable.helperProportions.width / 2 ) < r && // Left Half
+				t < y1 + ( draggable.helperProportions.height / 2 ) && // Bottom Half
+				y2 - ( draggable.helperProportions.height / 2 ) < b ); // Top Half
+		case "pointer":
+			return isOverAxis( event.pageY, t, droppable.proportions().height ) &&
+				isOverAxis( event.pageX, l, droppable.proportions().width );
+		case "touch":
+			return (
+				( y1 >= t && y1 <= b ) || // Top edge touching
+				( y2 >= t && y2 <= b ) || // Bottom edge touching
+				( y1 < t && y2 > b ) // Surrounded vertically
+			) && (
+				( x1 >= l && x1 <= r ) || // Left edge touching
+				( x2 >= l && x2 <= r ) || // Right edge touching
+				( x1 < l && x2 > r ) // Surrounded horizontally
+			);
+		default:
+			return false;
+		}
+	};
+} )();
+
+/*
+	This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+	current: null,
+	droppables: { "default": [] },
+	prepareOffsets: function( t, event ) {
+
+		var i, j,
+			m = $.ui.ddmanager.droppables[ t.options.scope ] || [],
+			type = event ? event.type : null, // workaround for #2317
+			list = ( t.currentItem || t.element ).find( ":data(ui-droppable)" ).addBack();
+
+		droppablesLoop: for ( i = 0; i < m.length; i++ ) {
+
+			// No disabled and non-accepted
+			if ( m[ i ].options.disabled || ( t && !m[ i ].accept.call( m[ i ].element[ 0 ],
+					( t.currentItem || t.element ) ) ) ) {
+				continue;
+			}
+
+			// Filter out elements in the current dragged item
+			for ( j = 0; j < list.length; j++ ) {
+				if ( list[ j ] === m[ i ].element[ 0 ] ) {
+					m[ i ].proportions().height = 0;
+					continue droppablesLoop;
+				}
+			}
+
+			m[ i ].visible = m[ i ].element.css( "display" ) !== "none";
+			if ( !m[ i ].visible ) {
+				continue;
+			}
+
+			// Activate the droppable if used directly from draggables
+			if ( type === "mousedown" ) {
+				m[ i ]._activate.call( m[ i ], event );
+			}
+
+			m[ i ].offset = m[ i ].element.offset();
+			m[ i ].proportions( {
+				width: m[ i ].element[ 0 ].offsetWidth,
+				height: m[ i ].element[ 0 ].offsetHeight
+			} );
+
+		}
+
+	},
+	drop: function( draggable, event ) {
+
+		var dropped = false;
+
+		// Create a copy of the droppables in case the list changes during the drop (#9116)
+		$.each( ( $.ui.ddmanager.droppables[ draggable.options.scope ] || [] ).slice(), function() {
+
+			if ( !this.options ) {
+				return;
+			}
+			if ( !this.options.disabled && this.visible &&
+					intersect( draggable, this, this.options.tolerance, event ) ) {
+				dropped = this._drop.call( this, event ) || dropped;
+			}
+
+			if ( !this.options.disabled && this.visible && this.accept.call( this.element[ 0 ],
+					( draggable.currentItem || draggable.element ) ) ) {
+				this.isout = true;
+				this.isover = false;
+				this._deactivate.call( this, event );
+			}
+
+		} );
+		return dropped;
+
+	},
+	dragStart: function( draggable, event ) {
+
+		// Listen for scrolling so that if the dragging causes scrolling the position of the
+		// droppables can be recalculated (see #5003)
+		draggable.element.parentsUntil( "body" ).on( "scroll.droppable", function() {
+			if ( !draggable.options.refreshPositions ) {
+				$.ui.ddmanager.prepareOffsets( draggable, event );
+			}
+		} );
+	},
+	drag: function( draggable, event ) {
+
+		// If you have a highly dynamic page, you might try this option. It renders positions
+		// every time you move the mouse.
+		if ( draggable.options.refreshPositions ) {
+			$.ui.ddmanager.prepareOffsets( draggable, event );
+		}
+
+		// Run through all droppables and check their positions based on specific tolerance options
+		$.each( $.ui.ddmanager.droppables[ draggable.options.scope ] || [], function() {
+
+			if ( this.options.disabled || this.greedyChild || !this.visible ) {
+				return;
+			}
+
+			var parentInstance, scope, parent,
+				intersects = intersect( draggable, this, this.options.tolerance, event ),
+				c = !intersects && this.isover ?
+					"isout" :
+					( intersects && !this.isover ? "isover" : null );
+			if ( !c ) {
+				return;
+			}
+
+			if ( this.options.greedy ) {
+
+				// find droppable parents with same scope
+				scope = this.options.scope;
+				parent = this.element.parents( ":data(ui-droppable)" ).filter( function() {
+					return $( this ).droppable( "instance" ).options.scope === scope;
+				} );
+
+				if ( parent.length ) {
+					parentInstance = $( parent[ 0 ] ).droppable( "instance" );
+					parentInstance.greedyChild = ( c === "isover" );
+				}
+			}
+
+			// We just moved into a greedy child
+			if ( parentInstance && c === "isover" ) {
+				parentInstance.isover = false;
+				parentInstance.isout = true;
+				parentInstance._out.call( parentInstance, event );
+			}
+
+			this[ c ] = true;
+			this[ c === "isout" ? "isover" : "isout" ] = false;
+			this[ c === "isover" ? "_over" : "_out" ].call( this, event );
+
+			// We just moved out of a greedy child
+			if ( parentInstance && c === "isout" ) {
+				parentInstance.isout = false;
+				parentInstance.isover = true;
+				parentInstance._over.call( parentInstance, event );
+			}
+		} );
+
+	},
+	dragStop: function( draggable, event ) {
+		draggable.element.parentsUntil( "body" ).off( "scroll.droppable" );
+
+		// Call prepareOffsets one final time since IE does not fire return scroll events when
+		// overflow was caused by drag (see #5003)
+		if ( !draggable.options.refreshPositions ) {
+			$.ui.ddmanager.prepareOffsets( draggable, event );
+		}
+	}
+};
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for activeClass and hoverClass options
+	$.widget( "ui.droppable", $.ui.droppable, {
+		options: {
+			hoverClass: false,
+			activeClass: false
+		},
+		_addActiveClass: function() {
+			this._super();
+			if ( this.options.activeClass ) {
+				this.element.addClass( this.options.activeClass );
+			}
+		},
+		_removeActiveClass: function() {
+			this._super();
+			if ( this.options.activeClass ) {
+				this.element.removeClass( this.options.activeClass );
+			}
+		},
+		_addHoverClass: function() {
+			this._super();
+			if ( this.options.hoverClass ) {
+				this.element.addClass( this.options.hoverClass );
+			}
+		},
+		_removeHoverClass: function() {
+			this._super();
+			if ( this.options.hoverClass ) {
+				this.element.removeClass( this.options.hoverClass );
+			}
+		}
+	} );
+}
+
+var widgetsDroppable = $.ui.droppable;
+
+
+/*!
+ * jQuery UI Resizable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Resizable
+//>>group: Interactions
+//>>description: Enables resize functionality for any element.
+//>>docs: http://api.jqueryui.com/resizable/
+//>>demos: http://jqueryui.com/resizable/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/resizable.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.resizable", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "resize",
+	options: {
+		alsoResize: false,
+		animate: false,
+		animateDuration: "slow",
+		animateEasing: "swing",
+		aspectRatio: false,
+		autoHide: false,
+		classes: {
+			"ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se"
+		},
+		containment: false,
+		ghost: false,
+		grid: false,
+		handles: "e,s,se",
+		helper: false,
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 10,
+		minWidth: 10,
+
+		// See #7960
+		zIndex: 90,
+
+		// Callbacks
+		resize: null,
+		start: null,
+		stop: null
+	},
+
+	_num: function( value ) {
+		return parseFloat( value ) || 0;
+	},
+
+	_isNumber: function( value ) {
+		return !isNaN( parseFloat( value ) );
+	},
+
+	_hasScroll: function( el, a ) {
+
+		if ( $( el ).css( "overflow" ) === "hidden" ) {
+			return false;
+		}
+
+		var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+			has = false;
+
+		if ( el[ scroll ] > 0 ) {
+			return true;
+		}
+
+		// TODO: determine which cases actually cause this to happen
+		// if the element doesn't have the scroll set, see if it's possible to
+		// set the scroll
+		el[ scroll ] = 1;
+		has = ( el[ scroll ] > 0 );
+		el[ scroll ] = 0;
+		return has;
+	},
+
+	_create: function() {
+
+		var margins,
+			o = this.options,
+			that = this;
+		this._addClass( "ui-resizable" );
+
+		$.extend( this, {
+			_aspectRatio: !!( o.aspectRatio ),
+			aspectRatio: o.aspectRatio,
+			originalElement: this.element,
+			_proportionallyResizeElements: [],
+			_helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
+		} );
+
+		// Wrap the element if it cannot hold child nodes
+		if ( this.element[ 0 ].nodeName.match( /^(canvas|textarea|input|select|button|img)$/i ) ) {
+
+			this.element.wrap(
+				$( "<div class='ui-wrapper' style='overflow: hidden;'></div>" ).css( {
+					position: this.element.css( "position" ),
+					width: this.element.outerWidth(),
+					height: this.element.outerHeight(),
+					top: this.element.css( "top" ),
+					left: this.element.css( "left" )
+				} )
+			);
+
+			this.element = this.element.parent().data(
+				"ui-resizable", this.element.resizable( "instance" )
+			);
+
+			this.elementIsWrapper = true;
+
+			margins = {
+				marginTop: this.originalElement.css( "marginTop" ),
+				marginRight: this.originalElement.css( "marginRight" ),
+				marginBottom: this.originalElement.css( "marginBottom" ),
+				marginLeft: this.originalElement.css( "marginLeft" )
+			};
+
+			this.element.css( margins );
+			this.originalElement.css( "margin", 0 );
+
+			// support: Safari
+			// Prevent Safari textarea resize
+			this.originalResizeStyle = this.originalElement.css( "resize" );
+			this.originalElement.css( "resize", "none" );
+
+			this._proportionallyResizeElements.push( this.originalElement.css( {
+				position: "static",
+				zoom: 1,
+				display: "block"
+			} ) );
+
+			// Support: IE9
+			// avoid IE jump (hard set the margin)
+			this.originalElement.css( margins );
+
+			this._proportionallyResize();
+		}
+
+		this._setupHandles();
+
+		if ( o.autoHide ) {
+			$( this.element )
+				.on( "mouseenter", function() {
+					if ( o.disabled ) {
+						return;
+					}
+					that._removeClass( "ui-resizable-autohide" );
+					that._handles.show();
+				} )
+				.on( "mouseleave", function() {
+					if ( o.disabled ) {
+						return;
+					}
+					if ( !that.resizing ) {
+						that._addClass( "ui-resizable-autohide" );
+						that._handles.hide();
+					}
+				} );
+		}
+
+		this._mouseInit();
+	},
+
+	_destroy: function() {
+
+		this._mouseDestroy();
+
+		var wrapper,
+			_destroy = function( exp ) {
+				$( exp )
+					.removeData( "resizable" )
+					.removeData( "ui-resizable" )
+					.off( ".resizable" )
+					.find( ".ui-resizable-handle" )
+						.remove();
+			};
+
+		// TODO: Unwrap at same DOM position
+		if ( this.elementIsWrapper ) {
+			_destroy( this.element );
+			wrapper = this.element;
+			this.originalElement.css( {
+				position: wrapper.css( "position" ),
+				width: wrapper.outerWidth(),
+				height: wrapper.outerHeight(),
+				top: wrapper.css( "top" ),
+				left: wrapper.css( "left" )
+			} ).insertAfter( wrapper );
+			wrapper.remove();
+		}
+
+		this.originalElement.css( "resize", this.originalResizeStyle );
+		_destroy( this.originalElement );
+
+		return this;
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+
+		switch ( key ) {
+		case "handles":
+			this._removeHandles();
+			this._setupHandles();
+			break;
+		default:
+			break;
+		}
+	},
+
+	_setupHandles: function() {
+		var o = this.options, handle, i, n, hname, axis, that = this;
+		this.handles = o.handles ||
+			( !$( ".ui-resizable-handle", this.element ).length ?
+				"e,s,se" : {
+					n: ".ui-resizable-n",
+					e: ".ui-resizable-e",
+					s: ".ui-resizable-s",
+					w: ".ui-resizable-w",
+					se: ".ui-resizable-se",
+					sw: ".ui-resizable-sw",
+					ne: ".ui-resizable-ne",
+					nw: ".ui-resizable-nw"
+				} );
+
+		this._handles = $();
+		if ( this.handles.constructor === String ) {
+
+			if ( this.handles === "all" ) {
+				this.handles = "n,e,s,w,se,sw,ne,nw";
+			}
+
+			n = this.handles.split( "," );
+			this.handles = {};
+
+			for ( i = 0; i < n.length; i++ ) {
+
+				handle = $.trim( n[ i ] );
+				hname = "ui-resizable-" + handle;
+				axis = $( "<div>" );
+				this._addClass( axis, "ui-resizable-handle " + hname );
+
+				axis.css( { zIndex: o.zIndex } );
+
+				this.handles[ handle ] = ".ui-resizable-" + handle;
+				this.element.append( axis );
+			}
+
+		}
+
+		this._renderAxis = function( target ) {
+
+			var i, axis, padPos, padWrapper;
+
+			target = target || this.element;
+
+			for ( i in this.handles ) {
+
+				if ( this.handles[ i ].constructor === String ) {
+					this.handles[ i ] = this.element.children( this.handles[ i ] ).first().show();
+				} else if ( this.handles[ i ].jquery || this.handles[ i ].nodeType ) {
+					this.handles[ i ] = $( this.handles[ i ] );
+					this._on( this.handles[ i ], { "mousedown": that._mouseDown } );
+				}
+
+				if ( this.elementIsWrapper &&
+						this.originalElement[ 0 ]
+							.nodeName
+							.match( /^(textarea|input|select|button)$/i ) ) {
+					axis = $( this.handles[ i ], this.element );
+
+					padWrapper = /sw|ne|nw|se|n|s/.test( i ) ?
+						axis.outerHeight() :
+						axis.outerWidth();
+
+					padPos = [ "padding",
+						/ne|nw|n/.test( i ) ? "Top" :
+						/se|sw|s/.test( i ) ? "Bottom" :
+						/^e$/.test( i ) ? "Right" : "Left" ].join( "" );
+
+					target.css( padPos, padWrapper );
+
+					this._proportionallyResize();
+				}
+
+				this._handles = this._handles.add( this.handles[ i ] );
+			}
+		};
+
+		// TODO: make renderAxis a prototype function
+		this._renderAxis( this.element );
+
+		this._handles = this._handles.add( this.element.find( ".ui-resizable-handle" ) );
+		this._handles.disableSelection();
+
+		this._handles.on( "mouseover", function() {
+			if ( !that.resizing ) {
+				if ( this.className ) {
+					axis = this.className.match( /ui-resizable-(se|sw|ne|nw|n|e|s|w)/i );
+				}
+				that.axis = axis && axis[ 1 ] ? axis[ 1 ] : "se";
+			}
+		} );
+
+		if ( o.autoHide ) {
+			this._handles.hide();
+			this._addClass( "ui-resizable-autohide" );
+		}
+	},
+
+	_removeHandles: function() {
+		this._handles.remove();
+	},
+
+	_mouseCapture: function( event ) {
+		var i, handle,
+			capture = false;
+
+		for ( i in this.handles ) {
+			handle = $( this.handles[ i ] )[ 0 ];
+			if ( handle === event.target || $.contains( handle, event.target ) ) {
+				capture = true;
+			}
+		}
+
+		return !this.options.disabled && capture;
+	},
+
+	_mouseStart: function( event ) {
+
+		var curleft, curtop, cursor,
+			o = this.options,
+			el = this.element;
+
+		this.resizing = true;
+
+		this._renderProxy();
+
+		curleft = this._num( this.helper.css( "left" ) );
+		curtop = this._num( this.helper.css( "top" ) );
+
+		if ( o.containment ) {
+			curleft += $( o.containment ).scrollLeft() || 0;
+			curtop += $( o.containment ).scrollTop() || 0;
+		}
+
+		this.offset = this.helper.offset();
+		this.position = { left: curleft, top: curtop };
+
+		this.size = this._helper ? {
+				width: this.helper.width(),
+				height: this.helper.height()
+			} : {
+				width: el.width(),
+				height: el.height()
+			};
+
+		this.originalSize = this._helper ? {
+				width: el.outerWidth(),
+				height: el.outerHeight()
+			} : {
+				width: el.width(),
+				height: el.height()
+			};
+
+		this.sizeDiff = {
+			width: el.outerWidth() - el.width(),
+			height: el.outerHeight() - el.height()
+		};
+
+		this.originalPosition = { left: curleft, top: curtop };
+		this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+		this.aspectRatio = ( typeof o.aspectRatio === "number" ) ?
+			o.aspectRatio :
+			( ( this.originalSize.width / this.originalSize.height ) || 1 );
+
+		cursor = $( ".ui-resizable-" + this.axis ).css( "cursor" );
+		$( "body" ).css( "cursor", cursor === "auto" ? this.axis + "-resize" : cursor );
+
+		this._addClass( "ui-resizable-resizing" );
+		this._propagate( "start", event );
+		return true;
+	},
+
+	_mouseDrag: function( event ) {
+
+		var data, props,
+			smp = this.originalMousePosition,
+			a = this.axis,
+			dx = ( event.pageX - smp.left ) || 0,
+			dy = ( event.pageY - smp.top ) || 0,
+			trigger = this._change[ a ];
+
+		this._updatePrevProperties();
+
+		if ( !trigger ) {
+			return false;
+		}
+
+		data = trigger.apply( this, [ event, dx, dy ] );
+
+		this._updateVirtualBoundaries( event.shiftKey );
+		if ( this._aspectRatio || event.shiftKey ) {
+			data = this._updateRatio( data, event );
+		}
+
+		data = this._respectSize( data, event );
+
+		this._updateCache( data );
+
+		this._propagate( "resize", event );
+
+		props = this._applyChanges();
+
+		if ( !this._helper && this._proportionallyResizeElements.length ) {
+			this._proportionallyResize();
+		}
+
+		if ( !$.isEmptyObject( props ) ) {
+			this._updatePrevProperties();
+			this._trigger( "resize", event, this.ui() );
+			this._applyChanges();
+		}
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+
+		this.resizing = false;
+		var pr, ista, soffseth, soffsetw, s, left, top,
+			o = this.options, that = this;
+
+		if ( this._helper ) {
+
+			pr = this._proportionallyResizeElements;
+			ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName );
+			soffseth = ista && this._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height;
+			soffsetw = ista ? 0 : that.sizeDiff.width;
+
+			s = {
+				width: ( that.helper.width()  - soffsetw ),
+				height: ( that.helper.height() - soffseth )
+			};
+			left = ( parseFloat( that.element.css( "left" ) ) +
+				( that.position.left - that.originalPosition.left ) ) || null;
+			top = ( parseFloat( that.element.css( "top" ) ) +
+				( that.position.top - that.originalPosition.top ) ) || null;
+
+			if ( !o.animate ) {
+				this.element.css( $.extend( s, { top: top, left: left } ) );
+			}
+
+			that.helper.height( that.size.height );
+			that.helper.width( that.size.width );
+
+			if ( this._helper && !o.animate ) {
+				this._proportionallyResize();
+			}
+		}
+
+		$( "body" ).css( "cursor", "auto" );
+
+		this._removeClass( "ui-resizable-resizing" );
+
+		this._propagate( "stop", event );
+
+		if ( this._helper ) {
+			this.helper.remove();
+		}
+
+		return false;
+
+	},
+
+	_updatePrevProperties: function() {
+		this.prevPosition = {
+			top: this.position.top,
+			left: this.position.left
+		};
+		this.prevSize = {
+			width: this.size.width,
+			height: this.size.height
+		};
+	},
+
+	_applyChanges: function() {
+		var props = {};
+
+		if ( this.position.top !== this.prevPosition.top ) {
+			props.top = this.position.top + "px";
+		}
+		if ( this.position.left !== this.prevPosition.left ) {
+			props.left = this.position.left + "px";
+		}
+		if ( this.size.width !== this.prevSize.width ) {
+			props.width = this.size.width + "px";
+		}
+		if ( this.size.height !== this.prevSize.height ) {
+			props.height = this.size.height + "px";
+		}
+
+		this.helper.css( props );
+
+		return props;
+	},
+
+	_updateVirtualBoundaries: function( forceAspectRatio ) {
+		var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
+			o = this.options;
+
+		b = {
+			minWidth: this._isNumber( o.minWidth ) ? o.minWidth : 0,
+			maxWidth: this._isNumber( o.maxWidth ) ? o.maxWidth : Infinity,
+			minHeight: this._isNumber( o.minHeight ) ? o.minHeight : 0,
+			maxHeight: this._isNumber( o.maxHeight ) ? o.maxHeight : Infinity
+		};
+
+		if ( this._aspectRatio || forceAspectRatio ) {
+			pMinWidth = b.minHeight * this.aspectRatio;
+			pMinHeight = b.minWidth / this.aspectRatio;
+			pMaxWidth = b.maxHeight * this.aspectRatio;
+			pMaxHeight = b.maxWidth / this.aspectRatio;
+
+			if ( pMinWidth > b.minWidth ) {
+				b.minWidth = pMinWidth;
+			}
+			if ( pMinHeight > b.minHeight ) {
+				b.minHeight = pMinHeight;
+			}
+			if ( pMaxWidth < b.maxWidth ) {
+				b.maxWidth = pMaxWidth;
+			}
+			if ( pMaxHeight < b.maxHeight ) {
+				b.maxHeight = pMaxHeight;
+			}
+		}
+		this._vBoundaries = b;
+	},
+
+	_updateCache: function( data ) {
+		this.offset = this.helper.offset();
+		if ( this._isNumber( data.left ) ) {
+			this.position.left = data.left;
+		}
+		if ( this._isNumber( data.top ) ) {
+			this.position.top = data.top;
+		}
+		if ( this._isNumber( data.height ) ) {
+			this.size.height = data.height;
+		}
+		if ( this._isNumber( data.width ) ) {
+			this.size.width = data.width;
+		}
+	},
+
+	_updateRatio: function( data ) {
+
+		var cpos = this.position,
+			csize = this.size,
+			a = this.axis;
+
+		if ( this._isNumber( data.height ) ) {
+			data.width = ( data.height * this.aspectRatio );
+		} else if ( this._isNumber( data.width ) ) {
+			data.height = ( data.width / this.aspectRatio );
+		}
+
+		if ( a === "sw" ) {
+			data.left = cpos.left + ( csize.width - data.width );
+			data.top = null;
+		}
+		if ( a === "nw" ) {
+			data.top = cpos.top + ( csize.height - data.height );
+			data.left = cpos.left + ( csize.width - data.width );
+		}
+
+		return data;
+	},
+
+	_respectSize: function( data ) {
+
+		var o = this._vBoundaries,
+			a = this.axis,
+			ismaxw = this._isNumber( data.width ) && o.maxWidth && ( o.maxWidth < data.width ),
+			ismaxh = this._isNumber( data.height ) && o.maxHeight && ( o.maxHeight < data.height ),
+			isminw = this._isNumber( data.width ) && o.minWidth && ( o.minWidth > data.width ),
+			isminh = this._isNumber( data.height ) && o.minHeight && ( o.minHeight > data.height ),
+			dw = this.originalPosition.left + this.originalSize.width,
+			dh = this.originalPosition.top + this.originalSize.height,
+			cw = /sw|nw|w/.test( a ), ch = /nw|ne|n/.test( a );
+		if ( isminw ) {
+			data.width = o.minWidth;
+		}
+		if ( isminh ) {
+			data.height = o.minHeight;
+		}
+		if ( ismaxw ) {
+			data.width = o.maxWidth;
+		}
+		if ( ismaxh ) {
+			data.height = o.maxHeight;
+		}
+
+		if ( isminw && cw ) {
+			data.left = dw - o.minWidth;
+		}
+		if ( ismaxw && cw ) {
+			data.left = dw - o.maxWidth;
+		}
+		if ( isminh && ch ) {
+			data.top = dh - o.minHeight;
+		}
+		if ( ismaxh && ch ) {
+			data.top = dh - o.maxHeight;
+		}
+
+		// Fixing jump error on top/left - bug #2330
+		if ( !data.width && !data.height && !data.left && data.top ) {
+			data.top = null;
+		} else if ( !data.width && !data.height && !data.top && data.left ) {
+			data.left = null;
+		}
+
+		return data;
+	},
+
+	_getPaddingPlusBorderDimensions: function( element ) {
+		var i = 0,
+			widths = [],
+			borders = [
+				element.css( "borderTopWidth" ),
+				element.css( "borderRightWidth" ),
+				element.css( "borderBottomWidth" ),
+				element.css( "borderLeftWidth" )
+			],
+			paddings = [
+				element.css( "paddingTop" ),
+				element.css( "paddingRight" ),
+				element.css( "paddingBottom" ),
+				element.css( "paddingLeft" )
+			];
+
+		for ( ; i < 4; i++ ) {
+			widths[ i ] = ( parseFloat( borders[ i ] ) || 0 );
+			widths[ i ] += ( parseFloat( paddings[ i ] ) || 0 );
+		}
+
+		return {
+			height: widths[ 0 ] + widths[ 2 ],
+			width: widths[ 1 ] + widths[ 3 ]
+		};
+	},
+
+	_proportionallyResize: function() {
+
+		if ( !this._proportionallyResizeElements.length ) {
+			return;
+		}
+
+		var prel,
+			i = 0,
+			element = this.helper || this.element;
+
+		for ( ; i < this._proportionallyResizeElements.length; i++ ) {
+
+			prel = this._proportionallyResizeElements[ i ];
+
+			// TODO: Seems like a bug to cache this.outerDimensions
+			// considering that we are in a loop.
+			if ( !this.outerDimensions ) {
+				this.outerDimensions = this._getPaddingPlusBorderDimensions( prel );
+			}
+
+			prel.css( {
+				height: ( element.height() - this.outerDimensions.height ) || 0,
+				width: ( element.width() - this.outerDimensions.width ) || 0
+			} );
+
+		}
+
+	},
+
+	_renderProxy: function() {
+
+		var el = this.element, o = this.options;
+		this.elementOffset = el.offset();
+
+		if ( this._helper ) {
+
+			this.helper = this.helper || $( "<div style='overflow:hidden;'></div>" );
+
+			this._addClass( this.helper, this._helper );
+			this.helper.css( {
+				width: this.element.outerWidth(),
+				height: this.element.outerHeight(),
+				position: "absolute",
+				left: this.elementOffset.left + "px",
+				top: this.elementOffset.top + "px",
+				zIndex: ++o.zIndex //TODO: Don't modify option
+			} );
+
+			this.helper
+				.appendTo( "body" )
+				.disableSelection();
+
+		} else {
+			this.helper = this.element;
+		}
+
+	},
+
+	_change: {
+		e: function( event, dx ) {
+			return { width: this.originalSize.width + dx };
+		},
+		w: function( event, dx ) {
+			var cs = this.originalSize, sp = this.originalPosition;
+			return { left: sp.left + dx, width: cs.width - dx };
+		},
+		n: function( event, dx, dy ) {
+			var cs = this.originalSize, sp = this.originalPosition;
+			return { top: sp.top + dy, height: cs.height - dy };
+		},
+		s: function( event, dx, dy ) {
+			return { height: this.originalSize.height + dy };
+		},
+		se: function( event, dx, dy ) {
+			return $.extend( this._change.s.apply( this, arguments ),
+				this._change.e.apply( this, [ event, dx, dy ] ) );
+		},
+		sw: function( event, dx, dy ) {
+			return $.extend( this._change.s.apply( this, arguments ),
+				this._change.w.apply( this, [ event, dx, dy ] ) );
+		},
+		ne: function( event, dx, dy ) {
+			return $.extend( this._change.n.apply( this, arguments ),
+				this._change.e.apply( this, [ event, dx, dy ] ) );
+		},
+		nw: function( event, dx, dy ) {
+			return $.extend( this._change.n.apply( this, arguments ),
+				this._change.w.apply( this, [ event, dx, dy ] ) );
+		}
+	},
+
+	_propagate: function( n, event ) {
+		$.ui.plugin.call( this, n, [ event, this.ui() ] );
+		( n !== "resize" && this._trigger( n, event, this.ui() ) );
+	},
+
+	plugins: {},
+
+	ui: function() {
+		return {
+			originalElement: this.originalElement,
+			element: this.element,
+			helper: this.helper,
+			position: this.position,
+			size: this.size,
+			originalSize: this.originalSize,
+			originalPosition: this.originalPosition
+		};
+	}
+
+} );
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add( "resizable", "animate", {
+
+	stop: function( event ) {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options,
+			pr = that._proportionallyResizeElements,
+			ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ),
+			soffseth = ista && that._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height,
+			soffsetw = ista ? 0 : that.sizeDiff.width,
+			style = {
+				width: ( that.size.width - soffsetw ),
+				height: ( that.size.height - soffseth )
+			},
+			left = ( parseFloat( that.element.css( "left" ) ) +
+				( that.position.left - that.originalPosition.left ) ) || null,
+			top = ( parseFloat( that.element.css( "top" ) ) +
+				( that.position.top - that.originalPosition.top ) ) || null;
+
+		that.element.animate(
+			$.extend( style, top && left ? { top: top, left: left } : {} ), {
+				duration: o.animateDuration,
+				easing: o.animateEasing,
+				step: function() {
+
+					var data = {
+						width: parseFloat( that.element.css( "width" ) ),
+						height: parseFloat( that.element.css( "height" ) ),
+						top: parseFloat( that.element.css( "top" ) ),
+						left: parseFloat( that.element.css( "left" ) )
+					};
+
+					if ( pr && pr.length ) {
+						$( pr[ 0 ] ).css( { width: data.width, height: data.height } );
+					}
+
+					// Propagating resize, and updating values for each animation step
+					that._updateCache( data );
+					that._propagate( "resize", event );
+
+				}
+			}
+		);
+	}
+
+} );
+
+$.ui.plugin.add( "resizable", "containment", {
+
+	start: function() {
+		var element, p, co, ch, cw, width, height,
+			that = $( this ).resizable( "instance" ),
+			o = that.options,
+			el = that.element,
+			oc = o.containment,
+			ce = ( oc instanceof $ ) ?
+				oc.get( 0 ) :
+				( /parent/.test( oc ) ) ? el.parent().get( 0 ) : oc;
+
+		if ( !ce ) {
+			return;
+		}
+
+		that.containerElement = $( ce );
+
+		if ( /document/.test( oc ) || oc === document ) {
+			that.containerOffset = {
+				left: 0,
+				top: 0
+			};
+			that.containerPosition = {
+				left: 0,
+				top: 0
+			};
+
+			that.parentData = {
+				element: $( document ),
+				left: 0,
+				top: 0,
+				width: $( document ).width(),
+				height: $( document ).height() || document.body.parentNode.scrollHeight
+			};
+		} else {
+			element = $( ce );
+			p = [];
+			$( [ "Top", "Right", "Left", "Bottom" ] ).each( function( i, name ) {
+				p[ i ] = that._num( element.css( "padding" + name ) );
+			} );
+
+			that.containerOffset = element.offset();
+			that.containerPosition = element.position();
+			that.containerSize = {
+				height: ( element.innerHeight() - p[ 3 ] ),
+				width: ( element.innerWidth() - p[ 1 ] )
+			};
+
+			co = that.containerOffset;
+			ch = that.containerSize.height;
+			cw = that.containerSize.width;
+			width = ( that._hasScroll ( ce, "left" ) ? ce.scrollWidth : cw );
+			height = ( that._hasScroll ( ce ) ? ce.scrollHeight : ch ) ;
+
+			that.parentData = {
+				element: ce,
+				left: co.left,
+				top: co.top,
+				width: width,
+				height: height
+			};
+		}
+	},
+
+	resize: function( event ) {
+		var woset, hoset, isParent, isOffsetRelative,
+			that = $( this ).resizable( "instance" ),
+			o = that.options,
+			co = that.containerOffset,
+			cp = that.position,
+			pRatio = that._aspectRatio || event.shiftKey,
+			cop = {
+				top: 0,
+				left: 0
+			},
+			ce = that.containerElement,
+			continueResize = true;
+
+		if ( ce[ 0 ] !== document && ( /static/ ).test( ce.css( "position" ) ) ) {
+			cop = co;
+		}
+
+		if ( cp.left < ( that._helper ? co.left : 0 ) ) {
+			that.size.width = that.size.width +
+				( that._helper ?
+					( that.position.left - co.left ) :
+					( that.position.left - cop.left ) );
+
+			if ( pRatio ) {
+				that.size.height = that.size.width / that.aspectRatio;
+				continueResize = false;
+			}
+			that.position.left = o.helper ? co.left : 0;
+		}
+
+		if ( cp.top < ( that._helper ? co.top : 0 ) ) {
+			that.size.height = that.size.height +
+				( that._helper ?
+					( that.position.top - co.top ) :
+					that.position.top );
+
+			if ( pRatio ) {
+				that.size.width = that.size.height * that.aspectRatio;
+				continueResize = false;
+			}
+			that.position.top = that._helper ? co.top : 0;
+		}
+
+		isParent = that.containerElement.get( 0 ) === that.element.parent().get( 0 );
+		isOffsetRelative = /relative|absolute/.test( that.containerElement.css( "position" ) );
+
+		if ( isParent && isOffsetRelative ) {
+			that.offset.left = that.parentData.left + that.position.left;
+			that.offset.top = that.parentData.top + that.position.top;
+		} else {
+			that.offset.left = that.element.offset().left;
+			that.offset.top = that.element.offset().top;
+		}
+
+		woset = Math.abs( that.sizeDiff.width +
+			( that._helper ?
+				that.offset.left - cop.left :
+				( that.offset.left - co.left ) ) );
+
+		hoset = Math.abs( that.sizeDiff.height +
+			( that._helper ?
+				that.offset.top - cop.top :
+				( that.offset.top - co.top ) ) );
+
+		if ( woset + that.size.width >= that.parentData.width ) {
+			that.size.width = that.parentData.width - woset;
+			if ( pRatio ) {
+				that.size.height = that.size.width / that.aspectRatio;
+				continueResize = false;
+			}
+		}
+
+		if ( hoset + that.size.height >= that.parentData.height ) {
+			that.size.height = that.parentData.height - hoset;
+			if ( pRatio ) {
+				that.size.width = that.size.height * that.aspectRatio;
+				continueResize = false;
+			}
+		}
+
+		if ( !continueResize ) {
+			that.position.left = that.prevPosition.left;
+			that.position.top = that.prevPosition.top;
+			that.size.width = that.prevSize.width;
+			that.size.height = that.prevSize.height;
+		}
+	},
+
+	stop: function() {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options,
+			co = that.containerOffset,
+			cop = that.containerPosition,
+			ce = that.containerElement,
+			helper = $( that.helper ),
+			ho = helper.offset(),
+			w = helper.outerWidth() - that.sizeDiff.width,
+			h = helper.outerHeight() - that.sizeDiff.height;
+
+		if ( that._helper && !o.animate && ( /relative/ ).test( ce.css( "position" ) ) ) {
+			$( this ).css( {
+				left: ho.left - cop.left - co.left,
+				width: w,
+				height: h
+			} );
+		}
+
+		if ( that._helper && !o.animate && ( /static/ ).test( ce.css( "position" ) ) ) {
+			$( this ).css( {
+				left: ho.left - cop.left - co.left,
+				width: w,
+				height: h
+			} );
+		}
+	}
+} );
+
+$.ui.plugin.add( "resizable", "alsoResize", {
+
+	start: function() {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options;
+
+		$( o.alsoResize ).each( function() {
+			var el = $( this );
+			el.data( "ui-resizable-alsoresize", {
+				width: parseFloat( el.width() ), height: parseFloat( el.height() ),
+				left: parseFloat( el.css( "left" ) ), top: parseFloat( el.css( "top" ) )
+			} );
+		} );
+	},
+
+	resize: function( event, ui ) {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options,
+			os = that.originalSize,
+			op = that.originalPosition,
+			delta = {
+				height: ( that.size.height - os.height ) || 0,
+				width: ( that.size.width - os.width ) || 0,
+				top: ( that.position.top - op.top ) || 0,
+				left: ( that.position.left - op.left ) || 0
+			};
+
+			$( o.alsoResize ).each( function() {
+				var el = $( this ), start = $( this ).data( "ui-resizable-alsoresize" ), style = {},
+					css = el.parents( ui.originalElement[ 0 ] ).length ?
+							[ "width", "height" ] :
+							[ "width", "height", "top", "left" ];
+
+				$.each( css, function( i, prop ) {
+					var sum = ( start[ prop ] || 0 ) + ( delta[ prop ] || 0 );
+					if ( sum && sum >= 0 ) {
+						style[ prop ] = sum || null;
+					}
+				} );
+
+				el.css( style );
+			} );
+	},
+
+	stop: function() {
+		$( this ).removeData( "ui-resizable-alsoresize" );
+	}
+} );
+
+$.ui.plugin.add( "resizable", "ghost", {
+
+	start: function() {
+
+		var that = $( this ).resizable( "instance" ), cs = that.size;
+
+		that.ghost = that.originalElement.clone();
+		that.ghost.css( {
+			opacity: 0.25,
+			display: "block",
+			position: "relative",
+			height: cs.height,
+			width: cs.width,
+			margin: 0,
+			left: 0,
+			top: 0
+		} );
+
+		that._addClass( that.ghost, "ui-resizable-ghost" );
+
+		// DEPRECATED
+		// TODO: remove after 1.12
+		if ( $.uiBackCompat !== false && typeof that.options.ghost === "string" ) {
+
+			// Ghost option
+			that.ghost.addClass( this.options.ghost );
+		}
+
+		that.ghost.appendTo( that.helper );
+
+	},
+
+	resize: function() {
+		var that = $( this ).resizable( "instance" );
+		if ( that.ghost ) {
+			that.ghost.css( {
+				position: "relative",
+				height: that.size.height,
+				width: that.size.width
+			} );
+		}
+	},
+
+	stop: function() {
+		var that = $( this ).resizable( "instance" );
+		if ( that.ghost && that.helper ) {
+			that.helper.get( 0 ).removeChild( that.ghost.get( 0 ) );
+		}
+	}
+
+} );
+
+$.ui.plugin.add( "resizable", "grid", {
+
+	resize: function() {
+		var outerDimensions,
+			that = $( this ).resizable( "instance" ),
+			o = that.options,
+			cs = that.size,
+			os = that.originalSize,
+			op = that.originalPosition,
+			a = that.axis,
+			grid = typeof o.grid === "number" ? [ o.grid, o.grid ] : o.grid,
+			gridX = ( grid[ 0 ] || 1 ),
+			gridY = ( grid[ 1 ] || 1 ),
+			ox = Math.round( ( cs.width - os.width ) / gridX ) * gridX,
+			oy = Math.round( ( cs.height - os.height ) / gridY ) * gridY,
+			newWidth = os.width + ox,
+			newHeight = os.height + oy,
+			isMaxWidth = o.maxWidth && ( o.maxWidth < newWidth ),
+			isMaxHeight = o.maxHeight && ( o.maxHeight < newHeight ),
+			isMinWidth = o.minWidth && ( o.minWidth > newWidth ),
+			isMinHeight = o.minHeight && ( o.minHeight > newHeight );
+
+		o.grid = grid;
+
+		if ( isMinWidth ) {
+			newWidth += gridX;
+		}
+		if ( isMinHeight ) {
+			newHeight += gridY;
+		}
+		if ( isMaxWidth ) {
+			newWidth -= gridX;
+		}
+		if ( isMaxHeight ) {
+			newHeight -= gridY;
+		}
+
+		if ( /^(se|s|e)$/.test( a ) ) {
+			that.size.width = newWidth;
+			that.size.height = newHeight;
+		} else if ( /^(ne)$/.test( a ) ) {
+			that.size.width = newWidth;
+			that.size.height = newHeight;
+			that.position.top = op.top - oy;
+		} else if ( /^(sw)$/.test( a ) ) {
+			that.size.width = newWidth;
+			that.size.height = newHeight;
+			that.position.left = op.left - ox;
+		} else {
+			if ( newHeight - gridY <= 0 || newWidth - gridX <= 0 ) {
+				outerDimensions = that._getPaddingPlusBorderDimensions( this );
+			}
+
+			if ( newHeight - gridY > 0 ) {
+				that.size.height = newHeight;
+				that.position.top = op.top - oy;
+			} else {
+				newHeight = gridY - outerDimensions.height;
+				that.size.height = newHeight;
+				that.position.top = op.top + os.height - newHeight;
+			}
+			if ( newWidth - gridX > 0 ) {
+				that.size.width = newWidth;
+				that.position.left = op.left - ox;
+			} else {
+				newWidth = gridX - outerDimensions.width;
+				that.size.width = newWidth;
+				that.position.left = op.left + os.width - newWidth;
+			}
+		}
+	}
+
+} );
+
+var widgetsResizable = $.ui.resizable;
+
+
+/*!
+ * jQuery UI Selectable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Selectable
+//>>group: Interactions
+//>>description: Allows groups of elements to be selected with the mouse.
+//>>docs: http://api.jqueryui.com/selectable/
+//>>demos: http://jqueryui.com/selectable/
+//>>css.structure: ../../themes/base/selectable.css
+
+
+
+var widgetsSelectable = $.widget( "ui.selectable", $.ui.mouse, {
+	version: "1.12.1",
+	options: {
+		appendTo: "body",
+		autoRefresh: true,
+		distance: 0,
+		filter: "*",
+		tolerance: "touch",
+
+		// Callbacks
+		selected: null,
+		selecting: null,
+		start: null,
+		stop: null,
+		unselected: null,
+		unselecting: null
+	},
+	_create: function() {
+		var that = this;
+
+		this._addClass( "ui-selectable" );
+
+		this.dragged = false;
+
+		// Cache selectee children based on filter
+		this.refresh = function() {
+			that.elementPos = $( that.element[ 0 ] ).offset();
+			that.selectees = $( that.options.filter, that.element[ 0 ] );
+			that._addClass( that.selectees, "ui-selectee" );
+			that.selectees.each( function() {
+				var $this = $( this ),
+					selecteeOffset = $this.offset(),
+					pos = {
+						left: selecteeOffset.left - that.elementPos.left,
+						top: selecteeOffset.top - that.elementPos.top
+					};
+				$.data( this, "selectable-item", {
+					element: this,
+					$element: $this,
+					left: pos.left,
+					top: pos.top,
+					right: pos.left + $this.outerWidth(),
+					bottom: pos.top + $this.outerHeight(),
+					startselected: false,
+					selected: $this.hasClass( "ui-selected" ),
+					selecting: $this.hasClass( "ui-selecting" ),
+					unselecting: $this.hasClass( "ui-unselecting" )
+				} );
+			} );
+		};
+		this.refresh();
+
+		this._mouseInit();
+
+		this.helper = $( "<div>" );
+		this._addClass( this.helper, "ui-selectable-helper" );
+	},
+
+	_destroy: function() {
+		this.selectees.removeData( "selectable-item" );
+		this._mouseDestroy();
+	},
+
+	_mouseStart: function( event ) {
+		var that = this,
+			options = this.options;
+
+		this.opos = [ event.pageX, event.pageY ];
+		this.elementPos = $( this.element[ 0 ] ).offset();
+
+		if ( this.options.disabled ) {
+			return;
+		}
+
+		this.selectees = $( options.filter, this.element[ 0 ] );
+
+		this._trigger( "start", event );
+
+		$( options.appendTo ).append( this.helper );
+
+		// position helper (lasso)
+		this.helper.css( {
+			"left": event.pageX,
+			"top": event.pageY,
+			"width": 0,
+			"height": 0
+		} );
+
+		if ( options.autoRefresh ) {
+			this.refresh();
+		}
+
+		this.selectees.filter( ".ui-selected" ).each( function() {
+			var selectee = $.data( this, "selectable-item" );
+			selectee.startselected = true;
+			if ( !event.metaKey && !event.ctrlKey ) {
+				that._removeClass( selectee.$element, "ui-selected" );
+				selectee.selected = false;
+				that._addClass( selectee.$element, "ui-unselecting" );
+				selectee.unselecting = true;
+
+				// selectable UNSELECTING callback
+				that._trigger( "unselecting", event, {
+					unselecting: selectee.element
+				} );
+			}
+		} );
+
+		$( event.target ).parents().addBack().each( function() {
+			var doSelect,
+				selectee = $.data( this, "selectable-item" );
+			if ( selectee ) {
+				doSelect = ( !event.metaKey && !event.ctrlKey ) ||
+					!selectee.$element.hasClass( "ui-selected" );
+				that._removeClass( selectee.$element, doSelect ? "ui-unselecting" : "ui-selected" )
+					._addClass( selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting" );
+				selectee.unselecting = !doSelect;
+				selectee.selecting = doSelect;
+				selectee.selected = doSelect;
+
+				// selectable (UN)SELECTING callback
+				if ( doSelect ) {
+					that._trigger( "selecting", event, {
+						selecting: selectee.element
+					} );
+				} else {
+					that._trigger( "unselecting", event, {
+						unselecting: selectee.element
+					} );
+				}
+				return false;
+			}
+		} );
+
+	},
+
+	_mouseDrag: function( event ) {
+
+		this.dragged = true;
+
+		if ( this.options.disabled ) {
+			return;
+		}
+
+		var tmp,
+			that = this,
+			options = this.options,
+			x1 = this.opos[ 0 ],
+			y1 = this.opos[ 1 ],
+			x2 = event.pageX,
+			y2 = event.pageY;
+
+		if ( x1 > x2 ) { tmp = x2; x2 = x1; x1 = tmp; }
+		if ( y1 > y2 ) { tmp = y2; y2 = y1; y1 = tmp; }
+		this.helper.css( { left: x1, top: y1, width: x2 - x1, height: y2 - y1 } );
+
+		this.selectees.each( function() {
+			var selectee = $.data( this, "selectable-item" ),
+				hit = false,
+				offset = {};
+
+			//prevent helper from being selected if appendTo: selectable
+			if ( !selectee || selectee.element === that.element[ 0 ] ) {
+				return;
+			}
+
+			offset.left   = selectee.left   + that.elementPos.left;
+			offset.right  = selectee.right  + that.elementPos.left;
+			offset.top    = selectee.top    + that.elementPos.top;
+			offset.bottom = selectee.bottom + that.elementPos.top;
+
+			if ( options.tolerance === "touch" ) {
+				hit = ( !( offset.left > x2 || offset.right < x1 || offset.top > y2 ||
+                    offset.bottom < y1 ) );
+			} else if ( options.tolerance === "fit" ) {
+				hit = ( offset.left > x1 && offset.right < x2 && offset.top > y1 &&
+                    offset.bottom < y2 );
+			}
+
+			if ( hit ) {
+
+				// SELECT
+				if ( selectee.selected ) {
+					that._removeClass( selectee.$element, "ui-selected" );
+					selectee.selected = false;
+				}
+				if ( selectee.unselecting ) {
+					that._removeClass( selectee.$element, "ui-unselecting" );
+					selectee.unselecting = false;
+				}
+				if ( !selectee.selecting ) {
+					that._addClass( selectee.$element, "ui-selecting" );
+					selectee.selecting = true;
+
+					// selectable SELECTING callback
+					that._trigger( "selecting", event, {
+						selecting: selectee.element
+					} );
+				}
+			} else {
+
+				// UNSELECT
+				if ( selectee.selecting ) {
+					if ( ( event.metaKey || event.ctrlKey ) && selectee.startselected ) {
+						that._removeClass( selectee.$element, "ui-selecting" );
+						selectee.selecting = false;
+						that._addClass( selectee.$element, "ui-selected" );
+						selectee.selected = true;
+					} else {
+						that._removeClass( selectee.$element, "ui-selecting" );
+						selectee.selecting = false;
+						if ( selectee.startselected ) {
+							that._addClass( selectee.$element, "ui-unselecting" );
+							selectee.unselecting = true;
+						}
+
+						// selectable UNSELECTING callback
+						that._trigger( "unselecting", event, {
+							unselecting: selectee.element
+						} );
+					}
+				}
+				if ( selectee.selected ) {
+					if ( !event.metaKey && !event.ctrlKey && !selectee.startselected ) {
+						that._removeClass( selectee.$element, "ui-selected" );
+						selectee.selected = false;
+
+						that._addClass( selectee.$element, "ui-unselecting" );
+						selectee.unselecting = true;
+
+						// selectable UNSELECTING callback
+						that._trigger( "unselecting", event, {
+							unselecting: selectee.element
+						} );
+					}
+				}
+			}
+		} );
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+		var that = this;
+
+		this.dragged = false;
+
+		$( ".ui-unselecting", this.element[ 0 ] ).each( function() {
+			var selectee = $.data( this, "selectable-item" );
+			that._removeClass( selectee.$element, "ui-unselecting" );
+			selectee.unselecting = false;
+			selectee.startselected = false;
+			that._trigger( "unselected", event, {
+				unselected: selectee.element
+			} );
+		} );
+		$( ".ui-selecting", this.element[ 0 ] ).each( function() {
+			var selectee = $.data( this, "selectable-item" );
+			that._removeClass( selectee.$element, "ui-selecting" )
+				._addClass( selectee.$element, "ui-selected" );
+			selectee.selecting = false;
+			selectee.selected = true;
+			selectee.startselected = true;
+			that._trigger( "selected", event, {
+				selected: selectee.element
+			} );
+		} );
+		this._trigger( "stop", event );
+
+		this.helper.remove();
+
+		return false;
+	}
+
+} );
+
+
+/*!
+ * jQuery UI Sortable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Sortable
+//>>group: Interactions
+//>>description: Enables items in a list to be sorted using the mouse.
+//>>docs: http://api.jqueryui.com/sortable/
+//>>demos: http://jqueryui.com/sortable/
+//>>css.structure: ../../themes/base/sortable.css
+
+
+
+var widgetsSortable = $.widget( "ui.sortable", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "sort",
+	ready: false,
+	options: {
+		appendTo: "parent",
+		axis: false,
+		connectWith: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		dropOnEmpty: true,
+		forcePlaceholderSize: false,
+		forceHelperSize: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		items: "> *",
+		opacity: false,
+		placeholder: false,
+		revert: false,
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		scope: "default",
+		tolerance: "intersect",
+		zIndex: 1000,
+
+		// Callbacks
+		activate: null,
+		beforeStop: null,
+		change: null,
+		deactivate: null,
+		out: null,
+		over: null,
+		receive: null,
+		remove: null,
+		sort: null,
+		start: null,
+		stop: null,
+		update: null
+	},
+
+	_isOverAxis: function( x, reference, size ) {
+		return ( x >= reference ) && ( x < ( reference + size ) );
+	},
+
+	_isFloating: function( item ) {
+		return ( /left|right/ ).test( item.css( "float" ) ) ||
+			( /inline|table-cell/ ).test( item.css( "display" ) );
+	},
+
+	_create: function() {
+		this.containerCache = {};
+		this._addClass( "ui-sortable" );
+
+		//Get the items
+		this.refresh();
+
+		//Let's determine the parent's offset
+		this.offset = this.element.offset();
+
+		//Initialize mouse events for interaction
+		this._mouseInit();
+
+		this._setHandleClassName();
+
+		//We're ready to go
+		this.ready = true;
+
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+
+		if ( key === "handle" ) {
+			this._setHandleClassName();
+		}
+	},
+
+	_setHandleClassName: function() {
+		var that = this;
+		this._removeClass( this.element.find( ".ui-sortable-handle" ), "ui-sortable-handle" );
+		$.each( this.items, function() {
+			that._addClass(
+				this.instance.options.handle ?
+					this.item.find( this.instance.options.handle ) :
+					this.item,
+				"ui-sortable-handle"
+			);
+		} );
+	},
+
+	_destroy: function() {
+		this._mouseDestroy();
+
+		for ( var i = this.items.length - 1; i >= 0; i-- ) {
+			this.items[ i ].item.removeData( this.widgetName + "-item" );
+		}
+
+		return this;
+	},
+
+	_mouseCapture: function( event, overrideHandle ) {
+		var currentItem = null,
+			validHandle = false,
+			that = this;
+
+		if ( this.reverting ) {
+			return false;
+		}
+
+		if ( this.options.disabled || this.options.type === "static" ) {
+			return false;
+		}
+
+		//We have to refresh the items data once first
+		this._refreshItems( event );
+
+		//Find out if the clicked node (or one of its parents) is a actual item in this.items
+		$( event.target ).parents().each( function() {
+			if ( $.data( this, that.widgetName + "-item" ) === that ) {
+				currentItem = $( this );
+				return false;
+			}
+		} );
+		if ( $.data( event.target, that.widgetName + "-item" ) === that ) {
+			currentItem = $( event.target );
+		}
+
+		if ( !currentItem ) {
+			return false;
+		}
+		if ( this.options.handle && !overrideHandle ) {
+			$( this.options.handle, currentItem ).find( "*" ).addBack().each( function() {
+				if ( this === event.target ) {
+					validHandle = true;
+				}
+			} );
+			if ( !validHandle ) {
+				return false;
+			}
+		}
+
+		this.currentItem = currentItem;
+		this._removeCurrentsFromItems();
+		return true;
+
+	},
+
+	_mouseStart: function( event, overrideHandle, noActivation ) {
+
+		var i, body,
+			o = this.options;
+
+		this.currentContainer = this;
+
+		//We only need to call refreshPositions, because the refreshItems call has been moved to
+		// mouseCapture
+		this.refreshPositions();
+
+		//Create and append the visible helper
+		this.helper = this._createHelper( event );
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Get the next scrolling parent
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.currentItem.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		$.extend( this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+
+			// This is a relative to absolute position minus the actual position calculation -
+			// only used for relative positioned helper
+			relative: this._getRelativeOffset()
+		} );
+
+		// Only after we got the offset, we can change the helper's position to absolute
+		// TODO: Still need to figure out a way to make relative sorting possible
+		this.helper.css( "position", "absolute" );
+		this.cssPosition = this.helper.css( "position" );
+
+		//Generate the original position
+		this.originalPosition = this._generatePosition( event );
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+		( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) );
+
+		//Cache the former DOM position
+		this.domPosition = {
+			prev: this.currentItem.prev()[ 0 ],
+			parent: this.currentItem.parent()[ 0 ]
+		};
+
+		// If the helper is not the original, hide the original so it's not playing any role during
+		// the drag, won't cause anything bad this way
+		if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) {
+			this.currentItem.hide();
+		}
+
+		//Create the placeholder
+		this._createPlaceholder();
+
+		//Set a containment if given in the options
+		if ( o.containment ) {
+			this._setContainment();
+		}
+
+		if ( o.cursor && o.cursor !== "auto" ) { // cursor option
+			body = this.document.find( "body" );
+
+			// Support: IE
+			this.storedCursor = body.css( "cursor" );
+			body.css( "cursor", o.cursor );
+
+			this.storedStylesheet =
+				$( "<style>*{ cursor: " + o.cursor + " !important; }</style>" ).appendTo( body );
+		}
+
+		if ( o.opacity ) { // opacity option
+			if ( this.helper.css( "opacity" ) ) {
+				this._storedOpacity = this.helper.css( "opacity" );
+			}
+			this.helper.css( "opacity", o.opacity );
+		}
+
+		if ( o.zIndex ) { // zIndex option
+			if ( this.helper.css( "zIndex" ) ) {
+				this._storedZIndex = this.helper.css( "zIndex" );
+			}
+			this.helper.css( "zIndex", o.zIndex );
+		}
+
+		//Prepare scrolling
+		if ( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				this.scrollParent[ 0 ].tagName !== "HTML" ) {
+			this.overflowOffset = this.scrollParent.offset();
+		}
+
+		//Call callbacks
+		this._trigger( "start", event, this._uiHash() );
+
+		//Recache the helper size
+		if ( !this._preserveHelperProportions ) {
+			this._cacheHelperProportions();
+		}
+
+		//Post "activate" events to possible containers
+		if ( !noActivation ) {
+			for ( i = this.containers.length - 1; i >= 0; i-- ) {
+				this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) );
+			}
+		}
+
+		//Prepare possible droppables
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.current = this;
+		}
+
+		if ( $.ui.ddmanager && !o.dropBehaviour ) {
+			$.ui.ddmanager.prepareOffsets( this, event );
+		}
+
+		this.dragging = true;
+
+		this._addClass( this.helper, "ui-sortable-helper" );
+
+		// Execute the drag once - this causes the helper not to be visiblebefore getting its
+		// correct position
+		this._mouseDrag( event );
+		return true;
+
+	},
+
+	_mouseDrag: function( event ) {
+		var i, item, itemElement, intersection,
+			o = this.options,
+			scrolled = false;
+
+		//Compute the helpers position
+		this.position = this._generatePosition( event );
+		this.positionAbs = this._convertPositionTo( "absolute" );
+
+		if ( !this.lastPositionAbs ) {
+			this.lastPositionAbs = this.positionAbs;
+		}
+
+		//Do scrolling
+		if ( this.options.scroll ) {
+			if ( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+					this.scrollParent[ 0 ].tagName !== "HTML" ) {
+
+				if ( ( this.overflowOffset.top + this.scrollParent[ 0 ].offsetHeight ) -
+						event.pageY < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollTop =
+						scrolled = this.scrollParent[ 0 ].scrollTop + o.scrollSpeed;
+				} else if ( event.pageY - this.overflowOffset.top < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollTop =
+						scrolled = this.scrollParent[ 0 ].scrollTop - o.scrollSpeed;
+				}
+
+				if ( ( this.overflowOffset.left + this.scrollParent[ 0 ].offsetWidth ) -
+						event.pageX < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollLeft = scrolled =
+						this.scrollParent[ 0 ].scrollLeft + o.scrollSpeed;
+				} else if ( event.pageX - this.overflowOffset.left < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollLeft = scrolled =
+						this.scrollParent[ 0 ].scrollLeft - o.scrollSpeed;
+				}
+
+			} else {
+
+				if ( event.pageY - this.document.scrollTop() < o.scrollSensitivity ) {
+					scrolled = this.document.scrollTop( this.document.scrollTop() - o.scrollSpeed );
+				} else if ( this.window.height() - ( event.pageY - this.document.scrollTop() ) <
+						o.scrollSensitivity ) {
+					scrolled = this.document.scrollTop( this.document.scrollTop() + o.scrollSpeed );
+				}
+
+				if ( event.pageX - this.document.scrollLeft() < o.scrollSensitivity ) {
+					scrolled = this.document.scrollLeft(
+						this.document.scrollLeft() - o.scrollSpeed
+					);
+				} else if ( this.window.width() - ( event.pageX - this.document.scrollLeft() ) <
+						o.scrollSensitivity ) {
+					scrolled = this.document.scrollLeft(
+						this.document.scrollLeft() + o.scrollSpeed
+					);
+				}
+
+			}
+
+			if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) {
+				$.ui.ddmanager.prepareOffsets( this, event );
+			}
+		}
+
+		//Regenerate the absolute position used for position checks
+		this.positionAbs = this._convertPositionTo( "absolute" );
+
+		//Set the helper position
+		if ( !this.options.axis || this.options.axis !== "y" ) {
+			this.helper[ 0 ].style.left = this.position.left + "px";
+		}
+		if ( !this.options.axis || this.options.axis !== "x" ) {
+			this.helper[ 0 ].style.top = this.position.top + "px";
+		}
+
+		//Rearrange
+		for ( i = this.items.length - 1; i >= 0; i-- ) {
+
+			//Cache variables and intersection, continue if no intersection
+			item = this.items[ i ];
+			itemElement = item.item[ 0 ];
+			intersection = this._intersectsWithPointer( item );
+			if ( !intersection ) {
+				continue;
+			}
+
+			// Only put the placeholder inside the current Container, skip all
+			// items from other containers. This works because when moving
+			// an item from one container to another the
+			// currentContainer is switched before the placeholder is moved.
+			//
+			// Without this, moving items in "sub-sortables" can cause
+			// the placeholder to jitter between the outer and inner container.
+			if ( item.instance !== this.currentContainer ) {
+				continue;
+			}
+
+			// Cannot intersect with itself
+			// no useless actions that have been done before
+			// no action if the item moved is the parent of the item checked
+			if ( itemElement !== this.currentItem[ 0 ] &&
+				this.placeholder[ intersection === 1 ? "next" : "prev" ]()[ 0 ] !== itemElement &&
+				!$.contains( this.placeholder[ 0 ], itemElement ) &&
+				( this.options.type === "semi-dynamic" ?
+					!$.contains( this.element[ 0 ], itemElement ) :
+					true
+				)
+			) {
+
+				this.direction = intersection === 1 ? "down" : "up";
+
+				if ( this.options.tolerance === "pointer" || this._intersectsWithSides( item ) ) {
+					this._rearrange( event, item );
+				} else {
+					break;
+				}
+
+				this._trigger( "change", event, this._uiHash() );
+				break;
+			}
+		}
+
+		//Post events to containers
+		this._contactContainers( event );
+
+		//Interconnect with droppables
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.drag( this, event );
+		}
+
+		//Call callbacks
+		this._trigger( "sort", event, this._uiHash() );
+
+		this.lastPositionAbs = this.positionAbs;
+		return false;
+
+	},
+
+	_mouseStop: function( event, noPropagation ) {
+
+		if ( !event ) {
+			return;
+		}
+
+		//If we are using droppables, inform the manager about the drop
+		if ( $.ui.ddmanager && !this.options.dropBehaviour ) {
+			$.ui.ddmanager.drop( this, event );
+		}
+
+		if ( this.options.revert ) {
+			var that = this,
+				cur = this.placeholder.offset(),
+				axis = this.options.axis,
+				animation = {};
+
+			if ( !axis || axis === "x" ) {
+				animation.left = cur.left - this.offset.parent.left - this.margins.left +
+					( this.offsetParent[ 0 ] === this.document[ 0 ].body ?
+						0 :
+						this.offsetParent[ 0 ].scrollLeft
+					);
+			}
+			if ( !axis || axis === "y" ) {
+				animation.top = cur.top - this.offset.parent.top - this.margins.top +
+					( this.offsetParent[ 0 ] === this.document[ 0 ].body ?
+						0 :
+						this.offsetParent[ 0 ].scrollTop
+					);
+			}
+			this.reverting = true;
+			$( this.helper ).animate(
+				animation,
+				parseInt( this.options.revert, 10 ) || 500,
+				function() {
+					that._clear( event );
+				}
+			);
+		} else {
+			this._clear( event, noPropagation );
+		}
+
+		return false;
+
+	},
+
+	cancel: function() {
+
+		if ( this.dragging ) {
+
+			this._mouseUp( new $.Event( "mouseup", { target: null } ) );
+
+			if ( this.options.helper === "original" ) {
+				this.currentItem.css( this._storedCSS );
+				this._removeClass( this.currentItem, "ui-sortable-helper" );
+			} else {
+				this.currentItem.show();
+			}
+
+			//Post deactivating events to containers
+			for ( var i = this.containers.length - 1; i >= 0; i-- ) {
+				this.containers[ i ]._trigger( "deactivate", null, this._uiHash( this ) );
+				if ( this.containers[ i ].containerCache.over ) {
+					this.containers[ i ]._trigger( "out", null, this._uiHash( this ) );
+					this.containers[ i ].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		if ( this.placeholder ) {
+
+			//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
+			// it unbinds ALL events from the original node!
+			if ( this.placeholder[ 0 ].parentNode ) {
+				this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] );
+			}
+			if ( this.options.helper !== "original" && this.helper &&
+					this.helper[ 0 ].parentNode ) {
+				this.helper.remove();
+			}
+
+			$.extend( this, {
+				helper: null,
+				dragging: false,
+				reverting: false,
+				_noFinalSort: null
+			} );
+
+			if ( this.domPosition.prev ) {
+				$( this.domPosition.prev ).after( this.currentItem );
+			} else {
+				$( this.domPosition.parent ).prepend( this.currentItem );
+			}
+		}
+
+		return this;
+
+	},
+
+	serialize: function( o ) {
+
+		var items = this._getItemsAsjQuery( o && o.connected ),
+			str = [];
+		o = o || {};
+
+		$( items ).each( function() {
+			var res = ( $( o.item || this ).attr( o.attribute || "id" ) || "" )
+				.match( o.expression || ( /(.+)[\-=_](.+)/ ) );
+			if ( res ) {
+				str.push(
+					( o.key || res[ 1 ] + "[]" ) +
+					"=" + ( o.key && o.expression ? res[ 1 ] : res[ 2 ] ) );
+			}
+		} );
+
+		if ( !str.length && o.key ) {
+			str.push( o.key + "=" );
+		}
+
+		return str.join( "&" );
+
+	},
+
+	toArray: function( o ) {
+
+		var items = this._getItemsAsjQuery( o && o.connected ),
+			ret = [];
+
+		o = o || {};
+
+		items.each( function() {
+			ret.push( $( o.item || this ).attr( o.attribute || "id" ) || "" );
+		} );
+		return ret;
+
+	},
+
+	/* Be careful with the following core functions */
+	_intersectsWith: function( item ) {
+
+		var x1 = this.positionAbs.left,
+			x2 = x1 + this.helperProportions.width,
+			y1 = this.positionAbs.top,
+			y2 = y1 + this.helperProportions.height,
+			l = item.left,
+			r = l + item.width,
+			t = item.top,
+			b = t + item.height,
+			dyClick = this.offset.click.top,
+			dxClick = this.offset.click.left,
+			isOverElementHeight = ( this.options.axis === "x" ) || ( ( y1 + dyClick ) > t &&
+				( y1 + dyClick ) < b ),
+			isOverElementWidth = ( this.options.axis === "y" ) || ( ( x1 + dxClick ) > l &&
+				( x1 + dxClick ) < r ),
+			isOverElement = isOverElementHeight && isOverElementWidth;
+
+		if ( this.options.tolerance === "pointer" ||
+			this.options.forcePointerForContainers ||
+			( this.options.tolerance !== "pointer" &&
+				this.helperProportions[ this.floating ? "width" : "height" ] >
+				item[ this.floating ? "width" : "height" ] )
+		) {
+			return isOverElement;
+		} else {
+
+			return ( l < x1 + ( this.helperProportions.width / 2 ) && // Right Half
+				x2 - ( this.helperProportions.width / 2 ) < r && // Left Half
+				t < y1 + ( this.helperProportions.height / 2 ) && // Bottom Half
+				y2 - ( this.helperProportions.height / 2 ) < b ); // Top Half
+
+		}
+	},
+
+	_intersectsWithPointer: function( item ) {
+		var verticalDirection, horizontalDirection,
+			isOverElementHeight = ( this.options.axis === "x" ) ||
+				this._isOverAxis(
+					this.positionAbs.top + this.offset.click.top, item.top, item.height ),
+			isOverElementWidth = ( this.options.axis === "y" ) ||
+				this._isOverAxis(
+					this.positionAbs.left + this.offset.click.left, item.left, item.width ),
+			isOverElement = isOverElementHeight && isOverElementWidth;
+
+		if ( !isOverElement ) {
+			return false;
+		}
+
+		verticalDirection = this._getDragVerticalDirection();
+		horizontalDirection = this._getDragHorizontalDirection();
+
+		return this.floating ?
+			( ( horizontalDirection === "right" || verticalDirection === "down" ) ? 2 : 1 )
+			: ( verticalDirection && ( verticalDirection === "down" ? 2 : 1 ) );
+
+	},
+
+	_intersectsWithSides: function( item ) {
+
+		var isOverBottomHalf = this._isOverAxis( this.positionAbs.top +
+				this.offset.click.top, item.top + ( item.height / 2 ), item.height ),
+			isOverRightHalf = this._isOverAxis( this.positionAbs.left +
+				this.offset.click.left, item.left + ( item.width / 2 ), item.width ),
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if ( this.floating && horizontalDirection ) {
+			return ( ( horizontalDirection === "right" && isOverRightHalf ) ||
+				( horizontalDirection === "left" && !isOverRightHalf ) );
+		} else {
+			return verticalDirection && ( ( verticalDirection === "down" && isOverBottomHalf ) ||
+				( verticalDirection === "up" && !isOverBottomHalf ) );
+		}
+
+	},
+
+	_getDragVerticalDirection: function() {
+		var delta = this.positionAbs.top - this.lastPositionAbs.top;
+		return delta !== 0 && ( delta > 0 ? "down" : "up" );
+	},
+
+	_getDragHorizontalDirection: function() {
+		var delta = this.positionAbs.left - this.lastPositionAbs.left;
+		return delta !== 0 && ( delta > 0 ? "right" : "left" );
+	},
+
+	refresh: function( event ) {
+		this._refreshItems( event );
+		this._setHandleClassName();
+		this.refreshPositions();
+		return this;
+	},
+
+	_connectWith: function() {
+		var options = this.options;
+		return options.connectWith.constructor === String ?
+			[ options.connectWith ] :
+			options.connectWith;
+	},
+
+	_getItemsAsjQuery: function( connected ) {
+
+		var i, j, cur, inst,
+			items = [],
+			queries = [],
+			connectWith = this._connectWith();
+
+		if ( connectWith && connected ) {
+			for ( i = connectWith.length - 1; i >= 0; i-- ) {
+				cur = $( connectWith[ i ], this.document[ 0 ] );
+				for ( j = cur.length - 1; j >= 0; j-- ) {
+					inst = $.data( cur[ j ], this.widgetFullName );
+					if ( inst && inst !== this && !inst.options.disabled ) {
+						queries.push( [ $.isFunction( inst.options.items ) ?
+							inst.options.items.call( inst.element ) :
+							$( inst.options.items, inst.element )
+								.not( ".ui-sortable-helper" )
+								.not( ".ui-sortable-placeholder" ), inst ] );
+					}
+				}
+			}
+		}
+
+		queries.push( [ $.isFunction( this.options.items ) ?
+			this.options.items
+				.call( this.element, null, { options: this.options, item: this.currentItem } ) :
+			$( this.options.items, this.element )
+				.not( ".ui-sortable-helper" )
+				.not( ".ui-sortable-placeholder" ), this ] );
+
+		function addItems() {
+			items.push( this );
+		}
+		for ( i = queries.length - 1; i >= 0; i-- ) {
+			queries[ i ][ 0 ].each( addItems );
+		}
+
+		return $( items );
+
+	},
+
+	_removeCurrentsFromItems: function() {
+
+		var list = this.currentItem.find( ":data(" + this.widgetName + "-item)" );
+
+		this.items = $.grep( this.items, function( item ) {
+			for ( var j = 0; j < list.length; j++ ) {
+				if ( list[ j ] === item.item[ 0 ] ) {
+					return false;
+				}
+			}
+			return true;
+		} );
+
+	},
+
+	_refreshItems: function( event ) {
+
+		this.items = [];
+		this.containers = [ this ];
+
+		var i, j, cur, inst, targetData, _queries, item, queriesLength,
+			items = this.items,
+			queries = [ [ $.isFunction( this.options.items ) ?
+				this.options.items.call( this.element[ 0 ], event, { item: this.currentItem } ) :
+				$( this.options.items, this.element ), this ] ],
+			connectWith = this._connectWith();
+
+		//Shouldn't be run the first time through due to massive slow-down
+		if ( connectWith && this.ready ) {
+			for ( i = connectWith.length - 1; i >= 0; i-- ) {
+				cur = $( connectWith[ i ], this.document[ 0 ] );
+				for ( j = cur.length - 1; j >= 0; j-- ) {
+					inst = $.data( cur[ j ], this.widgetFullName );
+					if ( inst && inst !== this && !inst.options.disabled ) {
+						queries.push( [ $.isFunction( inst.options.items ) ?
+							inst.options.items
+								.call( inst.element[ 0 ], event, { item: this.currentItem } ) :
+							$( inst.options.items, inst.element ), inst ] );
+						this.containers.push( inst );
+					}
+				}
+			}
+		}
+
+		for ( i = queries.length - 1; i >= 0; i-- ) {
+			targetData = queries[ i ][ 1 ];
+			_queries = queries[ i ][ 0 ];
+
+			for ( j = 0, queriesLength = _queries.length; j < queriesLength; j++ ) {
+				item = $( _queries[ j ] );
+
+				// Data for target checking (mouse manager)
+				item.data( this.widgetName + "-item", targetData );
+
+				items.push( {
+					item: item,
+					instance: targetData,
+					width: 0, height: 0,
+					left: 0, top: 0
+				} );
+			}
+		}
+
+	},
+
+	refreshPositions: function( fast ) {
+
+		// Determine whether items are being displayed horizontally
+		this.floating = this.items.length ?
+			this.options.axis === "x" || this._isFloating( this.items[ 0 ].item ) :
+			false;
+
+		//This has to be redone because due to the item being moved out/into the offsetParent,
+		// the offsetParent's position will change
+		if ( this.offsetParent && this.helper ) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		var i, item, t, p;
+
+		for ( i = this.items.length - 1; i >= 0; i-- ) {
+			item = this.items[ i ];
+
+			//We ignore calculating positions of all connected containers when we're not over them
+			if ( item.instance !== this.currentContainer && this.currentContainer &&
+					item.item[ 0 ] !== this.currentItem[ 0 ] ) {
+				continue;
+			}
+
+			t = this.options.toleranceElement ?
+				$( this.options.toleranceElement, item.item ) :
+				item.item;
+
+			if ( !fast ) {
+				item.width = t.outerWidth();
+				item.height = t.outerHeight();
+			}
+
+			p = t.offset();
+			item.left = p.left;
+			item.top = p.top;
+		}
+
+		if ( this.options.custom && this.options.custom.refreshContainers ) {
+			this.options.custom.refreshContainers.call( this );
+		} else {
+			for ( i = this.containers.length - 1; i >= 0; i-- ) {
+				p = this.containers[ i ].element.offset();
+				this.containers[ i ].containerCache.left = p.left;
+				this.containers[ i ].containerCache.top = p.top;
+				this.containers[ i ].containerCache.width =
+					this.containers[ i ].element.outerWidth();
+				this.containers[ i ].containerCache.height =
+					this.containers[ i ].element.outerHeight();
+			}
+		}
+
+		return this;
+	},
+
+	_createPlaceholder: function( that ) {
+		that = that || this;
+		var className,
+			o = that.options;
+
+		if ( !o.placeholder || o.placeholder.constructor === String ) {
+			className = o.placeholder;
+			o.placeholder = {
+				element: function() {
+
+					var nodeName = that.currentItem[ 0 ].nodeName.toLowerCase(),
+						element = $( "<" + nodeName + ">", that.document[ 0 ] );
+
+						that._addClass( element, "ui-sortable-placeholder",
+								className || that.currentItem[ 0 ].className )
+							._removeClass( element, "ui-sortable-helper" );
+
+					if ( nodeName === "tbody" ) {
+						that._createTrPlaceholder(
+							that.currentItem.find( "tr" ).eq( 0 ),
+							$( "<tr>", that.document[ 0 ] ).appendTo( element )
+						);
+					} else if ( nodeName === "tr" ) {
+						that._createTrPlaceholder( that.currentItem, element );
+					} else if ( nodeName === "img" ) {
+						element.attr( "src", that.currentItem.attr( "src" ) );
+					}
+
+					if ( !className ) {
+						element.css( "visibility", "hidden" );
+					}
+
+					return element;
+				},
+				update: function( container, p ) {
+
+					// 1. If a className is set as 'placeholder option, we don't force sizes -
+					// the class is responsible for that
+					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a
+					// class name is specified
+					if ( className && !o.forcePlaceholderSize ) {
+						return;
+					}
+
+					//If the element doesn't have a actual height by itself (without styles coming
+					// from a stylesheet), it receives the inline height from the dragged item
+					if ( !p.height() ) {
+						p.height(
+							that.currentItem.innerHeight() -
+							parseInt( that.currentItem.css( "paddingTop" ) || 0, 10 ) -
+							parseInt( that.currentItem.css( "paddingBottom" ) || 0, 10 ) );
+					}
+					if ( !p.width() ) {
+						p.width(
+							that.currentItem.innerWidth() -
+							parseInt( that.currentItem.css( "paddingLeft" ) || 0, 10 ) -
+							parseInt( that.currentItem.css( "paddingRight" ) || 0, 10 ) );
+					}
+				}
+			};
+		}
+
+		//Create the placeholder
+		that.placeholder = $( o.placeholder.element.call( that.element, that.currentItem ) );
+
+		//Append it after the actual current item
+		that.currentItem.after( that.placeholder );
+
+		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+		o.placeholder.update( that, that.placeholder );
+
+	},
+
+	_createTrPlaceholder: function( sourceTr, targetTr ) {
+		var that = this;
+
+		sourceTr.children().each( function() {
+			$( "<td>&#160;</td>", that.document[ 0 ] )
+				.attr( "colspan", $( this ).attr( "colspan" ) || 1 )
+				.appendTo( targetTr );
+		} );
+	},
+
+	_contactContainers: function( event ) {
+		var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom,
+			floating, axis,
+			innermostContainer = null,
+			innermostIndex = null;
+
+		// Get innermost container that intersects with item
+		for ( i = this.containers.length - 1; i >= 0; i-- ) {
+
+			// Never consider a container that's located within the item itself
+			if ( $.contains( this.currentItem[ 0 ], this.containers[ i ].element[ 0 ] ) ) {
+				continue;
+			}
+
+			if ( this._intersectsWith( this.containers[ i ].containerCache ) ) {
+
+				// If we've already found a container and it's more "inner" than this, then continue
+				if ( innermostContainer &&
+						$.contains(
+							this.containers[ i ].element[ 0 ],
+							innermostContainer.element[ 0 ] ) ) {
+					continue;
+				}
+
+				innermostContainer = this.containers[ i ];
+				innermostIndex = i;
+
+			} else {
+
+				// container doesn't intersect. trigger "out" event if necessary
+				if ( this.containers[ i ].containerCache.over ) {
+					this.containers[ i ]._trigger( "out", event, this._uiHash( this ) );
+					this.containers[ i ].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		// If no intersecting containers found, return
+		if ( !innermostContainer ) {
+			return;
+		}
+
+		// Move the item into the container if it's not there already
+		if ( this.containers.length === 1 ) {
+			if ( !this.containers[ innermostIndex ].containerCache.over ) {
+				this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) );
+				this.containers[ innermostIndex ].containerCache.over = 1;
+			}
+		} else {
+
+			// When entering a new container, we will find the item with the least distance and
+			// append our item near it
+			dist = 10000;
+			itemWithLeastDistance = null;
+			floating = innermostContainer.floating || this._isFloating( this.currentItem );
+			posProperty = floating ? "left" : "top";
+			sizeProperty = floating ? "width" : "height";
+			axis = floating ? "pageX" : "pageY";
+
+			for ( j = this.items.length - 1; j >= 0; j-- ) {
+				if ( !$.contains(
+						this.containers[ innermostIndex ].element[ 0 ], this.items[ j ].item[ 0 ] )
+				) {
+					continue;
+				}
+				if ( this.items[ j ].item[ 0 ] === this.currentItem[ 0 ] ) {
+					continue;
+				}
+
+				cur = this.items[ j ].item.offset()[ posProperty ];
+				nearBottom = false;
+				if ( event[ axis ] - cur > this.items[ j ][ sizeProperty ] / 2 ) {
+					nearBottom = true;
+				}
+
+				if ( Math.abs( event[ axis ] - cur ) < dist ) {
+					dist = Math.abs( event[ axis ] - cur );
+					itemWithLeastDistance = this.items[ j ];
+					this.direction = nearBottom ? "up" : "down";
+				}
+			}
+
+			//Check if dropOnEmpty is enabled
+			if ( !itemWithLeastDistance && !this.options.dropOnEmpty ) {
+				return;
+			}
+
+			if ( this.currentContainer === this.containers[ innermostIndex ] ) {
+				if ( !this.currentContainer.containerCache.over ) {
+					this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash() );
+					this.currentContainer.containerCache.over = 1;
+				}
+				return;
+			}
+
+			itemWithLeastDistance ?
+				this._rearrange( event, itemWithLeastDistance, null, true ) :
+				this._rearrange( event, null, this.containers[ innermostIndex ].element, true );
+			this._trigger( "change", event, this._uiHash() );
+			this.containers[ innermostIndex ]._trigger( "change", event, this._uiHash( this ) );
+			this.currentContainer = this.containers[ innermostIndex ];
+
+			//Update the placeholder
+			this.options.placeholder.update( this.currentContainer, this.placeholder );
+
+			this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) );
+			this.containers[ innermostIndex ].containerCache.over = 1;
+		}
+
+	},
+
+	_createHelper: function( event ) {
+
+		var o = this.options,
+			helper = $.isFunction( o.helper ) ?
+				$( o.helper.apply( this.element[ 0 ], [ event, this.currentItem ] ) ) :
+				( o.helper === "clone" ? this.currentItem.clone() : this.currentItem );
+
+		//Add the helper to the DOM if that didn't happen already
+		if ( !helper.parents( "body" ).length ) {
+			$( o.appendTo !== "parent" ?
+				o.appendTo :
+				this.currentItem[ 0 ].parentNode )[ 0 ].appendChild( helper[ 0 ] );
+		}
+
+		if ( helper[ 0 ] === this.currentItem[ 0 ] ) {
+			this._storedCSS = {
+				width: this.currentItem[ 0 ].style.width,
+				height: this.currentItem[ 0 ].style.height,
+				position: this.currentItem.css( "position" ),
+				top: this.currentItem.css( "top" ),
+				left: this.currentItem.css( "left" )
+			};
+		}
+
+		if ( !helper[ 0 ].style.width || o.forceHelperSize ) {
+			helper.width( this.currentItem.width() );
+		}
+		if ( !helper[ 0 ].style.height || o.forceHelperSize ) {
+			helper.height( this.currentItem.height() );
+		}
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function( obj ) {
+		if ( typeof obj === "string" ) {
+			obj = obj.split( " " );
+		}
+		if ( $.isArray( obj ) ) {
+			obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 };
+		}
+		if ( "left" in obj ) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ( "right" in obj ) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ( "top" in obj ) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ( "bottom" in obj ) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the
+		// following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the
+		// next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
+		// the document, which means that the scroll is included in the initial calculation of the
+		// offset of the parent, and never recalculated upon drag
+		if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		// This needs to be actually done for all browsers, since pageX/pageY includes this
+		// information with an ugly IE fix
+		if ( this.offsetParent[ 0 ] === this.document[ 0 ].body ||
+				( this.offsetParent[ 0 ].tagName &&
+				this.offsetParent[ 0 ].tagName.toLowerCase() === "html" && $.ui.ie ) ) {
+			po = { top: 0, left: 0 };
+		}
+
+		return {
+			top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ),
+			left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 )
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if ( this.cssPosition === "relative" ) {
+			var p = this.currentItem.position();
+			return {
+				top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) +
+					this.scrollParent.scrollTop(),
+				left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) +
+					this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: ( parseInt( this.currentItem.css( "marginLeft" ), 10 ) || 0 ),
+			top: ( parseInt( this.currentItem.css( "marginTop" ), 10 ) || 0 )
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var ce, co, over,
+			o = this.options;
+		if ( o.containment === "parent" ) {
+			o.containment = this.helper[ 0 ].parentNode;
+		}
+		if ( o.containment === "document" || o.containment === "window" ) {
+			this.containment = [
+				0 - this.offset.relative.left - this.offset.parent.left,
+				0 - this.offset.relative.top - this.offset.parent.top,
+				o.containment === "document" ?
+					this.document.width() :
+					this.window.width() - this.helperProportions.width - this.margins.left,
+				( o.containment === "document" ?
+					( this.document.height() || document.body.parentNode.scrollHeight ) :
+					this.window.height() || this.document[ 0 ].body.parentNode.scrollHeight
+				) - this.helperProportions.height - this.margins.top
+			];
+		}
+
+		if ( !( /^(document|window|parent)$/ ).test( o.containment ) ) {
+			ce = $( o.containment )[ 0 ];
+			co = $( o.containment ).offset();
+			over = ( $( ce ).css( "overflow" ) !== "hidden" );
+
+			this.containment = [
+				co.left + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) +
+					( parseInt( $( ce ).css( "paddingLeft" ), 10 ) || 0 ) - this.margins.left,
+				co.top + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) +
+					( parseInt( $( ce ).css( "paddingTop" ), 10 ) || 0 ) - this.margins.top,
+				co.left + ( over ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) -
+					( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) -
+					( parseInt( $( ce ).css( "paddingRight" ), 10 ) || 0 ) -
+					this.helperProportions.width - this.margins.left,
+				co.top + ( over ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) -
+					( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) -
+					( parseInt( $( ce ).css( "paddingBottom" ), 10 ) || 0 ) -
+					this.helperProportions.height - this.margins.top
+			];
+		}
+
+	},
+
+	_convertPositionTo: function( d, pos ) {
+
+		if ( !pos ) {
+			pos = this.position;
+		}
+		var mod = d === "absolute" ? 1 : -1,
+			scroll = this.cssPosition === "absolute" &&
+				!( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ?
+					this.offsetParent :
+					this.scrollParent,
+			scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName );
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pos.top	+
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top * mod -
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollTop() :
+					( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod )
+			),
+			left: (
+
+				// The absolute mouse position
+				pos.left +
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left * mod	-
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 :
+					scroll.scrollLeft() ) * mod )
+			)
+		};
+
+	},
+
+	_generatePosition: function( event ) {
+
+		var top, left,
+			o = this.options,
+			pageX = event.pageX,
+			pageY = event.pageY,
+			scroll = this.cssPosition === "absolute" &&
+				!( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ?
+					this.offsetParent :
+					this.scrollParent,
+				scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName );
+
+		// This is another very weird special case that only happens for relative elements:
+		// 1. If the css position is relative
+		// 2. and the scroll parent is the document or similar to the offset parent
+		// we have to refresh the relative offset during the scroll so there are no jumps
+		if ( this.cssPosition === "relative" && !( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				this.scrollParent[ 0 ] !== this.offsetParent[ 0 ] ) ) {
+			this.offset.relative = this._getRelativeOffset();
+		}
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if ( this.originalPosition ) { //If we are not dragging yet, we won't check for options
+
+			if ( this.containment ) {
+				if ( event.pageX - this.offset.click.left < this.containment[ 0 ] ) {
+					pageX = this.containment[ 0 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top < this.containment[ 1 ] ) {
+					pageY = this.containment[ 1 ] + this.offset.click.top;
+				}
+				if ( event.pageX - this.offset.click.left > this.containment[ 2 ] ) {
+					pageX = this.containment[ 2 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top > this.containment[ 3 ] ) {
+					pageY = this.containment[ 3 ] + this.offset.click.top;
+				}
+			}
+
+			if ( o.grid ) {
+				top = this.originalPageY + Math.round( ( pageY - this.originalPageY ) /
+					o.grid[ 1 ] ) * o.grid[ 1 ];
+				pageY = this.containment ?
+					( ( top - this.offset.click.top >= this.containment[ 1 ] &&
+						top - this.offset.click.top <= this.containment[ 3 ] ) ?
+							top :
+							( ( top - this.offset.click.top >= this.containment[ 1 ] ) ?
+								top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) :
+								top;
+
+				left = this.originalPageX + Math.round( ( pageX - this.originalPageX ) /
+					o.grid[ 0 ] ) * o.grid[ 0 ];
+				pageX = this.containment ?
+					( ( left - this.offset.click.left >= this.containment[ 0 ] &&
+						left - this.offset.click.left <= this.containment[ 2 ] ) ?
+							left :
+							( ( left - this.offset.click.left >= this.containment[ 0 ] ) ?
+								left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) :
+								left;
+			}
+
+		}
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pageY -
+
+				// Click offset (relative to the element)
+				this.offset.click.top -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top +
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollTop() :
+					( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) )
+			),
+			left: (
+
+				// The absolute mouse position
+				pageX -
+
+				// Click offset (relative to the element)
+				this.offset.click.left -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left +
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollLeft() :
+					scrollIsRootNode ? 0 : scroll.scrollLeft() ) )
+			)
+		};
+
+	},
+
+	_rearrange: function( event, i, a, hardRefresh ) {
+
+		a ? a[ 0 ].appendChild( this.placeholder[ 0 ] ) :
+			i.item[ 0 ].parentNode.insertBefore( this.placeholder[ 0 ],
+				( this.direction === "down" ? i.item[ 0 ] : i.item[ 0 ].nextSibling ) );
+
+		//Various things done here to improve the performance:
+		// 1. we create a setTimeout, that calls refreshPositions
+		// 2. on the instance, we have a counter variable, that get's higher after every append
+		// 3. on the local scope, we copy the counter variable, and check in the timeout,
+		// if it's still the same
+		// 4. this lets only the last addition to the timeout stack through
+		this.counter = this.counter ? ++this.counter : 1;
+		var counter = this.counter;
+
+		this._delay( function() {
+			if ( counter === this.counter ) {
+
+				//Precompute after each DOM insertion, NOT on mousemove
+				this.refreshPositions( !hardRefresh );
+			}
+		} );
+
+	},
+
+	_clear: function( event, noPropagation ) {
+
+		this.reverting = false;
+
+		// We delay all events that have to be triggered to after the point where the placeholder
+		// has been removed and everything else normalized again
+		var i,
+			delayedTriggers = [];
+
+		// We first have to update the dom position of the actual currentItem
+		// Note: don't do it if the current item is already removed (by a user), or it gets
+		// reappended (see #4088)
+		if ( !this._noFinalSort && this.currentItem.parent().length ) {
+			this.placeholder.before( this.currentItem );
+		}
+		this._noFinalSort = null;
+
+		if ( this.helper[ 0 ] === this.currentItem[ 0 ] ) {
+			for ( i in this._storedCSS ) {
+				if ( this._storedCSS[ i ] === "auto" || this._storedCSS[ i ] === "static" ) {
+					this._storedCSS[ i ] = "";
+				}
+			}
+			this.currentItem.css( this._storedCSS );
+			this._removeClass( this.currentItem, "ui-sortable-helper" );
+		} else {
+			this.currentItem.show();
+		}
+
+		if ( this.fromOutside && !noPropagation ) {
+			delayedTriggers.push( function( event ) {
+				this._trigger( "receive", event, this._uiHash( this.fromOutside ) );
+			} );
+		}
+		if ( ( this.fromOutside ||
+				this.domPosition.prev !==
+				this.currentItem.prev().not( ".ui-sortable-helper" )[ 0 ] ||
+				this.domPosition.parent !== this.currentItem.parent()[ 0 ] ) && !noPropagation ) {
+
+			// Trigger update callback if the DOM position has changed
+			delayedTriggers.push( function( event ) {
+				this._trigger( "update", event, this._uiHash() );
+			} );
+		}
+
+		// Check if the items Container has Changed and trigger appropriate
+		// events.
+		if ( this !== this.currentContainer ) {
+			if ( !noPropagation ) {
+				delayedTriggers.push( function( event ) {
+					this._trigger( "remove", event, this._uiHash() );
+				} );
+				delayedTriggers.push( ( function( c ) {
+					return function( event ) {
+						c._trigger( "receive", event, this._uiHash( this ) );
+					};
+				} ).call( this, this.currentContainer ) );
+				delayedTriggers.push( ( function( c ) {
+					return function( event ) {
+						c._trigger( "update", event, this._uiHash( this ) );
+					};
+				} ).call( this, this.currentContainer ) );
+			}
+		}
+
+		//Post events to containers
+		function delayEvent( type, instance, container ) {
+			return function( event ) {
+				container._trigger( type, event, instance._uiHash( instance ) );
+			};
+		}
+		for ( i = this.containers.length - 1; i >= 0; i-- ) {
+			if ( !noPropagation ) {
+				delayedTriggers.push( delayEvent( "deactivate", this, this.containers[ i ] ) );
+			}
+			if ( this.containers[ i ].containerCache.over ) {
+				delayedTriggers.push( delayEvent( "out", this, this.containers[ i ] ) );
+				this.containers[ i ].containerCache.over = 0;
+			}
+		}
+
+		//Do what was originally in plugins
+		if ( this.storedCursor ) {
+			this.document.find( "body" ).css( "cursor", this.storedCursor );
+			this.storedStylesheet.remove();
+		}
+		if ( this._storedOpacity ) {
+			this.helper.css( "opacity", this._storedOpacity );
+		}
+		if ( this._storedZIndex ) {
+			this.helper.css( "zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex );
+		}
+
+		this.dragging = false;
+
+		if ( !noPropagation ) {
+			this._trigger( "beforeStop", event, this._uiHash() );
+		}
+
+		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
+		// it unbinds ALL events from the original node!
+		this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] );
+
+		if ( !this.cancelHelperRemoval ) {
+			if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) {
+				this.helper.remove();
+			}
+			this.helper = null;
+		}
+
+		if ( !noPropagation ) {
+			for ( i = 0; i < delayedTriggers.length; i++ ) {
+
+				// Trigger all delayed events
+				delayedTriggers[ i ].call( this, event );
+			}
+			this._trigger( "stop", event, this._uiHash() );
+		}
+
+		this.fromOutside = false;
+		return !this.cancelHelperRemoval;
+
+	},
+
+	_trigger: function() {
+		if ( $.Widget.prototype._trigger.apply( this, arguments ) === false ) {
+			this.cancel();
+		}
+	},
+
+	_uiHash: function( _inst ) {
+		var inst = _inst || this;
+		return {
+			helper: inst.helper,
+			placeholder: inst.placeholder || $( [] ),
+			position: inst.position,
+			originalPosition: inst.originalPosition,
+			offset: inst.positionAbs,
+			item: inst.currentItem,
+			sender: _inst ? _inst.element : null
+		};
+	}
+
+} );
+
+
+/*!
+ * jQuery UI Accordion 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Accordion
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Displays collapsible content panels for presenting information in a limited amount of space.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/accordion/
+//>>demos: http://jqueryui.com/accordion/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/accordion.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsAccordion = $.widget( "ui.accordion", {
+	version: "1.12.1",
+	options: {
+		active: 0,
+		animate: {},
+		classes: {
+			"ui-accordion-header": "ui-corner-top",
+			"ui-accordion-header-collapsed": "ui-corner-all",
+			"ui-accordion-content": "ui-corner-bottom"
+		},
+		collapsible: false,
+		event: "click",
+		header: "> li > :first-child, > :not(li):even",
+		heightStyle: "auto",
+		icons: {
+			activeHeader: "ui-icon-triangle-1-s",
+			header: "ui-icon-triangle-1-e"
+		},
+
+		// Callbacks
+		activate: null,
+		beforeActivate: null
+	},
+
+	hideProps: {
+		borderTopWidth: "hide",
+		borderBottomWidth: "hide",
+		paddingTop: "hide",
+		paddingBottom: "hide",
+		height: "hide"
+	},
+
+	showProps: {
+		borderTopWidth: "show",
+		borderBottomWidth: "show",
+		paddingTop: "show",
+		paddingBottom: "show",
+		height: "show"
+	},
+
+	_create: function() {
+		var options = this.options;
+
+		this.prevShow = this.prevHide = $();
+		this._addClass( "ui-accordion", "ui-widget ui-helper-reset" );
+		this.element.attr( "role", "tablist" );
+
+		// Don't allow collapsible: false and active: false / null
+		if ( !options.collapsible && ( options.active === false || options.active == null ) ) {
+			options.active = 0;
+		}
+
+		this._processPanels();
+
+		// handle negative values
+		if ( options.active < 0 ) {
+			options.active += this.headers.length;
+		}
+		this._refresh();
+	},
+
+	_getCreateEventData: function() {
+		return {
+			header: this.active,
+			panel: !this.active.length ? $() : this.active.next()
+		};
+	},
+
+	_createIcons: function() {
+		var icon, children,
+			icons = this.options.icons;
+
+		if ( icons ) {
+			icon = $( "<span>" );
+			this._addClass( icon, "ui-accordion-header-icon", "ui-icon " + icons.header );
+			icon.prependTo( this.headers );
+			children = this.active.children( ".ui-accordion-header-icon" );
+			this._removeClass( children, icons.header )
+				._addClass( children, null, icons.activeHeader )
+				._addClass( this.headers, "ui-accordion-icons" );
+		}
+	},
+
+	_destroyIcons: function() {
+		this._removeClass( this.headers, "ui-accordion-icons" );
+		this.headers.children( ".ui-accordion-header-icon" ).remove();
+	},
+
+	_destroy: function() {
+		var contents;
+
+		// Clean up main element
+		this.element.removeAttr( "role" );
+
+		// Clean up headers
+		this.headers
+			.removeAttr( "role aria-expanded aria-selected aria-controls tabIndex" )
+			.removeUniqueId();
+
+		this._destroyIcons();
+
+		// Clean up content panels
+		contents = this.headers.next()
+			.css( "display", "" )
+			.removeAttr( "role aria-hidden aria-labelledby" )
+			.removeUniqueId();
+
+		if ( this.options.heightStyle !== "content" ) {
+			contents.css( "height", "" );
+		}
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "active" ) {
+
+			// _activate() will handle invalid values and update this.options
+			this._activate( value );
+			return;
+		}
+
+		if ( key === "event" ) {
+			if ( this.options.event ) {
+				this._off( this.headers, this.options.event );
+			}
+			this._setupEvents( value );
+		}
+
+		this._super( key, value );
+
+		// Setting collapsible: false while collapsed; open first panel
+		if ( key === "collapsible" && !value && this.options.active === false ) {
+			this._activate( 0 );
+		}
+
+		if ( key === "icons" ) {
+			this._destroyIcons();
+			if ( value ) {
+				this._createIcons();
+			}
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.element.attr( "aria-disabled", value );
+
+		// Support: IE8 Only
+		// #5332 / #6059 - opacity doesn't cascade to positioned elements in IE
+		// so we need to add the disabled class to the headers and panels
+		this._toggleClass( null, "ui-state-disabled", !!value );
+		this._toggleClass( this.headers.add( this.headers.next() ), null, "ui-state-disabled",
+			!!value );
+	},
+
+	_keydown: function( event ) {
+		if ( event.altKey || event.ctrlKey ) {
+			return;
+		}
+
+		var keyCode = $.ui.keyCode,
+			length = this.headers.length,
+			currentIndex = this.headers.index( event.target ),
+			toFocus = false;
+
+		switch ( event.keyCode ) {
+		case keyCode.RIGHT:
+		case keyCode.DOWN:
+			toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+			break;
+		case keyCode.LEFT:
+		case keyCode.UP:
+			toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+			break;
+		case keyCode.SPACE:
+		case keyCode.ENTER:
+			this._eventHandler( event );
+			break;
+		case keyCode.HOME:
+			toFocus = this.headers[ 0 ];
+			break;
+		case keyCode.END:
+			toFocus = this.headers[ length - 1 ];
+			break;
+		}
+
+		if ( toFocus ) {
+			$( event.target ).attr( "tabIndex", -1 );
+			$( toFocus ).attr( "tabIndex", 0 );
+			$( toFocus ).trigger( "focus" );
+			event.preventDefault();
+		}
+	},
+
+	_panelKeyDown: function( event ) {
+		if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) {
+			$( event.currentTarget ).prev().trigger( "focus" );
+		}
+	},
+
+	refresh: function() {
+		var options = this.options;
+		this._processPanels();
+
+		// Was collapsed or no panel
+		if ( ( options.active === false && options.collapsible === true ) ||
+				!this.headers.length ) {
+			options.active = false;
+			this.active = $();
+
+		// active false only when collapsible is true
+		} else if ( options.active === false ) {
+			this._activate( 0 );
+
+		// was active, but active panel is gone
+		} else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+
+			// all remaining panel are disabled
+			if ( this.headers.length === this.headers.find( ".ui-state-disabled" ).length ) {
+				options.active = false;
+				this.active = $();
+
+			// activate previous panel
+			} else {
+				this._activate( Math.max( 0, options.active - 1 ) );
+			}
+
+		// was active, active panel still exists
+		} else {
+
+			// make sure active index is correct
+			options.active = this.headers.index( this.active );
+		}
+
+		this._destroyIcons();
+
+		this._refresh();
+	},
+
+	_processPanels: function() {
+		var prevHeaders = this.headers,
+			prevPanels = this.panels;
+
+		this.headers = this.element.find( this.options.header );
+		this._addClass( this.headers, "ui-accordion-header ui-accordion-header-collapsed",
+			"ui-state-default" );
+
+		this.panels = this.headers.next().filter( ":not(.ui-accordion-content-active)" ).hide();
+		this._addClass( this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content" );
+
+		// Avoid memory leaks (#10056)
+		if ( prevPanels ) {
+			this._off( prevHeaders.not( this.headers ) );
+			this._off( prevPanels.not( this.panels ) );
+		}
+	},
+
+	_refresh: function() {
+		var maxHeight,
+			options = this.options,
+			heightStyle = options.heightStyle,
+			parent = this.element.parent();
+
+		this.active = this._findActive( options.active );
+		this._addClass( this.active, "ui-accordion-header-active", "ui-state-active" )
+			._removeClass( this.active, "ui-accordion-header-collapsed" );
+		this._addClass( this.active.next(), "ui-accordion-content-active" );
+		this.active.next().show();
+
+		this.headers
+			.attr( "role", "tab" )
+			.each( function() {
+				var header = $( this ),
+					headerId = header.uniqueId().attr( "id" ),
+					panel = header.next(),
+					panelId = panel.uniqueId().attr( "id" );
+				header.attr( "aria-controls", panelId );
+				panel.attr( "aria-labelledby", headerId );
+			} )
+			.next()
+				.attr( "role", "tabpanel" );
+
+		this.headers
+			.not( this.active )
+				.attr( {
+					"aria-selected": "false",
+					"aria-expanded": "false",
+					tabIndex: -1
+				} )
+				.next()
+					.attr( {
+						"aria-hidden": "true"
+					} )
+					.hide();
+
+		// Make sure at least one header is in the tab order
+		if ( !this.active.length ) {
+			this.headers.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			this.active.attr( {
+				"aria-selected": "true",
+				"aria-expanded": "true",
+				tabIndex: 0
+			} )
+				.next()
+					.attr( {
+						"aria-hidden": "false"
+					} );
+		}
+
+		this._createIcons();
+
+		this._setupEvents( options.event );
+
+		if ( heightStyle === "fill" ) {
+			maxHeight = parent.height();
+			this.element.siblings( ":visible" ).each( function() {
+				var elem = $( this ),
+					position = elem.css( "position" );
+
+				if ( position === "absolute" || position === "fixed" ) {
+					return;
+				}
+				maxHeight -= elem.outerHeight( true );
+			} );
+
+			this.headers.each( function() {
+				maxHeight -= $( this ).outerHeight( true );
+			} );
+
+			this.headers.next()
+				.each( function() {
+					$( this ).height( Math.max( 0, maxHeight -
+						$( this ).innerHeight() + $( this ).height() ) );
+				} )
+				.css( "overflow", "auto" );
+		} else if ( heightStyle === "auto" ) {
+			maxHeight = 0;
+			this.headers.next()
+				.each( function() {
+					var isVisible = $( this ).is( ":visible" );
+					if ( !isVisible ) {
+						$( this ).show();
+					}
+					maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() );
+					if ( !isVisible ) {
+						$( this ).hide();
+					}
+				} )
+				.height( maxHeight );
+		}
+	},
+
+	_activate: function( index ) {
+		var active = this._findActive( index )[ 0 ];
+
+		// Trying to activate the already active panel
+		if ( active === this.active[ 0 ] ) {
+			return;
+		}
+
+		// Trying to collapse, simulate a click on the currently active header
+		active = active || this.active[ 0 ];
+
+		this._eventHandler( {
+			target: active,
+			currentTarget: active,
+			preventDefault: $.noop
+		} );
+	},
+
+	_findActive: function( selector ) {
+		return typeof selector === "number" ? this.headers.eq( selector ) : $();
+	},
+
+	_setupEvents: function( event ) {
+		var events = {
+			keydown: "_keydown"
+		};
+		if ( event ) {
+			$.each( event.split( " " ), function( index, eventName ) {
+				events[ eventName ] = "_eventHandler";
+			} );
+		}
+
+		this._off( this.headers.add( this.headers.next() ) );
+		this._on( this.headers, events );
+		this._on( this.headers.next(), { keydown: "_panelKeyDown" } );
+		this._hoverable( this.headers );
+		this._focusable( this.headers );
+	},
+
+	_eventHandler: function( event ) {
+		var activeChildren, clickedChildren,
+			options = this.options,
+			active = this.active,
+			clicked = $( event.currentTarget ),
+			clickedIsActive = clicked[ 0 ] === active[ 0 ],
+			collapsing = clickedIsActive && options.collapsible,
+			toShow = collapsing ? $() : clicked.next(),
+			toHide = active.next(),
+			eventData = {
+				oldHeader: active,
+				oldPanel: toHide,
+				newHeader: collapsing ? $() : clicked,
+				newPanel: toShow
+			};
+
+		event.preventDefault();
+
+		if (
+
+				// click on active header, but not collapsible
+				( clickedIsActive && !options.collapsible ) ||
+
+				// allow canceling activation
+				( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+			return;
+		}
+
+		options.active = collapsing ? false : this.headers.index( clicked );
+
+		// When the call to ._toggle() comes after the class changes
+		// it causes a very odd bug in IE 8 (see #6720)
+		this.active = clickedIsActive ? $() : clicked;
+		this._toggle( eventData );
+
+		// Switch classes
+		// corner classes on the previously active header stay after the animation
+		this._removeClass( active, "ui-accordion-header-active", "ui-state-active" );
+		if ( options.icons ) {
+			activeChildren = active.children( ".ui-accordion-header-icon" );
+			this._removeClass( activeChildren, null, options.icons.activeHeader )
+				._addClass( activeChildren, null, options.icons.header );
+		}
+
+		if ( !clickedIsActive ) {
+			this._removeClass( clicked, "ui-accordion-header-collapsed" )
+				._addClass( clicked, "ui-accordion-header-active", "ui-state-active" );
+			if ( options.icons ) {
+				clickedChildren = clicked.children( ".ui-accordion-header-icon" );
+				this._removeClass( clickedChildren, null, options.icons.header )
+					._addClass( clickedChildren, null, options.icons.activeHeader );
+			}
+
+			this._addClass( clicked.next(), "ui-accordion-content-active" );
+		}
+	},
+
+	_toggle: function( data ) {
+		var toShow = data.newPanel,
+			toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
+
+		// Handle activating a panel during the animation for another activation
+		this.prevShow.add( this.prevHide ).stop( true, true );
+		this.prevShow = toShow;
+		this.prevHide = toHide;
+
+		if ( this.options.animate ) {
+			this._animate( toShow, toHide, data );
+		} else {
+			toHide.hide();
+			toShow.show();
+			this._toggleComplete( data );
+		}
+
+		toHide.attr( {
+			"aria-hidden": "true"
+		} );
+		toHide.prev().attr( {
+			"aria-selected": "false",
+			"aria-expanded": "false"
+		} );
+
+		// if we're switching panels, remove the old header from the tab order
+		// if we're opening from collapsed state, remove the previous header from the tab order
+		// if we're collapsing, then keep the collapsing header in the tab order
+		if ( toShow.length && toHide.length ) {
+			toHide.prev().attr( {
+				"tabIndex": -1,
+				"aria-expanded": "false"
+			} );
+		} else if ( toShow.length ) {
+			this.headers.filter( function() {
+				return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0;
+			} )
+				.attr( "tabIndex", -1 );
+		}
+
+		toShow
+			.attr( "aria-hidden", "false" )
+			.prev()
+				.attr( {
+					"aria-selected": "true",
+					"aria-expanded": "true",
+					tabIndex: 0
+				} );
+	},
+
+	_animate: function( toShow, toHide, data ) {
+		var total, easing, duration,
+			that = this,
+			adjust = 0,
+			boxSizing = toShow.css( "box-sizing" ),
+			down = toShow.length &&
+				( !toHide.length || ( toShow.index() < toHide.index() ) ),
+			animate = this.options.animate || {},
+			options = down && animate.down || animate,
+			complete = function() {
+				that._toggleComplete( data );
+			};
+
+		if ( typeof options === "number" ) {
+			duration = options;
+		}
+		if ( typeof options === "string" ) {
+			easing = options;
+		}
+
+		// fall back from options to animation in case of partial down settings
+		easing = easing || options.easing || animate.easing;
+		duration = duration || options.duration || animate.duration;
+
+		if ( !toHide.length ) {
+			return toShow.animate( this.showProps, duration, easing, complete );
+		}
+		if ( !toShow.length ) {
+			return toHide.animate( this.hideProps, duration, easing, complete );
+		}
+
+		total = toShow.show().outerHeight();
+		toHide.animate( this.hideProps, {
+			duration: duration,
+			easing: easing,
+			step: function( now, fx ) {
+				fx.now = Math.round( now );
+			}
+		} );
+		toShow
+			.hide()
+			.animate( this.showProps, {
+				duration: duration,
+				easing: easing,
+				complete: complete,
+				step: function( now, fx ) {
+					fx.now = Math.round( now );
+					if ( fx.prop !== "height" ) {
+						if ( boxSizing === "content-box" ) {
+							adjust += fx.now;
+						}
+					} else if ( that.options.heightStyle !== "content" ) {
+						fx.now = Math.round( total - toHide.outerHeight() - adjust );
+						adjust = 0;
+					}
+				}
+			} );
+	},
+
+	_toggleComplete: function( data ) {
+		var toHide = data.oldPanel,
+			prev = toHide.prev();
+
+		this._removeClass( toHide, "ui-accordion-content-active" );
+		this._removeClass( prev, "ui-accordion-header-active" )
+			._addClass( prev, "ui-accordion-header-collapsed" );
+
+		// Work around for rendering bug in IE (#5421)
+		if ( toHide.length ) {
+			toHide.parent()[ 0 ].className = toHide.parent()[ 0 ].className;
+		}
+		this._trigger( "activate", null, data );
+	}
+} );
+
+
+/*!
+ * jQuery UI Menu 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
-c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
-;/*
- * jQuery UI Effects Drop 1.8.14
+
+//>>label: Menu
+//>>group: Widgets
+//>>description: Creates nestable menus.
+//>>docs: http://api.jqueryui.com/menu/
+//>>demos: http://jqueryui.com/menu/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/menu.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsMenu = $.widget( "ui.menu", {
+	version: "1.12.1",
+	defaultElement: "<ul>",
+	delay: 300,
+	options: {
+		icons: {
+			submenu: "ui-icon-caret-1-e"
+		},
+		items: "> *",
+		menus: "ul",
+		position: {
+			my: "left top",
+			at: "right top"
+		},
+		role: "menu",
+
+		// Callbacks
+		blur: null,
+		focus: null,
+		select: null
+	},
+
+	_create: function() {
+		this.activeMenu = this.element;
+
+		// Flag used to prevent firing of the click handler
+		// as the event bubbles up through nested menus
+		this.mouseHandled = false;
+		this.element
+			.uniqueId()
+			.attr( {
+				role: this.options.role,
+				tabIndex: 0
+			} );
+
+		this._addClass( "ui-menu", "ui-widget ui-widget-content" );
+		this._on( {
+
+			// Prevent focus from sticking to links inside menu after clicking
+			// them (focus should always stay on UL during navigation).
+			"mousedown .ui-menu-item": function( event ) {
+				event.preventDefault();
+			},
+			"click .ui-menu-item": function( event ) {
+				var target = $( event.target );
+				var active = $( $.ui.safeActiveElement( this.document[ 0 ] ) );
+				if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) {
+					this.select( event );
+
+					// Only set the mouseHandled flag if the event will bubble, see #9469.
+					if ( !event.isPropagationStopped() ) {
+						this.mouseHandled = true;
+					}
+
+					// Open submenu on click
+					if ( target.has( ".ui-menu" ).length ) {
+						this.expand( event );
+					} else if ( !this.element.is( ":focus" ) &&
+							active.closest( ".ui-menu" ).length ) {
+
+						// Redirect focus to the menu
+						this.element.trigger( "focus", [ true ] );
+
+						// If the active item is on the top level, let it stay active.
+						// Otherwise, blur the active item since it is no longer visible.
+						if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) {
+							clearTimeout( this.timer );
+						}
+					}
+				}
+			},
+			"mouseenter .ui-menu-item": function( event ) {
+
+				// Ignore mouse events while typeahead is active, see #10458.
+				// Prevents focusing the wrong item when typeahead causes a scroll while the mouse
+				// is over an item in the menu
+				if ( this.previousFilter ) {
+					return;
+				}
+
+				var actualTarget = $( event.target ).closest( ".ui-menu-item" ),
+					target = $( event.currentTarget );
+
+				// Ignore bubbled events on parent items, see #11641
+				if ( actualTarget[ 0 ] !== target[ 0 ] ) {
+					return;
+				}
+
+				// Remove ui-state-active class from siblings of the newly focused menu item
+				// to avoid a jump caused by adjacent elements both having a class with a border
+				this._removeClass( target.siblings().children( ".ui-state-active" ),
+					null, "ui-state-active" );
+				this.focus( event, target );
+			},
+			mouseleave: "collapseAll",
+			"mouseleave .ui-menu": "collapseAll",
+			focus: function( event, keepActiveItem ) {
+
+				// If there's already an active item, keep it active
+				// If not, activate the first item
+				var item = this.active || this.element.find( this.options.items ).eq( 0 );
+
+				if ( !keepActiveItem ) {
+					this.focus( event, item );
+				}
+			},
+			blur: function( event ) {
+				this._delay( function() {
+					var notContained = !$.contains(
+						this.element[ 0 ],
+						$.ui.safeActiveElement( this.document[ 0 ] )
+					);
+					if ( notContained ) {
+						this.collapseAll( event );
+					}
+				} );
+			},
+			keydown: "_keydown"
+		} );
+
+		this.refresh();
+
+		// Clicks outside of a menu collapse any open menus
+		this._on( this.document, {
+			click: function( event ) {
+				if ( this._closeOnDocumentClick( event ) ) {
+					this.collapseAll( event );
+				}
+
+				// Reset the mouseHandled flag
+				this.mouseHandled = false;
+			}
+		} );
+	},
+
+	_destroy: function() {
+		var items = this.element.find( ".ui-menu-item" )
+				.removeAttr( "role aria-disabled" ),
+			submenus = items.children( ".ui-menu-item-wrapper" )
+				.removeUniqueId()
+				.removeAttr( "tabIndex role aria-haspopup" );
+
+		// Destroy (sub)menus
+		this.element
+			.removeAttr( "aria-activedescendant" )
+			.find( ".ui-menu" ).addBack()
+				.removeAttr( "role aria-labelledby aria-expanded aria-hidden aria-disabled " +
+					"tabIndex" )
+				.removeUniqueId()
+				.show();
+
+		submenus.children().each( function() {
+			var elem = $( this );
+			if ( elem.data( "ui-menu-submenu-caret" ) ) {
+				elem.remove();
+			}
+		} );
+	},
+
+	_keydown: function( event ) {
+		var match, prev, character, skip,
+			preventDefault = true;
+
+		switch ( event.keyCode ) {
+		case $.ui.keyCode.PAGE_UP:
+			this.previousPage( event );
+			break;
+		case $.ui.keyCode.PAGE_DOWN:
+			this.nextPage( event );
+			break;
+		case $.ui.keyCode.HOME:
+			this._move( "first", "first", event );
+			break;
+		case $.ui.keyCode.END:
+			this._move( "last", "last", event );
+			break;
+		case $.ui.keyCode.UP:
+			this.previous( event );
+			break;
+		case $.ui.keyCode.DOWN:
+			this.next( event );
+			break;
+		case $.ui.keyCode.LEFT:
+			this.collapse( event );
+			break;
+		case $.ui.keyCode.RIGHT:
+			if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+				this.expand( event );
+			}
+			break;
+		case $.ui.keyCode.ENTER:
+		case $.ui.keyCode.SPACE:
+			this._activate( event );
+			break;
+		case $.ui.keyCode.ESCAPE:
+			this.collapse( event );
+			break;
+		default:
+			preventDefault = false;
+			prev = this.previousFilter || "";
+			skip = false;
+
+			// Support number pad values
+			character = event.keyCode >= 96 && event.keyCode <= 105 ?
+				( event.keyCode - 96 ).toString() : String.fromCharCode( event.keyCode );
+
+			clearTimeout( this.filterTimer );
+
+			if ( character === prev ) {
+				skip = true;
+			} else {
+				character = prev + character;
+			}
+
+			match = this._filterMenuItems( character );
+			match = skip && match.index( this.active.next() ) !== -1 ?
+				this.active.nextAll( ".ui-menu-item" ) :
+				match;
+
+			// If no matches on the current filter, reset to the last character pressed
+			// to move down the menu to the first item that starts with that character
+			if ( !match.length ) {
+				character = String.fromCharCode( event.keyCode );
+				match = this._filterMenuItems( character );
+			}
+
+			if ( match.length ) {
+				this.focus( event, match );
+				this.previousFilter = character;
+				this.filterTimer = this._delay( function() {
+					delete this.previousFilter;
+				}, 1000 );
+			} else {
+				delete this.previousFilter;
+			}
+		}
+
+		if ( preventDefault ) {
+			event.preventDefault();
+		}
+	},
+
+	_activate: function( event ) {
+		if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+			if ( this.active.children( "[aria-haspopup='true']" ).length ) {
+				this.expand( event );
+			} else {
+				this.select( event );
+			}
+		}
+	},
+
+	refresh: function() {
+		var menus, items, newSubmenus, newItems, newWrappers,
+			that = this,
+			icon = this.options.icons.submenu,
+			submenus = this.element.find( this.options.menus );
+
+		this._toggleClass( "ui-menu-icons", null, !!this.element.find( ".ui-icon" ).length );
+
+		// Initialize nested menus
+		newSubmenus = submenus.filter( ":not(.ui-menu)" )
+			.hide()
+			.attr( {
+				role: this.options.role,
+				"aria-hidden": "true",
+				"aria-expanded": "false"
+			} )
+			.each( function() {
+				var menu = $( this ),
+					item = menu.prev(),
+					submenuCaret = $( "<span>" ).data( "ui-menu-submenu-caret", true );
+
+				that._addClass( submenuCaret, "ui-menu-icon", "ui-icon " + icon );
+				item
+					.attr( "aria-haspopup", "true" )
+					.prepend( submenuCaret );
+				menu.attr( "aria-labelledby", item.attr( "id" ) );
+			} );
+
+		this._addClass( newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front" );
+
+		menus = submenus.add( this.element );
+		items = menus.find( this.options.items );
+
+		// Initialize menu-items containing spaces and/or dashes only as dividers
+		items.not( ".ui-menu-item" ).each( function() {
+			var item = $( this );
+			if ( that._isDivider( item ) ) {
+				that._addClass( item, "ui-menu-divider", "ui-widget-content" );
+			}
+		} );
+
+		// Don't refresh list items that are already adapted
+		newItems = items.not( ".ui-menu-item, .ui-menu-divider" );
+		newWrappers = newItems.children()
+			.not( ".ui-menu" )
+				.uniqueId()
+				.attr( {
+					tabIndex: -1,
+					role: this._itemRole()
+				} );
+		this._addClass( newItems, "ui-menu-item" )
+			._addClass( newWrappers, "ui-menu-item-wrapper" );
+
+		// Add aria-disabled attribute to any disabled menu item
+		items.filter( ".ui-state-disabled" ).attr( "aria-disabled", "true" );
+
+		// If the active item has been removed, blur the menu
+		if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+			this.blur();
+		}
+	},
+
+	_itemRole: function() {
+		return {
+			menu: "menuitem",
+			listbox: "option"
+		}[ this.options.role ];
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "icons" ) {
+			var icons = this.element.find( ".ui-menu-icon" );
+			this._removeClass( icons, null, this.options.icons.submenu )
+				._addClass( icons, null, value.submenu );
+		}
+		this._super( key, value );
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.element.attr( "aria-disabled", String( value ) );
+		this._toggleClass( null, "ui-state-disabled", !!value );
+	},
+
+	focus: function( event, item ) {
+		var nested, focused, activeParent;
+		this.blur( event, event && event.type === "focus" );
+
+		this._scrollIntoView( item );
+
+		this.active = item.first();
+
+		focused = this.active.children( ".ui-menu-item-wrapper" );
+		this._addClass( focused, null, "ui-state-active" );
+
+		// Only update aria-activedescendant if there's a role
+		// otherwise we assume focus is managed elsewhere
+		if ( this.options.role ) {
+			this.element.attr( "aria-activedescendant", focused.attr( "id" ) );
+		}
+
+		// Highlight active parent menu item, if any
+		activeParent = this.active
+			.parent()
+				.closest( ".ui-menu-item" )
+					.children( ".ui-menu-item-wrapper" );
+		this._addClass( activeParent, null, "ui-state-active" );
+
+		if ( event && event.type === "keydown" ) {
+			this._close();
+		} else {
+			this.timer = this._delay( function() {
+				this._close();
+			}, this.delay );
+		}
+
+		nested = item.children( ".ui-menu" );
+		if ( nested.length && event && ( /^mouse/.test( event.type ) ) ) {
+			this._startOpening( nested );
+		}
+		this.activeMenu = item.parent();
+
+		this._trigger( "focus", event, { item: item } );
+	},
+
+	_scrollIntoView: function( item ) {
+		var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
+		if ( this._hasScroll() ) {
+			borderTop = parseFloat( $.css( this.activeMenu[ 0 ], "borderTopWidth" ) ) || 0;
+			paddingTop = parseFloat( $.css( this.activeMenu[ 0 ], "paddingTop" ) ) || 0;
+			offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
+			scroll = this.activeMenu.scrollTop();
+			elementHeight = this.activeMenu.height();
+			itemHeight = item.outerHeight();
+
+			if ( offset < 0 ) {
+				this.activeMenu.scrollTop( scroll + offset );
+			} else if ( offset + itemHeight > elementHeight ) {
+				this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight );
+			}
+		}
+	},
+
+	blur: function( event, fromFocus ) {
+		if ( !fromFocus ) {
+			clearTimeout( this.timer );
+		}
+
+		if ( !this.active ) {
+			return;
+		}
+
+		this._removeClass( this.active.children( ".ui-menu-item-wrapper" ),
+			null, "ui-state-active" );
+
+		this._trigger( "blur", event, { item: this.active } );
+		this.active = null;
+	},
+
+	_startOpening: function( submenu ) {
+		clearTimeout( this.timer );
+
+		// Don't open if already open fixes a Firefox bug that caused a .5 pixel
+		// shift in the submenu position when mousing over the caret icon
+		if ( submenu.attr( "aria-hidden" ) !== "true" ) {
+			return;
+		}
+
+		this.timer = this._delay( function() {
+			this._close();
+			this._open( submenu );
+		}, this.delay );
+	},
+
+	_open: function( submenu ) {
+		var position = $.extend( {
+			of: this.active
+		}, this.options.position );
+
+		clearTimeout( this.timer );
+		this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) )
+			.hide()
+			.attr( "aria-hidden", "true" );
+
+		submenu
+			.show()
+			.removeAttr( "aria-hidden" )
+			.attr( "aria-expanded", "true" )
+			.position( position );
+	},
+
+	collapseAll: function( event, all ) {
+		clearTimeout( this.timer );
+		this.timer = this._delay( function() {
+
+			// If we were passed an event, look for the submenu that contains the event
+			var currentMenu = all ? this.element :
+				$( event && event.target ).closest( this.element.find( ".ui-menu" ) );
+
+			// If we found no valid submenu ancestor, use the main menu to close all
+			// sub menus anyway
+			if ( !currentMenu.length ) {
+				currentMenu = this.element;
+			}
+
+			this._close( currentMenu );
+
+			this.blur( event );
+
+			// Work around active item staying active after menu is blurred
+			this._removeClass( currentMenu.find( ".ui-state-active" ), null, "ui-state-active" );
+
+			this.activeMenu = currentMenu;
+		}, this.delay );
+	},
+
+	// With no arguments, closes the currently active menu - if nothing is active
+	// it closes all menus.  If passed an argument, it will search for menus BELOW
+	_close: function( startMenu ) {
+		if ( !startMenu ) {
+			startMenu = this.active ? this.active.parent() : this.element;
+		}
+
+		startMenu.find( ".ui-menu" )
+			.hide()
+			.attr( "aria-hidden", "true" )
+			.attr( "aria-expanded", "false" );
+	},
+
+	_closeOnDocumentClick: function( event ) {
+		return !$( event.target ).closest( ".ui-menu" ).length;
+	},
+
+	_isDivider: function( item ) {
+
+		// Match hyphen, em dash, en dash
+		return !/[^\-\u2014\u2013\s]/.test( item.text() );
+	},
+
+	collapse: function( event ) {
+		var newItem = this.active &&
+			this.active.parent().closest( ".ui-menu-item", this.element );
+		if ( newItem && newItem.length ) {
+			this._close();
+			this.focus( event, newItem );
+		}
+	},
+
+	expand: function( event ) {
+		var newItem = this.active &&
+			this.active
+				.children( ".ui-menu " )
+					.find( this.options.items )
+						.first();
+
+		if ( newItem && newItem.length ) {
+			this._open( newItem.parent() );
+
+			// Delay so Firefox will not hide activedescendant change in expanding submenu from AT
+			this._delay( function() {
+				this.focus( event, newItem );
+			} );
+		}
+	},
+
+	next: function( event ) {
+		this._move( "next", "first", event );
+	},
+
+	previous: function( event ) {
+		this._move( "prev", "last", event );
+	},
+
+	isFirstItem: function() {
+		return this.active && !this.active.prevAll( ".ui-menu-item" ).length;
+	},
+
+	isLastItem: function() {
+		return this.active && !this.active.nextAll( ".ui-menu-item" ).length;
+	},
+
+	_move: function( direction, filter, event ) {
+		var next;
+		if ( this.active ) {
+			if ( direction === "first" || direction === "last" ) {
+				next = this.active
+					[ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" )
+					.eq( -1 );
+			} else {
+				next = this.active
+					[ direction + "All" ]( ".ui-menu-item" )
+					.eq( 0 );
+			}
+		}
+		if ( !next || !next.length || !this.active ) {
+			next = this.activeMenu.find( this.options.items )[ filter ]();
+		}
+
+		this.focus( event, next );
+	},
+
+	nextPage: function( event ) {
+		var item, base, height;
+
+		if ( !this.active ) {
+			this.next( event );
+			return;
+		}
+		if ( this.isLastItem() ) {
+			return;
+		}
+		if ( this._hasScroll() ) {
+			base = this.active.offset().top;
+			height = this.element.height();
+			this.active.nextAll( ".ui-menu-item" ).each( function() {
+				item = $( this );
+				return item.offset().top - base - height < 0;
+			} );
+
+			this.focus( event, item );
+		} else {
+			this.focus( event, this.activeMenu.find( this.options.items )
+				[ !this.active ? "first" : "last" ]() );
+		}
+	},
+
+	previousPage: function( event ) {
+		var item, base, height;
+		if ( !this.active ) {
+			this.next( event );
+			return;
+		}
+		if ( this.isFirstItem() ) {
+			return;
+		}
+		if ( this._hasScroll() ) {
+			base = this.active.offset().top;
+			height = this.element.height();
+			this.active.prevAll( ".ui-menu-item" ).each( function() {
+				item = $( this );
+				return item.offset().top - base + height > 0;
+			} );
+
+			this.focus( event, item );
+		} else {
+			this.focus( event, this.activeMenu.find( this.options.items ).first() );
+		}
+	},
+
+	_hasScroll: function() {
+		return this.element.outerHeight() < this.element.prop( "scrollHeight" );
+	},
+
+	select: function( event ) {
+
+		// TODO: It should never be possible to not have an active item at this
+		// point, but the tests don't trigger mouseenter before click.
+		this.active = this.active || $( event.target ).closest( ".ui-menu-item" );
+		var ui = { item: this.active };
+		if ( !this.active.has( ".ui-menu" ).length ) {
+			this.collapseAll( event, true );
+		}
+		this._trigger( "select", event, ui );
+	},
+
+	_filterMenuItems: function( character ) {
+		var escapedCharacter = character.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ),
+			regex = new RegExp( "^" + escapedCharacter, "i" );
+
+		return this.activeMenu
+			.find( this.options.items )
+
+				// Only match on items, not dividers or other content (#10571)
+				.filter( ".ui-menu-item" )
+					.filter( function() {
+						return regex.test(
+							$.trim( $( this ).children( ".ui-menu-item-wrapper" ).text() ) );
+					} );
+	}
+} );
+
+
+/*!
+ * jQuery UI Autocomplete 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Autocomplete
+//>>group: Widgets
+//>>description: Lists suggested words as the user is typing.
+//>>docs: http://api.jqueryui.com/autocomplete/
+//>>demos: http://jqueryui.com/autocomplete/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/autocomplete.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.autocomplete", {
+	version: "1.12.1",
+	defaultElement: "<input>",
+	options: {
+		appendTo: null,
+		autoFocus: false,
+		delay: 300,
+		minLength: 1,
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		source: null,
+
+		// Callbacks
+		change: null,
+		close: null,
+		focus: null,
+		open: null,
+		response: null,
+		search: null,
+		select: null
+	},
+
+	requestIndex: 0,
+	pending: 0,
+
+	_create: function() {
+
+		// Some browsers only repeat keydown events, not keypress events,
+		// so we use the suppressKeyPress flag to determine if we've already
+		// handled the keydown event. #7269
+		// Unfortunately the code for & in keypress is the same as the up arrow,
+		// so we use the suppressKeyPressRepeat flag to avoid handling keypress
+		// events when we know the keydown event was used to modify the
+		// search term. #7799
+		var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
+			nodeName = this.element[ 0 ].nodeName.toLowerCase(),
+			isTextarea = nodeName === "textarea",
+			isInput = nodeName === "input";
+
+		// Textareas are always multi-line
+		// Inputs are always single-line, even if inside a contentEditable element
+		// IE also treats inputs as contentEditable
+		// All other element types are determined by whether or not they're contentEditable
+		this.isMultiLine = isTextarea || !isInput && this._isContentEditable( this.element );
+
+		this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ];
+		this.isNewMenu = true;
+
+		this._addClass( "ui-autocomplete-input" );
+		this.element.attr( "autocomplete", "off" );
+
+		this._on( this.element, {
+			keydown: function( event ) {
+				if ( this.element.prop( "readOnly" ) ) {
+					suppressKeyPress = true;
+					suppressInput = true;
+					suppressKeyPressRepeat = true;
+					return;
+				}
+
+				suppressKeyPress = false;
+				suppressInput = false;
+				suppressKeyPressRepeat = false;
+				var keyCode = $.ui.keyCode;
+				switch ( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					suppressKeyPress = true;
+					this._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					suppressKeyPress = true;
+					this._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					suppressKeyPress = true;
+					this._keyEvent( "previous", event );
+					break;
+				case keyCode.DOWN:
+					suppressKeyPress = true;
+					this._keyEvent( "next", event );
+					break;
+				case keyCode.ENTER:
+
+					// when menu is open and has focus
+					if ( this.menu.active ) {
+
+						// #6055 - Opera still allows the keypress to occur
+						// which causes forms to submit
+						suppressKeyPress = true;
+						event.preventDefault();
+						this.menu.select( event );
+					}
+					break;
+				case keyCode.TAB:
+					if ( this.menu.active ) {
+						this.menu.select( event );
+					}
+					break;
+				case keyCode.ESCAPE:
+					if ( this.menu.element.is( ":visible" ) ) {
+						if ( !this.isMultiLine ) {
+							this._value( this.term );
+						}
+						this.close( event );
+
+						// Different browsers have different default behavior for escape
+						// Single press can mean undo or clear
+						// Double press in IE means clear the whole form
+						event.preventDefault();
+					}
+					break;
+				default:
+					suppressKeyPressRepeat = true;
+
+					// search timeout should be triggered before the input value is changed
+					this._searchTimeout( event );
+					break;
+				}
+			},
+			keypress: function( event ) {
+				if ( suppressKeyPress ) {
+					suppressKeyPress = false;
+					if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+						event.preventDefault();
+					}
+					return;
+				}
+				if ( suppressKeyPressRepeat ) {
+					return;
+				}
+
+				// Replicate some key handlers to allow them to repeat in Firefox and Opera
+				var keyCode = $.ui.keyCode;
+				switch ( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					this._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					this._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					this._keyEvent( "previous", event );
+					break;
+				case keyCode.DOWN:
+					this._keyEvent( "next", event );
+					break;
+				}
+			},
+			input: function( event ) {
+				if ( suppressInput ) {
+					suppressInput = false;
+					event.preventDefault();
+					return;
+				}
+				this._searchTimeout( event );
+			},
+			focus: function() {
+				this.selectedItem = null;
+				this.previous = this._value();
+			},
+			blur: function( event ) {
+				if ( this.cancelBlur ) {
+					delete this.cancelBlur;
+					return;
+				}
+
+				clearTimeout( this.searching );
+				this.close( event );
+				this._change( event );
+			}
+		} );
+
+		this._initSource();
+		this.menu = $( "<ul>" )
+			.appendTo( this._appendTo() )
+			.menu( {
+
+				// disable ARIA support, the live region takes care of that
+				role: null
+			} )
+			.hide()
+			.menu( "instance" );
+
+		this._addClass( this.menu.element, "ui-autocomplete", "ui-front" );
+		this._on( this.menu.element, {
+			mousedown: function( event ) {
+
+				// prevent moving focus out of the text field
+				event.preventDefault();
+
+				// IE doesn't prevent moving focus even with event.preventDefault()
+				// so we set a flag to know when we should ignore the blur event
+				this.cancelBlur = true;
+				this._delay( function() {
+					delete this.cancelBlur;
+
+					// Support: IE 8 only
+					// Right clicking a menu item or selecting text from the menu items will
+					// result in focus moving out of the input. However, we've already received
+					// and ignored the blur event because of the cancelBlur flag set above. So
+					// we restore focus to ensure that the menu closes properly based on the user's
+					// next actions.
+					if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) {
+						this.element.trigger( "focus" );
+					}
+				} );
+			},
+			menufocus: function( event, ui ) {
+				var label, item;
+
+				// support: Firefox
+				// Prevent accidental activation of menu items in Firefox (#7024 #9118)
+				if ( this.isNewMenu ) {
+					this.isNewMenu = false;
+					if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) {
+						this.menu.blur();
+
+						this.document.one( "mousemove", function() {
+							$( event.target ).trigger( event.originalEvent );
+						} );
+
+						return;
+					}
+				}
+
+				item = ui.item.data( "ui-autocomplete-item" );
+				if ( false !== this._trigger( "focus", event, { item: item } ) ) {
+
+					// use value to match what will end up in the input, if it was a key event
+					if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) {
+						this._value( item.value );
+					}
+				}
+
+				// Announce the value in the liveRegion
+				label = ui.item.attr( "aria-label" ) || item.value;
+				if ( label && $.trim( label ).length ) {
+					this.liveRegion.children().hide();
+					$( "<div>" ).text( label ).appendTo( this.liveRegion );
+				}
+			},
+			menuselect: function( event, ui ) {
+				var item = ui.item.data( "ui-autocomplete-item" ),
+					previous = this.previous;
+
+				// Only trigger when focus was lost (click on menu)
+				if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) {
+					this.element.trigger( "focus" );
+					this.previous = previous;
+
+					// #6109 - IE triggers two focus events and the second
+					// is asynchronous, so we need to reset the previous
+					// term synchronously and asynchronously :-(
+					this._delay( function() {
+						this.previous = previous;
+						this.selectedItem = item;
+					} );
+				}
+
+				if ( false !== this._trigger( "select", event, { item: item } ) ) {
+					this._value( item.value );
+				}
+
+				// reset the term after the select event
+				// this allows custom select handling to work properly
+				this.term = this._value();
+
+				this.close( event );
+				this.selectedItem = item;
+			}
+		} );
+
+		this.liveRegion = $( "<div>", {
+			role: "status",
+			"aria-live": "assertive",
+			"aria-relevant": "additions"
+		} )
+			.appendTo( this.document[ 0 ].body );
+
+		this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" );
+
+		// Turning off autocomplete prevents the browser from remembering the
+		// value when navigating through history, so we re-enable autocomplete
+		// if the page is unloaded before the widget is destroyed. #7790
+		this._on( this.window, {
+			beforeunload: function() {
+				this.element.removeAttr( "autocomplete" );
+			}
+		} );
+	},
+
+	_destroy: function() {
+		clearTimeout( this.searching );
+		this.element.removeAttr( "autocomplete" );
+		this.menu.element.remove();
+		this.liveRegion.remove();
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+		if ( key === "source" ) {
+			this._initSource();
+		}
+		if ( key === "appendTo" ) {
+			this.menu.element.appendTo( this._appendTo() );
+		}
+		if ( key === "disabled" && value && this.xhr ) {
+			this.xhr.abort();
+		}
+	},
+
+	_isEventTargetInWidget: function( event ) {
+		var menuElement = this.menu.element[ 0 ];
+
+		return event.target === this.element[ 0 ] ||
+			event.target === menuElement ||
+			$.contains( menuElement, event.target );
+	},
+
+	_closeOnClickOutside: function( event ) {
+		if ( !this._isEventTargetInWidget( event ) ) {
+			this.close();
+		}
+	},
+
+	_appendTo: function() {
+		var element = this.options.appendTo;
+
+		if ( element ) {
+			element = element.jquery || element.nodeType ?
+				$( element ) :
+				this.document.find( element ).eq( 0 );
+		}
+
+		if ( !element || !element[ 0 ] ) {
+			element = this.element.closest( ".ui-front, dialog" );
+		}
+
+		if ( !element.length ) {
+			element = this.document[ 0 ].body;
+		}
+
+		return element;
+	},
+
+	_initSource: function() {
+		var array, url,
+			that = this;
+		if ( $.isArray( this.options.source ) ) {
+			array = this.options.source;
+			this.source = function( request, response ) {
+				response( $.ui.autocomplete.filter( array, request.term ) );
+			};
+		} else if ( typeof this.options.source === "string" ) {
+			url = this.options.source;
+			this.source = function( request, response ) {
+				if ( that.xhr ) {
+					that.xhr.abort();
+				}
+				that.xhr = $.ajax( {
+					url: url,
+					data: request,
+					dataType: "json",
+					success: function( data ) {
+						response( data );
+					},
+					error: function() {
+						response( [] );
+					}
+				} );
+			};
+		} else {
+			this.source = this.options.source;
+		}
+	},
+
+	_searchTimeout: function( event ) {
+		clearTimeout( this.searching );
+		this.searching = this._delay( function() {
+
+			// Search if the value has changed, or if the user retypes the same value (see #7434)
+			var equalValues = this.term === this._value(),
+				menuVisible = this.menu.element.is( ":visible" ),
+				modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey;
+
+			if ( !equalValues || ( equalValues && !menuVisible && !modifierKey ) ) {
+				this.selectedItem = null;
+				this.search( null, event );
+			}
+		}, this.options.delay );
+	},
+
+	search: function( value, event ) {
+		value = value != null ? value : this._value();
+
+		// Always save the actual value, not the one passed as an argument
+		this.term = this._value();
+
+		if ( value.length < this.options.minLength ) {
+			return this.close( event );
+		}
+
+		if ( this._trigger( "search", event ) === false ) {
+			return;
+		}
+
+		return this._search( value );
+	},
+
+	_search: function( value ) {
+		this.pending++;
+		this._addClass( "ui-autocomplete-loading" );
+		this.cancelSearch = false;
+
+		this.source( { term: value }, this._response() );
+	},
+
+	_response: function() {
+		var index = ++this.requestIndex;
+
+		return $.proxy( function( content ) {
+			if ( index === this.requestIndex ) {
+				this.__response( content );
+			}
+
+			this.pending--;
+			if ( !this.pending ) {
+				this._removeClass( "ui-autocomplete-loading" );
+			}
+		}, this );
+	},
+
+	__response: function( content ) {
+		if ( content ) {
+			content = this._normalize( content );
+		}
+		this._trigger( "response", null, { content: content } );
+		if ( !this.options.disabled && content && content.length && !this.cancelSearch ) {
+			this._suggest( content );
+			this._trigger( "open" );
+		} else {
+
+			// use ._close() instead of .close() so we don't cancel future searches
+			this._close();
+		}
+	},
+
+	close: function( event ) {
+		this.cancelSearch = true;
+		this._close( event );
+	},
+
+	_close: function( event ) {
+
+		// Remove the handler that closes the menu on outside clicks
+		this._off( this.document, "mousedown" );
+
+		if ( this.menu.element.is( ":visible" ) ) {
+			this.menu.element.hide();
+			this.menu.blur();
+			this.isNewMenu = true;
+			this._trigger( "close", event );
+		}
+	},
+
+	_change: function( event ) {
+		if ( this.previous !== this._value() ) {
+			this._trigger( "change", event, { item: this.selectedItem } );
+		}
+	},
+
+	_normalize: function( items ) {
+
+		// assume all items have the right format when the first item is complete
+		if ( items.length && items[ 0 ].label && items[ 0 ].value ) {
+			return items;
+		}
+		return $.map( items, function( item ) {
+			if ( typeof item === "string" ) {
+				return {
+					label: item,
+					value: item
+				};
+			}
+			return $.extend( {}, item, {
+				label: item.label || item.value,
+				value: item.value || item.label
+			} );
+		} );
+	},
+
+	_suggest: function( items ) {
+		var ul = this.menu.element.empty();
+		this._renderMenu( ul, items );
+		this.isNewMenu = true;
+		this.menu.refresh();
+
+		// Size and position menu
+		ul.show();
+		this._resizeMenu();
+		ul.position( $.extend( {
+			of: this.element
+		}, this.options.position ) );
+
+		if ( this.options.autoFocus ) {
+			this.menu.next();
+		}
+
+		// Listen for interactions outside of the widget (#6642)
+		this._on( this.document, {
+			mousedown: "_closeOnClickOutside"
+		} );
+	},
+
+	_resizeMenu: function() {
+		var ul = this.menu.element;
+		ul.outerWidth( Math.max(
+
+			// Firefox wraps long text (possibly a rounding bug)
+			// so we add 1px to avoid the wrapping (#7513)
+			ul.width( "" ).outerWidth() + 1,
+			this.element.outerWidth()
+		) );
+	},
+
+	_renderMenu: function( ul, items ) {
+		var that = this;
+		$.each( items, function( index, item ) {
+			that._renderItemData( ul, item );
+		} );
+	},
+
+	_renderItemData: function( ul, item ) {
+		return this._renderItem( ul, item ).data( "ui-autocomplete-item", item );
+	},
+
+	_renderItem: function( ul, item ) {
+		return $( "<li>" )
+			.append( $( "<div>" ).text( item.label ) )
+			.appendTo( ul );
+	},
+
+	_move: function( direction, event ) {
+		if ( !this.menu.element.is( ":visible" ) ) {
+			this.search( null, event );
+			return;
+		}
+		if ( this.menu.isFirstItem() && /^previous/.test( direction ) ||
+				this.menu.isLastItem() && /^next/.test( direction ) ) {
+
+			if ( !this.isMultiLine ) {
+				this._value( this.term );
+			}
+
+			this.menu.blur();
+			return;
+		}
+		this.menu[ direction ]( event );
+	},
+
+	widget: function() {
+		return this.menu.element;
+	},
+
+	_value: function() {
+		return this.valueMethod.apply( this.element, arguments );
+	},
+
+	_keyEvent: function( keyEvent, event ) {
+		if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+			this._move( keyEvent, event );
+
+			// Prevents moving cursor to beginning/end of the text field in some browsers
+			event.preventDefault();
+		}
+	},
+
+	// Support: Chrome <=50
+	// We should be able to just use this.element.prop( "isContentEditable" )
+	// but hidden elements always report false in Chrome.
+	// https://code.google.com/p/chromium/issues/detail?id=313082
+	_isContentEditable: function( element ) {
+		if ( !element.length ) {
+			return false;
+		}
+
+		var editable = element.prop( "contentEditable" );
+
+		if ( editable === "inherit" ) {
+		  return this._isContentEditable( element.parent() );
+		}
+
+		return editable === "true";
+	}
+} );
+
+$.extend( $.ui.autocomplete, {
+	escapeRegex: function( value ) {
+		return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" );
+	},
+	filter: function( array, term ) {
+		var matcher = new RegExp( $.ui.autocomplete.escapeRegex( term ), "i" );
+		return $.grep( array, function( value ) {
+			return matcher.test( value.label || value.value || value );
+		} );
+	}
+} );
+
+// Live region extension, adding a `messages` option
+// NOTE: This is an experimental API. We are still investigating
+// a full solution for string manipulation and internationalization.
+$.widget( "ui.autocomplete", $.ui.autocomplete, {
+	options: {
+		messages: {
+			noResults: "No search results.",
+			results: function( amount ) {
+				return amount + ( amount > 1 ? " results are" : " result is" ) +
+					" available, use up and down arrow keys to navigate.";
+			}
+		}
+	},
+
+	__response: function( content ) {
+		var message;
+		this._superApply( arguments );
+		if ( this.options.disabled || this.cancelSearch ) {
+			return;
+		}
+		if ( content && content.length ) {
+			message = this.options.messages.results( content.length );
+		} else {
+			message = this.options.messages.noResults;
+		}
+		this.liveRegion.children().hide();
+		$( "<div>" ).text( message ).appendTo( this.liveRegion );
+	}
+} );
+
+var widgetsAutocomplete = $.ui.autocomplete;
+
+
+/*!
+ * jQuery UI Controlgroup 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Drop
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Controlgroup
+//>>group: Widgets
+//>>description: Visually groups form control widgets
+//>>docs: http://api.jqueryui.com/controlgroup/
+//>>demos: http://jqueryui.com/controlgroup/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/controlgroup.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g;
+
+var widgetsControlgroup = $.widget( "ui.controlgroup", {
+	version: "1.12.1",
+	defaultElement: "<div>",
+	options: {
+		direction: "horizontal",
+		disabled: null,
+		onlyVisible: true,
+		items: {
+			"button": "input[type=button], input[type=submit], input[type=reset], button, a",
+			"controlgroupLabel": ".ui-controlgroup-label",
+			"checkboxradio": "input[type='checkbox'], input[type='radio']",
+			"selectmenu": "select",
+			"spinner": ".ui-spinner-input"
+		}
+	},
+
+	_create: function() {
+		this._enhance();
+	},
+
+	// To support the enhanced option in jQuery Mobile, we isolate DOM manipulation
+	_enhance: function() {
+		this.element.attr( "role", "toolbar" );
+		this.refresh();
+	},
+
+	_destroy: function() {
+		this._callChildMethod( "destroy" );
+		this.childWidgets.removeData( "ui-controlgroup-data" );
+		this.element.removeAttr( "role" );
+		if ( this.options.items.controlgroupLabel ) {
+			this.element
+				.find( this.options.items.controlgroupLabel )
+				.find( ".ui-controlgroup-label-contents" )
+				.contents().unwrap();
+		}
+	},
+
+	_initWidgets: function() {
+		var that = this,
+			childWidgets = [];
+
+		// First we iterate over each of the items options
+		$.each( this.options.items, function( widget, selector ) {
+			var labels;
+			var options = {};
+
+			// Make sure the widget has a selector set
+			if ( !selector ) {
+				return;
+			}
+
+			if ( widget === "controlgroupLabel" ) {
+				labels = that.element.find( selector );
+				labels.each( function() {
+					var element = $( this );
+
+					if ( element.children( ".ui-controlgroup-label-contents" ).length ) {
+						return;
+					}
+					element.contents()
+						.wrapAll( "<span class='ui-controlgroup-label-contents'></span>" );
+				} );
+				that._addClass( labels, null, "ui-widget ui-widget-content ui-state-default" );
+				childWidgets = childWidgets.concat( labels.get() );
+				return;
+			}
+
+			// Make sure the widget actually exists
+			if ( !$.fn[ widget ] ) {
+				return;
+			}
+
+			// We assume everything is in the middle to start because we can't determine
+			// first / last elements until all enhancments are done.
+			if ( that[ "_" + widget + "Options" ] ) {
+				options = that[ "_" + widget + "Options" ]( "middle" );
+			} else {
+				options = { classes: {} };
+			}
+
+			// Find instances of this widget inside controlgroup and init them
+			that.element
+				.find( selector )
+				.each( function() {
+					var element = $( this );
+					var instance = element[ widget ]( "instance" );
+
+					// We need to clone the default options for this type of widget to avoid
+					// polluting the variable options which has a wider scope than a single widget.
+					var instanceOptions = $.widget.extend( {}, options );
+
+					// If the button is the child of a spinner ignore it
+					// TODO: Find a more generic solution
+					if ( widget === "button" && element.parent( ".ui-spinner" ).length ) {
+						return;
+					}
+
+					// Create the widget if it doesn't exist
+					if ( !instance ) {
+						instance = element[ widget ]()[ widget ]( "instance" );
+					}
+					if ( instance ) {
+						instanceOptions.classes =
+							that._resolveClassesValues( instanceOptions.classes, instance );
+					}
+					element[ widget ]( instanceOptions );
+
+					// Store an instance of the controlgroup to be able to reference
+					// from the outermost element for changing options and refresh
+					var widgetElement = element[ widget ]( "widget" );
+					$.data( widgetElement[ 0 ], "ui-controlgroup-data",
+						instance ? instance : element[ widget ]( "instance" ) );
+
+					childWidgets.push( widgetElement[ 0 ] );
+				} );
+		} );
+
+		this.childWidgets = $( $.unique( childWidgets ) );
+		this._addClass( this.childWidgets, "ui-controlgroup-item" );
+	},
+
+	_callChildMethod: function( method ) {
+		this.childWidgets.each( function() {
+			var element = $( this ),
+				data = element.data( "ui-controlgroup-data" );
+			if ( data && data[ method ] ) {
+				data[ method ]();
+			}
+		} );
+	},
+
+	_updateCornerClass: function( element, position ) {
+		var remove = "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all";
+		var add = this._buildSimpleOptions( position, "label" ).classes.label;
+
+		this._removeClass( element, null, remove );
+		this._addClass( element, null, add );
+	},
+
+	_buildSimpleOptions: function( position, key ) {
+		var direction = this.options.direction === "vertical";
+		var result = {
+			classes: {}
+		};
+		result.classes[ key ] = {
+			"middle": "",
+			"first": "ui-corner-" + ( direction ? "top" : "left" ),
+			"last": "ui-corner-" + ( direction ? "bottom" : "right" ),
+			"only": "ui-corner-all"
+		}[ position ];
+
+		return result;
+	},
+
+	_spinnerOptions: function( position ) {
+		var options = this._buildSimpleOptions( position, "ui-spinner" );
+
+		options.classes[ "ui-spinner-up" ] = "";
+		options.classes[ "ui-spinner-down" ] = "";
+
+		return options;
+	},
+
+	_buttonOptions: function( position ) {
+		return this._buildSimpleOptions( position, "ui-button" );
+	},
+
+	_checkboxradioOptions: function( position ) {
+		return this._buildSimpleOptions( position, "ui-checkboxradio-label" );
+	},
+
+	_selectmenuOptions: function( position ) {
+		var direction = this.options.direction === "vertical";
+		return {
+			width: direction ? "auto" : false,
+			classes: {
+				middle: {
+					"ui-selectmenu-button-open": "",
+					"ui-selectmenu-button-closed": ""
+				},
+				first: {
+					"ui-selectmenu-button-open": "ui-corner-" + ( direction ? "top" : "tl" ),
+					"ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "top" : "left" )
+				},
+				last: {
+					"ui-selectmenu-button-open": direction ? "" : "ui-corner-tr",
+					"ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "bottom" : "right" )
+				},
+				only: {
+					"ui-selectmenu-button-open": "ui-corner-top",
+					"ui-selectmenu-button-closed": "ui-corner-all"
+				}
+
+			}[ position ]
+		};
+	},
+
+	_resolveClassesValues: function( classes, instance ) {
+		var result = {};
+		$.each( classes, function( key ) {
+			var current = instance.options.classes[ key ] || "";
+			current = $.trim( current.replace( controlgroupCornerRegex, "" ) );
+			result[ key ] = ( current + " " + classes[ key ] ).replace( /\s+/g, " " );
+		} );
+		return result;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "direction" ) {
+			this._removeClass( "ui-controlgroup-" + this.options.direction );
+		}
+
+		this._super( key, value );
+		if ( key === "disabled" ) {
+			this._callChildMethod( value ? "disable" : "enable" );
+			return;
+		}
+
+		this.refresh();
+	},
+
+	refresh: function() {
+		var children,
+			that = this;
+
+		this._addClass( "ui-controlgroup ui-controlgroup-" + this.options.direction );
+
+		if ( this.options.direction === "horizontal" ) {
+			this._addClass( null, "ui-helper-clearfix" );
+		}
+		this._initWidgets();
+
+		children = this.childWidgets;
+
+		// We filter here because we need to track all childWidgets not just the visible ones
+		if ( this.options.onlyVisible ) {
+			children = children.filter( ":visible" );
+		}
+
+		if ( children.length ) {
+
+			// We do this last because we need to make sure all enhancment is done
+			// before determining first and last
+			$.each( [ "first", "last" ], function( index, value ) {
+				var instance = children[ value ]().data( "ui-controlgroup-data" );
+
+				if ( instance && that[ "_" + instance.widgetName + "Options" ] ) {
+					var options = that[ "_" + instance.widgetName + "Options" ](
+						children.length === 1 ? "only" : value
+					);
+					options.classes = that._resolveClassesValues( options.classes, instance );
+					instance.element[ instance.widgetName ]( options );
+				} else {
+					that._updateCornerClass( children[ value ](), value );
+				}
+			} );
+
+			// Finally call the refresh method on each of the child widgets.
+			this._callChildMethod( "refresh" );
+		}
+	}
+} );
+
+/*!
+ * jQuery UI Checkboxradio 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
-"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
-;/*
- * jQuery UI Effects Explode 1.8.14
+
+//>>label: Checkboxradio
+//>>group: Widgets
+//>>description: Enhances a form with multiple themeable checkboxes or radio buttons.
+//>>docs: http://api.jqueryui.com/checkboxradio/
+//>>demos: http://jqueryui.com/checkboxradio/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/button.css
+//>>css.structure: ../../themes/base/checkboxradio.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.checkboxradio", [ $.ui.formResetMixin, {
+	version: "1.12.1",
+	options: {
+		disabled: null,
+		label: null,
+		icon: true,
+		classes: {
+			"ui-checkboxradio-label": "ui-corner-all",
+			"ui-checkboxradio-icon": "ui-corner-all"
+		}
+	},
+
+	_getCreateOptions: function() {
+		var disabled, labels;
+		var that = this;
+		var options = this._super() || {};
+
+		// We read the type here, because it makes more sense to throw a element type error first,
+		// rather then the error for lack of a label. Often if its the wrong type, it
+		// won't have a label (e.g. calling on a div, btn, etc)
+		this._readType();
+
+		labels = this.element.labels();
+
+		// If there are multiple labels, use the last one
+		this.label = $( labels[ labels.length - 1 ] );
+		if ( !this.label.length ) {
+			$.error( "No label found for checkboxradio widget" );
+		}
+
+		this.originalLabel = "";
+
+		// We need to get the label text but this may also need to make sure it does not contain the
+		// input itself.
+		this.label.contents().not( this.element[ 0 ] ).each( function() {
+
+			// The label contents could be text, html, or a mix. We concat each element to get a
+			// string representation of the label, without the input as part of it.
+			that.originalLabel += this.nodeType === 3 ? $( this ).text() : this.outerHTML;
+		} );
+
+		// Set the label option if we found label text
+		if ( this.originalLabel ) {
+			options.label = this.originalLabel;
+		}
+
+		disabled = this.element[ 0 ].disabled;
+		if ( disabled != null ) {
+			options.disabled = disabled;
+		}
+		return options;
+	},
+
+	_create: function() {
+		var checked = this.element[ 0 ].checked;
+
+		this._bindFormResetHandler();
+
+		if ( this.options.disabled == null ) {
+			this.options.disabled = this.element[ 0 ].disabled;
+		}
+
+		this._setOption( "disabled", this.options.disabled );
+		this._addClass( "ui-checkboxradio", "ui-helper-hidden-accessible" );
+		this._addClass( this.label, "ui-checkboxradio-label", "ui-button ui-widget" );
+
+		if ( this.type === "radio" ) {
+			this._addClass( this.label, "ui-checkboxradio-radio-label" );
+		}
+
+		if ( this.options.label && this.options.label !== this.originalLabel ) {
+			this._updateLabel();
+		} else if ( this.originalLabel ) {
+			this.options.label = this.originalLabel;
+		}
+
+		this._enhance();
+
+		if ( checked ) {
+			this._addClass( this.label, "ui-checkboxradio-checked", "ui-state-active" );
+			if ( this.icon ) {
+				this._addClass( this.icon, null, "ui-state-hover" );
+			}
+		}
+
+		this._on( {
+			change: "_toggleClasses",
+			focus: function() {
+				this._addClass( this.label, null, "ui-state-focus ui-visual-focus" );
+			},
+			blur: function() {
+				this._removeClass( this.label, null, "ui-state-focus ui-visual-focus" );
+			}
+		} );
+	},
+
+	_readType: function() {
+		var nodeName = this.element[ 0 ].nodeName.toLowerCase();
+		this.type = this.element[ 0 ].type;
+		if ( nodeName !== "input" || !/radio|checkbox/.test( this.type ) ) {
+			$.error( "Can't create checkboxradio on element.nodeName=" + nodeName +
+				" and element.type=" + this.type );
+		}
+	},
+
+	// Support jQuery Mobile enhanced option
+	_enhance: function() {
+		this._updateIcon( this.element[ 0 ].checked );
+	},
+
+	widget: function() {
+		return this.label;
+	},
+
+	_getRadioGroup: function() {
+		var group;
+		var name = this.element[ 0 ].name;
+		var nameSelector = "input[name='" + $.ui.escapeSelector( name ) + "']";
+
+		if ( !name ) {
+			return $( [] );
+		}
+
+		if ( this.form.length ) {
+			group = $( this.form[ 0 ].elements ).filter( nameSelector );
+		} else {
+
+			// Not inside a form, check all inputs that also are not inside a form
+			group = $( nameSelector ).filter( function() {
+				return $( this ).form().length === 0;
+			} );
+		}
+
+		return group.not( this.element );
+	},
+
+	_toggleClasses: function() {
+		var checked = this.element[ 0 ].checked;
+		this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked );
+
+		if ( this.options.icon && this.type === "checkbox" ) {
+			this._toggleClass( this.icon, null, "ui-icon-check ui-state-checked", checked )
+				._toggleClass( this.icon, null, "ui-icon-blank", !checked );
+		}
+
+		if ( this.type === "radio" ) {
+			this._getRadioGroup()
+				.each( function() {
+					var instance = $( this ).checkboxradio( "instance" );
+
+					if ( instance ) {
+						instance._removeClass( instance.label,
+							"ui-checkboxradio-checked", "ui-state-active" );
+					}
+				} );
+		}
+	},
+
+	_destroy: function() {
+		this._unbindFormResetHandler();
+
+		if ( this.icon ) {
+			this.icon.remove();
+			this.iconSpace.remove();
+		}
+	},
+
+	_setOption: function( key, value ) {
+
+		// We don't allow the value to be set to nothing
+		if ( key === "label" && !value ) {
+			return;
+		}
+
+		this._super( key, value );
+
+		if ( key === "disabled" ) {
+			this._toggleClass( this.label, null, "ui-state-disabled", value );
+			this.element[ 0 ].disabled = value;
+
+			// Don't refresh when setting disabled
+			return;
+		}
+		this.refresh();
+	},
+
+	_updateIcon: function( checked ) {
+		var toAdd = "ui-icon ui-icon-background ";
+
+		if ( this.options.icon ) {
+			if ( !this.icon ) {
+				this.icon = $( "<span>" );
+				this.iconSpace = $( "<span> </span>" );
+				this._addClass( this.iconSpace, "ui-checkboxradio-icon-space" );
+			}
+
+			if ( this.type === "checkbox" ) {
+				toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank";
+				this._removeClass( this.icon, null, checked ? "ui-icon-blank" : "ui-icon-check" );
+			} else {
+				toAdd += "ui-icon-blank";
+			}
+			this._addClass( this.icon, "ui-checkboxradio-icon", toAdd );
+			if ( !checked ) {
+				this._removeClass( this.icon, null, "ui-icon-check ui-state-checked" );
+			}
+			this.icon.prependTo( this.label ).after( this.iconSpace );
+		} else if ( this.icon !== undefined ) {
+			this.icon.remove();
+			this.iconSpace.remove();
+			delete this.icon;
+		}
+	},
+
+	_updateLabel: function() {
+
+		// Remove the contents of the label ( minus the icon, icon space, and input )
+		var contents = this.label.contents().not( this.element[ 0 ] );
+		if ( this.icon ) {
+			contents = contents.not( this.icon[ 0 ] );
+		}
+		if ( this.iconSpace ) {
+			contents = contents.not( this.iconSpace[ 0 ] );
+		}
+		contents.remove();
+
+		this.label.append( this.options.label );
+	},
+
+	refresh: function() {
+		var checked = this.element[ 0 ].checked,
+			isDisabled = this.element[ 0 ].disabled;
+
+		this._updateIcon( checked );
+		this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked );
+		if ( this.options.label !== null ) {
+			this._updateLabel();
+		}
+
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOptions( { "disabled": isDisabled } );
+		}
+	}
+
+} ] );
+
+var widgetsCheckboxradio = $.ui.checkboxradio;
+
+
+/*!
+ * jQuery UI Button 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Button
+//>>group: Widgets
+//>>description: Enhances a form with themeable buttons.
+//>>docs: http://api.jqueryui.com/button/
+//>>demos: http://jqueryui.com/button/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/button.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.button", {
+	version: "1.12.1",
+	defaultElement: "<button>",
+	options: {
+		classes: {
+			"ui-button": "ui-corner-all"
+		},
+		disabled: null,
+		icon: null,
+		iconPosition: "beginning",
+		label: null,
+		showLabel: true
+	},
+
+	_getCreateOptions: function() {
+		var disabled,
+
+			// This is to support cases like in jQuery Mobile where the base widget does have
+			// an implementation of _getCreateOptions
+			options = this._super() || {};
+
+		this.isInput = this.element.is( "input" );
+
+		disabled = this.element[ 0 ].disabled;
+		if ( disabled != null ) {
+			options.disabled = disabled;
+		}
+
+		this.originalLabel = this.isInput ? this.element.val() : this.element.html();
+		if ( this.originalLabel ) {
+			options.label = this.originalLabel;
+		}
+
+		return options;
+	},
+
+	_create: function() {
+		if ( !this.option.showLabel & !this.options.icon ) {
+			this.options.showLabel = true;
+		}
+
+		// We have to check the option again here even though we did in _getCreateOptions,
+		// because null may have been passed on init which would override what was set in
+		// _getCreateOptions
+		if ( this.options.disabled == null ) {
+			this.options.disabled = this.element[ 0 ].disabled || false;
+		}
+
+		this.hasTitle = !!this.element.attr( "title" );
+
+		// Check to see if the label needs to be set or if its already correct
+		if ( this.options.label && this.options.label !== this.originalLabel ) {
+			if ( this.isInput ) {
+				this.element.val( this.options.label );
+			} else {
+				this.element.html( this.options.label );
+			}
+		}
+		this._addClass( "ui-button", "ui-widget" );
+		this._setOption( "disabled", this.options.disabled );
+		this._enhance();
+
+		if ( this.element.is( "a" ) ) {
+			this._on( {
+				"keyup": function( event ) {
+					if ( event.keyCode === $.ui.keyCode.SPACE ) {
+						event.preventDefault();
+
+						// Support: PhantomJS <= 1.9, IE 8 Only
+						// If a native click is available use it so we actually cause navigation
+						// otherwise just trigger a click event
+						if ( this.element[ 0 ].click ) {
+							this.element[ 0 ].click();
+						} else {
+							this.element.trigger( "click" );
+						}
+					}
+				}
+			} );
+		}
+	},
+
+	_enhance: function() {
+		if ( !this.element.is( "button" ) ) {
+			this.element.attr( "role", "button" );
+		}
+
+		if ( this.options.icon ) {
+			this._updateIcon( "icon", this.options.icon );
+			this._updateTooltip();
+		}
+	},
+
+	_updateTooltip: function() {
+		this.title = this.element.attr( "title" );
+
+		if ( !this.options.showLabel && !this.title ) {
+			this.element.attr( "title", this.options.label );
+		}
+	},
+
+	_updateIcon: function( option, value ) {
+		var icon = option !== "iconPosition",
+			position = icon ? this.options.iconPosition : value,
+			displayBlock = position === "top" || position === "bottom";
+
+		// Create icon
+		if ( !this.icon ) {
+			this.icon = $( "<span>" );
+
+			this._addClass( this.icon, "ui-button-icon", "ui-icon" );
+
+			if ( !this.options.showLabel ) {
+				this._addClass( "ui-button-icon-only" );
+			}
+		} else if ( icon ) {
+
+			// If we are updating the icon remove the old icon class
+			this._removeClass( this.icon, null, this.options.icon );
+		}
+
+		// If we are updating the icon add the new icon class
+		if ( icon ) {
+			this._addClass( this.icon, null, value );
+		}
+
+		this._attachIcon( position );
+
+		// If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove
+		// the iconSpace if there is one.
+		if ( displayBlock ) {
+			this._addClass( this.icon, null, "ui-widget-icon-block" );
+			if ( this.iconSpace ) {
+				this.iconSpace.remove();
+			}
+		} else {
+
+			// Position is beginning or end so remove the ui-widget-icon-block class and add the
+			// space if it does not exist
+			if ( !this.iconSpace ) {
+				this.iconSpace = $( "<span> </span>" );
+				this._addClass( this.iconSpace, "ui-button-icon-space" );
+			}
+			this._removeClass( this.icon, null, "ui-wiget-icon-block" );
+			this._attachIconSpace( position );
+		}
+	},
+
+	_destroy: function() {
+		this.element.removeAttr( "role" );
+
+		if ( this.icon ) {
+			this.icon.remove();
+		}
+		if ( this.iconSpace ) {
+			this.iconSpace.remove();
+		}
+		if ( !this.hasTitle ) {
+			this.element.removeAttr( "title" );
+		}
+	},
+
+	_attachIconSpace: function( iconPosition ) {
+		this.icon[ /^(?:end|bottom)/.test( iconPosition ) ? "before" : "after" ]( this.iconSpace );
+	},
+
+	_attachIcon: function( iconPosition ) {
+		this.element[ /^(?:end|bottom)/.test( iconPosition ) ? "append" : "prepend" ]( this.icon );
+	},
+
+	_setOptions: function( options ) {
+		var newShowLabel = options.showLabel === undefined ?
+				this.options.showLabel :
+				options.showLabel,
+			newIcon = options.icon === undefined ? this.options.icon : options.icon;
+
+		if ( !newShowLabel && !newIcon ) {
+			options.showLabel = true;
+		}
+		this._super( options );
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "icon" ) {
+			if ( value ) {
+				this._updateIcon( key, value );
+			} else if ( this.icon ) {
+				this.icon.remove();
+				if ( this.iconSpace ) {
+					this.iconSpace.remove();
+				}
+			}
+		}
+
+		if ( key === "iconPosition" ) {
+			this._updateIcon( key, value );
+		}
+
+		// Make sure we can't end up with a button that has neither text nor icon
+		if ( key === "showLabel" ) {
+				this._toggleClass( "ui-button-icon-only", null, !value );
+				this._updateTooltip();
+		}
+
+		if ( key === "label" ) {
+			if ( this.isInput ) {
+				this.element.val( value );
+			} else {
+
+				// If there is an icon, append it, else nothing then append the value
+				// this avoids removal of the icon when setting label text
+				this.element.html( value );
+				if ( this.icon ) {
+					this._attachIcon( this.options.iconPosition );
+					this._attachIconSpace( this.options.iconPosition );
+				}
+			}
+		}
+
+		this._super( key, value );
+
+		if ( key === "disabled" ) {
+			this._toggleClass( null, "ui-state-disabled", value );
+			this.element[ 0 ].disabled = value;
+			if ( value ) {
+				this.element.blur();
+			}
+		}
+	},
+
+	refresh: function() {
+
+		// Make sure to only check disabled if its an element that supports this otherwise
+		// check for the disabled class to determine state
+		var isDisabled = this.element.is( "input, button" ) ?
+			this.element[ 0 ].disabled : this.element.hasClass( "ui-button-disabled" );
+
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOptions( { disabled: isDisabled } );
+		}
+
+		this._updateTooltip();
+	}
+} );
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+
+	// Text and Icons options
+	$.widget( "ui.button", $.ui.button, {
+		options: {
+			text: true,
+			icons: {
+				primary: null,
+				secondary: null
+			}
+		},
+
+		_create: function() {
+			if ( this.options.showLabel && !this.options.text ) {
+				this.options.showLabel = this.options.text;
+			}
+			if ( !this.options.showLabel && this.options.text ) {
+				this.options.text = this.options.showLabel;
+			}
+			if ( !this.options.icon && ( this.options.icons.primary ||
+					this.options.icons.secondary ) ) {
+				if ( this.options.icons.primary ) {
+					this.options.icon = this.options.icons.primary;
+				} else {
+					this.options.icon = this.options.icons.secondary;
+					this.options.iconPosition = "end";
+				}
+			} else if ( this.options.icon ) {
+				this.options.icons.primary = this.options.icon;
+			}
+			this._super();
+		},
+
+		_setOption: function( key, value ) {
+			if ( key === "text" ) {
+				this._super( "showLabel", value );
+				return;
+			}
+			if ( key === "showLabel" ) {
+				this.options.text = value;
+			}
+			if ( key === "icon" ) {
+				this.options.icons.primary = value;
+			}
+			if ( key === "icons" ) {
+				if ( value.primary ) {
+					this._super( "icon", value.primary );
+					this._super( "iconPosition", "beginning" );
+				} else if ( value.secondary ) {
+					this._super( "icon", value.secondary );
+					this._super( "iconPosition", "end" );
+				}
+			}
+			this._superApply( arguments );
+		}
+	} );
+
+	$.fn.button = ( function( orig ) {
+		return function() {
+			if ( !this.length || ( this.length && this[ 0 ].tagName !== "INPUT" ) ||
+					( this.length && this[ 0 ].tagName === "INPUT" && (
+						this.attr( "type" ) !== "checkbox" && this.attr( "type" ) !== "radio"
+					) ) ) {
+				return orig.apply( this, arguments );
+			}
+			if ( !$.ui.checkboxradio ) {
+				$.error( "Checkboxradio widget missing" );
+			}
+			if ( arguments.length === 0 ) {
+				return this.checkboxradio( {
+					"icon": false
+				} );
+			}
+			return this.checkboxradio.apply( this, arguments );
+		};
+	} )( $.fn.button );
+
+	$.fn.buttonset = function() {
+		if ( !$.ui.controlgroup ) {
+			$.error( "Controlgroup widget missing" );
+		}
+		if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" && arguments[ 2 ] ) {
+			return this.controlgroup.apply( this,
+				[ arguments[ 0 ], "items.button", arguments[ 2 ] ] );
+		}
+		if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" ) {
+			return this.controlgroup.apply( this, [ arguments[ 0 ], "items.button" ] );
+		}
+		if ( typeof arguments[ 0 ] === "object" && arguments[ 0 ].items ) {
+			arguments[ 0 ].items = {
+				button: arguments[ 0 ].items
+			};
+		}
+		return this.controlgroup.apply( this, arguments );
+	};
+}
+
+var widgetsButton = $.ui.button;
+
+
+// jscs:disable maximumLineLength
+/* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */
+/*!
+ * jQuery UI Datepicker 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Explode
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Datepicker
+//>>group: Widgets
+//>>description: Displays a calendar from an input or inline for selecting dates.
+//>>docs: http://api.jqueryui.com/datepicker/
+//>>demos: http://jqueryui.com/datepicker/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/datepicker.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.extend( $.ui, { datepicker: { version: "1.12.1" } } );
+
+var datepicker_instActive;
+
+function datepicker_getZindex( elem ) {
+	var position, value;
+	while ( elem.length && elem[ 0 ] !== document ) {
+
+		// Ignore z-index if position is set to a value where z-index is ignored by the browser
+		// This makes behavior of this function consistent across browsers
+		// WebKit always returns auto if the element is positioned
+		position = elem.css( "position" );
+		if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+
+			// IE returns 0 when zIndex is not specified
+			// other browsers return a string
+			// we ignore the case of nested elements with an explicit value of 0
+			// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+			value = parseInt( elem.css( "zIndex" ), 10 );
+			if ( !isNaN( value ) && value !== 0 ) {
+				return value;
+			}
+		}
+		elem = elem.parent();
+	}
+
+	return 0;
+}
+/* Date picker manager.
+   Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+   Settings for (groups of) date pickers are maintained in an instance object,
+   allowing multiple different settings on the same page. */
+
+function Datepicker() {
+	this._curInst = null; // The current instance in use
+	this._keyEvent = false; // If the last event was a key event
+	this._disabledInputs = []; // List of date picker inputs that have been disabled
+	this._datepickerShowing = false; // True if the popup picker is showing , false if not
+	this._inDialog = false; // True if showing within a "dialog", false if not
+	this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
+	this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
+	this._appendClass = "ui-datepicker-append"; // The name of the append marker class
+	this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
+	this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
+	this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
+	this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
+	this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
+	this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
+	this.regional = []; // Available regional settings, indexed by language code
+	this.regional[ "" ] = { // Default regional settings
+		closeText: "Done", // Display text for close link
+		prevText: "Prev", // Display text for previous month link
+		nextText: "Next", // Display text for next month link
+		currentText: "Today", // Display text for current month link
+		monthNames: [ "January","February","March","April","May","June",
+			"July","August","September","October","November","December" ], // Names of months for drop-down and formatting
+		monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], // For formatting
+		dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], // For formatting
+		dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], // For formatting
+		dayNamesMin: [ "Su","Mo","Tu","We","Th","Fr","Sa" ], // Column headings for days starting at Sunday
+		weekHeader: "Wk", // Column header for week of the year
+		dateFormat: "mm/dd/yy", // See format options on parseDate
+		firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+		isRTL: false, // True if right-to-left language, false if left-to-right
+		showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+		yearSuffix: "" // Additional text to append to the year in the month headers
+	};
+	this._defaults = { // Global defaults for all the date picker instances
+		showOn: "focus", // "focus" for popup on focus,
+			// "button" for trigger button, or "both" for either
+		showAnim: "fadeIn", // Name of jQuery animation for popup
+		showOptions: {}, // Options for enhanced animations
+		defaultDate: null, // Used when field is blank: actual date,
+			// +/-number for offset from today, null for today
+		appendText: "", // Display text following the input box, e.g. showing the format
+		buttonText: "...", // Text for trigger button
+		buttonImage: "", // URL for trigger button image
+		buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+		hideIfNoPrevNext: false, // True to hide next/previous month links
+			// if not applicable, false to just disable them
+		navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+		gotoCurrent: false, // True if today link goes back to current selection instead
+		changeMonth: false, // True if month can be selected directly, false if only prev/next
+		changeYear: false, // True if year can be selected directly, false if only prev/next
+		yearRange: "c-10:c+10", // Range of years to display in drop-down,
+			// either relative to today's year (-nn:+nn), relative to currently displayed year
+			// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+		showOtherMonths: false, // True to show dates in other months, false to leave blank
+		selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+		showWeek: false, // True to show week of the year, false to not show it
+		calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+			// takes a Date and returns the number of the week for it
+		shortYearCutoff: "+10", // Short year values < this are in the current century,
+			// > this are in the previous century,
+			// string value starting with "+" for current year + value
+		minDate: null, // The earliest selectable date, or null for no limit
+		maxDate: null, // The latest selectable date, or null for no limit
+		duration: "fast", // Duration of display/closure
+		beforeShowDay: null, // Function that takes a date and returns an array with
+			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
+			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
+		beforeShow: null, // Function that takes an input field and
+			// returns a set of custom settings for the date picker
+		onSelect: null, // Define a callback function when a date is selected
+		onChangeMonthYear: null, // Define a callback function when the month or year is changed
+		onClose: null, // Define a callback function when the datepicker is closed
+		numberOfMonths: 1, // Number of months to show at a time
+		showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+		stepMonths: 1, // Number of months to step back/forward
+		stepBigMonths: 12, // Number of months to step back/forward for the big links
+		altField: "", // Selector for an alternate field to store selected dates into
+		altFormat: "", // The date format to use for the alternate field
+		constrainInput: true, // The input is constrained by the current date format
+		showButtonPanel: false, // True to show button panel, false to not show it
+		autoSize: false, // True to size the input for the date format, false to leave as is
+		disabled: false // The initial disabled state
+	};
+	$.extend( this._defaults, this.regional[ "" ] );
+	this.regional.en = $.extend( true, {}, this.regional[ "" ] );
+	this.regional[ "en-US" ] = $.extend( true, {}, this.regional.en );
+	this.dpDiv = datepicker_bindHover( $( "<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) );
+}
+
+$.extend( Datepicker.prototype, {
+	/* Class name added to elements to indicate already configured with a date picker. */
+	markerClassName: "hasDatepicker",
+
+	//Keep track of the maximum number of rows displayed (see #7043)
+	maxRows: 4,
+
+	// TODO rename to "widget" when switching to widget factory
+	_widgetDatepicker: function() {
+		return this.dpDiv;
+	},
+
+	/* Override the default settings for all instances of the date picker.
+	 * @param  settings  object - the new settings to use as defaults (anonymous object)
+	 * @return the manager object
+	 */
+	setDefaults: function( settings ) {
+		datepicker_extendRemove( this._defaults, settings || {} );
+		return this;
+	},
+
+	/* Attach the date picker to a jQuery selection.
+	 * @param  target	element - the target input field or division or span
+	 * @param  settings  object - the new settings to use for this date picker instance (anonymous)
+	 */
+	_attachDatepicker: function( target, settings ) {
+		var nodeName, inline, inst;
+		nodeName = target.nodeName.toLowerCase();
+		inline = ( nodeName === "div" || nodeName === "span" );
+		if ( !target.id ) {
+			this.uuid += 1;
+			target.id = "dp" + this.uuid;
+		}
+		inst = this._newInst( $( target ), inline );
+		inst.settings = $.extend( {}, settings || {} );
+		if ( nodeName === "input" ) {
+			this._connectDatepicker( target, inst );
+		} else if ( inline ) {
+			this._inlineDatepicker( target, inst );
+		}
+	},
+
+	/* Create a new instance object. */
+	_newInst: function( target, inline ) {
+		var id = target[ 0 ].id.replace( /([^A-Za-z0-9_\-])/g, "\\\\$1" ); // escape jQuery meta chars
+		return { id: id, input: target, // associated target
+			selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+			drawMonth: 0, drawYear: 0, // month being drawn
+			inline: inline, // is datepicker inline or not
+			dpDiv: ( !inline ? this.dpDiv : // presentation div
+			datepicker_bindHover( $( "<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) ) ) };
+	},
+
+	/* Attach the date picker to an input field. */
+	_connectDatepicker: function( target, inst ) {
+		var input = $( target );
+		inst.append = $( [] );
+		inst.trigger = $( [] );
+		if ( input.hasClass( this.markerClassName ) ) {
+			return;
+		}
+		this._attachments( input, inst );
+		input.addClass( this.markerClassName ).on( "keydown", this._doKeyDown ).
+			on( "keypress", this._doKeyPress ).on( "keyup", this._doKeyUp );
+		this._autoSize( inst );
+		$.data( target, "datepicker", inst );
+
+		//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
+		if ( inst.settings.disabled ) {
+			this._disableDatepicker( target );
+		}
+	},
+
+	/* Make attachments based on settings. */
+	_attachments: function( input, inst ) {
+		var showOn, buttonText, buttonImage,
+			appendText = this._get( inst, "appendText" ),
+			isRTL = this._get( inst, "isRTL" );
+
+		if ( inst.append ) {
+			inst.append.remove();
+		}
+		if ( appendText ) {
+			inst.append = $( "<span class='" + this._appendClass + "'>" + appendText + "</span>" );
+			input[ isRTL ? "before" : "after" ]( inst.append );
+		}
+
+		input.off( "focus", this._showDatepicker );
+
+		if ( inst.trigger ) {
+			inst.trigger.remove();
+		}
+
+		showOn = this._get( inst, "showOn" );
+		if ( showOn === "focus" || showOn === "both" ) { // pop-up date picker when in the marked field
+			input.on( "focus", this._showDatepicker );
+		}
+		if ( showOn === "button" || showOn === "both" ) { // pop-up date picker when button clicked
+			buttonText = this._get( inst, "buttonText" );
+			buttonImage = this._get( inst, "buttonImage" );
+			inst.trigger = $( this._get( inst, "buttonImageOnly" ) ?
+				$( "<img/>" ).addClass( this._triggerClass ).
+					attr( { src: buttonImage, alt: buttonText, title: buttonText } ) :
+				$( "<button type='button'></button>" ).addClass( this._triggerClass ).
+					html( !buttonImage ? buttonText : $( "<img/>" ).attr(
+					{ src:buttonImage, alt:buttonText, title:buttonText } ) ) );
+			input[ isRTL ? "before" : "after" ]( inst.trigger );
+			inst.trigger.on( "click", function() {
+				if ( $.datepicker._datepickerShowing && $.datepicker._lastInput === input[ 0 ] ) {
+					$.datepicker._hideDatepicker();
+				} else if ( $.datepicker._datepickerShowing && $.datepicker._lastInput !== input[ 0 ] ) {
+					$.datepicker._hideDatepicker();
+					$.datepicker._showDatepicker( input[ 0 ] );
+				} else {
+					$.datepicker._showDatepicker( input[ 0 ] );
+				}
+				return false;
+			} );
+		}
+	},
+
+	/* Apply the maximum length for the date format. */
+	_autoSize: function( inst ) {
+		if ( this._get( inst, "autoSize" ) && !inst.inline ) {
+			var findMax, max, maxI, i,
+				date = new Date( 2009, 12 - 1, 20 ), // Ensure double digits
+				dateFormat = this._get( inst, "dateFormat" );
+
+			if ( dateFormat.match( /[DM]/ ) ) {
+				findMax = function( names ) {
+					max = 0;
+					maxI = 0;
+					for ( i = 0; i < names.length; i++ ) {
+						if ( names[ i ].length > max ) {
+							max = names[ i ].length;
+							maxI = i;
+						}
+					}
+					return maxI;
+				};
+				date.setMonth( findMax( this._get( inst, ( dateFormat.match( /MM/ ) ?
+					"monthNames" : "monthNamesShort" ) ) ) );
+				date.setDate( findMax( this._get( inst, ( dateFormat.match( /DD/ ) ?
+					"dayNames" : "dayNamesShort" ) ) ) + 20 - date.getDay() );
+			}
+			inst.input.attr( "size", this._formatDate( inst, date ).length );
+		}
+	},
+
+	/* Attach an inline date picker to a div. */
+	_inlineDatepicker: function( target, inst ) {
+		var divSpan = $( target );
+		if ( divSpan.hasClass( this.markerClassName ) ) {
+			return;
+		}
+		divSpan.addClass( this.markerClassName ).append( inst.dpDiv );
+		$.data( target, "datepicker", inst );
+		this._setDate( inst, this._getDefaultDate( inst ), true );
+		this._updateDatepicker( inst );
+		this._updateAlternate( inst );
+
+		//If disabled option is true, disable the datepicker before showing it (see ticket #5665)
+		if ( inst.settings.disabled ) {
+			this._disableDatepicker( target );
+		}
+
+		// Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
+		// http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
+		inst.dpDiv.css( "display", "block" );
+	},
+
+	/* Pop-up the date picker in a "dialog" box.
+	 * @param  input element - ignored
+	 * @param  date	string or Date - the initial date to display
+	 * @param  onSelect  function - the function to call when a date is selected
+	 * @param  settings  object - update the dialog date picker instance's settings (anonymous object)
+	 * @param  pos int[2] - coordinates for the dialog's position within the screen or
+	 *					event - with x/y coordinates or
+	 *					leave empty for default (screen centre)
+	 * @return the manager object
+	 */
+	_dialogDatepicker: function( input, date, onSelect, settings, pos ) {
+		var id, browserWidth, browserHeight, scrollX, scrollY,
+			inst = this._dialogInst; // internal instance
+
+		if ( !inst ) {
+			this.uuid += 1;
+			id = "dp" + this.uuid;
+			this._dialogInput = $( "<input type='text' id='" + id +
+				"' style='position: absolute; top: -100px; width: 0px;'/>" );
+			this._dialogInput.on( "keydown", this._doKeyDown );
+			$( "body" ).append( this._dialogInput );
+			inst = this._dialogInst = this._newInst( this._dialogInput, false );
+			inst.settings = {};
+			$.data( this._dialogInput[ 0 ], "datepicker", inst );
+		}
+		datepicker_extendRemove( inst.settings, settings || {} );
+		date = ( date && date.constructor === Date ? this._formatDate( inst, date ) : date );
+		this._dialogInput.val( date );
+
+		this._pos = ( pos ? ( pos.length ? pos : [ pos.pageX, pos.pageY ] ) : null );
+		if ( !this._pos ) {
+			browserWidth = document.documentElement.clientWidth;
+			browserHeight = document.documentElement.clientHeight;
+			scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+			scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+			this._pos = // should use actual width/height below
+				[ ( browserWidth / 2 ) - 100 + scrollX, ( browserHeight / 2 ) - 150 + scrollY ];
+		}
+
+		// Move input on screen for focus, but hidden behind dialog
+		this._dialogInput.css( "left", ( this._pos[ 0 ] + 20 ) + "px" ).css( "top", this._pos[ 1 ] + "px" );
+		inst.settings.onSelect = onSelect;
+		this._inDialog = true;
+		this.dpDiv.addClass( this._dialogClass );
+		this._showDatepicker( this._dialogInput[ 0 ] );
+		if ( $.blockUI ) {
+			$.blockUI( this.dpDiv );
+		}
+		$.data( this._dialogInput[ 0 ], "datepicker", inst );
+		return this;
+	},
+
+	/* Detach a datepicker from its control.
+	 * @param  target	element - the target input field or division or span
+	 */
+	_destroyDatepicker: function( target ) {
+		var nodeName,
+			$target = $( target ),
+			inst = $.data( target, "datepicker" );
+
+		if ( !$target.hasClass( this.markerClassName ) ) {
+			return;
+		}
+
+		nodeName = target.nodeName.toLowerCase();
+		$.removeData( target, "datepicker" );
+		if ( nodeName === "input" ) {
+			inst.append.remove();
+			inst.trigger.remove();
+			$target.removeClass( this.markerClassName ).
+				off( "focus", this._showDatepicker ).
+				off( "keydown", this._doKeyDown ).
+				off( "keypress", this._doKeyPress ).
+				off( "keyup", this._doKeyUp );
+		} else if ( nodeName === "div" || nodeName === "span" ) {
+			$target.removeClass( this.markerClassName ).empty();
+		}
+
+		if ( datepicker_instActive === inst ) {
+			datepicker_instActive = null;
+		}
+	},
+
+	/* Enable the date picker to a jQuery selection.
+	 * @param  target	element - the target input field or division or span
+	 */
+	_enableDatepicker: function( target ) {
+		var nodeName, inline,
+			$target = $( target ),
+			inst = $.data( target, "datepicker" );
+
+		if ( !$target.hasClass( this.markerClassName ) ) {
+			return;
+		}
+
+		nodeName = target.nodeName.toLowerCase();
+		if ( nodeName === "input" ) {
+			target.disabled = false;
+			inst.trigger.filter( "button" ).
+				each( function() { this.disabled = false; } ).end().
+				filter( "img" ).css( { opacity: "1.0", cursor: "" } );
+		} else if ( nodeName === "div" || nodeName === "span" ) {
+			inline = $target.children( "." + this._inlineClass );
+			inline.children().removeClass( "ui-state-disabled" );
+			inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ).
+				prop( "disabled", false );
+		}
+		this._disabledInputs = $.map( this._disabledInputs,
+			function( value ) { return ( value === target ? null : value ); } ); // delete entry
+	},
+
+	/* Disable the date picker to a jQuery selection.
+	 * @param  target	element - the target input field or division or span
+	 */
+	_disableDatepicker: function( target ) {
+		var nodeName, inline,
+			$target = $( target ),
+			inst = $.data( target, "datepicker" );
+
+		if ( !$target.hasClass( this.markerClassName ) ) {
+			return;
+		}
+
+		nodeName = target.nodeName.toLowerCase();
+		if ( nodeName === "input" ) {
+			target.disabled = true;
+			inst.trigger.filter( "button" ).
+				each( function() { this.disabled = true; } ).end().
+				filter( "img" ).css( { opacity: "0.5", cursor: "default" } );
+		} else if ( nodeName === "div" || nodeName === "span" ) {
+			inline = $target.children( "." + this._inlineClass );
+			inline.children().addClass( "ui-state-disabled" );
+			inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ).
+				prop( "disabled", true );
+		}
+		this._disabledInputs = $.map( this._disabledInputs,
+			function( value ) { return ( value === target ? null : value ); } ); // delete entry
+		this._disabledInputs[ this._disabledInputs.length ] = target;
+	},
+
+	/* Is the first field in a jQuery collection disabled as a datepicker?
+	 * @param  target	element - the target input field or division or span
+	 * @return boolean - true if disabled, false if enabled
+	 */
+	_isDisabledDatepicker: function( target ) {
+		if ( !target ) {
+			return false;
+		}
+		for ( var i = 0; i < this._disabledInputs.length; i++ ) {
+			if ( this._disabledInputs[ i ] === target ) {
+				return true;
+			}
+		}
+		return false;
+	},
+
+	/* Retrieve the instance data for the target control.
+	 * @param  target  element - the target input field or division or span
+	 * @return  object - the associated instance data
+	 * @throws  error if a jQuery problem getting data
+	 */
+	_getInst: function( target ) {
+		try {
+			return $.data( target, "datepicker" );
+		}
+		catch ( err ) {
+			throw "Missing instance data for this datepicker";
+		}
+	},
+
+	/* Update or retrieve the settings for a date picker attached to an input field or division.
+	 * @param  target  element - the target input field or division or span
+	 * @param  name	object - the new settings to update or
+	 *				string - the name of the setting to change or retrieve,
+	 *				when retrieving also "all" for all instance settings or
+	 *				"defaults" for all global defaults
+	 * @param  value   any - the new value for the setting
+	 *				(omit if above is an object or to retrieve a value)
+	 */
+	_optionDatepicker: function( target, name, value ) {
+		var settings, date, minDate, maxDate,
+			inst = this._getInst( target );
+
+		if ( arguments.length === 2 && typeof name === "string" ) {
+			return ( name === "defaults" ? $.extend( {}, $.datepicker._defaults ) :
+				( inst ? ( name === "all" ? $.extend( {}, inst.settings ) :
+				this._get( inst, name ) ) : null ) );
+		}
+
+		settings = name || {};
+		if ( typeof name === "string" ) {
+			settings = {};
+			settings[ name ] = value;
+		}
+
+		if ( inst ) {
+			if ( this._curInst === inst ) {
+				this._hideDatepicker();
+			}
+
+			date = this._getDateDatepicker( target, true );
+			minDate = this._getMinMaxDate( inst, "min" );
+			maxDate = this._getMinMaxDate( inst, "max" );
+			datepicker_extendRemove( inst.settings, settings );
+
+			// reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+			if ( minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined ) {
+				inst.settings.minDate = this._formatDate( inst, minDate );
+			}
+			if ( maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined ) {
+				inst.settings.maxDate = this._formatDate( inst, maxDate );
+			}
+			if ( "disabled" in settings ) {
+				if ( settings.disabled ) {
+					this._disableDatepicker( target );
+				} else {
+					this._enableDatepicker( target );
+				}
+			}
+			this._attachments( $( target ), inst );
+			this._autoSize( inst );
+			this._setDate( inst, date );
+			this._updateAlternate( inst );
+			this._updateDatepicker( inst );
+		}
+	},
+
+	// Change method deprecated
+	_changeDatepicker: function( target, name, value ) {
+		this._optionDatepicker( target, name, value );
+	},
+
+	/* Redraw the date picker attached to an input field or division.
+	 * @param  target  element - the target input field or division or span
+	 */
+	_refreshDatepicker: function( target ) {
+		var inst = this._getInst( target );
+		if ( inst ) {
+			this._updateDatepicker( inst );
+		}
+	},
+
+	/* Set the dates for a jQuery selection.
+	 * @param  target element - the target input field or division or span
+	 * @param  date	Date - the new date
+	 */
+	_setDateDatepicker: function( target, date ) {
+		var inst = this._getInst( target );
+		if ( inst ) {
+			this._setDate( inst, date );
+			this._updateDatepicker( inst );
+			this._updateAlternate( inst );
+		}
+	},
+
+	/* Get the date(s) for the first entry in a jQuery selection.
+	 * @param  target element - the target input field or division or span
+	 * @param  noDefault boolean - true if no default date is to be used
+	 * @return Date - the current date
+	 */
+	_getDateDatepicker: function( target, noDefault ) {
+		var inst = this._getInst( target );
+		if ( inst && !inst.inline ) {
+			this._setDateFromField( inst, noDefault );
+		}
+		return ( inst ? this._getDate( inst ) : null );
+	},
+
+	/* Handle keystrokes. */
+	_doKeyDown: function( event ) {
+		var onSelect, dateStr, sel,
+			inst = $.datepicker._getInst( event.target ),
+			handled = true,
+			isRTL = inst.dpDiv.is( ".ui-datepicker-rtl" );
+
+		inst._keyEvent = true;
+		if ( $.datepicker._datepickerShowing ) {
+			switch ( event.keyCode ) {
+				case 9: $.datepicker._hideDatepicker();
+						handled = false;
+						break; // hide on tab out
+				case 13: sel = $( "td." + $.datepicker._dayOverClass + ":not(." +
+									$.datepicker._currentClass + ")", inst.dpDiv );
+						if ( sel[ 0 ] ) {
+							$.datepicker._selectDay( event.target, inst.selectedMonth, inst.selectedYear, sel[ 0 ] );
+						}
+
+						onSelect = $.datepicker._get( inst, "onSelect" );
+						if ( onSelect ) {
+							dateStr = $.datepicker._formatDate( inst );
+
+							// Trigger custom callback
+							onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] );
+						} else {
+							$.datepicker._hideDatepicker();
+						}
+
+						return false; // don't submit the form
+				case 27: $.datepicker._hideDatepicker();
+						break; // hide on escape
+				case 33: $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+							-$.datepicker._get( inst, "stepBigMonths" ) :
+							-$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						break; // previous month/year on page up/+ ctrl
+				case 34: $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+							+$.datepicker._get( inst, "stepBigMonths" ) :
+							+$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						break; // next month/year on page down/+ ctrl
+				case 35: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._clearDate( event.target );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // clear on ctrl or command +end
+				case 36: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._gotoToday( event.target );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // current on ctrl or command +home
+				case 37: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, ( isRTL ? +1 : -1 ), "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+
+						// -1 day on ctrl or command +left
+						if ( event.originalEvent.altKey ) {
+							$.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+								-$.datepicker._get( inst, "stepBigMonths" ) :
+								-$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						}
+
+						// next month/year on alt +left on Mac
+						break;
+				case 38: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, -7, "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // -1 week on ctrl or command +up
+				case 39: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, ( isRTL ? -1 : +1 ), "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+
+						// +1 day on ctrl or command +right
+						if ( event.originalEvent.altKey ) {
+							$.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+								+$.datepicker._get( inst, "stepBigMonths" ) :
+								+$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						}
+
+						// next month/year on alt +right
+						break;
+				case 40: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, +7, "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // +1 week on ctrl or command +down
+				default: handled = false;
+			}
+		} else if ( event.keyCode === 36 && event.ctrlKey ) { // display the date picker on ctrl+home
+			$.datepicker._showDatepicker( this );
+		} else {
+			handled = false;
+		}
+
+		if ( handled ) {
+			event.preventDefault();
+			event.stopPropagation();
+		}
+	},
+
+	/* Filter entered characters - based on date format. */
+	_doKeyPress: function( event ) {
+		var chars, chr,
+			inst = $.datepicker._getInst( event.target );
+
+		if ( $.datepicker._get( inst, "constrainInput" ) ) {
+			chars = $.datepicker._possibleChars( $.datepicker._get( inst, "dateFormat" ) );
+			chr = String.fromCharCode( event.charCode == null ? event.keyCode : event.charCode );
+			return event.ctrlKey || event.metaKey || ( chr < " " || !chars || chars.indexOf( chr ) > -1 );
+		}
+	},
+
+	/* Synchronise manual entry and field/alternate field. */
+	_doKeyUp: function( event ) {
+		var date,
+			inst = $.datepicker._getInst( event.target );
+
+		if ( inst.input.val() !== inst.lastVal ) {
+			try {
+				date = $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ),
+					( inst.input ? inst.input.val() : null ),
+					$.datepicker._getFormatConfig( inst ) );
+
+				if ( date ) { // only if valid
+					$.datepicker._setDateFromField( inst );
+					$.datepicker._updateAlternate( inst );
+					$.datepicker._updateDatepicker( inst );
+				}
+			}
+			catch ( err ) {
+			}
+		}
+		return true;
+	},
+
+	/* Pop-up the date picker for a given input field.
+	 * If false returned from beforeShow event handler do not show.
+	 * @param  input  element - the input field attached to the date picker or
+	 *					event - if triggered by focus
+	 */
+	_showDatepicker: function( input ) {
+		input = input.target || input;
+		if ( input.nodeName.toLowerCase() !== "input" ) { // find from button/image trigger
+			input = $( "input", input.parentNode )[ 0 ];
+		}
+
+		if ( $.datepicker._isDisabledDatepicker( input ) || $.datepicker._lastInput === input ) { // already here
+			return;
+		}
+
+		var inst, beforeShow, beforeShowSettings, isFixed,
+			offset, showAnim, duration;
+
+		inst = $.datepicker._getInst( input );
+		if ( $.datepicker._curInst && $.datepicker._curInst !== inst ) {
+			$.datepicker._curInst.dpDiv.stop( true, true );
+			if ( inst && $.datepicker._datepickerShowing ) {
+				$.datepicker._hideDatepicker( $.datepicker._curInst.input[ 0 ] );
+			}
+		}
+
+		beforeShow = $.datepicker._get( inst, "beforeShow" );
+		beforeShowSettings = beforeShow ? beforeShow.apply( input, [ input, inst ] ) : {};
+		if ( beforeShowSettings === false ) {
+			return;
+		}
+		datepicker_extendRemove( inst.settings, beforeShowSettings );
+
+		inst.lastVal = null;
+		$.datepicker._lastInput = input;
+		$.datepicker._setDateFromField( inst );
+
+		if ( $.datepicker._inDialog ) { // hide cursor
+			input.value = "";
+		}
+		if ( !$.datepicker._pos ) { // position below input
+			$.datepicker._pos = $.datepicker._findPos( input );
+			$.datepicker._pos[ 1 ] += input.offsetHeight; // add the height
+		}
+
+		isFixed = false;
+		$( input ).parents().each( function() {
+			isFixed |= $( this ).css( "position" ) === "fixed";
+			return !isFixed;
+		} );
+
+		offset = { left: $.datepicker._pos[ 0 ], top: $.datepicker._pos[ 1 ] };
+		$.datepicker._pos = null;
+
+		//to avoid flashes on Firefox
+		inst.dpDiv.empty();
+
+		// determine sizing offscreen
+		inst.dpDiv.css( { position: "absolute", display: "block", top: "-1000px" } );
+		$.datepicker._updateDatepicker( inst );
+
+		// fix width for dynamic number of date pickers
+		// and adjust position before showing
+		offset = $.datepicker._checkOffset( inst, offset, isFixed );
+		inst.dpDiv.css( { position: ( $.datepicker._inDialog && $.blockUI ?
+			"static" : ( isFixed ? "fixed" : "absolute" ) ), display: "none",
+			left: offset.left + "px", top: offset.top + "px" } );
+
+		if ( !inst.inline ) {
+			showAnim = $.datepicker._get( inst, "showAnim" );
+			duration = $.datepicker._get( inst, "duration" );
+			inst.dpDiv.css( "z-index", datepicker_getZindex( $( input ) ) + 1 );
+			$.datepicker._datepickerShowing = true;
+
+			if ( $.effects && $.effects.effect[ showAnim ] ) {
+				inst.dpDiv.show( showAnim, $.datepicker._get( inst, "showOptions" ), duration );
+			} else {
+				inst.dpDiv[ showAnim || "show" ]( showAnim ? duration : null );
+			}
+
+			if ( $.datepicker._shouldFocusInput( inst ) ) {
+				inst.input.trigger( "focus" );
+			}
+
+			$.datepicker._curInst = inst;
+		}
+	},
+
+	/* Generate the date picker content. */
+	_updateDatepicker: function( inst ) {
+		this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+		datepicker_instActive = inst; // for delegate hover events
+		inst.dpDiv.empty().append( this._generateHTML( inst ) );
+		this._attachHandlers( inst );
+
+		var origyearshtml,
+			numMonths = this._getNumberOfMonths( inst ),
+			cols = numMonths[ 1 ],
+			width = 17,
+			activeCell = inst.dpDiv.find( "." + this._dayOverClass + " a" );
+
+		if ( activeCell.length > 0 ) {
+			datepicker_handleMouseover.apply( activeCell.get( 0 ) );
+		}
+
+		inst.dpDiv.removeClass( "ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4" ).width( "" );
+		if ( cols > 1 ) {
+			inst.dpDiv.addClass( "ui-datepicker-multi-" + cols ).css( "width", ( width * cols ) + "em" );
+		}
+		inst.dpDiv[ ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ? "add" : "remove" ) +
+			"Class" ]( "ui-datepicker-multi" );
+		inst.dpDiv[ ( this._get( inst, "isRTL" ) ? "add" : "remove" ) +
+			"Class" ]( "ui-datepicker-rtl" );
+
+		if ( inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput( inst ) ) {
+			inst.input.trigger( "focus" );
+		}
+
+		// Deffered render of the years select (to avoid flashes on Firefox)
+		if ( inst.yearshtml ) {
+			origyearshtml = inst.yearshtml;
+			setTimeout( function() {
+
+				//assure that inst.yearshtml didn't change.
+				if ( origyearshtml === inst.yearshtml && inst.yearshtml ) {
+					inst.dpDiv.find( "select.ui-datepicker-year:first" ).replaceWith( inst.yearshtml );
+				}
+				origyearshtml = inst.yearshtml = null;
+			}, 0 );
+		}
+	},
+
+	// #6694 - don't focus the input if it's already focused
+	// this breaks the change event in IE
+	// Support: IE and jQuery <1.9
+	_shouldFocusInput: function( inst ) {
+		return inst.input && inst.input.is( ":visible" ) && !inst.input.is( ":disabled" ) && !inst.input.is( ":focus" );
+	},
+
+	/* Check positioning to remain on screen. */
+	_checkOffset: function( inst, offset, isFixed ) {
+		var dpWidth = inst.dpDiv.outerWidth(),
+			dpHeight = inst.dpDiv.outerHeight(),
+			inputWidth = inst.input ? inst.input.outerWidth() : 0,
+			inputHeight = inst.input ? inst.input.outerHeight() : 0,
+			viewWidth = document.documentElement.clientWidth + ( isFixed ? 0 : $( document ).scrollLeft() ),
+			viewHeight = document.documentElement.clientHeight + ( isFixed ? 0 : $( document ).scrollTop() );
+
+		offset.left -= ( this._get( inst, "isRTL" ) ? ( dpWidth - inputWidth ) : 0 );
+		offset.left -= ( isFixed && offset.left === inst.input.offset().left ) ? $( document ).scrollLeft() : 0;
+		offset.top -= ( isFixed && offset.top === ( inst.input.offset().top + inputHeight ) ) ? $( document ).scrollTop() : 0;
+
+		// Now check if datepicker is showing outside window viewport - move to a better place if so.
+		offset.left -= Math.min( offset.left, ( offset.left + dpWidth > viewWidth && viewWidth > dpWidth ) ?
+			Math.abs( offset.left + dpWidth - viewWidth ) : 0 );
+		offset.top -= Math.min( offset.top, ( offset.top + dpHeight > viewHeight && viewHeight > dpHeight ) ?
+			Math.abs( dpHeight + inputHeight ) : 0 );
+
+		return offset;
+	},
+
+	/* Find an object's position on the screen. */
+	_findPos: function( obj ) {
+		var position,
+			inst = this._getInst( obj ),
+			isRTL = this._get( inst, "isRTL" );
+
+		while ( obj && ( obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden( obj ) ) ) {
+			obj = obj[ isRTL ? "previousSibling" : "nextSibling" ];
+		}
+
+		position = $( obj ).offset();
+		return [ position.left, position.top ];
+	},
+
+	/* Hide the date picker from view.
+	 * @param  input  element - the input field attached to the date picker
+	 */
+	_hideDatepicker: function( input ) {
+		var showAnim, duration, postProcess, onClose,
+			inst = this._curInst;
+
+		if ( !inst || ( input && inst !== $.data( input, "datepicker" ) ) ) {
+			return;
+		}
+
+		if ( this._datepickerShowing ) {
+			showAnim = this._get( inst, "showAnim" );
+			duration = this._get( inst, "duration" );
+			postProcess = function() {
+				$.datepicker._tidyDialog( inst );
+			};
+
+			// DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+			if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) {
+				inst.dpDiv.hide( showAnim, $.datepicker._get( inst, "showOptions" ), duration, postProcess );
+			} else {
+				inst.dpDiv[ ( showAnim === "slideDown" ? "slideUp" :
+					( showAnim === "fadeIn" ? "fadeOut" : "hide" ) ) ]( ( showAnim ? duration : null ), postProcess );
+			}
+
+			if ( !showAnim ) {
+				postProcess();
+			}
+			this._datepickerShowing = false;
+
+			onClose = this._get( inst, "onClose" );
+			if ( onClose ) {
+				onClose.apply( ( inst.input ? inst.input[ 0 ] : null ), [ ( inst.input ? inst.input.val() : "" ), inst ] );
+			}
+
+			this._lastInput = null;
+			if ( this._inDialog ) {
+				this._dialogInput.css( { position: "absolute", left: "0", top: "-100px" } );
+				if ( $.blockUI ) {
+					$.unblockUI();
+					$( "body" ).append( this.dpDiv );
+				}
+			}
+			this._inDialog = false;
+		}
+	},
+
+	/* Tidy up after a dialog display. */
+	_tidyDialog: function( inst ) {
+		inst.dpDiv.removeClass( this._dialogClass ).off( ".ui-datepicker-calendar" );
+	},
+
+	/* Close date picker if clicked elsewhere. */
+	_checkExternalClick: function( event ) {
+		if ( !$.datepicker._curInst ) {
+			return;
+		}
+
+		var $target = $( event.target ),
+			inst = $.datepicker._getInst( $target[ 0 ] );
+
+		if ( ( ( $target[ 0 ].id !== $.datepicker._mainDivId &&
+				$target.parents( "#" + $.datepicker._mainDivId ).length === 0 &&
+				!$target.hasClass( $.datepicker.markerClassName ) &&
+				!$target.closest( "." + $.datepicker._triggerClass ).length &&
+				$.datepicker._datepickerShowing && !( $.datepicker._inDialog && $.blockUI ) ) ) ||
+			( $target.hasClass( $.datepicker.markerClassName ) && $.datepicker._curInst !== inst ) ) {
+				$.datepicker._hideDatepicker();
+		}
+	},
+
+	/* Adjust one of the date sub-fields. */
+	_adjustDate: function( id, offset, period ) {
+		var target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		if ( this._isDisabledDatepicker( target[ 0 ] ) ) {
+			return;
+		}
+		this._adjustInstDate( inst, offset +
+			( period === "M" ? this._get( inst, "showCurrentAtPos" ) : 0 ), // undo positioning
+			period );
+		this._updateDatepicker( inst );
+	},
+
+	/* Action for current link. */
+	_gotoToday: function( id ) {
+		var date,
+			target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		if ( this._get( inst, "gotoCurrent" ) && inst.currentDay ) {
+			inst.selectedDay = inst.currentDay;
+			inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+			inst.drawYear = inst.selectedYear = inst.currentYear;
+		} else {
+			date = new Date();
+			inst.selectedDay = date.getDate();
+			inst.drawMonth = inst.selectedMonth = date.getMonth();
+			inst.drawYear = inst.selectedYear = date.getFullYear();
+		}
+		this._notifyChange( inst );
+		this._adjustDate( target );
+	},
+
+	/* Action for selecting a new month/year. */
+	_selectMonthYear: function( id, select, period ) {
+		var target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		inst[ "selected" + ( period === "M" ? "Month" : "Year" ) ] =
+		inst[ "draw" + ( period === "M" ? "Month" : "Year" ) ] =
+			parseInt( select.options[ select.selectedIndex ].value, 10 );
+
+		this._notifyChange( inst );
+		this._adjustDate( target );
+	},
+
+	/* Action for selecting a day. */
+	_selectDay: function( id, month, year, td ) {
+		var inst,
+			target = $( id );
+
+		if ( $( td ).hasClass( this._unselectableClass ) || this._isDisabledDatepicker( target[ 0 ] ) ) {
+			return;
+		}
+
+		inst = this._getInst( target[ 0 ] );
+		inst.selectedDay = inst.currentDay = $( "a", td ).html();
+		inst.selectedMonth = inst.currentMonth = month;
+		inst.selectedYear = inst.currentYear = year;
+		this._selectDate( id, this._formatDate( inst,
+			inst.currentDay, inst.currentMonth, inst.currentYear ) );
+	},
+
+	/* Erase the input field and hide the date picker. */
+	_clearDate: function( id ) {
+		var target = $( id );
+		this._selectDate( target, "" );
+	},
+
+	/* Update the input field with the selected date. */
+	_selectDate: function( id, dateStr ) {
+		var onSelect,
+			target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		dateStr = ( dateStr != null ? dateStr : this._formatDate( inst ) );
+		if ( inst.input ) {
+			inst.input.val( dateStr );
+		}
+		this._updateAlternate( inst );
+
+		onSelect = this._get( inst, "onSelect" );
+		if ( onSelect ) {
+			onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] );  // trigger custom callback
+		} else if ( inst.input ) {
+			inst.input.trigger( "change" ); // fire the change event
+		}
+
+		if ( inst.inline ) {
+			this._updateDatepicker( inst );
+		} else {
+			this._hideDatepicker();
+			this._lastInput = inst.input[ 0 ];
+			if ( typeof( inst.input[ 0 ] ) !== "object" ) {
+				inst.input.trigger( "focus" ); // restore focus
+			}
+			this._lastInput = null;
+		}
+	},
+
+	/* Update any alternate field to synchronise with the main field. */
+	_updateAlternate: function( inst ) {
+		var altFormat, date, dateStr,
+			altField = this._get( inst, "altField" );
+
+		if ( altField ) { // update alternate field too
+			altFormat = this._get( inst, "altFormat" ) || this._get( inst, "dateFormat" );
+			date = this._getDate( inst );
+			dateStr = this.formatDate( altFormat, date, this._getFormatConfig( inst ) );
+			$( altField ).val( dateStr );
+		}
+	},
+
+	/* Set as beforeShowDay function to prevent selection of weekends.
+	 * @param  date  Date - the date to customise
+	 * @return [boolean, string] - is this date selectable?, what is its CSS class?
+	 */
+	noWeekends: function( date ) {
+		var day = date.getDay();
+		return [ ( day > 0 && day < 6 ), "" ];
+	},
+
+	/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+	 * @param  date  Date - the date to get the week for
+	 * @return  number - the number of the week within the year that contains this date
+	 */
+	iso8601Week: function( date ) {
+		var time,
+			checkDate = new Date( date.getTime() );
+
+		// Find Thursday of this week starting on Monday
+		checkDate.setDate( checkDate.getDate() + 4 - ( checkDate.getDay() || 7 ) );
+
+		time = checkDate.getTime();
+		checkDate.setMonth( 0 ); // Compare with Jan 1
+		checkDate.setDate( 1 );
+		return Math.floor( Math.round( ( time - checkDate ) / 86400000 ) / 7 ) + 1;
+	},
+
+	/* Parse a string value into a date object.
+	 * See formatDate below for the possible formats.
+	 *
+	 * @param  format string - the expected format of the date
+	 * @param  value string - the date in the above format
+	 * @param  settings Object - attributes include:
+	 *					shortYearCutoff  number - the cutoff year for determining the century (optional)
+	 *					dayNamesShort	string[7] - abbreviated names of the days from Sunday (optional)
+	 *					dayNames		string[7] - names of the days from Sunday (optional)
+	 *					monthNamesShort string[12] - abbreviated names of the months (optional)
+	 *					monthNames		string[12] - names of the months (optional)
+	 * @return  Date - the extracted date value or null if value is blank
+	 */
+	parseDate: function( format, value, settings ) {
+		if ( format == null || value == null ) {
+			throw "Invalid arguments";
+		}
+
+		value = ( typeof value === "object" ? value.toString() : value + "" );
+		if ( value === "" ) {
+			return null;
+		}
+
+		var iFormat, dim, extra,
+			iValue = 0,
+			shortYearCutoffTemp = ( settings ? settings.shortYearCutoff : null ) || this._defaults.shortYearCutoff,
+			shortYearCutoff = ( typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
+				new Date().getFullYear() % 100 + parseInt( shortYearCutoffTemp, 10 ) ),
+			dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort,
+			dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames,
+			monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort,
+			monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames,
+			year = -1,
+			month = -1,
+			day = -1,
+			doy = -1,
+			literal = false,
+			date,
+
+			// Check whether a format character is doubled
+			lookAhead = function( match ) {
+				var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+				if ( matches ) {
+					iFormat++;
+				}
+				return matches;
+			},
+
+			// Extract a number from the string value
+			getNumber = function( match ) {
+				var isDoubled = lookAhead( match ),
+					size = ( match === "@" ? 14 : ( match === "!" ? 20 :
+					( match === "y" && isDoubled ? 4 : ( match === "o" ? 3 : 2 ) ) ) ),
+					minSize = ( match === "y" ? size : 1 ),
+					digits = new RegExp( "^\\d{" + minSize + "," + size + "}" ),
+					num = value.substring( iValue ).match( digits );
+				if ( !num ) {
+					throw "Missing number at position " + iValue;
+				}
+				iValue += num[ 0 ].length;
+				return parseInt( num[ 0 ], 10 );
+			},
+
+			// Extract a name from the string value and convert to an index
+			getName = function( match, shortNames, longNames ) {
+				var index = -1,
+					names = $.map( lookAhead( match ) ? longNames : shortNames, function( v, k ) {
+						return [ [ k, v ] ];
+					} ).sort( function( a, b ) {
+						return -( a[ 1 ].length - b[ 1 ].length );
+					} );
+
+				$.each( names, function( i, pair ) {
+					var name = pair[ 1 ];
+					if ( value.substr( iValue, name.length ).toLowerCase() === name.toLowerCase() ) {
+						index = pair[ 0 ];
+						iValue += name.length;
+						return false;
+					}
+				} );
+				if ( index !== -1 ) {
+					return index + 1;
+				} else {
+					throw "Unknown name at position " + iValue;
+				}
+			},
+
+			// Confirm that a literal character matches the string value
+			checkLiteral = function() {
+				if ( value.charAt( iValue ) !== format.charAt( iFormat ) ) {
+					throw "Unexpected literal at position " + iValue;
+				}
+				iValue++;
+			};
+
+		for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+			if ( literal ) {
+				if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+					literal = false;
+				} else {
+					checkLiteral();
+				}
+			} else {
+				switch ( format.charAt( iFormat ) ) {
+					case "d":
+						day = getNumber( "d" );
+						break;
+					case "D":
+						getName( "D", dayNamesShort, dayNames );
+						break;
+					case "o":
+						doy = getNumber( "o" );
+						break;
+					case "m":
+						month = getNumber( "m" );
+						break;
+					case "M":
+						month = getName( "M", monthNamesShort, monthNames );
+						break;
+					case "y":
+						year = getNumber( "y" );
+						break;
+					case "@":
+						date = new Date( getNumber( "@" ) );
+						year = date.getFullYear();
+						month = date.getMonth() + 1;
+						day = date.getDate();
+						break;
+					case "!":
+						date = new Date( ( getNumber( "!" ) - this._ticksTo1970 ) / 10000 );
+						year = date.getFullYear();
+						month = date.getMonth() + 1;
+						day = date.getDate();
+						break;
+					case "'":
+						if ( lookAhead( "'" ) ) {
+							checkLiteral();
+						} else {
+							literal = true;
+						}
+						break;
+					default:
+						checkLiteral();
+				}
+			}
+		}
+
+		if ( iValue < value.length ) {
+			extra = value.substr( iValue );
+			if ( !/^\s+/.test( extra ) ) {
+				throw "Extra/unparsed characters found in date: " + extra;
+			}
+		}
+
+		if ( year === -1 ) {
+			year = new Date().getFullYear();
+		} else if ( year < 100 ) {
+			year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+				( year <= shortYearCutoff ? 0 : -100 );
+		}
+
+		if ( doy > -1 ) {
+			month = 1;
+			day = doy;
+			do {
+				dim = this._getDaysInMonth( year, month - 1 );
+				if ( day <= dim ) {
+					break;
+				}
+				month++;
+				day -= dim;
+			} while ( true );
+		}
+
+		date = this._daylightSavingAdjust( new Date( year, month - 1, day ) );
+		if ( date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day ) {
+			throw "Invalid date"; // E.g. 31/02/00
+		}
+		return date;
+	},
+
+	/* Standard date formats. */
+	ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
+	COOKIE: "D, dd M yy",
+	ISO_8601: "yy-mm-dd",
+	RFC_822: "D, d M y",
+	RFC_850: "DD, dd-M-y",
+	RFC_1036: "D, d M y",
+	RFC_1123: "D, d M yy",
+	RFC_2822: "D, d M yy",
+	RSS: "D, d M y", // RFC 822
+	TICKS: "!",
+	TIMESTAMP: "@",
+	W3C: "yy-mm-dd", // ISO 8601
+
+	_ticksTo1970: ( ( ( 1970 - 1 ) * 365 + Math.floor( 1970 / 4 ) - Math.floor( 1970 / 100 ) +
+		Math.floor( 1970 / 400 ) ) * 24 * 60 * 60 * 10000000 ),
+
+	/* Format a date object into a string value.
+	 * The format can be combinations of the following:
+	 * d  - day of month (no leading zero)
+	 * dd - day of month (two digit)
+	 * o  - day of year (no leading zeros)
+	 * oo - day of year (three digit)
+	 * D  - day name short
+	 * DD - day name long
+	 * m  - month of year (no leading zero)
+	 * mm - month of year (two digit)
+	 * M  - month name short
+	 * MM - month name long
+	 * y  - year (two digit)
+	 * yy - year (four digit)
+	 * @ - Unix timestamp (ms since 01/01/1970)
+	 * ! - Windows ticks (100ns since 01/01/0001)
+	 * "..." - literal text
+	 * '' - single quote
+	 *
+	 * @param  format string - the desired format of the date
+	 * @param  date Date - the date value to format
+	 * @param  settings Object - attributes include:
+	 *					dayNamesShort	string[7] - abbreviated names of the days from Sunday (optional)
+	 *					dayNames		string[7] - names of the days from Sunday (optional)
+	 *					monthNamesShort string[12] - abbreviated names of the months (optional)
+	 *					monthNames		string[12] - names of the months (optional)
+	 * @return  string - the date in the above format
+	 */
+	formatDate: function( format, date, settings ) {
+		if ( !date ) {
+			return "";
+		}
+
+		var iFormat,
+			dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort,
+			dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames,
+			monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort,
+			monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames,
+
+			// Check whether a format character is doubled
+			lookAhead = function( match ) {
+				var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+				if ( matches ) {
+					iFormat++;
+				}
+				return matches;
+			},
+
+			// Format a number, with leading zero if necessary
+			formatNumber = function( match, value, len ) {
+				var num = "" + value;
+				if ( lookAhead( match ) ) {
+					while ( num.length < len ) {
+						num = "0" + num;
+					}
+				}
+				return num;
+			},
+
+			// Format a name, short or long as requested
+			formatName = function( match, value, shortNames, longNames ) {
+				return ( lookAhead( match ) ? longNames[ value ] : shortNames[ value ] );
+			},
+			output = "",
+			literal = false;
+
+		if ( date ) {
+			for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+				if ( literal ) {
+					if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+						literal = false;
+					} else {
+						output += format.charAt( iFormat );
+					}
+				} else {
+					switch ( format.charAt( iFormat ) ) {
+						case "d":
+							output += formatNumber( "d", date.getDate(), 2 );
+							break;
+						case "D":
+							output += formatName( "D", date.getDay(), dayNamesShort, dayNames );
+							break;
+						case "o":
+							output += formatNumber( "o",
+								Math.round( ( new Date( date.getFullYear(), date.getMonth(), date.getDate() ).getTime() - new Date( date.getFullYear(), 0, 0 ).getTime() ) / 86400000 ), 3 );
+							break;
+						case "m":
+							output += formatNumber( "m", date.getMonth() + 1, 2 );
+							break;
+						case "M":
+							output += formatName( "M", date.getMonth(), monthNamesShort, monthNames );
+							break;
+						case "y":
+							output += ( lookAhead( "y" ) ? date.getFullYear() :
+								( date.getFullYear() % 100 < 10 ? "0" : "" ) + date.getFullYear() % 100 );
+							break;
+						case "@":
+							output += date.getTime();
+							break;
+						case "!":
+							output += date.getTime() * 10000 + this._ticksTo1970;
+							break;
+						case "'":
+							if ( lookAhead( "'" ) ) {
+								output += "'";
+							} else {
+								literal = true;
+							}
+							break;
+						default:
+							output += format.charAt( iFormat );
+					}
+				}
+			}
+		}
+		return output;
+	},
+
+	/* Extract all possible characters from the date format. */
+	_possibleChars: function( format ) {
+		var iFormat,
+			chars = "",
+			literal = false,
+
+			// Check whether a format character is doubled
+			lookAhead = function( match ) {
+				var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+				if ( matches ) {
+					iFormat++;
+				}
+				return matches;
+			};
+
+		for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+			if ( literal ) {
+				if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+					literal = false;
+				} else {
+					chars += format.charAt( iFormat );
+				}
+			} else {
+				switch ( format.charAt( iFormat ) ) {
+					case "d": case "m": case "y": case "@":
+						chars += "0123456789";
+						break;
+					case "D": case "M":
+						return null; // Accept anything
+					case "'":
+						if ( lookAhead( "'" ) ) {
+							chars += "'";
+						} else {
+							literal = true;
+						}
+						break;
+					default:
+						chars += format.charAt( iFormat );
+				}
+			}
+		}
+		return chars;
+	},
+
+	/* Get a setting value, defaulting if necessary. */
+	_get: function( inst, name ) {
+		return inst.settings[ name ] !== undefined ?
+			inst.settings[ name ] : this._defaults[ name ];
+	},
+
+	/* Parse existing date and initialise date picker. */
+	_setDateFromField: function( inst, noDefault ) {
+		if ( inst.input.val() === inst.lastVal ) {
+			return;
+		}
+
+		var dateFormat = this._get( inst, "dateFormat" ),
+			dates = inst.lastVal = inst.input ? inst.input.val() : null,
+			defaultDate = this._getDefaultDate( inst ),
+			date = defaultDate,
+			settings = this._getFormatConfig( inst );
+
+		try {
+			date = this.parseDate( dateFormat, dates, settings ) || defaultDate;
+		} catch ( event ) {
+			dates = ( noDefault ? "" : dates );
+		}
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		inst.currentDay = ( dates ? date.getDate() : 0 );
+		inst.currentMonth = ( dates ? date.getMonth() : 0 );
+		inst.currentYear = ( dates ? date.getFullYear() : 0 );
+		this._adjustInstDate( inst );
+	},
+
+	/* Retrieve the default date shown on opening. */
+	_getDefaultDate: function( inst ) {
+		return this._restrictMinMax( inst,
+			this._determineDate( inst, this._get( inst, "defaultDate" ), new Date() ) );
+	},
+
+	/* A date may be specified as an exact value or a relative one. */
+	_determineDate: function( inst, date, defaultDate ) {
+		var offsetNumeric = function( offset ) {
+				var date = new Date();
+				date.setDate( date.getDate() + offset );
+				return date;
+			},
+			offsetString = function( offset ) {
+				try {
+					return $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ),
+						offset, $.datepicker._getFormatConfig( inst ) );
+				}
+				catch ( e ) {
+
+					// Ignore
+				}
+
+				var date = ( offset.toLowerCase().match( /^c/ ) ?
+					$.datepicker._getDate( inst ) : null ) || new Date(),
+					year = date.getFullYear(),
+					month = date.getMonth(),
+					day = date.getDate(),
+					pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
+					matches = pattern.exec( offset );
+
+				while ( matches ) {
+					switch ( matches[ 2 ] || "d" ) {
+						case "d" : case "D" :
+							day += parseInt( matches[ 1 ], 10 ); break;
+						case "w" : case "W" :
+							day += parseInt( matches[ 1 ], 10 ) * 7; break;
+						case "m" : case "M" :
+							month += parseInt( matches[ 1 ], 10 );
+							day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) );
+							break;
+						case "y": case "Y" :
+							year += parseInt( matches[ 1 ], 10 );
+							day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) );
+							break;
+					}
+					matches = pattern.exec( offset );
+				}
+				return new Date( year, month, day );
+			},
+			newDate = ( date == null || date === "" ? defaultDate : ( typeof date === "string" ? offsetString( date ) :
+				( typeof date === "number" ? ( isNaN( date ) ? defaultDate : offsetNumeric( date ) ) : new Date( date.getTime() ) ) ) );
+
+		newDate = ( newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate );
+		if ( newDate ) {
+			newDate.setHours( 0 );
+			newDate.setMinutes( 0 );
+			newDate.setSeconds( 0 );
+			newDate.setMilliseconds( 0 );
+		}
+		return this._daylightSavingAdjust( newDate );
+	},
+
+	/* Handle switch to/from daylight saving.
+	 * Hours may be non-zero on daylight saving cut-over:
+	 * > 12 when midnight changeover, but then cannot generate
+	 * midnight datetime, so jump to 1AM, otherwise reset.
+	 * @param  date  (Date) the date to check
+	 * @return  (Date) the corrected date
+	 */
+	_daylightSavingAdjust: function( date ) {
+		if ( !date ) {
+			return null;
+		}
+		date.setHours( date.getHours() > 12 ? date.getHours() + 2 : 0 );
+		return date;
+	},
+
+	/* Set the date(s) directly. */
+	_setDate: function( inst, date, noChange ) {
+		var clear = !date,
+			origMonth = inst.selectedMonth,
+			origYear = inst.selectedYear,
+			newDate = this._restrictMinMax( inst, this._determineDate( inst, date, new Date() ) );
+
+		inst.selectedDay = inst.currentDay = newDate.getDate();
+		inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+		inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+		if ( ( origMonth !== inst.selectedMonth || origYear !== inst.selectedYear ) && !noChange ) {
+			this._notifyChange( inst );
+		}
+		this._adjustInstDate( inst );
+		if ( inst.input ) {
+			inst.input.val( clear ? "" : this._formatDate( inst ) );
+		}
+	},
+
+	/* Retrieve the date(s) directly. */
+	_getDate: function( inst ) {
+		var startDate = ( !inst.currentYear || ( inst.input && inst.input.val() === "" ) ? null :
+			this._daylightSavingAdjust( new Date(
+			inst.currentYear, inst.currentMonth, inst.currentDay ) ) );
+			return startDate;
+	},
+
+	/* Attach the onxxx handlers.  These are declared statically so
+	 * they work with static code transformers like Caja.
+	 */
+	_attachHandlers: function( inst ) {
+		var stepMonths = this._get( inst, "stepMonths" ),
+			id = "#" + inst.id.replace( /\\\\/g, "\\" );
+		inst.dpDiv.find( "[data-handler]" ).map( function() {
+			var handler = {
+				prev: function() {
+					$.datepicker._adjustDate( id, -stepMonths, "M" );
+				},
+				next: function() {
+					$.datepicker._adjustDate( id, +stepMonths, "M" );
+				},
+				hide: function() {
+					$.datepicker._hideDatepicker();
+				},
+				today: function() {
+					$.datepicker._gotoToday( id );
+				},
+				selectDay: function() {
+					$.datepicker._selectDay( id, +this.getAttribute( "data-month" ), +this.getAttribute( "data-year" ), this );
+					return false;
+				},
+				selectMonth: function() {
+					$.datepicker._selectMonthYear( id, this, "M" );
+					return false;
+				},
+				selectYear: function() {
+					$.datepicker._selectMonthYear( id, this, "Y" );
+					return false;
+				}
+			};
+			$( this ).on( this.getAttribute( "data-event" ), handler[ this.getAttribute( "data-handler" ) ] );
+		} );
+	},
+
+	/* Generate the HTML for the current state of the date picker. */
+	_generateHTML: function( inst ) {
+		var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
+			controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
+			monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
+			selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
+			cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
+			printDate, dRow, tbody, daySettings, otherMonth, unselectable,
+			tempDate = new Date(),
+			today = this._daylightSavingAdjust(
+				new Date( tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate() ) ), // clear time
+			isRTL = this._get( inst, "isRTL" ),
+			showButtonPanel = this._get( inst, "showButtonPanel" ),
+			hideIfNoPrevNext = this._get( inst, "hideIfNoPrevNext" ),
+			navigationAsDateFormat = this._get( inst, "navigationAsDateFormat" ),
+			numMonths = this._getNumberOfMonths( inst ),
+			showCurrentAtPos = this._get( inst, "showCurrentAtPos" ),
+			stepMonths = this._get( inst, "stepMonths" ),
+			isMultiMonth = ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ),
+			currentDate = this._daylightSavingAdjust( ( !inst.currentDay ? new Date( 9999, 9, 9 ) :
+				new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) ),
+			minDate = this._getMinMaxDate( inst, "min" ),
+			maxDate = this._getMinMaxDate( inst, "max" ),
+			drawMonth = inst.drawMonth - showCurrentAtPos,
+			drawYear = inst.drawYear;
+
+		if ( drawMonth < 0 ) {
+			drawMonth += 12;
+			drawYear--;
+		}
+		if ( maxDate ) {
+			maxDraw = this._daylightSavingAdjust( new Date( maxDate.getFullYear(),
+				maxDate.getMonth() - ( numMonths[ 0 ] * numMonths[ 1 ] ) + 1, maxDate.getDate() ) );
+			maxDraw = ( minDate && maxDraw < minDate ? minDate : maxDraw );
+			while ( this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 ) ) > maxDraw ) {
+				drawMonth--;
+				if ( drawMonth < 0 ) {
+					drawMonth = 11;
+					drawYear--;
+				}
+			}
+		}
+		inst.drawMonth = drawMonth;
+		inst.drawYear = drawYear;
+
+		prevText = this._get( inst, "prevText" );
+		prevText = ( !navigationAsDateFormat ? prevText : this.formatDate( prevText,
+			this._daylightSavingAdjust( new Date( drawYear, drawMonth - stepMonths, 1 ) ),
+			this._getFormatConfig( inst ) ) );
+
+		prev = ( this._canAdjustMonth( inst, -1, drawYear, drawMonth ) ?
+			"<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
+			" title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" :
+			( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" ) );
+
+		nextText = this._get( inst, "nextText" );
+		nextText = ( !navigationAsDateFormat ? nextText : this.formatDate( nextText,
+			this._daylightSavingAdjust( new Date( drawYear, drawMonth + stepMonths, 1 ) ),
+			this._getFormatConfig( inst ) ) );
+
+		next = ( this._canAdjustMonth( inst, +1, drawYear, drawMonth ) ?
+			"<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
+			" title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" :
+			( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" ) );
+
+		currentText = this._get( inst, "currentText" );
+		gotoDate = ( this._get( inst, "gotoCurrent" ) && inst.currentDay ? currentDate : today );
+		currentText = ( !navigationAsDateFormat ? currentText :
+			this.formatDate( currentText, gotoDate, this._getFormatConfig( inst ) ) );
+
+		controls = ( !inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
+			this._get( inst, "closeText" ) + "</button>" : "" );
+
+		buttonPanel = ( showButtonPanel ) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + ( isRTL ? controls : "" ) +
+			( this._isInRange( inst, gotoDate ) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
+			">" + currentText + "</button>" : "" ) + ( isRTL ? "" : controls ) + "</div>" : "";
+
+		firstDay = parseInt( this._get( inst, "firstDay" ), 10 );
+		firstDay = ( isNaN( firstDay ) ? 0 : firstDay );
+
+		showWeek = this._get( inst, "showWeek" );
+		dayNames = this._get( inst, "dayNames" );
+		dayNamesMin = this._get( inst, "dayNamesMin" );
+		monthNames = this._get( inst, "monthNames" );
+		monthNamesShort = this._get( inst, "monthNamesShort" );
+		beforeShowDay = this._get( inst, "beforeShowDay" );
+		showOtherMonths = this._get( inst, "showOtherMonths" );
+		selectOtherMonths = this._get( inst, "selectOtherMonths" );
+		defaultDate = this._getDefaultDate( inst );
+		html = "";
+
+		for ( row = 0; row < numMonths[ 0 ]; row++ ) {
+			group = "";
+			this.maxRows = 4;
+			for ( col = 0; col < numMonths[ 1 ]; col++ ) {
+				selectedDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, inst.selectedDay ) );
+				cornerClass = " ui-corner-all";
+				calender = "";
+				if ( isMultiMonth ) {
+					calender += "<div class='ui-datepicker-group";
+					if ( numMonths[ 1 ] > 1 ) {
+						switch ( col ) {
+							case 0: calender += " ui-datepicker-group-first";
+								cornerClass = " ui-corner-" + ( isRTL ? "right" : "left" ); break;
+							case numMonths[ 1 ] - 1: calender += " ui-datepicker-group-last";
+								cornerClass = " ui-corner-" + ( isRTL ? "left" : "right" ); break;
+							default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break;
+						}
+					}
+					calender += "'>";
+				}
+				calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
+					( /all|left/.test( cornerClass ) && row === 0 ? ( isRTL ? next : prev ) : "" ) +
+					( /all|right/.test( cornerClass ) && row === 0 ? ( isRTL ? prev : next ) : "" ) +
+					this._generateMonthYearHeader( inst, drawMonth, drawYear, minDate, maxDate,
+					row > 0 || col > 0, monthNames, monthNamesShort ) + // draw month headers
+					"</div><table class='ui-datepicker-calendar'><thead>" +
+					"<tr>";
+				thead = ( showWeek ? "<th class='ui-datepicker-week-col'>" + this._get( inst, "weekHeader" ) + "</th>" : "" );
+				for ( dow = 0; dow < 7; dow++ ) { // days of the week
+					day = ( dow + firstDay ) % 7;
+					thead += "<th scope='col'" + ( ( dow + firstDay + 6 ) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "" ) + ">" +
+						"<span title='" + dayNames[ day ] + "'>" + dayNamesMin[ day ] + "</span></th>";
+				}
+				calender += thead + "</tr></thead><tbody>";
+				daysInMonth = this._getDaysInMonth( drawYear, drawMonth );
+				if ( drawYear === inst.selectedYear && drawMonth === inst.selectedMonth ) {
+					inst.selectedDay = Math.min( inst.selectedDay, daysInMonth );
+				}
+				leadDays = ( this._getFirstDayOfMonth( drawYear, drawMonth ) - firstDay + 7 ) % 7;
+				curRows = Math.ceil( ( leadDays + daysInMonth ) / 7 ); // calculate the number of rows to generate
+				numRows = ( isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows ); //If multiple months, use the higher number of rows (see #7043)
+				this.maxRows = numRows;
+				printDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 - leadDays ) );
+				for ( dRow = 0; dRow < numRows; dRow++ ) { // create date picker rows
+					calender += "<tr>";
+					tbody = ( !showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
+						this._get( inst, "calculateWeek" )( printDate ) + "</td>" );
+					for ( dow = 0; dow < 7; dow++ ) { // create date picker days
+						daySettings = ( beforeShowDay ?
+							beforeShowDay.apply( ( inst.input ? inst.input[ 0 ] : null ), [ printDate ] ) : [ true, "" ] );
+						otherMonth = ( printDate.getMonth() !== drawMonth );
+						unselectable = ( otherMonth && !selectOtherMonths ) || !daySettings[ 0 ] ||
+							( minDate && printDate < minDate ) || ( maxDate && printDate > maxDate );
+						tbody += "<td class='" +
+							( ( dow + firstDay + 6 ) % 7 >= 5 ? " ui-datepicker-week-end" : "" ) + // highlight weekends
+							( otherMonth ? " ui-datepicker-other-month" : "" ) + // highlight days from other months
+							( ( printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent ) || // user pressed key
+							( defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime() ) ?
+
+							// or defaultDate is current printedDate and defaultDate is selectedDate
+							" " + this._dayOverClass : "" ) + // highlight selected day
+							( unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "" ) +  // highlight unselectable days
+							( otherMonth && !showOtherMonths ? "" : " " + daySettings[ 1 ] + // highlight custom dates
+							( printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "" ) + // highlight selected day
+							( printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "" ) ) + "'" + // highlight today (if different)
+							( ( !otherMonth || showOtherMonths ) && daySettings[ 2 ] ? " title='" + daySettings[ 2 ].replace( /'/g, "&#39;" ) + "'" : "" ) + // cell title
+							( unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'" ) + ">" + // actions
+							( otherMonth && !showOtherMonths ? "&#xa0;" : // display for other months
+							( unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
+							( printDate.getTime() === today.getTime() ? " ui-state-highlight" : "" ) +
+							( printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "" ) + // highlight selected day
+							( otherMonth ? " ui-priority-secondary" : "" ) + // distinguish dates from other months
+							"' href='#'>" + printDate.getDate() + "</a>" ) ) + "</td>"; // display selectable date
+						printDate.setDate( printDate.getDate() + 1 );
+						printDate = this._daylightSavingAdjust( printDate );
+					}
+					calender += tbody + "</tr>";
+				}
+				drawMonth++;
+				if ( drawMonth > 11 ) {
+					drawMonth = 0;
+					drawYear++;
+				}
+				calender += "</tbody></table>" + ( isMultiMonth ? "</div>" +
+							( ( numMonths[ 0 ] > 0 && col === numMonths[ 1 ] - 1 ) ? "<div class='ui-datepicker-row-break'></div>" : "" ) : "" );
+				group += calender;
+			}
+			html += group;
+		}
+		html += buttonPanel;
+		inst._keyEvent = false;
+		return html;
+	},
+
+	/* Generate the month and year header. */
+	_generateMonthYearHeader: function( inst, drawMonth, drawYear, minDate, maxDate,
+			secondary, monthNames, monthNamesShort ) {
+
+		var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
+			changeMonth = this._get( inst, "changeMonth" ),
+			changeYear = this._get( inst, "changeYear" ),
+			showMonthAfterYear = this._get( inst, "showMonthAfterYear" ),
+			html = "<div class='ui-datepicker-title'>",
+			monthHtml = "";
+
+		// Month selection
+		if ( secondary || !changeMonth ) {
+			monthHtml += "<span class='ui-datepicker-month'>" + monthNames[ drawMonth ] + "</span>";
+		} else {
+			inMinYear = ( minDate && minDate.getFullYear() === drawYear );
+			inMaxYear = ( maxDate && maxDate.getFullYear() === drawYear );
+			monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
+			for ( month = 0; month < 12; month++ ) {
+				if ( ( !inMinYear || month >= minDate.getMonth() ) && ( !inMaxYear || month <= maxDate.getMonth() ) ) {
+					monthHtml += "<option value='" + month + "'" +
+						( month === drawMonth ? " selected='selected'" : "" ) +
+						">" + monthNamesShort[ month ] + "</option>";
+				}
+			}
+			monthHtml += "</select>";
+		}
+
+		if ( !showMonthAfterYear ) {
+			html += monthHtml + ( secondary || !( changeMonth && changeYear ) ? "&#xa0;" : "" );
+		}
+
+		// Year selection
+		if ( !inst.yearshtml ) {
+			inst.yearshtml = "";
+			if ( secondary || !changeYear ) {
+				html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
+			} else {
+
+				// determine range of years to display
+				years = this._get( inst, "yearRange" ).split( ":" );
+				thisYear = new Date().getFullYear();
+				determineYear = function( value ) {
+					var year = ( value.match( /c[+\-].*/ ) ? drawYear + parseInt( value.substring( 1 ), 10 ) :
+						( value.match( /[+\-].*/ ) ? thisYear + parseInt( value, 10 ) :
+						parseInt( value, 10 ) ) );
+					return ( isNaN( year ) ? thisYear : year );
+				};
+				year = determineYear( years[ 0 ] );
+				endYear = Math.max( year, determineYear( years[ 1 ] || "" ) );
+				year = ( minDate ? Math.max( year, minDate.getFullYear() ) : year );
+				endYear = ( maxDate ? Math.min( endYear, maxDate.getFullYear() ) : endYear );
+				inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
+				for ( ; year <= endYear; year++ ) {
+					inst.yearshtml += "<option value='" + year + "'" +
+						( year === drawYear ? " selected='selected'" : "" ) +
+						">" + year + "</option>";
+				}
+				inst.yearshtml += "</select>";
+
+				html += inst.yearshtml;
+				inst.yearshtml = null;
+			}
+		}
+
+		html += this._get( inst, "yearSuffix" );
+		if ( showMonthAfterYear ) {
+			html += ( secondary || !( changeMonth && changeYear ) ? "&#xa0;" : "" ) + monthHtml;
+		}
+		html += "</div>"; // Close datepicker_header
+		return html;
+	},
+
+	/* Adjust one of the date sub-fields. */
+	_adjustInstDate: function( inst, offset, period ) {
+		var year = inst.selectedYear + ( period === "Y" ? offset : 0 ),
+			month = inst.selectedMonth + ( period === "M" ? offset : 0 ),
+			day = Math.min( inst.selectedDay, this._getDaysInMonth( year, month ) ) + ( period === "D" ? offset : 0 ),
+			date = this._restrictMinMax( inst, this._daylightSavingAdjust( new Date( year, month, day ) ) );
+
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		if ( period === "M" || period === "Y" ) {
+			this._notifyChange( inst );
+		}
+	},
+
+	/* Ensure a date is within any min/max bounds. */
+	_restrictMinMax: function( inst, date ) {
+		var minDate = this._getMinMaxDate( inst, "min" ),
+			maxDate = this._getMinMaxDate( inst, "max" ),
+			newDate = ( minDate && date < minDate ? minDate : date );
+		return ( maxDate && newDate > maxDate ? maxDate : newDate );
+	},
+
+	/* Notify change of month/year. */
+	_notifyChange: function( inst ) {
+		var onChange = this._get( inst, "onChangeMonthYear" );
+		if ( onChange ) {
+			onChange.apply( ( inst.input ? inst.input[ 0 ] : null ),
+				[ inst.selectedYear, inst.selectedMonth + 1, inst ] );
+		}
+	},
+
+	/* Determine the number of months to show. */
+	_getNumberOfMonths: function( inst ) {
+		var numMonths = this._get( inst, "numberOfMonths" );
+		return ( numMonths == null ? [ 1, 1 ] : ( typeof numMonths === "number" ? [ 1, numMonths ] : numMonths ) );
+	},
+
+	/* Determine the current maximum date - ensure no time components are set. */
+	_getMinMaxDate: function( inst, minMax ) {
+		return this._determineDate( inst, this._get( inst, minMax + "Date" ), null );
+	},
+
+	/* Find the number of days in a given month. */
+	_getDaysInMonth: function( year, month ) {
+		return 32 - this._daylightSavingAdjust( new Date( year, month, 32 ) ).getDate();
+	},
+
+	/* Find the day of the week of the first of a month. */
+	_getFirstDayOfMonth: function( year, month ) {
+		return new Date( year, month, 1 ).getDay();
+	},
+
+	/* Determines if we should allow a "next/prev" month display change. */
+	_canAdjustMonth: function( inst, offset, curYear, curMonth ) {
+		var numMonths = this._getNumberOfMonths( inst ),
+			date = this._daylightSavingAdjust( new Date( curYear,
+			curMonth + ( offset < 0 ? offset : numMonths[ 0 ] * numMonths[ 1 ] ), 1 ) );
+
+		if ( offset < 0 ) {
+			date.setDate( this._getDaysInMonth( date.getFullYear(), date.getMonth() ) );
+		}
+		return this._isInRange( inst, date );
+	},
+
+	/* Is the given date in the accepted range? */
+	_isInRange: function( inst, date ) {
+		var yearSplit, currentYear,
+			minDate = this._getMinMaxDate( inst, "min" ),
+			maxDate = this._getMinMaxDate( inst, "max" ),
+			minYear = null,
+			maxYear = null,
+			years = this._get( inst, "yearRange" );
+			if ( years ) {
+				yearSplit = years.split( ":" );
+				currentYear = new Date().getFullYear();
+				minYear = parseInt( yearSplit[ 0 ], 10 );
+				maxYear = parseInt( yearSplit[ 1 ], 10 );
+				if ( yearSplit[ 0 ].match( /[+\-].*/ ) ) {
+					minYear += currentYear;
+				}
+				if ( yearSplit[ 1 ].match( /[+\-].*/ ) ) {
+					maxYear += currentYear;
+				}
+			}
+
+		return ( ( !minDate || date.getTime() >= minDate.getTime() ) &&
+			( !maxDate || date.getTime() <= maxDate.getTime() ) &&
+			( !minYear || date.getFullYear() >= minYear ) &&
+			( !maxYear || date.getFullYear() <= maxYear ) );
+	},
+
+	/* Provide the configuration settings for formatting/parsing. */
+	_getFormatConfig: function( inst ) {
+		var shortYearCutoff = this._get( inst, "shortYearCutoff" );
+		shortYearCutoff = ( typeof shortYearCutoff !== "string" ? shortYearCutoff :
+			new Date().getFullYear() % 100 + parseInt( shortYearCutoff, 10 ) );
+		return { shortYearCutoff: shortYearCutoff,
+			dayNamesShort: this._get( inst, "dayNamesShort" ), dayNames: this._get( inst, "dayNames" ),
+			monthNamesShort: this._get( inst, "monthNamesShort" ), monthNames: this._get( inst, "monthNames" ) };
+	},
+
+	/* Format the given date for display. */
+	_formatDate: function( inst, day, month, year ) {
+		if ( !day ) {
+			inst.currentDay = inst.selectedDay;
+			inst.currentMonth = inst.selectedMonth;
+			inst.currentYear = inst.selectedYear;
+		}
+		var date = ( day ? ( typeof day === "object" ? day :
+			this._daylightSavingAdjust( new Date( year, month, day ) ) ) :
+			this._daylightSavingAdjust( new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) );
+		return this.formatDate( this._get( inst, "dateFormat" ), date, this._getFormatConfig( inst ) );
+	}
+} );
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function datepicker_bindHover( dpDiv ) {
+	var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
+	return dpDiv.on( "mouseout", selector, function() {
+			$( this ).removeClass( "ui-state-hover" );
+			if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) {
+				$( this ).removeClass( "ui-datepicker-prev-hover" );
+			}
+			if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) {
+				$( this ).removeClass( "ui-datepicker-next-hover" );
+			}
+		} )
+		.on( "mouseover", selector, datepicker_handleMouseover );
+}
+
+function datepicker_handleMouseover() {
+	if ( !$.datepicker._isDisabledDatepicker( datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[ 0 ] : datepicker_instActive.input[ 0 ] ) ) {
+		$( this ).parents( ".ui-datepicker-calendar" ).find( "a" ).removeClass( "ui-state-hover" );
+		$( this ).addClass( "ui-state-hover" );
+		if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) {
+			$( this ).addClass( "ui-datepicker-prev-hover" );
+		}
+		if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) {
+			$( this ).addClass( "ui-datepicker-next-hover" );
+		}
+	}
+}
+
+/* jQuery extend now ignores nulls! */
+function datepicker_extendRemove( target, props ) {
+	$.extend( target, props );
+	for ( var name in props ) {
+		if ( props[ name ] == null ) {
+			target[ name ] = props[ name ];
+		}
+	}
+	return target;
+}
+
+/* Invoke the datepicker functionality.
+   @param  options  string - a command, optionally followed by additional parameters or
+					Object - settings for attaching new datepicker functionality
+   @return  jQuery object */
+$.fn.datepicker = function( options ) {
+
+	/* Verify an empty collection wasn't passed - Fixes #6976 */
+	if ( !this.length ) {
+		return this;
+	}
+
+	/* Initialise the date picker. */
+	if ( !$.datepicker.initialized ) {
+		$( document ).on( "mousedown", $.datepicker._checkExternalClick );
+		$.datepicker.initialized = true;
+	}
+
+	/* Append datepicker main container to body if not exist. */
+	if ( $( "#" + $.datepicker._mainDivId ).length === 0 ) {
+		$( "body" ).append( $.datepicker.dpDiv );
+	}
+
+	var otherArgs = Array.prototype.slice.call( arguments, 1 );
+	if ( typeof options === "string" && ( options === "isDisabled" || options === "getDate" || options === "widget" ) ) {
+		return $.datepicker[ "_" + options + "Datepicker" ].
+			apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) );
+	}
+	if ( options === "option" && arguments.length === 2 && typeof arguments[ 1 ] === "string" ) {
+		return $.datepicker[ "_" + options + "Datepicker" ].
+			apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) );
+	}
+	return this.each( function() {
+		typeof options === "string" ?
+			$.datepicker[ "_" + options + "Datepicker" ].
+				apply( $.datepicker, [ this ].concat( otherArgs ) ) :
+			$.datepicker._attachDatepicker( this, options );
+	} );
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.12.1";
+
+var widgetsDatepicker = $.datepicker;
+
+
+/*!
+ * jQuery UI Dialog 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
-0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
-e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
-;/*
- * jQuery UI Effects Fade 1.8.14
+
+//>>label: Dialog
+//>>group: Widgets
+//>>description: Displays customizable dialog windows.
+//>>docs: http://api.jqueryui.com/dialog/
+//>>demos: http://jqueryui.com/dialog/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/dialog.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.dialog", {
+	version: "1.12.1",
+	options: {
+		appendTo: "body",
+		autoOpen: true,
+		buttons: [],
+		classes: {
+			"ui-dialog": "ui-corner-all",
+			"ui-dialog-titlebar": "ui-corner-all"
+		},
+		closeOnEscape: true,
+		closeText: "Close",
+		draggable: true,
+		hide: null,
+		height: "auto",
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 150,
+		minWidth: 150,
+		modal: false,
+		position: {
+			my: "center",
+			at: "center",
+			of: window,
+			collision: "fit",
+
+			// Ensure the titlebar is always visible
+			using: function( pos ) {
+				var topOffset = $( this ).css( pos ).offset().top;
+				if ( topOffset < 0 ) {
+					$( this ).css( "top", pos.top - topOffset );
+				}
+			}
+		},
+		resizable: true,
+		show: null,
+		title: null,
+		width: 300,
+
+		// Callbacks
+		beforeClose: null,
+		close: null,
+		drag: null,
+		dragStart: null,
+		dragStop: null,
+		focus: null,
+		open: null,
+		resize: null,
+		resizeStart: null,
+		resizeStop: null
+	},
+
+	sizeRelatedOptions: {
+		buttons: true,
+		height: true,
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true,
+		width: true
+	},
+
+	resizableRelatedOptions: {
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true
+	},
+
+	_create: function() {
+		this.originalCss = {
+			display: this.element[ 0 ].style.display,
+			width: this.element[ 0 ].style.width,
+			minHeight: this.element[ 0 ].style.minHeight,
+			maxHeight: this.element[ 0 ].style.maxHeight,
+			height: this.element[ 0 ].style.height
+		};
+		this.originalPosition = {
+			parent: this.element.parent(),
+			index: this.element.parent().children().index( this.element )
+		};
+		this.originalTitle = this.element.attr( "title" );
+		if ( this.options.title == null && this.originalTitle != null ) {
+			this.options.title = this.originalTitle;
+		}
+
+		// Dialogs can't be disabled
+		if ( this.options.disabled ) {
+			this.options.disabled = false;
+		}
+
+		this._createWrapper();
+
+		this.element
+			.show()
+			.removeAttr( "title" )
+			.appendTo( this.uiDialog );
+
+		this._addClass( "ui-dialog-content", "ui-widget-content" );
+
+		this._createTitlebar();
+		this._createButtonPane();
+
+		if ( this.options.draggable && $.fn.draggable ) {
+			this._makeDraggable();
+		}
+		if ( this.options.resizable && $.fn.resizable ) {
+			this._makeResizable();
+		}
+
+		this._isOpen = false;
+
+		this._trackFocus();
+	},
+
+	_init: function() {
+		if ( this.options.autoOpen ) {
+			this.open();
+		}
+	},
+
+	_appendTo: function() {
+		var element = this.options.appendTo;
+		if ( element && ( element.jquery || element.nodeType ) ) {
+			return $( element );
+		}
+		return this.document.find( element || "body" ).eq( 0 );
+	},
+
+	_destroy: function() {
+		var next,
+			originalPosition = this.originalPosition;
+
+		this._untrackInstance();
+		this._destroyOverlay();
+
+		this.element
+			.removeUniqueId()
+			.css( this.originalCss )
+
+			// Without detaching first, the following becomes really slow
+			.detach();
+
+		this.uiDialog.remove();
+
+		if ( this.originalTitle ) {
+			this.element.attr( "title", this.originalTitle );
+		}
+
+		next = originalPosition.parent.children().eq( originalPosition.index );
+
+		// Don't try to place the dialog next to itself (#8613)
+		if ( next.length && next[ 0 ] !== this.element[ 0 ] ) {
+			next.before( this.element );
+		} else {
+			originalPosition.parent.append( this.element );
+		}
+	},
+
+	widget: function() {
+		return this.uiDialog;
+	},
+
+	disable: $.noop,
+	enable: $.noop,
+
+	close: function( event ) {
+		var that = this;
+
+		if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) {
+			return;
+		}
+
+		this._isOpen = false;
+		this._focusedElement = null;
+		this._destroyOverlay();
+		this._untrackInstance();
+
+		if ( !this.opener.filter( ":focusable" ).trigger( "focus" ).length ) {
+
+			// Hiding a focused element doesn't trigger blur in WebKit
+			// so in case we have nothing to focus on, explicitly blur the active element
+			// https://bugs.webkit.org/show_bug.cgi?id=47182
+			$.ui.safeBlur( $.ui.safeActiveElement( this.document[ 0 ] ) );
+		}
+
+		this._hide( this.uiDialog, this.options.hide, function() {
+			that._trigger( "close", event );
+		} );
+	},
+
+	isOpen: function() {
+		return this._isOpen;
+	},
+
+	moveToTop: function() {
+		this._moveToTop();
+	},
+
+	_moveToTop: function( event, silent ) {
+		var moved = false,
+			zIndices = this.uiDialog.siblings( ".ui-front:visible" ).map( function() {
+				return +$( this ).css( "z-index" );
+			} ).get(),
+			zIndexMax = Math.max.apply( null, zIndices );
+
+		if ( zIndexMax >= +this.uiDialog.css( "z-index" ) ) {
+			this.uiDialog.css( "z-index", zIndexMax + 1 );
+			moved = true;
+		}
+
+		if ( moved && !silent ) {
+			this._trigger( "focus", event );
+		}
+		return moved;
+	},
+
+	open: function() {
+		var that = this;
+		if ( this._isOpen ) {
+			if ( this._moveToTop() ) {
+				this._focusTabbable();
+			}
+			return;
+		}
+
+		this._isOpen = true;
+		this.opener = $( $.ui.safeActiveElement( this.document[ 0 ] ) );
+
+		this._size();
+		this._position();
+		this._createOverlay();
+		this._moveToTop( null, true );
+
+		// Ensure the overlay is moved to the top with the dialog, but only when
+		// opening. The overlay shouldn't move after the dialog is open so that
+		// modeless dialogs opened after the modal dialog stack properly.
+		if ( this.overlay ) {
+			this.overlay.css( "z-index", this.uiDialog.css( "z-index" ) - 1 );
+		}
+
+		this._show( this.uiDialog, this.options.show, function() {
+			that._focusTabbable();
+			that._trigger( "focus" );
+		} );
+
+		// Track the dialog immediately upon openening in case a focus event
+		// somehow occurs outside of the dialog before an element inside the
+		// dialog is focused (#10152)
+		this._makeFocusTarget();
+
+		this._trigger( "open" );
+	},
+
+	_focusTabbable: function() {
+
+		// Set focus to the first match:
+		// 1. An element that was focused previously
+		// 2. First element inside the dialog matching [autofocus]
+		// 3. Tabbable element inside the content element
+		// 4. Tabbable element inside the buttonpane
+		// 5. The close button
+		// 6. The dialog itself
+		var hasFocus = this._focusedElement;
+		if ( !hasFocus ) {
+			hasFocus = this.element.find( "[autofocus]" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.element.find( ":tabbable" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.uiDialogButtonPane.find( ":tabbable" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.uiDialogTitlebarClose.filter( ":tabbable" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.uiDialog;
+		}
+		hasFocus.eq( 0 ).trigger( "focus" );
+	},
+
+	_keepFocus: function( event ) {
+		function checkFocus() {
+			var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ),
+				isActive = this.uiDialog[ 0 ] === activeElement ||
+					$.contains( this.uiDialog[ 0 ], activeElement );
+			if ( !isActive ) {
+				this._focusTabbable();
+			}
+		}
+		event.preventDefault();
+		checkFocus.call( this );
+
+		// support: IE
+		// IE <= 8 doesn't prevent moving focus even with event.preventDefault()
+		// so we check again later
+		this._delay( checkFocus );
+	},
+
+	_createWrapper: function() {
+		this.uiDialog = $( "<div>" )
+			.hide()
+			.attr( {
+
+				// Setting tabIndex makes the div focusable
+				tabIndex: -1,
+				role: "dialog"
+			} )
+			.appendTo( this._appendTo() );
+
+		this._addClass( this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front" );
+		this._on( this.uiDialog, {
+			keydown: function( event ) {
+				if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+						event.keyCode === $.ui.keyCode.ESCAPE ) {
+					event.preventDefault();
+					this.close( event );
+					return;
+				}
+
+				// Prevent tabbing out of dialogs
+				if ( event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented() ) {
+					return;
+				}
+				var tabbables = this.uiDialog.find( ":tabbable" ),
+					first = tabbables.filter( ":first" ),
+					last = tabbables.filter( ":last" );
+
+				if ( ( event.target === last[ 0 ] || event.target === this.uiDialog[ 0 ] ) &&
+						!event.shiftKey ) {
+					this._delay( function() {
+						first.trigger( "focus" );
+					} );
+					event.preventDefault();
+				} else if ( ( event.target === first[ 0 ] ||
+						event.target === this.uiDialog[ 0 ] ) && event.shiftKey ) {
+					this._delay( function() {
+						last.trigger( "focus" );
+					} );
+					event.preventDefault();
+				}
+			},
+			mousedown: function( event ) {
+				if ( this._moveToTop( event ) ) {
+					this._focusTabbable();
+				}
+			}
+		} );
+
+		// We assume that any existing aria-describedby attribute means
+		// that the dialog content is marked up properly
+		// otherwise we brute force the content as the description
+		if ( !this.element.find( "[aria-describedby]" ).length ) {
+			this.uiDialog.attr( {
+				"aria-describedby": this.element.uniqueId().attr( "id" )
+			} );
+		}
+	},
+
+	_createTitlebar: function() {
+		var uiDialogTitle;
+
+		this.uiDialogTitlebar = $( "<div>" );
+		this._addClass( this.uiDialogTitlebar,
+			"ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix" );
+		this._on( this.uiDialogTitlebar, {
+			mousedown: function( event ) {
+
+				// Don't prevent click on close button (#8838)
+				// Focusing a dialog that is partially scrolled out of view
+				// causes the browser to scroll it into view, preventing the click event
+				if ( !$( event.target ).closest( ".ui-dialog-titlebar-close" ) ) {
+
+					// Dialog isn't getting focus when dragging (#8063)
+					this.uiDialog.trigger( "focus" );
+				}
+			}
+		} );
+
+		// Support: IE
+		// Use type="button" to prevent enter keypresses in textboxes from closing the
+		// dialog in IE (#9312)
+		this.uiDialogTitlebarClose = $( "<button type='button'></button>" )
+			.button( {
+				label: $( "<a>" ).text( this.options.closeText ).html(),
+				icon: "ui-icon-closethick",
+				showLabel: false
+			} )
+			.appendTo( this.uiDialogTitlebar );
+
+		this._addClass( this.uiDialogTitlebarClose, "ui-dialog-titlebar-close" );
+		this._on( this.uiDialogTitlebarClose, {
+			click: function( event ) {
+				event.preventDefault();
+				this.close( event );
+			}
+		} );
+
+		uiDialogTitle = $( "<span>" ).uniqueId().prependTo( this.uiDialogTitlebar );
+		this._addClass( uiDialogTitle, "ui-dialog-title" );
+		this._title( uiDialogTitle );
+
+		this.uiDialogTitlebar.prependTo( this.uiDialog );
+
+		this.uiDialog.attr( {
+			"aria-labelledby": uiDialogTitle.attr( "id" )
+		} );
+	},
+
+	_title: function( title ) {
+		if ( this.options.title ) {
+			title.text( this.options.title );
+		} else {
+			title.html( "&#160;" );
+		}
+	},
+
+	_createButtonPane: function() {
+		this.uiDialogButtonPane = $( "<div>" );
+		this._addClass( this.uiDialogButtonPane, "ui-dialog-buttonpane",
+			"ui-widget-content ui-helper-clearfix" );
+
+		this.uiButtonSet = $( "<div>" )
+			.appendTo( this.uiDialogButtonPane );
+		this._addClass( this.uiButtonSet, "ui-dialog-buttonset" );
+
+		this._createButtons();
+	},
+
+	_createButtons: function() {
+		var that = this,
+			buttons = this.options.buttons;
+
+		// If we already have a button pane, remove it
+		this.uiDialogButtonPane.remove();
+		this.uiButtonSet.empty();
+
+		if ( $.isEmptyObject( buttons ) || ( $.isArray( buttons ) && !buttons.length ) ) {
+			this._removeClass( this.uiDialog, "ui-dialog-buttons" );
+			return;
+		}
+
+		$.each( buttons, function( name, props ) {
+			var click, buttonOptions;
+			props = $.isFunction( props ) ?
+				{ click: props, text: name } :
+				props;
+
+			// Default to a non-submitting button
+			props = $.extend( { type: "button" }, props );
+
+			// Change the context for the click callback to be the main element
+			click = props.click;
+			buttonOptions = {
+				icon: props.icon,
+				iconPosition: props.iconPosition,
+				showLabel: props.showLabel,
+
+				// Deprecated options
+				icons: props.icons,
+				text: props.text
+			};
+
+			delete props.click;
+			delete props.icon;
+			delete props.iconPosition;
+			delete props.showLabel;
+
+			// Deprecated options
+			delete props.icons;
+			if ( typeof props.text === "boolean" ) {
+				delete props.text;
+			}
+
+			$( "<button></button>", props )
+				.button( buttonOptions )
+				.appendTo( that.uiButtonSet )
+				.on( "click", function() {
+					click.apply( that.element[ 0 ], arguments );
+				} );
+		} );
+		this._addClass( this.uiDialog, "ui-dialog-buttons" );
+		this.uiDialogButtonPane.appendTo( this.uiDialog );
+	},
+
+	_makeDraggable: function() {
+		var that = this,
+			options = this.options;
+
+		function filteredUi( ui ) {
+			return {
+				position: ui.position,
+				offset: ui.offset
+			};
+		}
+
+		this.uiDialog.draggable( {
+			cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+			handle: ".ui-dialog-titlebar",
+			containment: "document",
+			start: function( event, ui ) {
+				that._addClass( $( this ), "ui-dialog-dragging" );
+				that._blockFrames();
+				that._trigger( "dragStart", event, filteredUi( ui ) );
+			},
+			drag: function( event, ui ) {
+				that._trigger( "drag", event, filteredUi( ui ) );
+			},
+			stop: function( event, ui ) {
+				var left = ui.offset.left - that.document.scrollLeft(),
+					top = ui.offset.top - that.document.scrollTop();
+
+				options.position = {
+					my: "left top",
+					at: "left" + ( left >= 0 ? "+" : "" ) + left + " " +
+						"top" + ( top >= 0 ? "+" : "" ) + top,
+					of: that.window
+				};
+				that._removeClass( $( this ), "ui-dialog-dragging" );
+				that._unblockFrames();
+				that._trigger( "dragStop", event, filteredUi( ui ) );
+			}
+		} );
+	},
+
+	_makeResizable: function() {
+		var that = this,
+			options = this.options,
+			handles = options.resizable,
+
+			// .ui-resizable has position: relative defined in the stylesheet
+			// but dialogs have to use absolute or fixed positioning
+			position = this.uiDialog.css( "position" ),
+			resizeHandles = typeof handles === "string" ?
+				handles :
+				"n,e,s,w,se,sw,ne,nw";
+
+		function filteredUi( ui ) {
+			return {
+				originalPosition: ui.originalPosition,
+				originalSize: ui.originalSize,
+				position: ui.position,
+				size: ui.size
+			};
+		}
+
+		this.uiDialog.resizable( {
+			cancel: ".ui-dialog-content",
+			containment: "document",
+			alsoResize: this.element,
+			maxWidth: options.maxWidth,
+			maxHeight: options.maxHeight,
+			minWidth: options.minWidth,
+			minHeight: this._minHeight(),
+			handles: resizeHandles,
+			start: function( event, ui ) {
+				that._addClass( $( this ), "ui-dialog-resizing" );
+				that._blockFrames();
+				that._trigger( "resizeStart", event, filteredUi( ui ) );
+			},
+			resize: function( event, ui ) {
+				that._trigger( "resize", event, filteredUi( ui ) );
+			},
+			stop: function( event, ui ) {
+				var offset = that.uiDialog.offset(),
+					left = offset.left - that.document.scrollLeft(),
+					top = offset.top - that.document.scrollTop();
+
+				options.height = that.uiDialog.height();
+				options.width = that.uiDialog.width();
+				options.position = {
+					my: "left top",
+					at: "left" + ( left >= 0 ? "+" : "" ) + left + " " +
+						"top" + ( top >= 0 ? "+" : "" ) + top,
+					of: that.window
+				};
+				that._removeClass( $( this ), "ui-dialog-resizing" );
+				that._unblockFrames();
+				that._trigger( "resizeStop", event, filteredUi( ui ) );
+			}
+		} )
+			.css( "position", position );
+	},
+
+	_trackFocus: function() {
+		this._on( this.widget(), {
+			focusin: function( event ) {
+				this._makeFocusTarget();
+				this._focusedElement = $( event.target );
+			}
+		} );
+	},
+
+	_makeFocusTarget: function() {
+		this._untrackInstance();
+		this._trackingInstances().unshift( this );
+	},
+
+	_untrackInstance: function() {
+		var instances = this._trackingInstances(),
+			exists = $.inArray( this, instances );
+		if ( exists !== -1 ) {
+			instances.splice( exists, 1 );
+		}
+	},
+
+	_trackingInstances: function() {
+		var instances = this.document.data( "ui-dialog-instances" );
+		if ( !instances ) {
+			instances = [];
+			this.document.data( "ui-dialog-instances", instances );
+		}
+		return instances;
+	},
+
+	_minHeight: function() {
+		var options = this.options;
+
+		return options.height === "auto" ?
+			options.minHeight :
+			Math.min( options.minHeight, options.height );
+	},
+
+	_position: function() {
+
+		// Need to show the dialog to get the actual offset in the position plugin
+		var isVisible = this.uiDialog.is( ":visible" );
+		if ( !isVisible ) {
+			this.uiDialog.show();
+		}
+		this.uiDialog.position( this.options.position );
+		if ( !isVisible ) {
+			this.uiDialog.hide();
+		}
+	},
+
+	_setOptions: function( options ) {
+		var that = this,
+			resize = false,
+			resizableOptions = {};
+
+		$.each( options, function( key, value ) {
+			that._setOption( key, value );
+
+			if ( key in that.sizeRelatedOptions ) {
+				resize = true;
+			}
+			if ( key in that.resizableRelatedOptions ) {
+				resizableOptions[ key ] = value;
+			}
+		} );
+
+		if ( resize ) {
+			this._size();
+			this._position();
+		}
+		if ( this.uiDialog.is( ":data(ui-resizable)" ) ) {
+			this.uiDialog.resizable( "option", resizableOptions );
+		}
+	},
+
+	_setOption: function( key, value ) {
+		var isDraggable, isResizable,
+			uiDialog = this.uiDialog;
+
+		if ( key === "disabled" ) {
+			return;
+		}
+
+		this._super( key, value );
+
+		if ( key === "appendTo" ) {
+			this.uiDialog.appendTo( this._appendTo() );
+		}
+
+		if ( key === "buttons" ) {
+			this._createButtons();
+		}
+
+		if ( key === "closeText" ) {
+			this.uiDialogTitlebarClose.button( {
+
+				// Ensure that we always pass a string
+				label: $( "<a>" ).text( "" + this.options.closeText ).html()
+			} );
+		}
+
+		if ( key === "draggable" ) {
+			isDraggable = uiDialog.is( ":data(ui-draggable)" );
+			if ( isDraggable && !value ) {
+				uiDialog.draggable( "destroy" );
+			}
+
+			if ( !isDraggable && value ) {
+				this._makeDraggable();
+			}
+		}
+
+		if ( key === "position" ) {
+			this._position();
+		}
+
+		if ( key === "resizable" ) {
+
+			// currently resizable, becoming non-resizable
+			isResizable = uiDialog.is( ":data(ui-resizable)" );
+			if ( isResizable && !value ) {
+				uiDialog.resizable( "destroy" );
+			}
+
+			// Currently resizable, changing handles
+			if ( isResizable && typeof value === "string" ) {
+				uiDialog.resizable( "option", "handles", value );
+			}
+
+			// Currently non-resizable, becoming resizable
+			if ( !isResizable && value !== false ) {
+				this._makeResizable();
+			}
+		}
+
+		if ( key === "title" ) {
+			this._title( this.uiDialogTitlebar.find( ".ui-dialog-title" ) );
+		}
+	},
+
+	_size: function() {
+
+		// If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+		// divs will both have width and height set, so we need to reset them
+		var nonContentHeight, minContentHeight, maxContentHeight,
+			options = this.options;
+
+		// Reset content sizing
+		this.element.show().css( {
+			width: "auto",
+			minHeight: 0,
+			maxHeight: "none",
+			height: 0
+		} );
+
+		if ( options.minWidth > options.width ) {
+			options.width = options.minWidth;
+		}
+
+		// Reset wrapper sizing
+		// determine the height of all the non-content elements
+		nonContentHeight = this.uiDialog.css( {
+			height: "auto",
+			width: options.width
+		} )
+			.outerHeight();
+		minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+		maxContentHeight = typeof options.maxHeight === "number" ?
+			Math.max( 0, options.maxHeight - nonContentHeight ) :
+			"none";
+
+		if ( options.height === "auto" ) {
+			this.element.css( {
+				minHeight: minContentHeight,
+				maxHeight: maxContentHeight,
+				height: "auto"
+			} );
+		} else {
+			this.element.height( Math.max( 0, options.height - nonContentHeight ) );
+		}
+
+		if ( this.uiDialog.is( ":data(ui-resizable)" ) ) {
+			this.uiDialog.resizable( "option", "minHeight", this._minHeight() );
+		}
+	},
+
+	_blockFrames: function() {
+		this.iframeBlocks = this.document.find( "iframe" ).map( function() {
+			var iframe = $( this );
+
+			return $( "<div>" )
+				.css( {
+					position: "absolute",
+					width: iframe.outerWidth(),
+					height: iframe.outerHeight()
+				} )
+				.appendTo( iframe.parent() )
+				.offset( iframe.offset() )[ 0 ];
+		} );
+	},
+
+	_unblockFrames: function() {
+		if ( this.iframeBlocks ) {
+			this.iframeBlocks.remove();
+			delete this.iframeBlocks;
+		}
+	},
+
+	_allowInteraction: function( event ) {
+		if ( $( event.target ).closest( ".ui-dialog" ).length ) {
+			return true;
+		}
+
+		// TODO: Remove hack when datepicker implements
+		// the .ui-front logic (#8989)
+		return !!$( event.target ).closest( ".ui-datepicker" ).length;
+	},
+
+	_createOverlay: function() {
+		if ( !this.options.modal ) {
+			return;
+		}
+
+		// We use a delay in case the overlay is created from an
+		// event that we're going to be cancelling (#2804)
+		var isOpening = true;
+		this._delay( function() {
+			isOpening = false;
+		} );
+
+		if ( !this.document.data( "ui-dialog-overlays" ) ) {
+
+			// Prevent use of anchors and inputs
+			// Using _on() for an event handler shared across many instances is
+			// safe because the dialogs stack and must be closed in reverse order
+			this._on( this.document, {
+				focusin: function( event ) {
+					if ( isOpening ) {
+						return;
+					}
+
+					if ( !this._allowInteraction( event ) ) {
+						event.preventDefault();
+						this._trackingInstances()[ 0 ]._focusTabbable();
+					}
+				}
+			} );
+		}
+
+		this.overlay = $( "<div>" )
+			.appendTo( this._appendTo() );
+
+		this._addClass( this.overlay, null, "ui-widget-overlay ui-front" );
+		this._on( this.overlay, {
+			mousedown: "_keepFocus"
+		} );
+		this.document.data( "ui-dialog-overlays",
+			( this.document.data( "ui-dialog-overlays" ) || 0 ) + 1 );
+	},
+
+	_destroyOverlay: function() {
+		if ( !this.options.modal ) {
+			return;
+		}
+
+		if ( this.overlay ) {
+			var overlays = this.document.data( "ui-dialog-overlays" ) - 1;
+
+			if ( !overlays ) {
+				this._off( this.document, "focusin" );
+				this.document.removeData( "ui-dialog-overlays" );
+			} else {
+				this.document.data( "ui-dialog-overlays", overlays );
+			}
+
+			this.overlay.remove();
+			this.overlay = null;
+		}
+	}
+} );
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for dialogClass option
+	$.widget( "ui.dialog", $.ui.dialog, {
+		options: {
+			dialogClass: ""
+		},
+		_createWrapper: function() {
+			this._super();
+			this.uiDialog.addClass( this.options.dialogClass );
+		},
+		_setOption: function( key, value ) {
+			if ( key === "dialogClass" ) {
+				this.uiDialog
+					.removeClass( this.options.dialogClass )
+					.addClass( value );
+			}
+			this._superApply( arguments );
+		}
+	} );
+}
+
+var widgetsDialog = $.ui.dialog;
+
+
+/*!
+ * jQuery UI Progressbar 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Progressbar
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/progressbar/
+//>>demos: http://jqueryui.com/progressbar/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/progressbar.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsProgressbar = $.widget( "ui.progressbar", {
+	version: "1.12.1",
+	options: {
+		classes: {
+			"ui-progressbar": "ui-corner-all",
+			"ui-progressbar-value": "ui-corner-left",
+			"ui-progressbar-complete": "ui-corner-right"
+		},
+		max: 100,
+		value: 0,
+
+		change: null,
+		complete: null
+	},
+
+	min: 0,
+
+	_create: function() {
+
+		// Constrain initial value
+		this.oldValue = this.options.value = this._constrainedValue();
+
+		this.element.attr( {
+
+			// Only set static values; aria-valuenow and aria-valuemax are
+			// set inside _refreshValue()
+			role: "progressbar",
+			"aria-valuemin": this.min
+		} );
+		this._addClass( "ui-progressbar", "ui-widget ui-widget-content" );
+
+		this.valueDiv = $( "<div>" ).appendTo( this.element );
+		this._addClass( this.valueDiv, "ui-progressbar-value", "ui-widget-header" );
+		this._refreshValue();
+	},
+
+	_destroy: function() {
+		this.element.removeAttr( "role aria-valuemin aria-valuemax aria-valuenow" );
+
+		this.valueDiv.remove();
+	},
+
+	value: function( newValue ) {
+		if ( newValue === undefined ) {
+			return this.options.value;
+		}
+
+		this.options.value = this._constrainedValue( newValue );
+		this._refreshValue();
+	},
+
+	_constrainedValue: function( newValue ) {
+		if ( newValue === undefined ) {
+			newValue = this.options.value;
+		}
+
+		this.indeterminate = newValue === false;
+
+		// Sanitize value
+		if ( typeof newValue !== "number" ) {
+			newValue = 0;
+		}
+
+		return this.indeterminate ? false :
+			Math.min( this.options.max, Math.max( this.min, newValue ) );
+	},
+
+	_setOptions: function( options ) {
+
+		// Ensure "value" option is set after other values (like max)
+		var value = options.value;
+		delete options.value;
+
+		this._super( options );
+
+		this.options.value = this._constrainedValue( value );
+		this._refreshValue();
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "max" ) {
+
+			// Don't allow a max less than min
+			value = Math.max( this.min, value );
+		}
+		this._super( key, value );
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.element.attr( "aria-disabled", value );
+		this._toggleClass( null, "ui-state-disabled", !!value );
+	},
+
+	_percentage: function() {
+		return this.indeterminate ?
+			100 :
+			100 * ( this.options.value - this.min ) / ( this.options.max - this.min );
+	},
+
+	_refreshValue: function() {
+		var value = this.options.value,
+			percentage = this._percentage();
+
+		this.valueDiv
+			.toggle( this.indeterminate || value > this.min )
+			.width( percentage.toFixed( 0 ) + "%" );
+
+		this
+			._toggleClass( this.valueDiv, "ui-progressbar-complete", null,
+				value === this.options.max )
+			._toggleClass( "ui-progressbar-indeterminate", null, this.indeterminate );
+
+		if ( this.indeterminate ) {
+			this.element.removeAttr( "aria-valuenow" );
+			if ( !this.overlayDiv ) {
+				this.overlayDiv = $( "<div>" ).appendTo( this.valueDiv );
+				this._addClass( this.overlayDiv, "ui-progressbar-overlay" );
+			}
+		} else {
+			this.element.attr( {
+				"aria-valuemax": this.options.max,
+				"aria-valuenow": value
+			} );
+			if ( this.overlayDiv ) {
+				this.overlayDiv.remove();
+				this.overlayDiv = null;
+			}
+		}
+
+		if ( this.oldValue !== value ) {
+			this.oldValue = value;
+			this._trigger( "change" );
+		}
+		if ( value === this.options.max ) {
+			this._trigger( "complete" );
+		}
+	}
+} );
+
+
+/*!
+ * jQuery UI Selectmenu 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Fade
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Selectmenu
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/selectmenu/
+//>>demos: http://jqueryui.com/selectmenu/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsSelectmenu = $.widget( "ui.selectmenu", [ $.ui.formResetMixin, {
+	version: "1.12.1",
+	defaultElement: "<select>",
+	options: {
+		appendTo: null,
+		classes: {
+			"ui-selectmenu-button-open": "ui-corner-top",
+			"ui-selectmenu-button-closed": "ui-corner-all"
+		},
+		disabled: null,
+		icons: {
+			button: "ui-icon-triangle-1-s"
+		},
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		width: false,
+
+		// Callbacks
+		change: null,
+		close: null,
+		focus: null,
+		open: null,
+		select: null
+	},
+
+	_create: function() {
+		var selectmenuId = this.element.uniqueId().attr( "id" );
+		this.ids = {
+			element: selectmenuId,
+			button: selectmenuId + "-button",
+			menu: selectmenuId + "-menu"
+		};
+
+		this._drawButton();
+		this._drawMenu();
+		this._bindFormResetHandler();
+
+		this._rendered = false;
+		this.menuItems = $();
+	},
+
+	_drawButton: function() {
+		var icon,
+			that = this,
+			item = this._parseOption(
+				this.element.find( "option:selected" ),
+				this.element[ 0 ].selectedIndex
+			);
+
+		// Associate existing label with the new button
+		this.labels = this.element.labels().attr( "for", this.ids.button );
+		this._on( this.labels, {
+			click: function( event ) {
+				this.button.focus();
+				event.preventDefault();
+			}
+		} );
+
+		// Hide original select element
+		this.element.hide();
+
+		// Create button
+		this.button = $( "<span>", {
+			tabindex: this.options.disabled ? -1 : 0,
+			id: this.ids.button,
+			role: "combobox",
+			"aria-expanded": "false",
+			"aria-autocomplete": "list",
+			"aria-owns": this.ids.menu,
+			"aria-haspopup": "true",
+			title: this.element.attr( "title" )
+		} )
+			.insertAfter( this.element );
+
+		this._addClass( this.button, "ui-selectmenu-button ui-selectmenu-button-closed",
+			"ui-button ui-widget" );
+
+		icon = $( "<span>" ).appendTo( this.button );
+		this._addClass( icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons.button );
+		this.buttonItem = this._renderButtonItem( item )
+			.appendTo( this.button );
+
+		if ( this.options.width !== false ) {
+			this._resizeButton();
+		}
+
+		this._on( this.button, this._buttonEvents );
+		this.button.one( "focusin", function() {
+
+			// Delay rendering the menu items until the button receives focus.
+			// The menu may have already been rendered via a programmatic open.
+			if ( !that._rendered ) {
+				that._refreshMenu();
+			}
+		} );
+	},
+
+	_drawMenu: function() {
+		var that = this;
+
+		// Create menu
+		this.menu = $( "<ul>", {
+			"aria-hidden": "true",
+			"aria-labelledby": this.ids.button,
+			id: this.ids.menu
+		} );
+
+		// Wrap menu
+		this.menuWrap = $( "<div>" ).append( this.menu );
+		this._addClass( this.menuWrap, "ui-selectmenu-menu", "ui-front" );
+		this.menuWrap.appendTo( this._appendTo() );
+
+		// Initialize menu widget
+		this.menuInstance = this.menu
+			.menu( {
+				classes: {
+					"ui-menu": "ui-corner-bottom"
+				},
+				role: "listbox",
+				select: function( event, ui ) {
+					event.preventDefault();
+
+					// Support: IE8
+					// If the item was selected via a click, the text selection
+					// will be destroyed in IE
+					that._setSelection();
+
+					that._select( ui.item.data( "ui-selectmenu-item" ), event );
+				},
+				focus: function( event, ui ) {
+					var item = ui.item.data( "ui-selectmenu-item" );
+
+					// Prevent inital focus from firing and check if its a newly focused item
+					if ( that.focusIndex != null && item.index !== that.focusIndex ) {
+						that._trigger( "focus", event, { item: item } );
+						if ( !that.isOpen ) {
+							that._select( item, event );
+						}
+					}
+					that.focusIndex = item.index;
+
+					that.button.attr( "aria-activedescendant",
+						that.menuItems.eq( item.index ).attr( "id" ) );
+				}
+			} )
+			.menu( "instance" );
+
+		// Don't close the menu on mouseleave
+		this.menuInstance._off( this.menu, "mouseleave" );
+
+		// Cancel the menu's collapseAll on document click
+		this.menuInstance._closeOnDocumentClick = function() {
+			return false;
+		};
+
+		// Selects often contain empty items, but never contain dividers
+		this.menuInstance._isDivider = function() {
+			return false;
+		};
+	},
+
+	refresh: function() {
+		this._refreshMenu();
+		this.buttonItem.replaceWith(
+			this.buttonItem = this._renderButtonItem(
+
+				// Fall back to an empty object in case there are no options
+				this._getSelectedItem().data( "ui-selectmenu-item" ) || {}
+			)
+		);
+		if ( this.options.width === null ) {
+			this._resizeButton();
+		}
+	},
+
+	_refreshMenu: function() {
+		var item,
+			options = this.element.find( "option" );
+
+		this.menu.empty();
+
+		this._parseOptions( options );
+		this._renderMenu( this.menu, this.items );
+
+		this.menuInstance.refresh();
+		this.menuItems = this.menu.find( "li" )
+			.not( ".ui-selectmenu-optgroup" )
+				.find( ".ui-menu-item-wrapper" );
+
+		this._rendered = true;
+
+		if ( !options.length ) {
+			return;
+		}
+
+		item = this._getSelectedItem();
+
+		// Update the menu to have the correct item focused
+		this.menuInstance.focus( null, item );
+		this._setAria( item.data( "ui-selectmenu-item" ) );
+
+		// Set disabled state
+		this._setOption( "disabled", this.element.prop( "disabled" ) );
+	},
+
+	open: function( event ) {
+		if ( this.options.disabled ) {
+			return;
+		}
+
+		// If this is the first time the menu is being opened, render the items
+		if ( !this._rendered ) {
+			this._refreshMenu();
+		} else {
+
+			// Menu clears focus on close, reset focus to selected item
+			this._removeClass( this.menu.find( ".ui-state-active" ), null, "ui-state-active" );
+			this.menuInstance.focus( null, this._getSelectedItem() );
+		}
+
+		// If there are no options, don't open the menu
+		if ( !this.menuItems.length ) {
+			return;
+		}
+
+		this.isOpen = true;
+		this._toggleAttr();
+		this._resizeMenu();
+		this._position();
+
+		this._on( this.document, this._documentClick );
+
+		this._trigger( "open", event );
+	},
+
+	_position: function() {
+		this.menuWrap.position( $.extend( { of: this.button }, this.options.position ) );
+	},
+
+	close: function( event ) {
+		if ( !this.isOpen ) {
+			return;
+		}
+
+		this.isOpen = false;
+		this._toggleAttr();
+
+		this.range = null;
+		this._off( this.document );
+
+		this._trigger( "close", event );
+	},
+
+	widget: function() {
+		return this.button;
+	},
+
+	menuWidget: function() {
+		return this.menu;
+	},
+
+	_renderButtonItem: function( item ) {
+		var buttonItem = $( "<span>" );
+
+		this._setText( buttonItem, item.label );
+		this._addClass( buttonItem, "ui-selectmenu-text" );
+
+		return buttonItem;
+	},
+
+	_renderMenu: function( ul, items ) {
+		var that = this,
+			currentOptgroup = "";
+
+		$.each( items, function( index, item ) {
+			var li;
+
+			if ( item.optgroup !== currentOptgroup ) {
+				li = $( "<li>", {
+					text: item.optgroup
+				} );
+				that._addClass( li, "ui-selectmenu-optgroup", "ui-menu-divider" +
+					( item.element.parent( "optgroup" ).prop( "disabled" ) ?
+						" ui-state-disabled" :
+						"" ) );
+
+				li.appendTo( ul );
+
+				currentOptgroup = item.optgroup;
+			}
+
+			that._renderItemData( ul, item );
+		} );
+	},
+
+	_renderItemData: function( ul, item ) {
+		return this._renderItem( ul, item ).data( "ui-selectmenu-item", item );
+	},
+
+	_renderItem: function( ul, item ) {
+		var li = $( "<li>" ),
+			wrapper = $( "<div>", {
+				title: item.element.attr( "title" )
+			} );
+
+		if ( item.disabled ) {
+			this._addClass( li, null, "ui-state-disabled" );
+		}
+		this._setText( wrapper, item.label );
+
+		return li.append( wrapper ).appendTo( ul );
+	},
+
+	_setText: function( element, value ) {
+		if ( value ) {
+			element.text( value );
+		} else {
+			element.html( "&#160;" );
+		}
+	},
+
+	_move: function( direction, event ) {
+		var item, next,
+			filter = ".ui-menu-item";
+
+		if ( this.isOpen ) {
+			item = this.menuItems.eq( this.focusIndex ).parent( "li" );
+		} else {
+			item = this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" );
+			filter += ":not(.ui-state-disabled)";
+		}
+
+		if ( direction === "first" || direction === "last" ) {
+			next = item[ direction === "first" ? "prevAll" : "nextAll" ]( filter ).eq( -1 );
+		} else {
+			next = item[ direction + "All" ]( filter ).eq( 0 );
+		}
+
+		if ( next.length ) {
+			this.menuInstance.focus( event, next );
+		}
+	},
+
+	_getSelectedItem: function() {
+		return this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" );
+	},
+
+	_toggle: function( event ) {
+		this[ this.isOpen ? "close" : "open" ]( event );
+	},
+
+	_setSelection: function() {
+		var selection;
+
+		if ( !this.range ) {
+			return;
+		}
+
+		if ( window.getSelection ) {
+			selection = window.getSelection();
+			selection.removeAllRanges();
+			selection.addRange( this.range );
+
+		// Support: IE8
+		} else {
+			this.range.select();
+		}
+
+		// Support: IE
+		// Setting the text selection kills the button focus in IE, but
+		// restoring the focus doesn't kill the selection.
+		this.button.focus();
+	},
+
+	_documentClick: {
+		mousedown: function( event ) {
+			if ( !this.isOpen ) {
+				return;
+			}
+
+			if ( !$( event.target ).closest( ".ui-selectmenu-menu, #" +
+					$.ui.escapeSelector( this.ids.button ) ).length ) {
+				this.close( event );
+			}
+		}
+	},
+
+	_buttonEvents: {
+
+		// Prevent text selection from being reset when interacting with the selectmenu (#10144)
+		mousedown: function() {
+			var selection;
+
+			if ( window.getSelection ) {
+				selection = window.getSelection();
+				if ( selection.rangeCount ) {
+					this.range = selection.getRangeAt( 0 );
+				}
+
+			// Support: IE8
+			} else {
+				this.range = document.selection.createRange();
+			}
+		},
+
+		click: function( event ) {
+			this._setSelection();
+			this._toggle( event );
+		},
+
+		keydown: function( event ) {
+			var preventDefault = true;
+			switch ( event.keyCode ) {
+			case $.ui.keyCode.TAB:
+			case $.ui.keyCode.ESCAPE:
+				this.close( event );
+				preventDefault = false;
+				break;
+			case $.ui.keyCode.ENTER:
+				if ( this.isOpen ) {
+					this._selectFocusedItem( event );
+				}
+				break;
+			case $.ui.keyCode.UP:
+				if ( event.altKey ) {
+					this._toggle( event );
+				} else {
+					this._move( "prev", event );
+				}
+				break;
+			case $.ui.keyCode.DOWN:
+				if ( event.altKey ) {
+					this._toggle( event );
+				} else {
+					this._move( "next", event );
+				}
+				break;
+			case $.ui.keyCode.SPACE:
+				if ( this.isOpen ) {
+					this._selectFocusedItem( event );
+				} else {
+					this._toggle( event );
+				}
+				break;
+			case $.ui.keyCode.LEFT:
+				this._move( "prev", event );
+				break;
+			case $.ui.keyCode.RIGHT:
+				this._move( "next", event );
+				break;
+			case $.ui.keyCode.HOME:
+			case $.ui.keyCode.PAGE_UP:
+				this._move( "first", event );
+				break;
+			case $.ui.keyCode.END:
+			case $.ui.keyCode.PAGE_DOWN:
+				this._move( "last", event );
+				break;
+			default:
+				this.menu.trigger( event );
+				preventDefault = false;
+			}
+
+			if ( preventDefault ) {
+				event.preventDefault();
+			}
+		}
+	},
+
+	_selectFocusedItem: function( event ) {
+		var item = this.menuItems.eq( this.focusIndex ).parent( "li" );
+		if ( !item.hasClass( "ui-state-disabled" ) ) {
+			this._select( item.data( "ui-selectmenu-item" ), event );
+		}
+	},
+
+	_select: function( item, event ) {
+		var oldIndex = this.element[ 0 ].selectedIndex;
+
+		// Change native select element
+		this.element[ 0 ].selectedIndex = item.index;
+		this.buttonItem.replaceWith( this.buttonItem = this._renderButtonItem( item ) );
+		this._setAria( item );
+		this._trigger( "select", event, { item: item } );
+
+		if ( item.index !== oldIndex ) {
+			this._trigger( "change", event, { item: item } );
+		}
+
+		this.close( event );
+	},
+
+	_setAria: function( item ) {
+		var id = this.menuItems.eq( item.index ).attr( "id" );
+
+		this.button.attr( {
+			"aria-labelledby": id,
+			"aria-activedescendant": id
+		} );
+		this.menu.attr( "aria-activedescendant", id );
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "icons" ) {
+			var icon = this.button.find( "span.ui-icon" );
+			this._removeClass( icon, null, this.options.icons.button )
+				._addClass( icon, null, value.button );
+		}
+
+		this._super( key, value );
+
+		if ( key === "appendTo" ) {
+			this.menuWrap.appendTo( this._appendTo() );
+		}
+
+		if ( key === "width" ) {
+			this._resizeButton();
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.menuInstance.option( "disabled", value );
+		this.button.attr( "aria-disabled", value );
+		this._toggleClass( this.button, null, "ui-state-disabled", value );
+
+		this.element.prop( "disabled", value );
+		if ( value ) {
+			this.button.attr( "tabindex", -1 );
+			this.close();
+		} else {
+			this.button.attr( "tabindex", 0 );
+		}
+	},
+
+	_appendTo: function() {
+		var element = this.options.appendTo;
+
+		if ( element ) {
+			element = element.jquery || element.nodeType ?
+				$( element ) :
+				this.document.find( element ).eq( 0 );
+		}
+
+		if ( !element || !element[ 0 ] ) {
+			element = this.element.closest( ".ui-front, dialog" );
+		}
+
+		if ( !element.length ) {
+			element = this.document[ 0 ].body;
+		}
+
+		return element;
+	},
+
+	_toggleAttr: function() {
+		this.button.attr( "aria-expanded", this.isOpen );
+
+		// We can't use two _toggleClass() calls here, because we need to make sure
+		// we always remove classes first and add them second, otherwise if both classes have the
+		// same theme class, it will be removed after we add it.
+		this._removeClass( this.button, "ui-selectmenu-button-" +
+			( this.isOpen ? "closed" : "open" ) )
+			._addClass( this.button, "ui-selectmenu-button-" +
+				( this.isOpen ? "open" : "closed" ) )
+			._toggleClass( this.menuWrap, "ui-selectmenu-open", null, this.isOpen );
+
+		this.menu.attr( "aria-hidden", !this.isOpen );
+	},
+
+	_resizeButton: function() {
+		var width = this.options.width;
+
+		// For `width: false`, just remove inline style and stop
+		if ( width === false ) {
+			this.button.css( "width", "" );
+			return;
+		}
+
+		// For `width: null`, match the width of the original element
+		if ( width === null ) {
+			width = this.element.show().outerWidth();
+			this.element.hide();
+		}
+
+		this.button.outerWidth( width );
+	},
+
+	_resizeMenu: function() {
+		this.menu.outerWidth( Math.max(
+			this.button.outerWidth(),
+
+			// Support: IE10
+			// IE10 wraps long text (possibly a rounding bug)
+			// so we add 1px to avoid the wrapping
+			this.menu.width( "" ).outerWidth() + 1
+		) );
+	},
+
+	_getCreateOptions: function() {
+		var options = this._super();
+
+		options.disabled = this.element.prop( "disabled" );
+
+		return options;
+	},
+
+	_parseOptions: function( options ) {
+		var that = this,
+			data = [];
+		options.each( function( index, item ) {
+			data.push( that._parseOption( $( item ), index ) );
+		} );
+		this.items = data;
+	},
+
+	_parseOption: function( option, index ) {
+		var optgroup = option.parent( "optgroup" );
+
+		return {
+			element: option,
+			index: index,
+			value: option.val(),
+			label: option.text(),
+			optgroup: optgroup.attr( "label" ) || "",
+			disabled: optgroup.prop( "disabled" ) || option.prop( "disabled" )
+		};
+	},
+
+	_destroy: function() {
+		this._unbindFormResetHandler();
+		this.menuWrap.remove();
+		this.button.remove();
+		this.element.show();
+		this.element.removeUniqueId();
+		this.labels.attr( "for", this.ids.element );
+	}
+} ] );
+
+
+/*!
+ * jQuery UI Slider 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
-;/*
- * jQuery UI Effects Fold 1.8.14
+
+//>>label: Slider
+//>>group: Widgets
+//>>description: Displays a flexible slider with ranges and accessibility via keyboard.
+//>>docs: http://api.jqueryui.com/slider/
+//>>demos: http://jqueryui.com/slider/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/slider.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsSlider = $.widget( "ui.slider", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "slide",
+
+	options: {
+		animate: false,
+		classes: {
+			"ui-slider": "ui-corner-all",
+			"ui-slider-handle": "ui-corner-all",
+
+			// Note: ui-widget-header isn't the most fittingly semantic framework class for this
+			// element, but worked best visually with a variety of themes
+			"ui-slider-range": "ui-corner-all ui-widget-header"
+		},
+		distance: 0,
+		max: 100,
+		min: 0,
+		orientation: "horizontal",
+		range: false,
+		step: 1,
+		value: 0,
+		values: null,
+
+		// Callbacks
+		change: null,
+		slide: null,
+		start: null,
+		stop: null
+	},
+
+	// Number of pages in a slider
+	// (how many times can you page up/down to go through the whole range)
+	numPages: 5,
+
+	_create: function() {
+		this._keySliding = false;
+		this._mouseSliding = false;
+		this._animateOff = true;
+		this._handleIndex = null;
+		this._detectOrientation();
+		this._mouseInit();
+		this._calculateNewMax();
+
+		this._addClass( "ui-slider ui-slider-" + this.orientation,
+			"ui-widget ui-widget-content" );
+
+		this._refresh();
+
+		this._animateOff = false;
+	},
+
+	_refresh: function() {
+		this._createRange();
+		this._createHandles();
+		this._setupEvents();
+		this._refreshValue();
+	},
+
+	_createHandles: function() {
+		var i, handleCount,
+			options = this.options,
+			existingHandles = this.element.find( ".ui-slider-handle" ),
+			handle = "<span tabindex='0'></span>",
+			handles = [];
+
+		handleCount = ( options.values && options.values.length ) || 1;
+
+		if ( existingHandles.length > handleCount ) {
+			existingHandles.slice( handleCount ).remove();
+			existingHandles = existingHandles.slice( 0, handleCount );
+		}
+
+		for ( i = existingHandles.length; i < handleCount; i++ ) {
+			handles.push( handle );
+		}
+
+		this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) );
+
+		this._addClass( this.handles, "ui-slider-handle", "ui-state-default" );
+
+		this.handle = this.handles.eq( 0 );
+
+		this.handles.each( function( i ) {
+			$( this )
+				.data( "ui-slider-handle-index", i )
+				.attr( "tabIndex", 0 );
+		} );
+	},
+
+	_createRange: function() {
+		var options = this.options;
+
+		if ( options.range ) {
+			if ( options.range === true ) {
+				if ( !options.values ) {
+					options.values = [ this._valueMin(), this._valueMin() ];
+				} else if ( options.values.length && options.values.length !== 2 ) {
+					options.values = [ options.values[ 0 ], options.values[ 0 ] ];
+				} else if ( $.isArray( options.values ) ) {
+					options.values = options.values.slice( 0 );
+				}
+			}
+
+			if ( !this.range || !this.range.length ) {
+				this.range = $( "<div>" )
+					.appendTo( this.element );
+
+				this._addClass( this.range, "ui-slider-range" );
+			} else {
+				this._removeClass( this.range, "ui-slider-range-min ui-slider-range-max" );
+
+				// Handle range switching from true to min/max
+				this.range.css( {
+					"left": "",
+					"bottom": ""
+				} );
+			}
+			if ( options.range === "min" || options.range === "max" ) {
+				this._addClass( this.range, "ui-slider-range-" + options.range );
+			}
+		} else {
+			if ( this.range ) {
+				this.range.remove();
+			}
+			this.range = null;
+		}
+	},
+
+	_setupEvents: function() {
+		this._off( this.handles );
+		this._on( this.handles, this._handleEvents );
+		this._hoverable( this.handles );
+		this._focusable( this.handles );
+	},
+
+	_destroy: function() {
+		this.handles.remove();
+		if ( this.range ) {
+			this.range.remove();
+		}
+
+		this._mouseDestroy();
+	},
+
+	_mouseCapture: function( event ) {
+		var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
+			that = this,
+			o = this.options;
+
+		if ( o.disabled ) {
+			return false;
+		}
+
+		this.elementSize = {
+			width: this.element.outerWidth(),
+			height: this.element.outerHeight()
+		};
+		this.elementOffset = this.element.offset();
+
+		position = { x: event.pageX, y: event.pageY };
+		normValue = this._normValueFromMouse( position );
+		distance = this._valueMax() - this._valueMin() + 1;
+		this.handles.each( function( i ) {
+			var thisDistance = Math.abs( normValue - that.values( i ) );
+			if ( ( distance > thisDistance ) ||
+				( distance === thisDistance &&
+					( i === that._lastChangedValue || that.values( i ) === o.min ) ) ) {
+				distance = thisDistance;
+				closestHandle = $( this );
+				index = i;
+			}
+		} );
+
+		allowed = this._start( event, index );
+		if ( allowed === false ) {
+			return false;
+		}
+		this._mouseSliding = true;
+
+		this._handleIndex = index;
+
+		this._addClass( closestHandle, null, "ui-state-active" );
+		closestHandle.trigger( "focus" );
+
+		offset = closestHandle.offset();
+		mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" );
+		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+			left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+			top: event.pageY - offset.top -
+				( closestHandle.height() / 2 ) -
+				( parseInt( closestHandle.css( "borderTopWidth" ), 10 ) || 0 ) -
+				( parseInt( closestHandle.css( "borderBottomWidth" ), 10 ) || 0 ) +
+				( parseInt( closestHandle.css( "marginTop" ), 10 ) || 0 )
+		};
+
+		if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+			this._slide( event, index, normValue );
+		}
+		this._animateOff = true;
+		return true;
+	},
+
+	_mouseStart: function() {
+		return true;
+	},
+
+	_mouseDrag: function( event ) {
+		var position = { x: event.pageX, y: event.pageY },
+			normValue = this._normValueFromMouse( position );
+
+		this._slide( event, this._handleIndex, normValue );
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+		this._removeClass( this.handles, null, "ui-state-active" );
+		this._mouseSliding = false;
+
+		this._stop( event, this._handleIndex );
+		this._change( event, this._handleIndex );
+
+		this._handleIndex = null;
+		this._clickOffset = null;
+		this._animateOff = false;
+
+		return false;
+	},
+
+	_detectOrientation: function() {
+		this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+	},
+
+	_normValueFromMouse: function( position ) {
+		var pixelTotal,
+			pixelMouse,
+			percentMouse,
+			valueTotal,
+			valueMouse;
+
+		if ( this.orientation === "horizontal" ) {
+			pixelTotal = this.elementSize.width;
+			pixelMouse = position.x - this.elementOffset.left -
+				( this._clickOffset ? this._clickOffset.left : 0 );
+		} else {
+			pixelTotal = this.elementSize.height;
+			pixelMouse = position.y - this.elementOffset.top -
+				( this._clickOffset ? this._clickOffset.top : 0 );
+		}
+
+		percentMouse = ( pixelMouse / pixelTotal );
+		if ( percentMouse > 1 ) {
+			percentMouse = 1;
+		}
+		if ( percentMouse < 0 ) {
+			percentMouse = 0;
+		}
+		if ( this.orientation === "vertical" ) {
+			percentMouse = 1 - percentMouse;
+		}
+
+		valueTotal = this._valueMax() - this._valueMin();
+		valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+		return this._trimAlignValue( valueMouse );
+	},
+
+	_uiHash: function( index, value, values ) {
+		var uiHash = {
+			handle: this.handles[ index ],
+			handleIndex: index,
+			value: value !== undefined ? value : this.value()
+		};
+
+		if ( this._hasMultipleValues() ) {
+			uiHash.value = value !== undefined ? value : this.values( index );
+			uiHash.values = values || this.values();
+		}
+
+		return uiHash;
+	},
+
+	_hasMultipleValues: function() {
+		return this.options.values && this.options.values.length;
+	},
+
+	_start: function( event, index ) {
+		return this._trigger( "start", event, this._uiHash( index ) );
+	},
+
+	_slide: function( event, index, newVal ) {
+		var allowed, otherVal,
+			currentValue = this.value(),
+			newValues = this.values();
+
+		if ( this._hasMultipleValues() ) {
+			otherVal = this.values( index ? 0 : 1 );
+			currentValue = this.values( index );
+
+			if ( this.options.values.length === 2 && this.options.range === true ) {
+				newVal =  index === 0 ? Math.min( otherVal, newVal ) : Math.max( otherVal, newVal );
+			}
+
+			newValues[ index ] = newVal;
+		}
+
+		if ( newVal === currentValue ) {
+			return;
+		}
+
+		allowed = this._trigger( "slide", event, this._uiHash( index, newVal, newValues ) );
+
+		// A slide can be canceled by returning false from the slide callback
+		if ( allowed === false ) {
+			return;
+		}
+
+		if ( this._hasMultipleValues() ) {
+			this.values( index, newVal );
+		} else {
+			this.value( newVal );
+		}
+	},
+
+	_stop: function( event, index ) {
+		this._trigger( "stop", event, this._uiHash( index ) );
+	},
+
+	_change: function( event, index ) {
+		if ( !this._keySliding && !this._mouseSliding ) {
+
+			//store the last changed value index for reference when handles overlap
+			this._lastChangedValue = index;
+			this._trigger( "change", event, this._uiHash( index ) );
+		}
+	},
+
+	value: function( newValue ) {
+		if ( arguments.length ) {
+			this.options.value = this._trimAlignValue( newValue );
+			this._refreshValue();
+			this._change( null, 0 );
+			return;
+		}
+
+		return this._value();
+	},
+
+	values: function( index, newValue ) {
+		var vals,
+			newValues,
+			i;
+
+		if ( arguments.length > 1 ) {
+			this.options.values[ index ] = this._trimAlignValue( newValue );
+			this._refreshValue();
+			this._change( null, index );
+			return;
+		}
+
+		if ( arguments.length ) {
+			if ( $.isArray( arguments[ 0 ] ) ) {
+				vals = this.options.values;
+				newValues = arguments[ 0 ];
+				for ( i = 0; i < vals.length; i += 1 ) {
+					vals[ i ] = this._trimAlignValue( newValues[ i ] );
+					this._change( null, i );
+				}
+				this._refreshValue();
+			} else {
+				if ( this._hasMultipleValues() ) {
+					return this._values( index );
+				} else {
+					return this.value();
+				}
+			}
+		} else {
+			return this._values();
+		}
+	},
+
+	_setOption: function( key, value ) {
+		var i,
+			valsLength = 0;
+
+		if ( key === "range" && this.options.range === true ) {
+			if ( value === "min" ) {
+				this.options.value = this._values( 0 );
+				this.options.values = null;
+			} else if ( value === "max" ) {
+				this.options.value = this._values( this.options.values.length - 1 );
+				this.options.values = null;
+			}
+		}
+
+		if ( $.isArray( this.options.values ) ) {
+			valsLength = this.options.values.length;
+		}
+
+		this._super( key, value );
+
+		switch ( key ) {
+			case "orientation":
+				this._detectOrientation();
+				this._removeClass( "ui-slider-horizontal ui-slider-vertical" )
+					._addClass( "ui-slider-" + this.orientation );
+				this._refreshValue();
+				if ( this.options.range ) {
+					this._refreshRange( value );
+				}
+
+				// Reset positioning from previous orientation
+				this.handles.css( value === "horizontal" ? "bottom" : "left", "" );
+				break;
+			case "value":
+				this._animateOff = true;
+				this._refreshValue();
+				this._change( null, 0 );
+				this._animateOff = false;
+				break;
+			case "values":
+				this._animateOff = true;
+				this._refreshValue();
+
+				// Start from the last handle to prevent unreachable handles (#9046)
+				for ( i = valsLength - 1; i >= 0; i-- ) {
+					this._change( null, i );
+				}
+				this._animateOff = false;
+				break;
+			case "step":
+			case "min":
+			case "max":
+				this._animateOff = true;
+				this._calculateNewMax();
+				this._refreshValue();
+				this._animateOff = false;
+				break;
+			case "range":
+				this._animateOff = true;
+				this._refresh();
+				this._animateOff = false;
+				break;
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this._toggleClass( null, "ui-state-disabled", !!value );
+	},
+
+	//internal value getter
+	// _value() returns value trimmed by min and max, aligned by step
+	_value: function() {
+		var val = this.options.value;
+		val = this._trimAlignValue( val );
+
+		return val;
+	},
+
+	//internal values getter
+	// _values() returns array of values trimmed by min and max, aligned by step
+	// _values( index ) returns single value trimmed by min and max, aligned by step
+	_values: function( index ) {
+		var val,
+			vals,
+			i;
+
+		if ( arguments.length ) {
+			val = this.options.values[ index ];
+			val = this._trimAlignValue( val );
+
+			return val;
+		} else if ( this._hasMultipleValues() ) {
+
+			// .slice() creates a copy of the array
+			// this copy gets trimmed by min and max and then returned
+			vals = this.options.values.slice();
+			for ( i = 0; i < vals.length; i += 1 ) {
+				vals[ i ] = this._trimAlignValue( vals[ i ] );
+			}
+
+			return vals;
+		} else {
+			return [];
+		}
+	},
+
+	// Returns the step-aligned value that val is closest to, between (inclusive) min and max
+	_trimAlignValue: function( val ) {
+		if ( val <= this._valueMin() ) {
+			return this._valueMin();
+		}
+		if ( val >= this._valueMax() ) {
+			return this._valueMax();
+		}
+		var step = ( this.options.step > 0 ) ? this.options.step : 1,
+			valModStep = ( val - this._valueMin() ) % step,
+			alignValue = val - valModStep;
+
+		if ( Math.abs( valModStep ) * 2 >= step ) {
+			alignValue += ( valModStep > 0 ) ? step : ( -step );
+		}
+
+		// Since JavaScript has problems with large floats, round
+		// the final value to 5 digits after the decimal point (see #4124)
+		return parseFloat( alignValue.toFixed( 5 ) );
+	},
+
+	_calculateNewMax: function() {
+		var max = this.options.max,
+			min = this._valueMin(),
+			step = this.options.step,
+			aboveMin = Math.round( ( max - min ) / step ) * step;
+		max = aboveMin + min;
+		if ( max > this.options.max ) {
+
+			//If max is not divisible by step, rounding off may increase its value
+			max -= step;
+		}
+		this.max = parseFloat( max.toFixed( this._precision() ) );
+	},
+
+	_precision: function() {
+		var precision = this._precisionOf( this.options.step );
+		if ( this.options.min !== null ) {
+			precision = Math.max( precision, this._precisionOf( this.options.min ) );
+		}
+		return precision;
+	},
+
+	_precisionOf: function( num ) {
+		var str = num.toString(),
+			decimal = str.indexOf( "." );
+		return decimal === -1 ? 0 : str.length - decimal - 1;
+	},
+
+	_valueMin: function() {
+		return this.options.min;
+	},
+
+	_valueMax: function() {
+		return this.max;
+	},
+
+	_refreshRange: function( orientation ) {
+		if ( orientation === "vertical" ) {
+			this.range.css( { "width": "", "left": "" } );
+		}
+		if ( orientation === "horizontal" ) {
+			this.range.css( { "height": "", "bottom": "" } );
+		}
+	},
+
+	_refreshValue: function() {
+		var lastValPercent, valPercent, value, valueMin, valueMax,
+			oRange = this.options.range,
+			o = this.options,
+			that = this,
+			animate = ( !this._animateOff ) ? o.animate : false,
+			_set = {};
+
+		if ( this._hasMultipleValues() ) {
+			this.handles.each( function( i ) {
+				valPercent = ( that.values( i ) - that._valueMin() ) / ( that._valueMax() -
+					that._valueMin() ) * 100;
+				_set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+				$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+				if ( that.options.range === true ) {
+					if ( that.orientation === "horizontal" ) {
+						if ( i === 0 ) {
+							that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+								left: valPercent + "%"
+							}, o.animate );
+						}
+						if ( i === 1 ) {
+							that.range[ animate ? "animate" : "css" ]( {
+								width: ( valPercent - lastValPercent ) + "%"
+							}, {
+								queue: false,
+								duration: o.animate
+							} );
+						}
+					} else {
+						if ( i === 0 ) {
+							that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+								bottom: ( valPercent ) + "%"
+							}, o.animate );
+						}
+						if ( i === 1 ) {
+							that.range[ animate ? "animate" : "css" ]( {
+								height: ( valPercent - lastValPercent ) + "%"
+							}, {
+								queue: false,
+								duration: o.animate
+							} );
+						}
+					}
+				}
+				lastValPercent = valPercent;
+			} );
+		} else {
+			value = this.value();
+			valueMin = this._valueMin();
+			valueMax = this._valueMax();
+			valPercent = ( valueMax !== valueMin ) ?
+					( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+					0;
+			_set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+			this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+			if ( oRange === "min" && this.orientation === "horizontal" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					width: valPercent + "%"
+				}, o.animate );
+			}
+			if ( oRange === "max" && this.orientation === "horizontal" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					width: ( 100 - valPercent ) + "%"
+				}, o.animate );
+			}
+			if ( oRange === "min" && this.orientation === "vertical" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					height: valPercent + "%"
+				}, o.animate );
+			}
+			if ( oRange === "max" && this.orientation === "vertical" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					height: ( 100 - valPercent ) + "%"
+				}, o.animate );
+			}
+		}
+	},
+
+	_handleEvents: {
+		keydown: function( event ) {
+			var allowed, curVal, newVal, step,
+				index = $( event.target ).data( "ui-slider-handle-index" );
+
+			switch ( event.keyCode ) {
+				case $.ui.keyCode.HOME:
+				case $.ui.keyCode.END:
+				case $.ui.keyCode.PAGE_UP:
+				case $.ui.keyCode.PAGE_DOWN:
+				case $.ui.keyCode.UP:
+				case $.ui.keyCode.RIGHT:
+				case $.ui.keyCode.DOWN:
+				case $.ui.keyCode.LEFT:
+					event.preventDefault();
+					if ( !this._keySliding ) {
+						this._keySliding = true;
+						this._addClass( $( event.target ), null, "ui-state-active" );
+						allowed = this._start( event, index );
+						if ( allowed === false ) {
+							return;
+						}
+					}
+					break;
+			}
+
+			step = this.options.step;
+			if ( this._hasMultipleValues() ) {
+				curVal = newVal = this.values( index );
+			} else {
+				curVal = newVal = this.value();
+			}
+
+			switch ( event.keyCode ) {
+				case $.ui.keyCode.HOME:
+					newVal = this._valueMin();
+					break;
+				case $.ui.keyCode.END:
+					newVal = this._valueMax();
+					break;
+				case $.ui.keyCode.PAGE_UP:
+					newVal = this._trimAlignValue(
+						curVal + ( ( this._valueMax() - this._valueMin() ) / this.numPages )
+					);
+					break;
+				case $.ui.keyCode.PAGE_DOWN:
+					newVal = this._trimAlignValue(
+						curVal - ( ( this._valueMax() - this._valueMin() ) / this.numPages ) );
+					break;
+				case $.ui.keyCode.UP:
+				case $.ui.keyCode.RIGHT:
+					if ( curVal === this._valueMax() ) {
+						return;
+					}
+					newVal = this._trimAlignValue( curVal + step );
+					break;
+				case $.ui.keyCode.DOWN:
+				case $.ui.keyCode.LEFT:
+					if ( curVal === this._valueMin() ) {
+						return;
+					}
+					newVal = this._trimAlignValue( curVal - step );
+					break;
+			}
+
+			this._slide( event, index, newVal );
+		},
+		keyup: function( event ) {
+			var index = $( event.target ).data( "ui-slider-handle-index" );
+
+			if ( this._keySliding ) {
+				this._keySliding = false;
+				this._stop( event, index );
+				this._change( event, index );
+				this._removeClass( $( event.target ), null, "ui-state-active" );
+			}
+		}
+	}
+} );
+
+
+/*!
+ * jQuery UI Spinner 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Spinner
+//>>group: Widgets
+//>>description: Displays buttons to easily input numbers via the keyboard or mouse.
+//>>docs: http://api.jqueryui.com/spinner/
+//>>demos: http://jqueryui.com/spinner/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/spinner.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+function spinnerModifer( fn ) {
+	return function() {
+		var previous = this.element.val();
+		fn.apply( this, arguments );
+		this._refresh();
+		if ( previous !== this.element.val() ) {
+			this._trigger( "change" );
+		}
+	};
+}
+
+$.widget( "ui.spinner", {
+	version: "1.12.1",
+	defaultElement: "<input>",
+	widgetEventPrefix: "spin",
+	options: {
+		classes: {
+			"ui-spinner": "ui-corner-all",
+			"ui-spinner-down": "ui-corner-br",
+			"ui-spinner-up": "ui-corner-tr"
+		},
+		culture: null,
+		icons: {
+			down: "ui-icon-triangle-1-s",
+			up: "ui-icon-triangle-1-n"
+		},
+		incremental: true,
+		max: null,
+		min: null,
+		numberFormat: null,
+		page: 10,
+		step: 1,
+
+		change: null,
+		spin: null,
+		start: null,
+		stop: null
+	},
+
+	_create: function() {
+
+		// handle string values that need to be parsed
+		this._setOption( "max", this.options.max );
+		this._setOption( "min", this.options.min );
+		this._setOption( "step", this.options.step );
+
+		// Only format if there is a value, prevents the field from being marked
+		// as invalid in Firefox, see #9573.
+		if ( this.value() !== "" ) {
+
+			// Format the value, but don't constrain.
+			this._value( this.element.val(), true );
+		}
+
+		this._draw();
+		this._on( this._events );
+		this._refresh();
+
+		// Turning off autocomplete prevents the browser from remembering the
+		// value when navigating through history, so we re-enable autocomplete
+		// if the page is unloaded before the widget is destroyed. #7790
+		this._on( this.window, {
+			beforeunload: function() {
+				this.element.removeAttr( "autocomplete" );
+			}
+		} );
+	},
+
+	_getCreateOptions: function() {
+		var options = this._super();
+		var element = this.element;
+
+		$.each( [ "min", "max", "step" ], function( i, option ) {
+			var value = element.attr( option );
+			if ( value != null && value.length ) {
+				options[ option ] = value;
+			}
+		} );
+
+		return options;
+	},
+
+	_events: {
+		keydown: function( event ) {
+			if ( this._start( event ) && this._keydown( event ) ) {
+				event.preventDefault();
+			}
+		},
+		keyup: "_stop",
+		focus: function() {
+			this.previous = this.element.val();
+		},
+		blur: function( event ) {
+			if ( this.cancelBlur ) {
+				delete this.cancelBlur;
+				return;
+			}
+
+			this._stop();
+			this._refresh();
+			if ( this.previous !== this.element.val() ) {
+				this._trigger( "change", event );
+			}
+		},
+		mousewheel: function( event, delta ) {
+			if ( !delta ) {
+				return;
+			}
+			if ( !this.spinning && !this._start( event ) ) {
+				return false;
+			}
+
+			this._spin( ( delta > 0 ? 1 : -1 ) * this.options.step, event );
+			clearTimeout( this.mousewheelTimer );
+			this.mousewheelTimer = this._delay( function() {
+				if ( this.spinning ) {
+					this._stop( event );
+				}
+			}, 100 );
+			event.preventDefault();
+		},
+		"mousedown .ui-spinner-button": function( event ) {
+			var previous;
+
+			// We never want the buttons to have focus; whenever the user is
+			// interacting with the spinner, the focus should be on the input.
+			// If the input is focused then this.previous is properly set from
+			// when the input first received focus. If the input is not focused
+			// then we need to set this.previous based on the value before spinning.
+			previous = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] ) ?
+				this.previous : this.element.val();
+			function checkFocus() {
+				var isActive = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] );
+				if ( !isActive ) {
+					this.element.trigger( "focus" );
+					this.previous = previous;
+
+					// support: IE
+					// IE sets focus asynchronously, so we need to check if focus
+					// moved off of the input because the user clicked on the button.
+					this._delay( function() {
+						this.previous = previous;
+					} );
+				}
+			}
+
+			// Ensure focus is on (or stays on) the text field
+			event.preventDefault();
+			checkFocus.call( this );
+
+			// Support: IE
+			// IE doesn't prevent moving focus even with event.preventDefault()
+			// so we set a flag to know when we should ignore the blur event
+			// and check (again) if focus moved off of the input.
+			this.cancelBlur = true;
+			this._delay( function() {
+				delete this.cancelBlur;
+				checkFocus.call( this );
+			} );
+
+			if ( this._start( event ) === false ) {
+				return;
+			}
+
+			this._repeat( null, $( event.currentTarget )
+				.hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+		},
+		"mouseup .ui-spinner-button": "_stop",
+		"mouseenter .ui-spinner-button": function( event ) {
+
+			// button will add ui-state-active if mouse was down while mouseleave and kept down
+			if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) {
+				return;
+			}
+
+			if ( this._start( event ) === false ) {
+				return false;
+			}
+			this._repeat( null, $( event.currentTarget )
+				.hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+		},
+
+		// TODO: do we really want to consider this a stop?
+		// shouldn't we just stop the repeater and wait until mouseup before
+		// we trigger the stop event?
+		"mouseleave .ui-spinner-button": "_stop"
+	},
+
+	// Support mobile enhanced option and make backcompat more sane
+	_enhance: function() {
+		this.uiSpinner = this.element
+			.attr( "autocomplete", "off" )
+			.wrap( "<span>" )
+			.parent()
+
+				// Add buttons
+				.append(
+					"<a></a><a></a>"
+				);
+	},
+
+	_draw: function() {
+		this._enhance();
+
+		this._addClass( this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content" );
+		this._addClass( "ui-spinner-input" );
+
+		this.element.attr( "role", "spinbutton" );
+
+		// Button bindings
+		this.buttons = this.uiSpinner.children( "a" )
+			.attr( "tabIndex", -1 )
+			.attr( "aria-hidden", true )
+			.button( {
+				classes: {
+					"ui-button": ""
+				}
+			} );
+
+		// TODO: Right now button does not support classes this is already updated in button PR
+		this._removeClass( this.buttons, "ui-corner-all" );
+
+		this._addClass( this.buttons.first(), "ui-spinner-button ui-spinner-up" );
+		this._addClass( this.buttons.last(), "ui-spinner-button ui-spinner-down" );
+		this.buttons.first().button( {
+			"icon": this.options.icons.up,
+			"showLabel": false
+		} );
+		this.buttons.last().button( {
+			"icon": this.options.icons.down,
+			"showLabel": false
+		} );
+
+		// IE 6 doesn't understand height: 50% for the buttons
+		// unless the wrapper has an explicit height
+		if ( this.buttons.height() > Math.ceil( this.uiSpinner.height() * 0.5 ) &&
+				this.uiSpinner.height() > 0 ) {
+			this.uiSpinner.height( this.uiSpinner.height() );
+		}
+	},
+
+	_keydown: function( event ) {
+		var options = this.options,
+			keyCode = $.ui.keyCode;
+
+		switch ( event.keyCode ) {
+		case keyCode.UP:
+			this._repeat( null, 1, event );
+			return true;
+		case keyCode.DOWN:
+			this._repeat( null, -1, event );
+			return true;
+		case keyCode.PAGE_UP:
+			this._repeat( null, options.page, event );
+			return true;
+		case keyCode.PAGE_DOWN:
+			this._repeat( null, -options.page, event );
+			return true;
+		}
+
+		return false;
+	},
+
+	_start: function( event ) {
+		if ( !this.spinning && this._trigger( "start", event ) === false ) {
+			return false;
+		}
+
+		if ( !this.counter ) {
+			this.counter = 1;
+		}
+		this.spinning = true;
+		return true;
+	},
+
+	_repeat: function( i, steps, event ) {
+		i = i || 500;
+
+		clearTimeout( this.timer );
+		this.timer = this._delay( function() {
+			this._repeat( 40, steps, event );
+		}, i );
+
+		this._spin( steps * this.options.step, event );
+	},
+
+	_spin: function( step, event ) {
+		var value = this.value() || 0;
+
+		if ( !this.counter ) {
+			this.counter = 1;
+		}
+
+		value = this._adjustValue( value + step * this._increment( this.counter ) );
+
+		if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false ) {
+			this._value( value );
+			this.counter++;
+		}
+	},
+
+	_increment: function( i ) {
+		var incremental = this.options.incremental;
+
+		if ( incremental ) {
+			return $.isFunction( incremental ) ?
+				incremental( i ) :
+				Math.floor( i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1 );
+		}
+
+		return 1;
+	},
+
+	_precision: function() {
+		var precision = this._precisionOf( this.options.step );
+		if ( this.options.min !== null ) {
+			precision = Math.max( precision, this._precisionOf( this.options.min ) );
+		}
+		return precision;
+	},
+
+	_precisionOf: function( num ) {
+		var str = num.toString(),
+			decimal = str.indexOf( "." );
+		return decimal === -1 ? 0 : str.length - decimal - 1;
+	},
+
+	_adjustValue: function( value ) {
+		var base, aboveMin,
+			options = this.options;
+
+		// Make sure we're at a valid step
+		// - find out where we are relative to the base (min or 0)
+		base = options.min !== null ? options.min : 0;
+		aboveMin = value - base;
+
+		// - round to the nearest step
+		aboveMin = Math.round( aboveMin / options.step ) * options.step;
+
+		// - rounding is based on 0, so adjust back to our base
+		value = base + aboveMin;
+
+		// Fix precision from bad JS floating point math
+		value = parseFloat( value.toFixed( this._precision() ) );
+
+		// Clamp the value
+		if ( options.max !== null && value > options.max ) {
+			return options.max;
+		}
+		if ( options.min !== null && value < options.min ) {
+			return options.min;
+		}
+
+		return value;
+	},
+
+	_stop: function( event ) {
+		if ( !this.spinning ) {
+			return;
+		}
+
+		clearTimeout( this.timer );
+		clearTimeout( this.mousewheelTimer );
+		this.counter = 0;
+		this.spinning = false;
+		this._trigger( "stop", event );
+	},
+
+	_setOption: function( key, value ) {
+		var prevValue, first, last;
+
+		if ( key === "culture" || key === "numberFormat" ) {
+			prevValue = this._parse( this.element.val() );
+			this.options[ key ] = value;
+			this.element.val( this._format( prevValue ) );
+			return;
+		}
+
+		if ( key === "max" || key === "min" || key === "step" ) {
+			if ( typeof value === "string" ) {
+				value = this._parse( value );
+			}
+		}
+		if ( key === "icons" ) {
+			first = this.buttons.first().find( ".ui-icon" );
+			this._removeClass( first, null, this.options.icons.up );
+			this._addClass( first, null, value.up );
+			last = this.buttons.last().find( ".ui-icon" );
+			this._removeClass( last, null, this.options.icons.down );
+			this._addClass( last, null, value.down );
+		}
+
+		this._super( key, value );
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this._toggleClass( this.uiSpinner, null, "ui-state-disabled", !!value );
+		this.element.prop( "disabled", !!value );
+		this.buttons.button( value ? "disable" : "enable" );
+	},
+
+	_setOptions: spinnerModifer( function( options ) {
+		this._super( options );
+	} ),
+
+	_parse: function( val ) {
+		if ( typeof val === "string" && val !== "" ) {
+			val = window.Globalize && this.options.numberFormat ?
+				Globalize.parseFloat( val, 10, this.options.culture ) : +val;
+		}
+		return val === "" || isNaN( val ) ? null : val;
+	},
+
+	_format: function( value ) {
+		if ( value === "" ) {
+			return "";
+		}
+		return window.Globalize && this.options.numberFormat ?
+			Globalize.format( value, this.options.numberFormat, this.options.culture ) :
+			value;
+	},
+
+	_refresh: function() {
+		this.element.attr( {
+			"aria-valuemin": this.options.min,
+			"aria-valuemax": this.options.max,
+
+			// TODO: what should we do with values that can't be parsed?
+			"aria-valuenow": this._parse( this.element.val() )
+		} );
+	},
+
+	isValid: function() {
+		var value = this.value();
+
+		// Null is invalid
+		if ( value === null ) {
+			return false;
+		}
+
+		// If value gets adjusted, it's invalid
+		return value === this._adjustValue( value );
+	},
+
+	// Update the value without triggering change
+	_value: function( value, allowAny ) {
+		var parsed;
+		if ( value !== "" ) {
+			parsed = this._parse( value );
+			if ( parsed !== null ) {
+				if ( !allowAny ) {
+					parsed = this._adjustValue( parsed );
+				}
+				value = this._format( parsed );
+			}
+		}
+		this.element.val( value );
+		this._refresh();
+	},
+
+	_destroy: function() {
+		this.element
+			.prop( "disabled", false )
+			.removeAttr( "autocomplete role aria-valuemin aria-valuemax aria-valuenow" );
+
+		this.uiSpinner.replaceWith( this.element );
+	},
+
+	stepUp: spinnerModifer( function( steps ) {
+		this._stepUp( steps );
+	} ),
+	_stepUp: function( steps ) {
+		if ( this._start() ) {
+			this._spin( ( steps || 1 ) * this.options.step );
+			this._stop();
+		}
+	},
+
+	stepDown: spinnerModifer( function( steps ) {
+		this._stepDown( steps );
+	} ),
+	_stepDown: function( steps ) {
+		if ( this._start() ) {
+			this._spin( ( steps || 1 ) * -this.options.step );
+			this._stop();
+		}
+	},
+
+	pageUp: spinnerModifer( function( pages ) {
+		this._stepUp( ( pages || 1 ) * this.options.page );
+	} ),
+
+	pageDown: spinnerModifer( function( pages ) {
+		this._stepDown( ( pages || 1 ) * this.options.page );
+	} ),
+
+	value: function( newVal ) {
+		if ( !arguments.length ) {
+			return this._parse( this.element.val() );
+		}
+		spinnerModifer( this._value ).call( this, newVal );
+	},
+
+	widget: function() {
+		return this.uiSpinner;
+	}
+} );
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for spinner html extension points
+	$.widget( "ui.spinner", $.ui.spinner, {
+		_enhance: function() {
+			this.uiSpinner = this.element
+				.attr( "autocomplete", "off" )
+				.wrap( this._uiSpinnerHtml() )
+				.parent()
+
+					// Add buttons
+					.append( this._buttonHtml() );
+		},
+		_uiSpinnerHtml: function() {
+			return "<span>";
+		},
+
+		_buttonHtml: function() {
+			return "<a></a><a></a>";
+		}
+	} );
+}
+
+var widgetsSpinner = $.ui.spinner;
+
+
+/*!
+ * jQuery UI Tabs 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Fold
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Tabs
+//>>group: Widgets
+//>>description: Transforms a set of container elements into a tab structure.
+//>>docs: http://api.jqueryui.com/tabs/
+//>>demos: http://jqueryui.com/tabs/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/tabs.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.tabs", {
+	version: "1.12.1",
+	delay: 300,
+	options: {
+		active: null,
+		classes: {
+			"ui-tabs": "ui-corner-all",
+			"ui-tabs-nav": "ui-corner-all",
+			"ui-tabs-panel": "ui-corner-bottom",
+			"ui-tabs-tab": "ui-corner-top"
+		},
+		collapsible: false,
+		event: "click",
+		heightStyle: "content",
+		hide: null,
+		show: null,
+
+		// Callbacks
+		activate: null,
+		beforeActivate: null,
+		beforeLoad: null,
+		load: null
+	},
+
+	_isLocal: ( function() {
+		var rhash = /#.*$/;
+
+		return function( anchor ) {
+			var anchorUrl, locationUrl;
+
+			anchorUrl = anchor.href.replace( rhash, "" );
+			locationUrl = location.href.replace( rhash, "" );
+
+			// Decoding may throw an error if the URL isn't UTF-8 (#9518)
+			try {
+				anchorUrl = decodeURIComponent( anchorUrl );
+			} catch ( error ) {}
+			try {
+				locationUrl = decodeURIComponent( locationUrl );
+			} catch ( error ) {}
+
+			return anchor.hash.length > 1 && anchorUrl === locationUrl;
+		};
+	} )(),
+
+	_create: function() {
+		var that = this,
+			options = this.options;
+
+		this.running = false;
+
+		this._addClass( "ui-tabs", "ui-widget ui-widget-content" );
+		this._toggleClass( "ui-tabs-collapsible", null, options.collapsible );
+
+		this._processTabs();
+		options.active = this._initialActive();
+
+		// Take disabling tabs via class attribute from HTML
+		// into account and update option properly.
+		if ( $.isArray( options.disabled ) ) {
+			options.disabled = $.unique( options.disabled.concat(
+				$.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) {
+					return that.tabs.index( li );
+				} )
+			) ).sort();
+		}
+
+		// Check for length avoids error when initializing empty list
+		if ( this.options.active !== false && this.anchors.length ) {
+			this.active = this._findActive( options.active );
+		} else {
+			this.active = $();
+		}
+
+		this._refresh();
+
+		if ( this.active.length ) {
+			this.load( options.active );
+		}
+	},
+
+	_initialActive: function() {
+		var active = this.options.active,
+			collapsible = this.options.collapsible,
+			locationHash = location.hash.substring( 1 );
+
+		if ( active === null ) {
+
+			// check the fragment identifier in the URL
+			if ( locationHash ) {
+				this.tabs.each( function( i, tab ) {
+					if ( $( tab ).attr( "aria-controls" ) === locationHash ) {
+						active = i;
+						return false;
+					}
+				} );
+			}
+
+			// Check for a tab marked active via a class
+			if ( active === null ) {
+				active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) );
+			}
+
+			// No active tab, set to false
+			if ( active === null || active === -1 ) {
+				active = this.tabs.length ? 0 : false;
+			}
+		}
+
+		// Handle numbers: negative, out of range
+		if ( active !== false ) {
+			active = this.tabs.index( this.tabs.eq( active ) );
+			if ( active === -1 ) {
+				active = collapsible ? false : 0;
+			}
+		}
+
+		// Don't allow collapsible: false and active: false
+		if ( !collapsible && active === false && this.anchors.length ) {
+			active = 0;
+		}
+
+		return active;
+	},
+
+	_getCreateEventData: function() {
+		return {
+			tab: this.active,
+			panel: !this.active.length ? $() : this._getPanelForTab( this.active )
+		};
+	},
+
+	_tabKeydown: function( event ) {
+		var focusedTab = $( $.ui.safeActiveElement( this.document[ 0 ] ) ).closest( "li" ),
+			selectedIndex = this.tabs.index( focusedTab ),
+			goingForward = true;
+
+		if ( this._handlePageNav( event ) ) {
+			return;
+		}
+
+		switch ( event.keyCode ) {
+		case $.ui.keyCode.RIGHT:
+		case $.ui.keyCode.DOWN:
+			selectedIndex++;
+			break;
+		case $.ui.keyCode.UP:
+		case $.ui.keyCode.LEFT:
+			goingForward = false;
+			selectedIndex--;
+			break;
+		case $.ui.keyCode.END:
+			selectedIndex = this.anchors.length - 1;
+			break;
+		case $.ui.keyCode.HOME:
+			selectedIndex = 0;
+			break;
+		case $.ui.keyCode.SPACE:
+
+			// Activate only, no collapsing
+			event.preventDefault();
+			clearTimeout( this.activating );
+			this._activate( selectedIndex );
+			return;
+		case $.ui.keyCode.ENTER:
+
+			// Toggle (cancel delayed activation, allow collapsing)
+			event.preventDefault();
+			clearTimeout( this.activating );
+
+			// Determine if we should collapse or activate
+			this._activate( selectedIndex === this.options.active ? false : selectedIndex );
+			return;
+		default:
+			return;
+		}
+
+		// Focus the appropriate tab, based on which key was pressed
+		event.preventDefault();
+		clearTimeout( this.activating );
+		selectedIndex = this._focusNextTab( selectedIndex, goingForward );
+
+		// Navigating with control/command key will prevent automatic activation
+		if ( !event.ctrlKey && !event.metaKey ) {
+
+			// Update aria-selected immediately so that AT think the tab is already selected.
+			// Otherwise AT may confuse the user by stating that they need to activate the tab,
+			// but the tab will already be activated by the time the announcement finishes.
+			focusedTab.attr( "aria-selected", "false" );
+			this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" );
+
+			this.activating = this._delay( function() {
+				this.option( "active", selectedIndex );
+			}, this.delay );
+		}
+	},
+
+	_panelKeydown: function( event ) {
+		if ( this._handlePageNav( event ) ) {
+			return;
+		}
+
+		// Ctrl+up moves focus to the current tab
+		if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) {
+			event.preventDefault();
+			this.active.trigger( "focus" );
+		}
+	},
+
+	// Alt+page up/down moves focus to the previous/next tab (and activates)
+	_handlePageNav: function( event ) {
+		if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) {
+			this._activate( this._focusNextTab( this.options.active - 1, false ) );
+			return true;
+		}
+		if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) {
+			this._activate( this._focusNextTab( this.options.active + 1, true ) );
+			return true;
+		}
+	},
+
+	_findNextTab: function( index, goingForward ) {
+		var lastTabIndex = this.tabs.length - 1;
+
+		function constrain() {
+			if ( index > lastTabIndex ) {
+				index = 0;
+			}
+			if ( index < 0 ) {
+				index = lastTabIndex;
+			}
+			return index;
+		}
+
+		while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) {
+			index = goingForward ? index + 1 : index - 1;
+		}
+
+		return index;
+	},
+
+	_focusNextTab: function( index, goingForward ) {
+		index = this._findNextTab( index, goingForward );
+		this.tabs.eq( index ).trigger( "focus" );
+		return index;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "active" ) {
+
+			// _activate() will handle invalid values and update this.options
+			this._activate( value );
+			return;
+		}
+
+		this._super( key, value );
+
+		if ( key === "collapsible" ) {
+			this._toggleClass( "ui-tabs-collapsible", null, value );
+
+			// Setting collapsible: false while collapsed; open first panel
+			if ( !value && this.options.active === false ) {
+				this._activate( 0 );
+			}
+		}
+
+		if ( key === "event" ) {
+			this._setupEvents( value );
+		}
+
+		if ( key === "heightStyle" ) {
+			this._setupHeightStyle( value );
+		}
+	},
+
+	_sanitizeSelector: function( hash ) {
+		return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : "";
+	},
+
+	refresh: function() {
+		var options = this.options,
+			lis = this.tablist.children( ":has(a[href])" );
+
+		// Get disabled tabs from class attribute from HTML
+		// this will get converted to a boolean if needed in _refresh()
+		options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) {
+			return lis.index( tab );
+		} );
+
+		this._processTabs();
+
+		// Was collapsed or no tabs
+		if ( options.active === false || !this.anchors.length ) {
+			options.active = false;
+			this.active = $();
+
+		// was active, but active tab is gone
+		} else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) {
+
+			// all remaining tabs are disabled
+			if ( this.tabs.length === options.disabled.length ) {
+				options.active = false;
+				this.active = $();
+
+			// activate previous tab
+			} else {
+				this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) );
+			}
+
+		// was active, active tab still exists
+		} else {
+
+			// make sure active index is correct
+			options.active = this.tabs.index( this.active );
+		}
+
+		this._refresh();
+	},
+
+	_refresh: function() {
+		this._setOptionDisabled( this.options.disabled );
+		this._setupEvents( this.options.event );
+		this._setupHeightStyle( this.options.heightStyle );
+
+		this.tabs.not( this.active ).attr( {
+			"aria-selected": "false",
+			"aria-expanded": "false",
+			tabIndex: -1
+		} );
+		this.panels.not( this._getPanelForTab( this.active ) )
+			.hide()
+			.attr( {
+				"aria-hidden": "true"
+			} );
+
+		// Make sure one tab is in the tab order
+		if ( !this.active.length ) {
+			this.tabs.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			this.active
+				.attr( {
+					"aria-selected": "true",
+					"aria-expanded": "true",
+					tabIndex: 0
+				} );
+			this._addClass( this.active, "ui-tabs-active", "ui-state-active" );
+			this._getPanelForTab( this.active )
+				.show()
+				.attr( {
+					"aria-hidden": "false"
+				} );
+		}
+	},
+
+	_processTabs: function() {
+		var that = this,
+			prevTabs = this.tabs,
+			prevAnchors = this.anchors,
+			prevPanels = this.panels;
+
+		this.tablist = this._getList().attr( "role", "tablist" );
+		this._addClass( this.tablist, "ui-tabs-nav",
+			"ui-helper-reset ui-helper-clearfix ui-widget-header" );
+
+		// Prevent users from focusing disabled tabs via click
+		this.tablist
+			.on( "mousedown" + this.eventNamespace, "> li", function( event ) {
+				if ( $( this ).is( ".ui-state-disabled" ) ) {
+					event.preventDefault();
+				}
+			} )
+
+			// Support: IE <9
+			// Preventing the default action in mousedown doesn't prevent IE
+			// from focusing the element, so if the anchor gets focused, blur.
+			// We don't have to worry about focusing the previously focused
+			// element since clicking on a non-focusable element should focus
+			// the body anyway.
+			.on( "focus" + this.eventNamespace, ".ui-tabs-anchor", function() {
+				if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) {
+					this.blur();
+				}
+			} );
+
+		this.tabs = this.tablist.find( "> li:has(a[href])" )
+			.attr( {
+				role: "tab",
+				tabIndex: -1
+			} );
+		this._addClass( this.tabs, "ui-tabs-tab", "ui-state-default" );
+
+		this.anchors = this.tabs.map( function() {
+			return $( "a", this )[ 0 ];
+		} )
+			.attr( {
+				role: "presentation",
+				tabIndex: -1
+			} );
+		this._addClass( this.anchors, "ui-tabs-anchor" );
+
+		this.panels = $();
+
+		this.anchors.each( function( i, anchor ) {
+			var selector, panel, panelId,
+				anchorId = $( anchor ).uniqueId().attr( "id" ),
+				tab = $( anchor ).closest( "li" ),
+				originalAriaControls = tab.attr( "aria-controls" );
+
+			// Inline tab
+			if ( that._isLocal( anchor ) ) {
+				selector = anchor.hash;
+				panelId = selector.substring( 1 );
+				panel = that.element.find( that._sanitizeSelector( selector ) );
+
+			// remote tab
+			} else {
+
+				// If the tab doesn't already have aria-controls,
+				// generate an id by using a throw-away element
+				panelId = tab.attr( "aria-controls" ) || $( {} ).uniqueId()[ 0 ].id;
+				selector = "#" + panelId;
+				panel = that.element.find( selector );
+				if ( !panel.length ) {
+					panel = that._createPanel( panelId );
+					panel.insertAfter( that.panels[ i - 1 ] || that.tablist );
+				}
+				panel.attr( "aria-live", "polite" );
+			}
+
+			if ( panel.length ) {
+				that.panels = that.panels.add( panel );
+			}
+			if ( originalAriaControls ) {
+				tab.data( "ui-tabs-aria-controls", originalAriaControls );
+			}
+			tab.attr( {
+				"aria-controls": panelId,
+				"aria-labelledby": anchorId
+			} );
+			panel.attr( "aria-labelledby", anchorId );
+		} );
+
+		this.panels.attr( "role", "tabpanel" );
+		this._addClass( this.panels, "ui-tabs-panel", "ui-widget-content" );
+
+		// Avoid memory leaks (#10056)
+		if ( prevTabs ) {
+			this._off( prevTabs.not( this.tabs ) );
+			this._off( prevAnchors.not( this.anchors ) );
+			this._off( prevPanels.not( this.panels ) );
+		}
+	},
+
+	// Allow overriding how to find the list for rare usage scenarios (#7715)
+	_getList: function() {
+		return this.tablist || this.element.find( "ol, ul" ).eq( 0 );
+	},
+
+	_createPanel: function( id ) {
+		return $( "<div>" )
+			.attr( "id", id )
+			.data( "ui-tabs-destroy", true );
+	},
+
+	_setOptionDisabled: function( disabled ) {
+		var currentItem, li, i;
+
+		if ( $.isArray( disabled ) ) {
+			if ( !disabled.length ) {
+				disabled = false;
+			} else if ( disabled.length === this.anchors.length ) {
+				disabled = true;
+			}
+		}
+
+		// Disable tabs
+		for ( i = 0; ( li = this.tabs[ i ] ); i++ ) {
+			currentItem = $( li );
+			if ( disabled === true || $.inArray( i, disabled ) !== -1 ) {
+				currentItem.attr( "aria-disabled", "true" );
+				this._addClass( currentItem, null, "ui-state-disabled" );
+			} else {
+				currentItem.removeAttr( "aria-disabled" );
+				this._removeClass( currentItem, null, "ui-state-disabled" );
+			}
+		}
+
+		this.options.disabled = disabled;
+
+		this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null,
+			disabled === true );
+	},
+
+	_setupEvents: function( event ) {
+		var events = {};
+		if ( event ) {
+			$.each( event.split( " " ), function( index, eventName ) {
+				events[ eventName ] = "_eventHandler";
+			} );
+		}
+
+		this._off( this.anchors.add( this.tabs ).add( this.panels ) );
+
+		// Always prevent the default action, even when disabled
+		this._on( true, this.anchors, {
+			click: function( event ) {
+				event.preventDefault();
+			}
+		} );
+		this._on( this.anchors, events );
+		this._on( this.tabs, { keydown: "_tabKeydown" } );
+		this._on( this.panels, { keydown: "_panelKeydown" } );
+
+		this._focusable( this.tabs );
+		this._hoverable( this.tabs );
+	},
+
+	_setupHeightStyle: function( heightStyle ) {
+		var maxHeight,
+			parent = this.element.parent();
+
+		if ( heightStyle === "fill" ) {
+			maxHeight = parent.height();
+			maxHeight -= this.element.outerHeight() - this.element.height();
+
+			this.element.siblings( ":visible" ).each( function() {
+				var elem = $( this ),
+					position = elem.css( "position" );
+
+				if ( position === "absolute" || position === "fixed" ) {
+					return;
+				}
+				maxHeight -= elem.outerHeight( true );
+			} );
+
+			this.element.children().not( this.panels ).each( function() {
+				maxHeight -= $( this ).outerHeight( true );
+			} );
+
+			this.panels.each( function() {
+				$( this ).height( Math.max( 0, maxHeight -
+					$( this ).innerHeight() + $( this ).height() ) );
+			} )
+				.css( "overflow", "auto" );
+		} else if ( heightStyle === "auto" ) {
+			maxHeight = 0;
+			this.panels.each( function() {
+				maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+			} ).height( maxHeight );
+		}
+	},
+
+	_eventHandler: function( event ) {
+		var options = this.options,
+			active = this.active,
+			anchor = $( event.currentTarget ),
+			tab = anchor.closest( "li" ),
+			clickedIsActive = tab[ 0 ] === active[ 0 ],
+			collapsing = clickedIsActive && options.collapsible,
+			toShow = collapsing ? $() : this._getPanelForTab( tab ),
+			toHide = !active.length ? $() : this._getPanelForTab( active ),
+			eventData = {
+				oldTab: active,
+				oldPanel: toHide,
+				newTab: collapsing ? $() : tab,
+				newPanel: toShow
+			};
+
+		event.preventDefault();
+
+		if ( tab.hasClass( "ui-state-disabled" ) ||
+
+				// tab is already loading
+				tab.hasClass( "ui-tabs-loading" ) ||
+
+				// can't switch durning an animation
+				this.running ||
+
+				// click on active header, but not collapsible
+				( clickedIsActive && !options.collapsible ) ||
+
+				// allow canceling activation
+				( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+			return;
+		}
+
+		options.active = collapsing ? false : this.tabs.index( tab );
+
+		this.active = clickedIsActive ? $() : tab;
+		if ( this.xhr ) {
+			this.xhr.abort();
+		}
+
+		if ( !toHide.length && !toShow.length ) {
+			$.error( "jQuery UI Tabs: Mismatching fragment identifier." );
+		}
+
+		if ( toShow.length ) {
+			this.load( this.tabs.index( tab ), event );
+		}
+		this._toggle( event, eventData );
+	},
+
+	// Handles show/hide for selecting tabs
+	_toggle: function( event, eventData ) {
+		var that = this,
+			toShow = eventData.newPanel,
+			toHide = eventData.oldPanel;
+
+		this.running = true;
+
+		function complete() {
+			that.running = false;
+			that._trigger( "activate", event, eventData );
+		}
+
+		function show() {
+			that._addClass( eventData.newTab.closest( "li" ), "ui-tabs-active", "ui-state-active" );
+
+			if ( toShow.length && that.options.show ) {
+				that._show( toShow, that.options.show, complete );
+			} else {
+				toShow.show();
+				complete();
+			}
+		}
+
+		// Start out by hiding, then showing, then completing
+		if ( toHide.length && this.options.hide ) {
+			this._hide( toHide, this.options.hide, function() {
+				that._removeClass( eventData.oldTab.closest( "li" ),
+					"ui-tabs-active", "ui-state-active" );
+				show();
+			} );
+		} else {
+			this._removeClass( eventData.oldTab.closest( "li" ),
+				"ui-tabs-active", "ui-state-active" );
+			toHide.hide();
+			show();
+		}
+
+		toHide.attr( "aria-hidden", "true" );
+		eventData.oldTab.attr( {
+			"aria-selected": "false",
+			"aria-expanded": "false"
+		} );
+
+		// If we're switching tabs, remove the old tab from the tab order.
+		// If we're opening from collapsed state, remove the previous tab from the tab order.
+		// If we're collapsing, then keep the collapsing tab in the tab order.
+		if ( toShow.length && toHide.length ) {
+			eventData.oldTab.attr( "tabIndex", -1 );
+		} else if ( toShow.length ) {
+			this.tabs.filter( function() {
+				return $( this ).attr( "tabIndex" ) === 0;
+			} )
+				.attr( "tabIndex", -1 );
+		}
+
+		toShow.attr( "aria-hidden", "false" );
+		eventData.newTab.attr( {
+			"aria-selected": "true",
+			"aria-expanded": "true",
+			tabIndex: 0
+		} );
+	},
+
+	_activate: function( index ) {
+		var anchor,
+			active = this._findActive( index );
+
+		// Trying to activate the already active panel
+		if ( active[ 0 ] === this.active[ 0 ] ) {
+			return;
+		}
+
+		// Trying to collapse, simulate a click on the current active header
+		if ( !active.length ) {
+			active = this.active;
+		}
+
+		anchor = active.find( ".ui-tabs-anchor" )[ 0 ];
+		this._eventHandler( {
+			target: anchor,
+			currentTarget: anchor,
+			preventDefault: $.noop
+		} );
+	},
+
+	_findActive: function( index ) {
+		return index === false ? $() : this.tabs.eq( index );
+	},
+
+	_getIndex: function( index ) {
+
+		// meta-function to give users option to provide a href string instead of a numerical index.
+		if ( typeof index === "string" ) {
+			index = this.anchors.index( this.anchors.filter( "[href$='" +
+				$.ui.escapeSelector( index ) + "']" ) );
+		}
+
+		return index;
+	},
+
+	_destroy: function() {
+		if ( this.xhr ) {
+			this.xhr.abort();
+		}
+
+		this.tablist
+			.removeAttr( "role" )
+			.off( this.eventNamespace );
+
+		this.anchors
+			.removeAttr( "role tabIndex" )
+			.removeUniqueId();
+
+		this.tabs.add( this.panels ).each( function() {
+			if ( $.data( this, "ui-tabs-destroy" ) ) {
+				$( this ).remove();
+			} else {
+				$( this ).removeAttr( "role tabIndex " +
+					"aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded" );
+			}
+		} );
+
+		this.tabs.each( function() {
+			var li = $( this ),
+				prev = li.data( "ui-tabs-aria-controls" );
+			if ( prev ) {
+				li
+					.attr( "aria-controls", prev )
+					.removeData( "ui-tabs-aria-controls" );
+			} else {
+				li.removeAttr( "aria-controls" );
+			}
+		} );
+
+		this.panels.show();
+
+		if ( this.options.heightStyle !== "content" ) {
+			this.panels.css( "height", "" );
+		}
+	},
+
+	enable: function( index ) {
+		var disabled = this.options.disabled;
+		if ( disabled === false ) {
+			return;
+		}
+
+		if ( index === undefined ) {
+			disabled = false;
+		} else {
+			index = this._getIndex( index );
+			if ( $.isArray( disabled ) ) {
+				disabled = $.map( disabled, function( num ) {
+					return num !== index ? num : null;
+				} );
+			} else {
+				disabled = $.map( this.tabs, function( li, num ) {
+					return num !== index ? num : null;
+				} );
+			}
+		}
+		this._setOptionDisabled( disabled );
+	},
+
+	disable: function( index ) {
+		var disabled = this.options.disabled;
+		if ( disabled === true ) {
+			return;
+		}
+
+		if ( index === undefined ) {
+			disabled = true;
+		} else {
+			index = this._getIndex( index );
+			if ( $.inArray( index, disabled ) !== -1 ) {
+				return;
+			}
+			if ( $.isArray( disabled ) ) {
+				disabled = $.merge( [ index ], disabled ).sort();
+			} else {
+				disabled = [ index ];
+			}
+		}
+		this._setOptionDisabled( disabled );
+	},
+
+	load: function( index, event ) {
+		index = this._getIndex( index );
+		var that = this,
+			tab = this.tabs.eq( index ),
+			anchor = tab.find( ".ui-tabs-anchor" ),
+			panel = this._getPanelForTab( tab ),
+			eventData = {
+				tab: tab,
+				panel: panel
+			},
+			complete = function( jqXHR, status ) {
+				if ( status === "abort" ) {
+					that.panels.stop( false, true );
+				}
+
+				that._removeClass( tab, "ui-tabs-loading" );
+				panel.removeAttr( "aria-busy" );
+
+				if ( jqXHR === that.xhr ) {
+					delete that.xhr;
+				}
+			};
+
+		// Not remote
+		if ( this._isLocal( anchor[ 0 ] ) ) {
+			return;
+		}
+
+		this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) );
+
+		// Support: jQuery <1.8
+		// jQuery <1.8 returns false if the request is canceled in beforeSend,
+		// but as of 1.8, $.ajax() always returns a jqXHR object.
+		if ( this.xhr && this.xhr.statusText !== "canceled" ) {
+			this._addClass( tab, "ui-tabs-loading" );
+			panel.attr( "aria-busy", "true" );
+
+			this.xhr
+				.done( function( response, status, jqXHR ) {
+
+					// support: jQuery <1.8
+					// http://bugs.jquery.com/ticket/11778
+					setTimeout( function() {
+						panel.html( response );
+						that._trigger( "load", event, eventData );
+
+						complete( jqXHR, status );
+					}, 1 );
+				} )
+				.fail( function( jqXHR, status ) {
+
+					// support: jQuery <1.8
+					// http://bugs.jquery.com/ticket/11778
+					setTimeout( function() {
+						complete( jqXHR, status );
+					}, 1 );
+				} );
+		}
+	},
+
+	_ajaxSettings: function( anchor, event, eventData ) {
+		var that = this;
+		return {
+
+			// Support: IE <11 only
+			// Strip any hash that exists to prevent errors with the Ajax request
+			url: anchor.attr( "href" ).replace( /#.*$/, "" ),
+			beforeSend: function( jqXHR, settings ) {
+				return that._trigger( "beforeLoad", event,
+					$.extend( { jqXHR: jqXHR, ajaxSettings: settings }, eventData ) );
+			}
+		};
+	},
+
+	_getPanelForTab: function( tab ) {
+		var id = $( tab ).attr( "aria-controls" );
+		return this.element.find( this._sanitizeSelector( "#" + id ) );
+	}
+} );
+
+// DEPRECATED
+// TODO: Switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for ui-tab class (now ui-tabs-tab)
+	$.widget( "ui.tabs", $.ui.tabs, {
+		_processTabs: function() {
+			this._superApply( arguments );
+			this._addClass( this.tabs, "ui-tab" );
+		}
+	} );
+}
+
+var widgetsTabs = $.ui.tabs;
+
+
+/*!
+ * jQuery UI Tooltip 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
-10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
-;/*
- * jQuery UI Effects Highlight 1.8.14
+
+//>>label: Tooltip
+//>>group: Widgets
+//>>description: Shows additional information for any element on hover or focus.
+//>>docs: http://api.jqueryui.com/tooltip/
+//>>demos: http://jqueryui.com/tooltip/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/tooltip.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.tooltip", {
+	version: "1.12.1",
+	options: {
+		classes: {
+			"ui-tooltip": "ui-corner-all ui-widget-shadow"
+		},
+		content: function() {
+
+			// support: IE<9, Opera in jQuery <1.7
+			// .text() can't accept undefined, so coerce to a string
+			var title = $( this ).attr( "title" ) || "";
+
+			// Escape title, since we're going from an attribute to raw HTML
+			return $( "<a>" ).text( title ).html();
+		},
+		hide: true,
+
+		// Disabled elements have inconsistent behavior across browsers (#8661)
+		items: "[title]:not([disabled])",
+		position: {
+			my: "left top+15",
+			at: "left bottom",
+			collision: "flipfit flip"
+		},
+		show: true,
+		track: false,
+
+		// Callbacks
+		close: null,
+		open: null
+	},
+
+	_addDescribedBy: function( elem, id ) {
+		var describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ );
+		describedby.push( id );
+		elem
+			.data( "ui-tooltip-id", id )
+			.attr( "aria-describedby", $.trim( describedby.join( " " ) ) );
+	},
+
+	_removeDescribedBy: function( elem ) {
+		var id = elem.data( "ui-tooltip-id" ),
+			describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ ),
+			index = $.inArray( id, describedby );
+
+		if ( index !== -1 ) {
+			describedby.splice( index, 1 );
+		}
+
+		elem.removeData( "ui-tooltip-id" );
+		describedby = $.trim( describedby.join( " " ) );
+		if ( describedby ) {
+			elem.attr( "aria-describedby", describedby );
+		} else {
+			elem.removeAttr( "aria-describedby" );
+		}
+	},
+
+	_create: function() {
+		this._on( {
+			mouseover: "open",
+			focusin: "open"
+		} );
+
+		// IDs of generated tooltips, needed for destroy
+		this.tooltips = {};
+
+		// IDs of parent tooltips where we removed the title attribute
+		this.parents = {};
+
+		// Append the aria-live region so tooltips announce correctly
+		this.liveRegion = $( "<div>" )
+			.attr( {
+				role: "log",
+				"aria-live": "assertive",
+				"aria-relevant": "additions"
+			} )
+			.appendTo( this.document[ 0 ].body );
+		this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" );
+
+		this.disabledTitles = $( [] );
+	},
+
+	_setOption: function( key, value ) {
+		var that = this;
+
+		this._super( key, value );
+
+		if ( key === "content" ) {
+			$.each( this.tooltips, function( id, tooltipData ) {
+				that._updateContent( tooltipData.element );
+			} );
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this[ value ? "_disable" : "_enable" ]();
+	},
+
+	_disable: function() {
+		var that = this;
+
+		// Close open tooltips
+		$.each( this.tooltips, function( id, tooltipData ) {
+			var event = $.Event( "blur" );
+			event.target = event.currentTarget = tooltipData.element[ 0 ];
+			that.close( event, true );
+		} );
+
+		// Remove title attributes to prevent native tooltips
+		this.disabledTitles = this.disabledTitles.add(
+			this.element.find( this.options.items ).addBack()
+				.filter( function() {
+					var element = $( this );
+					if ( element.is( "[title]" ) ) {
+						return element
+							.data( "ui-tooltip-title", element.attr( "title" ) )
+							.removeAttr( "title" );
+					}
+				} )
+		);
+	},
+
+	_enable: function() {
+
+		// restore title attributes
+		this.disabledTitles.each( function() {
+			var element = $( this );
+			if ( element.data( "ui-tooltip-title" ) ) {
+				element.attr( "title", element.data( "ui-tooltip-title" ) );
+			}
+		} );
+		this.disabledTitles = $( [] );
+	},
+
+	open: function( event ) {
+		var that = this,
+			target = $( event ? event.target : this.element )
+
+				// we need closest here due to mouseover bubbling,
+				// but always pointing at the same event target
+				.closest( this.options.items );
+
+		// No element to show a tooltip for or the tooltip is already open
+		if ( !target.length || target.data( "ui-tooltip-id" ) ) {
+			return;
+		}
+
+		if ( target.attr( "title" ) ) {
+			target.data( "ui-tooltip-title", target.attr( "title" ) );
+		}
+
+		target.data( "ui-tooltip-open", true );
+
+		// Kill parent tooltips, custom or native, for hover
+		if ( event && event.type === "mouseover" ) {
+			target.parents().each( function() {
+				var parent = $( this ),
+					blurEvent;
+				if ( parent.data( "ui-tooltip-open" ) ) {
+					blurEvent = $.Event( "blur" );
+					blurEvent.target = blurEvent.currentTarget = this;
+					that.close( blurEvent, true );
+				}
+				if ( parent.attr( "title" ) ) {
+					parent.uniqueId();
+					that.parents[ this.id ] = {
+						element: this,
+						title: parent.attr( "title" )
+					};
+					parent.attr( "title", "" );
+				}
+			} );
+		}
+
+		this._registerCloseHandlers( event, target );
+		this._updateContent( target, event );
+	},
+
+	_updateContent: function( target, event ) {
+		var content,
+			contentOption = this.options.content,
+			that = this,
+			eventType = event ? event.type : null;
+
+		if ( typeof contentOption === "string" || contentOption.nodeType ||
+				contentOption.jquery ) {
+			return this._open( event, target, contentOption );
+		}
+
+		content = contentOption.call( target[ 0 ], function( response ) {
+
+			// IE may instantly serve a cached response for ajax requests
+			// delay this call to _open so the other call to _open runs first
+			that._delay( function() {
+
+				// Ignore async response if tooltip was closed already
+				if ( !target.data( "ui-tooltip-open" ) ) {
+					return;
+				}
+
+				// JQuery creates a special event for focusin when it doesn't
+				// exist natively. To improve performance, the native event
+				// object is reused and the type is changed. Therefore, we can't
+				// rely on the type being correct after the event finished
+				// bubbling, so we set it back to the previous value. (#8740)
+				if ( event ) {
+					event.type = eventType;
+				}
+				this._open( event, target, response );
+			} );
+		} );
+		if ( content ) {
+			this._open( event, target, content );
+		}
+	},
+
+	_open: function( event, target, content ) {
+		var tooltipData, tooltip, delayedShow, a11yContent,
+			positionOption = $.extend( {}, this.options.position );
+
+		if ( !content ) {
+			return;
+		}
+
+		// Content can be updated multiple times. If the tooltip already
+		// exists, then just update the content and bail.
+		tooltipData = this._find( target );
+		if ( tooltipData ) {
+			tooltipData.tooltip.find( ".ui-tooltip-content" ).html( content );
+			return;
+		}
+
+		// If we have a title, clear it to prevent the native tooltip
+		// we have to check first to avoid defining a title if none exists
+		// (we don't want to cause an element to start matching [title])
+		//
+		// We use removeAttr only for key events, to allow IE to export the correct
+		// accessible attributes. For mouse events, set to empty string to avoid
+		// native tooltip showing up (happens only when removing inside mouseover).
+		if ( target.is( "[title]" ) ) {
+			if ( event && event.type === "mouseover" ) {
+				target.attr( "title", "" );
+			} else {
+				target.removeAttr( "title" );
+			}
+		}
+
+		tooltipData = this._tooltip( target );
+		tooltip = tooltipData.tooltip;
+		this._addDescribedBy( target, tooltip.attr( "id" ) );
+		tooltip.find( ".ui-tooltip-content" ).html( content );
+
+		// Support: Voiceover on OS X, JAWS on IE <= 9
+		// JAWS announces deletions even when aria-relevant="additions"
+		// Voiceover will sometimes re-read the entire log region's contents from the beginning
+		this.liveRegion.children().hide();
+		a11yContent = $( "<div>" ).html( tooltip.find( ".ui-tooltip-content" ).html() );
+		a11yContent.removeAttr( "name" ).find( "[name]" ).removeAttr( "name" );
+		a11yContent.removeAttr( "id" ).find( "[id]" ).removeAttr( "id" );
+		a11yContent.appendTo( this.liveRegion );
+
+		function position( event ) {
+			positionOption.of = event;
+			if ( tooltip.is( ":hidden" ) ) {
+				return;
+			}
+			tooltip.position( positionOption );
+		}
+		if ( this.options.track && event && /^mouse/.test( event.type ) ) {
+			this._on( this.document, {
+				mousemove: position
+			} );
+
+			// trigger once to override element-relative positioning
+			position( event );
+		} else {
+			tooltip.position( $.extend( {
+				of: target
+			}, this.options.position ) );
+		}
+
+		tooltip.hide();
+
+		this._show( tooltip, this.options.show );
+
+		// Handle tracking tooltips that are shown with a delay (#8644). As soon
+		// as the tooltip is visible, position the tooltip using the most recent
+		// event.
+		// Adds the check to add the timers only when both delay and track options are set (#14682)
+		if ( this.options.track && this.options.show && this.options.show.delay ) {
+			delayedShow = this.delayedShow = setInterval( function() {
+				if ( tooltip.is( ":visible" ) ) {
+					position( positionOption.of );
+					clearInterval( delayedShow );
+				}
+			}, $.fx.interval );
+		}
+
+		this._trigger( "open", event, { tooltip: tooltip } );
+	},
+
+	_registerCloseHandlers: function( event, target ) {
+		var events = {
+			keyup: function( event ) {
+				if ( event.keyCode === $.ui.keyCode.ESCAPE ) {
+					var fakeEvent = $.Event( event );
+					fakeEvent.currentTarget = target[ 0 ];
+					this.close( fakeEvent, true );
+				}
+			}
+		};
+
+		// Only bind remove handler for delegated targets. Non-delegated
+		// tooltips will handle this in destroy.
+		if ( target[ 0 ] !== this.element[ 0 ] ) {
+			events.remove = function() {
+				this._removeTooltip( this._find( target ).tooltip );
+			};
+		}
+
+		if ( !event || event.type === "mouseover" ) {
+			events.mouseleave = "close";
+		}
+		if ( !event || event.type === "focusin" ) {
+			events.focusout = "close";
+		}
+		this._on( true, target, events );
+	},
+
+	close: function( event ) {
+		var tooltip,
+			that = this,
+			target = $( event ? event.currentTarget : this.element ),
+			tooltipData = this._find( target );
+
+		// The tooltip may already be closed
+		if ( !tooltipData ) {
+
+			// We set ui-tooltip-open immediately upon open (in open()), but only set the
+			// additional data once there's actually content to show (in _open()). So even if the
+			// tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
+			// the period between open() and _open().
+			target.removeData( "ui-tooltip-open" );
+			return;
+		}
+
+		tooltip = tooltipData.tooltip;
+
+		// Disabling closes the tooltip, so we need to track when we're closing
+		// to avoid an infinite loop in case the tooltip becomes disabled on close
+		if ( tooltipData.closing ) {
+			return;
+		}
+
+		// Clear the interval for delayed tracking tooltips
+		clearInterval( this.delayedShow );
+
+		// Only set title if we had one before (see comment in _open())
+		// If the title attribute has changed since open(), don't restore
+		if ( target.data( "ui-tooltip-title" ) && !target.attr( "title" ) ) {
+			target.attr( "title", target.data( "ui-tooltip-title" ) );
+		}
+
+		this._removeDescribedBy( target );
+
+		tooltipData.hiding = true;
+		tooltip.stop( true );
+		this._hide( tooltip, this.options.hide, function() {
+			that._removeTooltip( $( this ) );
+		} );
+
+		target.removeData( "ui-tooltip-open" );
+		this._off( target, "mouseleave focusout keyup" );
+
+		// Remove 'remove' binding only on delegated targets
+		if ( target[ 0 ] !== this.element[ 0 ] ) {
+			this._off( target, "remove" );
+		}
+		this._off( this.document, "mousemove" );
+
+		if ( event && event.type === "mouseleave" ) {
+			$.each( this.parents, function( id, parent ) {
+				$( parent.element ).attr( "title", parent.title );
+				delete that.parents[ id ];
+			} );
+		}
+
+		tooltipData.closing = true;
+		this._trigger( "close", event, { tooltip: tooltip } );
+		if ( !tooltipData.hiding ) {
+			tooltipData.closing = false;
+		}
+	},
+
+	_tooltip: function( element ) {
+		var tooltip = $( "<div>" ).attr( "role", "tooltip" ),
+			content = $( "<div>" ).appendTo( tooltip ),
+			id = tooltip.uniqueId().attr( "id" );
+
+		this._addClass( content, "ui-tooltip-content" );
+		this._addClass( tooltip, "ui-tooltip", "ui-widget ui-widget-content" );
+
+		tooltip.appendTo( this._appendTo( element ) );
+
+		return this.tooltips[ id ] = {
+			element: element,
+			tooltip: tooltip
+		};
+	},
+
+	_find: function( target ) {
+		var id = target.data( "ui-tooltip-id" );
+		return id ? this.tooltips[ id ] : null;
+	},
+
+	_removeTooltip: function( tooltip ) {
+		tooltip.remove();
+		delete this.tooltips[ tooltip.attr( "id" ) ];
+	},
+
+	_appendTo: function( target ) {
+		var element = target.closest( ".ui-front, dialog" );
+
+		if ( !element.length ) {
+			element = this.document[ 0 ].body;
+		}
+
+		return element;
+	},
+
+	_destroy: function() {
+		var that = this;
+
+		// Close open tooltips
+		$.each( this.tooltips, function( id, tooltipData ) {
+
+			// Delegate to close method to handle common cleanup
+			var event = $.Event( "blur" ),
+				element = tooltipData.element;
+			event.target = event.currentTarget = element[ 0 ];
+			that.close( event, true );
+
+			// Remove immediately; destroying an open tooltip doesn't use the
+			// hide animation
+			$( "#" + id ).remove();
+
+			// Restore the title
+			if ( element.data( "ui-tooltip-title" ) ) {
+
+				// If the title attribute has changed since open(), don't restore
+				if ( !element.attr( "title" ) ) {
+					element.attr( "title", element.data( "ui-tooltip-title" ) );
+				}
+				element.removeData( "ui-tooltip-title" );
+			}
+		} );
+		this.liveRegion.remove();
+	}
+} );
+
+// DEPRECATED
+// TODO: Switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for tooltipClass option
+	$.widget( "ui.tooltip", $.ui.tooltip, {
+		options: {
+			tooltipClass: null
+		},
+		_tooltip: function() {
+			var tooltipData = this._superApply( arguments );
+			if ( this.options.tooltipClass ) {
+				tooltipData.tooltip.addClass( this.options.tooltipClass );
+			}
+			return tooltipData;
+		}
+	} );
+}
+
+var widgetsTooltip = $.ui.tooltip;
+
+
+/*!
+ * jQuery UI Effects 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Effects Core
+//>>group: Effects
+// jscs:disable maximumLineLength
+//>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/category/effects-core/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var dataSpace = "ui-effects-",
+	dataSpaceStyle = "ui-effects-style",
+	dataSpaceAnimated = "ui-effects-animated",
+
+	// Create a local jQuery because jQuery Color relies on it and the
+	// global may not exist with AMD and a custom build (#10199)
+	jQuery = $;
+
+$.effects = {
+	effect: {}
+};
+
+/*!
+ * jQuery Color Animations v2.1.2
+ * https://github.com/jquery/jquery-color
  *
- * http://docs.jquery.com/UI/Effects/Highlight
+ * Copyright 2014 jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  *
- * Depends:
- *	jquery.effects.core.js
+ * Date: Wed Jan 16 08:47:09 2013 -0600
  */
-(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
-this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
-;/*
- * jQuery UI Effects Pulsate 1.8.14
+( function( jQuery, undefined ) {
+
+	var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " +
+		"borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
+
+	// Plusequals test for += 100 -= 100
+	rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
+
+	// A set of RE's that can match strings and generate color tuples.
+	stringParsers = [ {
+			re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+			parse: function( execResult ) {
+				return [
+					execResult[ 1 ],
+					execResult[ 2 ],
+					execResult[ 3 ],
+					execResult[ 4 ]
+				];
+			}
+		}, {
+			re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+			parse: function( execResult ) {
+				return [
+					execResult[ 1 ] * 2.55,
+					execResult[ 2 ] * 2.55,
+					execResult[ 3 ] * 2.55,
+					execResult[ 4 ]
+				];
+			}
+		}, {
+
+			// This regex ignores A-F because it's compared against an already lowercased string
+			re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
+			parse: function( execResult ) {
+				return [
+					parseInt( execResult[ 1 ], 16 ),
+					parseInt( execResult[ 2 ], 16 ),
+					parseInt( execResult[ 3 ], 16 )
+				];
+			}
+		}, {
+
+			// This regex ignores A-F because it's compared against an already lowercased string
+			re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
+			parse: function( execResult ) {
+				return [
+					parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ),
+					parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ),
+					parseInt( execResult[ 3 ] + execResult[ 3 ], 16 )
+				];
+			}
+		}, {
+			re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+			space: "hsla",
+			parse: function( execResult ) {
+				return [
+					execResult[ 1 ],
+					execResult[ 2 ] / 100,
+					execResult[ 3 ] / 100,
+					execResult[ 4 ]
+				];
+			}
+		} ],
+
+	// JQuery.Color( )
+	color = jQuery.Color = function( color, green, blue, alpha ) {
+		return new jQuery.Color.fn.parse( color, green, blue, alpha );
+	},
+	spaces = {
+		rgba: {
+			props: {
+				red: {
+					idx: 0,
+					type: "byte"
+				},
+				green: {
+					idx: 1,
+					type: "byte"
+				},
+				blue: {
+					idx: 2,
+					type: "byte"
+				}
+			}
+		},
+
+		hsla: {
+			props: {
+				hue: {
+					idx: 0,
+					type: "degrees"
+				},
+				saturation: {
+					idx: 1,
+					type: "percent"
+				},
+				lightness: {
+					idx: 2,
+					type: "percent"
+				}
+			}
+		}
+	},
+	propTypes = {
+		"byte": {
+			floor: true,
+			max: 255
+		},
+		"percent": {
+			max: 1
+		},
+		"degrees": {
+			mod: 360,
+			floor: true
+		}
+	},
+	support = color.support = {},
+
+	// Element for support tests
+	supportElem = jQuery( "<p>" )[ 0 ],
+
+	// Colors = jQuery.Color.names
+	colors,
+
+	// Local aliases of functions called often
+	each = jQuery.each;
+
+// Determine rgba support immediately
+supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
+support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1;
+
+// Define cache name and alpha properties
+// for rgba and hsla spaces
+each( spaces, function( spaceName, space ) {
+	space.cache = "_" + spaceName;
+	space.props.alpha = {
+		idx: 3,
+		type: "percent",
+		def: 1
+	};
+} );
+
+function clamp( value, prop, allowEmpty ) {
+	var type = propTypes[ prop.type ] || {};
+
+	if ( value == null ) {
+		return ( allowEmpty || !prop.def ) ? null : prop.def;
+	}
+
+	// ~~ is an short way of doing floor for positive numbers
+	value = type.floor ? ~~value : parseFloat( value );
+
+	// IE will pass in empty strings as value for alpha,
+	// which will hit this case
+	if ( isNaN( value ) ) {
+		return prop.def;
+	}
+
+	if ( type.mod ) {
+
+		// We add mod before modding to make sure that negatives values
+		// get converted properly: -10 -> 350
+		return ( value + type.mod ) % type.mod;
+	}
+
+	// For now all property types without mod have min and max
+	return 0 > value ? 0 : type.max < value ? type.max : value;
+}
+
+function stringParse( string ) {
+	var inst = color(),
+		rgba = inst._rgba = [];
+
+	string = string.toLowerCase();
+
+	each( stringParsers, function( i, parser ) {
+		var parsed,
+			match = parser.re.exec( string ),
+			values = match && parser.parse( match ),
+			spaceName = parser.space || "rgba";
+
+		if ( values ) {
+			parsed = inst[ spaceName ]( values );
+
+			// If this was an rgba parse the assignment might happen twice
+			// oh well....
+			inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ];
+			rgba = inst._rgba = parsed._rgba;
+
+			// Exit each( stringParsers ) here because we matched
+			return false;
+		}
+	} );
+
+	// Found a stringParser that handled it
+	if ( rgba.length ) {
+
+		// If this came from a parsed string, force "transparent" when alpha is 0
+		// chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
+		if ( rgba.join() === "0,0,0,0" ) {
+			jQuery.extend( rgba, colors.transparent );
+		}
+		return inst;
+	}
+
+	// Named colors
+	return colors[ string ];
+}
+
+color.fn = jQuery.extend( color.prototype, {
+	parse: function( red, green, blue, alpha ) {
+		if ( red === undefined ) {
+			this._rgba = [ null, null, null, null ];
+			return this;
+		}
+		if ( red.jquery || red.nodeType ) {
+			red = jQuery( red ).css( green );
+			green = undefined;
+		}
+
+		var inst = this,
+			type = jQuery.type( red ),
+			rgba = this._rgba = [];
+
+		// More than 1 argument specified - assume ( red, green, blue, alpha )
+		if ( green !== undefined ) {
+			red = [ red, green, blue, alpha ];
+			type = "array";
+		}
+
+		if ( type === "string" ) {
+			return this.parse( stringParse( red ) || colors._default );
+		}
+
+		if ( type === "array" ) {
+			each( spaces.rgba.props, function( key, prop ) {
+				rgba[ prop.idx ] = clamp( red[ prop.idx ], prop );
+			} );
+			return this;
+		}
+
+		if ( type === "object" ) {
+			if ( red instanceof color ) {
+				each( spaces, function( spaceName, space ) {
+					if ( red[ space.cache ] ) {
+						inst[ space.cache ] = red[ space.cache ].slice();
+					}
+				} );
+			} else {
+				each( spaces, function( spaceName, space ) {
+					var cache = space.cache;
+					each( space.props, function( key, prop ) {
+
+						// If the cache doesn't exist, and we know how to convert
+						if ( !inst[ cache ] && space.to ) {
+
+							// If the value was null, we don't need to copy it
+							// if the key was alpha, we don't need to copy it either
+							if ( key === "alpha" || red[ key ] == null ) {
+								return;
+							}
+							inst[ cache ] = space.to( inst._rgba );
+						}
+
+						// This is the only case where we allow nulls for ALL properties.
+						// call clamp with alwaysAllowEmpty
+						inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true );
+					} );
+
+					// Everything defined but alpha?
+					if ( inst[ cache ] &&
+							jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) {
+
+						// Use the default of 1
+						inst[ cache ][ 3 ] = 1;
+						if ( space.from ) {
+							inst._rgba = space.from( inst[ cache ] );
+						}
+					}
+				} );
+			}
+			return this;
+		}
+	},
+	is: function( compare ) {
+		var is = color( compare ),
+			same = true,
+			inst = this;
+
+		each( spaces, function( _, space ) {
+			var localCache,
+				isCache = is[ space.cache ];
+			if ( isCache ) {
+				localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || [];
+				each( space.props, function( _, prop ) {
+					if ( isCache[ prop.idx ] != null ) {
+						same = ( isCache[ prop.idx ] === localCache[ prop.idx ] );
+						return same;
+					}
+				} );
+			}
+			return same;
+		} );
+		return same;
+	},
+	_space: function() {
+		var used = [],
+			inst = this;
+		each( spaces, function( spaceName, space ) {
+			if ( inst[ space.cache ] ) {
+				used.push( spaceName );
+			}
+		} );
+		return used.pop();
+	},
+	transition: function( other, distance ) {
+		var end = color( other ),
+			spaceName = end._space(),
+			space = spaces[ spaceName ],
+			startColor = this.alpha() === 0 ? color( "transparent" ) : this,
+			start = startColor[ space.cache ] || space.to( startColor._rgba ),
+			result = start.slice();
+
+		end = end[ space.cache ];
+		each( space.props, function( key, prop ) {
+			var index = prop.idx,
+				startValue = start[ index ],
+				endValue = end[ index ],
+				type = propTypes[ prop.type ] || {};
+
+			// If null, don't override start value
+			if ( endValue === null ) {
+				return;
+			}
+
+			// If null - use end
+			if ( startValue === null ) {
+				result[ index ] = endValue;
+			} else {
+				if ( type.mod ) {
+					if ( endValue - startValue > type.mod / 2 ) {
+						startValue += type.mod;
+					} else if ( startValue - endValue > type.mod / 2 ) {
+						startValue -= type.mod;
+					}
+				}
+				result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop );
+			}
+		} );
+		return this[ spaceName ]( result );
+	},
+	blend: function( opaque ) {
+
+		// If we are already opaque - return ourself
+		if ( this._rgba[ 3 ] === 1 ) {
+			return this;
+		}
+
+		var rgb = this._rgba.slice(),
+			a = rgb.pop(),
+			blend = color( opaque )._rgba;
+
+		return color( jQuery.map( rgb, function( v, i ) {
+			return ( 1 - a ) * blend[ i ] + a * v;
+		} ) );
+	},
+	toRgbaString: function() {
+		var prefix = "rgba(",
+			rgba = jQuery.map( this._rgba, function( v, i ) {
+				return v == null ? ( i > 2 ? 1 : 0 ) : v;
+			} );
+
+		if ( rgba[ 3 ] === 1 ) {
+			rgba.pop();
+			prefix = "rgb(";
+		}
+
+		return prefix + rgba.join() + ")";
+	},
+	toHslaString: function() {
+		var prefix = "hsla(",
+			hsla = jQuery.map( this.hsla(), function( v, i ) {
+				if ( v == null ) {
+					v = i > 2 ? 1 : 0;
+				}
+
+				// Catch 1 and 2
+				if ( i && i < 3 ) {
+					v = Math.round( v * 100 ) + "%";
+				}
+				return v;
+			} );
+
+		if ( hsla[ 3 ] === 1 ) {
+			hsla.pop();
+			prefix = "hsl(";
+		}
+		return prefix + hsla.join() + ")";
+	},
+	toHexString: function( includeAlpha ) {
+		var rgba = this._rgba.slice(),
+			alpha = rgba.pop();
+
+		if ( includeAlpha ) {
+			rgba.push( ~~( alpha * 255 ) );
+		}
+
+		return "#" + jQuery.map( rgba, function( v ) {
+
+			// Default to 0 when nulls exist
+			v = ( v || 0 ).toString( 16 );
+			return v.length === 1 ? "0" + v : v;
+		} ).join( "" );
+	},
+	toString: function() {
+		return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString();
+	}
+} );
+color.fn.parse.prototype = color.fn;
+
+// Hsla conversions adapted from:
+// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
+
+function hue2rgb( p, q, h ) {
+	h = ( h + 1 ) % 1;
+	if ( h * 6 < 1 ) {
+		return p + ( q - p ) * h * 6;
+	}
+	if ( h * 2 < 1 ) {
+		return q;
+	}
+	if ( h * 3 < 2 ) {
+		return p + ( q - p ) * ( ( 2 / 3 ) - h ) * 6;
+	}
+	return p;
+}
+
+spaces.hsla.to = function( rgba ) {
+	if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) {
+		return [ null, null, null, rgba[ 3 ] ];
+	}
+	var r = rgba[ 0 ] / 255,
+		g = rgba[ 1 ] / 255,
+		b = rgba[ 2 ] / 255,
+		a = rgba[ 3 ],
+		max = Math.max( r, g, b ),
+		min = Math.min( r, g, b ),
+		diff = max - min,
+		add = max + min,
+		l = add * 0.5,
+		h, s;
+
+	if ( min === max ) {
+		h = 0;
+	} else if ( r === max ) {
+		h = ( 60 * ( g - b ) / diff ) + 360;
+	} else if ( g === max ) {
+		h = ( 60 * ( b - r ) / diff ) + 120;
+	} else {
+		h = ( 60 * ( r - g ) / diff ) + 240;
+	}
+
+	// Chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
+	// otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
+	if ( diff === 0 ) {
+		s = 0;
+	} else if ( l <= 0.5 ) {
+		s = diff / add;
+	} else {
+		s = diff / ( 2 - add );
+	}
+	return [ Math.round( h ) % 360, s, l, a == null ? 1 : a ];
+};
+
+spaces.hsla.from = function( hsla ) {
+	if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) {
+		return [ null, null, null, hsla[ 3 ] ];
+	}
+	var h = hsla[ 0 ] / 360,
+		s = hsla[ 1 ],
+		l = hsla[ 2 ],
+		a = hsla[ 3 ],
+		q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
+		p = 2 * l - q;
+
+	return [
+		Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ),
+		Math.round( hue2rgb( p, q, h ) * 255 ),
+		Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ),
+		a
+	];
+};
+
+each( spaces, function( spaceName, space ) {
+	var props = space.props,
+		cache = space.cache,
+		to = space.to,
+		from = space.from;
+
+	// Makes rgba() and hsla()
+	color.fn[ spaceName ] = function( value ) {
+
+		// Generate a cache for this space if it doesn't exist
+		if ( to && !this[ cache ] ) {
+			this[ cache ] = to( this._rgba );
+		}
+		if ( value === undefined ) {
+			return this[ cache ].slice();
+		}
+
+		var ret,
+			type = jQuery.type( value ),
+			arr = ( type === "array" || type === "object" ) ? value : arguments,
+			local = this[ cache ].slice();
+
+		each( props, function( key, prop ) {
+			var val = arr[ type === "object" ? key : prop.idx ];
+			if ( val == null ) {
+				val = local[ prop.idx ];
+			}
+			local[ prop.idx ] = clamp( val, prop );
+		} );
+
+		if ( from ) {
+			ret = color( from( local ) );
+			ret[ cache ] = local;
+			return ret;
+		} else {
+			return color( local );
+		}
+	};
+
+	// Makes red() green() blue() alpha() hue() saturation() lightness()
+	each( props, function( key, prop ) {
+
+		// Alpha is included in more than one space
+		if ( color.fn[ key ] ) {
+			return;
+		}
+		color.fn[ key ] = function( value ) {
+			var vtype = jQuery.type( value ),
+				fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
+				local = this[ fn ](),
+				cur = local[ prop.idx ],
+				match;
+
+			if ( vtype === "undefined" ) {
+				return cur;
+			}
+
+			if ( vtype === "function" ) {
+				value = value.call( this, cur );
+				vtype = jQuery.type( value );
+			}
+			if ( value == null && prop.empty ) {
+				return this;
+			}
+			if ( vtype === "string" ) {
+				match = rplusequals.exec( value );
+				if ( match ) {
+					value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 );
+				}
+			}
+			local[ prop.idx ] = value;
+			return this[ fn ]( local );
+		};
+	} );
+} );
+
+// Add cssHook and .fx.step function for each named hook.
+// accept a space separated string of properties
+color.hook = function( hook ) {
+	var hooks = hook.split( " " );
+	each( hooks, function( i, hook ) {
+		jQuery.cssHooks[ hook ] = {
+			set: function( elem, value ) {
+				var parsed, curElem,
+					backgroundColor = "";
+
+				if ( value !== "transparent" && ( jQuery.type( value ) !== "string" ||
+						( parsed = stringParse( value ) ) ) ) {
+					value = color( parsed || value );
+					if ( !support.rgba && value._rgba[ 3 ] !== 1 ) {
+						curElem = hook === "backgroundColor" ? elem.parentNode : elem;
+						while (
+							( backgroundColor === "" || backgroundColor === "transparent" ) &&
+							curElem && curElem.style
+						) {
+							try {
+								backgroundColor = jQuery.css( curElem, "backgroundColor" );
+								curElem = curElem.parentNode;
+							} catch ( e ) {
+							}
+						}
+
+						value = value.blend( backgroundColor && backgroundColor !== "transparent" ?
+							backgroundColor :
+							"_default" );
+					}
+
+					value = value.toRgbaString();
+				}
+				try {
+					elem.style[ hook ] = value;
+				} catch ( e ) {
+
+					// Wrapped to prevent IE from throwing errors on "invalid" values like
+					// 'auto' or 'inherit'
+				}
+			}
+		};
+		jQuery.fx.step[ hook ] = function( fx ) {
+			if ( !fx.colorInit ) {
+				fx.start = color( fx.elem, hook );
+				fx.end = color( fx.end );
+				fx.colorInit = true;
+			}
+			jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) );
+		};
+	} );
+
+};
+
+color.hook( stepHooks );
+
+jQuery.cssHooks.borderColor = {
+	expand: function( value ) {
+		var expanded = {};
+
+		each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) {
+			expanded[ "border" + part + "Color" ] = value;
+		} );
+		return expanded;
+	}
+};
+
+// Basic color names only.
+// Usage of any of the other color names requires adding yourself or including
+// jquery.color.svg-names.js.
+colors = jQuery.Color.names = {
+
+	// 4.1. Basic color keywords
+	aqua: "#00ffff",
+	black: "#000000",
+	blue: "#0000ff",
+	fuchsia: "#ff00ff",
+	gray: "#808080",
+	green: "#008000",
+	lime: "#00ff00",
+	maroon: "#800000",
+	navy: "#000080",
+	olive: "#808000",
+	purple: "#800080",
+	red: "#ff0000",
+	silver: "#c0c0c0",
+	teal: "#008080",
+	white: "#ffffff",
+	yellow: "#ffff00",
+
+	// 4.2.3. "transparent" color keyword
+	transparent: [ null, null, null, 0 ],
+
+	_default: "#ffffff"
+};
+
+} )( jQuery );
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+( function() {
+
+var classAnimationActions = [ "add", "remove", "toggle" ],
+	shorthandStyles = {
+		border: 1,
+		borderBottom: 1,
+		borderColor: 1,
+		borderLeft: 1,
+		borderRight: 1,
+		borderTop: 1,
+		borderWidth: 1,
+		margin: 1,
+		padding: 1
+	};
+
+$.each(
+	[ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ],
+	function( _, prop ) {
+		$.fx.step[ prop ] = function( fx ) {
+			if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) {
+				jQuery.style( fx.elem, prop, fx.end );
+				fx.setAttr = true;
+			}
+		};
+	}
+);
+
+function getElementStyles( elem ) {
+	var key, len,
+		style = elem.ownerDocument.defaultView ?
+			elem.ownerDocument.defaultView.getComputedStyle( elem, null ) :
+			elem.currentStyle,
+		styles = {};
+
+	if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) {
+		len = style.length;
+		while ( len-- ) {
+			key = style[ len ];
+			if ( typeof style[ key ] === "string" ) {
+				styles[ $.camelCase( key ) ] = style[ key ];
+			}
+		}
+
+	// Support: Opera, IE <9
+	} else {
+		for ( key in style ) {
+			if ( typeof style[ key ] === "string" ) {
+				styles[ key ] = style[ key ];
+			}
+		}
+	}
+
+	return styles;
+}
+
+function styleDifference( oldStyle, newStyle ) {
+	var diff = {},
+		name, value;
+
+	for ( name in newStyle ) {
+		value = newStyle[ name ];
+		if ( oldStyle[ name ] !== value ) {
+			if ( !shorthandStyles[ name ] ) {
+				if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) {
+					diff[ name ] = value;
+				}
+			}
+		}
+	}
+
+	return diff;
+}
+
+// Support: jQuery <1.8
+if ( !$.fn.addBack ) {
+	$.fn.addBack = function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	};
+}
+
+$.effects.animateClass = function( value, duration, easing, callback ) {
+	var o = $.speed( duration, easing, callback );
+
+	return this.queue( function() {
+		var animated = $( this ),
+			baseClass = animated.attr( "class" ) || "",
+			applyClassChange,
+			allAnimations = o.children ? animated.find( "*" ).addBack() : animated;
+
+		// Map the animated objects to store the original styles.
+		allAnimations = allAnimations.map( function() {
+			var el = $( this );
+			return {
+				el: el,
+				start: getElementStyles( this )
+			};
+		} );
+
+		// Apply class change
+		applyClassChange = function() {
+			$.each( classAnimationActions, function( i, action ) {
+				if ( value[ action ] ) {
+					animated[ action + "Class" ]( value[ action ] );
+				}
+			} );
+		};
+		applyClassChange();
+
+		// Map all animated objects again - calculate new styles and diff
+		allAnimations = allAnimations.map( function() {
+			this.end = getElementStyles( this.el[ 0 ] );
+			this.diff = styleDifference( this.start, this.end );
+			return this;
+		} );
+
+		// Apply original class
+		animated.attr( "class", baseClass );
+
+		// Map all animated objects again - this time collecting a promise
+		allAnimations = allAnimations.map( function() {
+			var styleInfo = this,
+				dfd = $.Deferred(),
+				opts = $.extend( {}, o, {
+					queue: false,
+					complete: function() {
+						dfd.resolve( styleInfo );
+					}
+				} );
+
+			this.el.animate( this.diff, opts );
+			return dfd.promise();
+		} );
+
+		// Once all animations have completed:
+		$.when.apply( $, allAnimations.get() ).done( function() {
+
+			// Set the final class
+			applyClassChange();
+
+			// For each animated element,
+			// clear all css properties that were animated
+			$.each( arguments, function() {
+				var el = this.el;
+				$.each( this.diff, function( key ) {
+					el.css( key, "" );
+				} );
+			} );
+
+			// This is guarnteed to be there if you use jQuery.speed()
+			// it also handles dequeuing the next anim...
+			o.complete.call( animated[ 0 ] );
+		} );
+	} );
+};
+
+$.fn.extend( {
+	addClass: ( function( orig ) {
+		return function( classNames, speed, easing, callback ) {
+			return speed ?
+				$.effects.animateClass.call( this,
+					{ add: classNames }, speed, easing, callback ) :
+				orig.apply( this, arguments );
+		};
+	} )( $.fn.addClass ),
+
+	removeClass: ( function( orig ) {
+		return function( classNames, speed, easing, callback ) {
+			return arguments.length > 1 ?
+				$.effects.animateClass.call( this,
+					{ remove: classNames }, speed, easing, callback ) :
+				orig.apply( this, arguments );
+		};
+	} )( $.fn.removeClass ),
+
+	toggleClass: ( function( orig ) {
+		return function( classNames, force, speed, easing, callback ) {
+			if ( typeof force === "boolean" || force === undefined ) {
+				if ( !speed ) {
+
+					// Without speed parameter
+					return orig.apply( this, arguments );
+				} else {
+					return $.effects.animateClass.call( this,
+						( force ? { add: classNames } : { remove: classNames } ),
+						speed, easing, callback );
+				}
+			} else {
+
+				// Without force parameter
+				return $.effects.animateClass.call( this,
+					{ toggle: classNames }, force, speed, easing );
+			}
+		};
+	} )( $.fn.toggleClass ),
+
+	switchClass: function( remove, add, speed, easing, callback ) {
+		return $.effects.animateClass.call( this, {
+			add: add,
+			remove: remove
+		}, speed, easing, callback );
+	}
+} );
+
+} )();
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+( function() {
+
+if ( $.expr && $.expr.filters && $.expr.filters.animated ) {
+	$.expr.filters.animated = ( function( orig ) {
+		return function( elem ) {
+			return !!$( elem ).data( dataSpaceAnimated ) || orig( elem );
+		};
+	} )( $.expr.filters.animated );
+}
+
+if ( $.uiBackCompat !== false ) {
+	$.extend( $.effects, {
+
+		// Saves a set of properties in a data storage
+		save: function( element, set ) {
+			var i = 0, length = set.length;
+			for ( ; i < length; i++ ) {
+				if ( set[ i ] !== null ) {
+					element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] );
+				}
+			}
+		},
+
+		// Restores a set of previously saved properties from a data storage
+		restore: function( element, set ) {
+			var val, i = 0, length = set.length;
+			for ( ; i < length; i++ ) {
+				if ( set[ i ] !== null ) {
+					val = element.data( dataSpace + set[ i ] );
+					element.css( set[ i ], val );
+				}
+			}
+		},
+
+		setMode: function( el, mode ) {
+			if ( mode === "toggle" ) {
+				mode = el.is( ":hidden" ) ? "show" : "hide";
+			}
+			return mode;
+		},
+
+		// Wraps the element around a wrapper that copies position properties
+		createWrapper: function( element ) {
+
+			// If the element is already wrapped, return it
+			if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+				return element.parent();
+			}
+
+			// Wrap the element
+			var props = {
+					width: element.outerWidth( true ),
+					height: element.outerHeight( true ),
+					"float": element.css( "float" )
+				},
+				wrapper = $( "<div></div>" )
+					.addClass( "ui-effects-wrapper" )
+					.css( {
+						fontSize: "100%",
+						background: "transparent",
+						border: "none",
+						margin: 0,
+						padding: 0
+					} ),
+
+				// Store the size in case width/height are defined in % - Fixes #5245
+				size = {
+					width: element.width(),
+					height: element.height()
+				},
+				active = document.activeElement;
+
+			// Support: Firefox
+			// Firefox incorrectly exposes anonymous content
+			// https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+			try {
+				active.id;
+			} catch ( e ) {
+				active = document.body;
+			}
+
+			element.wrap( wrapper );
+
+			// Fixes #7595 - Elements lose focus when wrapped.
+			if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+				$( active ).trigger( "focus" );
+			}
+
+			// Hotfix for jQuery 1.4 since some change in wrap() seems to actually
+			// lose the reference to the wrapped element
+			wrapper = element.parent();
+
+			// Transfer positioning properties to the wrapper
+			if ( element.css( "position" ) === "static" ) {
+				wrapper.css( { position: "relative" } );
+				element.css( { position: "relative" } );
+			} else {
+				$.extend( props, {
+					position: element.css( "position" ),
+					zIndex: element.css( "z-index" )
+				} );
+				$.each( [ "top", "left", "bottom", "right" ], function( i, pos ) {
+					props[ pos ] = element.css( pos );
+					if ( isNaN( parseInt( props[ pos ], 10 ) ) ) {
+						props[ pos ] = "auto";
+					}
+				} );
+				element.css( {
+					position: "relative",
+					top: 0,
+					left: 0,
+					right: "auto",
+					bottom: "auto"
+				} );
+			}
+			element.css( size );
+
+			return wrapper.css( props ).show();
+		},
+
+		removeWrapper: function( element ) {
+			var active = document.activeElement;
+
+			if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+				element.parent().replaceWith( element );
+
+				// Fixes #7595 - Elements lose focus when wrapped.
+				if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+					$( active ).trigger( "focus" );
+				}
+			}
+
+			return element;
+		}
+	} );
+}
+
+$.extend( $.effects, {
+	version: "1.12.1",
+
+	define: function( name, mode, effect ) {
+		if ( !effect ) {
+			effect = mode;
+			mode = "effect";
+		}
+
+		$.effects.effect[ name ] = effect;
+		$.effects.effect[ name ].mode = mode;
+
+		return effect;
+	},
+
+	scaledDimensions: function( element, percent, direction ) {
+		if ( percent === 0 ) {
+			return {
+				height: 0,
+				width: 0,
+				outerHeight: 0,
+				outerWidth: 0
+			};
+		}
+
+		var x = direction !== "horizontal" ? ( ( percent || 100 ) / 100 ) : 1,
+			y = direction !== "vertical" ? ( ( percent || 100 ) / 100 ) : 1;
+
+		return {
+			height: element.height() * y,
+			width: element.width() * x,
+			outerHeight: element.outerHeight() * y,
+			outerWidth: element.outerWidth() * x
+		};
+
+	},
+
+	clipToBox: function( animation ) {
+		return {
+			width: animation.clip.right - animation.clip.left,
+			height: animation.clip.bottom - animation.clip.top,
+			left: animation.clip.left,
+			top: animation.clip.top
+		};
+	},
+
+	// Injects recently queued functions to be first in line (after "inprogress")
+	unshift: function( element, queueLength, count ) {
+		var queue = element.queue();
+
+		if ( queueLength > 1 ) {
+			queue.splice.apply( queue,
+				[ 1, 0 ].concat( queue.splice( queueLength, count ) ) );
+		}
+		element.dequeue();
+	},
+
+	saveStyle: function( element ) {
+		element.data( dataSpaceStyle, element[ 0 ].style.cssText );
+	},
+
+	restoreStyle: function( element ) {
+		element[ 0 ].style.cssText = element.data( dataSpaceStyle ) || "";
+		element.removeData( dataSpaceStyle );
+	},
+
+	mode: function( element, mode ) {
+		var hidden = element.is( ":hidden" );
+
+		if ( mode === "toggle" ) {
+			mode = hidden ? "show" : "hide";
+		}
+		if ( hidden ? mode === "hide" : mode === "show" ) {
+			mode = "none";
+		}
+		return mode;
+	},
+
+	// Translates a [top,left] array into a baseline value
+	getBaseline: function( origin, original ) {
+		var y, x;
+
+		switch ( origin[ 0 ] ) {
+		case "top":
+			y = 0;
+			break;
+		case "middle":
+			y = 0.5;
+			break;
+		case "bottom":
+			y = 1;
+			break;
+		default:
+			y = origin[ 0 ] / original.height;
+		}
+
+		switch ( origin[ 1 ] ) {
+		case "left":
+			x = 0;
+			break;
+		case "center":
+			x = 0.5;
+			break;
+		case "right":
+			x = 1;
+			break;
+		default:
+			x = origin[ 1 ] / original.width;
+		}
+
+		return {
+			x: x,
+			y: y
+		};
+	},
+
+	// Creates a placeholder element so that the original element can be made absolute
+	createPlaceholder: function( element ) {
+		var placeholder,
+			cssPosition = element.css( "position" ),
+			position = element.position();
+
+		// Lock in margins first to account for form elements, which
+		// will change margin if you explicitly set height
+		// see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380
+		// Support: Safari
+		element.css( {
+			marginTop: element.css( "marginTop" ),
+			marginBottom: element.css( "marginBottom" ),
+			marginLeft: element.css( "marginLeft" ),
+			marginRight: element.css( "marginRight" )
+		} )
+		.outerWidth( element.outerWidth() )
+		.outerHeight( element.outerHeight() );
+
+		if ( /^(static|relative)/.test( cssPosition ) ) {
+			cssPosition = "absolute";
+
+			placeholder = $( "<" + element[ 0 ].nodeName + ">" ).insertAfter( element ).css( {
+
+				// Convert inline to inline block to account for inline elements
+				// that turn to inline block based on content (like img)
+				display: /^(inline|ruby)/.test( element.css( "display" ) ) ?
+					"inline-block" :
+					"block",
+				visibility: "hidden",
+
+				// Margins need to be set to account for margin collapse
+				marginTop: element.css( "marginTop" ),
+				marginBottom: element.css( "marginBottom" ),
+				marginLeft: element.css( "marginLeft" ),
+				marginRight: element.css( "marginRight" ),
+				"float": element.css( "float" )
+			} )
+			.outerWidth( element.outerWidth() )
+			.outerHeight( element.outerHeight() )
+			.addClass( "ui-effects-placeholder" );
+
+			element.data( dataSpace + "placeholder", placeholder );
+		}
+
+		element.css( {
+			position: cssPosition,
+			left: position.left,
+			top: position.top
+		} );
+
+		return placeholder;
+	},
+
+	removePlaceholder: function( element ) {
+		var dataKey = dataSpace + "placeholder",
+				placeholder = element.data( dataKey );
+
+		if ( placeholder ) {
+			placeholder.remove();
+			element.removeData( dataKey );
+		}
+	},
+
+	// Removes a placeholder if it exists and restores
+	// properties that were modified during placeholder creation
+	cleanUp: function( element ) {
+		$.effects.restoreStyle( element );
+		$.effects.removePlaceholder( element );
+	},
+
+	setTransition: function( element, list, factor, value ) {
+		value = value || {};
+		$.each( list, function( i, x ) {
+			var unit = element.cssUnit( x );
+			if ( unit[ 0 ] > 0 ) {
+				value[ x ] = unit[ 0 ] * factor + unit[ 1 ];
+			}
+		} );
+		return value;
+	}
+} );
+
+// Return an effect options object for the given parameters:
+function _normalizeArguments( effect, options, speed, callback ) {
+
+	// Allow passing all options as the first parameter
+	if ( $.isPlainObject( effect ) ) {
+		options = effect;
+		effect = effect.effect;
+	}
+
+	// Convert to an object
+	effect = { effect: effect };
+
+	// Catch (effect, null, ...)
+	if ( options == null ) {
+		options = {};
+	}
+
+	// Catch (effect, callback)
+	if ( $.isFunction( options ) ) {
+		callback = options;
+		speed = null;
+		options = {};
+	}
+
+	// Catch (effect, speed, ?)
+	if ( typeof options === "number" || $.fx.speeds[ options ] ) {
+		callback = speed;
+		speed = options;
+		options = {};
+	}
+
+	// Catch (effect, options, callback)
+	if ( $.isFunction( speed ) ) {
+		callback = speed;
+		speed = null;
+	}
+
+	// Add options to effect
+	if ( options ) {
+		$.extend( effect, options );
+	}
+
+	speed = speed || options.duration;
+	effect.duration = $.fx.off ? 0 :
+		typeof speed === "number" ? speed :
+		speed in $.fx.speeds ? $.fx.speeds[ speed ] :
+		$.fx.speeds._default;
+
+	effect.complete = callback || options.complete;
+
+	return effect;
+}
+
+function standardAnimationOption( option ) {
+
+	// Valid standard speeds (nothing, number, named speed)
+	if ( !option || typeof option === "number" || $.fx.speeds[ option ] ) {
+		return true;
+	}
+
+	// Invalid strings - treat as "normal" speed
+	if ( typeof option === "string" && !$.effects.effect[ option ] ) {
+		return true;
+	}
+
+	// Complete callback
+	if ( $.isFunction( option ) ) {
+		return true;
+	}
+
+	// Options hash (but not naming an effect)
+	if ( typeof option === "object" && !option.effect ) {
+		return true;
+	}
+
+	// Didn't match any standard API
+	return false;
+}
+
+$.fn.extend( {
+	effect: function( /* effect, options, speed, callback */ ) {
+		var args = _normalizeArguments.apply( this, arguments ),
+			effectMethod = $.effects.effect[ args.effect ],
+			defaultMode = effectMethod.mode,
+			queue = args.queue,
+			queueName = queue || "fx",
+			complete = args.complete,
+			mode = args.mode,
+			modes = [],
+			prefilter = function( next ) {
+				var el = $( this ),
+					normalizedMode = $.effects.mode( el, mode ) || defaultMode;
+
+				// Sentinel for duck-punching the :animated psuedo-selector
+				el.data( dataSpaceAnimated, true );
+
+				// Save effect mode for later use,
+				// we can't just call $.effects.mode again later,
+				// as the .show() below destroys the initial state
+				modes.push( normalizedMode );
+
+				// See $.uiBackCompat inside of run() for removal of defaultMode in 1.13
+				if ( defaultMode && ( normalizedMode === "show" ||
+						( normalizedMode === defaultMode && normalizedMode === "hide" ) ) ) {
+					el.show();
+				}
+
+				if ( !defaultMode || normalizedMode !== "none" ) {
+					$.effects.saveStyle( el );
+				}
+
+				if ( $.isFunction( next ) ) {
+					next();
+				}
+			};
+
+		if ( $.fx.off || !effectMethod ) {
+
+			// Delegate to the original method (e.g., .show()) if possible
+			if ( mode ) {
+				return this[ mode ]( args.duration, complete );
+			} else {
+				return this.each( function() {
+					if ( complete ) {
+						complete.call( this );
+					}
+				} );
+			}
+		}
+
+		function run( next ) {
+			var elem = $( this );
+
+			function cleanup() {
+				elem.removeData( dataSpaceAnimated );
+
+				$.effects.cleanUp( elem );
+
+				if ( args.mode === "hide" ) {
+					elem.hide();
+				}
+
+				done();
+			}
+
+			function done() {
+				if ( $.isFunction( complete ) ) {
+					complete.call( elem[ 0 ] );
+				}
+
+				if ( $.isFunction( next ) ) {
+					next();
+				}
+			}
+
+			// Override mode option on a per element basis,
+			// as toggle can be either show or hide depending on element state
+			args.mode = modes.shift();
+
+			if ( $.uiBackCompat !== false && !defaultMode ) {
+				if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) {
+
+					// Call the core method to track "olddisplay" properly
+					elem[ mode ]();
+					done();
+				} else {
+					effectMethod.call( elem[ 0 ], args, done );
+				}
+			} else {
+				if ( args.mode === "none" ) {
+
+					// Call the core method to track "olddisplay" properly
+					elem[ mode ]();
+					done();
+				} else {
+					effectMethod.call( elem[ 0 ], args, cleanup );
+				}
+			}
+		}
+
+		// Run prefilter on all elements first to ensure that
+		// any showing or hiding happens before placeholder creation,
+		// which ensures that any layout changes are correctly captured.
+		return queue === false ?
+			this.each( prefilter ).each( run ) :
+			this.queue( queueName, prefilter ).queue( queueName, run );
+	},
+
+	show: ( function( orig ) {
+		return function( option ) {
+			if ( standardAnimationOption( option ) ) {
+				return orig.apply( this, arguments );
+			} else {
+				var args = _normalizeArguments.apply( this, arguments );
+				args.mode = "show";
+				return this.effect.call( this, args );
+			}
+		};
+	} )( $.fn.show ),
+
+	hide: ( function( orig ) {
+		return function( option ) {
+			if ( standardAnimationOption( option ) ) {
+				return orig.apply( this, arguments );
+			} else {
+				var args = _normalizeArguments.apply( this, arguments );
+				args.mode = "hide";
+				return this.effect.call( this, args );
+			}
+		};
+	} )( $.fn.hide ),
+
+	toggle: ( function( orig ) {
+		return function( option ) {
+			if ( standardAnimationOption( option ) || typeof option === "boolean" ) {
+				return orig.apply( this, arguments );
+			} else {
+				var args = _normalizeArguments.apply( this, arguments );
+				args.mode = "toggle";
+				return this.effect.call( this, args );
+			}
+		};
+	} )( $.fn.toggle ),
+
+	cssUnit: function( key ) {
+		var style = this.css( key ),
+			val = [];
+
+		$.each( [ "em", "px", "%", "pt" ], function( i, unit ) {
+			if ( style.indexOf( unit ) > 0 ) {
+				val = [ parseFloat( style ), unit ];
+			}
+		} );
+		return val;
+	},
+
+	cssClip: function( clipObj ) {
+		if ( clipObj ) {
+			return this.css( "clip", "rect(" + clipObj.top + "px " + clipObj.right + "px " +
+				clipObj.bottom + "px " + clipObj.left + "px)" );
+		}
+		return parseClip( this.css( "clip" ), this );
+	},
+
+	transfer: function( options, done ) {
+		var element = $( this ),
+			target = $( options.to ),
+			targetFixed = target.css( "position" ) === "fixed",
+			body = $( "body" ),
+			fixTop = targetFixed ? body.scrollTop() : 0,
+			fixLeft = targetFixed ? body.scrollLeft() : 0,
+			endPosition = target.offset(),
+			animation = {
+				top: endPosition.top - fixTop,
+				left: endPosition.left - fixLeft,
+				height: target.innerHeight(),
+				width: target.innerWidth()
+			},
+			startPosition = element.offset(),
+			transfer = $( "<div class='ui-effects-transfer'></div>" )
+				.appendTo( "body" )
+				.addClass( options.className )
+				.css( {
+					top: startPosition.top - fixTop,
+					left: startPosition.left - fixLeft,
+					height: element.innerHeight(),
+					width: element.innerWidth(),
+					position: targetFixed ? "fixed" : "absolute"
+				} )
+				.animate( animation, options.duration, options.easing, function() {
+					transfer.remove();
+					if ( $.isFunction( done ) ) {
+						done();
+					}
+				} );
+	}
+} );
+
+function parseClip( str, element ) {
+		var outerWidth = element.outerWidth(),
+			outerHeight = element.outerHeight(),
+			clipRegex = /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/,
+			values = clipRegex.exec( str ) || [ "", 0, outerWidth, outerHeight, 0 ];
+
+		return {
+			top: parseFloat( values[ 1 ] ) || 0,
+			right: values[ 2 ] === "auto" ? outerWidth : parseFloat( values[ 2 ] ),
+			bottom: values[ 3 ] === "auto" ? outerHeight : parseFloat( values[ 3 ] ),
+			left: parseFloat( values[ 4 ] ) || 0
+		};
+}
+
+$.fx.step.clip = function( fx ) {
+	if ( !fx.clipInit ) {
+		fx.start = $( fx.elem ).cssClip();
+		if ( typeof fx.end === "string" ) {
+			fx.end = parseClip( fx.end, fx.elem );
+		}
+		fx.clipInit = true;
+	}
+
+	$( fx.elem ).cssClip( {
+		top: fx.pos * ( fx.end.top - fx.start.top ) + fx.start.top,
+		right: fx.pos * ( fx.end.right - fx.start.right ) + fx.start.right,
+		bottom: fx.pos * ( fx.end.bottom - fx.start.bottom ) + fx.start.bottom,
+		left: fx.pos * ( fx.end.left - fx.start.left ) + fx.start.left
+	} );
+};
+
+} )();
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+( function() {
+
+// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
+
+var baseEasings = {};
+
+$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
+	baseEasings[ name ] = function( p ) {
+		return Math.pow( p, i + 2 );
+	};
+} );
+
+$.extend( baseEasings, {
+	Sine: function( p ) {
+		return 1 - Math.cos( p * Math.PI / 2 );
+	},
+	Circ: function( p ) {
+		return 1 - Math.sqrt( 1 - p * p );
+	},
+	Elastic: function( p ) {
+		return p === 0 || p === 1 ? p :
+			-Math.pow( 2, 8 * ( p - 1 ) ) * Math.sin( ( ( p - 1 ) * 80 - 7.5 ) * Math.PI / 15 );
+	},
+	Back: function( p ) {
+		return p * p * ( 3 * p - 2 );
+	},
+	Bounce: function( p ) {
+		var pow2,
+			bounce = 4;
+
+		while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
+		return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
+	}
+} );
+
+$.each( baseEasings, function( name, easeIn ) {
+	$.easing[ "easeIn" + name ] = easeIn;
+	$.easing[ "easeOut" + name ] = function( p ) {
+		return 1 - easeIn( 1 - p );
+	};
+	$.easing[ "easeInOut" + name ] = function( p ) {
+		return p < 0.5 ?
+			easeIn( p * 2 ) / 2 :
+			1 - easeIn( p * -2 + 2 ) / 2;
+	};
+} );
+
+} )();
+
+var effect = $.effects;
+
+
+/*!
+ * jQuery UI Effects Blind 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Blind Effect
+//>>group: Effects
+//>>description: Blinds the element.
+//>>docs: http://api.jqueryui.com/blind-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectBlind = $.effects.define( "blind", "hide", function( options, done ) {
+	var map = {
+			up: [ "bottom", "top" ],
+			vertical: [ "bottom", "top" ],
+			down: [ "top", "bottom" ],
+			left: [ "right", "left" ],
+			horizontal: [ "right", "left" ],
+			right: [ "left", "right" ]
+		},
+		element = $( this ),
+		direction = options.direction || "up",
+		start = element.cssClip(),
+		animate = { clip: $.extend( {}, start ) },
+		placeholder = $.effects.createPlaceholder( element );
+
+	animate.clip[ map[ direction ][ 0 ] ] = animate.clip[ map[ direction ][ 1 ] ];
+
+	if ( options.mode === "show" ) {
+		element.cssClip( animate.clip );
+		if ( placeholder ) {
+			placeholder.css( $.effects.clipToBox( animate ) );
+		}
+
+		animate.clip = start;
+	}
+
+	if ( placeholder ) {
+		placeholder.animate( $.effects.clipToBox( animate ), options.duration, options.easing );
+	}
+
+	element.animate( animate, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+} );
+
+
+/*!
+ * jQuery UI Effects Bounce 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Pulsate
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Bounce Effect
+//>>group: Effects
+//>>description: Bounces an element horizontally or vertically n times.
+//>>docs: http://api.jqueryui.com/bounce-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectBounce = $.effects.define( "bounce", function( options, done ) {
+	var upAnim, downAnim, refValue,
+		element = $( this ),
+
+		// Defaults:
+		mode = options.mode,
+		hide = mode === "hide",
+		show = mode === "show",
+		direction = options.direction || "up",
+		distance = options.distance,
+		times = options.times || 5,
+
+		// Number of internal animations
+		anims = times * 2 + ( show || hide ? 1 : 0 ),
+		speed = options.duration / anims,
+		easing = options.easing,
+
+		// Utility:
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		motion = ( direction === "up" || direction === "left" ),
+		i = 0,
+
+		queuelen = element.queue().length;
+
+	$.effects.createPlaceholder( element );
+
+	refValue = element.css( ref );
+
+	// Default distance for the BIGGEST bounce is the outer Distance / 3
+	if ( !distance ) {
+		distance = element[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3;
+	}
+
+	if ( show ) {
+		downAnim = { opacity: 1 };
+		downAnim[ ref ] = refValue;
+
+		// If we are showing, force opacity 0 and set the initial position
+		// then do the "first" animation
+		element
+			.css( "opacity", 0 )
+			.css( ref, motion ? -distance * 2 : distance * 2 )
+			.animate( downAnim, speed, easing );
+	}
+
+	// Start at the smallest distance if we are hiding
+	if ( hide ) {
+		distance = distance / Math.pow( 2, times - 1 );
+	}
+
+	downAnim = {};
+	downAnim[ ref ] = refValue;
+
+	// Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
+	for ( ; i < times; i++ ) {
+		upAnim = {};
+		upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+		element
+			.animate( upAnim, speed, easing )
+			.animate( downAnim, speed, easing );
+
+		distance = hide ? distance * 2 : distance / 2;
+	}
+
+	// Last Bounce when Hiding
+	if ( hide ) {
+		upAnim = { opacity: 0 };
+		upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+		element.animate( upAnim, speed, easing );
+	}
+
+	element.queue( done );
+
+	$.effects.unshift( element, queuelen, anims + 1 );
+} );
+
+
+/*!
+ * jQuery UI Effects Clip 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
-a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
-;/*
- * jQuery UI Effects Scale 1.8.14
+
+//>>label: Clip Effect
+//>>group: Effects
+//>>description: Clips the element on and off like an old TV.
+//>>docs: http://api.jqueryui.com/clip-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectClip = $.effects.define( "clip", "hide", function( options, done ) {
+	var start,
+		animate = {},
+		element = $( this ),
+		direction = options.direction || "vertical",
+		both = direction === "both",
+		horizontal = both || direction === "horizontal",
+		vertical = both || direction === "vertical";
+
+	start = element.cssClip();
+	animate.clip = {
+		top: vertical ? ( start.bottom - start.top ) / 2 : start.top,
+		right: horizontal ? ( start.right - start.left ) / 2 : start.right,
+		bottom: vertical ? ( start.bottom - start.top ) / 2 : start.bottom,
+		left: horizontal ? ( start.right - start.left ) / 2 : start.left
+	};
+
+	$.effects.createPlaceholder( element );
+
+	if ( options.mode === "show" ) {
+		element.cssClip( animate.clip );
+		animate.clip = start;
+	}
+
+	element.animate( animate, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+
+} );
+
+
+/*!
+ * jQuery UI Effects Drop 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Drop Effect
+//>>group: Effects
+//>>description: Moves an element in one direction and hides it at the same time.
+//>>docs: http://api.jqueryui.com/drop-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectDrop = $.effects.define( "drop", "hide", function( options, done ) {
+
+	var distance,
+		element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+		direction = options.direction || "left",
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		motion = ( direction === "up" || direction === "left" ) ? "-=" : "+=",
+		oppositeMotion = ( motion === "+=" ) ? "-=" : "+=",
+		animation = {
+			opacity: 0
+		};
+
+	$.effects.createPlaceholder( element );
+
+	distance = options.distance ||
+		element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ) / 2;
+
+	animation[ ref ] = motion + distance;
+
+	if ( show ) {
+		element.css( animation );
+
+		animation[ ref ] = oppositeMotion + distance;
+		animation.opacity = 1;
+	}
+
+	// Animate
+	element.animate( animation, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+} );
+
+
+/*!
+ * jQuery UI Effects Explode 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Scale
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Explode Effect
+//>>group: Effects
+// jscs:disable maximumLineLength
+//>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/explode-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectExplode = $.effects.define( "explode", "hide", function( options, done ) {
+
+	var i, j, left, top, mx, my,
+		rows = options.pieces ? Math.round( Math.sqrt( options.pieces ) ) : 3,
+		cells = rows,
+		element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+
+		// Show and then visibility:hidden the element before calculating offset
+		offset = element.show().css( "visibility", "hidden" ).offset(),
+
+		// Width and height of a piece
+		width = Math.ceil( element.outerWidth() / cells ),
+		height = Math.ceil( element.outerHeight() / rows ),
+		pieces = [];
+
+	// Children animate complete:
+	function childComplete() {
+		pieces.push( this );
+		if ( pieces.length === rows * cells ) {
+			animComplete();
+		}
+	}
+
+	// Clone the element for each row and cell.
+	for ( i = 0; i < rows; i++ ) { // ===>
+		top = offset.top + i * height;
+		my = i - ( rows - 1 ) / 2;
+
+		for ( j = 0; j < cells; j++ ) { // |||
+			left = offset.left + j * width;
+			mx = j - ( cells - 1 ) / 2;
+
+			// Create a clone of the now hidden main element that will be absolute positioned
+			// within a wrapper div off the -left and -top equal to size of our pieces
+			element
+				.clone()
+				.appendTo( "body" )
+				.wrap( "<div></div>" )
+				.css( {
+					position: "absolute",
+					visibility: "visible",
+					left: -j * width,
+					top: -i * height
+				} )
+
+				// Select the wrapper - make it overflow: hidden and absolute positioned based on
+				// where the original was located +left and +top equal to the size of pieces
+				.parent()
+					.addClass( "ui-effects-explode" )
+					.css( {
+						position: "absolute",
+						overflow: "hidden",
+						width: width,
+						height: height,
+						left: left + ( show ? mx * width : 0 ),
+						top: top + ( show ? my * height : 0 ),
+						opacity: show ? 0 : 1
+					} )
+					.animate( {
+						left: left + ( show ? 0 : mx * width ),
+						top: top + ( show ? 0 : my * height ),
+						opacity: show ? 1 : 0
+					}, options.duration || 500, options.easing, childComplete );
+		}
+	}
+
+	function animComplete() {
+		element.css( {
+			visibility: "visible"
+		} );
+		$( pieces ).remove();
+		done();
+	}
+} );
+
+
+/*!
+ * jQuery UI Effects Fade 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
-b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
-1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
-p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
-if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
-a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
-child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
-n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
-;/*
- * jQuery UI Effects Shake 1.8.14
+
+//>>label: Fade Effect
+//>>group: Effects
+//>>description: Fades the element.
+//>>docs: http://api.jqueryui.com/fade-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectFade = $.effects.define( "fade", "toggle", function( options, done ) {
+	var show = options.mode === "show";
+
+	$( this )
+		.css( "opacity", show ? 0 : 1 )
+		.animate( {
+			opacity: show ? 1 : 0
+		}, {
+			queue: false,
+			duration: options.duration,
+			easing: options.easing,
+			complete: done
+		} );
+} );
+
+
+/*!
+ * jQuery UI Effects Fold 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Fold Effect
+//>>group: Effects
+//>>description: Folds an element first horizontally and then vertically.
+//>>docs: http://api.jqueryui.com/fold-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectFold = $.effects.define( "fold", "hide", function( options, done ) {
+
+	// Create element
+	var element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+		hide = mode === "hide",
+		size = options.size || 15,
+		percent = /([0-9]+)%/.exec( size ),
+		horizFirst = !!options.horizFirst,
+		ref = horizFirst ? [ "right", "bottom" ] : [ "bottom", "right" ],
+		duration = options.duration / 2,
+
+		placeholder = $.effects.createPlaceholder( element ),
+
+		start = element.cssClip(),
+		animation1 = { clip: $.extend( {}, start ) },
+		animation2 = { clip: $.extend( {}, start ) },
+
+		distance = [ start[ ref[ 0 ] ], start[ ref[ 1 ] ] ],
+
+		queuelen = element.queue().length;
+
+	if ( percent ) {
+		size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ];
+	}
+	animation1.clip[ ref[ 0 ] ] = size;
+	animation2.clip[ ref[ 0 ] ] = size;
+	animation2.clip[ ref[ 1 ] ] = 0;
+
+	if ( show ) {
+		element.cssClip( animation2.clip );
+		if ( placeholder ) {
+			placeholder.css( $.effects.clipToBox( animation2 ) );
+		}
+
+		animation2.clip = start;
+	}
+
+	// Animate
+	element
+		.queue( function( next ) {
+			if ( placeholder ) {
+				placeholder
+					.animate( $.effects.clipToBox( animation1 ), duration, options.easing )
+					.animate( $.effects.clipToBox( animation2 ), duration, options.easing );
+			}
+
+			next();
+		} )
+		.animate( animation1, duration, options.easing )
+		.animate( animation2, duration, options.easing )
+		.queue( done );
+
+	$.effects.unshift( element, queuelen, 4 );
+} );
+
+
+/*!
+ * jQuery UI Effects Highlight 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Shake
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Highlight Effect
+//>>group: Effects
+//>>description: Highlights the background of an element in a defined color for a custom duration.
+//>>docs: http://api.jqueryui.com/highlight-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectHighlight = $.effects.define( "highlight", "show", function( options, done ) {
+	var element = $( this ),
+		animation = {
+			backgroundColor: element.css( "backgroundColor" )
+		};
+
+	if ( options.mode === "hide" ) {
+		animation.opacity = 0;
+	}
+
+	$.effects.saveStyle( element );
+
+	element
+		.css( {
+			backgroundImage: "none",
+			backgroundColor: options.color || "#ffff99"
+		} )
+		.animate( animation, {
+			queue: false,
+			duration: options.duration,
+			easing: options.easing,
+			complete: done
+		} );
+} );
+
+
+/*!
+ * jQuery UI Effects Size 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
-(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
-;/*
- * jQuery UI Effects Slide 1.8.14
+
+//>>label: Size Effect
+//>>group: Effects
+//>>description: Resize an element to a specified width and height.
+//>>docs: http://api.jqueryui.com/size-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectSize = $.effects.define( "size", function( options, done ) {
+
+	// Create element
+	var baseline, factor, temp,
+		element = $( this ),
+
+		// Copy for children
+		cProps = [ "fontSize" ],
+		vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ],
+		hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ],
+
+		// Set options
+		mode = options.mode,
+		restore = mode !== "effect",
+		scale = options.scale || "both",
+		origin = options.origin || [ "middle", "center" ],
+		position = element.css( "position" ),
+		pos = element.position(),
+		original = $.effects.scaledDimensions( element ),
+		from = options.from || original,
+		to = options.to || $.effects.scaledDimensions( element, 0 );
+
+	$.effects.createPlaceholder( element );
+
+	if ( mode === "show" ) {
+		temp = from;
+		from = to;
+		to = temp;
+	}
+
+	// Set scaling factor
+	factor = {
+		from: {
+			y: from.height / original.height,
+			x: from.width / original.width
+		},
+		to: {
+			y: to.height / original.height,
+			x: to.width / original.width
+		}
+	};
+
+	// Scale the css box
+	if ( scale === "box" || scale === "both" ) {
+
+		// Vertical props scaling
+		if ( factor.from.y !== factor.to.y ) {
+			from = $.effects.setTransition( element, vProps, factor.from.y, from );
+			to = $.effects.setTransition( element, vProps, factor.to.y, to );
+		}
+
+		// Horizontal props scaling
+		if ( factor.from.x !== factor.to.x ) {
+			from = $.effects.setTransition( element, hProps, factor.from.x, from );
+			to = $.effects.setTransition( element, hProps, factor.to.x, to );
+		}
+	}
+
+	// Scale the content
+	if ( scale === "content" || scale === "both" ) {
+
+		// Vertical props scaling
+		if ( factor.from.y !== factor.to.y ) {
+			from = $.effects.setTransition( element, cProps, factor.from.y, from );
+			to = $.effects.setTransition( element, cProps, factor.to.y, to );
+		}
+	}
+
+	// Adjust the position properties based on the provided origin points
+	if ( origin ) {
+		baseline = $.effects.getBaseline( origin, original );
+		from.top = ( original.outerHeight - from.outerHeight ) * baseline.y + pos.top;
+		from.left = ( original.outerWidth - from.outerWidth ) * baseline.x + pos.left;
+		to.top = ( original.outerHeight - to.outerHeight ) * baseline.y + pos.top;
+		to.left = ( original.outerWidth - to.outerWidth ) * baseline.x + pos.left;
+	}
+	element.css( from );
+
+	// Animate the children if desired
+	if ( scale === "content" || scale === "both" ) {
+
+		vProps = vProps.concat( [ "marginTop", "marginBottom" ] ).concat( cProps );
+		hProps = hProps.concat( [ "marginLeft", "marginRight" ] );
+
+		// Only animate children with width attributes specified
+		// TODO: is this right? should we include anything with css width specified as well
+		element.find( "*[width]" ).each( function() {
+			var child = $( this ),
+				childOriginal = $.effects.scaledDimensions( child ),
+				childFrom = {
+					height: childOriginal.height * factor.from.y,
+					width: childOriginal.width * factor.from.x,
+					outerHeight: childOriginal.outerHeight * factor.from.y,
+					outerWidth: childOriginal.outerWidth * factor.from.x
+				},
+				childTo = {
+					height: childOriginal.height * factor.to.y,
+					width: childOriginal.width * factor.to.x,
+					outerHeight: childOriginal.height * factor.to.y,
+					outerWidth: childOriginal.width * factor.to.x
+				};
+
+			// Vertical props scaling
+			if ( factor.from.y !== factor.to.y ) {
+				childFrom = $.effects.setTransition( child, vProps, factor.from.y, childFrom );
+				childTo = $.effects.setTransition( child, vProps, factor.to.y, childTo );
+			}
+
+			// Horizontal props scaling
+			if ( factor.from.x !== factor.to.x ) {
+				childFrom = $.effects.setTransition( child, hProps, factor.from.x, childFrom );
+				childTo = $.effects.setTransition( child, hProps, factor.to.x, childTo );
+			}
+
+			if ( restore ) {
+				$.effects.saveStyle( child );
+			}
+
+			// Animate children
+			child.css( childFrom );
+			child.animate( childTo, options.duration, options.easing, function() {
+
+				// Restore children
+				if ( restore ) {
+					$.effects.restoreStyle( child );
+				}
+			} );
+		} );
+	}
+
+	// Animate
+	element.animate( to, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: function() {
+
+			var offset = element.offset();
+
+			if ( to.opacity === 0 ) {
+				element.css( "opacity", from.opacity );
+			}
+
+			if ( !restore ) {
+				element
+					.css( "position", position === "static" ? "relative" : position )
+					.offset( offset );
+
+				// Need to save style here so that automatic style restoration
+				// doesn't restore to the original styles from before the animation.
+				$.effects.saveStyle( element );
+			}
+
+			done();
+		}
+	} );
+
+} );
+
+
+/*!
+ * jQuery UI Effects Scale 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Scale Effect
+//>>group: Effects
+//>>description: Grows or shrinks an element and its content.
+//>>docs: http://api.jqueryui.com/scale-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectScale = $.effects.define( "scale", function( options, done ) {
+
+	// Create element
+	var el = $( this ),
+		mode = options.mode,
+		percent = parseInt( options.percent, 10 ) ||
+			( parseInt( options.percent, 10 ) === 0 ? 0 : ( mode !== "effect" ? 0 : 100 ) ),
+
+		newOptions = $.extend( true, {
+			from: $.effects.scaledDimensions( el ),
+			to: $.effects.scaledDimensions( el, percent, options.direction || "both" ),
+			origin: options.origin || [ "middle", "center" ]
+		}, options );
+
+	// Fade option to support puff
+	if ( options.fade ) {
+		newOptions.from.opacity = 1;
+		newOptions.to.opacity = 0;
+	}
+
+	$.effects.effect.size.call( this, newOptions, done );
+} );
+
+
+/*!
+ * jQuery UI Effects Puff 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Slide
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Puff Effect
+//>>group: Effects
+//>>description: Creates a puff effect by scaling the element up and hiding it at the same time.
+//>>docs: http://api.jqueryui.com/puff-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectPuff = $.effects.define( "puff", "hide", function( options, done ) {
+	var newOptions = $.extend( true, {}, options, {
+		fade: true,
+		percent: parseInt( options.percent, 10 ) || 150
+	} );
+
+	$.effects.effect.scale.call( this, newOptions, done );
+} );
+
+
+/*!
+ * jQuery UI Effects Pulsate 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
-var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
-;/*
- * jQuery UI Effects Transfer 1.8.14
+
+//>>label: Pulsate Effect
+//>>group: Effects
+//>>description: Pulsates an element n times by changing the opacity to zero and back.
+//>>docs: http://api.jqueryui.com/pulsate-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectPulsate = $.effects.define( "pulsate", "show", function( options, done ) {
+	var element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+		hide = mode === "hide",
+		showhide = show || hide,
+
+		// Showing or hiding leaves off the "last" animation
+		anims = ( ( options.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ),
+		duration = options.duration / anims,
+		animateTo = 0,
+		i = 1,
+		queuelen = element.queue().length;
+
+	if ( show || !element.is( ":visible" ) ) {
+		element.css( "opacity", 0 ).show();
+		animateTo = 1;
+	}
+
+	// Anims - 1 opacity "toggles"
+	for ( ; i < anims; i++ ) {
+		element.animate( { opacity: animateTo }, duration, options.easing );
+		animateTo = 1 - animateTo;
+	}
+
+	element.animate( { opacity: animateTo }, duration, options.easing );
+
+	element.queue( done );
+
+	$.effects.unshift( element, queuelen, anims + 1 );
+} );
+
+
+/*!
+ * jQuery UI Effects Shake 1.12.1
+ * http://jqueryui.com
  *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
  * http://jquery.org/license
+ */
+
+//>>label: Shake Effect
+//>>group: Effects
+//>>description: Shakes an element horizontally or vertically n times.
+//>>docs: http://api.jqueryui.com/shake-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectShake = $.effects.define( "shake", function( options, done ) {
+
+	var i = 1,
+		element = $( this ),
+		direction = options.direction || "left",
+		distance = options.distance || 20,
+		times = options.times || 3,
+		anims = times * 2 + 1,
+		speed = Math.round( options.duration / anims ),
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		positiveMotion = ( direction === "up" || direction === "left" ),
+		animation = {},
+		animation1 = {},
+		animation2 = {},
+
+		queuelen = element.queue().length;
+
+	$.effects.createPlaceholder( element );
+
+	// Animation
+	animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance;
+	animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2;
+	animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2;
+
+	// Animate
+	element.animate( animation, speed, options.easing );
+
+	// Shakes
+	for ( ; i < times; i++ ) {
+		element
+			.animate( animation1, speed, options.easing )
+			.animate( animation2, speed, options.easing );
+	}
+
+	element
+		.animate( animation1, speed, options.easing )
+		.animate( animation, speed / 2, options.easing )
+		.queue( done );
+
+	$.effects.unshift( element, queuelen, anims + 1 );
+} );
+
+
+/*!
+ * jQuery UI Effects Slide 1.12.1
+ * http://jqueryui.com
  *
- * http://docs.jquery.com/UI/Effects/Transfer
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Slide Effect
+//>>group: Effects
+//>>description: Slides an element in and out of the viewport.
+//>>docs: http://api.jqueryui.com/slide-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectSlide = $.effects.define( "slide", "show", function( options, done ) {
+	var startClip, startRef,
+		element = $( this ),
+		map = {
+			up: [ "bottom", "top" ],
+			down: [ "top", "bottom" ],
+			left: [ "right", "left" ],
+			right: [ "left", "right" ]
+		},
+		mode = options.mode,
+		direction = options.direction || "left",
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		positiveMotion = ( direction === "up" || direction === "left" ),
+		distance = options.distance ||
+			element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ),
+		animation = {};
+
+	$.effects.createPlaceholder( element );
+
+	startClip = element.cssClip();
+	startRef = element.position()[ ref ];
+
+	// Define hide animation
+	animation[ ref ] = ( positiveMotion ? -1 : 1 ) * distance + startRef;
+	animation.clip = element.cssClip();
+	animation.clip[ map[ direction ][ 1 ] ] = animation.clip[ map[ direction ][ 0 ] ];
+
+	// Reverse the animation if we're showing
+	if ( mode === "show" ) {
+		element.cssClip( animation.clip );
+		element.css( ref, animation[ ref ] );
+		animation.clip = startClip;
+		animation[ ref ] = startRef;
+	}
+
+	// Actually animate
+	element.animate( animation, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+} );
+
+
+/*!
+ * jQuery UI Effects Transfer 1.12.1
+ * http://jqueryui.com
  *
- * Depends:
- *	jquery.effects.core.js
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
  */
-(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
-b.dequeue()})})}})(jQuery);
-;
\ No newline at end of file
+
+//>>label: Transfer Effect
+//>>group: Effects
+//>>description: Displays a transfer effect from one element to another.
+//>>docs: http://api.jqueryui.com/transfer-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effect;
+if ( $.uiBackCompat !== false ) {
+	effect = $.effects.define( "transfer", function( options, done ) {
+		$( this ).transfer( options, done );
+	} );
+}
+var effectsEffectTransfer = effect;
+
+
+
+
+}));
\ No newline at end of file
diff --git a/www/include/common/javascript/jquery/jquery.js b/www/include/common/javascript/jquery/jquery.js
index 3774ff9861..0b1232b7fe 100644
--- a/www/include/common/javascript/jquery/jquery.js
+++ b/www/include/common/javascript/jquery/jquery.js
@@ -1,291 +1,150 @@
 /*!
- * jQuery JavaScript Library v1.7.2
+ * jQuery JavaScript Library v1.12.4
  * http://jquery.com/
  *
- * Copyright 2011, John Resig
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
  * Includes Sizzle.js
  * http://sizzlejs.com/
- * Copyright 2011, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
  *
- * Date: Wed Mar 21 12:46:34 2012 -0700
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2016-05-20T17:17Z
  */
-(function( window, undefined ) {
-
-// Use the correct document accordingly with window argument (sandbox)
-var document = window.document,
-	navigator = window.navigator,
-	location = window.location;
-var jQuery = (function() {
-
-// Define a local copy of jQuery
-var jQuery = function( selector, context ) {
-		// The jQuery object is actually just the init constructor 'enhanced'
-		return new jQuery.fn.init( selector, context, rootjQuery );
-	},
-
-	// Map over jQuery in case of overwrite
-	_jQuery = window.jQuery,
-
-	// Map over the $ in case of overwrite
-	_$ = window.$,
-
-	// A central reference to the root jQuery(document)
-	rootjQuery,
-
-	// A simple way to check for HTML strings or ID strings
-	// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
-	quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,
-
-	// Check if a string has a non-whitespace character in it
-	rnotwhite = /\S/,
-
-	// Used for trimming whitespace
-	trimLeft = /^\s+/,
-	trimRight = /\s+$/,
-
-	// Match a standalone tag
-	rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
-
-	// JSON RegExp
-	rvalidchars = /^[\],:{}\s]*$/,
-	rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,
-	rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,
-	rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
-
-	// Useragent RegExp
-	rwebkit = /(webkit)[ \/]([\w.]+)/,
-	ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
-	rmsie = /(msie) ([\w.]+)/,
-	rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
-
-	// Matches dashed string for camelizing
-	rdashAlpha = /-([a-z]|[0-9])/ig,
-	rmsPrefix = /^-ms-/,
-
-	// Used by jQuery.camelCase as callback to replace()
-	fcamelCase = function( all, letter ) {
-		return ( letter + "" ).toUpperCase();
-	},
-
-	// Keep a UserAgent string for use with jQuery.browser
-	userAgent = navigator.userAgent,
-
-	// For matching the engine and version of the browser
-	browserMatch,
-
-	// The deferred used on DOM ready
-	readyList,
-
-	// The ready event handler
-	DOMContentLoaded,
 
-	// Save a reference to some core methods
-	toString = Object.prototype.toString,
-	hasOwn = Object.prototype.hasOwnProperty,
-	push = Array.prototype.push,
-	slice = Array.prototype.slice,
-	trim = String.prototype.trim,
-	indexOf = Array.prototype.indexOf,
-
-	// [[Class]] -> type pairs
-	class2type = {};
+(function( global, factory ) {
+
+	if ( typeof module === "object" && typeof module.exports === "object" ) {
+		// For CommonJS and CommonJS-like environments where a proper `window`
+		// is present, execute the factory and get jQuery.
+		// For environments that do not have a `window` with a `document`
+		// (such as Node.js), expose a factory as module.exports.
+		// This accentuates the need for the creation of a real `window`.
+		// e.g. var jQuery = require("jquery")(window);
+		// See ticket #14549 for more info.
+		module.exports = global.document ?
+			factory( global, true ) :
+			function( w ) {
+				if ( !w.document ) {
+					throw new Error( "jQuery requires a window with a document" );
+				}
+				return factory( w );
+			};
+	} else {
+		factory( global );
+	}
 
-jQuery.fn = jQuery.prototype = {
-	constructor: jQuery,
-	init: function( selector, context, rootjQuery ) {
-		var match, elem, ret, doc;
+// Pass this if window is not defined yet
+}(typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
 
-		// Handle $(""), $(null), or $(undefined)
-		if ( !selector ) {
-			return this;
-		}
+// Support: Firefox 18+
+// Can't be in strict mode, several libs including ASP.NET trace
+// the stack via arguments.caller.callee and Firefox dies if
+// you try to trace through "use strict" call chains. (#13335)
+//"use strict";
+var deletedIds = [];
 
-		// Handle $(DOMElement)
-		if ( selector.nodeType ) {
-			this.context = this[0] = selector;
-			this.length = 1;
-			return this;
-		}
+var document = window.document;
 
-		// The body element only exists once, optimize finding it
-		if ( selector === "body" && !context && document.body ) {
-			this.context = document;
-			this[0] = document.body;
-			this.selector = selector;
-			this.length = 1;
-			return this;
-		}
+var slice = deletedIds.slice;
 
-		// Handle HTML strings
-		if ( typeof selector === "string" ) {
-			// Are we dealing with HTML string or an ID?
-			if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
-				// Assume that strings that start and end with <> are HTML and skip the regex check
-				match = [ null, selector, null ];
+var concat = deletedIds.concat;
 
-			} else {
-				match = quickExpr.exec( selector );
-			}
+var push = deletedIds.push;
 
-			// Verify a match, and that no context was specified for #id
-			if ( match && (match[1] || !context) ) {
+var indexOf = deletedIds.indexOf;
 
-				// HANDLE: $(html) -> $(array)
-				if ( match[1] ) {
-					context = context instanceof jQuery ? context[0] : context;
-					doc = ( context ? context.ownerDocument || context : document );
+var class2type = {};
 
-					// If a single string is passed in and it's a single tag
-					// just do a createElement and skip the rest
-					ret = rsingleTag.exec( selector );
+var toString = class2type.toString;
 
-					if ( ret ) {
-						if ( jQuery.isPlainObject( context ) ) {
-							selector = [ document.createElement( ret[1] ) ];
-							jQuery.fn.attr.call( selector, context, true );
+var hasOwn = class2type.hasOwnProperty;
 
-						} else {
-							selector = [ doc.createElement( ret[1] ) ];
-						}
+var support = {};
 
-					} else {
-						ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
-						selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes;
-					}
 
-					return jQuery.merge( this, selector );
 
-				// HANDLE: $("#id")
-				} else {
-					elem = document.getElementById( match[2] );
+var
+	version = "1.12.4",
 
-					// Check parentNode to catch when Blackberry 4.6 returns
-					// nodes that are no longer in the document #6963
-					if ( elem && elem.parentNode ) {
-						// Handle the case where IE and Opera return items
-						// by name instead of ID
-						if ( elem.id !== match[2] ) {
-							return rootjQuery.find( selector );
-						}
+	// Define a local copy of jQuery
+	jQuery = function( selector, context ) {
 
-						// Otherwise, we inject the element directly into the jQuery object
-						this.length = 1;
-						this[0] = elem;
-					}
+		// The jQuery object is actually just the init constructor 'enhanced'
+		// Need init if jQuery is called (just allow error to be thrown if not included)
+		return new jQuery.fn.init( selector, context );
+	},
 
-					this.context = document;
-					this.selector = selector;
-					return this;
-				}
+	// Support: Android<4.1, IE<9
+	// Make sure we trim BOM and NBSP
+	rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
 
-			// HANDLE: $(expr, $(...))
-			} else if ( !context || context.jquery ) {
-				return ( context || rootjQuery ).find( selector );
+	// Matches dashed string for camelizing
+	rmsPrefix = /^-ms-/,
+	rdashAlpha = /-([\da-z])/gi,
 
-			// HANDLE: $(expr, context)
-			// (which is just equivalent to: $(context).find(expr)
-			} else {
-				return this.constructor( context ).find( selector );
-			}
+	// Used by jQuery.camelCase as callback to replace()
+	fcamelCase = function( all, letter ) {
+		return letter.toUpperCase();
+	};
 
-		// HANDLE: $(function)
-		// Shortcut for document ready
-		} else if ( jQuery.isFunction( selector ) ) {
-			return rootjQuery.ready( selector );
-		}
+jQuery.fn = jQuery.prototype = {
 
-		if ( selector.selector !== undefined ) {
-			this.selector = selector.selector;
-			this.context = selector.context;
-		}
+	// The current version of jQuery being used
+	jquery: version,
 
-		return jQuery.makeArray( selector, this );
-	},
+	constructor: jQuery,
 
 	// Start with an empty selector
 	selector: "",
 
-	// The current version of jQuery being used
-	jquery: "1.7.2",
-
 	// The default length of a jQuery object is 0
 	length: 0,
 
-	// The number of elements contained in the matched element set
-	size: function() {
-		return this.length;
-	},
-
 	toArray: function() {
-		return slice.call( this, 0 );
+		return slice.call( this );
 	},
 
 	// Get the Nth element in the matched element set OR
 	// Get the whole matched element set as a clean array
 	get: function( num ) {
-		return num == null ?
+		return num != null ?
 
-			// Return a 'clean' array
-			this.toArray() :
+			// Return just the one element from the set
+			( num < 0 ? this[ num + this.length ] : this[ num ] ) :
 
-			// Return just the object
-			( num < 0 ? this[ this.length + num ] : this[ num ] );
+			// Return all the elements in a clean array
+			slice.call( this );
 	},
 
 	// Take an array of elements and push it onto the stack
 	// (returning the new matched element set)
-	pushStack: function( elems, name, selector ) {
-		// Build a new jQuery matched element set
-		var ret = this.constructor();
-
-		if ( jQuery.isArray( elems ) ) {
-			push.apply( ret, elems );
+	pushStack: function( elems ) {
 
-		} else {
-			jQuery.merge( ret, elems );
-		}
+		// Build a new jQuery matched element set
+		var ret = jQuery.merge( this.constructor(), elems );
 
 		// Add the old object onto the stack (as a reference)
 		ret.prevObject = this;
-
 		ret.context = this.context;
 
-		if ( name === "find" ) {
-			ret.selector = this.selector + ( this.selector ? " " : "" ) + selector;
-		} else if ( name ) {
-			ret.selector = this.selector + "." + name + "(" + selector + ")";
-		}
-
 		// Return the newly-formed element set
 		return ret;
 	},
 
 	// Execute a callback for every element in the matched set.
-	// (You can seed the arguments with an array of args, but this is
-	// only used internally.)
-	each: function( callback, args ) {
-		return jQuery.each( this, callback, args );
+	each: function( callback ) {
+		return jQuery.each( this, callback );
 	},
 
-	ready: function( fn ) {
-		// Attach the listeners
-		jQuery.bindReady();
-
-		// Add the callback
-		readyList.add( fn );
-
-		return this;
+	map: function( callback ) {
+		return this.pushStack( jQuery.map( this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		} ) );
 	},
 
-	eq: function( i ) {
-		i = +i;
-		return i === -1 ?
-			this.slice( i ) :
-			this.slice( i, i + 1 );
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ) );
 	},
 
 	first: function() {
@@ -296,34 +155,26 @@ jQuery.fn = jQuery.prototype = {
 		return this.eq( -1 );
 	},
 
-	slice: function() {
-		return this.pushStack( slice.apply( this, arguments ),
-			"slice", slice.call(arguments).join(",") );
-	},
-
-	map: function( callback ) {
-		return this.pushStack( jQuery.map(this, function( elem, i ) {
-			return callback.call( elem, i, elem );
-		}));
+	eq: function( i ) {
+		var len = this.length,
+			j = +i + ( i < 0 ? len : 0 );
+		return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
 	},
 
 	end: function() {
-		return this.prevObject || this.constructor(null);
+		return this.prevObject || this.constructor();
 	},
 
 	// For internal use only.
 	// Behaves like an Array's method, not like a jQuery method.
 	push: push,
-	sort: [].sort,
-	splice: [].splice
+	sort: deletedIds.sort,
+	splice: deletedIds.splice
 };
 
-// Give the init function the jQuery prototype for later instantiation
-jQuery.fn.init.prototype = jQuery.fn;
-
 jQuery.extend = jQuery.fn.extend = function() {
-	var options, name, src, copy, copyIsArray, clone,
-		target = arguments[0] || {},
+	var src, copyIsArray, copy, name, options, clone,
+		target = arguments[ 0 ] || {},
 		i = 1,
 		length = arguments.length,
 		deep = false;
@@ -331,25 +182,28 @@ jQuery.extend = jQuery.fn.extend = function() {
 	// Handle a deep copy situation
 	if ( typeof target === "boolean" ) {
 		deep = target;
-		target = arguments[1] || {};
+
 		// skip the boolean and the target
-		i = 2;
+		target = arguments[ i ] || {};
+		i++;
 	}
 
 	// Handle case when target is a string or something (possible in deep copy)
-	if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+	if ( typeof target !== "object" && !jQuery.isFunction( target ) ) {
 		target = {};
 	}
 
 	// extend jQuery itself if only one argument is passed
-	if ( length === i ) {
+	if ( i === length ) {
 		target = this;
-		--i;
+		i--;
 	}
 
 	for ( ; i < length; i++ ) {
+
 		// Only deal with non-null/undefined values
-		if ( (options = arguments[ i ]) != null ) {
+		if ( ( options = arguments[ i ] ) != null ) {
+
 			// Extend the base object
 			for ( name in options ) {
 				src = target[ name ];
@@ -361,13 +215,15 @@ jQuery.extend = jQuery.fn.extend = function() {
 				}
 
 				// Recurse if we're merging plain objects or arrays
-				if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+				if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
+					( copyIsArray = jQuery.isArray( copy ) ) ) ) {
+
 					if ( copyIsArray ) {
 						copyIsArray = false;
-						clone = src && jQuery.isArray(src) ? src : [];
+						clone = src && jQuery.isArray( src ) ? src : [];
 
 					} else {
-						clone = src && jQuery.isPlainObject(src) ? src : {};
+						clone = src && jQuery.isPlainObject( src ) ? src : {};
 					}
 
 					// Never move original objects, clone them
@@ -385,233 +241,112 @@ jQuery.extend = jQuery.fn.extend = function() {
 	return target;
 };
 
-jQuery.extend({
-	noConflict: function( deep ) {
-		if ( window.$ === jQuery ) {
-			window.$ = _$;
-		}
-
-		if ( deep && window.jQuery === jQuery ) {
-			window.jQuery = _jQuery;
-		}
-
-		return jQuery;
-	},
-
-	// Is the DOM ready to be used? Set to true once it occurs.
-	isReady: false,
-
-	// A counter to track how many items to wait for before
-	// the ready event fires. See #6781
-	readyWait: 1,
-
-	// Hold (or release) the ready event
-	holdReady: function( hold ) {
-		if ( hold ) {
-			jQuery.readyWait++;
-		} else {
-			jQuery.ready( true );
-		}
-	},
-
-	// Handle when the DOM is ready
-	ready: function( wait ) {
-		// Either a released hold or an DOMready/load event and not yet ready
-		if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) {
-			// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
-			if ( !document.body ) {
-				return setTimeout( jQuery.ready, 1 );
-			}
-
-			// Remember that the DOM is ready
-			jQuery.isReady = true;
+jQuery.extend( {
 
-			// If a normal DOM Ready event fired, decrement, and wait if need be
-			if ( wait !== true && --jQuery.readyWait > 0 ) {
-				return;
-			}
+	// Unique for each copy of jQuery on the page
+	expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
 
-			// If there are functions bound, to execute
-			readyList.fireWith( document, [ jQuery ] );
+	// Assume jQuery is ready without the ready module
+	isReady: true,
 
-			// Trigger any bound ready events
-			if ( jQuery.fn.trigger ) {
-				jQuery( document ).trigger( "ready" ).off( "ready" );
-			}
-		}
+	error: function( msg ) {
+		throw new Error( msg );
 	},
 
-	bindReady: function() {
-		if ( readyList ) {
-			return;
-		}
-
-		readyList = jQuery.Callbacks( "once memory" );
-
-		// Catch cases where $(document).ready() is called after the
-		// browser event has already occurred.
-		if ( document.readyState === "complete" ) {
-			// Handle it asynchronously to allow scripts the opportunity to delay ready
-			return setTimeout( jQuery.ready, 1 );
-		}
-
-		// Mozilla, Opera and webkit nightlies currently support this event
-		if ( document.addEventListener ) {
-			// Use the handy event callback
-			document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
-
-			// A fallback to window.onload, that will always work
-			window.addEventListener( "load", jQuery.ready, false );
-
-		// If IE event model is used
-		} else if ( document.attachEvent ) {
-			// ensure firing before onload,
-			// maybe late but safe also for iframes
-			document.attachEvent( "onreadystatechange", DOMContentLoaded );
-
-			// A fallback to window.onload, that will always work
-			window.attachEvent( "onload", jQuery.ready );
-
-			// If IE and not a frame
-			// continually check to see if the document is ready
-			var toplevel = false;
-
-			try {
-				toplevel = window.frameElement == null;
-			} catch(e) {}
-
-			if ( document.documentElement.doScroll && toplevel ) {
-				doScrollCheck();
-			}
-		}
-	},
+	noop: function() {},
 
 	// See test/unit/core.js for details concerning isFunction.
 	// Since version 1.3, DOM methods and functions like alert
 	// aren't supported. They return false on IE (#2968).
 	isFunction: function( obj ) {
-		return jQuery.type(obj) === "function";
+		return jQuery.type( obj ) === "function";
 	},
 
 	isArray: Array.isArray || function( obj ) {
-		return jQuery.type(obj) === "array";
+		return jQuery.type( obj ) === "array";
 	},
 
 	isWindow: function( obj ) {
+		/* jshint eqeqeq: false */
 		return obj != null && obj == obj.window;
 	},
 
 	isNumeric: function( obj ) {
-		return !isNaN( parseFloat(obj) ) && isFinite( obj );
+
+		// parseFloat NaNs numeric-cast false positives (null|true|false|"")
+		// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
+		// subtraction forces infinities to NaN
+		// adding 1 corrects loss of precision from parseFloat (#15100)
+		var realStringObj = obj && obj.toString();
+		return !jQuery.isArray( obj ) && ( realStringObj - parseFloat( realStringObj ) + 1 ) >= 0;
 	},
 
-	type: function( obj ) {
-		return obj == null ?
-			String( obj ) :
-			class2type[ toString.call(obj) ] || "object";
+	isEmptyObject: function( obj ) {
+		var name;
+		for ( name in obj ) {
+			return false;
+		}
+		return true;
 	},
 
 	isPlainObject: function( obj ) {
+		var key;
+
 		// Must be an Object.
 		// Because of IE, we also have to check the presence of the constructor property.
 		// Make sure that DOM nodes and window objects don't pass through, as well
-		if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+		if ( !obj || jQuery.type( obj ) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
 			return false;
 		}
 
 		try {
+
 			// Not own constructor property must be Object
 			if ( obj.constructor &&
-				!hasOwn.call(obj, "constructor") &&
-				!hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+				!hasOwn.call( obj, "constructor" ) &&
+				!hasOwn.call( obj.constructor.prototype, "isPrototypeOf" ) ) {
 				return false;
 			}
 		} catch ( e ) {
+
 			// IE8,9 Will throw exceptions on certain host objects #9897
 			return false;
 		}
 
+		// Support: IE<9
+		// Handle iteration over inherited properties before own properties.
+		if ( !support.ownFirst ) {
+			for ( key in obj ) {
+				return hasOwn.call( obj, key );
+			}
+		}
+
 		// Own properties are enumerated firstly, so to speed up,
 		// if last one is own, then all properties are own.
-
-		var key;
 		for ( key in obj ) {}
 
 		return key === undefined || hasOwn.call( obj, key );
 	},
 
-	isEmptyObject: function( obj ) {
-		for ( var name in obj ) {
-			return false;
-		}
-		return true;
-	},
-
-	error: function( msg ) {
-		throw new Error( msg );
-	},
-
-	parseJSON: function( data ) {
-		if ( typeof data !== "string" || !data ) {
-			return null;
-		}
-
-		// Make sure leading/trailing whitespace is removed (IE can't handle it)
-		data = jQuery.trim( data );
-
-		// Attempt to parse using the native JSON parser first
-		if ( window.JSON && window.JSON.parse ) {
-			return window.JSON.parse( data );
-		}
-
-		// Make sure the incoming data is actual JSON
-		// Logic borrowed from http://json.org/json2.js
-		if ( rvalidchars.test( data.replace( rvalidescape, "@" )
-			.replace( rvalidtokens, "]" )
-			.replace( rvalidbraces, "")) ) {
-
-			return ( new Function( "return " + data ) )();
-
-		}
-		jQuery.error( "Invalid JSON: " + data );
-	},
-
-	// Cross-browser xml parsing
-	parseXML: function( data ) {
-		if ( typeof data !== "string" || !data ) {
-			return null;
-		}
-		var xml, tmp;
-		try {
-			if ( window.DOMParser ) { // Standard
-				tmp = new DOMParser();
-				xml = tmp.parseFromString( data , "text/xml" );
-			} else { // IE
-				xml = new ActiveXObject( "Microsoft.XMLDOM" );
-				xml.async = "false";
-				xml.loadXML( data );
-			}
-		} catch( e ) {
-			xml = undefined;
-		}
-		if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
-			jQuery.error( "Invalid XML: " + data );
+	type: function( obj ) {
+		if ( obj == null ) {
+			return obj + "";
 		}
-		return xml;
+		return typeof obj === "object" || typeof obj === "function" ?
+			class2type[ toString.call( obj ) ] || "object" :
+			typeof obj;
 	},
 
-	noop: function() {},
-
-	// Evaluates a script in a global context
 	// Workarounds based on findings by Jim Driscoll
 	// http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
 	globalEval: function( data ) {
-		if ( data && rnotwhite.test( data ) ) {
+		if ( data && jQuery.trim( data ) ) {
+
 			// We use execScript on Internet Explorer
 			// We use an anonymous function so that context is window
 			// rather than jQuery in Firefox
 			( window.execScript || function( data ) {
-				window[ "eval" ].call( window, data );
+				window[ "eval" ].call( window, data ); // jscs:ignore requireDotNotation
 			} )( data );
 		}
 	},
@@ -623,98 +358,70 @@ jQuery.extend({
 	},
 
 	nodeName: function( elem, name ) {
-		return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+		return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
 	},
 
-	// args is for internal usage only
-	each: function( object, callback, args ) {
-		var name, i = 0,
-			length = object.length,
-			isObj = length === undefined || jQuery.isFunction( object );
+	each: function( obj, callback ) {
+		var length, i = 0;
 
-		if ( args ) {
-			if ( isObj ) {
-				for ( name in object ) {
-					if ( callback.apply( object[ name ], args ) === false ) {
-						break;
-					}
-				}
-			} else {
-				for ( ; i < length; ) {
-					if ( callback.apply( object[ i++ ], args ) === false ) {
-						break;
-					}
+		if ( isArrayLike( obj ) ) {
+			length = obj.length;
+			for ( ; i < length; i++ ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
 				}
 			}
-
-		// A special, fast, case for the most common use of each
 		} else {
-			if ( isObj ) {
-				for ( name in object ) {
-					if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
-						break;
-					}
-				}
-			} else {
-				for ( ; i < length; ) {
-					if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) {
-						break;
-					}
+			for ( i in obj ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
 				}
 			}
 		}
 
-		return object;
+		return obj;
 	},
 
-	// Use native String.trim function wherever possible
-	trim: trim ?
-		function( text ) {
-			return text == null ?
-				"" :
-				trim.call( text );
-		} :
-
-		// Otherwise use our own trimming functionality
-		function( text ) {
-			return text == null ?
-				"" :
-				text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
-		},
+	// Support: Android<4.1, IE<9
+	trim: function( text ) {
+		return text == null ?
+			"" :
+			( text + "" ).replace( rtrim, "" );
+	},
 
 	// results is for internal usage only
-	makeArray: function( array, results ) {
+	makeArray: function( arr, results ) {
 		var ret = results || [];
 
-		if ( array != null ) {
-			// The window, strings (and functions) also have 'length'
-			// Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
-			var type = jQuery.type( array );
-
-			if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) {
-				push.call( ret, array );
+		if ( arr != null ) {
+			if ( isArrayLike( Object( arr ) ) ) {
+				jQuery.merge( ret,
+					typeof arr === "string" ?
+					[ arr ] : arr
+				);
 			} else {
-				jQuery.merge( ret, array );
+				push.call( ret, arr );
 			}
 		}
 
 		return ret;
 	},
 
-	inArray: function( elem, array, i ) {
+	inArray: function( elem, arr, i ) {
 		var len;
 
-		if ( array ) {
+		if ( arr ) {
 			if ( indexOf ) {
-				return indexOf.call( array, elem, i );
+				return indexOf.call( arr, elem, i );
 			}
 
-			len = array.length;
+			len = arr.length;
 			i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;
 
 			for ( ; i < len; i++ ) {
+
 				// Skip accessing in sparse arrays
-				if ( i in array && array[ i ] === elem ) {
+				if ( i in arr && arr[ i ] === elem ) {
 					return i;
 				}
 			}
@@ -724,16 +431,18 @@ jQuery.extend({
 	},
 
 	merge: function( first, second ) {
-		var i = first.length,
-			j = 0;
+		var len = +second.length,
+			j = 0,
+			i = first.length;
 
-		if ( typeof second.length === "number" ) {
-			for ( var l = second.length; j < l; j++ ) {
-				first[ i++ ] = second[ j ];
-			}
+		while ( j < len ) {
+			first[ i++ ] = second[ j++ ];
+		}
 
-		} else {
-			while ( second[j] !== undefined ) {
+		// Support: IE<9
+		// Workaround casting of .length to NaN on otherwise arraylike objects (e.g., NodeLists)
+		if ( len !== len ) {
+			while ( second[ j ] !== undefined ) {
 				first[ i++ ] = second[ j++ ];
 			}
 		}
@@ -743,53 +452,55 @@ jQuery.extend({
 		return first;
 	},
 
-	grep: function( elems, callback, inv ) {
-		var ret = [], retVal;
-		inv = !!inv;
+	grep: function( elems, callback, invert ) {
+		var callbackInverse,
+			matches = [],
+			i = 0,
+			length = elems.length,
+			callbackExpect = !invert;
 
 		// Go through the array, only saving the items
 		// that pass the validator function
-		for ( var i = 0, length = elems.length; i < length; i++ ) {
-			retVal = !!callback( elems[ i ], i );
-			if ( inv !== retVal ) {
-				ret.push( elems[ i ] );
+		for ( ; i < length; i++ ) {
+			callbackInverse = !callback( elems[ i ], i );
+			if ( callbackInverse !== callbackExpect ) {
+				matches.push( elems[ i ] );
 			}
 		}
 
-		return ret;
+		return matches;
 	},
 
 	// arg is for internal usage only
 	map: function( elems, callback, arg ) {
-		var value, key, ret = [],
+		var length, value,
 			i = 0,
-			length = elems.length,
-			// jquery objects are treated as arrays
-			isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ;
+			ret = [];
 
-		// Go through the array, translating each of the items to their
-		if ( isArray ) {
+		// Go through the array, translating each of the items to their new values
+		if ( isArrayLike( elems ) ) {
+			length = elems.length;
 			for ( ; i < length; i++ ) {
 				value = callback( elems[ i ], i, arg );
 
 				if ( value != null ) {
-					ret[ ret.length ] = value;
+					ret.push( value );
 				}
 			}
 
 		// Go through every key on the object,
 		} else {
-			for ( key in elems ) {
-				value = callback( elems[ key ], key, arg );
+			for ( i in elems ) {
+				value = callback( elems[ i ], i, arg );
 
 				if ( value != null ) {
-					ret[ ret.length ] = value;
+					ret.push( value );
 				}
 			}
 		}
 
 		// Flatten any nested arrays
-		return ret.concat.apply( [], ret );
+		return concat.apply( [], ret );
 	},
 
 	// A global GUID counter for objects
@@ -798,8 +509,10 @@ jQuery.extend({
 	// Bind a function to a context, optionally partially applying any
 	// arguments.
 	proxy: function( fn, context ) {
+		var args, proxy, tmp;
+
 		if ( typeof context === "string" ) {
-			var tmp = fn[ context ];
+			tmp = fn[ context ];
 			context = fn;
 			fn = tmp;
 		}
@@ -811,2092 +524,4314 @@ jQuery.extend({
 		}
 
 		// Simulated bind
-		var args = slice.call( arguments, 2 ),
-			proxy = function() {
-				return fn.apply( context, args.concat( slice.call( arguments ) ) );
-			};
+		args = slice.call( arguments, 2 );
+		proxy = function() {
+			return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
+		};
 
 		// Set the guid of unique handler to the same of original handler, so it can be removed
-		proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+		proxy.guid = fn.guid = fn.guid || jQuery.guid++;
 
 		return proxy;
 	},
 
-	// Mutifunctional method to get and set values to a collection
-	// The value/s can optionally be executed if it's a function
-	access: function( elems, fn, key, value, chainable, emptyGet, pass ) {
-		var exec,
-			bulk = key == null,
-			i = 0,
-			length = elems.length;
-
-		// Sets many values
-		if ( key && typeof key === "object" ) {
-			for ( i in key ) {
-				jQuery.access( elems, fn, i, key[i], 1, emptyGet, value );
-			}
-			chainable = 1;
-
-		// Sets one value
-		} else if ( value !== undefined ) {
-			// Optionally, function values get executed if exec is true
-			exec = pass === undefined && jQuery.isFunction( value );
+	now: function() {
+		return +( new Date() );
+	},
 
-			if ( bulk ) {
-				// Bulk operations only iterate when executing function values
-				if ( exec ) {
-					exec = fn;
-					fn = function( elem, key, value ) {
-						return exec.call( jQuery( elem ), value );
-					};
+	// jQuery.support is not used in Core but other projects attach their
+	// properties to it so it needs to exist.
+	support: support
+} );
 
-				// Otherwise they run against the entire set
-				} else {
-					fn.call( elems, value );
-					fn = null;
-				}
-			}
+// JSHint would error on this code due to the Symbol not being defined in ES5.
+// Defining this global in .jshintrc would create a danger of using the global
+// unguarded in another place, it seems safer to just disable JSHint for these
+// three lines.
+/* jshint ignore: start */
+if ( typeof Symbol === "function" ) {
+	jQuery.fn[ Symbol.iterator ] = deletedIds[ Symbol.iterator ];
+}
+/* jshint ignore: end */
 
-			if ( fn ) {
-				for (; i < length; i++ ) {
-					fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
-				}
-			}
+// Populate the class2type map
+jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
+function( i, name ) {
+	class2type[ "[object " + name + "]" ] = name.toLowerCase();
+} );
 
-			chainable = 1;
-		}
+function isArrayLike( obj ) {
 
-		return chainable ?
-			elems :
+	// Support: iOS 8.2 (not reproducible in simulator)
+	// `in` check used to prevent JIT error (gh-2145)
+	// hasOwn isn't used here due to false negatives
+	// regarding Nodelist length in IE
+	var length = !!obj && "length" in obj && obj.length,
+		type = jQuery.type( obj );
 
-			// Gets
-			bulk ?
-				fn.call( elems ) :
-				length ? fn( elems[0], key ) : emptyGet;
-	},
+	if ( type === "function" || jQuery.isWindow( obj ) ) {
+		return false;
+	}
 
-	now: function() {
-		return ( new Date() ).getTime();
+	return type === "array" || length === 0 ||
+		typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+var Sizzle =
+/*!
+ * Sizzle CSS Selector Engine v2.2.1
+ * http://sizzlejs.com/
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2015-10-17
+ */
+(function( window ) {
+
+var i,
+	support,
+	Expr,
+	getText,
+	isXML,
+	tokenize,
+	compile,
+	select,
+	outermostContext,
+	sortInput,
+	hasDuplicate,
+
+	// Local document vars
+	setDocument,
+	document,
+	docElem,
+	documentIsHTML,
+	rbuggyQSA,
+	rbuggyMatches,
+	matches,
+	contains,
+
+	// Instance-specific data
+	expando = "sizzle" + 1 * new Date(),
+	preferredDoc = window.document,
+	dirruns = 0,
+	done = 0,
+	classCache = createCache(),
+	tokenCache = createCache(),
+	compilerCache = createCache(),
+	sortOrder = function( a, b ) {
+		if ( a === b ) {
+			hasDuplicate = true;
+		}
+		return 0;
 	},
 
-	// Use of jQuery.browser is frowned upon.
-	// More details: http://docs.jquery.com/Utilities/jQuery.browser
-	uaMatch: function( ua ) {
-		ua = ua.toLowerCase();
+	// General-purpose constants
+	MAX_NEGATIVE = 1 << 31,
 
-		var match = rwebkit.exec( ua ) ||
-			ropera.exec( ua ) ||
-			rmsie.exec( ua ) ||
-			ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) ||
-			[];
-
-		return { browser: match[1] || "", version: match[2] || "0" };
-	},
-
-	sub: function() {
-		function jQuerySub( selector, context ) {
-			return new jQuerySub.fn.init( selector, context );
-		}
-		jQuery.extend( true, jQuerySub, this );
-		jQuerySub.superclass = this;
-		jQuerySub.fn = jQuerySub.prototype = this();
-		jQuerySub.fn.constructor = jQuerySub;
-		jQuerySub.sub = this.sub;
-		jQuerySub.fn.init = function init( selector, context ) {
-			if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) {
-				context = jQuerySub( context );
+	// Instance methods
+	hasOwn = ({}).hasOwnProperty,
+	arr = [],
+	pop = arr.pop,
+	push_native = arr.push,
+	push = arr.push,
+	slice = arr.slice,
+	// Use a stripped-down indexOf as it's faster than native
+	// http://jsperf.com/thor-indexof-vs-for/5
+	indexOf = function( list, elem ) {
+		var i = 0,
+			len = list.length;
+		for ( ; i < len; i++ ) {
+			if ( list[i] === elem ) {
+				return i;
 			}
-
-			return jQuery.fn.init.call( this, selector, context, rootjQuerySub );
-		};
-		jQuerySub.fn.init.prototype = jQuerySub.fn;
-		var rootjQuerySub = jQuerySub(document);
-		return jQuerySub;
+		}
+		return -1;
 	},
 
-	browser: {}
-});
-
-// Populate the class2type map
-jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
-	class2type[ "[object " + name + "]" ] = name.toLowerCase();
-});
+	booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
+
+	// Regular expressions
+
+	// http://www.w3.org/TR/css3-selectors/#whitespace
+	whitespace = "[\\x20\\t\\r\\n\\f]",
+
+	// http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+	identifier = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",
+
+	// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
+	attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
+		// Operator (capture 2)
+		"*([*^$|!~]?=)" + whitespace +
+		// "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
+		"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace +
+		"*\\]",
+
+	pseudos = ":(" + identifier + ")(?:\\((" +
+		// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
+		// 1. quoted (capture 3; capture 4 or capture 5)
+		"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
+		// 2. simple (capture 6)
+		"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
+		// 3. anything else (capture 2)
+		".*" +
+		")\\)|)",
+
+	// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+	rwhitespace = new RegExp( whitespace + "+", "g" ),
+	rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
+
+	rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+	rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ),
+
+	rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ),
+
+	rpseudo = new RegExp( pseudos ),
+	ridentifier = new RegExp( "^" + identifier + "$" ),
+
+	matchExpr = {
+		"ID": new RegExp( "^#(" + identifier + ")" ),
+		"CLASS": new RegExp( "^\\.(" + identifier + ")" ),
+		"TAG": new RegExp( "^(" + identifier + "|[*])" ),
+		"ATTR": new RegExp( "^" + attributes ),
+		"PSEUDO": new RegExp( "^" + pseudos ),
+		"CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
+			"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+			"*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+		"bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
+		// For use in libraries implementing .is()
+		// We use this for POS matching in `select`
+		"needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
+			whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+	},
+
+	rinputs = /^(?:input|select|textarea|button)$/i,
+	rheader = /^h\d$/i,
+
+	rnative = /^[^{]+\{\s*\[native \w/,
+
+	// Easily-parseable/retrievable ID or TAG or CLASS selectors
+	rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+	rsibling = /[+~]/,
+	rescape = /'|\\/g,
+
+	// CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+	runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ),
+	funescape = function( _, escaped, escapedWhitespace ) {
+		var high = "0x" + escaped - 0x10000;
+		// NaN means non-codepoint
+		// Support: Firefox<24
+		// Workaround erroneous numeric interpretation of +"0x"
+		return high !== high || escapedWhitespace ?
+			escaped :
+			high < 0 ?
+				// BMP codepoint
+				String.fromCharCode( high + 0x10000 ) :
+				// Supplemental Plane codepoint (surrogate pair)
+				String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+	},
+
+	// Used for iframes
+	// See setDocument()
+	// Removing the function wrapper causes a "Permission Denied"
+	// error in IE
+	unloadHandler = function() {
+		setDocument();
+	};
 
-browserMatch = jQuery.uaMatch( userAgent );
-if ( browserMatch.browser ) {
-	jQuery.browser[ browserMatch.browser ] = true;
-	jQuery.browser.version = browserMatch.version;
-}
+// Optimize for push.apply( _, NodeList )
+try {
+	push.apply(
+		(arr = slice.call( preferredDoc.childNodes )),
+		preferredDoc.childNodes
+	);
+	// Support: Android<4.0
+	// Detect silently failing push.apply
+	arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+	push = { apply: arr.length ?
+
+		// Leverage slice if possible
+		function( target, els ) {
+			push_native.apply( target, slice.call(els) );
+		} :
 
-// Deprecated, use jQuery.browser.webkit instead
-if ( jQuery.browser.webkit ) {
-	jQuery.browser.safari = true;
+		// Support: IE<9
+		// Otherwise append directly
+		function( target, els ) {
+			var j = target.length,
+				i = 0;
+			// Can't trust NodeList.length
+			while ( (target[j++] = els[i++]) ) {}
+			target.length = j - 1;
+		}
+	};
 }
 
-// IE doesn't match non-breaking spaces with \s
-if ( rnotwhite.test( "\xA0" ) ) {
-	trimLeft = /^[\s\xA0]+/;
-	trimRight = /[\s\xA0]+$/;
-}
+function Sizzle( selector, context, results, seed ) {
+	var m, i, elem, nid, nidselect, match, groups, newSelector,
+		newContext = context && context.ownerDocument,
 
-// All jQuery objects should point back to these
-rootjQuery = jQuery(document);
+		// nodeType defaults to 9, since context defaults to document
+		nodeType = context ? context.nodeType : 9;
 
-// Cleanup functions for the document ready method
-if ( document.addEventListener ) {
-	DOMContentLoaded = function() {
-		document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
-		jQuery.ready();
-	};
+	results = results || [];
 
-} else if ( document.attachEvent ) {
-	DOMContentLoaded = function() {
-		// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
-		if ( document.readyState === "complete" ) {
-			document.detachEvent( "onreadystatechange", DOMContentLoaded );
-			jQuery.ready();
-		}
-	};
-}
+	// Return early from calls with invalid selector or context
+	if ( typeof selector !== "string" || !selector ||
+		nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
 
-// The DOM ready check for Internet Explorer
-function doScrollCheck() {
-	if ( jQuery.isReady ) {
-		return;
+		return results;
 	}
 
-	try {
-		// If IE is used, use the trick by Diego Perini
-		// http://javascript.nwbox.com/IEContentLoaded/
-		document.documentElement.doScroll("left");
-	} catch(e) {
-		setTimeout( doScrollCheck, 1 );
-		return;
-	}
+	// Try to shortcut find operations (as opposed to filters) in HTML documents
+	if ( !seed ) {
 
-	// and execute any waiting functions
-	jQuery.ready();
-}
+		if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {
+			setDocument( context );
+		}
+		context = context || document;
 
-return jQuery;
+		if ( documentIsHTML ) {
 
-})();
+			// If the selector is sufficiently simple, try using a "get*By*" DOM method
+			// (excepting DocumentFragment context, where the methods don't exist)
+			if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {
 
+				// ID selector
+				if ( (m = match[1]) ) {
 
-// String to Object flags format cache
-var flagsCache = {};
+					// Document context
+					if ( nodeType === 9 ) {
+						if ( (elem = context.getElementById( m )) ) {
 
-// Convert String-formatted flags into Object-formatted ones and store in cache
-function createFlags( flags ) {
-	var object = flagsCache[ flags ] = {},
-		i, length;
-	flags = flags.split( /\s+/ );
-	for ( i = 0, length = flags.length; i < length; i++ ) {
-		object[ flags[i] ] = true;
-	}
-	return object;
-}
+							// Support: IE, Opera, Webkit
+							// TODO: identify versions
+							// getElementById can match elements by name instead of ID
+							if ( elem.id === m ) {
+								results.push( elem );
+								return results;
+							}
+						} else {
+							return results;
+						}
 
-/*
- * Create a callback list using the following parameters:
- *
- *	flags:	an optional list of space-separated flags that will change how
- *			the callback list behaves
- *
- * By default a callback list will act like an event callback list and can be
- * "fired" multiple times.
- *
- * Possible flags:
- *
- *	once:			will ensure the callback list can only be fired once (like a Deferred)
- *
- *	memory:			will keep track of previous values and will call any callback added
- *					after the list has been fired right away with the latest "memorized"
- *					values (like a Deferred)
- *
- *	unique:			will ensure a callback can only be added once (no duplicate in the list)
- *
- *	stopOnFalse:	interrupt callings when a callback returns false
- *
- */
-jQuery.Callbacks = function( flags ) {
+					// Element context
+					} else {
 
-	// Convert flags from String-formatted to Object-formatted
-	// (we check in cache first)
-	flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {};
+						// Support: IE, Opera, Webkit
+						// TODO: identify versions
+						// getElementById can match elements by name instead of ID
+						if ( newContext && (elem = newContext.getElementById( m )) &&
+							contains( context, elem ) &&
+							elem.id === m ) {
 
-	var // Actual callback list
-		list = [],
-		// Stack of fire calls for repeatable lists
-		stack = [],
-		// Last fire value (for non-forgettable lists)
-		memory,
-		// Flag to know if list was already fired
-		fired,
-		// Flag to know if list is currently firing
-		firing,
-		// First callback to fire (used internally by add and fireWith)
-		firingStart,
-		// End of the loop when firing
-		firingLength,
-		// Index of currently firing callback (modified by remove if needed)
-		firingIndex,
-		// Add one or several callbacks to the list
-		add = function( args ) {
-			var i,
-				length,
-				elem,
-				type,
-				actual;
-			for ( i = 0, length = args.length; i < length; i++ ) {
-				elem = args[ i ];
-				type = jQuery.type( elem );
-				if ( type === "array" ) {
-					// Inspect recursively
-					add( elem );
-				} else if ( type === "function" ) {
-					// Add if not in unique mode and callback is not in
-					if ( !flags.unique || !self.has( elem ) ) {
-						list.push( elem );
-					}
-				}
-			}
-		},
-		// Fire callbacks
-		fire = function( context, args ) {
-			args = args || [];
-			memory = !flags.memory || [ context, args ];
-			fired = true;
-			firing = true;
-			firingIndex = firingStart || 0;
-			firingStart = 0;
-			firingLength = list.length;
-			for ( ; list && firingIndex < firingLength; firingIndex++ ) {
-				if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) {
-					memory = true; // Mark as halted
-					break;
-				}
-			}
-			firing = false;
-			if ( list ) {
-				if ( !flags.once ) {
-					if ( stack && stack.length ) {
-						memory = stack.shift();
-						self.fireWith( memory[ 0 ], memory[ 1 ] );
-					}
-				} else if ( memory === true ) {
-					self.disable();
-				} else {
-					list = [];
-				}
-			}
-		},
-		// Actual Callbacks object
-		self = {
-			// Add a callback or a collection of callbacks to the list
-			add: function() {
-				if ( list ) {
-					var length = list.length;
-					add( arguments );
-					// Do we need to add the callbacks to the
-					// current firing batch?
-					if ( firing ) {
-						firingLength = list.length;
-					// With memory, if we're not firing then
-					// we should call right away, unless previous
-					// firing was halted (stopOnFalse)
-					} else if ( memory && memory !== true ) {
-						firingStart = length;
-						fire( memory[ 0 ], memory[ 1 ] );
-					}
-				}
-				return this;
-			},
-			// Remove a callback from the list
-			remove: function() {
-				if ( list ) {
-					var args = arguments,
-						argIndex = 0,
-						argLength = args.length;
-					for ( ; argIndex < argLength ; argIndex++ ) {
-						for ( var i = 0; i < list.length; i++ ) {
-							if ( args[ argIndex ] === list[ i ] ) {
-								// Handle firingIndex and firingLength
-								if ( firing ) {
-									if ( i <= firingLength ) {
-										firingLength--;
-										if ( i <= firingIndex ) {
-											firingIndex--;
-										}
-									}
-								}
-								// Remove the element
-								list.splice( i--, 1 );
-								// If we have some unicity property then
-								// we only need to do this once
-								if ( flags.unique ) {
-									break;
-								}
-							}
-						}
-					}
-				}
-				return this;
-			},
-			// Control if a given callback is in the list
-			has: function( fn ) {
-				if ( list ) {
-					var i = 0,
-						length = list.length;
-					for ( ; i < length; i++ ) {
-						if ( fn === list[ i ] ) {
-							return true;
-						}
-					}
-				}
-				return false;
-			},
-			// Remove all callbacks from the list
-			empty: function() {
-				list = [];
-				return this;
-			},
-			// Have the list do nothing anymore
-			disable: function() {
-				list = stack = memory = undefined;
-				return this;
-			},
-			// Is it disabled?
-			disabled: function() {
-				return !list;
-			},
-			// Lock the list in its current state
-			lock: function() {
-				stack = undefined;
-				if ( !memory || memory === true ) {
-					self.disable();
-				}
-				return this;
-			},
-			// Is it locked?
-			locked: function() {
-				return !stack;
-			},
-			// Call all callbacks with the given context and arguments
-			fireWith: function( context, args ) {
-				if ( stack ) {
-					if ( firing ) {
-						if ( !flags.once ) {
-							stack.push( [ context, args ] );
+							results.push( elem );
+							return results;
 						}
-					} else if ( !( flags.once && memory ) ) {
-						fire( context, args );
 					}
-				}
-				return this;
-			},
-			// Call all the callbacks with the given arguments
-			fire: function() {
-				self.fireWith( this, arguments );
-				return this;
-			},
-			// To know if the callbacks have already been called at least once
-			fired: function() {
-				return !!fired;
-			}
-		};
 
-	return self;
-};
+				// Type selector
+				} else if ( match[2] ) {
+					push.apply( results, context.getElementsByTagName( selector ) );
+					return results;
 
+				// Class selector
+				} else if ( (m = match[3]) && support.getElementsByClassName &&
+					context.getElementsByClassName ) {
 
+					push.apply( results, context.getElementsByClassName( m ) );
+					return results;
+				}
+			}
 
+			// Take advantage of querySelectorAll
+			if ( support.qsa &&
+				!compilerCache[ selector + " " ] &&
+				(!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
 
-var // Static reference to slice
-	sliceDeferred = [].slice;
+				if ( nodeType !== 1 ) {
+					newContext = context;
+					newSelector = selector;
 
-jQuery.extend({
+				// qSA looks outside Element context, which is not what we want
+				// Thanks to Andrew Dupont for this workaround technique
+				// Support: IE <=8
+				// Exclude object elements
+				} else if ( context.nodeName.toLowerCase() !== "object" ) {
 
-	Deferred: function( func ) {
-		var doneList = jQuery.Callbacks( "once memory" ),
-			failList = jQuery.Callbacks( "once memory" ),
-			progressList = jQuery.Callbacks( "memory" ),
-			state = "pending",
-			lists = {
-				resolve: doneList,
-				reject: failList,
-				notify: progressList
-			},
-			promise = {
-				done: doneList.add,
-				fail: failList.add,
-				progress: progressList.add,
+					// Capture the context ID, setting it first if necessary
+					if ( (nid = context.getAttribute( "id" )) ) {
+						nid = nid.replace( rescape, "\\$&" );
+					} else {
+						context.setAttribute( "id", (nid = expando) );
+					}
 
-				state: function() {
-					return state;
-				},
+					// Prefix every selector in the list
+					groups = tokenize( selector );
+					i = groups.length;
+					nidselect = ridentifier.test( nid ) ? "#" + nid : "[id='" + nid + "']";
+					while ( i-- ) {
+						groups[i] = nidselect + " " + toSelector( groups[i] );
+					}
+					newSelector = groups.join( "," );
 
-				// Deprecated
-				isResolved: doneList.fired,
-				isRejected: failList.fired,
+					// Expand context for sibling selectors
+					newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
+						context;
+				}
 
-				then: function( doneCallbacks, failCallbacks, progressCallbacks ) {
-					deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks );
-					return this;
-				},
-				always: function() {
-					deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments );
-					return this;
-				},
-				pipe: function( fnDone, fnFail, fnProgress ) {
-					return jQuery.Deferred(function( newDefer ) {
-						jQuery.each( {
-							done: [ fnDone, "resolve" ],
-							fail: [ fnFail, "reject" ],
-							progress: [ fnProgress, "notify" ]
-						}, function( handler, data ) {
-							var fn = data[ 0 ],
-								action = data[ 1 ],
-								returned;
-							if ( jQuery.isFunction( fn ) ) {
-								deferred[ handler ](function() {
-									returned = fn.apply( this, arguments );
-									if ( returned && jQuery.isFunction( returned.promise ) ) {
-										returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify );
-									} else {
-										newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] );
-									}
-								});
-							} else {
-								deferred[ handler ]( newDefer[ action ] );
-							}
-						});
-					}).promise();
-				},
-				// Get a promise for this deferred
-				// If obj is provided, the promise aspect is added to the object
-				promise: function( obj ) {
-					if ( obj == null ) {
-						obj = promise;
-					} else {
-						for ( var key in promise ) {
-							obj[ key ] = promise[ key ];
+				if ( newSelector ) {
+					try {
+						push.apply( results,
+							newContext.querySelectorAll( newSelector )
+						);
+						return results;
+					} catch ( qsaError ) {
+					} finally {
+						if ( nid === expando ) {
+							context.removeAttribute( "id" );
 						}
 					}
-					return obj;
 				}
-			},
-			deferred = promise.promise({}),
-			key;
-
-		for ( key in lists ) {
-			deferred[ key ] = lists[ key ].fire;
-			deferred[ key + "With" ] = lists[ key ].fireWith;
+			}
 		}
+	}
 
-		// Handle state
-		deferred.done( function() {
-			state = "resolved";
-		}, failList.disable, progressList.lock ).fail( function() {
-			state = "rejected";
-		}, doneList.disable, progressList.lock );
-
-		// Call given func if any
-		if ( func ) {
-			func.call( deferred, deferred );
-		}
+	// All others
+	return select( selector.replace( rtrim, "$1" ), context, results, seed );
+}
 
-		// All done!
-		return deferred;
-	},
+/**
+ * Create key-value caches of limited size
+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
+ *	property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ *	deleting the oldest entry
+ */
+function createCache() {
+	var keys = [];
 
-	// Deferred helper
-	when: function( firstParam ) {
-		var args = sliceDeferred.call( arguments, 0 ),
-			i = 0,
-			length = args.length,
-			pValues = new Array( length ),
-			count = length,
-			pCount = length,
-			deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ?
-				firstParam :
-				jQuery.Deferred(),
-			promise = deferred.promise();
-		function resolveFunc( i ) {
-			return function( value ) {
-				args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value;
-				if ( !( --count ) ) {
-					deferred.resolveWith( deferred, args );
-				}
-			};
-		}
-		function progressFunc( i ) {
-			return function( value ) {
-				pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value;
-				deferred.notifyWith( promise, pValues );
-			};
-		}
-		if ( length > 1 ) {
-			for ( ; i < length; i++ ) {
-				if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) {
-					args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) );
-				} else {
-					--count;
-				}
-			}
-			if ( !count ) {
-				deferred.resolveWith( deferred, args );
-			}
-		} else if ( deferred !== firstParam ) {
-			deferred.resolveWith( deferred, length ? [ firstParam ] : [] );
+	function cache( key, value ) {
+		// Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+		if ( keys.push( key + " " ) > Expr.cacheLength ) {
+			// Only keep the most recent entries
+			delete cache[ keys.shift() ];
 		}
-		return promise;
+		return (cache[ key + " " ] = value);
 	}
-});
-
+	return cache;
+}
 
+/**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+	fn[ expando ] = true;
+	return fn;
+}
 
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created div and expects a boolean result
+ */
+function assert( fn ) {
+	var div = document.createElement("div");
 
-jQuery.support = (function() {
+	try {
+		return !!fn( div );
+	} catch (e) {
+		return false;
+	} finally {
+		// Remove from its parent by default
+		if ( div.parentNode ) {
+			div.parentNode.removeChild( div );
+		}
+		// release memory in IE
+		div = null;
+	}
+}
 
-	var support,
-		all,
-		a,
-		select,
-		opt,
-		input,
-		fragment,
-		tds,
-		events,
-		eventName,
-		i,
-		isSupported,
-		div = document.createElement( "div" ),
-		documentElement = document.documentElement;
+/**
+ * Adds the same handler for all of the specified attrs
+ * @param {String} attrs Pipe-separated list of attributes
+ * @param {Function} handler The method that will be applied
+ */
+function addHandle( attrs, handler ) {
+	var arr = attrs.split("|"),
+		i = arr.length;
 
-	// Preliminary tests
-	div.setAttribute("className", "t");
-	div.innerHTML = "   <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+	while ( i-- ) {
+		Expr.attrHandle[ arr[i] ] = handler;
+	}
+}
 
-	all = div.getElementsByTagName( "*" );
-	a = div.getElementsByTagName( "a" )[ 0 ];
+/**
+ * Checks document order of two siblings
+ * @param {Element} a
+ * @param {Element} b
+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
+ */
+function siblingCheck( a, b ) {
+	var cur = b && a,
+		diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
+			( ~b.sourceIndex || MAX_NEGATIVE ) -
+			( ~a.sourceIndex || MAX_NEGATIVE );
+
+	// Use IE sourceIndex if available on both nodes
+	if ( diff ) {
+		return diff;
+	}
 
-	// Can't get basic test support
-	if ( !all || !all.length || !a ) {
-		return {};
-	}
-
-	// First batch of supports tests
-	select = document.createElement( "select" );
-	opt = select.appendChild( document.createElement("option") );
-	input = div.getElementsByTagName( "input" )[ 0 ];
-
-	support = {
-		// IE strips leading whitespace when .innerHTML is used
-		leadingWhitespace: ( div.firstChild.nodeType === 3 ),
-
-		// Make sure that tbody elements aren't automatically inserted
-		// IE will insert them into empty tables
-		tbody: !div.getElementsByTagName("tbody").length,
-
-		// Make sure that link elements get serialized correctly by innerHTML
-		// This requires a wrapper element in IE
-		htmlSerialize: !!div.getElementsByTagName("link").length,
-
-		// Get the style information from getAttribute
-		// (IE uses .cssText instead)
-		style: /top/.test( a.getAttribute("style") ),
-
-		// Make sure that URLs aren't manipulated
-		// (IE normalizes it by default)
-		hrefNormalized: ( a.getAttribute("href") === "/a" ),
-
-		// Make sure that element opacity exists
-		// (IE uses filter instead)
-		// Use a regex to work around a WebKit issue. See #5145
-		opacity: /^0.55/.test( a.style.opacity ),
-
-		// Verify style float existence
-		// (IE uses styleFloat instead of cssFloat)
-		cssFloat: !!a.style.cssFloat,
-
-		// Make sure that if no value is specified for a checkbox
-		// that it defaults to "on".
-		// (WebKit defaults to "" instead)
-		checkOn: ( input.value === "on" ),
-
-		// Make sure that a selected-by-default option has a working selected property.
-		// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
-		optSelected: opt.selected,
-
-		// Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
-		getSetAttribute: div.className !== "t",
-
-		// Tests for enctype support on a form(#6743)
-		enctype: !!document.createElement("form").enctype,
-
-		// Makes sure cloning an html5 element does not cause problems
-		// Where outerHTML is undefined, this still works
-		html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>",
-
-		// Will be defined later
-		submitBubbles: true,
-		changeBubbles: true,
-		focusinBubbles: false,
-		deleteExpando: true,
-		noCloneEvent: true,
-		inlineBlockNeedsLayout: false,
-		shrinkWrapBlocks: false,
-		reliableMarginRight: true,
-		pixelMargin: true
-	};
+	// Check if b follows a
+	if ( cur ) {
+		while ( (cur = cur.nextSibling) ) {
+			if ( cur === b ) {
+				return -1;
+			}
+		}
+	}
 
-	// jQuery.boxModel DEPRECATED in 1.3, use jQuery.support.boxModel instead
-	jQuery.boxModel = support.boxModel = (document.compatMode === "CSS1Compat");
+	return a ? 1 : -1;
+}
 
-	// Make sure checked status is properly cloned
-	input.checked = true;
-	support.noCloneChecked = input.cloneNode( true ).checked;
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+	return function( elem ) {
+		var name = elem.nodeName.toLowerCase();
+		return name === "input" && elem.type === type;
+	};
+}
 
-	// Make sure that the options inside disabled selects aren't marked as disabled
-	// (WebKit marks them as disabled)
-	select.disabled = true;
-	support.optDisabled = !opt.disabled;
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+	return function( elem ) {
+		var name = elem.nodeName.toLowerCase();
+		return (name === "input" || name === "button") && elem.type === type;
+	};
+}
 
-	// Test to see if it's possible to delete an expando from an element
-	// Fails in Internet Explorer
-	try {
-		delete div.test;
-	} catch( e ) {
-		support.deleteExpando = false;
-	}
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+	return markFunction(function( argument ) {
+		argument = +argument;
+		return markFunction(function( seed, matches ) {
+			var j,
+				matchIndexes = fn( [], seed.length, argument ),
+				i = matchIndexes.length;
 
-	if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
-		div.attachEvent( "onclick", function() {
-			// Cloning a node shouldn't copy over any
-			// bound event handlers (IE does this)
-			support.noCloneEvent = false;
+			// Match elements found at the specified indexes
+			while ( i-- ) {
+				if ( seed[ (j = matchIndexes[i]) ] ) {
+					seed[j] = !(matches[j] = seed[j]);
+				}
+			}
 		});
-		div.cloneNode( true ).fireEvent( "onclick" );
-	}
+	});
+}
 
-	// Check if a radio maintains its value
-	// after being appended to the DOM
-	input = document.createElement("input");
-	input.value = "t";
-	input.setAttribute("type", "radio");
-	support.radioValue = input.value === "t";
+/**
+ * Checks a node for validity as a Sizzle context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+	return context && typeof context.getElementsByTagName !== "undefined" && context;
+}
 
-	input.setAttribute("checked", "checked");
+// Expose support vars for convenience
+support = Sizzle.support = {};
 
-	// #11217 - WebKit loses check when the name is after the checked attribute
-	input.setAttribute( "name", "t" );
+/**
+ * Detects XML nodes
+ * @param {Element|Object} elem An element or a document
+ * @returns {Boolean} True iff elem is a non-HTML XML node
+ */
+isXML = Sizzle.isXML = function( elem ) {
+	// documentElement is verified for cases where it doesn't yet exist
+	// (such as loading iframes in IE - #4833)
+	var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+	return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
 
-	div.appendChild( input );
-	fragment = document.createDocumentFragment();
-	fragment.appendChild( div.lastChild );
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+setDocument = Sizzle.setDocument = function( node ) {
+	var hasCompare, parent,
+		doc = node ? node.ownerDocument || node : preferredDoc;
 
-	// WebKit doesn't clone checked state correctly in fragments
-	support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
+	// Return early if doc is invalid or already selected
+	if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {
+		return document;
+	}
 
-	// Check if a disconnected checkbox will retain its checked
-	// value of true after appended to the DOM (IE6/7)
-	support.appendChecked = input.checked;
+	// Update global variables
+	document = doc;
+	docElem = document.documentElement;
+	documentIsHTML = !isXML( document );
 
-	fragment.removeChild( input );
-	fragment.appendChild( div );
+	// Support: IE 9-11, Edge
+	// Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
+	if ( (parent = document.defaultView) && parent.top !== parent ) {
+		// Support: IE 11
+		if ( parent.addEventListener ) {
+			parent.addEventListener( "unload", unloadHandler, false );
 
-	// Technique from Juriy Zaytsev
-	// http://perfectionkills.com/detecting-event-support-without-browser-sniffing/
-	// We only care about the case where non-standard event systems
-	// are used, namely in IE. Short-circuiting here helps us to
-	// avoid an eval call (in setAttribute) which can cause CSP
-	// to go haywire. See: https://developer.mozilla.org/en/Security/CSP
-	if ( div.attachEvent ) {
-		for ( i in {
-			submit: 1,
-			change: 1,
-			focusin: 1
-		}) {
-			eventName = "on" + i;
-			isSupported = ( eventName in div );
-			if ( !isSupported ) {
-				div.setAttribute( eventName, "return;" );
-				isSupported = ( typeof div[ eventName ] === "function" );
-			}
-			support[ i + "Bubbles" ] = isSupported;
-		}
-	}
-
-	fragment.removeChild( div );
-
-	// Null elements to avoid leaks in IE
-	fragment = select = opt = div = input = null;
-
-	// Run tests that need a body at doc ready
-	jQuery(function() {
-		var container, outer, inner, table, td, offsetSupport,
-			marginDiv, conMarginTop, style, html, positionTopLeftWidthHeight,
-			paddingMarginBorderVisibility, paddingMarginBorder,
-			body = document.getElementsByTagName("body")[0];
-
-		if ( !body ) {
-			// Return for frameset docs that don't have a body
-			return;
+		// Support: IE 9 - 10 only
+		} else if ( parent.attachEvent ) {
+			parent.attachEvent( "onunload", unloadHandler );
 		}
+	}
 
-		conMarginTop = 1;
-		paddingMarginBorder = "padding:0;margin:0;border:";
-		positionTopLeftWidthHeight = "position:absolute;top:0;left:0;width:1px;height:1px;";
-		paddingMarginBorderVisibility = paddingMarginBorder + "0;visibility:hidden;";
-		style = "style='" + positionTopLeftWidthHeight + paddingMarginBorder + "5px solid #000;";
-		html = "<div " + style + "display:block;'><div style='" + paddingMarginBorder + "0;display:block;overflow:hidden;'></div></div>" +
-			"<table " + style + "' cellpadding='0' cellspacing='0'>" +
-			"<tr><td></td></tr></table>";
+	/* Attributes
+	---------------------------------------------------------------------- */
 
-		container = document.createElement("div");
-		container.style.cssText = paddingMarginBorderVisibility + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px";
-		body.insertBefore( container, body.firstChild );
+	// Support: IE<8
+	// Verify that getAttribute really returns attributes and not properties
+	// (excepting IE8 booleans)
+	support.attributes = assert(function( div ) {
+		div.className = "i";
+		return !div.getAttribute("className");
+	});
 
-		// Construct the test element
-		div = document.createElement("div");
-		container.appendChild( div );
+	/* getElement(s)By*
+	---------------------------------------------------------------------- */
 
-		// Check if table cells still have offsetWidth/Height when they are set
-		// to display:none and there are still other visible table cells in a
-		// table row; if so, offsetWidth/Height are not reliable for use when
-		// determining if an element has been hidden directly using
-		// display:none (it is still safe to use offsets if a parent element is
-		// hidden; don safety goggles and see bug #4512 for more information).
-		// (only IE 8 fails this test)
-		div.innerHTML = "<table><tr><td style='" + paddingMarginBorder + "0;display:none'></td><td>t</td></tr></table>";
-		tds = div.getElementsByTagName( "td" );
-		isSupported = ( tds[ 0 ].offsetHeight === 0 );
-
-		tds[ 0 ].style.display = "";
-		tds[ 1 ].style.display = "none";
-
-		// Check if empty table cells still have offsetWidth/Height
-		// (IE <= 8 fail this test)
-		support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
-
-		// Check if div with explicit width and no margin-right incorrectly
-		// gets computed margin-right based on width of container. For more
-		// info see bug #3333
-		// Fails in WebKit before Feb 2011 nightlies
-		// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
-		if ( window.getComputedStyle ) {
-			div.innerHTML = "";
-			marginDiv = document.createElement( "div" );
-			marginDiv.style.width = "0";
-			marginDiv.style.marginRight = "0";
-			div.style.width = "2px";
-			div.appendChild( marginDiv );
-			support.reliableMarginRight =
-				( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0;
-		}
+	// Check if getElementsByTagName("*") returns only elements
+	support.getElementsByTagName = assert(function( div ) {
+		div.appendChild( document.createComment("") );
+		return !div.getElementsByTagName("*").length;
+	});
 
-		if ( typeof div.style.zoom !== "undefined" ) {
-			// Check if natively block-level elements act like inline-block
-			// elements when setting their display to 'inline' and giving
-			// them layout
-			// (IE < 8 does this)
-			div.innerHTML = "";
-			div.style.width = div.style.padding = "1px";
-			div.style.border = 0;
-			div.style.overflow = "hidden";
-			div.style.display = "inline";
-			div.style.zoom = 1;
-			support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 );
-
-			// Check if elements with layout shrink-wrap their children
-			// (IE 6 does this)
-			div.style.display = "block";
-			div.style.overflow = "visible";
-			div.innerHTML = "<div style='width:5px;'></div>";
-			support.shrinkWrapBlocks = ( div.offsetWidth !== 3 );
-		}
-
-		div.style.cssText = positionTopLeftWidthHeight + paddingMarginBorderVisibility;
-		div.innerHTML = html;
-
-		outer = div.firstChild;
-		inner = outer.firstChild;
-		td = outer.nextSibling.firstChild.firstChild;
-
-		offsetSupport = {
-			doesNotAddBorder: ( inner.offsetTop !== 5 ),
-			doesAddBorderForTableAndCells: ( td.offsetTop === 5 )
+	// Support: IE<9
+	support.getElementsByClassName = rnative.test( document.getElementsByClassName );
+
+	// Support: IE<10
+	// Check if getElementById returns elements by name
+	// The broken getElementById methods don't pick up programatically-set names,
+	// so use a roundabout getElementsByName test
+	support.getById = assert(function( div ) {
+		docElem.appendChild( div ).id = expando;
+		return !document.getElementsByName || !document.getElementsByName( expando ).length;
+	});
+
+	// ID find and filter
+	if ( support.getById ) {
+		Expr.find["ID"] = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var m = context.getElementById( id );
+				return m ? [ m ] : [];
+			}
+		};
+		Expr.filter["ID"] = function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				return elem.getAttribute("id") === attrId;
+			};
+		};
+	} else {
+		// Support: IE6/7
+		// getElementById is not reliable as a find shortcut
+		delete Expr.find["ID"];
+
+		Expr.filter["ID"] =  function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				var node = typeof elem.getAttributeNode !== "undefined" &&
+					elem.getAttributeNode("id");
+				return node && node.value === attrId;
+			};
 		};
+	}
 
-		inner.style.position = "fixed";
-		inner.style.top = "20px";
+	// Tag
+	Expr.find["TAG"] = support.getElementsByTagName ?
+		function( tag, context ) {
+			if ( typeof context.getElementsByTagName !== "undefined" ) {
+				return context.getElementsByTagName( tag );
 
-		// safari subtracts parent border width here which is 5px
-		offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 );
-		inner.style.position = inner.style.top = "";
+			// DocumentFragment nodes don't have gEBTN
+			} else if ( support.qsa ) {
+				return context.querySelectorAll( tag );
+			}
+		} :
 
-		outer.style.overflow = "hidden";
-		outer.style.position = "relative";
+		function( tag, context ) {
+			var elem,
+				tmp = [],
+				i = 0,
+				// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
+				results = context.getElementsByTagName( tag );
 
-		offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 );
-		offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop );
+			// Filter out possible comments
+			if ( tag === "*" ) {
+				while ( (elem = results[i++]) ) {
+					if ( elem.nodeType === 1 ) {
+						tmp.push( elem );
+					}
+				}
 
-		if ( window.getComputedStyle ) {
-			div.style.marginTop = "1%";
-			support.pixelMargin = ( window.getComputedStyle( div, null ) || { marginTop: 0 } ).marginTop !== "1%";
-		}
+				return tmp;
+			}
+			return results;
+		};
 
-		if ( typeof container.style.zoom !== "undefined" ) {
-			container.style.zoom = 1;
+	// Class
+	Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) {
+		if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
+			return context.getElementsByClassName( className );
 		}
+	};
 
-		body.removeChild( container );
-		marginDiv = div = container = null;
-
-		jQuery.extend( support, offsetSupport );
-	});
+	/* QSA/matchesSelector
+	---------------------------------------------------------------------- */
 
-	return support;
-})();
+	// QSA and matchesSelector support
 
+	// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+	rbuggyMatches = [];
 
+	// qSa(:focus) reports false when true (Chrome 21)
+	// We allow this because of a bug in IE8/9 that throws an error
+	// whenever `document.activeElement` is accessed on an iframe
+	// So, we allow :focus to pass through QSA all the time to avoid the IE error
+	// See http://bugs.jquery.com/ticket/13378
+	rbuggyQSA = [];
 
+	if ( (support.qsa = rnative.test( document.querySelectorAll )) ) {
+		// Build QSA regex
+		// Regex strategy adopted from Diego Perini
+		assert(function( div ) {
+			// Select is set to empty string on purpose
+			// This is to test IE's treatment of not explicitly
+			// setting a boolean content attribute,
+			// since its presence should be enough
+			// http://bugs.jquery.com/ticket/12359
+			docElem.appendChild( div ).innerHTML = "<a id='" + expando + "'></a>" +
+				"<select id='" + expando + "-\r\\' msallowcapture=''>" +
+				"<option selected=''></option></select>";
 
-var rbrace = /^(?:\{.*\}|\[.*\])$/,
-	rmultiDash = /([A-Z])/g;
+			// Support: IE8, Opera 11-12.16
+			// Nothing should be selected when empty strings follow ^= or $= or *=
+			// The test attribute must be unknown in Opera but "safe" for WinRT
+			// http://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
+			if ( div.querySelectorAll("[msallowcapture^='']").length ) {
+				rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
+			}
 
-jQuery.extend({
-	cache: {},
+			// Support: IE8
+			// Boolean attributes and "value" are not treated correctly
+			if ( !div.querySelectorAll("[selected]").length ) {
+				rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+			}
 
-	// Please use with caution
-	uuid: 0,
+			// Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
+			if ( !div.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
+				rbuggyQSA.push("~=");
+			}
 
-	// Unique for each copy of jQuery on the page
-	// Non-digits removed to match rinlinejQuery
-	expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
+			// Webkit/Opera - :checked should return selected option elements
+			// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+			// IE8 throws error here and will not see later tests
+			if ( !div.querySelectorAll(":checked").length ) {
+				rbuggyQSA.push(":checked");
+			}
 
-	// The following elements throw uncatchable exceptions if you
-	// attempt to add expando properties to them.
-	noData: {
-		"embed": true,
-		// Ban all objects except for Flash (which handle expandos)
-		"object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
-		"applet": true
-	},
+			// Support: Safari 8+, iOS 8+
+			// https://bugs.webkit.org/show_bug.cgi?id=136851
+			// In-page `selector#id sibing-combinator selector` fails
+			if ( !div.querySelectorAll( "a#" + expando + "+*" ).length ) {
+				rbuggyQSA.push(".#.+[+~]");
+			}
+		});
 
-	hasData: function( elem ) {
-		elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
-		return !!elem && !isEmptyDataObject( elem );
-	},
+		assert(function( div ) {
+			// Support: Windows 8 Native Apps
+			// The type and name attributes are restricted during .innerHTML assignment
+			var input = document.createElement("input");
+			input.setAttribute( "type", "hidden" );
+			div.appendChild( input ).setAttribute( "name", "D" );
 
-	data: function( elem, name, data, pvt /* Internal Use Only */ ) {
-		if ( !jQuery.acceptData( elem ) ) {
-			return;
-		}
+			// Support: IE8
+			// Enforce case-sensitivity of name attribute
+			if ( div.querySelectorAll("[name=d]").length ) {
+				rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
+			}
 
-		var privateCache, thisCache, ret,
-			internalKey = jQuery.expando,
-			getByName = typeof name === "string",
+			// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+			// IE8 throws error here and will not see later tests
+			if ( !div.querySelectorAll(":enabled").length ) {
+				rbuggyQSA.push( ":enabled", ":disabled" );
+			}
 
-			// We have to handle DOM nodes and JS objects differently because IE6-7
-			// can't GC object references properly across the DOM-JS boundary
-			isNode = elem.nodeType,
+			// Opera 10-11 does not throw on post-comma invalid pseudos
+			div.querySelectorAll("*,:x");
+			rbuggyQSA.push(",.*:");
+		});
+	}
 
-			// Only DOM nodes need the global jQuery cache; JS object data is
-			// attached directly to the object so GC can occur automatically
-			cache = isNode ? jQuery.cache : elem,
+	if ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||
+		docElem.webkitMatchesSelector ||
+		docElem.mozMatchesSelector ||
+		docElem.oMatchesSelector ||
+		docElem.msMatchesSelector) )) ) {
 
-			// Only defining an ID for JS objects if its cache already exists allows
-			// the code to shortcut on the same path as a DOM node with no cache
-			id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey,
-			isEvents = name === "events";
+		assert(function( div ) {
+			// Check to see if it's possible to do matchesSelector
+			// on a disconnected node (IE 9)
+			support.disconnectedMatch = matches.call( div, "div" );
 
-		// Avoid doing any more work than we need to when trying to get data on an
-		// object that has no data at all
-		if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) {
-			return;
-		}
+			// This should fail with an exception
+			// Gecko does not error, returns false instead
+			matches.call( div, "[s!='']:x" );
+			rbuggyMatches.push( "!=", pseudos );
+		});
+	}
 
-		if ( !id ) {
-			// Only DOM nodes need a new unique ID for each element since their data
-			// ends up in the global cache
-			if ( isNode ) {
-				elem[ internalKey ] = id = ++jQuery.uuid;
-			} else {
-				id = internalKey;
+	rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
+	rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") );
+
+	/* Contains
+	---------------------------------------------------------------------- */
+	hasCompare = rnative.test( docElem.compareDocumentPosition );
+
+	// Element contains another
+	// Purposefully self-exclusive
+	// As in, an element does not contain itself
+	contains = hasCompare || rnative.test( docElem.contains ) ?
+		function( a, b ) {
+			var adown = a.nodeType === 9 ? a.documentElement : a,
+				bup = b && b.parentNode;
+			return a === bup || !!( bup && bup.nodeType === 1 && (
+				adown.contains ?
+					adown.contains( bup ) :
+					a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+			));
+		} :
+		function( a, b ) {
+			if ( b ) {
+				while ( (b = b.parentNode) ) {
+					if ( b === a ) {
+						return true;
+					}
+				}
 			}
-		}
+			return false;
+		};
 
-		if ( !cache[ id ] ) {
-			cache[ id ] = {};
+	/* Sorting
+	---------------------------------------------------------------------- */
 
-			// Avoids exposing jQuery metadata on plain JS objects when the object
-			// is serialized using JSON.stringify
-			if ( !isNode ) {
-				cache[ id ].toJSON = jQuery.noop;
-			}
+	// Document order sorting
+	sortOrder = hasCompare ?
+	function( a, b ) {
+
+		// Flag for duplicate removal
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
 		}
 
-		// An object can be passed to jQuery.data instead of a key/value pair; this gets
-		// shallow copied over onto the existing cache
-		if ( typeof name === "object" || typeof name === "function" ) {
-			if ( pvt ) {
-				cache[ id ] = jQuery.extend( cache[ id ], name );
-			} else {
-				cache[ id ].data = jQuery.extend( cache[ id ].data, name );
-			}
+		// Sort on method existence if only one input has compareDocumentPosition
+		var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+		if ( compare ) {
+			return compare;
 		}
 
-		privateCache = thisCache = cache[ id ];
+		// Calculate position if both inputs belong to the same document
+		compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?
+			a.compareDocumentPosition( b ) :
 
-		// jQuery data() is stored in a separate object inside the object's internal data
-		// cache in order to avoid key collisions between internal data and user-defined
-		// data.
-		if ( !pvt ) {
-			if ( !thisCache.data ) {
-				thisCache.data = {};
-			}
+			// Otherwise we know they are disconnected
+			1;
 
-			thisCache = thisCache.data;
-		}
+		// Disconnected nodes
+		if ( compare & 1 ||
+			(!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {
+
+			// Choose the first element that is related to our preferred document
+			if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {
+				return -1;
+			}
+			if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {
+				return 1;
+			}
 
-		if ( data !== undefined ) {
-			thisCache[ jQuery.camelCase( name ) ] = data;
+			// Maintain original order
+			return sortInput ?
+				( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+				0;
 		}
 
-		// Users should not attempt to inspect the internal events object using jQuery.data,
-		// it is undocumented and subject to change. But does anyone listen? No.
-		if ( isEvents && !thisCache[ name ] ) {
-			return privateCache.events;
+		return compare & 4 ? -1 : 1;
+	} :
+	function( a, b ) {
+		// Exit early if the nodes are identical
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
 		}
 
-		// Check for both converted-to-camel and non-converted data property names
-		// If a data property was specified
-		if ( getByName ) {
+		var cur,
+			i = 0,
+			aup = a.parentNode,
+			bup = b.parentNode,
+			ap = [ a ],
+			bp = [ b ];
+
+		// Parentless nodes are either documents or disconnected
+		if ( !aup || !bup ) {
+			return a === document ? -1 :
+				b === document ? 1 :
+				aup ? -1 :
+				bup ? 1 :
+				sortInput ?
+				( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+				0;
 
-			// First Try to find as-is property data
-			ret = thisCache[ name ];
+		// If the nodes are siblings, we can do a quick check
+		} else if ( aup === bup ) {
+			return siblingCheck( a, b );
+		}
 
-			// Test for null|undefined property data
-			if ( ret == null ) {
+		// Otherwise we need full lists of their ancestors for comparison
+		cur = a;
+		while ( (cur = cur.parentNode) ) {
+			ap.unshift( cur );
+		}
+		cur = b;
+		while ( (cur = cur.parentNode) ) {
+			bp.unshift( cur );
+		}
 
-				// Try to find the camelCased property
-				ret = thisCache[ jQuery.camelCase( name ) ];
-			}
-		} else {
-			ret = thisCache;
+		// Walk down the tree looking for a discrepancy
+		while ( ap[i] === bp[i] ) {
+			i++;
 		}
 
-		return ret;
-	},
+		return i ?
+			// Do a sibling check if the nodes have a common ancestor
+			siblingCheck( ap[i], bp[i] ) :
 
-	removeData: function( elem, name, pvt /* Internal Use Only */ ) {
-		if ( !jQuery.acceptData( elem ) ) {
-			return;
-		}
+			// Otherwise nodes in our document sort first
+			ap[i] === preferredDoc ? -1 :
+			bp[i] === preferredDoc ? 1 :
+			0;
+	};
 
-		var thisCache, i, l,
+	return document;
+};
 
-			// Reference to internal data cache key
-			internalKey = jQuery.expando,
+Sizzle.matches = function( expr, elements ) {
+	return Sizzle( expr, null, null, elements );
+};
 
-			isNode = elem.nodeType,
+Sizzle.matchesSelector = function( elem, expr ) {
+	// Set document vars if needed
+	if ( ( elem.ownerDocument || elem ) !== document ) {
+		setDocument( elem );
+	}
 
-			// See jQuery.data for more information
-			cache = isNode ? jQuery.cache : elem,
+	// Make sure that attribute selectors are quoted
+	expr = expr.replace( rattributeQuotes, "='$1']" );
 
-			// See jQuery.data for more information
-			id = isNode ? elem[ internalKey ] : internalKey;
+	if ( support.matchesSelector && documentIsHTML &&
+		!compilerCache[ expr + " " ] &&
+		( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
+		( !rbuggyQSA     || !rbuggyQSA.test( expr ) ) ) {
 
-		// If there is already no cache entry for this object, there is no
-		// purpose in continuing
-		if ( !cache[ id ] ) {
-			return;
-		}
+		try {
+			var ret = matches.call( elem, expr );
 
-		if ( name ) {
+			// IE 9's matchesSelector returns false on disconnected nodes
+			if ( ret || support.disconnectedMatch ||
+					// As well, disconnected nodes are said to be in a document
+					// fragment in IE 9
+					elem.document && elem.document.nodeType !== 11 ) {
+				return ret;
+			}
+		} catch (e) {}
+	}
 
-			thisCache = pvt ? cache[ id ] : cache[ id ].data;
+	return Sizzle( expr, document, null, [ elem ] ).length > 0;
+};
 
-			if ( thisCache ) {
+Sizzle.contains = function( context, elem ) {
+	// Set document vars if needed
+	if ( ( context.ownerDocument || context ) !== document ) {
+		setDocument( context );
+	}
+	return contains( context, elem );
+};
 
-				// Support array or space separated string names for data keys
-				if ( !jQuery.isArray( name ) ) {
+Sizzle.attr = function( elem, name ) {
+	// Set document vars if needed
+	if ( ( elem.ownerDocument || elem ) !== document ) {
+		setDocument( elem );
+	}
 
-					// try the string as a key before any manipulation
-					if ( name in thisCache ) {
-						name = [ name ];
-					} else {
+	var fn = Expr.attrHandle[ name.toLowerCase() ],
+		// Don't get fooled by Object.prototype properties (jQuery #13807)
+		val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+			fn( elem, name, !documentIsHTML ) :
+			undefined;
 
-						// split the camel cased version by spaces unless a key with the spaces exists
-						name = jQuery.camelCase( name );
-						if ( name in thisCache ) {
-							name = [ name ];
-						} else {
-							name = name.split( " " );
-						}
-					}
-				}
+	return val !== undefined ?
+		val :
+		support.attributes || !documentIsHTML ?
+			elem.getAttribute( name ) :
+			(val = elem.getAttributeNode(name)) && val.specified ?
+				val.value :
+				null;
+};
 
-				for ( i = 0, l = name.length; i < l; i++ ) {
-					delete thisCache[ name[i] ];
-				}
+Sizzle.error = function( msg ) {
+	throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
 
-				// If there is no data left in the cache, we want to continue
-				// and let the cache object itself get destroyed
-				if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) {
-					return;
-				}
-			}
-		}
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+Sizzle.uniqueSort = function( results ) {
+	var elem,
+		duplicates = [],
+		j = 0,
+		i = 0;
 
-		// See jQuery.data for more information
-		if ( !pvt ) {
-			delete cache[ id ].data;
+	// Unless we *know* we can detect duplicates, assume their presence
+	hasDuplicate = !support.detectDuplicates;
+	sortInput = !support.sortStable && results.slice( 0 );
+	results.sort( sortOrder );
 
-			// Don't destroy the parent cache unless the internal data object
-			// had been the only thing left in it
-			if ( !isEmptyDataObject(cache[ id ]) ) {
-				return;
+	if ( hasDuplicate ) {
+		while ( (elem = results[i++]) ) {
+			if ( elem === results[ i ] ) {
+				j = duplicates.push( i );
 			}
 		}
-
-		// Browsers that fail expando deletion also refuse to delete expandos on
-		// the window, but it will allow it on all other JS objects; other browsers
-		// don't care
-		// Ensure that `cache` is not a window object #10080
-		if ( jQuery.support.deleteExpando || !cache.setInterval ) {
-			delete cache[ id ];
-		} else {
-			cache[ id ] = null;
+		while ( j-- ) {
+			results.splice( duplicates[ j ], 1 );
 		}
+	}
 
-		// We destroyed the cache and need to eliminate the expando on the node to avoid
-		// false lookups in the cache for entries that no longer exist
-		if ( isNode ) {
-			// IE does not allow us to delete expando properties from nodes,
-			// nor does it have a removeAttribute function on Document nodes;
-			// we must handle all of these cases
-			if ( jQuery.support.deleteExpando ) {
-				delete elem[ internalKey ];
-			} else if ( elem.removeAttribute ) {
-				elem.removeAttribute( internalKey );
-			} else {
-				elem[ internalKey ] = null;
-			}
-		}
-	},
+	// Clear input after sorting to release objects
+	// See https://github.com/jquery/sizzle/pull/225
+	sortInput = null;
 
-	// For internal use only.
-	_data: function( elem, name, data ) {
-		return jQuery.data( elem, name, data, true );
-	},
+	return results;
+};
 
-	// A method for determining if a DOM node can handle the data expando
-	acceptData: function( elem ) {
-		if ( elem.nodeName ) {
-			var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+	var node,
+		ret = "",
+		i = 0,
+		nodeType = elem.nodeType;
 
-			if ( match ) {
-				return !(match === true || elem.getAttribute("classid") !== match);
+	if ( !nodeType ) {
+		// If no nodeType, this is expected to be an array
+		while ( (node = elem[i++]) ) {
+			// Do not traverse comment nodes
+			ret += getText( node );
+		}
+	} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+		// Use textContent for elements
+		// innerText usage removed for consistency of new lines (jQuery #11153)
+		if ( typeof elem.textContent === "string" ) {
+			return elem.textContent;
+		} else {
+			// Traverse its children
+			for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+				ret += getText( elem );
 			}
 		}
-
-		return true;
+	} else if ( nodeType === 3 || nodeType === 4 ) {
+		return elem.nodeValue;
 	}
-});
+	// Do not include comment or processing instruction nodes
 
-jQuery.fn.extend({
-	data: function( key, value ) {
-		var parts, part, attr, name, l,
-			elem = this[0],
-			i = 0,
-			data = null;
+	return ret;
+};
 
-		// Gets all values
-		if ( key === undefined ) {
-			if ( this.length ) {
-				data = jQuery.data( elem );
+Expr = Sizzle.selectors = {
 
-				if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) {
-					attr = elem.attributes;
-					for ( l = attr.length; i < l; i++ ) {
-						name = attr[i].name;
+	// Can be adjusted by the user
+	cacheLength: 50,
 
-						if ( name.indexOf( "data-" ) === 0 ) {
-							name = jQuery.camelCase( name.substring(5) );
+	createPseudo: markFunction,
 
-							dataAttr( elem, name, data[ name ] );
-						}
-					}
-					jQuery._data( elem, "parsedAttrs", true );
-				}
-			}
+	match: matchExpr,
 
-			return data;
-		}
+	attrHandle: {},
 
-		// Sets multiple values
-		if ( typeof key === "object" ) {
-			return this.each(function() {
-				jQuery.data( this, key );
-			});
-		}
+	find: {},
+
+	relative: {
+		">": { dir: "parentNode", first: true },
+		" ": { dir: "parentNode" },
+		"+": { dir: "previousSibling", first: true },
+		"~": { dir: "previousSibling" }
+	},
 
-		parts = key.split( ".", 2 );
-		parts[1] = parts[1] ? "." + parts[1] : "";
-		part = parts[1] + "!";
+	preFilter: {
+		"ATTR": function( match ) {
+			match[1] = match[1].replace( runescape, funescape );
 
-		return jQuery.access( this, function( value ) {
+			// Move the given value to match[3] whether quoted or unquoted
+			match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape );
 
-			if ( value === undefined ) {
-				data = this.triggerHandler( "getData" + part, [ parts[0] ] );
+			if ( match[2] === "~=" ) {
+				match[3] = " " + match[3] + " ";
+			}
+
+			return match.slice( 0, 4 );
+		},
 
-				// Try to fetch any internally stored data first
-				if ( data === undefined && elem ) {
-					data = jQuery.data( elem, key );
-					data = dataAttr( elem, key, data );
+		"CHILD": function( match ) {
+			/* matches from matchExpr["CHILD"]
+				1 type (only|nth|...)
+				2 what (child|of-type)
+				3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+				4 xn-component of xn+y argument ([+-]?\d*n|)
+				5 sign of xn-component
+				6 x of xn-component
+				7 sign of y-component
+				8 y of y-component
+			*/
+			match[1] = match[1].toLowerCase();
+
+			if ( match[1].slice( 0, 3 ) === "nth" ) {
+				// nth-* requires argument
+				if ( !match[3] ) {
+					Sizzle.error( match[0] );
 				}
 
-				return data === undefined && parts[1] ?
-					this.data( parts[0] ) :
-					data;
+				// numeric x and y parameters for Expr.filter.CHILD
+				// remember that false/true cast respectively to 0/1
+				match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
+				match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
+
+			// other types prohibit arguments
+			} else if ( match[3] ) {
+				Sizzle.error( match[0] );
 			}
 
-			parts[1] = value;
-			this.each(function() {
-				var self = jQuery( this );
+			return match;
+		},
 
-				self.triggerHandler( "setData" + part, parts );
-				jQuery.data( this, key, value );
-				self.triggerHandler( "changeData" + part, parts );
-			});
-		}, null, value, arguments.length > 1, null, false );
-	},
+		"PSEUDO": function( match ) {
+			var excess,
+				unquoted = !match[6] && match[2];
 
-	removeData: function( key ) {
-		return this.each(function() {
-			jQuery.removeData( this, key );
-		});
-	}
-});
+			if ( matchExpr["CHILD"].test( match[0] ) ) {
+				return null;
+			}
 
-function dataAttr( elem, key, data ) {
-	// If nothing was found internally, try to fetch any
-	// data from the HTML5 data-* attribute
-	if ( data === undefined && elem.nodeType === 1 ) {
+			// Accept quoted arguments as-is
+			if ( match[3] ) {
+				match[2] = match[4] || match[5] || "";
 
-		var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
+			// Strip excess characters from unquoted arguments
+			} else if ( unquoted && rpseudo.test( unquoted ) &&
+				// Get excess from tokenize (recursively)
+				(excess = tokenize( unquoted, true )) &&
+				// advance to the next closing parenthesis
+				(excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
 
-		data = elem.getAttribute( name );
+				// excess is a negative index
+				match[0] = match[0].slice( 0, excess );
+				match[2] = unquoted.slice( 0, excess );
+			}
 
-		if ( typeof data === "string" ) {
-			try {
-				data = data === "true" ? true :
-				data === "false" ? false :
-				data === "null" ? null :
-				jQuery.isNumeric( data ) ? +data :
-					rbrace.test( data ) ? jQuery.parseJSON( data ) :
-					data;
-			} catch( e ) {}
+			// Return only captures needed by the pseudo filter method (type and argument)
+			return match.slice( 0, 3 );
+		}
+	},
 
-			// Make sure we set the data so it isn't changed later
-			jQuery.data( elem, key, data );
+	filter: {
 
-		} else {
-			data = undefined;
-		}
-	}
+		"TAG": function( nodeNameSelector ) {
+			var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+			return nodeNameSelector === "*" ?
+				function() { return true; } :
+				function( elem ) {
+					return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+				};
+		},
 
-	return data;
-}
+		"CLASS": function( className ) {
+			var pattern = classCache[ className + " " ];
 
-// checks a cache object for emptiness
-function isEmptyDataObject( obj ) {
-	for ( var name in obj ) {
+			return pattern ||
+				(pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
+				classCache( className, function( elem ) {
+					return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" );
+				});
+		},
 
-		// if the public data object is empty, the private is still empty
-		if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) {
-			continue;
-		}
-		if ( name !== "toJSON" ) {
-			return false;
-		}
-	}
+		"ATTR": function( name, operator, check ) {
+			return function( elem ) {
+				var result = Sizzle.attr( elem, name );
 
-	return true;
-}
+				if ( result == null ) {
+					return operator === "!=";
+				}
+				if ( !operator ) {
+					return true;
+				}
 
+				result += "";
 
+				return operator === "=" ? result === check :
+					operator === "!=" ? result !== check :
+					operator === "^=" ? check && result.indexOf( check ) === 0 :
+					operator === "*=" ? check && result.indexOf( check ) > -1 :
+					operator === "$=" ? check && result.slice( -check.length ) === check :
+					operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
+					operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
+					false;
+			};
+		},
 
+		"CHILD": function( type, what, argument, first, last ) {
+			var simple = type.slice( 0, 3 ) !== "nth",
+				forward = type.slice( -4 ) !== "last",
+				ofType = what === "of-type";
+
+			return first === 1 && last === 0 ?
+
+				// Shortcut for :nth-*(n)
+				function( elem ) {
+					return !!elem.parentNode;
+				} :
+
+				function( elem, context, xml ) {
+					var cache, uniqueCache, outerCache, node, nodeIndex, start,
+						dir = simple !== forward ? "nextSibling" : "previousSibling",
+						parent = elem.parentNode,
+						name = ofType && elem.nodeName.toLowerCase(),
+						useCache = !xml && !ofType,
+						diff = false;
+
+					if ( parent ) {
+
+						// :(first|last|only)-(child|of-type)
+						if ( simple ) {
+							while ( dir ) {
+								node = elem;
+								while ( (node = node[ dir ]) ) {
+									if ( ofType ?
+										node.nodeName.toLowerCase() === name :
+										node.nodeType === 1 ) {
+
+										return false;
+									}
+								}
+								// Reverse direction for :only-* (if we haven't yet done so)
+								start = dir = type === "only" && !start && "nextSibling";
+							}
+							return true;
+						}
 
-function handleQueueMarkDefer( elem, type, src ) {
-	var deferDataKey = type + "defer",
-		queueDataKey = type + "queue",
-		markDataKey = type + "mark",
-		defer = jQuery._data( elem, deferDataKey );
-	if ( defer &&
-		( src === "queue" || !jQuery._data(elem, queueDataKey) ) &&
-		( src === "mark" || !jQuery._data(elem, markDataKey) ) ) {
-		// Give room for hard-coded callbacks to fire first
-		// and eventually mark/queue something else on the element
-		setTimeout( function() {
-			if ( !jQuery._data( elem, queueDataKey ) &&
-				!jQuery._data( elem, markDataKey ) ) {
-				jQuery.removeData( elem, deferDataKey, true );
-				defer.fire();
-			}
-		}, 0 );
-	}
-}
+						start = [ forward ? parent.firstChild : parent.lastChild ];
 
-jQuery.extend({
+						// non-xml :nth-child(...) stores cache data on `parent`
+						if ( forward && useCache ) {
 
-	_mark: function( elem, type ) {
-		if ( elem ) {
-			type = ( type || "fx" ) + "mark";
-			jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 );
-		}
-	},
+							// Seek `elem` from a previously-cached index
 
-	_unmark: function( force, elem, type ) {
-		if ( force !== true ) {
-			type = elem;
-			elem = force;
-			force = false;
-		}
-		if ( elem ) {
-			type = type || "fx";
-			var key = type + "mark",
-				count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 );
-			if ( count ) {
-				jQuery._data( elem, key, count );
-			} else {
-				jQuery.removeData( elem, key, true );
-				handleQueueMarkDefer( elem, type, "mark" );
-			}
-		}
-	},
+							// ...in a gzip-friendly way
+							node = parent;
+							outerCache = node[ expando ] || (node[ expando ] = {});
 
-	queue: function( elem, type, data ) {
-		var q;
-		if ( elem ) {
-			type = ( type || "fx" ) + "queue";
-			q = jQuery._data( elem, type );
+							// Support: IE <9 only
+							// Defend against cloned attroperties (jQuery gh-1709)
+							uniqueCache = outerCache[ node.uniqueID ] ||
+								(outerCache[ node.uniqueID ] = {});
 
-			// Speed up dequeue by getting out quickly if this is just a lookup
-			if ( data ) {
-				if ( !q || jQuery.isArray(data) ) {
-					q = jQuery._data( elem, type, jQuery.makeArray(data) );
-				} else {
-					q.push( data );
-				}
-			}
-			return q || [];
-		}
-	},
+							cache = uniqueCache[ type ] || [];
+							nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+							diff = nodeIndex && cache[ 2 ];
+							node = nodeIndex && parent.childNodes[ nodeIndex ];
 
-	dequeue: function( elem, type ) {
-		type = type || "fx";
+							while ( (node = ++nodeIndex && node && node[ dir ] ||
 
-		var queue = jQuery.queue( elem, type ),
-			fn = queue.shift(),
-			hooks = {};
+								// Fallback to seeking `elem` from the start
+								(diff = nodeIndex = 0) || start.pop()) ) {
 
-		// If the fx queue is dequeued, always remove the progress sentinel
-		if ( fn === "inprogress" ) {
-			fn = queue.shift();
-		}
+								// When found, cache indexes on `parent` and break
+								if ( node.nodeType === 1 && ++diff && node === elem ) {
+									uniqueCache[ type ] = [ dirruns, nodeIndex, diff ];
+									break;
+								}
+							}
 
-		if ( fn ) {
-			// Add a progress sentinel to prevent the fx queue from being
-			// automatically dequeued
-			if ( type === "fx" ) {
-				queue.unshift( "inprogress" );
-			}
+						} else {
+							// Use previously-cached element index if available
+							if ( useCache ) {
+								// ...in a gzip-friendly way
+								node = elem;
+								outerCache = node[ expando ] || (node[ expando ] = {});
+
+								// Support: IE <9 only
+								// Defend against cloned attroperties (jQuery gh-1709)
+								uniqueCache = outerCache[ node.uniqueID ] ||
+									(outerCache[ node.uniqueID ] = {});
+
+								cache = uniqueCache[ type ] || [];
+								nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+								diff = nodeIndex;
+							}
 
-			jQuery._data( elem, type + ".run", hooks );
-			fn.call( elem, function() {
-				jQuery.dequeue( elem, type );
-			}, hooks );
-		}
+							// xml :nth-child(...)
+							// or :nth-last-child(...) or :nth(-last)?-of-type(...)
+							if ( diff === false ) {
+								// Use the same loop as above to seek `elem` from the start
+								while ( (node = ++nodeIndex && node && node[ dir ] ||
+									(diff = nodeIndex = 0) || start.pop()) ) {
 
-		if ( !queue.length ) {
-			jQuery.removeData( elem, type + "queue " + type + ".run", true );
-			handleQueueMarkDefer( elem, type, "queue" );
-		}
-	}
-});
+									if ( ( ofType ?
+										node.nodeName.toLowerCase() === name :
+										node.nodeType === 1 ) &&
+										++diff ) {
 
-jQuery.fn.extend({
-	queue: function( type, data ) {
-		var setter = 2;
+										// Cache the index of each encountered element
+										if ( useCache ) {
+											outerCache = node[ expando ] || (node[ expando ] = {});
 
-		if ( typeof type !== "string" ) {
-			data = type;
-			type = "fx";
-			setter--;
-		}
+											// Support: IE <9 only
+											// Defend against cloned attroperties (jQuery gh-1709)
+											uniqueCache = outerCache[ node.uniqueID ] ||
+												(outerCache[ node.uniqueID ] = {});
 
-		if ( arguments.length < setter ) {
-			return jQuery.queue( this[0], type );
-		}
+											uniqueCache[ type ] = [ dirruns, diff ];
+										}
 
-		return data === undefined ?
-			this :
-			this.each(function() {
-				var queue = jQuery.queue( this, type, data );
+										if ( node === elem ) {
+											break;
+										}
+									}
+								}
+							}
+						}
 
-				if ( type === "fx" && queue[0] !== "inprogress" ) {
-					jQuery.dequeue( this, type );
-				}
-			});
-	},
-	dequeue: function( type ) {
-		return this.each(function() {
-			jQuery.dequeue( this, type );
-		});
-	},
-	// Based off of the plugin by Clint Helfers, with permission.
-	// http://blindsignals.com/index.php/2009/07/jquery-delay/
-	delay: function( time, type ) {
-		time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
-		type = type || "fx";
+						// Incorporate the offset, then check against cycle size
+						diff -= last;
+						return diff === first || ( diff % first === 0 && diff / first >= 0 );
+					}
+				};
+		},
 
-		return this.queue( type, function( next, hooks ) {
-			var timeout = setTimeout( next, time );
-			hooks.stop = function() {
-				clearTimeout( timeout );
-			};
-		});
-	},
-	clearQueue: function( type ) {
-		return this.queue( type || "fx", [] );
-	},
-	// Get a promise resolved when queues of a certain type
-	// are emptied (fx is the type by default)
-	promise: function( type, object ) {
-		if ( typeof type !== "string" ) {
-			object = type;
-			type = undefined;
-		}
-		type = type || "fx";
-		var defer = jQuery.Deferred(),
-			elements = this,
-			i = elements.length,
-			count = 1,
-			deferDataKey = type + "defer",
-			queueDataKey = type + "queue",
-			markDataKey = type + "mark",
-			tmp;
-		function resolve() {
-			if ( !( --count ) ) {
-				defer.resolveWith( elements, [ elements ] );
-			}
-		}
-		while( i-- ) {
-			if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) ||
-					( jQuery.data( elements[ i ], queueDataKey, undefined, true ) ||
-						jQuery.data( elements[ i ], markDataKey, undefined, true ) ) &&
-					jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) {
-				count++;
-				tmp.add( resolve );
+		"PSEUDO": function( pseudo, argument ) {
+			// pseudo-class names are case-insensitive
+			// http://www.w3.org/TR/selectors/#pseudo-classes
+			// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+			// Remember that setFilters inherits from pseudos
+			var args,
+				fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+					Sizzle.error( "unsupported pseudo: " + pseudo );
+
+			// The user may use createPseudo to indicate that
+			// arguments are needed to create the filter function
+			// just as Sizzle does
+			if ( fn[ expando ] ) {
+				return fn( argument );
+			}
+
+			// But maintain support for old signatures
+			if ( fn.length > 1 ) {
+				args = [ pseudo, pseudo, "", argument ];
+				return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+					markFunction(function( seed, matches ) {
+						var idx,
+							matched = fn( seed, argument ),
+							i = matched.length;
+						while ( i-- ) {
+							idx = indexOf( seed, matched[i] );
+							seed[ idx ] = !( matches[ idx ] = matched[i] );
+						}
+					}) :
+					function( elem ) {
+						return fn( elem, 0, args );
+					};
 			}
-		}
-		resolve();
-		return defer.promise( object );
-	}
-});
 
+			return fn;
+		}
+	},
 
+	pseudos: {
+		// Potentially complex pseudos
+		"not": markFunction(function( selector ) {
+			// Trim the selector passed to compile
+			// to avoid treating leading and trailing
+			// spaces as combinators
+			var input = [],
+				results = [],
+				matcher = compile( selector.replace( rtrim, "$1" ) );
 
+			return matcher[ expando ] ?
+				markFunction(function( seed, matches, context, xml ) {
+					var elem,
+						unmatched = matcher( seed, null, xml, [] ),
+						i = seed.length;
 
-var rclass = /[\n\t\r]/g,
-	rspace = /\s+/,
-	rreturn = /\r/g,
-	rtype = /^(?:button|input)$/i,
-	rfocusable = /^(?:button|input|object|select|textarea)$/i,
-	rclickable = /^a(?:rea)?$/i,
-	rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
-	getSetAttribute = jQuery.support.getSetAttribute,
-	nodeHook, boolHook, fixSpecified;
+					// Match elements unmatched by `matcher`
+					while ( i-- ) {
+						if ( (elem = unmatched[i]) ) {
+							seed[i] = !(matches[i] = elem);
+						}
+					}
+				}) :
+				function( elem, context, xml ) {
+					input[0] = elem;
+					matcher( input, null, xml, results );
+					// Don't keep the element (issue #299)
+					input[0] = null;
+					return !results.pop();
+				};
+		}),
 
-jQuery.fn.extend({
-	attr: function( name, value ) {
-		return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 );
-	},
+		"has": markFunction(function( selector ) {
+			return function( elem ) {
+				return Sizzle( selector, elem ).length > 0;
+			};
+		}),
 
-	removeAttr: function( name ) {
-		return this.each(function() {
-			jQuery.removeAttr( this, name );
-		});
-	},
+		"contains": markFunction(function( text ) {
+			text = text.replace( runescape, funescape );
+			return function( elem ) {
+				return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
+			};
+		}),
+
+		// "Whether an element is represented by a :lang() selector
+		// is based solely on the element's language value
+		// being equal to the identifier C,
+		// or beginning with the identifier C immediately followed by "-".
+		// The matching of C against the element's language value is performed case-insensitively.
+		// The identifier C does not have to be a valid language name."
+		// http://www.w3.org/TR/selectors/#lang-pseudo
+		"lang": markFunction( function( lang ) {
+			// lang value must be a valid identifier
+			if ( !ridentifier.test(lang || "") ) {
+				Sizzle.error( "unsupported lang: " + lang );
+			}
+			lang = lang.replace( runescape, funescape ).toLowerCase();
+			return function( elem ) {
+				var elemLang;
+				do {
+					if ( (elemLang = documentIsHTML ?
+						elem.lang :
+						elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) {
+
+						elemLang = elemLang.toLowerCase();
+						return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+					}
+				} while ( (elem = elem.parentNode) && elem.nodeType === 1 );
+				return false;
+			};
+		}),
 
-	prop: function( name, value ) {
-		return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 );
-	},
+		// Miscellaneous
+		"target": function( elem ) {
+			var hash = window.location && window.location.hash;
+			return hash && hash.slice( 1 ) === elem.id;
+		},
 
-	removeProp: function( name ) {
-		name = jQuery.propFix[ name ] || name;
-		return this.each(function() {
-			// try/catch handles cases where IE balks (such as removing a property on window)
-			try {
-				this[ name ] = undefined;
-				delete this[ name ];
-			} catch( e ) {}
-		});
-	},
+		"root": function( elem ) {
+			return elem === docElem;
+		},
 
-	addClass: function( value ) {
-		var classNames, i, l, elem,
-			setClass, c, cl;
+		"focus": function( elem ) {
+			return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
+		},
 
-		if ( jQuery.isFunction( value ) ) {
-			return this.each(function( j ) {
-				jQuery( this ).addClass( value.call(this, j, this.className) );
-			});
-		}
+		// Boolean properties
+		"enabled": function( elem ) {
+			return elem.disabled === false;
+		},
 
-		if ( value && typeof value === "string" ) {
-			classNames = value.split( rspace );
+		"disabled": function( elem ) {
+			return elem.disabled === true;
+		},
 
-			for ( i = 0, l = this.length; i < l; i++ ) {
-				elem = this[ i ];
+		"checked": function( elem ) {
+			// In CSS3, :checked should return both checked and selected elements
+			// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+			var nodeName = elem.nodeName.toLowerCase();
+			return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+		},
 
-				if ( elem.nodeType === 1 ) {
-					if ( !elem.className && classNames.length === 1 ) {
-						elem.className = value;
+		"selected": function( elem ) {
+			// Accessing this property makes selected-by-default
+			// options in Safari work properly
+			if ( elem.parentNode ) {
+				elem.parentNode.selectedIndex;
+			}
 
-					} else {
-						setClass = " " + elem.className + " ";
+			return elem.selected === true;
+		},
 
-						for ( c = 0, cl = classNames.length; c < cl; c++ ) {
-							if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) {
-								setClass += classNames[ c ] + " ";
-							}
-						}
-						elem.className = jQuery.trim( setClass );
-					}
+		// Contents
+		"empty": function( elem ) {
+			// http://www.w3.org/TR/selectors/#empty-pseudo
+			// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+			//   but not by others (comment: 8; processing instruction: 7; etc.)
+			// nodeType < 6 works because attributes (2) do not appear as children
+			for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+				if ( elem.nodeType < 6 ) {
+					return false;
 				}
 			}
-		}
+			return true;
+		},
 
-		return this;
-	},
+		"parent": function( elem ) {
+			return !Expr.pseudos["empty"]( elem );
+		},
 
-	removeClass: function( value ) {
-		var classNames, i, l, elem, className, c, cl;
+		// Element/input types
+		"header": function( elem ) {
+			return rheader.test( elem.nodeName );
+		},
 
-		if ( jQuery.isFunction( value ) ) {
-			return this.each(function( j ) {
-				jQuery( this ).removeClass( value.call(this, j, this.className) );
-			});
-		}
+		"input": function( elem ) {
+			return rinputs.test( elem.nodeName );
+		},
 
-		if ( (value && typeof value === "string") || value === undefined ) {
-			classNames = ( value || "" ).split( rspace );
+		"button": function( elem ) {
+			var name = elem.nodeName.toLowerCase();
+			return name === "input" && elem.type === "button" || name === "button";
+		},
 
-			for ( i = 0, l = this.length; i < l; i++ ) {
-				elem = this[ i ];
+		"text": function( elem ) {
+			var attr;
+			return elem.nodeName.toLowerCase() === "input" &&
+				elem.type === "text" &&
 
-				if ( elem.nodeType === 1 && elem.className ) {
-					if ( value ) {
-						className = (" " + elem.className + " ").replace( rclass, " " );
-						for ( c = 0, cl = classNames.length; c < cl; c++ ) {
-							className = className.replace(" " + classNames[ c ] + " ", " ");
-						}
-						elem.className = jQuery.trim( className );
+				// Support: IE<8
+				// New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
+				( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" );
+		},
 
-					} else {
-						elem.className = "";
-					}
-				}
-			}
-		}
+		// Position-in-collection
+		"first": createPositionalPseudo(function() {
+			return [ 0 ];
+		}),
 
-		return this;
-	},
+		"last": createPositionalPseudo(function( matchIndexes, length ) {
+			return [ length - 1 ];
+		}),
 
-	toggleClass: function( value, stateVal ) {
-		var type = typeof value,
-			isBool = typeof stateVal === "boolean";
+		"eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
+			return [ argument < 0 ? argument + length : argument ];
+		}),
 
-		if ( jQuery.isFunction( value ) ) {
-			return this.each(function( i ) {
-				jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
-			});
-		}
-
-		return this.each(function() {
-			if ( type === "string" ) {
-				// toggle individual class names
-				var className,
-					i = 0,
-					self = jQuery( this ),
-					state = stateVal,
-					classNames = value.split( rspace );
-
-				while ( (className = classNames[ i++ ]) ) {
-					// check each className given, space seperated list
-					state = isBool ? state : !self.hasClass( className );
-					self[ state ? "addClass" : "removeClass" ]( className );
-				}
-
-			} else if ( type === "undefined" || type === "boolean" ) {
-				if ( this.className ) {
-					// store className if set
-					jQuery._data( this, "__className__", this.className );
-				}
-
-				// toggle whole className
-				this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+		"even": createPositionalPseudo(function( matchIndexes, length ) {
+			var i = 0;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
 			}
-		});
-	},
+			return matchIndexes;
+		}),
 
-	hasClass: function( selector ) {
-		var className = " " + selector + " ",
-			i = 0,
-			l = this.length;
-		for ( ; i < l; i++ ) {
-			if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
-				return true;
+		"odd": createPositionalPseudo(function( matchIndexes, length ) {
+			var i = 1;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
 			}
-		}
+			return matchIndexes;
+		}),
 
-		return false;
-	},
+		"lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+			var i = argument < 0 ? argument + length : argument;
+			for ( ; --i >= 0; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		}),
 
-	val: function( value ) {
-		var hooks, ret, isFunction,
-			elem = this[0];
+		"gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+			var i = argument < 0 ? argument + length : argument;
+			for ( ; ++i < length; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		})
+	}
+};
 
-		if ( !arguments.length ) {
-			if ( elem ) {
-				hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+Expr.pseudos["nth"] = Expr.pseudos["eq"];
 
-				if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
-					return ret;
-				}
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+	Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+	Expr.pseudos[ i ] = createButtonPseudo( i );
+}
 
-				ret = elem.value;
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
 
-				return typeof ret === "string" ?
-					// handle most common string cases
-					ret.replace(rreturn, "") :
-					// handle cases where value is null/undef or number
-					ret == null ? "" : ret;
-			}
+tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
+	var matched, match, tokens, type,
+		soFar, groups, preFilters,
+		cached = tokenCache[ selector + " " ];
 
-			return;
-		}
+	if ( cached ) {
+		return parseOnly ? 0 : cached.slice( 0 );
+	}
 
-		isFunction = jQuery.isFunction( value );
+	soFar = selector;
+	groups = [];
+	preFilters = Expr.preFilter;
 
-		return this.each(function( i ) {
-			var self = jQuery(this), val;
+	while ( soFar ) {
 
-			if ( this.nodeType !== 1 ) {
-				return;
+		// Comma and first run
+		if ( !matched || (match = rcomma.exec( soFar )) ) {
+			if ( match ) {
+				// Don't consume trailing commas as valid
+				soFar = soFar.slice( match[0].length ) || soFar;
 			}
+			groups.push( (tokens = []) );
+		}
 
-			if ( isFunction ) {
-				val = value.call( this, i, self.val() );
-			} else {
-				val = value;
-			}
+		matched = false;
 
-			// Treat null/undefined as ""; convert numbers to string
-			if ( val == null ) {
-				val = "";
-			} else if ( typeof val === "number" ) {
-				val += "";
-			} else if ( jQuery.isArray( val ) ) {
-				val = jQuery.map(val, function ( value ) {
-					return value == null ? "" : value + "";
+		// Combinators
+		if ( (match = rcombinators.exec( soFar )) ) {
+			matched = match.shift();
+			tokens.push({
+				value: matched,
+				// Cast descendant combinators to space
+				type: match[0].replace( rtrim, " " )
+			});
+			soFar = soFar.slice( matched.length );
+		}
+
+		// Filters
+		for ( type in Expr.filter ) {
+			if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
+				(match = preFilters[ type ]( match ))) ) {
+				matched = match.shift();
+				tokens.push({
+					value: matched,
+					type: type,
+					matches: match
 				});
+				soFar = soFar.slice( matched.length );
 			}
+		}
 
-			hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+		if ( !matched ) {
+			break;
+		}
+	}
 
-			// If set returns undefined, fall back to normal setting
-			if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
-				this.value = val;
-			}
-		});
+	// Return the length of the invalid excess
+	// if we're just parsing
+	// Otherwise, throw an error or return tokens
+	return parseOnly ?
+		soFar.length :
+		soFar ?
+			Sizzle.error( selector ) :
+			// Cache the tokens
+			tokenCache( selector, groups ).slice( 0 );
+};
+
+function toSelector( tokens ) {
+	var i = 0,
+		len = tokens.length,
+		selector = "";
+	for ( ; i < len; i++ ) {
+		selector += tokens[i].value;
 	}
-});
+	return selector;
+}
 
-jQuery.extend({
-	valHooks: {
-		option: {
-			get: function( elem ) {
-				// attributes.value is undefined in Blackberry 4.7 but
-				// uses .value. See #6932
-				var val = elem.attributes.value;
-				return !val || val.specified ? elem.value : elem.text;
+function addCombinator( matcher, combinator, base ) {
+	var dir = combinator.dir,
+		checkNonElements = base && dir === "parentNode",
+		doneName = done++;
+
+	return combinator.first ?
+		// Check against closest ancestor/preceding element
+		function( elem, context, xml ) {
+			while ( (elem = elem[ dir ]) ) {
+				if ( elem.nodeType === 1 || checkNonElements ) {
+					return matcher( elem, context, xml );
+				}
 			}
-		},
-		select: {
-			get: function( elem ) {
-				var value, i, max, option,
-					index = elem.selectedIndex,
-					values = [],
-					options = elem.options,
-					one = elem.type === "select-one";
+		} :
+
+		// Check against all ancestor/preceding elements
+		function( elem, context, xml ) {
+			var oldCache, uniqueCache, outerCache,
+				newCache = [ dirruns, doneName ];
 
-				// Nothing was selected
-				if ( index < 0 ) {
-					return null;
+			// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
+			if ( xml ) {
+				while ( (elem = elem[ dir ]) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						if ( matcher( elem, context, xml ) ) {
+							return true;
+						}
+					}
 				}
+			} else {
+				while ( (elem = elem[ dir ]) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						outerCache = elem[ expando ] || (elem[ expando ] = {});
 
-				// Loop through all the selected options
-				i = one ? index : 0;
-				max = one ? index + 1 : options.length;
-				for ( ; i < max; i++ ) {
-					option = options[ i ];
+						// Support: IE <9 only
+						// Defend against cloned attroperties (jQuery gh-1709)
+						uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {});
 
-					// Don't return options that are disabled or in a disabled optgroup
-					if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
-							(!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
+						if ( (oldCache = uniqueCache[ dir ]) &&
+							oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
 
-						// Get the specific value for the option
-						value = jQuery( option ).val();
+							// Assign to newCache so results back-propagate to previous elements
+							return (newCache[ 2 ] = oldCache[ 2 ]);
+						} else {
+							// Reuse newcache so results back-propagate to previous elements
+							uniqueCache[ dir ] = newCache;
 
-						// We don't need an array for one selects
-						if ( one ) {
-							return value;
+							// A match means we're done; a fail means we have to keep checking
+							if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {
+								return true;
+							}
 						}
-
-						// Multi-Selects return an array
-						values.push( value );
 					}
 				}
+			}
+		};
+}
 
-				// Fixes Bug #2551 -- select.val() broken in IE after form.reset()
-				if ( one && !values.length && options.length ) {
-					return jQuery( options[ index ] ).val();
+function elementMatcher( matchers ) {
+	return matchers.length > 1 ?
+		function( elem, context, xml ) {
+			var i = matchers.length;
+			while ( i-- ) {
+				if ( !matchers[i]( elem, context, xml ) ) {
+					return false;
 				}
+			}
+			return true;
+		} :
+		matchers[0];
+}
 
-				return values;
-			},
-
-			set: function( elem, value ) {
-				var values = jQuery.makeArray( value );
+function multipleContexts( selector, contexts, results ) {
+	var i = 0,
+		len = contexts.length;
+	for ( ; i < len; i++ ) {
+		Sizzle( selector, contexts[i], results );
+	}
+	return results;
+}
 
-				jQuery(elem).find("option").each(function() {
-					this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
-				});
+function condense( unmatched, map, filter, context, xml ) {
+	var elem,
+		newUnmatched = [],
+		i = 0,
+		len = unmatched.length,
+		mapped = map != null;
 
-				if ( !values.length ) {
-					elem.selectedIndex = -1;
+	for ( ; i < len; i++ ) {
+		if ( (elem = unmatched[i]) ) {
+			if ( !filter || filter( elem, context, xml ) ) {
+				newUnmatched.push( elem );
+				if ( mapped ) {
+					map.push( i );
 				}
-				return values;
 			}
 		}
-	},
+	}
 
-	attrFn: {
-		val: true,
-		css: true,
-		html: true,
-		text: true,
-		data: true,
-		width: true,
-		height: true,
-		offset: true
-	},
+	return newUnmatched;
+}
 
-	attr: function( elem, name, value, pass ) {
-		var ret, hooks, notxml,
-			nType = elem.nodeType;
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+	if ( postFilter && !postFilter[ expando ] ) {
+		postFilter = setMatcher( postFilter );
+	}
+	if ( postFinder && !postFinder[ expando ] ) {
+		postFinder = setMatcher( postFinder, postSelector );
+	}
+	return markFunction(function( seed, results, context, xml ) {
+		var temp, i, elem,
+			preMap = [],
+			postMap = [],
+			preexisting = results.length,
 
-		// don't get/set attributes on text, comment and attribute nodes
-		if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
-			return;
-		}
+			// Get initial elements from seed or context
+			elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
 
-		if ( pass && name in jQuery.attrFn ) {
-			return jQuery( elem )[ name ]( value );
-		}
+			// Prefilter to get matcher input, preserving a map for seed-results synchronization
+			matcherIn = preFilter && ( seed || !selector ) ?
+				condense( elems, preMap, preFilter, context, xml ) :
+				elems,
 
-		// Fallback to prop when attributes are not supported
-		if ( typeof elem.getAttribute === "undefined" ) {
-			return jQuery.prop( elem, name, value );
+			matcherOut = matcher ?
+				// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+				postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+					// ...intermediate processing is necessary
+					[] :
+
+					// ...otherwise use results directly
+					results :
+				matcherIn;
+
+		// Find primary matches
+		if ( matcher ) {
+			matcher( matcherIn, matcherOut, context, xml );
 		}
 
-		notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+		// Apply postFilter
+		if ( postFilter ) {
+			temp = condense( matcherOut, postMap );
+			postFilter( temp, [], context, xml );
 
-		// All attributes are lowercase
-		// Grab necessary hook if one is defined
-		if ( notxml ) {
-			name = name.toLowerCase();
-			hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook );
+			// Un-match failing elements by moving them back to matcherIn
+			i = temp.length;
+			while ( i-- ) {
+				if ( (elem = temp[i]) ) {
+					matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
+				}
+			}
 		}
 
-		if ( value !== undefined ) {
+		if ( seed ) {
+			if ( postFinder || preFilter ) {
+				if ( postFinder ) {
+					// Get the final matcherOut by condensing this intermediate into postFinder contexts
+					temp = [];
+					i = matcherOut.length;
+					while ( i-- ) {
+						if ( (elem = matcherOut[i]) ) {
+							// Restore matcherIn since elem is not yet a final match
+							temp.push( (matcherIn[i] = elem) );
+						}
+					}
+					postFinder( null, (matcherOut = []), temp, xml );
+				}
 
-			if ( value === null ) {
-				jQuery.removeAttr( elem, name );
-				return;
+				// Move matched elements from seed to results to keep them synchronized
+				i = matcherOut.length;
+				while ( i-- ) {
+					if ( (elem = matcherOut[i]) &&
+						(temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {
 
-			} else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) {
-				return ret;
+						seed[temp] = !(results[temp] = elem);
+					}
+				}
+			}
 
+		// Add elements to results, through postFinder if defined
+		} else {
+			matcherOut = condense(
+				matcherOut === results ?
+					matcherOut.splice( preexisting, matcherOut.length ) :
+					matcherOut
+			);
+			if ( postFinder ) {
+				postFinder( null, results, matcherOut, xml );
 			} else {
-				elem.setAttribute( name, "" + value );
-				return value;
+				push.apply( results, matcherOut );
 			}
+		}
+	});
+}
 
-		} else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) {
+function matcherFromTokens( tokens ) {
+	var checkContext, matcher, j,
+		len = tokens.length,
+		leadingRelative = Expr.relative[ tokens[0].type ],
+		implicitRelative = leadingRelative || Expr.relative[" "],
+		i = leadingRelative ? 1 : 0,
+
+		// The foundational matcher ensures that elements are reachable from top-level context(s)
+		matchContext = addCombinator( function( elem ) {
+			return elem === checkContext;
+		}, implicitRelative, true ),
+		matchAnyContext = addCombinator( function( elem ) {
+			return indexOf( checkContext, elem ) > -1;
+		}, implicitRelative, true ),
+		matchers = [ function( elem, context, xml ) {
+			var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+				(checkContext = context).nodeType ?
+					matchContext( elem, context, xml ) :
+					matchAnyContext( elem, context, xml ) );
+			// Avoid hanging onto element (issue #299)
+			checkContext = null;
 			return ret;
+		} ];
 
+	for ( ; i < len; i++ ) {
+		if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
+			matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
 		} else {
-
-			ret = elem.getAttribute( name );
-
-			// Non-existent attributes return null, we normalize to undefined
-			return ret === null ?
-				undefined :
-				ret;
+			matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
+
+			// Return special upon seeing a positional matcher
+			if ( matcher[ expando ] ) {
+				// Find the next relative operator (if any) for proper handling
+				j = ++i;
+				for ( ; j < len; j++ ) {
+					if ( Expr.relative[ tokens[j].type ] ) {
+						break;
+					}
+				}
+				return setMatcher(
+					i > 1 && elementMatcher( matchers ),
+					i > 1 && toSelector(
+						// If the preceding token was a descendant combinator, insert an implicit any-element `*`
+						tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" })
+					).replace( rtrim, "$1" ),
+					matcher,
+					i < j && matcherFromTokens( tokens.slice( i, j ) ),
+					j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
+					j < len && toSelector( tokens )
+				);
+			}
+			matchers.push( matcher );
 		}
-	},
-
-	removeAttr: function( elem, value ) {
-		var propName, attrNames, name, l, isBool,
-			i = 0;
-
-		if ( value && elem.nodeType === 1 ) {
-			attrNames = value.toLowerCase().split( rspace );
-			l = attrNames.length;
+	}
 
-			for ( ; i < l; i++ ) {
-				name = attrNames[ i ];
+	return elementMatcher( matchers );
+}
 
-				if ( name ) {
-					propName = jQuery.propFix[ name ] || name;
-					isBool = rboolean.test( name );
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+	var bySet = setMatchers.length > 0,
+		byElement = elementMatchers.length > 0,
+		superMatcher = function( seed, context, xml, results, outermost ) {
+			var elem, j, matcher,
+				matchedCount = 0,
+				i = "0",
+				unmatched = seed && [],
+				setMatched = [],
+				contextBackup = outermostContext,
+				// We must always have either seed elements or outermost context
+				elems = seed || byElement && Expr.find["TAG"]( "*", outermost ),
+				// Use integer dirruns iff this is the outermost matcher
+				dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
+				len = elems.length;
+
+			if ( outermost ) {
+				outermostContext = context === document || context || outermost;
+			}
+
+			// Add elements passing elementMatchers directly to results
+			// Support: IE<9, Safari
+			// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
+			for ( ; i !== len && (elem = elems[i]) != null; i++ ) {
+				if ( byElement && elem ) {
+					j = 0;
+					if ( !context && elem.ownerDocument !== document ) {
+						setDocument( elem );
+						xml = !documentIsHTML;
+					}
+					while ( (matcher = elementMatchers[j++]) ) {
+						if ( matcher( elem, context || document, xml) ) {
+							results.push( elem );
+							break;
+						}
+					}
+					if ( outermost ) {
+						dirruns = dirrunsUnique;
+					}
+				}
 
-					// See #9699 for explanation of this approach (setting first, then removal)
-					// Do not do this for boolean attributes (see #10870)
-					if ( !isBool ) {
-						jQuery.attr( elem, name, "" );
+				// Track unmatched elements for set filters
+				if ( bySet ) {
+					// They will have gone through all possible matchers
+					if ( (elem = !matcher && elem) ) {
+						matchedCount--;
 					}
-					elem.removeAttribute( getSetAttribute ? name : propName );
 
-					// Set corresponding property to false for boolean attributes
-					if ( isBool && propName in elem ) {
-						elem[ propName ] = false;
+					// Lengthen the array for every element, matched or not
+					if ( seed ) {
+						unmatched.push( elem );
 					}
 				}
 			}
-		}
-	},
 
-	attrHooks: {
-		type: {
-			set: function( elem, value ) {
-				// We can't allow the type property to be changed (since it causes problems in IE)
-				if ( rtype.test( elem.nodeName ) && elem.parentNode ) {
-					jQuery.error( "type property can't be changed" );
-				} else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
-					// Setting the type on a radio button after the value resets the value in IE6-9
-					// Reset value to it's default in case type is set after value
-					// This is for element creation
-					var val = elem.value;
-					elem.setAttribute( "type", value );
-					if ( val ) {
-						elem.value = val;
-					}
-					return value;
+			// `i` is now the count of elements visited above, and adding it to `matchedCount`
+			// makes the latter nonnegative.
+			matchedCount += i;
+
+			// Apply set filters to unmatched elements
+			// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
+			// equals `i`), unless we didn't visit _any_ elements in the above loop because we have
+			// no element matchers and no seed.
+			// Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
+			// case, which will result in a "00" `matchedCount` that differs from `i` but is also
+			// numerically zero.
+			if ( bySet && i !== matchedCount ) {
+				j = 0;
+				while ( (matcher = setMatchers[j++]) ) {
+					matcher( unmatched, setMatched, context, xml );
 				}
-			}
-		},
-		// Use the value property for back compat
-		// Use the nodeHook for button elements in IE6/7 (#1954)
-		value: {
-			get: function( elem, name ) {
-				if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
-					return nodeHook.get( elem, name );
+
+				if ( seed ) {
+					// Reintegrate element matches to eliminate the need for sorting
+					if ( matchedCount > 0 ) {
+						while ( i-- ) {
+							if ( !(unmatched[i] || setMatched[i]) ) {
+								setMatched[i] = pop.call( results );
+							}
+						}
+					}
+
+					// Discard index placeholder values to get only actual matches
+					setMatched = condense( setMatched );
 				}
-				return name in elem ?
-					elem.value :
-					null;
-			},
-			set: function( elem, value, name ) {
-				if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
-					return nodeHook.set( elem, value, name );
+
+				// Add matches to results
+				push.apply( results, setMatched );
+
+				// Seedless set matches succeeding multiple successful matchers stipulate sorting
+				if ( outermost && !seed && setMatched.length > 0 &&
+					( matchedCount + setMatchers.length ) > 1 ) {
+
+					Sizzle.uniqueSort( results );
 				}
-				// Does not return so that setAttribute is also used
-				elem.value = value;
 			}
-		}
-	},
 
-	propFix: {
-		tabindex: "tabIndex",
-		readonly: "readOnly",
-		"for": "htmlFor",
-		"class": "className",
-		maxlength: "maxLength",
-		cellspacing: "cellSpacing",
-		cellpadding: "cellPadding",
-		rowspan: "rowSpan",
-		colspan: "colSpan",
-		usemap: "useMap",
-		frameborder: "frameBorder",
-		contenteditable: "contentEditable"
-	},
+			// Override manipulation of globals by nested matchers
+			if ( outermost ) {
+				dirruns = dirrunsUnique;
+				outermostContext = contextBackup;
+			}
 
-	prop: function( elem, name, value ) {
-		var ret, hooks, notxml,
-			nType = elem.nodeType;
+			return unmatched;
+		};
 
-		// don't get/set properties on text, comment and attribute nodes
-		if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
-			return;
+	return bySet ?
+		markFunction( superMatcher ) :
+		superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
+	var i,
+		setMatchers = [],
+		elementMatchers = [],
+		cached = compilerCache[ selector + " " ];
+
+	if ( !cached ) {
+		// Generate a function of recursive functions that can be used to check each element
+		if ( !match ) {
+			match = tokenize( selector );
+		}
+		i = match.length;
+		while ( i-- ) {
+			cached = matcherFromTokens( match[i] );
+			if ( cached[ expando ] ) {
+				setMatchers.push( cached );
+			} else {
+				elementMatchers.push( cached );
+			}
 		}
 
-		notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+		// Cache the compiled function
+		cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
 
-		if ( notxml ) {
-			// Fix name and attach hooks
-			name = jQuery.propFix[ name ] || name;
-			hooks = jQuery.propHooks[ name ];
-		}
+		// Save selector and tokenization
+		cached.selector = selector;
+	}
+	return cached;
+};
 
-		if ( value !== undefined ) {
-			if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
-				return ret;
+/**
+ * A low-level selection function that works with Sizzle's compiled
+ *  selector functions
+ * @param {String|Function} selector A selector or a pre-compiled
+ *  selector function built with Sizzle.compile
+ * @param {Element} context
+ * @param {Array} [results]
+ * @param {Array} [seed] A set of elements to match against
+ */
+select = Sizzle.select = function( selector, context, results, seed ) {
+	var i, tokens, token, type, find,
+		compiled = typeof selector === "function" && selector,
+		match = !seed && tokenize( (selector = compiled.selector || selector) );
 
-			} else {
-				return ( elem[ name ] = value );
-			}
+	results = results || [];
 
-		} else {
-			if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
-				return ret;
+	// Try to minimize operations if there is only one selector in the list and no seed
+	// (the latter of which guarantees us context)
+	if ( match.length === 1 ) {
 
-			} else {
-				return elem[ name ];
+		// Reduce context if the leading compound selector is an ID
+		tokens = match[0] = match[0].slice( 0 );
+		if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
+				support.getById && context.nodeType === 9 && documentIsHTML &&
+				Expr.relative[ tokens[1].type ] ) {
+
+			context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];
+			if ( !context ) {
+				return results;
+
+			// Precompiled matchers will still verify ancestry, so step up a level
+			} else if ( compiled ) {
+				context = context.parentNode;
 			}
+
+			selector = selector.slice( tokens.shift().value.length );
 		}
-	},
 
-	propHooks: {
-		tabIndex: {
-			get: function( elem ) {
-				// elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
-				// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
-				var attributeNode = elem.getAttributeNode("tabindex");
+		// Fetch a seed set for right-to-left matching
+		i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length;
+		while ( i-- ) {
+			token = tokens[i];
 
-				return attributeNode && attributeNode.specified ?
-					parseInt( attributeNode.value, 10 ) :
-					rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
-						0 :
-						undefined;
+			// Abort if we hit a combinator
+			if ( Expr.relative[ (type = token.type) ] ) {
+				break;
+			}
+			if ( (find = Expr.find[ type ]) ) {
+				// Search, expanding context for leading sibling combinators
+				if ( (seed = find(
+					token.matches[0].replace( runescape, funescape ),
+					rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context
+				)) ) {
+
+					// If seed is empty or no tokens remain, we can return early
+					tokens.splice( i, 1 );
+					selector = seed.length && toSelector( tokens );
+					if ( !selector ) {
+						push.apply( results, seed );
+						return results;
+					}
+
+					break;
+				}
 			}
 		}
 	}
-});
 
-// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional)
-jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex;
+	// Compile and execute a filtering function if one is not provided
+	// Provide `match` to avoid retokenization if we modified the selector above
+	( compiled || compile( selector, match ) )(
+		seed,
+		context,
+		!documentIsHTML,
+		results,
+		!context || rsibling.test( selector ) && testContext( context.parentNode ) || context
+	);
+	return results;
+};
 
-// Hook for boolean attributes
-boolHook = {
-	get: function( elem, name ) {
-		// Align boolean attributes with corresponding properties
-		// Fall back to attribute presence where some booleans are not supported
-		var attrNode,
-			property = jQuery.prop( elem, name );
-		return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ?
-			name.toLowerCase() :
-			undefined;
-	},
-	set: function( elem, value, name ) {
-		var propName;
-		if ( value === false ) {
-			// Remove boolean attributes when set to false
-			jQuery.removeAttr( elem, name );
+// One-time assignments
+
+// Sort stability
+support.sortStable = expando.split("").sort( sortOrder ).join("") === expando;
+
+// Support: Chrome 14-35+
+// Always assume duplicates if they aren't passed to the comparison function
+support.detectDuplicates = !!hasDuplicate;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert(function( div1 ) {
+	// Should return 1, but returns 4 (following)
+	return div1.compareDocumentPosition( document.createElement("div") ) & 1;
+});
+
+// Support: IE<8
+// Prevent attribute/property "interpolation"
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !assert(function( div ) {
+	div.innerHTML = "<a href='#'></a>";
+	return div.firstChild.getAttribute("href") === "#" ;
+}) ) {
+	addHandle( "type|href|height|width", function( elem, name, isXML ) {
+		if ( !isXML ) {
+			return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
+		}
+	});
+}
+
+// Support: IE<9
+// Use defaultValue in place of getAttribute("value")
+if ( !support.attributes || !assert(function( div ) {
+	div.innerHTML = "<input/>";
+	div.firstChild.setAttribute( "value", "" );
+	return div.firstChild.getAttribute( "value" ) === "";
+}) ) {
+	addHandle( "value", function( elem, name, isXML ) {
+		if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
+			return elem.defaultValue;
+		}
+	});
+}
+
+// Support: IE<9
+// Use getAttributeNode to fetch booleans when getAttribute lies
+if ( !assert(function( div ) {
+	return div.getAttribute("disabled") == null;
+}) ) {
+	addHandle( booleans, function( elem, name, isXML ) {
+		var val;
+		if ( !isXML ) {
+			return elem[ name ] === true ? name.toLowerCase() :
+					(val = elem.getAttributeNode( name )) && val.specified ?
+					val.value :
+				null;
+		}
+	});
+}
+
+return Sizzle;
+
+})( window );
+
+
+
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[ ":" ] = jQuery.expr.pseudos;
+jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+
+var dir = function( elem, dir, until ) {
+	var matched = [],
+		truncate = until !== undefined;
+
+	while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
+		if ( elem.nodeType === 1 ) {
+			if ( truncate && jQuery( elem ).is( until ) ) {
+				break;
+			}
+			matched.push( elem );
+		}
+	}
+	return matched;
+};
+
+
+var siblings = function( n, elem ) {
+	var matched = [];
+
+	for ( ; n; n = n.nextSibling ) {
+		if ( n.nodeType === 1 && n !== elem ) {
+			matched.push( n );
+		}
+	}
+
+	return matched;
+};
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+var rsingleTag = ( /^<([\w-]+)\s*\/?>(?:<\/\1>|)$/ );
+
+
+
+var risSimple = /^.[^:#\[\.,]*$/;
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+	if ( jQuery.isFunction( qualifier ) ) {
+		return jQuery.grep( elements, function( elem, i ) {
+			/* jshint -W018 */
+			return !!qualifier.call( elem, i, elem ) !== not;
+		} );
+
+	}
+
+	if ( qualifier.nodeType ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( elem === qualifier ) !== not;
+		} );
+
+	}
+
+	if ( typeof qualifier === "string" ) {
+		if ( risSimple.test( qualifier ) ) {
+			return jQuery.filter( qualifier, elements, not );
+		}
+
+		qualifier = jQuery.filter( qualifier, elements );
+	}
+
+	return jQuery.grep( elements, function( elem ) {
+		return ( jQuery.inArray( elem, qualifier ) > -1 ) !== not;
+	} );
+}
+
+jQuery.filter = function( expr, elems, not ) {
+	var elem = elems[ 0 ];
+
+	if ( not ) {
+		expr = ":not(" + expr + ")";
+	}
+
+	return elems.length === 1 && elem.nodeType === 1 ?
+		jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [] :
+		jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+			return elem.nodeType === 1;
+		} ) );
+};
+
+jQuery.fn.extend( {
+	find: function( selector ) {
+		var i,
+			ret = [],
+			self = this,
+			len = self.length;
+
+		if ( typeof selector !== "string" ) {
+			return this.pushStack( jQuery( selector ).filter( function() {
+				for ( i = 0; i < len; i++ ) {
+					if ( jQuery.contains( self[ i ], this ) ) {
+						return true;
+					}
+				}
+			} ) );
+		}
+
+		for ( i = 0; i < len; i++ ) {
+			jQuery.find( selector, self[ i ], ret );
+		}
+
+		// Needed because $( selector, context ) becomes $( context ).find( selector )
+		ret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret );
+		ret.selector = this.selector ? this.selector + " " + selector : selector;
+		return ret;
+	},
+	filter: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], false ) );
+	},
+	not: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], true ) );
+	},
+	is: function( selector ) {
+		return !!winnow(
+			this,
+
+			// If this is a positional/relative selector, check membership in the returned set
+			// so $("p:first").is("p:last") won't return true for a doc with two "p".
+			typeof selector === "string" && rneedsContext.test( selector ) ?
+				jQuery( selector ) :
+				selector || [],
+			false
+		).length;
+	}
+} );
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+	// A simple way to check for HTML strings
+	// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+	// Strict HTML recognition (#11290: must start with <)
+	rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,
+
+	init = jQuery.fn.init = function( selector, context, root ) {
+		var match, elem;
+
+		// HANDLE: $(""), $(null), $(undefined), $(false)
+		if ( !selector ) {
+			return this;
+		}
+
+		// init accepts an alternate rootjQuery
+		// so migrate can support jQuery.sub (gh-2101)
+		root = root || rootjQuery;
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			if ( selector.charAt( 0 ) === "<" &&
+				selector.charAt( selector.length - 1 ) === ">" &&
+				selector.length >= 3 ) {
+
+				// Assume that strings that start and end with <> are HTML and skip the regex check
+				match = [ null, selector, null ];
+
+			} else {
+				match = rquickExpr.exec( selector );
+			}
+
+			// Match html or make sure no context is specified for #id
+			if ( match && ( match[ 1 ] || !context ) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[ 1 ] ) {
+					context = context instanceof jQuery ? context[ 0 ] : context;
+
+					// scripts is true for back-compat
+					// Intentionally let the error be thrown if parseHTML is not present
+					jQuery.merge( this, jQuery.parseHTML(
+						match[ 1 ],
+						context && context.nodeType ? context.ownerDocument || context : document,
+						true
+					) );
+
+					// HANDLE: $(html, props)
+					if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
+						for ( match in context ) {
+
+							// Properties of context are called as methods if possible
+							if ( jQuery.isFunction( this[ match ] ) ) {
+								this[ match ]( context[ match ] );
+
+							// ...and otherwise set as attributes
+							} else {
+								this.attr( match, context[ match ] );
+							}
+						}
+					}
+
+					return this;
+
+				// HANDLE: $(#id)
+				} else {
+					elem = document.getElementById( match[ 2 ] );
+
+					// Check parentNode to catch when Blackberry 4.6 returns
+					// nodes that are no longer in the document #6963
+					if ( elem && elem.parentNode ) {
+
+						// Handle the case where IE and Opera return items
+						// by name instead of ID
+						if ( elem.id !== match[ 2 ] ) {
+							return rootjQuery.find( selector );
+						}
+
+						// Otherwise, we inject the element directly into the jQuery object
+						this.length = 1;
+						this[ 0 ] = elem;
+					}
+
+					this.context = document;
+					this.selector = selector;
+					return this;
+				}
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return ( context || root ).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return this.constructor( context ).find( selector );
+			}
+
+		// HANDLE: $(DOMElement)
+		} else if ( selector.nodeType ) {
+			this.context = this[ 0 ] = selector;
+			this.length = 1;
+			return this;
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( jQuery.isFunction( selector ) ) {
+			return typeof root.ready !== "undefined" ?
+				root.ready( selector ) :
+
+				// Execute immediately if ready is not present
+				selector( jQuery );
+		}
+
+		if ( selector.selector !== undefined ) {
+			this.selector = selector.selector;
+			this.context = selector.context;
+		}
+
+		return jQuery.makeArray( selector, this );
+	};
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+
+	// methods guaranteed to produce a unique set when starting from a unique set
+	guaranteedUnique = {
+		children: true,
+		contents: true,
+		next: true,
+		prev: true
+	};
+
+jQuery.fn.extend( {
+	has: function( target ) {
+		var i,
+			targets = jQuery( target, this ),
+			len = targets.length;
+
+		return this.filter( function() {
+			for ( i = 0; i < len; i++ ) {
+				if ( jQuery.contains( this, targets[ i ] ) ) {
+					return true;
+				}
+			}
+		} );
+	},
+
+	closest: function( selectors, context ) {
+		var cur,
+			i = 0,
+			l = this.length,
+			matched = [],
+			pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ?
+				jQuery( selectors, context || this.context ) :
+				0;
+
+		for ( ; i < l; i++ ) {
+			for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
+
+				// Always skip document fragments
+				if ( cur.nodeType < 11 && ( pos ?
+					pos.index( cur ) > -1 :
+
+					// Don't pass non-elements to Sizzle
+					cur.nodeType === 1 &&
+						jQuery.find.matchesSelector( cur, selectors ) ) ) {
+
+					matched.push( cur );
+					break;
+				}
+			}
+		}
+
+		return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
+	},
+
+	// Determine the position of an element within
+	// the matched set of elements
+	index: function( elem ) {
+
+		// No argument, return index in parent
+		if ( !elem ) {
+			return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
+		}
+
+		// index in selector
+		if ( typeof elem === "string" ) {
+			return jQuery.inArray( this[ 0 ], jQuery( elem ) );
+		}
+
+		// Locate the position of the desired element
+		return jQuery.inArray(
+
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[ 0 ] : elem, this );
+	},
+
+	add: function( selector, context ) {
+		return this.pushStack(
+			jQuery.uniqueSort(
+				jQuery.merge( this.get(), jQuery( selector, context ) )
+			)
+		);
+	},
+
+	addBack: function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	}
+} );
+
+function sibling( cur, dir ) {
+	do {
+		cur = cur[ dir ];
+	} while ( cur && cur.nodeType !== 1 );
+
+	return cur;
+}
+
+jQuery.each( {
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, i, until ) {
+		return dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return sibling( elem, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return sibling( elem, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, i, until ) {
+		return dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, i, until ) {
+		return dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return siblings( ( elem.parentNode || {} ).firstChild, elem );
+	},
+	children: function( elem ) {
+		return siblings( elem.firstChild );
+	},
+	contents: function( elem ) {
+		return jQuery.nodeName( elem, "iframe" ) ?
+			elem.contentDocument || elem.contentWindow.document :
+			jQuery.merge( [], elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var ret = jQuery.map( this, fn, until );
+
+		if ( name.slice( -5 ) !== "Until" ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			ret = jQuery.filter( selector, ret );
+		}
+
+		if ( this.length > 1 ) {
+
+			// Remove duplicates
+			if ( !guaranteedUnique[ name ] ) {
+				ret = jQuery.uniqueSort( ret );
+			}
+
+			// Reverse order for parents* and prev-derivatives
+			if ( rparentsprev.test( name ) ) {
+				ret = ret.reverse();
+			}
+		}
+
+		return this.pushStack( ret );
+	};
+} );
+var rnotwhite = ( /\S+/g );
+
+
+
+// Convert String-formatted options into Object-formatted ones
+function createOptions( options ) {
+	var object = {};
+	jQuery.each( options.match( rnotwhite ) || [], function( _, flag ) {
+		object[ flag ] = true;
+	} );
+	return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ *	options: an optional list of space-separated options that will change how
+ *			the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ *	once:			will ensure the callback list can only be fired once (like a Deferred)
+ *
+ *	memory:			will keep track of previous values and will call any callback added
+ *					after the list has been fired right away with the latest "memorized"
+ *					values (like a Deferred)
+ *
+ *	unique:			will ensure a callback can only be added once (no duplicate in the list)
+ *
+ *	stopOnFalse:	interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+	// Convert options from String-formatted to Object-formatted if needed
+	// (we check in cache first)
+	options = typeof options === "string" ?
+		createOptions( options ) :
+		jQuery.extend( {}, options );
+
+	var // Flag to know if list is currently firing
+		firing,
+
+		// Last fire value for non-forgettable lists
+		memory,
+
+		// Flag to know if list was already fired
+		fired,
+
+		// Flag to prevent firing
+		locked,
+
+		// Actual callback list
+		list = [],
+
+		// Queue of execution data for repeatable lists
+		queue = [],
+
+		// Index of currently firing callback (modified by add/remove as needed)
+		firingIndex = -1,
+
+		// Fire callbacks
+		fire = function() {
+
+			// Enforce single-firing
+			locked = options.once;
+
+			// Execute callbacks for all pending executions,
+			// respecting firingIndex overrides and runtime changes
+			fired = firing = true;
+			for ( ; queue.length; firingIndex = -1 ) {
+				memory = queue.shift();
+				while ( ++firingIndex < list.length ) {
+
+					// Run callback and check for early termination
+					if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
+						options.stopOnFalse ) {
+
+						// Jump to end and forget the data so .add doesn't re-fire
+						firingIndex = list.length;
+						memory = false;
+					}
+				}
+			}
+
+			// Forget the data if we're done with it
+			if ( !options.memory ) {
+				memory = false;
+			}
+
+			firing = false;
+
+			// Clean up if we're done firing for good
+			if ( locked ) {
+
+				// Keep an empty list if we have data for future add calls
+				if ( memory ) {
+					list = [];
+
+				// Otherwise, this object is spent
+				} else {
+					list = "";
+				}
+			}
+		},
+
+		// Actual Callbacks object
+		self = {
+
+			// Add a callback or a collection of callbacks to the list
+			add: function() {
+				if ( list ) {
+
+					// If we have memory from a past run, we should fire after adding
+					if ( memory && !firing ) {
+						firingIndex = list.length - 1;
+						queue.push( memory );
+					}
+
+					( function add( args ) {
+						jQuery.each( args, function( _, arg ) {
+							if ( jQuery.isFunction( arg ) ) {
+								if ( !options.unique || !self.has( arg ) ) {
+									list.push( arg );
+								}
+							} else if ( arg && arg.length && jQuery.type( arg ) !== "string" ) {
+
+								// Inspect recursively
+								add( arg );
+							}
+						} );
+					} )( arguments );
+
+					if ( memory && !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Remove a callback from the list
+			remove: function() {
+				jQuery.each( arguments, function( _, arg ) {
+					var index;
+					while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+						list.splice( index, 1 );
+
+						// Handle firing indexes
+						if ( index <= firingIndex ) {
+							firingIndex--;
+						}
+					}
+				} );
+				return this;
+			},
+
+			// Check if a given callback is in the list.
+			// If no argument is given, return whether or not list has callbacks attached.
+			has: function( fn ) {
+				return fn ?
+					jQuery.inArray( fn, list ) > -1 :
+					list.length > 0;
+			},
+
+			// Remove all callbacks from the list
+			empty: function() {
+				if ( list ) {
+					list = [];
+				}
+				return this;
+			},
+
+			// Disable .fire and .add
+			// Abort any current/pending executions
+			// Clear all callbacks and values
+			disable: function() {
+				locked = queue = [];
+				list = memory = "";
+				return this;
+			},
+			disabled: function() {
+				return !list;
+			},
+
+			// Disable .fire
+			// Also disable .add unless we have memory (since it would have no effect)
+			// Abort any pending executions
+			lock: function() {
+				locked = true;
+				if ( !memory ) {
+					self.disable();
+				}
+				return this;
+			},
+			locked: function() {
+				return !!locked;
+			},
+
+			// Call all callbacks with the given context and arguments
+			fireWith: function( context, args ) {
+				if ( !locked ) {
+					args = args || [];
+					args = [ context, args.slice ? args.slice() : args ];
+					queue.push( args );
+					if ( !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Call all the callbacks with the given arguments
+			fire: function() {
+				self.fireWith( this, arguments );
+				return this;
+			},
+
+			// To know if the callbacks have already been called at least once
+			fired: function() {
+				return !!fired;
+			}
+		};
+
+	return self;
+};
+
+
+jQuery.extend( {
+
+	Deferred: function( func ) {
+		var tuples = [
+
+				// action, add listener, listener list, final state
+				[ "resolve", "done", jQuery.Callbacks( "once memory" ), "resolved" ],
+				[ "reject", "fail", jQuery.Callbacks( "once memory" ), "rejected" ],
+				[ "notify", "progress", jQuery.Callbacks( "memory" ) ]
+			],
+			state = "pending",
+			promise = {
+				state: function() {
+					return state;
+				},
+				always: function() {
+					deferred.done( arguments ).fail( arguments );
+					return this;
+				},
+				then: function( /* fnDone, fnFail, fnProgress */ ) {
+					var fns = arguments;
+					return jQuery.Deferred( function( newDefer ) {
+						jQuery.each( tuples, function( i, tuple ) {
+							var fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];
+
+							// deferred[ done | fail | progress ] for forwarding actions to newDefer
+							deferred[ tuple[ 1 ] ]( function() {
+								var returned = fn && fn.apply( this, arguments );
+								if ( returned && jQuery.isFunction( returned.promise ) ) {
+									returned.promise()
+										.progress( newDefer.notify )
+										.done( newDefer.resolve )
+										.fail( newDefer.reject );
+								} else {
+									newDefer[ tuple[ 0 ] + "With" ](
+										this === promise ? newDefer.promise() : this,
+										fn ? [ returned ] : arguments
+									);
+								}
+							} );
+						} );
+						fns = null;
+					} ).promise();
+				},
+
+				// Get a promise for this deferred
+				// If obj is provided, the promise aspect is added to the object
+				promise: function( obj ) {
+					return obj != null ? jQuery.extend( obj, promise ) : promise;
+				}
+			},
+			deferred = {};
+
+		// Keep pipe for back-compat
+		promise.pipe = promise.then;
+
+		// Add list-specific methods
+		jQuery.each( tuples, function( i, tuple ) {
+			var list = tuple[ 2 ],
+				stateString = tuple[ 3 ];
+
+			// promise[ done | fail | progress ] = list.add
+			promise[ tuple[ 1 ] ] = list.add;
+
+			// Handle state
+			if ( stateString ) {
+				list.add( function() {
+
+					// state = [ resolved | rejected ]
+					state = stateString;
+
+				// [ reject_list | resolve_list ].disable; progress_list.lock
+				}, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );
+			}
+
+			// deferred[ resolve | reject | notify ]
+			deferred[ tuple[ 0 ] ] = function() {
+				deferred[ tuple[ 0 ] + "With" ]( this === deferred ? promise : this, arguments );
+				return this;
+			};
+			deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
+		} );
+
+		// Make the deferred a promise
+		promise.promise( deferred );
+
+		// Call given func if any
+		if ( func ) {
+			func.call( deferred, deferred );
+		}
+
+		// All done!
+		return deferred;
+	},
+
+	// Deferred helper
+	when: function( subordinate /* , ..., subordinateN */ ) {
+		var i = 0,
+			resolveValues = slice.call( arguments ),
+			length = resolveValues.length,
+
+			// the count of uncompleted subordinates
+			remaining = length !== 1 ||
+				( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,
+
+			// the master Deferred.
+			// If resolveValues consist of only a single Deferred, just use that.
+			deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
+
+			// Update function for both resolve and progress values
+			updateFunc = function( i, contexts, values ) {
+				return function( value ) {
+					contexts[ i ] = this;
+					values[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+					if ( values === progressValues ) {
+						deferred.notifyWith( contexts, values );
+
+					} else if ( !( --remaining ) ) {
+						deferred.resolveWith( contexts, values );
+					}
+				};
+			},
+
+			progressValues, progressContexts, resolveContexts;
+
+		// add listeners to Deferred subordinates; treat others as resolved
+		if ( length > 1 ) {
+			progressValues = new Array( length );
+			progressContexts = new Array( length );
+			resolveContexts = new Array( length );
+			for ( ; i < length; i++ ) {
+				if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {
+					resolveValues[ i ].promise()
+						.progress( updateFunc( i, progressContexts, progressValues ) )
+						.done( updateFunc( i, resolveContexts, resolveValues ) )
+						.fail( deferred.reject );
+				} else {
+					--remaining;
+				}
+			}
+		}
+
+		// if we're not waiting on anything, resolve the master
+		if ( !remaining ) {
+			deferred.resolveWith( resolveContexts, resolveValues );
+		}
+
+		return deferred.promise();
+	}
+} );
+
+
+// The deferred used on DOM ready
+var readyList;
+
+jQuery.fn.ready = function( fn ) {
+
+	// Add the callback
+	jQuery.ready.promise().done( fn );
+
+	return this;
+};
+
+jQuery.extend( {
+
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+
+	// A counter to track how many items to wait for before
+	// the ready event fires. See #6781
+	readyWait: 1,
+
+	// Hold (or release) the ready event
+	holdReady: function( hold ) {
+		if ( hold ) {
+			jQuery.readyWait++;
+		} else {
+			jQuery.ready( true );
+		}
+	},
+
+	// Handle when the DOM is ready
+	ready: function( wait ) {
+
+		// Abort if there are pending holds or we're already ready
+		if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+			return;
+		}
+
+		// Remember that the DOM is ready
+		jQuery.isReady = true;
+
+		// If a normal DOM Ready event fired, decrement, and wait if need be
+		if ( wait !== true && --jQuery.readyWait > 0 ) {
+			return;
+		}
+
+		// If there are functions bound, to execute
+		readyList.resolveWith( document, [ jQuery ] );
+
+		// Trigger any bound ready events
+		if ( jQuery.fn.triggerHandler ) {
+			jQuery( document ).triggerHandler( "ready" );
+			jQuery( document ).off( "ready" );
+		}
+	}
+} );
+
+/**
+ * Clean-up method for dom ready events
+ */
+function detach() {
+	if ( document.addEventListener ) {
+		document.removeEventListener( "DOMContentLoaded", completed );
+		window.removeEventListener( "load", completed );
+
+	} else {
+		document.detachEvent( "onreadystatechange", completed );
+		window.detachEvent( "onload", completed );
+	}
+}
+
+/**
+ * The ready event handler and self cleanup method
+ */
+function completed() {
+
+	// readyState === "complete" is good enough for us to call the dom ready in oldIE
+	if ( document.addEventListener ||
+		window.event.type === "load" ||
+		document.readyState === "complete" ) {
+
+		detach();
+		jQuery.ready();
+	}
+}
+
+jQuery.ready.promise = function( obj ) {
+	if ( !readyList ) {
+
+		readyList = jQuery.Deferred();
+
+		// Catch cases where $(document).ready() is called
+		// after the browser event has already occurred.
+		// Support: IE6-10
+		// Older IE sometimes signals "interactive" too soon
+		if ( document.readyState === "complete" ||
+			( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
+
+			// Handle it asynchronously to allow scripts the opportunity to delay ready
+			window.setTimeout( jQuery.ready );
+
+		// Standards-based browsers support DOMContentLoaded
+		} else if ( document.addEventListener ) {
+
+			// Use the handy event callback
+			document.addEventListener( "DOMContentLoaded", completed );
+
+			// A fallback to window.onload, that will always work
+			window.addEventListener( "load", completed );
+
+		// If IE event model is used
+		} else {
+
+			// Ensure firing before onload, maybe late but safe also for iframes
+			document.attachEvent( "onreadystatechange", completed );
+
+			// A fallback to window.onload, that will always work
+			window.attachEvent( "onload", completed );
+
+			// If IE and not a frame
+			// continually check to see if the document is ready
+			var top = false;
+
+			try {
+				top = window.frameElement == null && document.documentElement;
+			} catch ( e ) {}
+
+			if ( top && top.doScroll ) {
+				( function doScrollCheck() {
+					if ( !jQuery.isReady ) {
+
+						try {
+
+							// Use the trick by Diego Perini
+							// http://javascript.nwbox.com/IEContentLoaded/
+							top.doScroll( "left" );
+						} catch ( e ) {
+							return window.setTimeout( doScrollCheck, 50 );
+						}
+
+						// detach all dom ready events
+						detach();
+
+						// and execute any waiting functions
+						jQuery.ready();
+					}
+				} )();
+			}
+		}
+	}
+	return readyList.promise( obj );
+};
+
+// Kick off the DOM ready check even if the user does not
+jQuery.ready.promise();
+
+
+
+
+// Support: IE<9
+// Iteration over object's inherited properties before its own
+var i;
+for ( i in jQuery( support ) ) {
+	break;
+}
+support.ownFirst = i === "0";
+
+// Note: most support tests are defined in their respective modules.
+// false until the test is run
+support.inlineBlockNeedsLayout = false;
+
+// Execute ASAP in case we need to set body.style.zoom
+jQuery( function() {
+
+	// Minified: var a,b,c,d
+	var val, div, body, container;
+
+	body = document.getElementsByTagName( "body" )[ 0 ];
+	if ( !body || !body.style ) {
+
+		// Return for frameset docs that don't have a body
+		return;
+	}
+
+	// Setup
+	div = document.createElement( "div" );
+	container = document.createElement( "div" );
+	container.style.cssText = "position:absolute;border:0;width:0;height:0;top:0;left:-9999px";
+	body.appendChild( container ).appendChild( div );
+
+	if ( typeof div.style.zoom !== "undefined" ) {
+
+		// Support: IE<8
+		// Check if natively block-level elements act like inline-block
+		// elements when setting their display to 'inline' and giving
+		// them layout
+		div.style.cssText = "display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1";
+
+		support.inlineBlockNeedsLayout = val = div.offsetWidth === 3;
+		if ( val ) {
+
+			// Prevent IE 6 from affecting layout for positioned elements #11048
+			// Prevent IE from shrinking the body in IE 7 mode #12869
+			// Support: IE<8
+			body.style.zoom = 1;
+		}
+	}
+
+	body.removeChild( container );
+} );
+
+
+( function() {
+	var div = document.createElement( "div" );
+
+	// Support: IE<9
+	support.deleteExpando = true;
+	try {
+		delete div.test;
+	} catch ( e ) {
+		support.deleteExpando = false;
+	}
+
+	// Null elements to avoid leaks in IE.
+	div = null;
+} )();
+var acceptData = function( elem ) {
+	var noData = jQuery.noData[ ( elem.nodeName + " " ).toLowerCase() ],
+		nodeType = +elem.nodeType || 1;
+
+	// Do not set data on non-element DOM nodes because it will not be cleared (#8335).
+	return nodeType !== 1 && nodeType !== 9 ?
+		false :
+
+		// Nodes accept data unless otherwise specified; rejection can be conditional
+		!noData || noData !== true && elem.getAttribute( "classid" ) === noData;
+};
+
+
+
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+	rmultiDash = /([A-Z])/g;
+
+function dataAttr( elem, key, data ) {
+
+	// If nothing was found internally, try to fetch any
+	// data from the HTML5 data-* attribute
+	if ( data === undefined && elem.nodeType === 1 ) {
+
+		var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
+
+		data = elem.getAttribute( name );
+
+		if ( typeof data === "string" ) {
+			try {
+				data = data === "true" ? true :
+					data === "false" ? false :
+					data === "null" ? null :
+
+					// Only convert to a number if it doesn't change the string
+					+data + "" === data ? +data :
+					rbrace.test( data ) ? jQuery.parseJSON( data ) :
+					data;
+			} catch ( e ) {}
+
+			// Make sure we set the data so it isn't changed later
+			jQuery.data( elem, key, data );
+
+		} else {
+			data = undefined;
+		}
+	}
+
+	return data;
+}
+
+// checks a cache object for emptiness
+function isEmptyDataObject( obj ) {
+	var name;
+	for ( name in obj ) {
+
+		// if the public data object is empty, the private is still empty
+		if ( name === "data" && jQuery.isEmptyObject( obj[ name ] ) ) {
+			continue;
+		}
+		if ( name !== "toJSON" ) {
+			return false;
+		}
+	}
+
+	return true;
+}
+
+function internalData( elem, name, data, pvt /* Internal Use Only */ ) {
+	if ( !acceptData( elem ) ) {
+		return;
+	}
+
+	var ret, thisCache,
+		internalKey = jQuery.expando,
+
+		// We have to handle DOM nodes and JS objects differently because IE6-7
+		// can't GC object references properly across the DOM-JS boundary
+		isNode = elem.nodeType,
+
+		// Only DOM nodes need the global jQuery cache; JS object data is
+		// attached directly to the object so GC can occur automatically
+		cache = isNode ? jQuery.cache : elem,
+
+		// Only defining an ID for JS objects if its cache already exists allows
+		// the code to shortcut on the same path as a DOM node with no cache
+		id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey;
+
+	// Avoid doing any more work than we need to when trying to get data on an
+	// object that has no data at all
+	if ( ( !id || !cache[ id ] || ( !pvt && !cache[ id ].data ) ) &&
+		data === undefined && typeof name === "string" ) {
+		return;
+	}
+
+	if ( !id ) {
+
+		// Only DOM nodes need a new unique ID for each element since their data
+		// ends up in the global cache
+		if ( isNode ) {
+			id = elem[ internalKey ] = deletedIds.pop() || jQuery.guid++;
+		} else {
+			id = internalKey;
+		}
+	}
+
+	if ( !cache[ id ] ) {
+
+		// Avoid exposing jQuery metadata on plain JS objects when the object
+		// is serialized using JSON.stringify
+		cache[ id ] = isNode ? {} : { toJSON: jQuery.noop };
+	}
+
+	// An object can be passed to jQuery.data instead of a key/value pair; this gets
+	// shallow copied over onto the existing cache
+	if ( typeof name === "object" || typeof name === "function" ) {
+		if ( pvt ) {
+			cache[ id ] = jQuery.extend( cache[ id ], name );
 		} else {
-			// value is true since we know at this point it's type boolean and not false
-			// Set boolean attributes to the same name and set the DOM property
-			propName = jQuery.propFix[ name ] || name;
-			if ( propName in elem ) {
-				// Only set the IDL specifically if it already exists on the element
-				elem[ propName ] = true;
+			cache[ id ].data = jQuery.extend( cache[ id ].data, name );
+		}
+	}
+
+	thisCache = cache[ id ];
+
+	// jQuery data() is stored in a separate object inside the object's internal data
+	// cache in order to avoid key collisions between internal data and user-defined
+	// data.
+	if ( !pvt ) {
+		if ( !thisCache.data ) {
+			thisCache.data = {};
+		}
+
+		thisCache = thisCache.data;
+	}
+
+	if ( data !== undefined ) {
+		thisCache[ jQuery.camelCase( name ) ] = data;
+	}
+
+	// Check for both converted-to-camel and non-converted data property names
+	// If a data property was specified
+	if ( typeof name === "string" ) {
+
+		// First Try to find as-is property data
+		ret = thisCache[ name ];
+
+		// Test for null|undefined property data
+		if ( ret == null ) {
+
+			// Try to find the camelCased property
+			ret = thisCache[ jQuery.camelCase( name ) ];
+		}
+	} else {
+		ret = thisCache;
+	}
+
+	return ret;
+}
+
+function internalRemoveData( elem, name, pvt ) {
+	if ( !acceptData( elem ) ) {
+		return;
+	}
+
+	var thisCache, i,
+		isNode = elem.nodeType,
+
+		// See jQuery.data for more information
+		cache = isNode ? jQuery.cache : elem,
+		id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+	// If there is already no cache entry for this object, there is no
+	// purpose in continuing
+	if ( !cache[ id ] ) {
+		return;
+	}
+
+	if ( name ) {
+
+		thisCache = pvt ? cache[ id ] : cache[ id ].data;
+
+		if ( thisCache ) {
+
+			// Support array or space separated string names for data keys
+			if ( !jQuery.isArray( name ) ) {
+
+				// try the string as a key before any manipulation
+				if ( name in thisCache ) {
+					name = [ name ];
+				} else {
+
+					// split the camel cased version by spaces unless a key with the spaces exists
+					name = jQuery.camelCase( name );
+					if ( name in thisCache ) {
+						name = [ name ];
+					} else {
+						name = name.split( " " );
+					}
+				}
+			} else {
+
+				// If "name" is an array of keys...
+				// When data is initially created, via ("key", "val") signature,
+				// keys will be converted to camelCase.
+				// Since there is no way to tell _how_ a key was added, remove
+				// both plain key and camelCase key. #12786
+				// This will only penalize the array argument path.
+				name = name.concat( jQuery.map( name, jQuery.camelCase ) );
+			}
+
+			i = name.length;
+			while ( i-- ) {
+				delete thisCache[ name[ i ] ];
+			}
+
+			// If there is no data left in the cache, we want to continue
+			// and let the cache object itself get destroyed
+			if ( pvt ? !isEmptyDataObject( thisCache ) : !jQuery.isEmptyObject( thisCache ) ) {
+				return;
+			}
+		}
+	}
+
+	// See jQuery.data for more information
+	if ( !pvt ) {
+		delete cache[ id ].data;
+
+		// Don't destroy the parent cache unless the internal data object
+		// had been the only thing left in it
+		if ( !isEmptyDataObject( cache[ id ] ) ) {
+			return;
+		}
+	}
+
+	// Destroy the cache
+	if ( isNode ) {
+		jQuery.cleanData( [ elem ], true );
+
+	// Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
+	/* jshint eqeqeq: false */
+	} else if ( support.deleteExpando || cache != cache.window ) {
+		/* jshint eqeqeq: true */
+		delete cache[ id ];
+
+	// When all else fails, undefined
+	} else {
+		cache[ id ] = undefined;
+	}
+}
+
+jQuery.extend( {
+	cache: {},
+
+	// The following elements (space-suffixed to avoid Object.prototype collisions)
+	// throw uncatchable exceptions if you attempt to set expando properties
+	noData: {
+		"applet ": true,
+		"embed ": true,
+
+		// ...but Flash objects (which have this classid) *can* handle expandos
+		"object ": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"
+	},
+
+	hasData: function( elem ) {
+		elem = elem.nodeType ? jQuery.cache[ elem[ jQuery.expando ] ] : elem[ jQuery.expando ];
+		return !!elem && !isEmptyDataObject( elem );
+	},
+
+	data: function( elem, name, data ) {
+		return internalData( elem, name, data );
+	},
+
+	removeData: function( elem, name ) {
+		return internalRemoveData( elem, name );
+	},
+
+	// For internal use only.
+	_data: function( elem, name, data ) {
+		return internalData( elem, name, data, true );
+	},
+
+	_removeData: function( elem, name ) {
+		return internalRemoveData( elem, name, true );
+	}
+} );
+
+jQuery.fn.extend( {
+	data: function( key, value ) {
+		var i, name, data,
+			elem = this[ 0 ],
+			attrs = elem && elem.attributes;
+
+		// Special expections of .data basically thwart jQuery.access,
+		// so implement the relevant behavior ourselves
+
+		// Gets all values
+		if ( key === undefined ) {
+			if ( this.length ) {
+				data = jQuery.data( elem );
+
+				if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) {
+					i = attrs.length;
+					while ( i-- ) {
+
+						// Support: IE11+
+						// The attrs elements can be null (#14894)
+						if ( attrs[ i ] ) {
+							name = attrs[ i ].name;
+							if ( name.indexOf( "data-" ) === 0 ) {
+								name = jQuery.camelCase( name.slice( 5 ) );
+								dataAttr( elem, name, data[ name ] );
+							}
+						}
+					}
+					jQuery._data( elem, "parsedAttrs", true );
+				}
+			}
+
+			return data;
+		}
+
+		// Sets multiple values
+		if ( typeof key === "object" ) {
+			return this.each( function() {
+				jQuery.data( this, key );
+			} );
+		}
+
+		return arguments.length > 1 ?
+
+			// Sets one value
+			this.each( function() {
+				jQuery.data( this, key, value );
+			} ) :
+
+			// Gets one value
+			// Try to fetch any internally stored data first
+			elem ? dataAttr( elem, key, jQuery.data( elem, key ) ) : undefined;
+	},
+
+	removeData: function( key ) {
+		return this.each( function() {
+			jQuery.removeData( this, key );
+		} );
+	}
+} );
+
+
+jQuery.extend( {
+	queue: function( elem, type, data ) {
+		var queue;
+
+		if ( elem ) {
+			type = ( type || "fx" ) + "queue";
+			queue = jQuery._data( elem, type );
+
+			// Speed up dequeue by getting out quickly if this is just a lookup
+			if ( data ) {
+				if ( !queue || jQuery.isArray( data ) ) {
+					queue = jQuery._data( elem, type, jQuery.makeArray( data ) );
+				} else {
+					queue.push( data );
+				}
+			}
+			return queue || [];
+		}
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ),
+			startLength = queue.length,
+			fn = queue.shift(),
+			hooks = jQuery._queueHooks( elem, type ),
+			next = function() {
+				jQuery.dequeue( elem, type );
+			};
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+			startLength--;
+		}
+
+		if ( fn ) {
+
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift( "inprogress" );
+			}
+
+			// clear up the last queue stop function
+			delete hooks.stop;
+			fn.call( elem, next, hooks );
+		}
+
+		if ( !startLength && hooks ) {
+			hooks.empty.fire();
+		}
+	},
+
+	// not intended for public consumption - generates a queueHooks object,
+	// or returns the current one
+	_queueHooks: function( elem, type ) {
+		var key = type + "queueHooks";
+		return jQuery._data( elem, key ) || jQuery._data( elem, key, {
+			empty: jQuery.Callbacks( "once memory" ).add( function() {
+				jQuery._removeData( elem, type + "queue" );
+				jQuery._removeData( elem, key );
+			} )
+		} );
+	}
+} );
+
+jQuery.fn.extend( {
+	queue: function( type, data ) {
+		var setter = 2;
+
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+			setter--;
+		}
+
+		if ( arguments.length < setter ) {
+			return jQuery.queue( this[ 0 ], type );
+		}
+
+		return data === undefined ?
+			this :
+			this.each( function() {
+				var queue = jQuery.queue( this, type, data );
+
+				// ensure a hooks for this queue
+				jQuery._queueHooks( this, type );
+
+				if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
+					jQuery.dequeue( this, type );
+				}
+			} );
+	},
+	dequeue: function( type ) {
+		return this.each( function() {
+			jQuery.dequeue( this, type );
+		} );
+	},
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	},
+
+	// Get a promise resolved when queues of a certain type
+	// are emptied (fx is the type by default)
+	promise: function( type, obj ) {
+		var tmp,
+			count = 1,
+			defer = jQuery.Deferred(),
+			elements = this,
+			i = this.length,
+			resolve = function() {
+				if ( !( --count ) ) {
+					defer.resolveWith( elements, [ elements ] );
+				}
+			};
+
+		if ( typeof type !== "string" ) {
+			obj = type;
+			type = undefined;
+		}
+		type = type || "fx";
+
+		while ( i-- ) {
+			tmp = jQuery._data( elements[ i ], type + "queueHooks" );
+			if ( tmp && tmp.empty ) {
+				count++;
+				tmp.empty.add( resolve );
+			}
+		}
+		resolve();
+		return defer.promise( obj );
+	}
+} );
+
+
+( function() {
+	var shrinkWrapBlocksVal;
+
+	support.shrinkWrapBlocks = function() {
+		if ( shrinkWrapBlocksVal != null ) {
+			return shrinkWrapBlocksVal;
+		}
+
+		// Will be changed later if needed.
+		shrinkWrapBlocksVal = false;
+
+		// Minified: var b,c,d
+		var div, body, container;
+
+		body = document.getElementsByTagName( "body" )[ 0 ];
+		if ( !body || !body.style ) {
+
+			// Test fired too early or in an unsupported environment, exit.
+			return;
+		}
+
+		// Setup
+		div = document.createElement( "div" );
+		container = document.createElement( "div" );
+		container.style.cssText = "position:absolute;border:0;width:0;height:0;top:0;left:-9999px";
+		body.appendChild( container ).appendChild( div );
+
+		// Support: IE6
+		// Check if elements with layout shrink-wrap their children
+		if ( typeof div.style.zoom !== "undefined" ) {
+
+			// Reset CSS: box-sizing; display; margin; border
+			div.style.cssText =
+
+				// Support: Firefox<29, Android 2.3
+				// Vendor-prefix box-sizing
+				"-webkit-box-sizing:content-box;-moz-box-sizing:content-box;" +
+				"box-sizing:content-box;display:block;margin:0;border:0;" +
+				"padding:1px;width:1px;zoom:1";
+			div.appendChild( document.createElement( "div" ) ).style.width = "5px";
+			shrinkWrapBlocksVal = div.offsetWidth !== 3;
+		}
+
+		body.removeChild( container );
+
+		return shrinkWrapBlocksVal;
+	};
+
+} )();
+var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
+
+var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
+
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var isHidden = function( elem, el ) {
+
+		// isHidden might be called from jQuery#filter function;
+		// in that case, element will be second argument
+		elem = el || elem;
+		return jQuery.css( elem, "display" ) === "none" ||
+			!jQuery.contains( elem.ownerDocument, elem );
+	};
+
+
+
+function adjustCSS( elem, prop, valueParts, tween ) {
+	var adjusted,
+		scale = 1,
+		maxIterations = 20,
+		currentValue = tween ?
+			function() { return tween.cur(); } :
+			function() { return jQuery.css( elem, prop, "" ); },
+		initial = currentValue(),
+		unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+		// Starting value computation is required for potential unit mismatches
+		initialInUnit = ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
+			rcssNum.exec( jQuery.css( elem, prop ) );
+
+	if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
+
+		// Trust units reported by jQuery.css
+		unit = unit || initialInUnit[ 3 ];
+
+		// Make sure we update the tween properties later on
+		valueParts = valueParts || [];
+
+		// Iteratively approximate from a nonzero starting point
+		initialInUnit = +initial || 1;
+
+		do {
+
+			// If previous iteration zeroed out, double until we get *something*.
+			// Use string for doubling so we don't accidentally see scale as unchanged below
+			scale = scale || ".5";
+
+			// Adjust and apply
+			initialInUnit = initialInUnit / scale;
+			jQuery.style( elem, prop, initialInUnit + unit );
+
+		// Update scale, tolerating zero or NaN from tween.cur()
+		// Break the loop if scale is unchanged or perfect, or if we've just had enough.
+		} while (
+			scale !== ( scale = currentValue() / initial ) && scale !== 1 && --maxIterations
+		);
+	}
+
+	if ( valueParts ) {
+		initialInUnit = +initialInUnit || +initial || 0;
+
+		// Apply relative offset (+=/-=) if specified
+		adjusted = valueParts[ 1 ] ?
+			initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+			+valueParts[ 2 ];
+		if ( tween ) {
+			tween.unit = unit;
+			tween.start = initialInUnit;
+			tween.end = adjusted;
+		}
+	}
+	return adjusted;
+}
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+	var i = 0,
+		length = elems.length,
+		bulk = key == null;
+
+	// Sets many values
+	if ( jQuery.type( key ) === "object" ) {
+		chainable = true;
+		for ( i in key ) {
+			access( elems, fn, i, key[ i ], true, emptyGet, raw );
+		}
+
+	// Sets one value
+	} else if ( value !== undefined ) {
+		chainable = true;
+
+		if ( !jQuery.isFunction( value ) ) {
+			raw = true;
+		}
+
+		if ( bulk ) {
+
+			// Bulk operations run against the entire set
+			if ( raw ) {
+				fn.call( elems, value );
+				fn = null;
+
+			// ...except when executing function values
+			} else {
+				bulk = fn;
+				fn = function( elem, key, value ) {
+					return bulk.call( jQuery( elem ), value );
+				};
 			}
+		}
 
-			elem.setAttribute( name, name.toLowerCase() );
+		if ( fn ) {
+			for ( ; i < length; i++ ) {
+				fn(
+					elems[ i ],
+					key,
+					raw ? value : value.call( elems[ i ], i, fn( elems[ i ], key ) )
+				);
+			}
 		}
-		return name;
 	}
+
+	return chainable ?
+		elems :
+
+		// Gets
+		bulk ?
+			fn.call( elems ) :
+			length ? fn( elems[ 0 ], key ) : emptyGet;
 };
+var rcheckableType = ( /^(?:checkbox|radio)$/i );
 
-// IE6/7 do not support getting/setting some attributes with get/setAttribute
-if ( !getSetAttribute ) {
+var rtagName = ( /<([\w:-]+)/ );
 
-	fixSpecified = {
-		name: true,
-		id: true,
-		coords: true
-	};
+var rscriptType = ( /^$|\/(?:java|ecma)script/i );
 
-	// Use this for any attribute in IE6/7
-	// This fixes almost every IE6/7 issue
-	nodeHook = jQuery.valHooks.button = {
-		get: function( elem, name ) {
-			var ret;
-			ret = elem.getAttributeNode( name );
-			return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ?
-				ret.nodeValue :
+var rleadingWhitespace = ( /^\s+/ );
+
+var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|" +
+		"details|dialog|figcaption|figure|footer|header|hgroup|main|" +
+		"mark|meter|nav|output|picture|progress|section|summary|template|time|video";
+
+
+
+function createSafeFragment( document ) {
+	var list = nodeNames.split( "|" ),
+		safeFrag = document.createDocumentFragment();
+
+	if ( safeFrag.createElement ) {
+		while ( list.length ) {
+			safeFrag.createElement(
+				list.pop()
+			);
+		}
+	}
+	return safeFrag;
+}
+
+
+( function() {
+	var div = document.createElement( "div" ),
+		fragment = document.createDocumentFragment(),
+		input = document.createElement( "input" );
+
+	// Setup
+	div.innerHTML = "  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+
+	// IE strips leading whitespace when .innerHTML is used
+	support.leadingWhitespace = div.firstChild.nodeType === 3;
+
+	// Make sure that tbody elements aren't automatically inserted
+	// IE will insert them into empty tables
+	support.tbody = !div.getElementsByTagName( "tbody" ).length;
+
+	// Make sure that link elements get serialized correctly by innerHTML
+	// This requires a wrapper element in IE
+	support.htmlSerialize = !!div.getElementsByTagName( "link" ).length;
+
+	// Makes sure cloning an html5 element does not cause problems
+	// Where outerHTML is undefined, this still works
+	support.html5Clone =
+		document.createElement( "nav" ).cloneNode( true ).outerHTML !== "<:nav></:nav>";
+
+	// Check if a disconnected checkbox will retain its checked
+	// value of true after appended to the DOM (IE6/7)
+	input.type = "checkbox";
+	input.checked = true;
+	fragment.appendChild( input );
+	support.appendChecked = input.checked;
+
+	// Make sure textarea (and checkbox) defaultValue is properly cloned
+	// Support: IE6-IE11+
+	div.innerHTML = "<textarea>x</textarea>";
+	support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+
+	// #11217 - WebKit loses check when the name is after the checked attribute
+	fragment.appendChild( div );
+
+	// Support: Windows Web Apps (WWA)
+	// `name` and `type` must use .setAttribute for WWA (#14901)
+	input = document.createElement( "input" );
+	input.setAttribute( "type", "radio" );
+	input.setAttribute( "checked", "checked" );
+	input.setAttribute( "name", "t" );
+
+	div.appendChild( input );
+
+	// Support: Safari 5.1, iOS 5.1, Android 4.x, Android 2.3
+	// old WebKit doesn't clone checked state correctly in fragments
+	support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+	// Support: IE<9
+	// Cloned elements keep attachEvent handlers, we use addEventListener on IE9+
+	support.noCloneEvent = !!div.addEventListener;
+
+	// Support: IE<9
+	// Since attributes and properties are the same in IE,
+	// cleanData must set properties to undefined rather than use removeAttribute
+	div[ jQuery.expando ] = 1;
+	support.attributes = !div.getAttribute( jQuery.expando );
+} )();
+
+
+// We have to close these tags to support XHTML (#13200)
+var wrapMap = {
+	option: [ 1, "<select multiple='multiple'>", "</select>" ],
+	legend: [ 1, "<fieldset>", "</fieldset>" ],
+	area: [ 1, "<map>", "</map>" ],
+
+	// Support: IE8
+	param: [ 1, "<object>", "</object>" ],
+	thead: [ 1, "<table>", "</table>" ],
+	tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+	col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+	td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+	// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
+	// unless wrapped in a div with non-breaking characters in front of it.
+	_default: support.htmlSerialize ? [ 0, "", "" ] : [ 1, "X<div>", "</div>" ]
+};
+
+// Support: IE8-IE9
+wrapMap.optgroup = wrapMap.option;
+
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+
+function getAll( context, tag ) {
+	var elems, elem,
+		i = 0,
+		found = typeof context.getElementsByTagName !== "undefined" ?
+			context.getElementsByTagName( tag || "*" ) :
+			typeof context.querySelectorAll !== "undefined" ?
+				context.querySelectorAll( tag || "*" ) :
 				undefined;
-		},
-		set: function( elem, value, name ) {
-			// Set the existing or create a new attribute node
-			var ret = elem.getAttributeNode( name );
-			if ( !ret ) {
-				ret = document.createAttribute( name );
-				elem.setAttributeNode( ret );
+
+	if ( !found ) {
+		for ( found = [], elems = context.childNodes || context;
+			( elem = elems[ i ] ) != null;
+			i++
+		) {
+			if ( !tag || jQuery.nodeName( elem, tag ) ) {
+				found.push( elem );
+			} else {
+				jQuery.merge( found, getAll( elem, tag ) );
 			}
-			return ( ret.nodeValue = value + "" );
 		}
-	};
+	}
 
-	// Apply the nodeHook to tabindex
-	jQuery.attrHooks.tabindex.set = nodeHook.set;
+	return tag === undefined || tag && jQuery.nodeName( context, tag ) ?
+		jQuery.merge( [ context ], found ) :
+		found;
+}
 
-	// Set width and height to auto instead of 0 on empty string( Bug #8150 )
-	// This is for removals
-	jQuery.each([ "width", "height" ], function( i, name ) {
-		jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
-			set: function( elem, value ) {
-				if ( value === "" ) {
-					elem.setAttribute( name, "auto" );
-					return value;
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+	var elem,
+		i = 0;
+	for ( ; ( elem = elems[ i ] ) != null; i++ ) {
+		jQuery._data(
+			elem,
+			"globalEval",
+			!refElements || jQuery._data( refElements[ i ], "globalEval" )
+		);
+	}
+}
+
+
+var rhtml = /<|&#?\w+;/,
+	rtbody = /<tbody/i;
+
+function fixDefaultChecked( elem ) {
+	if ( rcheckableType.test( elem.type ) ) {
+		elem.defaultChecked = elem.checked;
+	}
+}
+
+function buildFragment( elems, context, scripts, selection, ignored ) {
+	var j, elem, contains,
+		tmp, tag, tbody, wrap,
+		l = elems.length,
+
+		// Ensure a safe fragment
+		safe = createSafeFragment( context ),
+
+		nodes = [],
+		i = 0;
+
+	for ( ; i < l; i++ ) {
+		elem = elems[ i ];
+
+		if ( elem || elem === 0 ) {
+
+			// Add nodes directly
+			if ( jQuery.type( elem ) === "object" ) {
+				jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+			// Convert non-html into a text node
+			} else if ( !rhtml.test( elem ) ) {
+				nodes.push( context.createTextNode( elem ) );
+
+			// Convert html into DOM nodes
+			} else {
+				tmp = tmp || safe.appendChild( context.createElement( "div" ) );
+
+				// Deserialize a standard representation
+				tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
+				wrap = wrapMap[ tag ] || wrapMap._default;
+
+				tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
+
+				// Descend through wrappers to the right content
+				j = wrap[ 0 ];
+				while ( j-- ) {
+					tmp = tmp.lastChild;
 				}
-			}
-		});
-	});
 
-	// Set contenteditable to false on removals(#10429)
-	// Setting to empty string throws an error as an invalid value
-	jQuery.attrHooks.contenteditable = {
-		get: nodeHook.get,
-		set: function( elem, value, name ) {
-			if ( value === "" ) {
-				value = "false";
+				// Manually add leading whitespace removed by IE
+				if ( !support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+					nodes.push( context.createTextNode( rleadingWhitespace.exec( elem )[ 0 ] ) );
+				}
+
+				// Remove IE's autoinserted <tbody> from table fragments
+				if ( !support.tbody ) {
+
+					// String was a <table>, *may* have spurious <tbody>
+					elem = tag === "table" && !rtbody.test( elem ) ?
+						tmp.firstChild :
+
+						// String was a bare <thead> or <tfoot>
+						wrap[ 1 ] === "<table>" && !rtbody.test( elem ) ?
+							tmp :
+							0;
+
+					j = elem && elem.childNodes.length;
+					while ( j-- ) {
+						if ( jQuery.nodeName( ( tbody = elem.childNodes[ j ] ), "tbody" ) &&
+							!tbody.childNodes.length ) {
+
+							elem.removeChild( tbody );
+						}
+					}
+				}
+
+				jQuery.merge( nodes, tmp.childNodes );
+
+				// Fix #12392 for WebKit and IE > 9
+				tmp.textContent = "";
+
+				// Fix #12392 for oldIE
+				while ( tmp.firstChild ) {
+					tmp.removeChild( tmp.firstChild );
+				}
+
+				// Remember the top-level container for proper cleanup
+				tmp = safe.lastChild;
 			}
-			nodeHook.set( elem, value, name );
 		}
-	};
-}
+	}
 
+	// Fix #11356: Clear elements from fragment
+	if ( tmp ) {
+		safe.removeChild( tmp );
+	}
 
-// Some attributes require a special call on IE
-if ( !jQuery.support.hrefNormalized ) {
-	jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
-		jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
-			get: function( elem ) {
-				var ret = elem.getAttribute( name, 2 );
-				return ret === null ? undefined : ret;
+	// Reset defaultChecked for any radios and checkboxes
+	// about to be appended to the DOM in IE 6/7 (#8060)
+	if ( !support.appendChecked ) {
+		jQuery.grep( getAll( nodes, "input" ), fixDefaultChecked );
+	}
+
+	i = 0;
+	while ( ( elem = nodes[ i++ ] ) ) {
+
+		// Skip elements already in the context collection (trac-4087)
+		if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
+			if ( ignored ) {
+				ignored.push( elem );
 			}
-		});
-	});
-}
 
-if ( !jQuery.support.style ) {
-	jQuery.attrHooks.style = {
-		get: function( elem ) {
-			// Return undefined in the case of empty string
-			// Normalize to lowercase since IE uppercases css property names
-			return elem.style.cssText.toLowerCase() || undefined;
-		},
-		set: function( elem, value ) {
-			return ( elem.style.cssText = "" + value );
+			continue;
 		}
-	};
-}
 
-// Safari mis-reports the default selected property of an option
-// Accessing the parent's selectedIndex property fixes it
-if ( !jQuery.support.optSelected ) {
-	jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
-		get: function( elem ) {
-			var parent = elem.parentNode;
+		contains = jQuery.contains( elem.ownerDocument, elem );
 
-			if ( parent ) {
-				parent.selectedIndex;
+		// Append to fragment
+		tmp = getAll( safe.appendChild( elem ), "script" );
 
-				// Make sure that it also works with optgroups, see #5701
-				if ( parent.parentNode ) {
-					parent.parentNode.selectedIndex;
+		// Preserve script evaluation history
+		if ( contains ) {
+			setGlobalEval( tmp );
+		}
+
+		// Capture executables
+		if ( scripts ) {
+			j = 0;
+			while ( ( elem = tmp[ j++ ] ) ) {
+				if ( rscriptType.test( elem.type || "" ) ) {
+					scripts.push( elem );
 				}
 			}
-			return null;
 		}
-	});
+	}
+
+	tmp = null;
+
+	return safe;
 }
 
-// IE6/7 call enctype encoding
-if ( !jQuery.support.enctype ) {
-	jQuery.propFix.enctype = "encoding";
+
+( function() {
+	var i, eventName,
+		div = document.createElement( "div" );
+
+	// Support: IE<9 (lack submit/change bubble), Firefox (lack focus(in | out) events)
+	for ( i in { submit: true, change: true, focusin: true } ) {
+		eventName = "on" + i;
+
+		if ( !( support[ i ] = eventName in window ) ) {
+
+			// Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP)
+			div.setAttribute( eventName, "t" );
+			support[ i ] = div.attributes[ eventName ].expando === false;
+		}
+	}
+
+	// Null elements to avoid leaks in IE.
+	div = null;
+} )();
+
+
+var rformElems = /^(?:input|select|textarea)$/i,
+	rkeyEvent = /^key/,
+	rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,
+	rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+	rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
+
+function returnTrue() {
+	return true;
 }
 
-// Radios and checkboxes getter/setter
-if ( !jQuery.support.checkOn ) {
-	jQuery.each([ "radio", "checkbox" ], function() {
-		jQuery.valHooks[ this ] = {
-			get: function( elem ) {
-				// Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
-				return elem.getAttribute("value") === null ? "on" : elem.value;
-			}
-		};
-	});
+function returnFalse() {
+	return false;
 }
-jQuery.each([ "radio", "checkbox" ], function() {
-	jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
-		set: function( elem, value ) {
-			if ( jQuery.isArray( value ) ) {
-				return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
-			}
+
+// Support: IE9
+// See #13393 for more info
+function safeActiveElement() {
+	try {
+		return document.activeElement;
+	} catch ( err ) { }
+}
+
+function on( elem, types, selector, data, fn, one ) {
+	var origFn, type;
+
+	// Types can be a map of types/handlers
+	if ( typeof types === "object" ) {
+
+		// ( types-Object, selector, data )
+		if ( typeof selector !== "string" ) {
+
+			// ( types-Object, data )
+			data = data || selector;
+			selector = undefined;
 		}
-	});
-});
+		for ( type in types ) {
+			on( elem, type, selector, data, types[ type ], one );
+		}
+		return elem;
+	}
+
+	if ( data == null && fn == null ) {
+
+		// ( types, fn )
+		fn = selector;
+		data = selector = undefined;
+	} else if ( fn == null ) {
+		if ( typeof selector === "string" ) {
+
+			// ( types, selector, fn )
+			fn = data;
+			data = undefined;
+		} else {
 
+			// ( types, data, fn )
+			fn = data;
+			data = selector;
+			selector = undefined;
+		}
+	}
+	if ( fn === false ) {
+		fn = returnFalse;
+	} else if ( !fn ) {
+		return elem;
+	}
 
+	if ( one === 1 ) {
+		origFn = fn;
+		fn = function( event ) {
 
+			// Can use an empty set, since event contains the info
+			jQuery().off( event );
+			return origFn.apply( this, arguments );
+		};
 
-var rformElems = /^(?:textarea|input|select)$/i,
-	rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/,
-	rhoverHack = /(?:^|\s)hover(\.\S+)?\b/,
-	rkeyEvent = /^key/,
-	rmouseEvent = /^(?:mouse|contextmenu)|click/,
-	rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
-	rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,
-	quickParse = function( selector ) {
-		var quick = rquickIs.exec( selector );
-		if ( quick ) {
-			//   0  1    2   3
-			// [ _, tag, id, class ]
-			quick[1] = ( quick[1] || "" ).toLowerCase();
-			quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" );
-		}
-		return quick;
-	},
-	quickIs = function( elem, m ) {
-		var attrs = elem.attributes || {};
-		return (
-			(!m[1] || elem.nodeName.toLowerCase() === m[1]) &&
-			(!m[2] || (attrs.id || {}).value === m[2]) &&
-			(!m[3] || m[3].test( (attrs[ "class" ] || {}).value ))
-		);
-	},
-	hoverHack = function( events ) {
-		return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" );
-	};
+		// Use same guid so caller can remove using origFn
+		fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+	}
+	return elem.each( function() {
+		jQuery.event.add( this, types, fn, data, selector );
+	} );
+}
 
 /*
  * Helper functions for managing events -- not part of the public interface.
@@ -2904,14 +4839,16 @@ var rformElems = /^(?:textarea|input|select)$/i,
  */
 jQuery.event = {
 
-	add: function( elem, types, handler, data, selector ) {
+	global: {},
 
-		var elemData, eventHandle, events,
-			t, tns, type, namespaces, handleObj,
-			handleObjIn, quick, handlers, special;
+	add: function( elem, types, handler, data, selector ) {
+		var tmp, events, t, handleObjIn,
+			special, eventHandle, handleObj,
+			handlers, type, namespaces, origType,
+			elemData = jQuery._data( elem );
 
-		// Don't attach events to noData or text/comment nodes (allow plain objects tho)
-		if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) {
+		// Don't attach events to noData or text/comment nodes (but allow plain objects)
+		if ( !elemData ) {
 			return;
 		}
 
@@ -2928,31 +4865,37 @@ jQuery.event = {
 		}
 
 		// Init the element's event structure and main handler, if this is the first
-		events = elemData.events;
-		if ( !events ) {
-			elemData.events = events = {};
+		if ( !( events = elemData.events ) ) {
+			events = elemData.events = {};
 		}
-		eventHandle = elemData.handle;
-		if ( !eventHandle ) {
-			elemData.handle = eventHandle = function( e ) {
+		if ( !( eventHandle = elemData.handle ) ) {
+			eventHandle = elemData.handle = function( e ) {
+
 				// Discard the second event of a jQuery.event.trigger() and
 				// when an event is called after a page has unloaded
-				return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
+				return typeof jQuery !== "undefined" &&
+					( !e || jQuery.event.triggered !== e.type ) ?
 					jQuery.event.dispatch.apply( eventHandle.elem, arguments ) :
 					undefined;
 			};
-			// Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
+
+			// Add elem as a property of the handle fn to prevent a memory leak
+			// with IE non-native events
 			eventHandle.elem = elem;
 		}
 
 		// Handle multiple events separated by a space
-		// jQuery(...).bind("mouseover mouseout", fn);
-		types = jQuery.trim( hoverHack(types) ).split( " " );
-		for ( t = 0; t < types.length; t++ ) {
-
-			tns = rtypenamespace.exec( types[t] ) || [];
-			type = tns[1];
-			namespaces = ( tns[2] || "" ).split( "." ).sort();
+		types = ( types || "" ).match( rnotwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// There *must* be a type, no attaching namespace-only handlers
+			if ( !type ) {
+				continue;
+			}
 
 			// If event changes its type, use the special event handlers for the changed type
 			special = jQuery.event.special[ type ] || {};
@@ -2964,25 +4907,26 @@ jQuery.event = {
 			special = jQuery.event.special[ type ] || {};
 
 			// handleObj is passed to all event handlers
-			handleObj = jQuery.extend({
+			handleObj = jQuery.extend( {
 				type: type,
-				origType: tns[1],
+				origType: origType,
 				data: data,
 				handler: handler,
 				guid: handler.guid,
 				selector: selector,
-				quick: selector && quickParse( selector ),
-				namespace: namespaces.join(".")
+				needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+				namespace: namespaces.join( "." )
 			}, handleObjIn );
 
 			// Init the event handler queue if we're the first
-			handlers = events[ type ];
-			if ( !handlers ) {
+			if ( !( handlers = events[ type ] ) ) {
 				handlers = events[ type ] = [];
 				handlers.delegateCount = 0;
 
 				// Only use addEventListener/attachEvent if the special events handler returns false
-				if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+				if ( !special.setup ||
+					special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+
 					// Bind the global event handler to the element
 					if ( elem.addEventListener ) {
 						elem.addEventListener( type, eventHandle, false );
@@ -3016,25 +4960,25 @@ jQuery.event = {
 		elem = null;
 	},
 
-	global: {},
-
 	// Detach an event or set of events from an element
 	remove: function( elem, types, handler, selector, mappedTypes ) {
+		var j, handleObj, tmp,
+			origCount, t, events,
+			special, handlers, type,
+			namespaces, origType,
+			elemData = jQuery.hasData( elem ) && jQuery._data( elem );
 
-		var elemData = jQuery.hasData( elem ) && jQuery._data( elem ),
-			t, tns, type, origType, namespaces, origCount,
-			j, events, special, handle, eventType, handleObj;
-
-		if ( !elemData || !(events = elemData.events) ) {
+		if ( !elemData || !( events = elemData.events ) ) {
 			return;
 		}
 
 		// Once for each type.namespace in types; type may be omitted
-		types = jQuery.trim( hoverHack( types || "" ) ).split(" ");
-		for ( t = 0; t < types.length; t++ ) {
-			tns = rtypenamespace.exec( types[t] ) || [];
-			type = origType = tns[1];
-			namespaces = tns[2];
+		types = ( types || "" ).match( rnotwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
 
 			// Unbind all events (on this namespace, if provided) for the element
 			if ( !type ) {
@@ -3045,23 +4989,25 @@ jQuery.event = {
 			}
 
 			special = jQuery.event.special[ type ] || {};
-			type = ( selector? special.delegateType : special.bindType ) || type;
-			eventType = events[ type ] || [];
-			origCount = eventType.length;
-			namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null;
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+			handlers = events[ type ] || [];
+			tmp = tmp[ 2 ] &&
+				new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
 
 			// Remove matching events
-			for ( j = 0; j < eventType.length; j++ ) {
-				handleObj = eventType[ j ];
+			origCount = j = handlers.length;
+			while ( j-- ) {
+				handleObj = handlers[ j ];
 
 				if ( ( mappedTypes || origType === handleObj.origType ) &&
-					 ( !handler || handler.guid === handleObj.guid ) &&
-					 ( !namespaces || namespaces.test( handleObj.namespace ) ) &&
-					 ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
-					eventType.splice( j--, 1 );
+					( !handler || handler.guid === handleObj.guid ) &&
+					( !tmp || tmp.test( handleObj.namespace ) ) &&
+					( !selector || selector === handleObj.selector ||
+						selector === "**" && handleObj.selector ) ) {
+					handlers.splice( j, 1 );
 
 					if ( handleObj.selector ) {
-						eventType.delegateCount--;
+						handlers.delegateCount--;
 					}
 					if ( special.remove ) {
 						special.remove.call( elem, handleObj );
@@ -3071,8 +5017,10 @@ jQuery.event = {
 
 			// Remove generic event handler if we removed something and no more handlers exist
 			// (avoids potential for endless recursion during removal of special event handlers)
-			if ( eventType.length === 0 && origCount !== eventType.length ) {
-				if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+			if ( origCount && !handlers.length ) {
+				if ( !special.teardown ||
+					special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+
 					jQuery.removeEvent( elem, type, elemData.handle );
 				}
 
@@ -3082,87 +5030,53 @@ jQuery.event = {
 
 		// Remove the expando if it's no longer used
 		if ( jQuery.isEmptyObject( events ) ) {
-			handle = elemData.handle;
-			if ( handle ) {
-				handle.elem = null;
-			}
+			delete elemData.handle;
 
 			// removeData also checks for emptiness and clears the expando if empty
 			// so use it instead of delete
-			jQuery.removeData( elem, [ "events", "handle" ], true );
+			jQuery._removeData( elem, "events" );
 		}
 	},
 
-	// Events that are safe to short-circuit if no handlers are attached.
-	// Native DOM events should not be added, they may have inline handlers.
-	customEvent: {
-		"getData": true,
-		"setData": true,
-		"changeData": true
-	},
-
 	trigger: function( event, data, elem, onlyHandlers ) {
+		var handle, ontype, cur,
+			bubbleType, special, tmp, i,
+			eventPath = [ elem || document ],
+			type = hasOwn.call( event, "type" ) ? event.type : event,
+			namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
+
+		cur = tmp = elem = elem || document;
+
 		// Don't do events on text and comment nodes
-		if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) {
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
 			return;
 		}
 
-		// Event object or event type
-		var type = event.type || event,
-			namespaces = [],
-			cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType;
-
 		// focus/blur morphs to focusin/out; ensure we're not firing them right now
 		if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
 			return;
 		}
 
-		if ( type.indexOf( "!" ) >= 0 ) {
-			// Exclusive events trigger only for the exact event (no namespaces)
-			type = type.slice(0, -1);
-			exclusive = true;
-		}
+		if ( type.indexOf( "." ) > -1 ) {
 
-		if ( type.indexOf( "." ) >= 0 ) {
 			// Namespaced trigger; create a regexp to match event type in handle()
-			namespaces = type.split(".");
+			namespaces = type.split( "." );
 			type = namespaces.shift();
 			namespaces.sort();
 		}
+		ontype = type.indexOf( ":" ) < 0 && "on" + type;
 
-		if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) {
-			// No jQuery handlers for this event type, and it can't have inline handlers
-			return;
-		}
-
-		// Caller can pass in an Event, Object, or just an event type string
-		event = typeof event === "object" ?
-			// jQuery.Event object
-			event[ jQuery.expando ] ? event :
-			// Object literal
-			new jQuery.Event( type, event ) :
-			// Just the event type (string)
-			new jQuery.Event( type );
+		// Caller can pass in a jQuery.Event object, Object, or just an event type string
+		event = event[ jQuery.expando ] ?
+			event :
+			new jQuery.Event( type, typeof event === "object" && event );
 
-		event.type = type;
-		event.isTrigger = true;
-		event.exclusive = exclusive;
+		// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+		event.isTrigger = onlyHandlers ? 2 : 3;
 		event.namespace = namespaces.join( "." );
-		event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null;
-		ontype = type.indexOf( ":" ) < 0 ? "on" + type : "";
-
-		// Handle a global trigger
-		if ( !elem ) {
-
-			// TODO: Stop taunting the data cache; remove global events and always attach to document
-			cache = jQuery.cache;
-			for ( i in cache ) {
-				if ( cache[ i ].events && cache[ i ].events[ type ] ) {
-					jQuery.event.trigger( event, data, cache[ i ].handle.elem, true );
-				}
-			}
-			return;
-		}
+		event.rnamespace = event.namespace ?
+			new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) :
+			null;
 
 		// Clean up the event in case it is being reused
 		event.result = undefined;
@@ -3171,48 +5085,58 @@ jQuery.event = {
 		}
 
 		// Clone any incoming data and prepend the event, creating the handler arg list
-		data = data != null ? jQuery.makeArray( data ) : [];
-		data.unshift( event );
+		data = data == null ?
+			[ event ] :
+			jQuery.makeArray( data, [ event ] );
 
 		// Allow special events to draw outside the lines
 		special = jQuery.event.special[ type ] || {};
-		if ( special.trigger && special.trigger.apply( elem, data ) === false ) {
+		if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
 			return;
 		}
 
 		// Determine event propagation path in advance, per W3C events spec (#9951)
 		// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
-		eventPath = [[ elem, special.bindType || type ]];
 		if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
 
 			bubbleType = special.delegateType || type;
-			cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode;
-			old = null;
+			if ( !rfocusMorph.test( bubbleType + type ) ) {
+				cur = cur.parentNode;
+			}
 			for ( ; cur; cur = cur.parentNode ) {
-				eventPath.push([ cur, bubbleType ]);
-				old = cur;
+				eventPath.push( cur );
+				tmp = cur;
 			}
 
 			// Only add window if we got to document (e.g., not plain obj or detached DOM)
-			if ( old && old === elem.ownerDocument ) {
-				eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]);
+			if ( tmp === ( elem.ownerDocument || document ) ) {
+				eventPath.push( tmp.defaultView || tmp.parentWindow || window );
 			}
 		}
 
 		// Fire handlers on the event path
-		for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) {
+		i = 0;
+		while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
+
+			event.type = i > 1 ?
+				bubbleType :
+				special.bindType || type;
 
-			cur = eventPath[i][0];
-			event.type = eventPath[i][1];
+			// jQuery handler
+			handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] &&
+				jQuery._data( cur, "handle" );
 
-			handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" );
 			if ( handle ) {
 				handle.apply( cur, data );
 			}
-			// Note that this is a bare JS function and not a jQuery handler
+
+			// Native handler
 			handle = ontype && cur[ ontype ];
-			if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) {
-				event.preventDefault();
+			if ( handle && handle.apply && acceptData( cur ) ) {
+				event.result = handle.apply( cur, data );
+				if ( event.result === false ) {
+					event.preventDefault();
+				}
 			}
 		}
 		event.type = type;
@@ -3220,29 +5144,37 @@ jQuery.event = {
 		// If nobody prevented the default action, do it now
 		if ( !onlyHandlers && !event.isDefaultPrevented() ) {
 
-			if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) &&
-				!(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
+			if (
+				( !special._default ||
+				 special._default.apply( eventPath.pop(), data ) === false
+				) && acceptData( elem )
+			) {
 
 				// Call a native DOM method on the target with the same name name as the event.
 				// Can't use an .isFunction() check here because IE6/7 fails that test.
 				// Don't do default actions on window, that's where global variables be (#6170)
-				// IE<9 dies on focus/blur to hidden element (#1486)
-				if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) {
+				if ( ontype && elem[ type ] && !jQuery.isWindow( elem ) ) {
 
 					// Don't re-trigger an onFOO event when we call its FOO() method
-					old = elem[ ontype ];
+					tmp = elem[ ontype ];
 
-					if ( old ) {
+					if ( tmp ) {
 						elem[ ontype ] = null;
 					}
 
 					// Prevent re-triggering of the same event, since we already bubbled it above
 					jQuery.event.triggered = type;
-					elem[ type ]();
+					try {
+						elem[ type ]();
+					} catch ( e ) {
+
+						// IE<9 dies on focus/blur to hidden element (#1486,#12518)
+						// only reproducible on winXP IE8 native, not IE9 in IE8 mode
+					}
 					jQuery.event.triggered = undefined;
 
-					if ( old ) {
-						elem[ ontype ] = old;
+					if ( tmp ) {
+						elem[ ontype ] = tmp;
 					}
 				}
 			}
@@ -3254,18 +5186,16 @@ jQuery.event = {
 	dispatch: function( event ) {
 
 		// Make a writable jQuery.Event from the native event object
-		event = jQuery.event.fix( event || window.event );
+		event = jQuery.event.fix( event );
 
-		var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []),
-			delegateCount = handlers.delegateCount,
-			args = [].slice.call( arguments, 0 ),
-			run_all = !event.exclusive && !event.namespace,
-			special = jQuery.event.special[ event.type ] || {},
+		var i, j, ret, matched, handleObj,
 			handlerQueue = [],
-			i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related;
+			args = slice.call( arguments ),
+			handlers = ( jQuery._data( this, "events" ) || {} )[ event.type ] || [],
+			special = jQuery.event.special[ event.type ] || {};
 
 		// Use the fix-ed jQuery.Event rather than the (read-only) native event
-		args[0] = event;
+		args[ 0 ] = event;
 		event.delegateTarget = this;
 
 		// Call the preDispatch hook for the mapped type, and let it bail if desired
@@ -3273,91 +5203,153 @@ jQuery.event = {
 			return;
 		}
 
-		// Determine handlers that should run if there are delegated events
-		// Avoid non-left-click bubbling in Firefox (#3861)
-		if ( delegateCount && !(event.button && event.type === "click") ) {
+		// Determine handlers
+		handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+		// Run delegates first; they may want to stop propagation beneath us
+		i = 0;
+		while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
+			event.currentTarget = matched.elem;
+
+			j = 0;
+			while ( ( handleObj = matched.handlers[ j++ ] ) &&
+				!event.isImmediatePropagationStopped() ) {
+
+				// Triggered event must either 1) have no namespace, or 2) have namespace(s)
+				// a subset or equal to those in the bound event (both can have no namespace).
+				if ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) {
+
+					event.handleObj = handleObj;
+					event.data = handleObj.data;
+
+					ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
+						handleObj.handler ).apply( matched.elem, args );
+
+					if ( ret !== undefined ) {
+						if ( ( event.result = ret ) === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+				}
+			}
+		}
 
-			// Pregenerate a single jQuery object for reuse with .is()
-			jqcur = jQuery(this);
-			jqcur.context = this.ownerDocument || this;
+		// Call the postDispatch hook for the mapped type
+		if ( special.postDispatch ) {
+			special.postDispatch.call( this, event );
+		}
 
-			for ( cur = event.target; cur != this; cur = cur.parentNode || this ) {
+		return event.result;
+	},
 
-				// Don't process events on disabled elements (#6911, #8165)
-				if ( cur.disabled !== true ) {
-					selMatch = {};
+	handlers: function( event, handlers ) {
+		var i, matches, sel, handleObj,
+			handlerQueue = [],
+			delegateCount = handlers.delegateCount,
+			cur = event.target;
+
+		// Support (at least): Chrome, IE9
+		// Find delegate handlers
+		// Black-hole SVG <use> instance trees (#13180)
+		//
+		// Support: Firefox<=42+
+		// Avoid non-left-click in FF but don't block IE radio events (#3861, gh-2343)
+		if ( delegateCount && cur.nodeType &&
+			( event.type !== "click" || isNaN( event.button ) || event.button < 1 ) ) {
+
+			/* jshint eqeqeq: false */
+			for ( ; cur != this; cur = cur.parentNode || this ) {
+				/* jshint eqeqeq: true */
+
+				// Don't check non-elements (#13208)
+				// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+				if ( cur.nodeType === 1 && ( cur.disabled !== true || event.type !== "click" ) ) {
 					matches = [];
-					jqcur[0] = cur;
 					for ( i = 0; i < delegateCount; i++ ) {
 						handleObj = handlers[ i ];
-						sel = handleObj.selector;
 
-						if ( selMatch[ sel ] === undefined ) {
-							selMatch[ sel ] = (
-								handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel )
-							);
+						// Don't conflict with Object.prototype properties (#13203)
+						sel = handleObj.selector + " ";
+
+						if ( matches[ sel ] === undefined ) {
+							matches[ sel ] = handleObj.needsContext ?
+								jQuery( sel, this ).index( cur ) > -1 :
+								jQuery.find( sel, this, null, [ cur ] ).length;
 						}
-						if ( selMatch[ sel ] ) {
+						if ( matches[ sel ] ) {
 							matches.push( handleObj );
 						}
 					}
 					if ( matches.length ) {
-						handlerQueue.push({ elem: cur, matches: matches });
+						handlerQueue.push( { elem: cur, handlers: matches } );
 					}
 				}
 			}
 		}
 
 		// Add the remaining (directly-bound) handlers
-		if ( handlers.length > delegateCount ) {
-			handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) });
+		if ( delegateCount < handlers.length ) {
+			handlerQueue.push( { elem: this, handlers: handlers.slice( delegateCount ) } );
 		}
 
-		// Run delegates first; they may want to stop propagation beneath us
-		for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) {
-			matched = handlerQueue[ i ];
-			event.currentTarget = matched.elem;
+		return handlerQueue;
+	},
+
+	fix: function( event ) {
+		if ( event[ jQuery.expando ] ) {
+			return event;
+		}
 
-			for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) {
-				handleObj = matched.matches[ j ];
+		// Create a writable copy of the event object and normalize some properties
+		var i, prop, copy,
+			type = event.type,
+			originalEvent = event,
+			fixHook = this.fixHooks[ type ];
 
-				// Triggered event must either 1) be non-exclusive and have no namespace, or
-				// 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
-				if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) {
+		if ( !fixHook ) {
+			this.fixHooks[ type ] = fixHook =
+				rmouseEvent.test( type ) ? this.mouseHooks :
+				rkeyEvent.test( type ) ? this.keyHooks :
+				{};
+		}
+		copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
 
-					event.data = handleObj.data;
-					event.handleObj = handleObj;
+		event = new jQuery.Event( originalEvent );
 
-					ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
-							.apply( matched.elem, args );
+		i = copy.length;
+		while ( i-- ) {
+			prop = copy[ i ];
+			event[ prop ] = originalEvent[ prop ];
+		}
 
-					if ( ret !== undefined ) {
-						event.result = ret;
-						if ( ret === false ) {
-							event.preventDefault();
-							event.stopPropagation();
-						}
-					}
-				}
-			}
+		// Support: IE<9
+		// Fix target property (#1925)
+		if ( !event.target ) {
+			event.target = originalEvent.srcElement || document;
 		}
 
-		// Call the postDispatch hook for the mapped type
-		if ( special.postDispatch ) {
-			special.postDispatch.call( this, event );
+		// Support: Safari 6-8+
+		// Target should not be a text node (#504, #13143)
+		if ( event.target.nodeType === 3 ) {
+			event.target = event.target.parentNode;
 		}
 
-		return event.result;
+		// Support: IE<9
+		// For mouse/key events, metaKey==false if it's undefined (#3368, #11328)
+		event.metaKey = !!event.metaKey;
+
+		return fixHook.filter ? fixHook.filter( event, originalEvent ) : event;
 	},
 
 	// Includes some event props shared by KeyEvent and MouseEvent
-	// *** attrChange attrName relatedNode srcElement  are not normalized, non-W3C, deprecated, will be removed in 1.8 ***
-	props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
+	props: ( "altKey bubbles cancelable ctrlKey currentTarget detail eventPhase " +
+		"metaKey relatedTarget shiftKey target timeStamp view which" ).split( " " ),
 
 	fixHooks: {},
 
 	keyHooks: {
-		props: "char charCode key keyCode".split(" "),
+		props: "char charCode key keyCode".split( " " ),
 		filter: function( event, original ) {
 
 			// Add which for key events
@@ -3370,9 +5362,10 @@ jQuery.event = {
 	},
 
 	mouseHooks: {
-		props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
+		props: ( "button buttons clientX clientY fromElement offsetX offsetY " +
+			"pageX pageY screenX screenY toElement" ).split( " " ),
 		filter: function( event, original ) {
-			var eventDoc, doc, body,
+			var body, eventDoc, doc,
 				button = original.button,
 				fromElement = original.fromElement;
 
@@ -3382,13 +5375,19 @@ jQuery.event = {
 				doc = eventDoc.documentElement;
 				body = eventDoc.body;
 
-				event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
-				event.pageY = original.clientY + ( doc && doc.scrollTop  || body && body.scrollTop  || 0 ) - ( doc && doc.clientTop  || body && body.clientTop  || 0 );
+				event.pageX = original.clientX +
+					( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) -
+					( doc && doc.clientLeft || body && body.clientLeft || 0 );
+				event.pageY = original.clientY +
+					( doc && doc.scrollTop  || body && body.scrollTop  || 0 ) -
+					( doc && doc.clientTop  || body && body.clientTop  || 0 );
 			}
 
 			// Add relatedTarget, if necessary
 			if ( !event.relatedTarget && fromElement ) {
-				event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
+				event.relatedTarget = fromElement === event.target ?
+					original.toElement :
+					fromElement;
 			}
 
 			// Add which for click: 1 === left; 2 === middle; 3 === right
@@ -3401,118 +5400,123 @@ jQuery.event = {
 		}
 	},
 
-	fix: function( event ) {
-		if ( event[ jQuery.expando ] ) {
-			return event;
-		}
-
-		// Create a writable copy of the event object and normalize some properties
-		var i, prop,
-			originalEvent = event,
-			fixHook = jQuery.event.fixHooks[ event.type ] || {},
-			copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
-
-		event = jQuery.Event( originalEvent );
-
-		for ( i = copy.length; i; ) {
-			prop = copy[ --i ];
-			event[ prop ] = originalEvent[ prop ];
-		}
-
-		// Fix target property, if necessary (#1925, IE 6/7/8 & Safari2)
-		if ( !event.target ) {
-			event.target = originalEvent.srcElement || document;
-		}
-
-		// Target should not be a text node (#504, Safari)
-		if ( event.target.nodeType === 3 ) {
-			event.target = event.target.parentNode;
-		}
-
-		// For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8)
-		if ( event.metaKey === undefined ) {
-			event.metaKey = event.ctrlKey;
-		}
-
-		return fixHook.filter? fixHook.filter( event, originalEvent ) : event;
-	},
-
 	special: {
-		ready: {
-			// Make sure the ready event is setup
-			setup: jQuery.bindReady
-		},
-
 		load: {
+
 			// Prevent triggered image.load events from bubbling to window.load
 			noBubble: true
 		},
-
 		focus: {
+
+			// Fire native event if possible so blur/focus sequence is correct
+			trigger: function() {
+				if ( this !== safeActiveElement() && this.focus ) {
+					try {
+						this.focus();
+						return false;
+					} catch ( e ) {
+
+						// Support: IE<9
+						// If we error on focus to hidden element (#1486, #12518),
+						// let .trigger() run the handlers
+					}
+				}
+			},
 			delegateType: "focusin"
 		},
 		blur: {
+			trigger: function() {
+				if ( this === safeActiveElement() && this.blur ) {
+					this.blur();
+					return false;
+				}
+			},
 			delegateType: "focusout"
 		},
+		click: {
 
-		beforeunload: {
-			setup: function( data, namespaces, eventHandle ) {
-				// We only want to do this special case on windows
-				if ( jQuery.isWindow( this ) ) {
-					this.onbeforeunload = eventHandle;
+			// For checkbox, fire native event so checked state will be right
+			trigger: function() {
+				if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) {
+					this.click();
+					return false;
 				}
 			},
 
-			teardown: function( namespaces, eventHandle ) {
-				if ( this.onbeforeunload === eventHandle ) {
-					this.onbeforeunload = null;
+			// For cross-browser consistency, don't fire native .click() on links
+			_default: function( event ) {
+				return jQuery.nodeName( event.target, "a" );
+			}
+		},
+
+		beforeunload: {
+			postDispatch: function( event ) {
+
+				// Support: Firefox 20+
+				// Firefox doesn't alert if the returnValue field is not set.
+				if ( event.result !== undefined && event.originalEvent ) {
+					event.originalEvent.returnValue = event.result;
 				}
 			}
 		}
 	},
 
-	simulate: function( type, elem, event, bubble ) {
-		// Piggyback on a donor event to simulate a different one.
-		// Fake originalEvent to avoid donor's stopPropagation, but if the
-		// simulated event prevents default then we do the same on the donor.
+	// Piggyback on a donor event to simulate a different one
+	simulate: function( type, elem, event ) {
 		var e = jQuery.extend(
 			new jQuery.Event(),
 			event,
-			{ type: type,
-				isSimulated: true,
-				originalEvent: {}
+			{
+				type: type,
+				isSimulated: true
+
+				// Previously, `originalEvent: {}` was set here, so stopPropagation call
+				// would not be triggered on donor event, since in our own
+				// jQuery.event.stopPropagation function we had a check for existence of
+				// originalEvent.stopPropagation method, so, consequently it would be a noop.
+				//
+				// Guard for simulated events was moved to jQuery.event.stopPropagation function
+				// since `originalEvent` should point to the original event for the
+				// constancy with other events and for more focused logic
 			}
 		);
-		if ( bubble ) {
-			jQuery.event.trigger( e, null, elem );
-		} else {
-			jQuery.event.dispatch.call( elem, e );
-		}
+
+		jQuery.event.trigger( e, null, elem );
+
 		if ( e.isDefaultPrevented() ) {
 			event.preventDefault();
 		}
 	}
 };
 
-// Some plugins are using, but it's undocumented/deprecated and will be removed.
-// The 1.7 special event interface should provide all the hooks needed now.
-jQuery.event.handle = jQuery.event.dispatch;
-
 jQuery.removeEvent = document.removeEventListener ?
 	function( elem, type, handle ) {
+
+		// This "if" is needed for plain objects
 		if ( elem.removeEventListener ) {
-			elem.removeEventListener( type, handle, false );
+			elem.removeEventListener( type, handle );
 		}
 	} :
 	function( elem, type, handle ) {
+		var name = "on" + type;
+
 		if ( elem.detachEvent ) {
-			elem.detachEvent( "on" + type, handle );
+
+			// #8545, #7054, preventing memory leaks for custom events in IE6-8
+			// detachEvent needed property on element, by name of that event,
+			// to properly expose it to GC
+			if ( typeof elem[ name ] === "undefined" ) {
+				elem[ name ] = null;
+			}
+
+			elem.detachEvent( name, handle );
 		}
 	};
 
 jQuery.Event = function( src, props ) {
+
 	// Allow instantiation without the 'new' keyword
-	if ( !(this instanceof jQuery.Event) ) {
+	if ( !( this instanceof jQuery.Event ) ) {
 		return new jQuery.Event( src, props );
 	}
 
@@ -3523,8 +5527,13 @@ jQuery.Event = function( src, props ) {
 
 		// Events bubbling up the document may have been marked as prevented
 		// by a handler lower down the tree; reflect the correct value.
-		this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false ||
-			src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse;
+		this.isDefaultPrevented = src.defaultPrevented ||
+				src.defaultPrevented === undefined &&
+
+				// Support: IE < 9, Android < 4.0
+				src.returnValue === false ?
+			returnTrue :
+			returnFalse;
 
 	// Event type
 	} else {
@@ -3543,75 +5552,90 @@ jQuery.Event = function( src, props ) {
 	this[ jQuery.expando ] = true;
 };
 
-function returnFalse() {
-	return false;
-}
-function returnTrue() {
-	return true;
-}
-
 // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
 // http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
 jQuery.Event.prototype = {
-	preventDefault: function() {
-		this.isDefaultPrevented = returnTrue;
+	constructor: jQuery.Event,
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse,
 
+	preventDefault: function() {
 		var e = this.originalEvent;
+
+		this.isDefaultPrevented = returnTrue;
 		if ( !e ) {
 			return;
 		}
 
-		// if preventDefault exists run it on the original event
+		// If preventDefault exists, run it on the original event
 		if ( e.preventDefault ) {
 			e.preventDefault();
 
-		// otherwise set the returnValue property of the original event to false (IE)
+		// Support: IE
+		// Otherwise set the returnValue property of the original event to false
 		} else {
 			e.returnValue = false;
 		}
 	},
 	stopPropagation: function() {
+		var e = this.originalEvent;
+
 		this.isPropagationStopped = returnTrue;
 
-		var e = this.originalEvent;
-		if ( !e ) {
+		if ( !e || this.isSimulated ) {
 			return;
 		}
-		// if stopPropagation exists run it on the original event
+
+		// If stopPropagation exists, run it on the original event
 		if ( e.stopPropagation ) {
 			e.stopPropagation();
 		}
-		// otherwise set the cancelBubble property of the original event to true (IE)
+
+		// Support: IE
+		// Set the cancelBubble property of the original event to true
 		e.cancelBubble = true;
 	},
 	stopImmediatePropagation: function() {
+		var e = this.originalEvent;
+
 		this.isImmediatePropagationStopped = returnTrue;
+
+		if ( e && e.stopImmediatePropagation ) {
+			e.stopImmediatePropagation();
+		}
+
 		this.stopPropagation();
-	},
-	isDefaultPrevented: returnFalse,
-	isPropagationStopped: returnFalse,
-	isImmediatePropagationStopped: returnFalse
+	}
 };
 
 // Create mouseenter/leave events using mouseover/out and event-time checks
-jQuery.each({
+// so that event delegation works in jQuery.
+// Do the same for pointerenter/pointerleave and pointerover/pointerout
+//
+// Support: Safari 7 only
+// Safari sends mouseenter too often; see:
+// https://code.google.com/p/chromium/issues/detail?id=470258
+// for the description of the bug (it existed in older Chrome versions as well).
+jQuery.each( {
 	mouseenter: "mouseover",
-	mouseleave: "mouseout"
+	mouseleave: "mouseout",
+	pointerenter: "pointerover",
+	pointerleave: "pointerout"
 }, function( orig, fix ) {
 	jQuery.event.special[ orig ] = {
 		delegateType: fix,
 		bindType: fix,
 
 		handle: function( event ) {
-			var target = this,
+			var ret,
+				target = this,
 				related = event.relatedTarget,
-				handleObj = event.handleObj,
-				selector = handleObj.selector,
-				ret;
+				handleObj = event.handleObj;
 
-			// For mousenter/leave call the handler if related is outside the target.
+			// For mouseenter/leave call the handler if related is outside the target.
 			// NB: No relatedTarget if the mouse left/entered the browser window
-			if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
+			if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
 				event.type = handleObj.origType;
 				ret = handleObj.handler.apply( this, arguments );
 				event.type = fix;
@@ -3619,13 +5643,14 @@ jQuery.each({
 			return ret;
 		}
 	};
-});
+} );
 
 // IE submit delegation
-if ( !jQuery.support.submitBubbles ) {
+if ( !support.submit ) {
 
 	jQuery.event.special.submit = {
 		setup: function() {
+
 			// Only need this for delegated form submit events
 			if ( jQuery.nodeName( this, "form" ) ) {
 				return false;
@@ -3633,30 +5658,42 @@ if ( !jQuery.support.submitBubbles ) {
 
 			// Lazy-add a submit handler when a descendant form may potentially be submitted
 			jQuery.event.add( this, "click._submit keypress._submit", function( e ) {
+
 				// Node name check avoids a VML-related crash in IE (#9807)
 				var elem = e.target,
-					form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined;
-				if ( form && !form._submit_attached ) {
+					form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ?
+
+						// Support: IE <=8
+						// We use jQuery.prop instead of elem.form
+						// to allow fixing the IE8 delegated submit issue (gh-2332)
+						// by 3rd party polyfills/workarounds.
+						jQuery.prop( elem, "form" ) :
+						undefined;
+
+				if ( form && !jQuery._data( form, "submit" ) ) {
 					jQuery.event.add( form, "submit._submit", function( event ) {
-						event._submit_bubble = true;
-					});
-					form._submit_attached = true;
+						event._submitBubble = true;
+					} );
+					jQuery._data( form, "submit", true );
 				}
-			});
+			} );
+
 			// return undefined since we don't need an event listener
 		},
-		
+
 		postDispatch: function( event ) {
+
 			// If form was submitted by the user, bubble the event up the tree
-			if ( event._submit_bubble ) {
-				delete event._submit_bubble;
+			if ( event._submitBubble ) {
+				delete event._submitBubble;
 				if ( this.parentNode && !event.isTrigger ) {
-					jQuery.event.simulate( "submit", this.parentNode, event, true );
+					jQuery.event.simulate( "submit", this.parentNode, event );
 				}
 			}
 		},
 
 		teardown: function() {
+
 			// Only need this for delegated form submit events
 			if ( jQuery.nodeName( this, "form" ) ) {
 				return false;
@@ -3669,51 +5706,57 @@ if ( !jQuery.support.submitBubbles ) {
 }
 
 // IE change delegation and checkbox/radio fix
-if ( !jQuery.support.changeBubbles ) {
+if ( !support.change ) {
 
 	jQuery.event.special.change = {
 
 		setup: function() {
 
 			if ( rformElems.test( this.nodeName ) ) {
+
 				// IE doesn't fire change on a check/radio until blur; trigger it on click
 				// after a propertychange. Eat the blur-change in special.change.handle.
 				// This still fires onchange a second time for check/radio after blur.
 				if ( this.type === "checkbox" || this.type === "radio" ) {
 					jQuery.event.add( this, "propertychange._change", function( event ) {
 						if ( event.originalEvent.propertyName === "checked" ) {
-							this._just_changed = true;
+							this._justChanged = true;
 						}
-					});
+					} );
 					jQuery.event.add( this, "click._change", function( event ) {
-						if ( this._just_changed && !event.isTrigger ) {
-							this._just_changed = false;
-							jQuery.event.simulate( "change", this, event, true );
+						if ( this._justChanged && !event.isTrigger ) {
+							this._justChanged = false;
 						}
-					});
+
+						// Allow triggered, simulated change events (#11500)
+						jQuery.event.simulate( "change", this, event );
+					} );
 				}
 				return false;
 			}
+
 			// Delegated event; lazy-add a change handler on descendant inputs
 			jQuery.event.add( this, "beforeactivate._change", function( e ) {
 				var elem = e.target;
 
-				if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) {
+				if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "change" ) ) {
 					jQuery.event.add( elem, "change._change", function( event ) {
 						if ( this.parentNode && !event.isSimulated && !event.isTrigger ) {
-							jQuery.event.simulate( "change", this.parentNode, event, true );
+							jQuery.event.simulate( "change", this.parentNode, event );
 						}
-					});
-					elem._change_attached = true;
+					} );
+					jQuery._data( elem, "change", true );
 				}
-			});
+			} );
 		},
 
 		handle: function( event ) {
 			var elem = event.target;
 
 			// Swallow native change events from checkbox/radio, we already triggered them above
-			if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) {
+			if ( this !== elem || event.isSimulated || event.isTrigger ||
+				( elem.type !== "radio" && elem.type !== "checkbox" ) ) {
+
 				return event.handleObj.handler.apply( this, arguments );
 			}
 		},
@@ -3721,3272 +5764,3328 @@ if ( !jQuery.support.changeBubbles ) {
 		teardown: function() {
 			jQuery.event.remove( this, "._change" );
 
-			return rformElems.test( this.nodeName );
+			return !rformElems.test( this.nodeName );
 		}
 	};
 }
 
-// Create "bubbling" focus and blur events
-if ( !jQuery.support.focusinBubbles ) {
-	jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
-
-		// Attach a single capturing handler while someone wants focusin/focusout
-		var attaches = 0,
-			handler = function( event ) {
-				jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
-			};
+// Support: Firefox
+// Firefox doesn't have focus(in | out) events
+// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
+//
+// Support: Chrome, Safari
+// focus(in | out) events fire after focus & blur events,
+// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
+// Related ticket - https://code.google.com/p/chromium/issues/detail?id=449857
+if ( !support.focusin ) {
+	jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+		// Attach a single capturing handler on the document while someone wants focusin/focusout
+		var handler = function( event ) {
+			jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) );
+		};
 
 		jQuery.event.special[ fix ] = {
 			setup: function() {
-				if ( attaches++ === 0 ) {
-					document.addEventListener( orig, handler, true );
+				var doc = this.ownerDocument || this,
+					attaches = jQuery._data( doc, fix );
+
+				if ( !attaches ) {
+					doc.addEventListener( orig, handler, true );
 				}
+				jQuery._data( doc, fix, ( attaches || 0 ) + 1 );
 			},
 			teardown: function() {
-				if ( --attaches === 0 ) {
-					document.removeEventListener( orig, handler, true );
+				var doc = this.ownerDocument || this,
+					attaches = jQuery._data( doc, fix ) - 1;
+
+				if ( !attaches ) {
+					doc.removeEventListener( orig, handler, true );
+					jQuery._removeData( doc, fix );
+				} else {
+					jQuery._data( doc, fix, attaches );
 				}
 			}
 		};
-	});
+	} );
 }
 
-jQuery.fn.extend({
-
-	on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
-		var origFn, type;
-
-		// Types can be a map of types/handlers
-		if ( typeof types === "object" ) {
-			// ( types-Object, selector, data )
-			if ( typeof selector !== "string" ) { // && selector != null
-				// ( types-Object, data )
-				data = data || selector;
-				selector = undefined;
-			}
-			for ( type in types ) {
-				this.on( type, selector, data, types[ type ], one );
-			}
-			return this;
-		}
-
-		if ( data == null && fn == null ) {
-			// ( types, fn )
-			fn = selector;
-			data = selector = undefined;
-		} else if ( fn == null ) {
-			if ( typeof selector === "string" ) {
-				// ( types, selector, fn )
-				fn = data;
-				data = undefined;
-			} else {
-				// ( types, data, fn )
-				fn = data;
-				data = selector;
-				selector = undefined;
-			}
-		}
-		if ( fn === false ) {
-			fn = returnFalse;
-		} else if ( !fn ) {
-			return this;
-		}
-
-		if ( one === 1 ) {
-			origFn = fn;
-			fn = function( event ) {
-				// Can use an empty set, since event contains the info
-				jQuery().off( event );
-				return origFn.apply( this, arguments );
-			};
-			// Use same guid so caller can remove using origFn
-			fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
-		}
-		return this.each( function() {
-			jQuery.event.add( this, types, fn, data, selector );
-		});
+jQuery.fn.extend( {
+	on: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn );
+	},
+	live: function( types, data, fn ) {
+		jQuery(this.context).on( types, this.selector, data, fn );
+		return this;
 	},
 	one: function( types, selector, data, fn ) {
-		return this.on( types, selector, data, fn, 1 );
+		return on( this, types, selector, data, fn, 1 );
 	},
 	off: function( types, selector, fn ) {
+		var handleObj, type;
 		if ( types && types.preventDefault && types.handleObj ) {
+
 			// ( event )  dispatched jQuery.Event
-			var handleObj = types.handleObj;
+			handleObj = types.handleObj;
 			jQuery( types.delegateTarget ).off(
-				handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
+				handleObj.namespace ?
+					handleObj.origType + "." + handleObj.namespace :
+					handleObj.origType,
 				handleObj.selector,
 				handleObj.handler
 			);
 			return this;
 		}
 		if ( typeof types === "object" ) {
-			// ( types-object [, selector] )
-			for ( var type in types ) {
-				this.off( type, selector, types[ type ] );
-			}
-			return this;
-		}
-		if ( selector === false || typeof selector === "function" ) {
-			// ( types [, fn] )
-			fn = selector;
-			selector = undefined;
-		}
-		if ( fn === false ) {
-			fn = returnFalse;
-		}
-		return this.each(function() {
-			jQuery.event.remove( this, types, fn, selector );
-		});
-	},
-
-	bind: function( types, data, fn ) {
-		return this.on( types, null, data, fn );
-	},
-	unbind: function( types, fn ) {
-		return this.off( types, null, fn );
-	},
 
-	live: function( types, data, fn ) {
-		jQuery( this.context ).on( types, this.selector, data, fn );
-		return this;
-	},
-	die: function( types, fn ) {
-		jQuery( this.context ).off( types, this.selector || "**", fn );
-		return this;
-	},
+			// ( types-object [, selector] )
+			for ( type in types ) {
+				this.off( type, selector, types[ type ] );
+			}
+			return this;
+		}
+		if ( selector === false || typeof selector === "function" ) {
 
-	delegate: function( selector, types, data, fn ) {
-		return this.on( types, selector, data, fn );
-	},
-	undelegate: function( selector, types, fn ) {
-		// ( namespace ) or ( selector, types [, fn] )
-		return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn );
+			// ( types [, fn] )
+			fn = selector;
+			selector = undefined;
+		}
+		if ( fn === false ) {
+			fn = returnFalse;
+		}
+		return this.each( function() {
+			jQuery.event.remove( this, types, fn, selector );
+		} );
 	},
 
 	trigger: function( type, data ) {
-		return this.each(function() {
+		return this.each( function() {
 			jQuery.event.trigger( type, data, this );
-		});
+		} );
 	},
 	triggerHandler: function( type, data ) {
-		if ( this[0] ) {
-			return jQuery.event.trigger( type, data, this[0], true );
+		var elem = this[ 0 ];
+		if ( elem ) {
+			return jQuery.event.trigger( type, data, elem, true );
 		}
-	},
+	}
+} );
 
-	toggle: function( fn ) {
-		// Save reference to arguments for access in closure
-		var args = arguments,
-			guid = fn.guid || jQuery.guid++,
-			i = 0,
-			toggler = function( event ) {
-				// Figure out which function to execute
-				var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
-				jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
 
-				// Make sure that clicks stop
-				event.preventDefault();
+var rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g,
+	rnoshimcache = new RegExp( "<(?:" + nodeNames + ")[\\s/>]", "i" ),
+	rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi,
 
-				// and execute the function
-				return args[ lastToggle ].apply( this, arguments ) || false;
-			};
+	// Support: IE 10-11, Edge 10240+
+	// In IE/Edge using regex groups here causes severe slowdowns.
+	// See https://connect.microsoft.com/IE/feedback/details/1736512/
+	rnoInnerhtml = /<script|<style|<link/i,
 
-		// link all the functions, so any of them can unbind this click handler
-		toggler.guid = guid;
-		while ( i < args.length ) {
-			args[ i++ ].guid = guid;
-		}
+	// checked="checked" or checked
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+	rscriptTypeMasked = /^true\/(.*)/,
+	rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,
+	safeFragment = createSafeFragment( document ),
+	fragmentDiv = safeFragment.appendChild( document.createElement( "div" ) );
+
+// Support: IE<8
+// Manipulating tables requires a tbody
+function manipulationTarget( elem, content ) {
+	return jQuery.nodeName( elem, "table" ) &&
+		jQuery.nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ?
+
+		elem.getElementsByTagName( "tbody" )[ 0 ] ||
+			elem.appendChild( elem.ownerDocument.createElement( "tbody" ) ) :
+		elem;
+}
 
-		return this.click( toggler );
-	},
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+	elem.type = ( jQuery.find.attr( elem, "type" ) !== null ) + "/" + elem.type;
+	return elem;
+}
+function restoreScript( elem ) {
+	var match = rscriptTypeMasked.exec( elem.type );
+	if ( match ) {
+		elem.type = match[ 1 ];
+	} else {
+		elem.removeAttribute( "type" );
+	}
+	return elem;
+}
 
-	hover: function( fnOver, fnOut ) {
-		return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+function cloneCopyEvent( src, dest ) {
+	if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+		return;
 	}
-});
 
-jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
-	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
-	"change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
+	var type, i, l,
+		oldData = jQuery._data( src ),
+		curData = jQuery._data( dest, oldData ),
+		events = oldData.events;
 
-	// Handle event binding
-	jQuery.fn[ name ] = function( data, fn ) {
-		if ( fn == null ) {
-			fn = data;
-			data = null;
-		}
+	if ( events ) {
+		delete curData.handle;
+		curData.events = {};
 
-		return arguments.length > 0 ?
-			this.on( name, null, data, fn ) :
-			this.trigger( name );
-	};
+		for ( type in events ) {
+			for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+				jQuery.event.add( dest, type, events[ type ][ i ] );
+			}
+		}
+	}
 
-	if ( jQuery.attrFn ) {
-		jQuery.attrFn[ name ] = true;
+	// make the cloned public data object a copy from the original
+	if ( curData.data ) {
+		curData.data = jQuery.extend( {}, curData.data );
 	}
+}
+
+function fixCloneNodeIssues( src, dest ) {
+	var nodeName, e, data;
 
-	if ( rkeyEvent.test( name ) ) {
-		jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks;
+	// We do not need to do anything for non-Elements
+	if ( dest.nodeType !== 1 ) {
+		return;
 	}
 
-	if ( rmouseEvent.test( name ) ) {
-		jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks;
+	nodeName = dest.nodeName.toLowerCase();
+
+	// IE6-8 copies events bound via attachEvent when using cloneNode.
+	if ( !support.noCloneEvent && dest[ jQuery.expando ] ) {
+		data = jQuery._data( dest );
+
+		for ( e in data.events ) {
+			jQuery.removeEvent( dest, e, data.handle );
+		}
+
+		// Event data gets referenced instead of copied if the expando gets copied too
+		dest.removeAttribute( jQuery.expando );
 	}
-});
 
+	// IE blanks contents when cloning scripts, and tries to evaluate newly-set text
+	if ( nodeName === "script" && dest.text !== src.text ) {
+		disableScript( dest ).text = src.text;
+		restoreScript( dest );
 
+	// IE6-10 improperly clones children of object elements using classid.
+	// IE10 throws NoModificationAllowedError if parent is null, #12132.
+	} else if ( nodeName === "object" ) {
+		if ( dest.parentNode ) {
+			dest.outerHTML = src.outerHTML;
+		}
 
-/*!
- * Sizzle CSS Selector Engine
- *  Copyright 2011, The Dojo Foundation
- *  Released under the MIT, BSD, and GPL Licenses.
- *  More information: http://sizzlejs.com/
- */
-(function(){
+		// This path appears unavoidable for IE9. When cloning an object
+		// element in IE9, the outerHTML strategy above is not sufficient.
+		// If the src has innerHTML and the destination does not,
+		// copy the src.innerHTML into the dest.innerHTML. #10324
+		if ( support.html5Clone && ( src.innerHTML && !jQuery.trim( dest.innerHTML ) ) ) {
+			dest.innerHTML = src.innerHTML;
+		}
 
-var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
-	expando = "sizcache" + (Math.random() + '').replace('.', ''),
-	done = 0,
-	toString = Object.prototype.toString,
-	hasDuplicate = false,
-	baseHasDuplicate = true,
-	rBackslash = /\\/g,
-	rReturn = /\r\n/g,
-	rNonWord = /\W/;
-
-// Here we check if the JavaScript engine is using some sort of
-// optimization where it does not always call our comparision
-// function. If that is the case, discard the hasDuplicate value.
-//   Thus far that includes Google Chrome.
-[0, 0].sort(function() {
-	baseHasDuplicate = false;
-	return 0;
-});
+	} else if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
 
-var Sizzle = function( selector, context, results, seed ) {
-	results = results || [];
-	context = context || document;
+		// IE6-8 fails to persist the checked state of a cloned checkbox
+		// or radio button. Worse, IE6-7 fail to give the cloned element
+		// a checked appearance if the defaultChecked value isn't also set
 
-	var origContext = context;
+		dest.defaultChecked = dest.checked = src.checked;
 
-	if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
-		return [];
-	}
+		// IE6-7 get confused and end up setting the value of a cloned
+		// checkbox/radio button to an empty string instead of "on"
+		if ( dest.value !== src.value ) {
+			dest.value = src.value;
+		}
 
-	if ( !selector || typeof selector !== "string" ) {
-		return results;
-	}
+	// IE6-8 fails to return the selected option to the default selected
+	// state when cloning options
+	} else if ( nodeName === "option" ) {
+		dest.defaultSelected = dest.selected = src.defaultSelected;
 
-	var m, set, checkSet, extra, ret, cur, pop, i,
-		prune = true,
-		contextXML = Sizzle.isXML( context ),
-		parts = [],
-		soFar = selector;
+	// IE6-8 fails to set the defaultValue to the correct value when
+	// cloning other types of input fields
+	} else if ( nodeName === "input" || nodeName === "textarea" ) {
+		dest.defaultValue = src.defaultValue;
+	}
+}
 
-	// Reset the position of the chunker regexp (start from head)
-	do {
-		chunker.exec( "" );
-		m = chunker.exec( soFar );
+function domManip( collection, args, callback, ignored ) {
 
-		if ( m ) {
-			soFar = m[3];
+	// Flatten any nested arrays
+	args = concat.apply( [], args );
 
-			parts.push( m[1] );
+	var first, node, hasScripts,
+		scripts, doc, fragment,
+		i = 0,
+		l = collection.length,
+		iNoClone = l - 1,
+		value = args[ 0 ],
+		isFunction = jQuery.isFunction( value );
 
-			if ( m[2] ) {
-				extra = m[3];
-				break;
+	// We can't cloneNode fragments that contain checked, in WebKit
+	if ( isFunction ||
+			( l > 1 && typeof value === "string" &&
+				!support.checkClone && rchecked.test( value ) ) ) {
+		return collection.each( function( index ) {
+			var self = collection.eq( index );
+			if ( isFunction ) {
+				args[ 0 ] = value.call( this, index, self.html() );
 			}
+			domManip( self, args, callback, ignored );
+		} );
+	}
+
+	if ( l ) {
+		fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
+		first = fragment.firstChild;
+
+		if ( fragment.childNodes.length === 1 ) {
+			fragment = first;
 		}
-	} while ( m );
 
-	if ( parts.length > 1 && origPOS.exec( selector ) ) {
+		// Require either new content or an interest in ignored elements to invoke the callback
+		if ( first || ignored ) {
+			scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+			hasScripts = scripts.length;
 
-		if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
-			set = posProcess( parts[0] + parts[1], context, seed );
+			// Use the original fragment for the last item
+			// instead of the first because it can end up
+			// being emptied incorrectly in certain situations (#8070).
+			for ( ; i < l; i++ ) {
+				node = fragment;
 
-		} else {
-			set = Expr.relative[ parts[0] ] ?
-				[ context ] :
-				Sizzle( parts.shift(), context );
+				if ( i !== iNoClone ) {
+					node = jQuery.clone( node, true, true );
 
-			while ( parts.length ) {
-				selector = parts.shift();
+					// Keep references to cloned scripts for later restoration
+					if ( hasScripts ) {
 
-				if ( Expr.relative[ selector ] ) {
-					selector += parts.shift();
+						// Support: Android<4.1, PhantomJS<2
+						// push.apply(_, arraylike) throws on ancient WebKit
+						jQuery.merge( scripts, getAll( node, "script" ) );
+					}
 				}
 
-				set = posProcess( selector, set, seed );
+				callback.call( collection[ i ], node, i );
 			}
-		}
 
-	} else {
-		// Take a shortcut and set the context if the root selector is an ID
-		// (but not if it'll be faster if the inner selector is an ID)
-		if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
-				Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+			if ( hasScripts ) {
+				doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+				// Reenable scripts
+				jQuery.map( scripts, restoreScript );
+
+				// Evaluate executable scripts on first document insertion
+				for ( i = 0; i < hasScripts; i++ ) {
+					node = scripts[ i ];
+					if ( rscriptType.test( node.type || "" ) &&
+						!jQuery._data( node, "globalEval" ) &&
+						jQuery.contains( doc, node ) ) {
+
+						if ( node.src ) {
+
+							// Optional AJAX dependency, but won't run scripts if not present
+							if ( jQuery._evalUrl ) {
+								jQuery._evalUrl( node.src );
+							}
+						} else {
+							jQuery.globalEval(
+								( node.text || node.textContent || node.innerHTML || "" )
+									.replace( rcleanScript, "" )
+							);
+						}
+					}
+				}
+			}
 
-			ret = Sizzle.find( parts.shift(), context, contextXML );
-			context = ret.expr ?
-				Sizzle.filter( ret.expr, ret.set )[0] :
-				ret.set[0];
+			// Fix #11809: Avoid leaking memory
+			fragment = first = null;
 		}
+	}
 
-		if ( context ) {
-			ret = seed ?
-				{ expr: parts.pop(), set: makeArray(seed) } :
-				Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+	return collection;
+}
 
-			set = ret.expr ?
-				Sizzle.filter( ret.expr, ret.set ) :
-				ret.set;
+function remove( elem, selector, keepData ) {
+	var node,
+		elems = selector ? jQuery.filter( selector, elem ) : elem,
+		i = 0;
 
-			if ( parts.length > 0 ) {
-				checkSet = makeArray( set );
+	for ( ; ( node = elems[ i ] ) != null; i++ ) {
 
-			} else {
-				prune = false;
+		if ( !keepData && node.nodeType === 1 ) {
+			jQuery.cleanData( getAll( node ) );
+		}
+
+		if ( node.parentNode ) {
+			if ( keepData && jQuery.contains( node.ownerDocument, node ) ) {
+				setGlobalEval( getAll( node, "script" ) );
 			}
+			node.parentNode.removeChild( node );
+		}
+	}
 
-			while ( parts.length ) {
-				cur = parts.pop();
-				pop = cur;
+	return elem;
+}
 
-				if ( !Expr.relative[ cur ] ) {
-					cur = "";
-				} else {
-					pop = parts.pop();
-				}
+jQuery.extend( {
+	htmlPrefilter: function( html ) {
+		return html.replace( rxhtmlTag, "<$1></$2>" );
+	},
 
-				if ( pop == null ) {
-					pop = context;
-				}
+	clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+		var destElements, node, clone, i, srcElements,
+			inPage = jQuery.contains( elem.ownerDocument, elem );
 
-				Expr.relative[ cur ]( checkSet, pop, contextXML );
-			}
+		if ( support.html5Clone || jQuery.isXMLDoc( elem ) ||
+			!rnoshimcache.test( "<" + elem.nodeName + ">" ) ) {
+
+			clone = elem.cloneNode( true );
 
+		// IE<=8 does not properly clone detached, unknown element nodes
 		} else {
-			checkSet = parts = [];
+			fragmentDiv.innerHTML = elem.outerHTML;
+			fragmentDiv.removeChild( clone = fragmentDiv.firstChild );
 		}
-	}
 
-	if ( !checkSet ) {
-		checkSet = set;
-	}
+		if ( ( !support.noCloneEvent || !support.noCloneChecked ) &&
+				( elem.nodeType === 1 || elem.nodeType === 11 ) && !jQuery.isXMLDoc( elem ) ) {
 
-	if ( !checkSet ) {
-		Sizzle.error( cur || selector );
-	}
+			// We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2
+			destElements = getAll( clone );
+			srcElements = getAll( elem );
 
-	if ( toString.call(checkSet) === "[object Array]" ) {
-		if ( !prune ) {
-			results.push.apply( results, checkSet );
+			// Fix all IE cloning issues
+			for ( i = 0; ( node = srcElements[ i ] ) != null; ++i ) {
 
-		} else if ( context && context.nodeType === 1 ) {
-			for ( i = 0; checkSet[i] != null; i++ ) {
-				if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
-					results.push( set[i] );
+				// Ensure that the destination node is not null; Fixes #9587
+				if ( destElements[ i ] ) {
+					fixCloneNodeIssues( node, destElements[ i ] );
 				}
 			}
+		}
 
-		} else {
-			for ( i = 0; checkSet[i] != null; i++ ) {
-				if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
-					results.push( set[i] );
+		// Copy the events from the original to the clone
+		if ( dataAndEvents ) {
+			if ( deepDataAndEvents ) {
+				srcElements = srcElements || getAll( elem );
+				destElements = destElements || getAll( clone );
+
+				for ( i = 0; ( node = srcElements[ i ] ) != null; i++ ) {
+					cloneCopyEvent( node, destElements[ i ] );
 				}
+			} else {
+				cloneCopyEvent( elem, clone );
 			}
 		}
 
-	} else {
-		makeArray( checkSet, results );
-	}
+		// Preserve script evaluation history
+		destElements = getAll( clone, "script" );
+		if ( destElements.length > 0 ) {
+			setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+		}
 
-	if ( extra ) {
-		Sizzle( extra, origContext, results, seed );
-		Sizzle.uniqueSort( results );
-	}
+		destElements = srcElements = node = null;
 
-	return results;
-};
+		// Return the cloned set
+		return clone;
+	},
 
-Sizzle.uniqueSort = function( results ) {
-	if ( sortOrder ) {
-		hasDuplicate = baseHasDuplicate;
-		results.sort( sortOrder );
-
-		if ( hasDuplicate ) {
-			for ( var i = 1; i < results.length; i++ ) {
-				if ( results[i] === results[ i - 1 ] ) {
-					results.splice( i--, 1 );
-				}
-			}
-		}
-	}
+	cleanData: function( elems, /* internal */ forceAcceptData ) {
+		var elem, type, id, data,
+			i = 0,
+			internalKey = jQuery.expando,
+			cache = jQuery.cache,
+			attributes = support.attributes,
+			special = jQuery.event.special;
 
-	return results;
-};
+		for ( ; ( elem = elems[ i ] ) != null; i++ ) {
+			if ( forceAcceptData || acceptData( elem ) ) {
 
-Sizzle.matches = function( expr, set ) {
-	return Sizzle( expr, null, null, set );
-};
+				id = elem[ internalKey ];
+				data = id && cache[ id ];
 
-Sizzle.matchesSelector = function( node, expr ) {
-	return Sizzle( expr, null, null, [node] ).length > 0;
-};
+				if ( data ) {
+					if ( data.events ) {
+						for ( type in data.events ) {
+							if ( special[ type ] ) {
+								jQuery.event.remove( elem, type );
 
-Sizzle.find = function( expr, context, isXML ) {
-	var set, i, len, match, type, left;
+							// This is a shortcut to avoid jQuery.event.remove's overhead
+							} else {
+								jQuery.removeEvent( elem, type, data.handle );
+							}
+						}
+					}
 
-	if ( !expr ) {
-		return [];
-	}
+					// Remove cache only if it was not already removed by jQuery.event.remove
+					if ( cache[ id ] ) {
 
-	for ( i = 0, len = Expr.order.length; i < len; i++ ) {
-		type = Expr.order[i];
+						delete cache[ id ];
 
-		if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
-			left = match[1];
-			match.splice( 1, 1 );
+						// Support: IE<9
+						// IE does not allow us to delete expando properties from nodes
+						// IE creates expando attributes along with the property
+						// IE does not have a removeAttribute function on Document nodes
+						if ( !attributes && typeof elem.removeAttribute !== "undefined" ) {
+							elem.removeAttribute( internalKey );
 
-			if ( left.substr( left.length - 1 ) !== "\\" ) {
-				match[1] = (match[1] || "").replace( rBackslash, "" );
-				set = Expr.find[ type ]( match, context, isXML );
+						// Webkit & Blink performance suffers when deleting properties
+						// from DOM nodes, so set to undefined instead
+						// https://code.google.com/p/chromium/issues/detail?id=378607
+						} else {
+							elem[ internalKey ] = undefined;
+						}
 
-				if ( set != null ) {
-					expr = expr.replace( Expr.match[ type ], "" );
-					break;
+						deletedIds.push( id );
+					}
 				}
 			}
 		}
 	}
+} );
 
-	if ( !set ) {
-		set = typeof context.getElementsByTagName !== "undefined" ?
-			context.getElementsByTagName( "*" ) :
-			[];
-	}
+jQuery.fn.extend( {
 
-	return { set: set, expr: expr };
-};
+	// Keep domManip exposed until 3.0 (gh-2225)
+	domManip: domManip,
+
+	detach: function( selector ) {
+		return remove( this, selector, true );
+	},
 
-Sizzle.filter = function( expr, set, inplace, not ) {
-	var match, anyFound,
-		type, found, item, filter, left,
-		i, pass,
-		old = expr,
-		result = [],
-		curLoop = set,
-		isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
+	remove: function( selector ) {
+		return remove( this, selector );
+	},
 
-	while ( expr && set.length ) {
-		for ( type in Expr.filter ) {
-			if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
-				filter = Expr.filter[ type ];
-				left = match[1];
+	text: function( value ) {
+		return access( this, function( value ) {
+			return value === undefined ?
+				jQuery.text( this ) :
+				this.empty().append(
+					( this[ 0 ] && this[ 0 ].ownerDocument || document ).createTextNode( value )
+				);
+		}, null, value, arguments.length );
+	},
 
-				anyFound = false;
+	append: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.appendChild( elem );
+			}
+		} );
+	},
 
-				match.splice(1,1);
+	prepend: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.insertBefore( elem, target.firstChild );
+			}
+		} );
+	},
 
-				if ( left.substr( left.length - 1 ) === "\\" ) {
-					continue;
-				}
+	before: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this );
+			}
+		} );
+	},
 
-				if ( curLoop === result ) {
-					result = [];
-				}
+	after: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			}
+		} );
+	},
 
-				if ( Expr.preFilter[ type ] ) {
-					match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+	empty: function() {
+		var elem,
+			i = 0;
 
-					if ( !match ) {
-						anyFound = found = true;
+		for ( ; ( elem = this[ i ] ) != null; i++ ) {
 
-					} else if ( match === true ) {
-						continue;
-					}
-				}
+			// Remove element nodes and prevent memory leaks
+			if ( elem.nodeType === 1 ) {
+				jQuery.cleanData( getAll( elem, false ) );
+			}
 
-				if ( match ) {
-					for ( i = 0; (item = curLoop[i]) != null; i++ ) {
-						if ( item ) {
-							found = filter( item, match, i, curLoop );
-							pass = not ^ found;
+			// Remove any remaining nodes
+			while ( elem.firstChild ) {
+				elem.removeChild( elem.firstChild );
+			}
 
-							if ( inplace && found != null ) {
-								if ( pass ) {
-									anyFound = true;
+			// If this is a select, ensure that it displays empty (#12336)
+			// Support: IE<9
+			if ( elem.options && jQuery.nodeName( elem, "select" ) ) {
+				elem.options.length = 0;
+			}
+		}
 
-								} else {
-									curLoop[i] = false;
-								}
+		return this;
+	},
 
-							} else if ( pass ) {
-								result.push( item );
-								anyFound = true;
-							}
-						}
-					}
-				}
+	clone: function( dataAndEvents, deepDataAndEvents ) {
+		dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+		deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+		return this.map( function() {
+			return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+		} );
+	},
+
+	html: function( value ) {
+		return access( this, function( value ) {
+			var elem = this[ 0 ] || {},
+				i = 0,
+				l = this.length;
+
+			if ( value === undefined ) {
+				return elem.nodeType === 1 ?
+					elem.innerHTML.replace( rinlinejQuery, "" ) :
+					undefined;
+			}
 
-				if ( found !== undefined ) {
-					if ( !inplace ) {
-						curLoop = result;
-					}
+			// See if we can take a shortcut and just use innerHTML
+			if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+				( support.htmlSerialize || !rnoshimcache.test( value )  ) &&
+				( support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&
+				!wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
 
-					expr = expr.replace( Expr.match[ type ], "" );
+				value = jQuery.htmlPrefilter( value );
 
-					if ( !anyFound ) {
-						return [];
-					}
+				try {
+					for ( ; i < l; i++ ) {
 
-					break;
-				}
-			}
-		}
+						// Remove element nodes and prevent memory leaks
+						elem = this[ i ] || {};
+						if ( elem.nodeType === 1 ) {
+							jQuery.cleanData( getAll( elem, false ) );
+							elem.innerHTML = value;
+						}
+					}
 
-		// Improper expression
-		if ( expr === old ) {
-			if ( anyFound == null ) {
-				Sizzle.error( expr );
+					elem = 0;
 
-			} else {
-				break;
+				// If using innerHTML throws an exception, use the fallback method
+				} catch ( e ) {}
 			}
-		}
 
-		old = expr;
-	}
+			if ( elem ) {
+				this.empty().append( value );
+			}
+		}, null, value, arguments.length );
+	},
 
-	return curLoop;
-};
+	replaceWith: function() {
+		var ignored = [];
 
-Sizzle.error = function( msg ) {
-	throw new Error( "Syntax error, unrecognized expression: " + msg );
-};
+		// Make the changes, replacing each non-ignored context element with the new content
+		return domManip( this, arguments, function( elem ) {
+			var parent = this.parentNode;
 
-/**
- * Utility function for retreiving the text value of an array of DOM nodes
- * @param {Array|Element} elem
- */
-var getText = Sizzle.getText = function( elem ) {
-    var i, node,
-		nodeType = elem.nodeType,
-		ret = "";
-
-	if ( nodeType ) {
-		if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
-			// Use textContent || innerText for elements
-			if ( typeof elem.textContent === 'string' ) {
-				return elem.textContent;
-			} else if ( typeof elem.innerText === 'string' ) {
-				// Replace IE's carriage returns
-				return elem.innerText.replace( rReturn, '' );
-			} else {
-				// Traverse it's children
-				for ( elem = elem.firstChild; elem; elem = elem.nextSibling) {
-					ret += getText( elem );
+			if ( jQuery.inArray( this, ignored ) < 0 ) {
+				jQuery.cleanData( getAll( this ) );
+				if ( parent ) {
+					parent.replaceChild( elem, this );
 				}
 			}
-		} else if ( nodeType === 3 || nodeType === 4 ) {
-			return elem.nodeValue;
-		}
-	} else {
 
-		// If no nodeType, this is expected to be an array
-		for ( i = 0; (node = elem[i]); i++ ) {
-			// Do not traverse comment nodes
-			if ( node.nodeType !== 8 ) {
-				ret += getText( node );
-			}
-		}
+		// Force callback invocation
+		}, ignored );
 	}
-	return ret;
-};
+} );
 
-var Expr = Sizzle.selectors = {
-	order: [ "ID", "NAME", "TAG" ],
-
-	match: {
-		ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
-		CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
-		NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,
-		ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,
-		TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,
-		CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,
-		POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,
-		PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
-	},
-
-	leftMatch: {},
+jQuery.each( {
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var elems,
+			i = 0,
+			ret = [],
+			insert = jQuery( selector ),
+			last = insert.length - 1;
 
-	attrMap: {
-		"class": "className",
-		"for": "htmlFor"
-	},
+		for ( ; i <= last; i++ ) {
+			elems = i === last ? this : this.clone( true );
+			jQuery( insert[ i ] )[ original ]( elems );
 
-	attrHandle: {
-		href: function( elem ) {
-			return elem.getAttribute( "href" );
-		},
-		type: function( elem ) {
-			return elem.getAttribute( "type" );
+			// Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get()
+			push.apply( ret, elems.get() );
 		}
-	},
 
-	relative: {
-		"+": function(checkSet, part){
-			var isPartStr = typeof part === "string",
-				isTag = isPartStr && !rNonWord.test( part ),
-				isPartStrNotTag = isPartStr && !isTag;
+		return this.pushStack( ret );
+	};
+} );
 
-			if ( isTag ) {
-				part = part.toLowerCase();
-			}
 
-			for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
-				if ( (elem = checkSet[i]) ) {
-					while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+var iframe,
+	elemdisplay = {
 
-					checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
-						elem || false :
-						elem === part;
-				}
-			}
+		// Support: Firefox
+		// We have to pre-define these values for FF (#10227)
+		HTML: "block",
+		BODY: "block"
+	};
 
-			if ( isPartStrNotTag ) {
-				Sizzle.filter( part, checkSet, true );
-			}
-		},
+/**
+ * Retrieve the actual display of a element
+ * @param {String} name nodeName of the element
+ * @param {Object} doc Document object
+ */
 
-		">": function( checkSet, part ) {
-			var elem,
-				isPartStr = typeof part === "string",
-				i = 0,
-				l = checkSet.length;
+// Called only from within defaultDisplay
+function actualDisplay( name, doc ) {
+	var elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),
 
-			if ( isPartStr && !rNonWord.test( part ) ) {
-				part = part.toLowerCase();
+		display = jQuery.css( elem[ 0 ], "display" );
 
-				for ( ; i < l; i++ ) {
-					elem = checkSet[i];
+	// We don't have any data stored on the element,
+	// so use "detach" method as fast way to get rid of the element
+	elem.detach();
 
-					if ( elem ) {
-						var parent = elem.parentNode;
-						checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
-					}
-				}
+	return display;
+}
 
-			} else {
-				for ( ; i < l; i++ ) {
-					elem = checkSet[i];
+/**
+ * Try to determine the default display value of an element
+ * @param {String} nodeName
+ */
+function defaultDisplay( nodeName ) {
+	var doc = document,
+		display = elemdisplay[ nodeName ];
 
-					if ( elem ) {
-						checkSet[i] = isPartStr ?
-							elem.parentNode :
-							elem.parentNode === part;
-					}
-				}
+	if ( !display ) {
+		display = actualDisplay( nodeName, doc );
 
-				if ( isPartStr ) {
-					Sizzle.filter( part, checkSet, true );
-				}
-			}
-		},
+		// If the simple way fails, read from inside an iframe
+		if ( display === "none" || !display ) {
 
-		"": function(checkSet, part, isXML){
-			var nodeCheck,
-				doneName = done++,
-				checkFn = dirCheck;
+			// Use the already-created iframe if possible
+			iframe = ( iframe || jQuery( "<iframe frameborder='0' width='0' height='0'/>" ) )
+				.appendTo( doc.documentElement );
 
-			if ( typeof part === "string" && !rNonWord.test( part ) ) {
-				part = part.toLowerCase();
-				nodeCheck = part;
-				checkFn = dirNodeCheck;
-			}
+			// Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse
+			doc = ( iframe[ 0 ].contentWindow || iframe[ 0 ].contentDocument ).document;
 
-			checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
-		},
+			// Support: IE
+			doc.write();
+			doc.close();
 
-		"~": function( checkSet, part, isXML ) {
-			var nodeCheck,
-				doneName = done++,
-				checkFn = dirCheck;
+			display = actualDisplay( nodeName, doc );
+			iframe.detach();
+		}
 
-			if ( typeof part === "string" && !rNonWord.test( part ) ) {
-				part = part.toLowerCase();
-				nodeCheck = part;
-				checkFn = dirNodeCheck;
-			}
+		// Store the correct default display
+		elemdisplay[ nodeName ] = display;
+	}
 
-			checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
-		}
-	},
+	return display;
+}
+var rmargin = ( /^margin/ );
 
-	find: {
-		ID: function( match, context, isXML ) {
-			if ( typeof context.getElementById !== "undefined" && !isXML ) {
-				var m = context.getElementById(match[1]);
-				// Check parentNode to catch when Blackberry 4.6 returns
-				// nodes that are no longer in the document #6963
-				return m && m.parentNode ? [m] : [];
-			}
-		},
+var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
 
-		NAME: function( match, context ) {
-			if ( typeof context.getElementsByName !== "undefined" ) {
-				var ret = [],
-					results = context.getElementsByName( match[1] );
+var swap = function( elem, options, callback, args ) {
+	var ret, name,
+		old = {};
 
-				for ( var i = 0, l = results.length; i < l; i++ ) {
-					if ( results[i].getAttribute("name") === match[1] ) {
-						ret.push( results[i] );
-					}
-				}
+	// Remember the old values, and insert the new ones
+	for ( name in options ) {
+		old[ name ] = elem.style[ name ];
+		elem.style[ name ] = options[ name ];
+	}
 
-				return ret.length === 0 ? null : ret;
-			}
-		},
+	ret = callback.apply( elem, args || [] );
 
-		TAG: function( match, context ) {
-			if ( typeof context.getElementsByTagName !== "undefined" ) {
-				return context.getElementsByTagName( match[1] );
-			}
-		}
-	},
-	preFilter: {
-		CLASS: function( match, curLoop, inplace, result, not, isXML ) {
-			match = " " + match[1].replace( rBackslash, "" ) + " ";
+	// Revert the old values
+	for ( name in options ) {
+		elem.style[ name ] = old[ name ];
+	}
 
-			if ( isXML ) {
-				return match;
-			}
+	return ret;
+};
 
-			for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
-				if ( elem ) {
-					if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) {
-						if ( !inplace ) {
-							result.push( elem );
-						}
 
-					} else if ( inplace ) {
-						curLoop[i] = false;
-					}
-				}
-			}
+var documentElement = document.documentElement;
 
-			return false;
-		},
 
-		ID: function( match ) {
-			return match[1].replace( rBackslash, "" );
-		},
 
-		TAG: function( match, curLoop ) {
-			return match[1].replace( rBackslash, "" ).toLowerCase();
-		},
+( function() {
+	var pixelPositionVal, pixelMarginRightVal, boxSizingReliableVal,
+		reliableHiddenOffsetsVal, reliableMarginRightVal, reliableMarginLeftVal,
+		container = document.createElement( "div" ),
+		div = document.createElement( "div" );
 
-		CHILD: function( match ) {
-			if ( match[1] === "nth" ) {
-				if ( !match[2] ) {
-					Sizzle.error( match[0] );
-				}
+	// Finish early in limited (non-browser) environments
+	if ( !div.style ) {
+		return;
+	}
 
-				match[2] = match[2].replace(/^\+|\s*/g, '');
+	div.style.cssText = "float:left;opacity:.5";
 
-				// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
-				var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec(
-					match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
-					!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+	// Support: IE<9
+	// Make sure that element opacity exists (as opposed to filter)
+	support.opacity = div.style.opacity === "0.5";
 
-				// calculate the numbers (first)n+(last) including if they are negative
-				match[2] = (test[1] + (test[2] || 1)) - 0;
-				match[3] = test[3] - 0;
-			}
-			else if ( match[2] ) {
-				Sizzle.error( match[0] );
-			}
+	// Verify style float existence
+	// (IE uses styleFloat instead of cssFloat)
+	support.cssFloat = !!div.style.cssFloat;
 
-			// TODO: Move to normal caching system
-			match[0] = done++;
+	div.style.backgroundClip = "content-box";
+	div.cloneNode( true ).style.backgroundClip = "";
+	support.clearCloneStyle = div.style.backgroundClip === "content-box";
 
-			return match;
-		},
+	container = document.createElement( "div" );
+	container.style.cssText = "border:0;width:8px;height:0;top:0;left:-9999px;" +
+		"padding:0;margin-top:1px;position:absolute";
+	div.innerHTML = "";
+	container.appendChild( div );
 
-		ATTR: function( match, curLoop, inplace, result, not, isXML ) {
-			var name = match[1] = match[1].replace( rBackslash, "" );
+	// Support: Firefox<29, Android 2.3
+	// Vendor-prefix box-sizing
+	support.boxSizing = div.style.boxSizing === "" || div.style.MozBoxSizing === "" ||
+		div.style.WebkitBoxSizing === "";
 
-			if ( !isXML && Expr.attrMap[name] ) {
-				match[1] = Expr.attrMap[name];
+	jQuery.extend( support, {
+		reliableHiddenOffsets: function() {
+			if ( pixelPositionVal == null ) {
+				computeStyleTests();
 			}
+			return reliableHiddenOffsetsVal;
+		},
 
-			// Handle if an un-quoted value was used
-			match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" );
+		boxSizingReliable: function() {
 
-			if ( match[2] === "~=" ) {
-				match[4] = " " + match[4] + " ";
+			// We're checking for pixelPositionVal here instead of boxSizingReliableVal
+			// since that compresses better and they're computed together anyway.
+			if ( pixelPositionVal == null ) {
+				computeStyleTests();
 			}
-
-			return match;
+			return boxSizingReliableVal;
 		},
 
-		PSEUDO: function( match, curLoop, inplace, result, not ) {
-			if ( match[1] === "not" ) {
-				// If we're dealing with a complex expression, or a simple one
-				if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
-					match[3] = Sizzle(match[3], null, null, curLoop);
+		pixelMarginRight: function() {
 
-				} else {
-					var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+			// Support: Android 4.0-4.3
+			if ( pixelPositionVal == null ) {
+				computeStyleTests();
+			}
+			return pixelMarginRightVal;
+		},
 
-					if ( !inplace ) {
-						result.push.apply( result, ret );
-					}
+		pixelPosition: function() {
+			if ( pixelPositionVal == null ) {
+				computeStyleTests();
+			}
+			return pixelPositionVal;
+		},
 
-					return false;
-				}
+		reliableMarginRight: function() {
 
-			} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
-				return true;
+			// Support: Android 2.3
+			if ( pixelPositionVal == null ) {
+				computeStyleTests();
 			}
-
-			return match;
+			return reliableMarginRightVal;
 		},
 
-		POS: function( match ) {
-			match.unshift( true );
+		reliableMarginLeft: function() {
 
-			return match;
+			// Support: IE <=8 only, Android 4.0 - 4.3 only, Firefox <=3 - 37
+			if ( pixelPositionVal == null ) {
+				computeStyleTests();
+			}
+			return reliableMarginLeftVal;
 		}
-	},
+	} );
 
-	filters: {
-		enabled: function( elem ) {
-			return elem.disabled === false && elem.type !== "hidden";
-		},
-
-		disabled: function( elem ) {
-			return elem.disabled === true;
-		},
+	function computeStyleTests() {
+		var contents, divStyle,
+			documentElement = document.documentElement;
 
-		checked: function( elem ) {
-			return elem.checked === true;
-		},
+		// Setup
+		documentElement.appendChild( container );
 
-		selected: function( elem ) {
-			// Accessing this property makes selected-by-default
-			// options in Safari work properly
-			if ( elem.parentNode ) {
-				elem.parentNode.selectedIndex;
-			}
+		div.style.cssText =
 
-			return elem.selected === true;
-		},
+			// Support: Android 2.3
+			// Vendor-prefix box-sizing
+			"-webkit-box-sizing:border-box;box-sizing:border-box;" +
+			"position:relative;display:block;" +
+			"margin:auto;border:1px;padding:1px;" +
+			"top:1%;width:50%";
 
-		parent: function( elem ) {
-			return !!elem.firstChild;
-		},
+		// Support: IE<9
+		// Assume reasonable values in the absence of getComputedStyle
+		pixelPositionVal = boxSizingReliableVal = reliableMarginLeftVal = false;
+		pixelMarginRightVal = reliableMarginRightVal = true;
 
-		empty: function( elem ) {
-			return !elem.firstChild;
-		},
+		// Check for getComputedStyle so that this code is not run in IE<9.
+		if ( window.getComputedStyle ) {
+			divStyle = window.getComputedStyle( div );
+			pixelPositionVal = ( divStyle || {} ).top !== "1%";
+			reliableMarginLeftVal = ( divStyle || {} ).marginLeft === "2px";
+			boxSizingReliableVal = ( divStyle || { width: "4px" } ).width === "4px";
 
-		has: function( elem, i, match ) {
-			return !!Sizzle( match[3], elem ).length;
-		},
+			// Support: Android 4.0 - 4.3 only
+			// Some styles come back with percentage values, even though they shouldn't
+			div.style.marginRight = "50%";
+			pixelMarginRightVal = ( divStyle || { marginRight: "4px" } ).marginRight === "4px";
 
-		header: function( elem ) {
-			return (/h\d/i).test( elem.nodeName );
-		},
+			// Support: Android 2.3 only
+			// Div with explicit width and no margin-right incorrectly
+			// gets computed margin-right based on width of container (#3333)
+			// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+			contents = div.appendChild( document.createElement( "div" ) );
 
-		text: function( elem ) {
-			var attr = elem.getAttribute( "type" ), type = elem.type;
-			// IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
-			// use getAttribute instead to test this case
-			return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null );
-		},
+			// Reset CSS: box-sizing; display; margin; border; padding
+			contents.style.cssText = div.style.cssText =
 
-		radio: function( elem ) {
-			return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type;
-		},
+				// Support: Android 2.3
+				// Vendor-prefix box-sizing
+				"-webkit-box-sizing:content-box;-moz-box-sizing:content-box;" +
+				"box-sizing:content-box;display:block;margin:0;border:0;padding:0";
+			contents.style.marginRight = contents.style.width = "0";
+			div.style.width = "1px";
 
-		checkbox: function( elem ) {
-			return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type;
-		},
+			reliableMarginRightVal =
+				!parseFloat( ( window.getComputedStyle( contents ) || {} ).marginRight );
 
-		file: function( elem ) {
-			return elem.nodeName.toLowerCase() === "input" && "file" === elem.type;
-		},
+			div.removeChild( contents );
+		}
 
-		password: function( elem ) {
-			return elem.nodeName.toLowerCase() === "input" && "password" === elem.type;
-		},
+		// Support: IE6-8
+		// First check that getClientRects works as expected
+		// Check if table cells still have offsetWidth/Height when they are set
+		// to display:none and there are still other visible table cells in a
+		// table row; if so, offsetWidth/Height are not reliable for use when
+		// determining if an element has been hidden directly using
+		// display:none (it is still safe to use offsets if a parent element is
+		// hidden; don safety goggles and see bug #4512 for more information).
+		div.style.display = "none";
+		reliableHiddenOffsetsVal = div.getClientRects().length === 0;
+		if ( reliableHiddenOffsetsVal ) {
+			div.style.display = "";
+			div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
+			div.childNodes[ 0 ].style.borderCollapse = "separate";
+			contents = div.getElementsByTagName( "td" );
+			contents[ 0 ].style.cssText = "margin:0;border:0;padding:0;display:none";
+			reliableHiddenOffsetsVal = contents[ 0 ].offsetHeight === 0;
+			if ( reliableHiddenOffsetsVal ) {
+				contents[ 0 ].style.display = "";
+				contents[ 1 ].style.display = "none";
+				reliableHiddenOffsetsVal = contents[ 0 ].offsetHeight === 0;
+			}
+		}
+
+		// Teardown
+		documentElement.removeChild( container );
+	}
 
-		submit: function( elem ) {
-			var name = elem.nodeName.toLowerCase();
-			return (name === "input" || name === "button") && "submit" === elem.type;
-		},
+} )();
 
-		image: function( elem ) {
-			return elem.nodeName.toLowerCase() === "input" && "image" === elem.type;
-		},
 
-		reset: function( elem ) {
-			var name = elem.nodeName.toLowerCase();
-			return (name === "input" || name === "button") && "reset" === elem.type;
-		},
+var getStyles, curCSS,
+	rposition = /^(top|right|bottom|left)$/;
 
-		button: function( elem ) {
-			var name = elem.nodeName.toLowerCase();
-			return name === "input" && "button" === elem.type || name === "button";
-		},
+if ( window.getComputedStyle ) {
+	getStyles = function( elem ) {
 
-		input: function( elem ) {
-			return (/input|select|textarea|button/i).test( elem.nodeName );
-		},
+		// Support: IE<=11+, Firefox<=30+ (#15098, #14150)
+		// IE throws on elements created in popups
+		// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
+		var view = elem.ownerDocument.defaultView;
 
-		focus: function( elem ) {
-			return elem === elem.ownerDocument.activeElement;
+		if ( !view || !view.opener ) {
+			view = window;
 		}
-	},
-	setFilters: {
-		first: function( elem, i ) {
-			return i === 0;
-		},
-
-		last: function( elem, i, match, array ) {
-			return i === array.length - 1;
-		},
-
-		even: function( elem, i ) {
-			return i % 2 === 0;
-		},
 
-		odd: function( elem, i ) {
-			return i % 2 === 1;
-		},
+		return view.getComputedStyle( elem );
+	};
 
-		lt: function( elem, i, match ) {
-			return i < match[3] - 0;
-		},
+	curCSS = function( elem, name, computed ) {
+		var width, minWidth, maxWidth, ret,
+			style = elem.style;
 
-		gt: function( elem, i, match ) {
-			return i > match[3] - 0;
-		},
+		computed = computed || getStyles( elem );
 
-		nth: function( elem, i, match ) {
-			return match[3] - 0 === i;
-		},
+		// getPropertyValue is only needed for .css('filter') in IE9, see #12537
+		ret = computed ? computed.getPropertyValue( name ) || computed[ name ] : undefined;
 
-		eq: function( elem, i, match ) {
-			return match[3] - 0 === i;
+		// Support: Opera 12.1x only
+		// Fall back to style even without computed
+		// computed is undefined for elems on document fragments
+		if ( ( ret === "" || ret === undefined ) && !jQuery.contains( elem.ownerDocument, elem ) ) {
+			ret = jQuery.style( elem, name );
 		}
-	},
-	filter: {
-		PSEUDO: function( elem, match, i, array ) {
-			var name = match[1],
-				filter = Expr.filters[ name ];
 
-			if ( filter ) {
-				return filter( elem, i, match, array );
+		if ( computed ) {
 
-			} else if ( name === "contains" ) {
-				return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0;
+			// A tribute to the "awesome hack by Dean Edwards"
+			// Chrome < 17 and Safari 5.0 uses "computed value"
+			// instead of "used value" for margin-right
+			// Safari 5.1.7 (at least) returns percentage for a larger set of values,
+			// but width seems to be reliably pixels
+			// this is against the CSSOM draft spec:
+			// http://dev.w3.org/csswg/cssom/#resolved-values
+			if ( !support.pixelMarginRight() && rnumnonpx.test( ret ) && rmargin.test( name ) ) {
 
-			} else if ( name === "not" ) {
-				var not = match[3];
+				// Remember the original values
+				width = style.width;
+				minWidth = style.minWidth;
+				maxWidth = style.maxWidth;
 
-				for ( var j = 0, l = not.length; j < l; j++ ) {
-					if ( not[j] === elem ) {
-						return false;
-					}
-				}
-
-				return true;
+				// Put in the new values to get a computed value out
+				style.minWidth = style.maxWidth = style.width = ret;
+				ret = computed.width;
 
-			} else {
-				Sizzle.error( name );
+				// Revert the changed values
+				style.width = width;
+				style.minWidth = minWidth;
+				style.maxWidth = maxWidth;
 			}
-		},
+		}
 
-		CHILD: function( elem, match ) {
-			var first, last,
-				doneName, parent, cache,
-				count, diff,
-				type = match[1],
-				node = elem;
-
-			switch ( type ) {
-				case "only":
-				case "first":
-					while ( (node = node.previousSibling) ) {
-						if ( node.nodeType === 1 ) {
-							return false;
-						}
-					}
+		// Support: IE
+		// IE returns zIndex value as an integer.
+		return ret === undefined ?
+			ret :
+			ret + "";
+	};
+} else if ( documentElement.currentStyle ) {
+	getStyles = function( elem ) {
+		return elem.currentStyle;
+	};
 
-					if ( type === "first" ) {
-						return true;
-					}
+	curCSS = function( elem, name, computed ) {
+		var left, rs, rsLeft, ret,
+			style = elem.style;
 
-					node = elem;
+		computed = computed || getStyles( elem );
+		ret = computed ? computed[ name ] : undefined;
 
-					/* falls through */
-				case "last":
-					while ( (node = node.nextSibling) ) {
-						if ( node.nodeType === 1 ) {
-							return false;
-						}
-					}
+		// Avoid setting ret to empty string here
+		// so we don't default to auto
+		if ( ret == null && style && style[ name ] ) {
+			ret = style[ name ];
+		}
 
-					return true;
+		// From the awesome hack by Dean Edwards
+		// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+		// If we're not dealing with a regular pixel number
+		// but a number that has a weird ending, we need to convert it to pixels
+		// but not position css attributes, as those are
+		// proportional to the parent element instead
+		// and we can't measure the parent instead because it
+		// might trigger a "stacking dolls" problem
+		if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) {
 
-				case "nth":
-					first = match[2];
-					last = match[3];
+			// Remember the original values
+			left = style.left;
+			rs = elem.runtimeStyle;
+			rsLeft = rs && rs.left;
 
-					if ( first === 1 && last === 0 ) {
-						return true;
-					}
+			// Put in the new values to get a computed value out
+			if ( rsLeft ) {
+				rs.left = elem.currentStyle.left;
+			}
+			style.left = name === "fontSize" ? "1em" : ret;
+			ret = style.pixelLeft + "px";
+
+			// Revert the changed values
+			style.left = left;
+			if ( rsLeft ) {
+				rs.left = rsLeft;
+			}
+		}
 
-					doneName = match[0];
-					parent = elem.parentNode;
+		// Support: IE
+		// IE returns zIndex value as an integer.
+		return ret === undefined ?
+			ret :
+			ret + "" || "auto";
+	};
+}
 
-					if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) {
-						count = 0;
 
-						for ( node = parent.firstChild; node; node = node.nextSibling ) {
-							if ( node.nodeType === 1 ) {
-								node.nodeIndex = ++count;
-							}
-						}
 
-						parent[ expando ] = doneName;
-					}
 
-					diff = elem.nodeIndex - last;
+function addGetHookIf( conditionFn, hookFn ) {
 
-					if ( first === 0 ) {
-						return diff === 0;
+	// Define the hook, we'll check on the first run if it's really needed.
+	return {
+		get: function() {
+			if ( conditionFn() ) {
 
-					} else {
-						return ( diff % first === 0 && diff / first >= 0 );
-					}
+				// Hook not needed (or it's not possible to use it due
+				// to missing dependency), remove it.
+				delete this.get;
+				return;
 			}
-		},
 
-		ID: function( elem, match ) {
-			return elem.nodeType === 1 && elem.getAttribute("id") === match;
-		},
+			// Hook needed; redefine it so that the support test is not executed again.
+			return ( this.get = hookFn ).apply( this, arguments );
+		}
+	};
+}
 
-		TAG: function( elem, match ) {
-			return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match;
-		},
 
-		CLASS: function( elem, match ) {
-			return (" " + (elem.className || elem.getAttribute("class")) + " ")
-				.indexOf( match ) > -1;
-		},
+var
 
-		ATTR: function( elem, match ) {
-			var name = match[1],
-				result = Sizzle.attr ?
-					Sizzle.attr( elem, name ) :
-					Expr.attrHandle[ name ] ?
-					Expr.attrHandle[ name ]( elem ) :
-					elem[ name ] != null ?
-						elem[ name ] :
-						elem.getAttribute( name ),
-				value = result + "",
-				type = match[2],
-				check = match[4];
-
-			return result == null ?
-				type === "!=" :
-				!type && Sizzle.attr ?
-				result != null :
-				type === "=" ?
-				value === check :
-				type === "*=" ?
-				value.indexOf(check) >= 0 :
-				type === "~=" ?
-				(" " + value + " ").indexOf(check) >= 0 :
-				!check ?
-				value && result !== false :
-				type === "!=" ?
-				value !== check :
-				type === "^=" ?
-				value.indexOf(check) === 0 :
-				type === "$=" ?
-				value.substr(value.length - check.length) === check :
-				type === "|=" ?
-				value === check || value.substr(0, check.length + 1) === check + "-" :
-				false;
-		},
+		ralpha = /alpha\([^)]*\)/i,
+	ropacity = /opacity\s*=\s*([^)]*)/i,
 
-		POS: function( elem, match, i, array ) {
-			var name = match[2],
-				filter = Expr.setFilters[ name ];
+	// swappable if display is none or starts with table except
+	// "table", "table-cell", or "table-caption"
+	// see here for display values:
+	// https://developer.mozilla.org/en-US/docs/CSS/display
+	rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+	rnumsplit = new RegExp( "^(" + pnum + ")(.*)$", "i" ),
 
-			if ( filter ) {
-				return filter( elem, i, match, array );
-			}
-		}
-	}
-};
+	cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+	cssNormalTransform = {
+		letterSpacing: "0",
+		fontWeight: "400"
+	},
+
+	cssPrefixes = [ "Webkit", "O", "Moz", "ms" ],
+	emptyStyle = document.createElement( "div" ).style;
 
-var origPOS = Expr.match.POS,
-	fescape = function(all, num){
-		return "\\" + (num - 0 + 1);
-	};
 
-for ( var type in Expr.match ) {
-	Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) );
-	Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
-}
-// Expose origPOS
-// "global" as in regardless of relation to brackets/parens
-Expr.match.globalPOS = origPOS;
+// return a css property mapped to a potentially vendor prefixed property
+function vendorPropName( name ) {
+
+	// shortcut for names that are not vendor prefixed
+	if ( name in emptyStyle ) {
+		return name;
+	}
 
-var makeArray = function( array, results ) {
-	array = Array.prototype.slice.call( array, 0 );
+	// check for vendor prefixed names
+	var capName = name.charAt( 0 ).toUpperCase() + name.slice( 1 ),
+		i = cssPrefixes.length;
 
-	if ( results ) {
-		results.push.apply( results, array );
-		return results;
+	while ( i-- ) {
+		name = cssPrefixes[ i ] + capName;
+		if ( name in emptyStyle ) {
+			return name;
+		}
 	}
+}
 
-	return array;
-};
+function showHide( elements, show ) {
+	var display, elem, hidden,
+		values = [],
+		index = 0,
+		length = elements.length;
 
-// Perform a simple check to determine if the browser is capable of
-// converting a NodeList to an array using builtin methods.
-// Also verifies that the returned array holds DOM nodes
-// (which is not the case in the Blackberry browser)
-try {
-	Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
+	for ( ; index < length; index++ ) {
+		elem = elements[ index ];
+		if ( !elem.style ) {
+			continue;
+		}
 
-// Provide a fallback method if it does not work
-} catch( e ) {
-	makeArray = function( array, results ) {
-		var i = 0,
-			ret = results || [];
+		values[ index ] = jQuery._data( elem, "olddisplay" );
+		display = elem.style.display;
+		if ( show ) {
 
-		if ( toString.call(array) === "[object Array]" ) {
-			Array.prototype.push.apply( ret, array );
+			// Reset the inline display of this element to learn if it is
+			// being hidden by cascaded rules or not
+			if ( !values[ index ] && display === "none" ) {
+				elem.style.display = "";
+			}
 
+			// Set elements which have been overridden with display: none
+			// in a stylesheet to whatever the default browser style is
+			// for such an element
+			if ( elem.style.display === "" && isHidden( elem ) ) {
+				values[ index ] =
+					jQuery._data( elem, "olddisplay", defaultDisplay( elem.nodeName ) );
+			}
 		} else {
-			if ( typeof array.length === "number" ) {
-				for ( var l = array.length; i < l; i++ ) {
-					ret.push( array[i] );
-				}
+			hidden = isHidden( elem );
 
-			} else {
-				for ( ; array[i]; i++ ) {
-					ret.push( array[i] );
-				}
+			if ( display && display !== "none" || !hidden ) {
+				jQuery._data(
+					elem,
+					"olddisplay",
+					hidden ? display : jQuery.css( elem, "display" )
+				);
 			}
 		}
+	}
 
-		return ret;
-	};
-}
-
-var sortOrder, siblingCheck;
-
-if ( document.documentElement.compareDocumentPosition ) {
-	sortOrder = function( a, b ) {
-		if ( a === b ) {
-			hasDuplicate = true;
-			return 0;
+	// Set the display of most of the elements in a second loop
+	// to avoid the constant reflow
+	for ( index = 0; index < length; index++ ) {
+		elem = elements[ index ];
+		if ( !elem.style ) {
+			continue;
 		}
-
-		if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
-			return a.compareDocumentPosition ? -1 : 1;
+		if ( !show || elem.style.display === "none" || elem.style.display === "" ) {
+			elem.style.display = show ? values[ index ] || "" : "none";
 		}
+	}
 
-		return a.compareDocumentPosition(b) & 4 ? -1 : 1;
-	};
+	return elements;
+}
 
-} else {
-	sortOrder = function( a, b ) {
-		// The nodes are identical, we can exit early
-		if ( a === b ) {
-			hasDuplicate = true;
-			return 0;
+function setPositiveNumber( elem, value, subtract ) {
+	var matches = rnumsplit.exec( value );
+	return matches ?
 
-		// Fallback to using sourceIndex (in IE) if it's available on both nodes
-		} else if ( a.sourceIndex && b.sourceIndex ) {
-			return a.sourceIndex - b.sourceIndex;
-		}
+		// Guard against undefined "subtract", e.g., when used as in cssHooks
+		Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) :
+		value;
+}
 
-		var al, bl,
-			ap = [],
-			bp = [],
-			aup = a.parentNode,
-			bup = b.parentNode,
-			cur = aup;
+function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) {
+	var i = extra === ( isBorderBox ? "border" : "content" ) ?
 
-		// If the nodes are siblings (or identical) we can do a quick check
-		if ( aup === bup ) {
-			return siblingCheck( a, b );
+		// If we already have the right measurement, avoid augmentation
+		4 :
 
-		// If no parents were found then the nodes are disconnected
-		} else if ( !aup ) {
-			return -1;
+		// Otherwise initialize for horizontal or vertical properties
+		name === "width" ? 1 : 0,
 
-		} else if ( !bup ) {
-			return 1;
-		}
+		val = 0;
 
-		// Otherwise they're somewhere else in the tree so we need
-		// to build up a full list of the parentNodes for comparison
-		while ( cur ) {
-			ap.unshift( cur );
-			cur = cur.parentNode;
+	for ( ; i < 4; i += 2 ) {
+
+		// both box models exclude margin, so add it if we want it
+		if ( extra === "margin" ) {
+			val += jQuery.css( elem, extra + cssExpand[ i ], true, styles );
 		}
 
-		cur = bup;
+		if ( isBorderBox ) {
 
-		while ( cur ) {
-			bp.unshift( cur );
-			cur = cur.parentNode;
-		}
+			// border-box includes padding, so remove it if we want content
+			if ( extra === "content" ) {
+				val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+			}
+
+			// at this point, extra isn't border nor margin, so remove border
+			if ( extra !== "margin" ) {
+				val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+		} else {
 
-		al = ap.length;
-		bl = bp.length;
+			// at this point, extra isn't content, so add padding
+			val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
 
-		// Start walking down the tree looking for a discrepancy
-		for ( var i = 0; i < al && i < bl; i++ ) {
-			if ( ap[i] !== bp[i] ) {
-				return siblingCheck( ap[i], bp[i] );
+			// at this point, extra isn't content nor padding, so add border
+			if ( extra !== "padding" ) {
+				val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
 			}
 		}
+	}
 
-		// We ended someplace up the tree so do a sibling check
-		return i === al ?
-			siblingCheck( a, bp[i], -1 ) :
-			siblingCheck( ap[i], b, 1 );
-	};
+	return val;
+}
 
-	siblingCheck = function( a, b, ret ) {
-		if ( a === b ) {
-			return ret;
-		}
+function getWidthOrHeight( elem, name, extra ) {
 
-		var cur = a.nextSibling;
+	// Start with offset property, which is equivalent to the border-box value
+	var valueIsBorderBox = true,
+		val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+		styles = getStyles( elem ),
+		isBorderBox = support.boxSizing &&
+			jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
 
-		while ( cur ) {
-			if ( cur === b ) {
-				return -1;
-			}
+	// some non-html elements return undefined for offsetWidth, so check for null/undefined
+	// svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
+	// MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
+	if ( val <= 0 || val == null ) {
 
-			cur = cur.nextSibling;
+		// Fall back to computed then uncomputed css if necessary
+		val = curCSS( elem, name, styles );
+		if ( val < 0 || val == null ) {
+			val = elem.style[ name ];
 		}
 
-		return 1;
-	};
-}
+		// Computed unit is not pixels. Stop here and return.
+		if ( rnumnonpx.test( val ) ) {
+			return val;
+		}
 
-// Check to see if the browser returns elements by name when
-// querying by getElementById (and provide a workaround)
-(function(){
-	// We're going to inject a fake input element with a specified name
-	var form = document.createElement("div"),
-		id = "script" + (new Date()).getTime(),
-		root = document.documentElement;
+		// we need the check for style in case a browser which returns unreliable values
+		// for getComputedStyle silently falls back to the reliable elem.style
+		valueIsBorderBox = isBorderBox &&
+			( support.boxSizingReliable() || val === elem.style[ name ] );
+
+		// Normalize "", auto, and prepare for extra
+		val = parseFloat( val ) || 0;
+	}
 
-	form.innerHTML = "<a name='" + id + "'/>";
+	// use the active box-sizing model to add/subtract irrelevant styles
+	return ( val +
+		augmentWidthOrHeight(
+			elem,
+			name,
+			extra || ( isBorderBox ? "border" : "content" ),
+			valueIsBorderBox,
+			styles
+		)
+	) + "px";
+}
 
-	// Inject it into the root element, check its status, and remove it quickly
-	root.insertBefore( form, root.firstChild );
+jQuery.extend( {
 
-	// The workaround has to do additional checks after a getElementById
-	// Which slows things down for other browsers (hence the branching)
-	if ( document.getElementById( id ) ) {
-		Expr.find.ID = function( match, context, isXML ) {
-			if ( typeof context.getElementById !== "undefined" && !isXML ) {
-				var m = context.getElementById(match[1]);
+	// Add in style property hooks for overriding the default
+	// behavior of getting and setting a style property
+	cssHooks: {
+		opacity: {
+			get: function( elem, computed ) {
+				if ( computed ) {
 
-				return m ?
-					m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
-						[m] :
-						undefined :
-					[];
+					// We should always get a number back from opacity
+					var ret = curCSS( elem, "opacity" );
+					return ret === "" ? "1" : ret;
+				}
 			}
-		};
+		}
+	},
 
-		Expr.filter.ID = function( elem, match ) {
-			var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+	// Don't automatically add "px" to these possibly-unitless properties
+	cssNumber: {
+		"animationIterationCount": true,
+		"columnCount": true,
+		"fillOpacity": true,
+		"flexGrow": true,
+		"flexShrink": true,
+		"fontWeight": true,
+		"lineHeight": true,
+		"opacity": true,
+		"order": true,
+		"orphans": true,
+		"widows": true,
+		"zIndex": true,
+		"zoom": true
+	},
 
-			return elem.nodeType === 1 && node && node.nodeValue === match;
-		};
-	}
+	// Add in properties whose names you wish to fix before
+	// setting or getting the value
+	cssProps: {
 
-	root.removeChild( form );
+		// normalize float css property
+		"float": support.cssFloat ? "cssFloat" : "styleFloat"
+	},
 
-	// release memory in IE
-	root = form = null;
-})();
+	// Get and set the style property on a DOM Node
+	style: function( elem, name, value, extra ) {
 
-(function(){
-	// Check to see if the browser returns only elements
-	// when doing getElementsByTagName("*")
+		// Don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+			return;
+		}
 
-	// Create a fake element
-	var div = document.createElement("div");
-	div.appendChild( document.createComment("") );
+		// Make sure that we're working with the right name
+		var ret, type, hooks,
+			origName = jQuery.camelCase( name ),
+			style = elem.style;
 
-	// Make sure no comments are found
-	if ( div.getElementsByTagName("*").length > 0 ) {
-		Expr.find.TAG = function( match, context ) {
-			var results = context.getElementsByTagName( match[1] );
+		name = jQuery.cssProps[ origName ] ||
+			( jQuery.cssProps[ origName ] = vendorPropName( origName ) || origName );
 
-			// Filter out possible comments
-			if ( match[1] === "*" ) {
-				var tmp = [];
+		// gets hook for the prefixed version
+		// followed by the unprefixed version
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
 
-				for ( var i = 0; results[i]; i++ ) {
-					if ( results[i].nodeType === 1 ) {
-						tmp.push( results[i] );
-					}
-				}
+		// Check if we're setting a value
+		if ( value !== undefined ) {
+			type = typeof value;
 
-				results = tmp;
+			// Convert "+=" or "-=" to relative numbers (#7345)
+			if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
+				value = adjustCSS( elem, name, ret );
+
+				// Fixes bug #9237
+				type = "number";
 			}
 
-			return results;
-		};
-	}
+			// Make sure that null and NaN values aren't set. See: #7116
+			if ( value == null || value !== value ) {
+				return;
+			}
 
-	// Check to see if an attribute returns normalized href attributes
-	div.innerHTML = "<a href='#'></a>";
+			// If a number was passed in, add the unit (except for certain CSS properties)
+			if ( type === "number" ) {
+				value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" );
+			}
 
-	if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
-			div.firstChild.getAttribute("href") !== "#" ) {
+			// Fixes #8908, it can be done more correctly by specifing setters in cssHooks,
+			// but it would mean to define eight
+			// (for every problematic property) identical functions
+			if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
+				style[ name ] = "inherit";
+			}
 
-		Expr.attrHandle.href = function( elem ) {
-			return elem.getAttribute( "href", 2 );
-		};
-	}
+			// If a hook was provided, use that value, otherwise just set the specified value
+			if ( !hooks || !( "set" in hooks ) ||
+				( value = hooks.set( elem, value, extra ) ) !== undefined ) {
 
-	// release memory in IE
-	div = null;
-})();
+				// Support: IE
+				// Swallow errors from 'invalid' CSS values (#5509)
+				try {
+					style[ name ] = value;
+				} catch ( e ) {}
+			}
 
-if ( document.querySelectorAll ) {
-	(function(){
-		var oldSizzle = Sizzle,
-			div = document.createElement("div"),
-			id = "__sizzle__";
+		} else {
 
-		div.innerHTML = "<p class='TEST'></p>";
+			// If a hook was provided get the non-computed value from there
+			if ( hooks && "get" in hooks &&
+				( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
 
-		// Safari can't handle uppercase or unicode characters when
-		// in quirks mode.
-		if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
-			return;
+				return ret;
+			}
+
+			// Otherwise just get the value from the style object
+			return style[ name ];
 		}
+	},
 
-		Sizzle = function( query, context, extra, seed ) {
-			context = context || document;
+	css: function( elem, name, extra, styles ) {
+		var num, val, hooks,
+			origName = jQuery.camelCase( name );
 
-			// Only use querySelectorAll on non-XML documents
-			// (ID selectors don't work in non-HTML documents)
-			if ( !seed && !Sizzle.isXML(context) ) {
-				// See if we find a selector to speed up
-				var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query );
+		// Make sure that we're working with the right name
+		name = jQuery.cssProps[ origName ] ||
+			( jQuery.cssProps[ origName ] = vendorPropName( origName ) || origName );
 
-				if ( match && (context.nodeType === 1 || context.nodeType === 9) ) {
-					// Speed-up: Sizzle("TAG")
-					if ( match[1] ) {
-						return makeArray( context.getElementsByTagName( query ), extra );
+		// gets hook for the prefixed version
+		// followed by the unprefixed version
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
 
-					// Speed-up: Sizzle(".CLASS")
-					} else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) {
-						return makeArray( context.getElementsByClassName( match[2] ), extra );
-					}
-				}
+		// If a hook was provided get the computed value from there
+		if ( hooks && "get" in hooks ) {
+			val = hooks.get( elem, true, extra );
+		}
 
-				if ( context.nodeType === 9 ) {
-					// Speed-up: Sizzle("body")
-					// The body element only exists once, optimize finding it
-					if ( query === "body" && context.body ) {
-						return makeArray( [ context.body ], extra );
-
-					// Speed-up: Sizzle("#ID")
-					} else if ( match && match[3] ) {
-						var elem = context.getElementById( match[3] );
-
-						// Check parentNode to catch when Blackberry 4.6 returns
-						// nodes that are no longer in the document #6963
-						if ( elem && elem.parentNode ) {
-							// Handle the case where IE and Opera return items
-							// by name instead of ID
-							if ( elem.id === match[3] ) {
-								return makeArray( [ elem ], extra );
-							}
+		// Otherwise, if a way to get the computed value exists, use that
+		if ( val === undefined ) {
+			val = curCSS( elem, name, styles );
+		}
 
-						} else {
-							return makeArray( [], extra );
-						}
-					}
+		//convert "normal" to computed value
+		if ( val === "normal" && name in cssNormalTransform ) {
+			val = cssNormalTransform[ name ];
+		}
 
-					try {
-						return makeArray( context.querySelectorAll(query), extra );
-					} catch(qsaError) {}
-
-				// qSA works strangely on Element-rooted queries
-				// We can work around this by specifying an extra ID on the root
-				// and working up from there (Thanks to Andrew Dupont for the technique)
-				// IE 8 doesn't work on object elements
-				} else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
-					var oldContext = context,
-						old = context.getAttribute( "id" ),
-						nid = old || id,
-						hasParent = context.parentNode,
-						relativeHierarchySelector = /^\s*[+~]/.test( query );
-
-					if ( !old ) {
-						context.setAttribute( "id", nid );
-					} else {
-						nid = nid.replace( /'/g, "\\$&" );
-					}
-					if ( relativeHierarchySelector && hasParent ) {
-						context = context.parentNode;
-					}
+		// Return, converting to number if forced or a qualifier was provided and val looks numeric
+		if ( extra === "" || extra ) {
+			num = parseFloat( val );
+			return extra === true || isFinite( num ) ? num || 0 : val;
+		}
+		return val;
+	}
+} );
 
-					try {
-						if ( !relativeHierarchySelector || hasParent ) {
-							return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra );
-						}
+jQuery.each( [ "height", "width" ], function( i, name ) {
+	jQuery.cssHooks[ name ] = {
+		get: function( elem, computed, extra ) {
+			if ( computed ) {
 
-					} catch(pseudoError) {
-					} finally {
-						if ( !old ) {
-							oldContext.removeAttribute( "id" );
-						}
-					}
-				}
+				// certain elements can have dimension info if we invisibly show them
+				// however, it must have a current display style that would benefit from this
+				return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
+					elem.offsetWidth === 0 ?
+						swap( elem, cssShow, function() {
+							return getWidthOrHeight( elem, name, extra );
+						} ) :
+						getWidthOrHeight( elem, name, extra );
 			}
+		},
 
-			return oldSizzle(query, context, extra, seed);
-		};
-
-		for ( var prop in oldSizzle ) {
-			Sizzle[ prop ] = oldSizzle[ prop ];
+		set: function( elem, value, extra ) {
+			var styles = extra && getStyles( elem );
+			return setPositiveNumber( elem, value, extra ?
+				augmentWidthOrHeight(
+					elem,
+					name,
+					extra,
+					support.boxSizing &&
+						jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+					styles
+				) : 0
+			);
 		}
+	};
+} );
 
-		// release memory in IE
-		div = null;
-	})();
-}
+if ( !support.opacity ) {
+	jQuery.cssHooks.opacity = {
+		get: function( elem, computed ) {
 
-(function(){
-	var html = document.documentElement,
-		matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector;
+			// IE uses filters for opacity
+			return ropacity.test( ( computed && elem.currentStyle ?
+				elem.currentStyle.filter :
+				elem.style.filter ) || "" ) ?
+					( 0.01 * parseFloat( RegExp.$1 ) ) + "" :
+					computed ? "1" : "";
+		},
 
-	if ( matches ) {
-		// Check to see if it's possible to do matchesSelector
-		// on a disconnected node (IE 9 fails this)
-		var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ),
-			pseudoWorks = false;
+		set: function( elem, value ) {
+			var style = elem.style,
+				currentStyle = elem.currentStyle,
+				opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
+				filter = currentStyle && currentStyle.filter || style.filter || "";
 
-		try {
-			// This should fail with an exception
-			// Gecko does not error, returns false instead
-			matches.call( document.documentElement, "[test!='']:sizzle" );
+			// IE has trouble with opacity if it does not have layout
+			// Force it by setting the zoom level
+			style.zoom = 1;
 
-		} catch( pseudoError ) {
-			pseudoWorks = true;
-		}
+			// if setting opacity to 1, and no other filters exist -
+			// attempt to remove filter attribute #6652
+			// if value === "", then remove inline opacity #12685
+			if ( ( value >= 1 || value === "" ) &&
+					jQuery.trim( filter.replace( ralpha, "" ) ) === "" &&
+					style.removeAttribute ) {
 
-		Sizzle.matchesSelector = function( node, expr ) {
-			// Make sure that attribute selectors are quoted
-			expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']");
+				// Setting style.filter to null, "" & " " still leave "filter:" in the cssText
+				// if "filter:" is present at all, clearType is disabled, we want to avoid this
+				// style.removeAttribute is IE Only, but so apparently is this code path...
+				style.removeAttribute( "filter" );
 
-			if ( !Sizzle.isXML( node ) ) {
-				try {
-					if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
-						var ret = matches.call( node, expr );
-
-						// IE 9's matchesSelector returns false on disconnected nodes
-						if ( ret || !disconnectedMatch ||
-								// As well, disconnected nodes are said to be in a document
-								// fragment in IE 9, so check for that
-								node.document && node.document.nodeType !== 11 ) {
-							return ret;
-						}
-					}
-				} catch(e) {}
+				// if there is no filter style applied in a css rule
+				// or unset inline opacity, we are done
+				if ( value === "" || currentStyle && !currentStyle.filter ) {
+					return;
+				}
 			}
 
-			return Sizzle(expr, null, null, [node]).length > 0;
-		};
-	}
-})();
-
-(function(){
-	var div = document.createElement("div");
-
-	div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+			// otherwise, set new filter values
+			style.filter = ralpha.test( filter ) ?
+				filter.replace( ralpha, opacity ) :
+				filter + " " + opacity;
+		}
+	};
+}
 
-	// Opera can't find a second classname (in 9.6)
-	// Also, make sure that getElementsByClassName actually exists
-	if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
-		return;
+jQuery.cssHooks.marginRight = addGetHookIf( support.reliableMarginRight,
+	function( elem, computed ) {
+		if ( computed ) {
+			return swap( elem, { "display": "inline-block" },
+				curCSS, [ elem, "marginRight" ] );
+		}
 	}
-
-	// Safari caches class attributes, doesn't catch changes (in 3.2)
-	div.lastChild.className = "e";
-
-	if ( div.getElementsByClassName("e").length === 1 ) {
-		return;
+);
+
+jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
+	function( elem, computed ) {
+		if ( computed ) {
+			return (
+				parseFloat( curCSS( elem, "marginLeft" ) ) ||
+
+				// Support: IE<=11+
+				// Running getBoundingClientRect on a disconnected node in IE throws an error
+				// Support: IE8 only
+				// getClientRects() errors on disconnected elems
+				( jQuery.contains( elem.ownerDocument, elem ) ?
+					elem.getBoundingClientRect().left -
+						swap( elem, { marginLeft: 0 }, function() {
+							return elem.getBoundingClientRect().left;
+						} ) :
+					0
+				)
+			) + "px";
+		}
 	}
+);
 
-	Expr.order.splice(1, 0, "CLASS");
-	Expr.find.CLASS = function( match, context, isXML ) {
-		if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
-			return context.getElementsByClassName(match[1]);
-		}
-	};
+// These hooks are used by animate to expand properties
+jQuery.each( {
+	margin: "",
+	padding: "",
+	border: "Width"
+}, function( prefix, suffix ) {
+	jQuery.cssHooks[ prefix + suffix ] = {
+		expand: function( value ) {
+			var i = 0,
+				expanded = {},
 
-	// release memory in IE
-	div = null;
-})();
+				// assumes a single number if not a string
+				parts = typeof value === "string" ? value.split( " " ) : [ value ];
 
-function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
-	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
-		var elem = checkSet[i];
+			for ( ; i < 4; i++ ) {
+				expanded[ prefix + cssExpand[ i ] + suffix ] =
+					parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+			}
 
-		if ( elem ) {
-			var match = false;
+			return expanded;
+		}
+	};
 
-			elem = elem[dir];
+	if ( !rmargin.test( prefix ) ) {
+		jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+	}
+} );
 
-			while ( elem ) {
-				if ( elem[ expando ] === doneName ) {
-					match = checkSet[elem.sizset];
-					break;
-				}
+jQuery.fn.extend( {
+	css: function( name, value ) {
+		return access( this, function( elem, name, value ) {
+			var styles, len,
+				map = {},
+				i = 0;
 
-				if ( elem.nodeType === 1 && !isXML ){
-					elem[ expando ] = doneName;
-					elem.sizset = i;
-				}
+			if ( jQuery.isArray( name ) ) {
+				styles = getStyles( elem );
+				len = name.length;
 
-				if ( elem.nodeName.toLowerCase() === cur ) {
-					match = elem;
-					break;
+				for ( ; i < len; i++ ) {
+					map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
 				}
 
-				elem = elem[dir];
+				return map;
 			}
 
-			checkSet[i] = match;
+			return value !== undefined ?
+				jQuery.style( elem, name, value ) :
+				jQuery.css( elem, name );
+		}, name, value, arguments.length > 1 );
+	},
+	show: function() {
+		return showHide( this, true );
+	},
+	hide: function() {
+		return showHide( this );
+	},
+	toggle: function( state ) {
+		if ( typeof state === "boolean" ) {
+			return state ? this.show() : this.hide();
 		}
-	}
-}
 
-function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
-	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
-		var elem = checkSet[i];
-
-		if ( elem ) {
-			var match = false;
+		return this.each( function() {
+			if ( isHidden( this ) ) {
+				jQuery( this ).show();
+			} else {
+				jQuery( this ).hide();
+			}
+		} );
+	}
+} );
 
-			elem = elem[dir];
 
-			while ( elem ) {
-				if ( elem[ expando ] === doneName ) {
-					match = checkSet[elem.sizset];
-					break;
-				}
+function Tween( elem, options, prop, end, easing ) {
+	return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
 
-				if ( elem.nodeType === 1 ) {
-					if ( !isXML ) {
-						elem[ expando ] = doneName;
-						elem.sizset = i;
-					}
+Tween.prototype = {
+	constructor: Tween,
+	init: function( elem, options, prop, end, easing, unit ) {
+		this.elem = elem;
+		this.prop = prop;
+		this.easing = easing || jQuery.easing._default;
+		this.options = options;
+		this.start = this.now = this.cur();
+		this.end = end;
+		this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+	},
+	cur: function() {
+		var hooks = Tween.propHooks[ this.prop ];
 
-					if ( typeof cur !== "string" ) {
-						if ( elem === cur ) {
-							match = true;
-							break;
-						}
+		return hooks && hooks.get ?
+			hooks.get( this ) :
+			Tween.propHooks._default.get( this );
+	},
+	run: function( percent ) {
+		var eased,
+			hooks = Tween.propHooks[ this.prop ];
 
-					} else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
-						match = elem;
-						break;
-					}
-				}
+		if ( this.options.duration ) {
+			this.pos = eased = jQuery.easing[ this.easing ](
+				percent, this.options.duration * percent, 0, 1, this.options.duration
+			);
+		} else {
+			this.pos = eased = percent;
+		}
+		this.now = ( this.end - this.start ) * eased + this.start;
 
-				elem = elem[dir];
-			}
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
 
-			checkSet[i] = match;
+		if ( hooks && hooks.set ) {
+			hooks.set( this );
+		} else {
+			Tween.propHooks._default.set( this );
 		}
+		return this;
 	}
-}
+};
 
-if ( document.documentElement.contains ) {
-	Sizzle.contains = function( a, b ) {
-		return a !== b && (a.contains ? a.contains(b) : true);
-	};
+Tween.prototype.init.prototype = Tween.prototype;
 
-} else if ( document.documentElement.compareDocumentPosition ) {
-	Sizzle.contains = function( a, b ) {
-		return !!(a.compareDocumentPosition(b) & 16);
-	};
+Tween.propHooks = {
+	_default: {
+		get: function( tween ) {
+			var result;
 
-} else {
-	Sizzle.contains = function() {
-		return false;
-	};
-}
+			// Use a property on the element directly when it is not a DOM element,
+			// or when there is no matching style property that exists.
+			if ( tween.elem.nodeType !== 1 ||
+				tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
+				return tween.elem[ tween.prop ];
+			}
 
-Sizzle.isXML = function( elem ) {
-	// documentElement is verified for cases where it doesn't yet exist
-	// (such as loading iframes in IE - #4833)
-	var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+			// passing an empty string as a 3rd parameter to .css will automatically
+			// attempt a parseFloat and fallback to a string if the parse fails
+			// so, simple values such as "10px" are parsed to Float.
+			// complex values such as "rotate(1rad)" are returned as is.
+			result = jQuery.css( tween.elem, tween.prop, "" );
 
-	return documentElement ? documentElement.nodeName !== "HTML" : false;
+			// Empty strings, null, undefined and "auto" are converted to 0.
+			return !result || result === "auto" ? 0 : result;
+		},
+		set: function( tween ) {
+
+			// use step hook for back compat - use cssHook if its there - use .style if its
+			// available and use plain properties where available
+			if ( jQuery.fx.step[ tween.prop ] ) {
+				jQuery.fx.step[ tween.prop ]( tween );
+			} else if ( tween.elem.nodeType === 1 &&
+				( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null ||
+					jQuery.cssHooks[ tween.prop ] ) ) {
+				jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+			} else {
+				tween.elem[ tween.prop ] = tween.now;
+			}
+		}
+	}
 };
 
-var posProcess = function( selector, context, seed ) {
-	var match,
-		tmpSet = [],
-		later = "",
-		root = context.nodeType ? [context] : context;
+// Support: IE <=9
+// Panic based approach to setting things on disconnected nodes
 
-	// Position selectors must be done after the filter
-	// And so must :not(positional) so we move all PSEUDOs to the end
-	while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
-		later += match[0];
-		selector = selector.replace( Expr.match.PSEUDO, "" );
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+	set: function( tween ) {
+		if ( tween.elem.nodeType && tween.elem.parentNode ) {
+			tween.elem[ tween.prop ] = tween.now;
+		}
 	}
+};
 
-	selector = Expr.relative[selector] ? selector + "*" : selector;
+jQuery.easing = {
+	linear: function( p ) {
+		return p;
+	},
+	swing: function( p ) {
+		return 0.5 - Math.cos( p * Math.PI ) / 2;
+	},
+	_default: "swing"
+};
 
-	for ( var i = 0, l = root.length; i < l; i++ ) {
-		Sizzle( selector, root[i], tmpSet, seed );
-	}
+jQuery.fx = Tween.prototype.init;
 
-	return Sizzle.filter( later, tmpSet );
-};
+// Back Compat <1.8 extension point
+jQuery.fx.step = {};
 
-// EXPOSE
-// Override sizzle attribute retrieval
-Sizzle.attr = jQuery.attr;
-Sizzle.selectors.attrMap = {};
-jQuery.find = Sizzle;
-jQuery.expr = Sizzle.selectors;
-jQuery.expr[":"] = jQuery.expr.filters;
-jQuery.unique = Sizzle.uniqueSort;
-jQuery.text = Sizzle.getText;
-jQuery.isXMLDoc = Sizzle.isXML;
-jQuery.contains = Sizzle.contains;
 
 
-})();
 
+var
+	fxNow, timerId,
+	rfxtypes = /^(?:toggle|show|hide)$/,
+	rrun = /queueHooks$/;
 
-var runtil = /Until$/,
-	rparentsprev = /^(?:parents|prevUntil|prevAll)/,
-	// Note: This RegExp should be improved, or likely pulled from Sizzle
-	rmultiselector = /,/,
-	isSimple = /^.[^:#\[\.,]*$/,
-	slice = Array.prototype.slice,
-	POS = jQuery.expr.match.globalPOS,
-	// methods guaranteed to produce a unique set when starting from a unique set
-	guaranteedUnique = {
-		children: true,
-		contents: true,
-		next: true,
-		prev: true
-	};
+// Animations created synchronously will run synchronously
+function createFxNow() {
+	window.setTimeout( function() {
+		fxNow = undefined;
+	} );
+	return ( fxNow = jQuery.now() );
+}
 
-jQuery.fn.extend({
-	find: function( selector ) {
-		var self = this,
-			i, l;
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+	var which,
+		attrs = { height: type },
+		i = 0;
+
+	// if we include width, step value is 1 to do all cssExpand values,
+	// if we don't include width, step value is 2 to skip over Left and Right
+	includeWidth = includeWidth ? 1 : 0;
+	for ( ; i < 4 ; i += 2 - includeWidth ) {
+		which = cssExpand[ i ];
+		attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+	}
 
-		if ( typeof selector !== "string" ) {
-			return jQuery( selector ).filter(function() {
-				for ( i = 0, l = self.length; i < l; i++ ) {
-					if ( jQuery.contains( self[ i ], this ) ) {
-						return true;
-					}
-				}
-			});
-		}
+	if ( includeWidth ) {
+		attrs.opacity = attrs.width = type;
+	}
 
-		var ret = this.pushStack( "", "find", selector ),
-			length, n, r;
+	return attrs;
+}
 
-		for ( i = 0, l = this.length; i < l; i++ ) {
-			length = ret.length;
-			jQuery.find( selector, this[i], ret );
+function createTween( value, prop, animation ) {
+	var tween,
+		collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ),
+		index = 0,
+		length = collection.length;
+	for ( ; index < length; index++ ) {
+		if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
 
-			if ( i > 0 ) {
-				// Make sure that the results are unique
-				for ( n = length; n < ret.length; n++ ) {
-					for ( r = 0; r < length; r++ ) {
-						if ( ret[r] === ret[n] ) {
-							ret.splice(n--, 1);
-							break;
-						}
-					}
-				}
-			}
+			// we're done with this property
+			return tween;
 		}
+	}
+}
 
-		return ret;
-	},
-
-	has: function( target ) {
-		var targets = jQuery( target );
-		return this.filter(function() {
-			for ( var i = 0, l = targets.length; i < l; i++ ) {
-				if ( jQuery.contains( this, targets[i] ) ) {
-					return true;
+function defaultPrefilter( elem, props, opts ) {
+	/* jshint validthis: true */
+	var prop, value, toggle, tween, hooks, oldfire, display, checkDisplay,
+		anim = this,
+		orig = {},
+		style = elem.style,
+		hidden = elem.nodeType && isHidden( elem ),
+		dataShow = jQuery._data( elem, "fxshow" );
+
+	// handle queue: false promises
+	if ( !opts.queue ) {
+		hooks = jQuery._queueHooks( elem, "fx" );
+		if ( hooks.unqueued == null ) {
+			hooks.unqueued = 0;
+			oldfire = hooks.empty.fire;
+			hooks.empty.fire = function() {
+				if ( !hooks.unqueued ) {
+					oldfire();
 				}
-			}
-		});
-	},
+			};
+		}
+		hooks.unqueued++;
 
-	not: function( selector ) {
-		return this.pushStack( winnow(this, selector, false), "not", selector);
-	},
+		anim.always( function() {
 
-	filter: function( selector ) {
-		return this.pushStack( winnow(this, selector, true), "filter", selector );
-	},
+			// doing this makes sure that the complete handler will be called
+			// before this completes
+			anim.always( function() {
+				hooks.unqueued--;
+				if ( !jQuery.queue( elem, "fx" ).length ) {
+					hooks.empty.fire();
+				}
+			} );
+		} );
+	}
 
-	is: function( selector ) {
-		return !!selector && (
-			typeof selector === "string" ?
-				// If this is a positional selector, check membership in the returned set
-				// so $("p:first").is("p:last") won't return true for a doc with two "p".
-				POS.test( selector ) ?
-					jQuery( selector, this.context ).index( this[0] ) >= 0 :
-					jQuery.filter( selector, this ).length > 0 :
-				this.filter( selector ).length > 0 );
-	},
+	// height/width overflow pass
+	if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) {
 
-	closest: function( selectors, context ) {
-		var ret = [], i, l, cur = this[0];
+		// Make sure that nothing sneaks out
+		// Record all 3 overflow attributes because IE does not
+		// change the overflow attribute when overflowX and
+		// overflowY are set to the same value
+		opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
 
-		// Array (deprecated as of jQuery 1.7)
-		if ( jQuery.isArray( selectors ) ) {
-			var level = 1;
+		// Set display property to inline-block for height/width
+		// animations on inline elements that are having width/height animated
+		display = jQuery.css( elem, "display" );
 
-			while ( cur && cur.ownerDocument && cur !== context ) {
-				for ( i = 0; i < selectors.length; i++ ) {
+		// Test default display if display is currently "none"
+		checkDisplay = display === "none" ?
+			jQuery._data( elem, "olddisplay" ) || defaultDisplay( elem.nodeName ) : display;
 
-					if ( jQuery( cur ).is( selectors[ i ] ) ) {
-						ret.push({ selector: selectors[ i ], elem: cur, level: level });
-					}
-				}
+		if ( checkDisplay === "inline" && jQuery.css( elem, "float" ) === "none" ) {
 
-				cur = cur.parentNode;
-				level++;
+			// inline-level elements accept inline-block;
+			// block-level elements need to be inline with layout
+			if ( !support.inlineBlockNeedsLayout || defaultDisplay( elem.nodeName ) === "inline" ) {
+				style.display = "inline-block";
+			} else {
+				style.zoom = 1;
 			}
-
-			return ret;
 		}
+	}
 
-		// String
-		var pos = POS.test( selectors ) || typeof selectors !== "string" ?
-				jQuery( selectors, context || this.context ) :
-				0;
-
-		for ( i = 0, l = this.length; i < l; i++ ) {
-			cur = this[i];
-
-			while ( cur ) {
-				if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
-					ret.push( cur );
-					break;
+	if ( opts.overflow ) {
+		style.overflow = "hidden";
+		if ( !support.shrinkWrapBlocks() ) {
+			anim.always( function() {
+				style.overflow = opts.overflow[ 0 ];
+				style.overflowX = opts.overflow[ 1 ];
+				style.overflowY = opts.overflow[ 2 ];
+			} );
+		}
+	}
 
+	// show/hide pass
+	for ( prop in props ) {
+		value = props[ prop ];
+		if ( rfxtypes.exec( value ) ) {
+			delete props[ prop ];
+			toggle = toggle || value === "toggle";
+			if ( value === ( hidden ? "hide" : "show" ) ) {
+
+				// If there is dataShow left over from a stopped hide or show
+				// and we are going to proceed with show, we should pretend to be hidden
+				if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
+					hidden = true;
 				} else {
-					cur = cur.parentNode;
-					if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) {
-						break;
-					}
+					continue;
 				}
 			}
-		}
+			orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
 
-		ret = ret.length > 1 ? jQuery.unique( ret ) : ret;
-
-		return this.pushStack( ret, "closest", selectors );
-	},
-
-	// Determine the position of an element within
-	// the matched set of elements
-	index: function( elem ) {
-
-		// No argument, return index in parent
-		if ( !elem ) {
-			return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1;
+		// Any non-fx value stops us from restoring the original display value
+		} else {
+			display = undefined;
 		}
+	}
 
-		// index in selector
-		if ( typeof elem === "string" ) {
-			return jQuery.inArray( this[0], jQuery( elem ) );
+	if ( !jQuery.isEmptyObject( orig ) ) {
+		if ( dataShow ) {
+			if ( "hidden" in dataShow ) {
+				hidden = dataShow.hidden;
+			}
+		} else {
+			dataShow = jQuery._data( elem, "fxshow", {} );
 		}
 
-		// Locate the position of the desired element
-		return jQuery.inArray(
-			// If it receives a jQuery object, the first element is used
-			elem.jquery ? elem[0] : elem, this );
-	},
-
-	add: function( selector, context ) {
-		var set = typeof selector === "string" ?
-				jQuery( selector, context ) :
-				jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
-			all = jQuery.merge( this.get(), set );
+		// store state if its toggle - enables .stop().toggle() to "reverse"
+		if ( toggle ) {
+			dataShow.hidden = !hidden;
+		}
+		if ( hidden ) {
+			jQuery( elem ).show();
+		} else {
+			anim.done( function() {
+				jQuery( elem ).hide();
+			} );
+		}
+		anim.done( function() {
+			var prop;
+			jQuery._removeData( elem, "fxshow" );
+			for ( prop in orig ) {
+				jQuery.style( elem, prop, orig[ prop ] );
+			}
+		} );
+		for ( prop in orig ) {
+			tween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
 
-		return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
-			all :
-			jQuery.unique( all ) );
-	},
+			if ( !( prop in dataShow ) ) {
+				dataShow[ prop ] = tween.start;
+				if ( hidden ) {
+					tween.end = tween.start;
+					tween.start = prop === "width" || prop === "height" ? 1 : 0;
+				}
+			}
+		}
 
-	andSelf: function() {
-		return this.add( this.prevObject );
+	// If this is a noop like .hide().hide(), restore an overwritten display value
+	} else if ( ( display === "none" ? defaultDisplay( elem.nodeName ) : display ) === "inline" ) {
+		style.display = display;
 	}
-});
-
-// A painfully simple check to see if an element is disconnected
-// from a document (should be improved, where feasible).
-function isDisconnected( node ) {
-	return !node || !node.parentNode || node.parentNode.nodeType === 11;
 }
 
-jQuery.each({
-	parent: function( elem ) {
-		var parent = elem.parentNode;
-		return parent && parent.nodeType !== 11 ? parent : null;
-	},
-	parents: function( elem ) {
-		return jQuery.dir( elem, "parentNode" );
-	},
-	parentsUntil: function( elem, i, until ) {
-		return jQuery.dir( elem, "parentNode", until );
-	},
-	next: function( elem ) {
-		return jQuery.nth( elem, 2, "nextSibling" );
-	},
-	prev: function( elem ) {
-		return jQuery.nth( elem, 2, "previousSibling" );
-	},
-	nextAll: function( elem ) {
-		return jQuery.dir( elem, "nextSibling" );
-	},
-	prevAll: function( elem ) {
-		return jQuery.dir( elem, "previousSibling" );
-	},
-	nextUntil: function( elem, i, until ) {
-		return jQuery.dir( elem, "nextSibling", until );
-	},
-	prevUntil: function( elem, i, until ) {
-		return jQuery.dir( elem, "previousSibling", until );
-	},
-	siblings: function( elem ) {
-		return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );
-	},
-	children: function( elem ) {
-		return jQuery.sibling( elem.firstChild );
-	},
-	contents: function( elem ) {
-		return jQuery.nodeName( elem, "iframe" ) ?
-			elem.contentDocument || elem.contentWindow.document :
-			jQuery.makeArray( elem.childNodes );
-	}
-}, function( name, fn ) {
-	jQuery.fn[ name ] = function( until, selector ) {
-		var ret = jQuery.map( this, fn, until );
+function propFilter( props, specialEasing ) {
+	var index, name, easing, value, hooks;
 
-		if ( !runtil.test( name ) ) {
-			selector = until;
+	// camelCase, specialEasing and expand cssHook pass
+	for ( index in props ) {
+		name = jQuery.camelCase( index );
+		easing = specialEasing[ name ];
+		value = props[ index ];
+		if ( jQuery.isArray( value ) ) {
+			easing = value[ 1 ];
+			value = props[ index ] = value[ 0 ];
 		}
 
-		if ( selector && typeof selector === "string" ) {
-			ret = jQuery.filter( selector, ret );
+		if ( index !== name ) {
+			props[ name ] = value;
+			delete props[ index ];
 		}
 
-		ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
+		hooks = jQuery.cssHooks[ name ];
+		if ( hooks && "expand" in hooks ) {
+			value = hooks.expand( value );
+			delete props[ name ];
 
-		if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
-			ret = ret.reverse();
+			// not quite $.extend, this wont overwrite keys already present.
+			// also - reusing 'index' from above because we have the correct "name"
+			for ( index in value ) {
+				if ( !( index in props ) ) {
+					props[ index ] = value[ index ];
+					specialEasing[ index ] = easing;
+				}
+			}
+		} else {
+			specialEasing[ name ] = easing;
 		}
+	}
+}
 
-		return this.pushStack( ret, name, slice.call( arguments ).join(",") );
-	};
-});
+function Animation( elem, properties, options ) {
+	var result,
+		stopped,
+		index = 0,
+		length = Animation.prefilters.length,
+		deferred = jQuery.Deferred().always( function() {
+
+			// don't match elem in the :animated selector
+			delete tick.elem;
+		} ),
+		tick = function() {
+			if ( stopped ) {
+				return false;
+			}
+			var currentTime = fxNow || createFxNow(),
+				remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
 
-jQuery.extend({
-	filter: function( expr, elems, not ) {
-		if ( not ) {
-			expr = ":not(" + expr + ")";
-		}
+				// Support: Android 2.3
+				// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
+				temp = remaining / animation.duration || 0,
+				percent = 1 - temp,
+				index = 0,
+				length = animation.tweens.length;
 
-		return elems.length === 1 ?
-			jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
-			jQuery.find.matches(expr, elems);
-	},
+			for ( ; index < length ; index++ ) {
+				animation.tweens[ index ].run( percent );
+			}
 
-	dir: function( elem, dir, until ) {
-		var matched = [],
-			cur = elem[ dir ];
+			deferred.notifyWith( elem, [ animation, percent, remaining ] );
 
-		while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
-			if ( cur.nodeType === 1 ) {
-				matched.push( cur );
+			if ( percent < 1 && length ) {
+				return remaining;
+			} else {
+				deferred.resolveWith( elem, [ animation ] );
+				return false;
 			}
-			cur = cur[dir];
-		}
-		return matched;
-	},
+		},
+		animation = deferred.promise( {
+			elem: elem,
+			props: jQuery.extend( {}, properties ),
+			opts: jQuery.extend( true, {
+				specialEasing: {},
+				easing: jQuery.easing._default
+			}, options ),
+			originalProperties: properties,
+			originalOptions: options,
+			startTime: fxNow || createFxNow(),
+			duration: options.duration,
+			tweens: [],
+			createTween: function( prop, end ) {
+				var tween = jQuery.Tween( elem, animation.opts, prop, end,
+						animation.opts.specialEasing[ prop ] || animation.opts.easing );
+				animation.tweens.push( tween );
+				return tween;
+			},
+			stop: function( gotoEnd ) {
+				var index = 0,
 
-	nth: function( cur, result, dir, elem ) {
-		result = result || 1;
-		var num = 0;
+					// if we are going to the end, we want to run all the tweens
+					// otherwise we skip this part
+					length = gotoEnd ? animation.tweens.length : 0;
+				if ( stopped ) {
+					return this;
+				}
+				stopped = true;
+				for ( ; index < length ; index++ ) {
+					animation.tweens[ index ].run( 1 );
+				}
 
-		for ( ; cur; cur = cur[dir] ) {
-			if ( cur.nodeType === 1 && ++num === result ) {
-				break;
+				// resolve when we played the last frame
+				// otherwise, reject
+				if ( gotoEnd ) {
+					deferred.notifyWith( elem, [ animation, 1, 0 ] );
+					deferred.resolveWith( elem, [ animation, gotoEnd ] );
+				} else {
+					deferred.rejectWith( elem, [ animation, gotoEnd ] );
+				}
+				return this;
 			}
-		}
+		} ),
+		props = animation.props;
 
-		return cur;
-	},
-
-	sibling: function( n, elem ) {
-		var r = [];
+	propFilter( props, animation.opts.specialEasing );
 
-		for ( ; n; n = n.nextSibling ) {
-			if ( n.nodeType === 1 && n !== elem ) {
-				r.push( n );
+	for ( ; index < length ; index++ ) {
+		result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
+		if ( result ) {
+			if ( jQuery.isFunction( result.stop ) ) {
+				jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
+					jQuery.proxy( result.stop, result );
 			}
+			return result;
 		}
-
-		return r;
 	}
-});
-
-// Implement the identical functionality for filter and not
-function winnow( elements, qualifier, keep ) {
-
-	// Can't pass null or undefined to indexOf in Firefox 4
-	// Set to 0 to skip string check
-	qualifier = qualifier || 0;
-
-	if ( jQuery.isFunction( qualifier ) ) {
-		return jQuery.grep(elements, function( elem, i ) {
-			var retVal = !!qualifier.call( elem, i, elem );
-			return retVal === keep;
-		});
-
-	} else if ( qualifier.nodeType ) {
-		return jQuery.grep(elements, function( elem, i ) {
-			return ( elem === qualifier ) === keep;
-		});
 
-	} else if ( typeof qualifier === "string" ) {
-		var filtered = jQuery.grep(elements, function( elem ) {
-			return elem.nodeType === 1;
-		});
+	jQuery.map( props, createTween, animation );
 
-		if ( isSimple.test( qualifier ) ) {
-			return jQuery.filter(qualifier, filtered, !keep);
-		} else {
-			qualifier = jQuery.filter( qualifier, filtered );
-		}
+	if ( jQuery.isFunction( animation.opts.start ) ) {
+		animation.opts.start.call( elem, animation );
 	}
 
-	return jQuery.grep(elements, function( elem, i ) {
-		return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep;
-	});
+	jQuery.fx.timer(
+		jQuery.extend( tick, {
+			elem: elem,
+			anim: animation,
+			queue: animation.opts.queue
+		} )
+	);
+
+	// attach callbacks from options
+	return animation.progress( animation.opts.progress )
+		.done( animation.opts.done, animation.opts.complete )
+		.fail( animation.opts.fail )
+		.always( animation.opts.always );
 }
 
+jQuery.Animation = jQuery.extend( Animation, {
 
+	tweeners: {
+		"*": [ function( prop, value ) {
+			var tween = this.createTween( prop, value );
+			adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
+			return tween;
+		} ]
+	},
 
-
-function createSafeFragment( document ) {
-	var list = nodeNames.split( "|" ),
-	safeFrag = document.createDocumentFragment();
-
-	if ( safeFrag.createElement ) {
-		while ( list.length ) {
-			safeFrag.createElement(
-				list.pop()
-			);
+	tweener: function( props, callback ) {
+		if ( jQuery.isFunction( props ) ) {
+			callback = props;
+			props = [ "*" ];
+		} else {
+			props = props.match( rnotwhite );
 		}
-	}
-	return safeFrag;
-}
-
-var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
-		"header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
-	rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
-	rleadingWhitespace = /^\s+/,
-	rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,
-	rtagName = /<([\w:]+)/,
-	rtbody = /<tbody/i,
-	rhtml = /<|&#?\w+;/,
-	rnoInnerhtml = /<(?:script|style)/i,
-	rnocache = /<(?:script|object|embed|option|style)/i,
-	rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
-	// checked="checked" or checked
-	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
-	rscriptType = /\/(java|ecma)script/i,
-	rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/,
-	wrapMap = {
-		option: [ 1, "<select multiple='multiple'>", "</select>" ],
-		legend: [ 1, "<fieldset>", "</fieldset>" ],
-		thead: [ 1, "<table>", "</table>" ],
-		tr: [ 2, "<table><tbody>", "</tbody></table>" ],
-		td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
-		col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
-		area: [ 1, "<map>", "</map>" ],
-		_default: [ 0, "", "" ]
-	},
-	safeFragment = createSafeFragment( document );
-
-wrapMap.optgroup = wrapMap.option;
-wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
-wrapMap.th = wrapMap.td;
 
-// IE can't serialize <link> and <script> tags normally
-if ( !jQuery.support.htmlSerialize ) {
-	wrapMap._default = [ 1, "div<div>", "</div>" ];
-}
+		var prop,
+			index = 0,
+			length = props.length;
 
-jQuery.fn.extend({
-	text: function( value ) {
-		return jQuery.access( this, function( value ) {
-			return value === undefined ?
-				jQuery.text( this ) :
-				this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) );
-		}, null, value, arguments.length );
+		for ( ; index < length ; index++ ) {
+			prop = props[ index ];
+			Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];
+			Animation.tweeners[ prop ].unshift( callback );
+		}
 	},
 
-	wrapAll: function( html ) {
-		if ( jQuery.isFunction( html ) ) {
-			return this.each(function(i) {
-				jQuery(this).wrapAll( html.call(this, i) );
-			});
-		}
+	prefilters: [ defaultPrefilter ],
 
-		if ( this[0] ) {
-			// The elements to wrap the target around
-			var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+	prefilter: function( callback, prepend ) {
+		if ( prepend ) {
+			Animation.prefilters.unshift( callback );
+		} else {
+			Animation.prefilters.push( callback );
+		}
+	}
+} );
+
+jQuery.speed = function( speed, easing, fn ) {
+	var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+		complete: fn || !fn && easing ||
+			jQuery.isFunction( speed ) && speed,
+		duration: speed,
+		easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
+	};
 
-			if ( this[0].parentNode ) {
-				wrap.insertBefore( this[0] );
-			}
+	opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+		opt.duration in jQuery.fx.speeds ?
+			jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
 
-			wrap.map(function() {
-				var elem = this;
+	// normalize opt.queue - true/undefined/null -> "fx"
+	if ( opt.queue == null || opt.queue === true ) {
+		opt.queue = "fx";
+	}
 
-				while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
-					elem = elem.firstChild;
-				}
+	// Queueing
+	opt.old = opt.complete;
 
-				return elem;
-			}).append( this );
+	opt.complete = function() {
+		if ( jQuery.isFunction( opt.old ) ) {
+			opt.old.call( this );
 		}
 
-		return this;
-	},
-
-	wrapInner: function( html ) {
-		if ( jQuery.isFunction( html ) ) {
-			return this.each(function(i) {
-				jQuery(this).wrapInner( html.call(this, i) );
-			});
+		if ( opt.queue ) {
+			jQuery.dequeue( this, opt.queue );
 		}
+	};
 
-		return this.each(function() {
-			var self = jQuery( this ),
-				contents = self.contents();
+	return opt;
+};
 
-			if ( contents.length ) {
-				contents.wrapAll( html );
+jQuery.fn.extend( {
+	fadeTo: function( speed, to, easing, callback ) {
 
-			} else {
-				self.append( html );
-			}
-		});
+		// show any hidden elements after setting opacity to 0
+		return this.filter( isHidden ).css( "opacity", 0 ).show()
+
+			// animate to the value specified
+			.end().animate( { opacity: to }, speed, easing, callback );
 	},
+	animate: function( prop, speed, easing, callback ) {
+		var empty = jQuery.isEmptyObject( prop ),
+			optall = jQuery.speed( speed, easing, callback ),
+			doAnimation = function() {
 
-	wrap: function( html ) {
-		var isFunction = jQuery.isFunction( html );
+				// Operate on a copy of prop so per-property easing won't be lost
+				var anim = Animation( this, jQuery.extend( {}, prop ), optall );
 
-		return this.each(function(i) {
-			jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
-		});
+				// Empty animations, or finishing resolves immediately
+				if ( empty || jQuery._data( this, "finish" ) ) {
+					anim.stop( true );
+				}
+			};
+			doAnimation.finish = doAnimation;
+
+		return empty || optall.queue === false ?
+			this.each( doAnimation ) :
+			this.queue( optall.queue, doAnimation );
 	},
+	stop: function( type, clearQueue, gotoEnd ) {
+		var stopQueue = function( hooks ) {
+			var stop = hooks.stop;
+			delete hooks.stop;
+			stop( gotoEnd );
+		};
 
-	unwrap: function() {
-		return this.parent().each(function() {
-			if ( !jQuery.nodeName( this, "body" ) ) {
-				jQuery( this ).replaceWith( this.childNodes );
+		if ( typeof type !== "string" ) {
+			gotoEnd = clearQueue;
+			clearQueue = type;
+			type = undefined;
+		}
+		if ( clearQueue && type !== false ) {
+			this.queue( type || "fx", [] );
+		}
+
+		return this.each( function() {
+			var dequeue = true,
+				index = type != null && type + "queueHooks",
+				timers = jQuery.timers,
+				data = jQuery._data( this );
+
+			if ( index ) {
+				if ( data[ index ] && data[ index ].stop ) {
+					stopQueue( data[ index ] );
+				}
+			} else {
+				for ( index in data ) {
+					if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+						stopQueue( data[ index ] );
+					}
+				}
 			}
-		}).end();
-	},
 
-	append: function() {
-		return this.domManip(arguments, true, function( elem ) {
-			if ( this.nodeType === 1 ) {
-				this.appendChild( elem );
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this &&
+					( type == null || timers[ index ].queue === type ) ) {
+
+					timers[ index ].anim.stop( gotoEnd );
+					dequeue = false;
+					timers.splice( index, 1 );
+				}
 			}
-		});
-	},
 
-	prepend: function() {
-		return this.domManip(arguments, true, function( elem ) {
-			if ( this.nodeType === 1 ) {
-				this.insertBefore( elem, this.firstChild );
+			// start the next in the queue if the last step wasn't forced
+			// timers currently will call their complete callbacks, which will dequeue
+			// but only if they were gotoEnd
+			if ( dequeue || !gotoEnd ) {
+				jQuery.dequeue( this, type );
 			}
-		});
+		} );
 	},
-
-	before: function() {
-		if ( this[0] && this[0].parentNode ) {
-			return this.domManip(arguments, false, function( elem ) {
-				this.parentNode.insertBefore( elem, this );
-			});
-		} else if ( arguments.length ) {
-			var set = jQuery.clean( arguments );
-			set.push.apply( set, this.toArray() );
-			return this.pushStack( set, "before", arguments );
+	finish: function( type ) {
+		if ( type !== false ) {
+			type = type || "fx";
 		}
-	},
+		return this.each( function() {
+			var index,
+				data = jQuery._data( this ),
+				queue = data[ type + "queue" ],
+				hooks = data[ type + "queueHooks" ],
+				timers = jQuery.timers,
+				length = queue ? queue.length : 0;
 
-	after: function() {
-		if ( this[0] && this[0].parentNode ) {
-			return this.domManip(arguments, false, function( elem ) {
-				this.parentNode.insertBefore( elem, this.nextSibling );
-			});
-		} else if ( arguments.length ) {
-			var set = this.pushStack( this, "after", arguments );
-			set.push.apply( set, jQuery.clean(arguments) );
-			return set;
-		}
-	},
+			// enable finishing flag on private data
+			data.finish = true;
+
+			// empty the queue first
+			jQuery.queue( this, type, [] );
+
+			if ( hooks && hooks.stop ) {
+				hooks.stop.call( this, true );
+			}
 
-	// keepData is for internal use only--do not document
-	remove: function( selector, keepData ) {
-		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
-			if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
-				if ( !keepData && elem.nodeType === 1 ) {
-					jQuery.cleanData( elem.getElementsByTagName("*") );
-					jQuery.cleanData( [ elem ] );
+			// look for any active animations, and finish them
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+					timers[ index ].anim.stop( true );
+					timers.splice( index, 1 );
 				}
+			}
 
-				if ( elem.parentNode ) {
-					elem.parentNode.removeChild( elem );
+			// look for any animations in the old queue and finish them
+			for ( index = 0; index < length; index++ ) {
+				if ( queue[ index ] && queue[ index ].finish ) {
+					queue[ index ].finish.call( this );
 				}
 			}
-		}
 
-		return this;
-	},
+			// turn off finishing flag
+			delete data.finish;
+		} );
+	}
+} );
 
-	empty: function() {
-		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
-			// Remove element nodes and prevent memory leaks
-			if ( elem.nodeType === 1 ) {
-				jQuery.cleanData( elem.getElementsByTagName("*") );
-			}
+jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) {
+	var cssFn = jQuery.fn[ name ];
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return speed == null || typeof speed === "boolean" ?
+			cssFn.apply( this, arguments ) :
+			this.animate( genFx( name, true ), speed, easing, callback );
+	};
+} );
 
-			// Remove any remaining nodes
-			while ( elem.firstChild ) {
-				elem.removeChild( elem.firstChild );
-			}
+// Generate shortcuts for custom animations
+jQuery.each( {
+	slideDown: genFx( "show" ),
+	slideUp: genFx( "hide" ),
+	slideToggle: genFx( "toggle" ),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" },
+	fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return this.animate( props, speed, easing, callback );
+	};
+} );
+
+jQuery.timers = [];
+jQuery.fx.tick = function() {
+	var timer,
+		timers = jQuery.timers,
+		i = 0;
+
+	fxNow = jQuery.now();
+
+	for ( ; i < timers.length; i++ ) {
+		timer = timers[ i ];
+
+		// Checks the timer has not already been removed
+		if ( !timer() && timers[ i ] === timer ) {
+			timers.splice( i--, 1 );
 		}
+	}
 
-		return this;
-	},
+	if ( !timers.length ) {
+		jQuery.fx.stop();
+	}
+	fxNow = undefined;
+};
 
-	clone: function( dataAndEvents, deepDataAndEvents ) {
-		dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
-		deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+jQuery.fx.timer = function( timer ) {
+	jQuery.timers.push( timer );
+	if ( timer() ) {
+		jQuery.fx.start();
+	} else {
+		jQuery.timers.pop();
+	}
+};
 
-		return this.map( function () {
-			return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
-		});
-	},
+jQuery.fx.interval = 13;
 
-	html: function( value ) {
-		return jQuery.access( this, function( value ) {
-			var elem = this[0] || {},
-				i = 0,
-				l = this.length;
+jQuery.fx.start = function() {
+	if ( !timerId ) {
+		timerId = window.setInterval( jQuery.fx.tick, jQuery.fx.interval );
+	}
+};
 
-			if ( value === undefined ) {
-				return elem.nodeType === 1 ?
-					elem.innerHTML.replace( rinlinejQuery, "" ) :
-					null;
-			}
+jQuery.fx.stop = function() {
+	window.clearInterval( timerId );
+	timerId = null;
+};
 
+jQuery.fx.speeds = {
+	slow: 600,
+	fast: 200,
 
-			if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
-				( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&
-				!wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) {
+	// Default speed
+	_default: 400
+};
 
-				value = value.replace( rxhtmlTag, "<$1></$2>" );
 
-				try {
-					for (; i < l; i++ ) {
-						// Remove element nodes and prevent memory leaks
-						elem = this[i] || {};
-						if ( elem.nodeType === 1 ) {
-							jQuery.cleanData( elem.getElementsByTagName( "*" ) );
-							elem.innerHTML = value;
-						}
-					}
+// Based off of the plugin by Clint Helfers, with permission.
+// http://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/
+jQuery.fn.delay = function( time, type ) {
+	time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+	type = type || "fx";
 
-					elem = 0;
+	return this.queue( type, function( next, hooks ) {
+		var timeout = window.setTimeout( next, time );
+		hooks.stop = function() {
+			window.clearTimeout( timeout );
+		};
+	} );
+};
 
-				// If using innerHTML throws an exception, use the fallback method
-				} catch(e) {}
-			}
 
-			if ( elem ) {
-				this.empty().append( value );
-			}
-		}, null, value, arguments.length );
-	},
+( function() {
+	var a,
+		input = document.createElement( "input" ),
+		div = document.createElement( "div" ),
+		select = document.createElement( "select" ),
+		opt = select.appendChild( document.createElement( "option" ) );
 
-	replaceWith: function( value ) {
-		if ( this[0] && this[0].parentNode ) {
-			// Make sure that the elements are removed from the DOM before they are inserted
-			// this can help fix replacing a parent with child elements
-			if ( jQuery.isFunction( value ) ) {
-				return this.each(function(i) {
-					var self = jQuery(this), old = self.html();
-					self.replaceWith( value.call( this, i, old ) );
-				});
-			}
+	// Setup
+	div = document.createElement( "div" );
+	div.setAttribute( "className", "t" );
+	div.innerHTML = "  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+	a = div.getElementsByTagName( "a" )[ 0 ];
 
-			if ( typeof value !== "string" ) {
-				value = jQuery( value ).detach();
-			}
+	// Support: Windows Web Apps (WWA)
+	// `type` must use .setAttribute for WWA (#14901)
+	input.setAttribute( "type", "checkbox" );
+	div.appendChild( input );
 
-			return this.each(function() {
-				var next = this.nextSibling,
-					parent = this.parentNode;
+	a = div.getElementsByTagName( "a" )[ 0 ];
 
-				jQuery( this ).remove();
+	// First batch of tests.
+	a.style.cssText = "top:1px";
 
-				if ( next ) {
-					jQuery(next).before( value );
-				} else {
-					jQuery(parent).append( value );
-				}
-			});
-		} else {
-			return this.length ?
-				this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) :
-				this;
-		}
-	},
+	// Test setAttribute on camelCase class.
+	// If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+	support.getSetAttribute = div.className !== "t";
 
-	detach: function( selector ) {
-		return this.remove( selector, true );
-	},
+	// Get the style information from getAttribute
+	// (IE uses .cssText instead)
+	support.style = /top/.test( a.getAttribute( "style" ) );
 
-	domManip: function( args, table, callback ) {
-		var results, first, fragment, parent,
-			value = args[0],
-			scripts = [];
+	// Make sure that URLs aren't manipulated
+	// (IE normalizes it by default)
+	support.hrefNormalized = a.getAttribute( "href" ) === "/a";
 
-		// We can't cloneNode fragments that contain checked, in WebKit
-		if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
-			return this.each(function() {
-				jQuery(this).domManip( args, table, callback, true );
-			});
-		}
+	// Check the default checkbox/radio value ("" on WebKit; "on" elsewhere)
+	support.checkOn = !!input.value;
 
-		if ( jQuery.isFunction(value) ) {
-			return this.each(function(i) {
-				var self = jQuery(this);
-				args[0] = value.call(this, i, table ? self.html() : undefined);
-				self.domManip( args, table, callback );
-			});
-		}
+	// Make sure that a selected-by-default option has a working selected property.
+	// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+	support.optSelected = opt.selected;
+
+	// Tests for enctype support on a form (#6743)
+	support.enctype = !!document.createElement( "form" ).enctype;
+
+	// Make sure that the options inside disabled selects aren't marked as disabled
+	// (WebKit marks them as disabled)
+	select.disabled = true;
+	support.optDisabled = !opt.disabled;
 
-		if ( this[0] ) {
-			parent = value && value.parentNode;
+	// Support: IE8 only
+	// Check if we can trust getAttribute("value")
+	input = document.createElement( "input" );
+	input.setAttribute( "value", "" );
+	support.input = input.getAttribute( "value" ) === "";
 
-			// If we're in a fragment, just use that instead of building a new one
-			if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
-				results = { fragment: parent };
+	// Check if an input maintains its value after becoming a radio
+	input.value = "t";
+	input.setAttribute( "type", "radio" );
+	support.radioValue = input.value === "t";
+} )();
 
-			} else {
-				results = jQuery.buildFragment( args, this, scripts );
-			}
 
-			fragment = results.fragment;
+var rreturn = /\r/g,
+	rspaces = /[\x20\t\r\n\f]+/g;
 
-			if ( fragment.childNodes.length === 1 ) {
-				first = fragment = fragment.firstChild;
-			} else {
-				first = fragment.firstChild;
-			}
-
-			if ( first ) {
-				table = table && jQuery.nodeName( first, "tr" );
-
-				for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) {
-					callback.call(
-						table ?
-							root(this[i], first) :
-							this[i],
-						// Make sure that we do not leak memory by inadvertently discarding
-						// the original fragment (which might have attached data) instead of
-						// using it; in addition, use the original fragment object for the last
-						// item instead of first because it can end up being emptied incorrectly
-						// in certain situations (Bug #8070).
-						// Fragments from the fragment cache must always be cloned and never used
-						// in place.
-						results.cacheable || ( l > 1 && i < lastIndex ) ?
-							jQuery.clone( fragment, true, true ) :
-							fragment
-					);
+jQuery.fn.extend( {
+	val: function( value ) {
+		var hooks, ret, isFunction,
+			elem = this[ 0 ];
+
+		if ( !arguments.length ) {
+			if ( elem ) {
+				hooks = jQuery.valHooks[ elem.type ] ||
+					jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+				if (
+					hooks &&
+					"get" in hooks &&
+					( ret = hooks.get( elem, "value" ) ) !== undefined
+				) {
+					return ret;
 				}
-			}
 
-			if ( scripts.length ) {
-				jQuery.each( scripts, function( i, elem ) {
-					if ( elem.src ) {
-						jQuery.ajax({
-							type: "GET",
-							global: false,
-							url: elem.src,
-							async: false,
-							dataType: "script"
-						});
-					} else {
-						jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) );
-					}
+				ret = elem.value;
 
-					if ( elem.parentNode ) {
-						elem.parentNode.removeChild( elem );
-					}
-				});
-			}
-		}
+				return typeof ret === "string" ?
 
-		return this;
-	}
-});
+					// handle most common string cases
+					ret.replace( rreturn, "" ) :
 
-function root( elem, cur ) {
-	return jQuery.nodeName(elem, "table") ?
-		(elem.getElementsByTagName("tbody")[0] ||
-		elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
-		elem;
-}
+					// handle cases where value is null/undef or number
+					ret == null ? "" : ret;
+			}
 
-function cloneCopyEvent( src, dest ) {
+			return;
+		}
 
-	if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
-		return;
-	}
+		isFunction = jQuery.isFunction( value );
 
-	var type, i, l,
-		oldData = jQuery._data( src ),
-		curData = jQuery._data( dest, oldData ),
-		events = oldData.events;
+		return this.each( function( i ) {
+			var val;
 
-	if ( events ) {
-		delete curData.handle;
-		curData.events = {};
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
 
-		for ( type in events ) {
-			for ( i = 0, l = events[ type ].length; i < l; i++ ) {
-				jQuery.event.add( dest, type, events[ type ][ i ] );
+			if ( isFunction ) {
+				val = value.call( this, i, jQuery( this ).val() );
+			} else {
+				val = value;
 			}
-		}
-	}
 
-	// make the cloned public data object a copy from the original
-	if ( curData.data ) {
-		curData.data = jQuery.extend( {}, curData.data );
-	}
-}
+			// Treat null/undefined as ""; convert numbers to string
+			if ( val == null ) {
+				val = "";
+			} else if ( typeof val === "number" ) {
+				val += "";
+			} else if ( jQuery.isArray( val ) ) {
+				val = jQuery.map( val, function( value ) {
+					return value == null ? "" : value + "";
+				} );
+			}
 
-function cloneFixAttributes( src, dest ) {
-	var nodeName;
+			hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
 
-	// We do not need to do anything for non-Elements
-	if ( dest.nodeType !== 1 ) {
-		return;
+			// If set returns undefined, fall back to normal setting
+			if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) {
+				this.value = val;
+			}
+		} );
 	}
+} );
 
-	// clearAttributes removes the attributes, which we don't want,
-	// but also removes the attachEvent events, which we *do* want
-	if ( dest.clearAttributes ) {
-		dest.clearAttributes();
-	}
+jQuery.extend( {
+	valHooks: {
+		option: {
+			get: function( elem ) {
+				var val = jQuery.find.attr( elem, "value" );
+				return val != null ?
+					val :
 
-	// mergeAttributes, in contrast, only merges back on the
-	// original attributes, not the events
-	if ( dest.mergeAttributes ) {
-		dest.mergeAttributes( src );
-	}
+					// Support: IE10-11+
+					// option.text throws exceptions (#14686, #14858)
+					// Strip and collapse whitespace
+					// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
+					jQuery.trim( jQuery.text( elem ) ).replace( rspaces, " " );
+			}
+		},
+		select: {
+			get: function( elem ) {
+				var value, option,
+					options = elem.options,
+					index = elem.selectedIndex,
+					one = elem.type === "select-one" || index < 0,
+					values = one ? null : [],
+					max = one ? index + 1 : options.length,
+					i = index < 0 ?
+						max :
+						one ? index : 0;
 
-	nodeName = dest.nodeName.toLowerCase();
+				// Loop through all the selected options
+				for ( ; i < max; i++ ) {
+					option = options[ i ];
 
-	// IE6-8 fail to clone children inside object elements that use
-	// the proprietary classid attribute value (rather than the type
-	// attribute) to identify the type of content to display
-	if ( nodeName === "object" ) {
-		dest.outerHTML = src.outerHTML;
+					// oldIE doesn't update selected after form reset (#2551)
+					if ( ( option.selected || i === index ) &&
 
-	} else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) {
-		// IE6-8 fails to persist the checked state of a cloned checkbox
-		// or radio button. Worse, IE6-7 fail to give the cloned element
-		// a checked appearance if the defaultChecked value isn't also set
-		if ( src.checked ) {
-			dest.defaultChecked = dest.checked = src.checked;
-		}
+							// Don't return options that are disabled or in a disabled optgroup
+							( support.optDisabled ?
+								!option.disabled :
+								option.getAttribute( "disabled" ) === null ) &&
+							( !option.parentNode.disabled ||
+								!jQuery.nodeName( option.parentNode, "optgroup" ) ) ) {
 
-		// IE6-7 get confused and end up setting the value of a cloned
-		// checkbox/radio button to an empty string instead of "on"
-		if ( dest.value !== src.value ) {
-			dest.value = src.value;
-		}
+						// Get the specific value for the option
+						value = jQuery( option ).val();
 
-	// IE6-8 fails to return the selected option to the default selected
-	// state when cloning options
-	} else if ( nodeName === "option" ) {
-		dest.selected = src.defaultSelected;
+						// We don't need an array for one selects
+						if ( one ) {
+							return value;
+						}
 
-	// IE6-8 fails to set the defaultValue to the correct value when
-	// cloning other types of input fields
-	} else if ( nodeName === "input" || nodeName === "textarea" ) {
-		dest.defaultValue = src.defaultValue;
+						// Multi-Selects return an array
+						values.push( value );
+					}
+				}
 
-	// IE blanks contents when cloning scripts
-	} else if ( nodeName === "script" && dest.text !== src.text ) {
-		dest.text = src.text;
-	}
+				return values;
+			},
 
-	// Event data gets referenced instead of copied if the expando
-	// gets copied too
-	dest.removeAttribute( jQuery.expando );
+			set: function( elem, value ) {
+				var optionSet, option,
+					options = elem.options,
+					values = jQuery.makeArray( value ),
+					i = options.length;
 
-	// Clear flags for bubbling special change/submit events, they must
-	// be reattached when the newly cloned events are first activated
-	dest.removeAttribute( "_submit_attached" );
-	dest.removeAttribute( "_change_attached" );
-}
+				while ( i-- ) {
+					option = options[ i ];
 
-jQuery.buildFragment = function( args, nodes, scripts ) {
-	var fragment, cacheable, cacheresults, doc,
-	first = args[ 0 ];
+					if ( jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 ) {
 
-	// nodes may contain either an explicit document object,
-	// a jQuery collection or context object.
-	// If nodes[0] contains a valid object to assign to doc
-	if ( nodes && nodes[0] ) {
-		doc = nodes[0].ownerDocument || nodes[0];
-	}
+						// Support: IE6
+						// When new option element is added to select box we need to
+						// force reflow of newly added node in order to workaround delay
+						// of initialization properties
+						try {
+							option.selected = optionSet = true;
 
-	// Ensure that an attr object doesn't incorrectly stand in as a document object
-	// Chrome and Firefox seem to allow this to occur and will throw exception
-	// Fixes #8950
-	if ( !doc.createDocumentFragment ) {
-		doc = document;
-	}
+						} catch ( _ ) {
 
-	// Only cache "small" (1/2 KB) HTML strings that are associated with the main document
-	// Cloning options loses the selected state, so don't cache them
-	// IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
-	// Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
-	// Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501
-	if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document &&
-		first.charAt(0) === "<" && !rnocache.test( first ) &&
-		(jQuery.support.checkClone || !rchecked.test( first )) &&
-		(jQuery.support.html5Clone || !rnoshimcache.test( first )) ) {
+							// Will be executed only in IE6
+							option.scrollHeight;
+						}
 
-		cacheable = true;
+					} else {
+						option.selected = false;
+					}
+				}
 
-		cacheresults = jQuery.fragments[ first ];
-		if ( cacheresults && cacheresults !== 1 ) {
-			fragment = cacheresults;
-		}
-	}
+				// Force browsers to behave consistently when non-matching value is set
+				if ( !optionSet ) {
+					elem.selectedIndex = -1;
+				}
 
-	if ( !fragment ) {
-		fragment = doc.createDocumentFragment();
-		jQuery.clean( args, doc, fragment, scripts );
+				return options;
+			}
+		}
 	}
+} );
 
-	if ( cacheable ) {
-		jQuery.fragments[ first ] = cacheresults ? fragment : 1;
+// Radios and checkboxes getter/setter
+jQuery.each( [ "radio", "checkbox" ], function() {
+	jQuery.valHooks[ this ] = {
+		set: function( elem, value ) {
+			if ( jQuery.isArray( value ) ) {
+				return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
+			}
+		}
+	};
+	if ( !support.checkOn ) {
+		jQuery.valHooks[ this ].get = function( elem ) {
+			return elem.getAttribute( "value" ) === null ? "on" : elem.value;
+		};
 	}
+} );
 
-	return { fragment: fragment, cacheable: cacheable };
-};
 
-jQuery.fragments = {};
 
-jQuery.each({
-	appendTo: "append",
-	prependTo: "prepend",
-	insertBefore: "before",
-	insertAfter: "after",
-	replaceAll: "replaceWith"
-}, function( name, original ) {
-	jQuery.fn[ name ] = function( selector ) {
-		var ret = [],
-			insert = jQuery( selector ),
-			parent = this.length === 1 && this[0].parentNode;
 
-		if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
-			insert[ original ]( this[0] );
-			return this;
+var nodeHook, boolHook,
+	attrHandle = jQuery.expr.attrHandle,
+	ruseDefault = /^(?:checked|selected)$/i,
+	getSetAttribute = support.getSetAttribute,
+	getSetInput = support.input;
 
-		} else {
-			for ( var i = 0, l = insert.length; i < l; i++ ) {
-				var elems = ( i > 0 ? this.clone(true) : this ).get();
-				jQuery( insert[i] )[ original ]( elems );
-				ret = ret.concat( elems );
-			}
+jQuery.fn.extend( {
+	attr: function( name, value ) {
+		return access( this, jQuery.attr, name, value, arguments.length > 1 );
+	},
 
-			return this.pushStack( ret, name, insert.selector );
-		}
-	};
-});
+	removeAttr: function( name ) {
+		return this.each( function() {
+			jQuery.removeAttr( this, name );
+		} );
+	}
+} );
 
-function getAll( elem ) {
-	if ( typeof elem.getElementsByTagName !== "undefined" ) {
-		return elem.getElementsByTagName( "*" );
+jQuery.extend( {
+	attr: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
 
-	} else if ( typeof elem.querySelectorAll !== "undefined" ) {
-		return elem.querySelectorAll( "*" );
+		// Don't get/set attributes on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
 
-	} else {
-		return [];
-	}
-}
+		// Fallback to prop when attributes are not supported
+		if ( typeof elem.getAttribute === "undefined" ) {
+			return jQuery.prop( elem, name, value );
+		}
 
-// Used in clean, fixes the defaultChecked property
-function fixDefaultChecked( elem ) {
-	if ( elem.type === "checkbox" || elem.type === "radio" ) {
-		elem.defaultChecked = elem.checked;
-	}
-}
-// Finds all inputs and passes them to fixDefaultChecked
-function findInputs( elem ) {
-	var nodeName = ( elem.nodeName || "" ).toLowerCase();
-	if ( nodeName === "input" ) {
-		fixDefaultChecked( elem );
-	// Skip scripts, get other children
-	} else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) {
-		jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked );
-	}
-}
+		// All attributes are lowercase
+		// Grab necessary hook if one is defined
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+			name = name.toLowerCase();
+			hooks = jQuery.attrHooks[ name ] ||
+				( jQuery.expr.match.bool.test( name ) ? boolHook : nodeHook );
+		}
 
-// Derived From: http://www.iecss.com/shimprove/javascript/shimprove.1-0-1.js
-function shimCloneNode( elem ) {
-	var div = document.createElement( "div" );
-	safeFragment.appendChild( div );
+		if ( value !== undefined ) {
+			if ( value === null ) {
+				jQuery.removeAttr( elem, name );
+				return;
+			}
 
-	div.innerHTML = elem.outerHTML;
-	return div.firstChild;
-}
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
 
-jQuery.extend({
-	clone: function( elem, dataAndEvents, deepDataAndEvents ) {
-		var srcElements,
-			destElements,
-			i,
-			// IE<=8 does not properly clone detached, unknown element nodes
-			clone = jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ?
-				elem.cloneNode( true ) :
-				shimCloneNode( elem );
-
-		if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
-				(elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
-			// IE copies events bound via attachEvent when using cloneNode.
-			// Calling detachEvent on the clone will also remove the events
-			// from the original. In order to get around this, we use some
-			// proprietary methods to clear the events. Thanks to MooTools
-			// guys for this hotness.
-
-			cloneFixAttributes( elem, clone );
-
-			// Using Sizzle here is crazy slow, so we use getElementsByTagName instead
-			srcElements = getAll( elem );
-			destElements = getAll( clone );
+			elem.setAttribute( name, value + "" );
+			return value;
+		}
 
-			// Weird iteration because IE will replace the length property
-			// with an element if you are cloning the body and one of the
-			// elements on the page has a name or id of "length"
-			for ( i = 0; srcElements[i]; ++i ) {
-				// Ensure that the destination node is not null; Fixes #9587
-				if ( destElements[i] ) {
-					cloneFixAttributes( srcElements[i], destElements[i] );
-				}
-			}
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
 		}
 
-		// Copy the events from the original to the clone
-		if ( dataAndEvents ) {
-			cloneCopyEvent( elem, clone );
+		ret = jQuery.find.attr( elem, name );
 
-			if ( deepDataAndEvents ) {
-				srcElements = getAll( elem );
-				destElements = getAll( clone );
+		// Non-existent attributes return null, we normalize to undefined
+		return ret == null ? undefined : ret;
+	},
+
+	attrHooks: {
+		type: {
+			set: function( elem, value ) {
+				if ( !support.radioValue && value === "radio" &&
+					jQuery.nodeName( elem, "input" ) ) {
 
-				for ( i = 0; srcElements[i]; ++i ) {
-					cloneCopyEvent( srcElements[i], destElements[i] );
+					// Setting the type on a radio button after the value resets the value in IE8-9
+					// Reset value to default in case type is set after value during creation
+					var val = elem.value;
+					elem.setAttribute( "type", value );
+					if ( val ) {
+						elem.value = val;
+					}
+					return value;
 				}
 			}
 		}
-
-		srcElements = destElements = null;
-
-		// Return the cloned set
-		return clone;
 	},
 
-	clean: function( elems, context, fragment, scripts ) {
-		var checkScriptType, script, j,
-				ret = [];
-
-		context = context || document;
+	removeAttr: function( elem, value ) {
+		var name, propName,
+			i = 0,
+			attrNames = value && value.match( rnotwhite );
 
-		// !context.createElement fails in IE with an error but returns typeof 'object'
-		if ( typeof context.createElement === "undefined" ) {
-			context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
-		}
+		if ( attrNames && elem.nodeType === 1 ) {
+			while ( ( name = attrNames[ i++ ] ) ) {
+				propName = jQuery.propFix[ name ] || name;
 
-		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
-			if ( typeof elem === "number" ) {
-				elem += "";
-			}
+				// Boolean attributes get special treatment (#10870)
+				if ( jQuery.expr.match.bool.test( name ) ) {
 
-			if ( !elem ) {
-				continue;
-			}
+					// Set corresponding property to false
+					if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) {
+						elem[ propName ] = false;
 
-			// Convert html string into DOM nodes
-			if ( typeof elem === "string" ) {
-				if ( !rhtml.test( elem ) ) {
-					elem = context.createTextNode( elem );
-				} else {
-					// Fix "XHTML"-style tags in all browsers
-					elem = elem.replace(rxhtmlTag, "<$1></$2>");
-
-					// Trim whitespace, otherwise indexOf won't work as expected
-					var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(),
-						wrap = wrapMap[ tag ] || wrapMap._default,
-						depth = wrap[0],
-						div = context.createElement("div"),
-						safeChildNodes = safeFragment.childNodes,
-						remove;
-
-					// Append wrapper element to unknown element safe doc fragment
-					if ( context === document ) {
-						// Use the fragment we've already created for this document
-						safeFragment.appendChild( div );
+					// Support: IE<9
+					// Also clear defaultChecked/defaultSelected (if appropriate)
 					} else {
-						// Use a fragment created with the owner document
-						createSafeFragment( context ).appendChild( div );
+						elem[ jQuery.camelCase( "default-" + name ) ] =
+							elem[ propName ] = false;
 					}
 
-					// Go to html and back, then peel off extra wrappers
-					div.innerHTML = wrap[1] + elem + wrap[2];
-
-					// Move to the right depth
-					while ( depth-- ) {
-						div = div.lastChild;
-					}
+				// See #9699 for explanation of this approach (setting first, then removal)
+				} else {
+					jQuery.attr( elem, name, "" );
+				}
 
-					// Remove IE's autoinserted <tbody> from table fragments
-					if ( !jQuery.support.tbody ) {
+				elem.removeAttribute( getSetAttribute ? name : propName );
+			}
+		}
+	}
+} );
 
-						// String was a <table>, *may* have spurious <tbody>
-						var hasBody = rtbody.test(elem),
-							tbody = tag === "table" && !hasBody ?
-								div.firstChild && div.firstChild.childNodes :
+// Hooks for boolean attributes
+boolHook = {
+	set: function( elem, value, name ) {
+		if ( value === false ) {
 
-								// String was a bare <thead> or <tfoot>
-								wrap[1] === "<table>" && !hasBody ?
-									div.childNodes :
-									[];
+			// Remove boolean attributes when set to false
+			jQuery.removeAttr( elem, name );
+		} else if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) {
 
-						for ( j = tbody.length - 1; j >= 0 ; --j ) {
-							if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
-								tbody[ j ].parentNode.removeChild( tbody[ j ] );
-							}
-						}
-					}
+			// IE<8 needs the *property* name
+			elem.setAttribute( !getSetAttribute && jQuery.propFix[ name ] || name, name );
 
-					// IE completely kills leading whitespace when innerHTML is used
-					if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
-						div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
-					}
+		} else {
 
-					elem = div.childNodes;
+			// Support: IE<9
+			// Use defaultChecked and defaultSelected for oldIE
+			elem[ jQuery.camelCase( "default-" + name ) ] = elem[ name ] = true;
+		}
+		return name;
+	}
+};
 
-					// Clear elements from DocumentFragment (safeFragment or otherwise)
-					// to avoid hoarding elements. Fixes #11356
-					if ( div ) {
-						div.parentNode.removeChild( div );
+jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) {
+	var getter = attrHandle[ name ] || jQuery.find.attr;
 
-						// Guard against -1 index exceptions in FF3.6
-						if ( safeChildNodes.length > 0 ) {
-							remove = safeChildNodes[ safeChildNodes.length - 1 ];
+	if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) {
+		attrHandle[ name ] = function( elem, name, isXML ) {
+			var ret, handle;
+			if ( !isXML ) {
 
-							if ( remove && remove.parentNode ) {
-								remove.parentNode.removeChild( remove );
-							}
-						}
-					}
-				}
+				// Avoid an infinite loop by temporarily removing this function from the getter
+				handle = attrHandle[ name ];
+				attrHandle[ name ] = ret;
+				ret = getter( elem, name, isXML ) != null ?
+					name.toLowerCase() :
+					null;
+				attrHandle[ name ] = handle;
 			}
-
-			// Resets defaultChecked for any radios and checkboxes
-			// about to be appended to the DOM in IE 6/7 (#8060)
-			var len;
-			if ( !jQuery.support.appendChecked ) {
-				if ( elem[0] && typeof (len = elem.length) === "number" ) {
-					for ( j = 0; j < len; j++ ) {
-						findInputs( elem[j] );
-					}
-				} else {
-					findInputs( elem );
-				}
+			return ret;
+		};
+	} else {
+		attrHandle[ name ] = function( elem, name, isXML ) {
+			if ( !isXML ) {
+				return elem[ jQuery.camelCase( "default-" + name ) ] ?
+					name.toLowerCase() :
+					null;
 			}
+		};
+	}
+} );
+
+// fix oldIE attroperties
+if ( !getSetInput || !getSetAttribute ) {
+	jQuery.attrHooks.value = {
+		set: function( elem, value, name ) {
+			if ( jQuery.nodeName( elem, "input" ) ) {
 
-			if ( elem.nodeType ) {
-				ret.push( elem );
+				// Does not return so that setAttribute is also used
+				elem.defaultValue = value;
 			} else {
-				ret = jQuery.merge( ret, elem );
+
+				// Use nodeHook if defined (#1954); otherwise setAttribute is fine
+				return nodeHook && nodeHook.set( elem, value, name );
 			}
 		}
+	};
+}
 
-		if ( fragment ) {
-			checkScriptType = function( elem ) {
-				return !elem.type || rscriptType.test( elem.type );
-			};
-			for ( i = 0; ret[i]; i++ ) {
-				script = ret[i];
-				if ( scripts && jQuery.nodeName( script, "script" ) && (!script.type || rscriptType.test( script.type )) ) {
-					scripts.push( script.parentNode ? script.parentNode.removeChild( script ) : script );
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !getSetAttribute ) {
 
-				} else {
-					if ( script.nodeType === 1 ) {
-						var jsTags = jQuery.grep( script.getElementsByTagName( "script" ), checkScriptType );
+	// Use this for any attribute in IE6/7
+	// This fixes almost every IE6/7 issue
+	nodeHook = {
+		set: function( elem, value, name ) {
 
-						ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
-					}
-					fragment.appendChild( script );
-				}
+			// Set the existing or create a new attribute node
+			var ret = elem.getAttributeNode( name );
+			if ( !ret ) {
+				elem.setAttributeNode(
+					( ret = elem.ownerDocument.createAttribute( name ) )
+				);
+			}
+
+			ret.value = value += "";
+
+			// Break association with cloned elements by also using setAttribute (#9646)
+			if ( name === "value" || value === elem.getAttribute( name ) ) {
+				return value;
 			}
 		}
+	};
 
-		return ret;
-	},
+	// Some attributes are constructed with empty-string values when not defined
+	attrHandle.id = attrHandle.name = attrHandle.coords =
+		function( elem, name, isXML ) {
+			var ret;
+			if ( !isXML ) {
+				return ( ret = elem.getAttributeNode( name ) ) && ret.value !== "" ?
+					ret.value :
+					null;
+			}
+		};
 
-	cleanData: function( elems ) {
-		var data, id,
-			cache = jQuery.cache,
-			special = jQuery.event.special,
-			deleteExpando = jQuery.support.deleteExpando;
+	// Fixing value retrieval on a button requires this module
+	jQuery.valHooks.button = {
+		get: function( elem, name ) {
+			var ret = elem.getAttributeNode( name );
+			if ( ret && ret.specified ) {
+				return ret.value;
+			}
+		},
+		set: nodeHook.set
+	};
 
-		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
-			if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
-				continue;
+	// Set contenteditable to false on removals(#10429)
+	// Setting to empty string throws an error as an invalid value
+	jQuery.attrHooks.contenteditable = {
+		set: function( elem, value, name ) {
+			nodeHook.set( elem, value === "" ? false : value, name );
+		}
+	};
+
+	// Set width and height to auto instead of 0 on empty string( Bug #8150 )
+	// This is for removals
+	jQuery.each( [ "width", "height" ], function( i, name ) {
+		jQuery.attrHooks[ name ] = {
+			set: function( elem, value ) {
+				if ( value === "" ) {
+					elem.setAttribute( name, "auto" );
+					return value;
+				}
 			}
+		};
+	} );
+}
 
-			id = elem[ jQuery.expando ];
+if ( !support.style ) {
+	jQuery.attrHooks.style = {
+		get: function( elem ) {
 
-			if ( id ) {
-				data = cache[ id ];
+			// Return undefined in the case of empty string
+			// Note: IE uppercases css property names, but if we were to .toLowerCase()
+			// .cssText, that would destroy case sensitivity in URL's, like in "background"
+			return elem.style.cssText || undefined;
+		},
+		set: function( elem, value ) {
+			return ( elem.style.cssText = value + "" );
+		}
+	};
+}
 
-				if ( data && data.events ) {
-					for ( var type in data.events ) {
-						if ( special[ type ] ) {
-							jQuery.event.remove( elem, type );
 
-						// This is a shortcut to avoid jQuery.event.remove's overhead
-						} else {
-							jQuery.removeEvent( elem, type, data.handle );
-						}
-					}
 
-					// Null the DOM reference to avoid IE6/7/8 leak (#7054)
-					if ( data.handle ) {
-						data.handle.elem = null;
-					}
-				}
 
-				if ( deleteExpando ) {
-					delete elem[ jQuery.expando ];
+var rfocusable = /^(?:input|select|textarea|button|object)$/i,
+	rclickable = /^(?:a|area)$/i;
 
-				} else if ( elem.removeAttribute ) {
-					elem.removeAttribute( jQuery.expando );
-				}
+jQuery.fn.extend( {
+	prop: function( name, value ) {
+		return access( this, jQuery.prop, name, value, arguments.length > 1 );
+	},
 
-				delete cache[ id ];
-			}
-		}
+	removeProp: function( name ) {
+		name = jQuery.propFix[ name ] || name;
+		return this.each( function() {
+
+			// try/catch handles cases where IE balks (such as removing a property on window)
+			try {
+				this[ name ] = undefined;
+				delete this[ name ];
+			} catch ( e ) {}
+		} );
 	}
-});
+} );
 
+jQuery.extend( {
+	prop: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
 
+		// Don't get/set properties on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
 
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
 
-var ralpha = /alpha\([^)]*\)/i,
-	ropacity = /opacity=([^)]*)/,
-	// fixed for IE9, see #8346
-	rupper = /([A-Z]|^ms)/g,
-	rnum = /^[\-+]?(?:\d*\.)?\d+$/i,
-	rnumnonpx = /^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,
-	rrelNum = /^([\-+])=([\-+.\de]+)/,
-	rmargin = /^margin/,
+			// Fix name and attach hooks
+			name = jQuery.propFix[ name ] || name;
+			hooks = jQuery.propHooks[ name ];
+		}
 
-	cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+		if ( value !== undefined ) {
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
 
-	// order is important!
-	cssExpand = [ "Top", "Right", "Bottom", "Left" ],
+			return ( elem[ name ] = value );
+		}
 
-	curCSS,
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
 
-	getComputedStyle,
-	currentStyle;
+		return elem[ name ];
+	},
 
-jQuery.fn.css = function( name, value ) {
-	return jQuery.access( this, function( elem, name, value ) {
-		return value !== undefined ?
-			jQuery.style( elem, name, value ) :
-			jQuery.css( elem, name );
-	}, name, value, arguments.length > 1 );
-};
+	propHooks: {
+		tabIndex: {
+			get: function( elem ) {
 
-jQuery.extend({
-	// Add in style property hooks for overriding the default
-	// behavior of getting and setting a style property
-	cssHooks: {
-		opacity: {
-			get: function( elem, computed ) {
-				if ( computed ) {
-					// We should always get a number back from opacity
-					var ret = curCSS( elem, "opacity" );
-					return ret === "" ? "1" : ret;
+				// elem.tabIndex doesn't always return the
+				// correct value when it hasn't been explicitly set
+				// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+				// Use proper attribute retrieval(#12072)
+				var tabindex = jQuery.find.attr( elem, "tabindex" );
 
-				} else {
-					return elem.style.opacity;
-				}
+				return tabindex ?
+					parseInt( tabindex, 10 ) :
+					rfocusable.test( elem.nodeName ) ||
+						rclickable.test( elem.nodeName ) && elem.href ?
+							0 :
+							-1;
 			}
 		}
 	},
 
-	// Exclude the following css properties to add px
-	cssNumber: {
-		"fillOpacity": true,
-		"fontWeight": true,
-		"lineHeight": true,
-		"opacity": true,
-		"orphans": true,
-		"widows": true,
-		"zIndex": true,
-		"zoom": true
-	},
-
-	// Add in properties whose names you wish to fix before
-	// setting or getting the value
-	cssProps: {
-		// normalize float css property
-		"float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
-	},
+	propFix: {
+		"for": "htmlFor",
+		"class": "className"
+	}
+} );
 
-	// Get and set the style property on a DOM Node
-	style: function( elem, name, value, extra ) {
-		// Don't set styles on text and comment nodes
-		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
-			return;
-		}
+// Some attributes require a special call on IE
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !support.hrefNormalized ) {
 
-		// Make sure that we're working with the right name
-		var ret, type, origName = jQuery.camelCase( name ),
-			style = elem.style, hooks = jQuery.cssHooks[ origName ];
+	// href/src property should get the full normalized URL (#10299/#12915)
+	jQuery.each( [ "href", "src" ], function( i, name ) {
+		jQuery.propHooks[ name ] = {
+			get: function( elem ) {
+				return elem.getAttribute( name, 4 );
+			}
+		};
+	} );
+}
 
-		name = jQuery.cssProps[ origName ] || origName;
+// Support: Safari, IE9+
+// Accessing the selectedIndex property
+// forces the browser to respect setting selected
+// on the option
+// The getter ensures a default option is selected
+// when in an optgroup
+if ( !support.optSelected ) {
+	jQuery.propHooks.selected = {
+		get: function( elem ) {
+			var parent = elem.parentNode;
 
-		// Check if we're setting a value
-		if ( value !== undefined ) {
-			type = typeof value;
+			if ( parent ) {
+				parent.selectedIndex;
 
-			// convert relative number strings (+= or -=) to relative numbers. #7345
-			if ( type === "string" && (ret = rrelNum.exec( value )) ) {
-				value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) );
-				// Fixes bug #9237
-				type = "number";
+				// Make sure that it also works with optgroups, see #5701
+				if ( parent.parentNode ) {
+					parent.parentNode.selectedIndex;
+				}
 			}
+			return null;
+		},
+		set: function( elem ) {
+			var parent = elem.parentNode;
+			if ( parent ) {
+				parent.selectedIndex;
 
-			// Make sure that NaN and null values aren't set. See: #7116
-			if ( value == null || type === "number" && isNaN( value ) ) {
-				return;
+				if ( parent.parentNode ) {
+					parent.parentNode.selectedIndex;
+				}
 			}
+		}
+	};
+}
 
-			// If a number was passed in, add 'px' to the (except for certain CSS properties)
-			if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
-				value += "px";
-			}
+jQuery.each( [
+	"tabIndex",
+	"readOnly",
+	"maxLength",
+	"cellSpacing",
+	"cellPadding",
+	"rowSpan",
+	"colSpan",
+	"useMap",
+	"frameBorder",
+	"contentEditable"
+], function() {
+	jQuery.propFix[ this.toLowerCase() ] = this;
+} );
 
-			// If a hook was provided, use that value, otherwise just set the specified value
-			if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) {
-				// Wrapped to prevent IE from throwing errors when 'invalid' values are provided
-				// Fixes bug #5509
-				try {
-					style[ name ] = value;
-				} catch(e) {}
-			}
+// IE6/7 call enctype encoding
+if ( !support.enctype ) {
+	jQuery.propFix.enctype = "encoding";
+}
 
-		} else {
-			// If a hook was provided get the non-computed value from there
-			if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
-				return ret;
-			}
 
-			// Otherwise just get the value from the style object
-			return style[ name ];
-		}
-	},
 
-	css: function( elem, name, extra ) {
-		var ret, hooks;
 
-		// Make sure that we're working with the right name
-		name = jQuery.camelCase( name );
-		hooks = jQuery.cssHooks[ name ];
-		name = jQuery.cssProps[ name ] || name;
+var rclass = /[\t\r\n\f]/g;
+
+function getClass( elem ) {
+	return jQuery.attr( elem, "class" ) || "";
+}
+
+jQuery.fn.extend( {
+	addClass: function( value ) {
+		var classes, elem, cur, curValue, clazz, j, finalValue,
+			i = 0;
 
-		// cssFloat needs a special treatment
-		if ( name === "cssFloat" ) {
-			name = "float";
+		if ( jQuery.isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
+			} );
 		}
 
-		// If a hook was provided get the computed value from there
-		if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
-			return ret;
+		if ( typeof value === "string" && value ) {
+			classes = value.match( rnotwhite ) || [];
 
-		// Otherwise, if a way to get the computed value exists, use that
-		} else if ( curCSS ) {
-			return curCSS( elem, name );
+			while ( ( elem = this[ i++ ] ) ) {
+				curValue = getClass( elem );
+				cur = elem.nodeType === 1 &&
+					( " " + curValue + " " ).replace( rclass, " " );
+
+				if ( cur ) {
+					j = 0;
+					while ( ( clazz = classes[ j++ ] ) ) {
+						if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
+							cur += clazz + " ";
+						}
+					}
+
+					// only assign if different to avoid unneeded rendering.
+					finalValue = jQuery.trim( cur );
+					if ( curValue !== finalValue ) {
+						jQuery.attr( elem, "class", finalValue );
+					}
+				}
+			}
 		}
+
+		return this;
 	},
 
-	// A method for quickly swapping in/out CSS properties to get correct calculations
-	swap: function( elem, options, callback ) {
-		var old = {},
-			ret, name;
+	removeClass: function( value ) {
+		var classes, elem, cur, curValue, clazz, j, finalValue,
+			i = 0;
 
-		// Remember the old values, and insert the new ones
-		for ( name in options ) {
-			old[ name ] = elem.style[ name ];
-			elem.style[ name ] = options[ name ];
+		if ( jQuery.isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
+			} );
 		}
 
-		ret = callback.call( elem );
-
-		// Revert the old values
-		for ( name in options ) {
-			elem.style[ name ] = old[ name ];
+		if ( !arguments.length ) {
+			return this.attr( "class", "" );
 		}
 
-		return ret;
-	}
-});
+		if ( typeof value === "string" && value ) {
+			classes = value.match( rnotwhite ) || [];
 
-// DEPRECATED in 1.3, Use jQuery.css() instead
-jQuery.curCSS = jQuery.css;
+			while ( ( elem = this[ i++ ] ) ) {
+				curValue = getClass( elem );
 
-if ( document.defaultView && document.defaultView.getComputedStyle ) {
-	getComputedStyle = function( elem, name ) {
-		var ret, defaultView, computedStyle, width,
-			style = elem.style;
+				// This expression is here for better compressibility (see addClass)
+				cur = elem.nodeType === 1 &&
+					( " " + curValue + " " ).replace( rclass, " " );
 
-		name = name.replace( rupper, "-$1" ).toLowerCase();
+				if ( cur ) {
+					j = 0;
+					while ( ( clazz = classes[ j++ ] ) ) {
 
-		if ( (defaultView = elem.ownerDocument.defaultView) &&
-				(computedStyle = defaultView.getComputedStyle( elem, null )) ) {
+						// Remove *all* instances
+						while ( cur.indexOf( " " + clazz + " " ) > -1 ) {
+							cur = cur.replace( " " + clazz + " ", " " );
+						}
+					}
 
-			ret = computedStyle.getPropertyValue( name );
-			if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
-				ret = jQuery.style( elem, name );
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = jQuery.trim( cur );
+					if ( curValue !== finalValue ) {
+						jQuery.attr( elem, "class", finalValue );
+					}
+				}
 			}
 		}
 
-		// A tribute to the "awesome hack by Dean Edwards"
-		// WebKit uses "computed value (percentage if specified)" instead of "used value" for margins
-		// which is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
-		if ( !jQuery.support.pixelMargin && computedStyle && rmargin.test( name ) && rnumnonpx.test( ret ) ) {
-			width = style.width;
-			style.width = ret;
-			ret = computedStyle.width;
-			style.width = width;
-		}
+		return this;
+	},
 
-		return ret;
-	};
-}
+	toggleClass: function( value, stateVal ) {
+		var type = typeof value;
 
-if ( document.documentElement.currentStyle ) {
-	currentStyle = function( elem, name ) {
-		var left, rsLeft, uncomputed,
-			ret = elem.currentStyle && elem.currentStyle[ name ],
-			style = elem.style;
+		if ( typeof stateVal === "boolean" && type === "string" ) {
+			return stateVal ? this.addClass( value ) : this.removeClass( value );
+		}
 
-		// Avoid setting ret to empty string here
-		// so we don't default to auto
-		if ( ret == null && style && (uncomputed = style[ name ]) ) {
-			ret = uncomputed;
+		if ( jQuery.isFunction( value ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).toggleClass(
+					value.call( this, i, getClass( this ), stateVal ),
+					stateVal
+				);
+			} );
 		}
 
-		// From the awesome hack by Dean Edwards
-		// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+		return this.each( function() {
+			var className, i, self, classNames;
 
-		// If we're not dealing with a regular pixel number
-		// but a number that has a weird ending, we need to convert it to pixels
-		if ( rnumnonpx.test( ret ) ) {
+			if ( type === "string" ) {
 
-			// Remember the original values
-			left = style.left;
-			rsLeft = elem.runtimeStyle && elem.runtimeStyle.left;
+				// Toggle individual class names
+				i = 0;
+				self = jQuery( this );
+				classNames = value.match( rnotwhite ) || [];
 
-			// Put in the new values to get a computed value out
-			if ( rsLeft ) {
-				elem.runtimeStyle.left = elem.currentStyle.left;
-			}
-			style.left = name === "fontSize" ? "1em" : ret;
-			ret = style.pixelLeft + "px";
+				while ( ( className = classNames[ i++ ] ) ) {
 
-			// Revert the changed values
-			style.left = left;
-			if ( rsLeft ) {
-				elem.runtimeStyle.left = rsLeft;
-			}
-		}
+					// Check each className given, space separated list
+					if ( self.hasClass( className ) ) {
+						self.removeClass( className );
+					} else {
+						self.addClass( className );
+					}
+				}
 
-		return ret === "" ? "auto" : ret;
-	};
-}
+			// Toggle whole class name
+			} else if ( value === undefined || type === "boolean" ) {
+				className = getClass( this );
+				if ( className ) {
 
-curCSS = getComputedStyle || currentStyle;
+					// store className if set
+					jQuery._data( this, "__className__", className );
+				}
 
-function getWidthOrHeight( elem, name, extra ) {
+				// If the element has a class name or if we're passed "false",
+				// then remove the whole classname (if there was one, the above saved it).
+				// Otherwise bring back whatever was previously saved (if anything),
+				// falling back to the empty string if nothing was stored.
+				jQuery.attr( this, "class",
+					className || value === false ?
+					"" :
+					jQuery._data( this, "__className__" ) || ""
+				);
+			}
+		} );
+	},
 
-	// Start with offset property
-	var val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
-		i = name === "width" ? 1 : 0,
-		len = 4;
+	hasClass: function( selector ) {
+		var className, elem,
+			i = 0;
 
-	if ( val > 0 ) {
-		if ( extra !== "border" ) {
-			for ( ; i < len; i += 2 ) {
-				if ( !extra ) {
-					val -= parseFloat( jQuery.css( elem, "padding" + cssExpand[ i ] ) ) || 0;
-				}
-				if ( extra === "margin" ) {
-					val += parseFloat( jQuery.css( elem, extra + cssExpand[ i ] ) ) || 0;
-				} else {
-					val -= parseFloat( jQuery.css( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0;
-				}
+		className = " " + selector + " ";
+		while ( ( elem = this[ i++ ] ) ) {
+			if ( elem.nodeType === 1 &&
+				( " " + getClass( elem ) + " " ).replace( rclass, " " )
+					.indexOf( className ) > -1
+			) {
+				return true;
 			}
 		}
 
-		return val + "px";
+		return false;
 	}
+} );
 
-	// Fall back to computed then uncomputed css if necessary
-	val = curCSS( elem, name );
-	if ( val < 0 || val == null ) {
-		val = elem.style[ name ];
-	}
 
-	// Computed unit is not pixels. Stop here and return.
-	if ( rnumnonpx.test(val) ) {
-		return val;
-	}
 
-	// Normalize "", auto, and prepare for extra
-	val = parseFloat( val ) || 0;
 
-	// Add padding, border, margin
-	if ( extra ) {
-		for ( ; i < len; i += 2 ) {
-			val += parseFloat( jQuery.css( elem, "padding" + cssExpand[ i ] ) ) || 0;
-			if ( extra !== "padding" ) {
-				val += parseFloat( jQuery.css( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0;
-			}
-			if ( extra === "margin" ) {
-				val += parseFloat( jQuery.css( elem, extra + cssExpand[ i ]) ) || 0;
-			}
-		}
-	}
+// Return jQuery for attributes-only inclusion
 
-	return val + "px";
-}
 
-jQuery.each([ "height", "width" ], function( i, name ) {
-	jQuery.cssHooks[ name ] = {
-		get: function( elem, computed, extra ) {
-			if ( computed ) {
-				if ( elem.offsetWidth !== 0 ) {
-					return getWidthOrHeight( elem, name, extra );
-				} else {
-					return jQuery.swap( elem, cssShow, function() {
-						return getWidthOrHeight( elem, name, extra );
-					});
-				}
-			}
-		},
+jQuery.each( ( "blur focus focusin focusout load resize scroll unload click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup error contextmenu" ).split( " " ),
+	function( i, name ) {
 
-		set: function( elem, value ) {
-			return rnum.test( value ) ?
-				value + "px" :
-				value;
-		}
+	// Handle event binding
+	jQuery.fn[ name ] = function( data, fn ) {
+		return arguments.length > 0 ?
+			this.on( name, null, data, fn ) :
+			this.trigger( name );
 	};
-});
+} );
 
-if ( !jQuery.support.opacity ) {
-	jQuery.cssHooks.opacity = {
-		get: function( elem, computed ) {
-			// IE uses filters for opacity
-			return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
-				( parseFloat( RegExp.$1 ) / 100 ) + "" :
-				computed ? "1" : "";
-		},
-
-		set: function( elem, value ) {
-			var style = elem.style,
-				currentStyle = elem.currentStyle,
-				opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
-				filter = currentStyle && currentStyle.filter || style.filter || "";
+jQuery.fn.extend( {
+	hover: function( fnOver, fnOut ) {
+		return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+	}
+} );
 
-			// IE has trouble with opacity if it does not have layout
-			// Force it by setting the zoom level
-			style.zoom = 1;
 
-			// if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
-			if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) {
+var location = window.location;
 
-				// Setting style.filter to null, "" & " " still leave "filter:" in the cssText
-				// if "filter:" is present at all, clearType is disabled, we want to avoid this
-				// style.removeAttribute is IE Only, but so apparently is this code path...
-				style.removeAttribute( "filter" );
+var nonce = jQuery.now();
 
-				// if there there is no filter style applied in a css rule, we are done
-				if ( currentStyle && !currentStyle.filter ) {
-					return;
-				}
-			}
+var rquery = ( /\?/ );
 
-			// otherwise, set new filter values
-			style.filter = ralpha.test( filter ) ?
-				filter.replace( ralpha, opacity ) :
-				filter + " " + opacity;
-		}
-	};
-}
 
-jQuery(function() {
-	// This hook cannot be added until DOM ready because the support test
-	// for it is not run until after DOM ready
-	if ( !jQuery.support.reliableMarginRight ) {
-		jQuery.cssHooks.marginRight = {
-			get: function( elem, computed ) {
-				// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
-				// Work around by temporarily setting element display to inline-block
-				return jQuery.swap( elem, { "display": "inline-block" }, function() {
-					if ( computed ) {
-						return curCSS( elem, "margin-right" );
-					} else {
-						return elem.style.marginRight;
-					}
-				});
-			}
-		};
-	}
-});
 
-if ( jQuery.expr && jQuery.expr.filters ) {
-	jQuery.expr.filters.hidden = function( elem ) {
-		var width = elem.offsetWidth,
-			height = elem.offsetHeight;
+var rvalidtokens = /(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;
 
-		return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none");
-	};
+jQuery.parseJSON = function( data ) {
 
-	jQuery.expr.filters.visible = function( elem ) {
-		return !jQuery.expr.filters.hidden( elem );
-	};
-}
+	// Attempt to parse using the native JSON parser first
+	if ( window.JSON && window.JSON.parse ) {
 
-// These hooks are used by animate to expand properties
-jQuery.each({
-	margin: "",
-	padding: "",
-	border: "Width"
-}, function( prefix, suffix ) {
+		// Support: Android 2.3
+		// Workaround failure to string-cast null input
+		return window.JSON.parse( data + "" );
+	}
 
-	jQuery.cssHooks[ prefix + suffix ] = {
-		expand: function( value ) {
-			var i,
+	var requireNonComma,
+		depth = null,
+		str = jQuery.trim( data + "" );
 
-				// assumes a single number if not a string
-				parts = typeof value === "string" ? value.split(" ") : [ value ],
-				expanded = {};
+	// Guard against invalid (and possibly dangerous) input by ensuring that nothing remains
+	// after removing valid tokens
+	return str && !jQuery.trim( str.replace( rvalidtokens, function( token, comma, open, close ) {
 
-			for ( i = 0; i < 4; i++ ) {
-				expanded[ prefix + cssExpand[ i ] + suffix ] =
-					parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
-			}
+		// Force termination if we see a misplaced comma
+		if ( requireNonComma && comma ) {
+			depth = 0;
+		}
 
-			return expanded;
+		// Perform no more replacements after returning to outermost depth
+		if ( depth === 0 ) {
+			return token;
 		}
-	};
-});
 
+		// Commas must not follow "[", "{", or ","
+		requireNonComma = open || comma;
 
+		// Determine new depth
+		// array/object open ("[" or "{"): depth += true - false (increment)
+		// array/object close ("]" or "}"): depth += false - true (decrement)
+		// other cases ("," or primitive): depth += true - true (numeric cast)
+		depth += !close - !open;
 
+		// Remove this token
+		return "";
+	} ) ) ?
+		( Function( "return " + str ) )() :
+		jQuery.error( "Invalid JSON: " + data );
+};
 
-var r20 = /%20/g,
-	rbracket = /\[\]$/,
-	rCRLF = /\r?\n/g,
+
+// Cross-browser xml parsing
+jQuery.parseXML = function( data ) {
+	var xml, tmp;
+	if ( !data || typeof data !== "string" ) {
+		return null;
+	}
+	try {
+		if ( window.DOMParser ) { // Standard
+			tmp = new window.DOMParser();
+			xml = tmp.parseFromString( data, "text/xml" );
+		} else { // IE
+			xml = new window.ActiveXObject( "Microsoft.XMLDOM" );
+			xml.async = "false";
+			xml.loadXML( data );
+		}
+	} catch ( e ) {
+		xml = undefined;
+	}
+	if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
+		jQuery.error( "Invalid XML: " + data );
+	}
+	return xml;
+};
+
+
+var
 	rhash = /#.*$/,
-	rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
-	rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
+	rts = /([?&])_=[^&]*/,
+
+	// IE leaves an \r character at EOL
+	rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg,
+
 	// #7653, #8125, #8152: local protocol detection
-	rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,
+	rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
 	rnoContent = /^(?:GET|HEAD)$/,
 	rprotocol = /^\/\//,
-	rquery = /\?/,
-	rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
-	rselectTextarea = /^(?:select|textarea)/i,
-	rspacesAjax = /\s+/,
-	rts = /([?&])_=[^&]*/,
-	rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,
-
-	// Keep a copy of the old load method
-	_load = jQuery.fn.load,
+	rurl = /^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,
 
 	/* Prefilters
 	 * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
@@ -7006,29 +9105,14 @@ var r20 = /%20/g,
 	 */
 	transports = {},
 
-	// Document location
-	ajaxLocation,
-
-	// Document location segments
-	ajaxLocParts,
-
 	// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
-	allTypes = ["*/"] + ["*"];
+	allTypes = "*/".concat( "*" ),
 
-// #8138, IE may throw an exception when accessing
-// a field from window.location if document.domain has been set
-try {
-	ajaxLocation = location.href;
-} catch( e ) {
-	// Use the href attribute of an A element
-	// since IE will modify it given document.location
-	ajaxLocation = document.createElement( "a" );
-	ajaxLocation.href = "";
-	ajaxLocation = ajaxLocation.href;
-}
+	// Document location
+	ajaxLocation = location.href,
 
-// Segment location into parts
-ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+	// Segment location into parts
+	ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
 
 // Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
 function addToPrefiltersOrTransports( structure ) {
@@ -7041,77 +9125,63 @@ function addToPrefiltersOrTransports( structure ) {
 			dataTypeExpression = "*";
 		}
 
+		var dataType,
+			i = 0,
+			dataTypes = dataTypeExpression.toLowerCase().match( rnotwhite ) || [];
+
 		if ( jQuery.isFunction( func ) ) {
-			var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ),
-				i = 0,
-				length = dataTypes.length,
-				dataType,
-				list,
-				placeBefore;
 
 			// For each dataType in the dataTypeExpression
-			for ( ; i < length; i++ ) {
-				dataType = dataTypes[ i ];
-				// We control if we're asked to add before
-				// any existing element
-				placeBefore = /^\+/.test( dataType );
-				if ( placeBefore ) {
-					dataType = dataType.substr( 1 ) || "*";
+			while ( ( dataType = dataTypes[ i++ ] ) ) {
+
+				// Prepend if requested
+				if ( dataType.charAt( 0 ) === "+" ) {
+					dataType = dataType.slice( 1 ) || "*";
+					( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );
+
+				// Otherwise append
+				} else {
+					( structure[ dataType ] = structure[ dataType ] || [] ).push( func );
 				}
-				list = structure[ dataType ] = structure[ dataType ] || [];
-				// then we add to the structure accordingly
-				list[ placeBefore ? "unshift" : "push" ]( func );
 			}
 		}
 	};
 }
 
 // Base inspection function for prefilters and transports
-function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
-		dataType /* internal */, inspected /* internal */ ) {
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
 
-	dataType = dataType || options.dataTypes[ 0 ];
-	inspected = inspected || {};
+	var inspected = {},
+		seekingTransport = ( structure === transports );
 
-	inspected[ dataType ] = true;
+	function inspect( dataType ) {
+		var selected;
+		inspected[ dataType ] = true;
+		jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+			var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+			if ( typeof dataTypeOrTransport === "string" &&
+				!seekingTransport && !inspected[ dataTypeOrTransport ] ) {
 
-	var list = structure[ dataType ],
-		i = 0,
-		length = list ? list.length : 0,
-		executeOnly = ( structure === prefilters ),
-		selection;
-
-	for ( ; i < length && ( executeOnly || !selection ); i++ ) {
-		selection = list[ i ]( options, originalOptions, jqXHR );
-		// If we got redirected to another dataType
-		// we try there if executing only and not done already
-		if ( typeof selection === "string" ) {
-			if ( !executeOnly || inspected[ selection ] ) {
-				selection = undefined;
-			} else {
-				options.dataTypes.unshift( selection );
-				selection = inspectPrefiltersOrTransports(
-						structure, options, originalOptions, jqXHR, selection, inspected );
+				options.dataTypes.unshift( dataTypeOrTransport );
+				inspect( dataTypeOrTransport );
+				return false;
+			} else if ( seekingTransport ) {
+				return !( selected = dataTypeOrTransport );
 			}
-		}
-	}
-	// If we're only executing or nothing was selected
-	// we try the catchall dataType if not done already
-	if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
-		selection = inspectPrefiltersOrTransports(
-				structure, options, originalOptions, jqXHR, "*", inspected );
+		} );
+		return selected;
 	}
-	// unnecessary when only executing (prefilters)
-	// but it'll be ignored by the caller in that case
-	return selection;
+
+	return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
 }
 
 // A special extend for ajax options
 // that takes "flat" options (not to be deep extended)
 // Fixes #9887
 function ajaxExtend( target, src ) {
-	var key, deep,
+	var deep, key,
 		flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
 	for ( key in src ) {
 		if ( src[ key ] !== undefined ) {
 			( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
@@ -7120,172 +9190,184 @@ function ajaxExtend( target, src ) {
 	if ( deep ) {
 		jQuery.extend( true, target, deep );
 	}
+
+	return target;
 }
 
-jQuery.fn.extend({
-	load: function( url, params, callback ) {
-		if ( typeof url !== "string" && _load ) {
-			return _load.apply( this, arguments );
+/* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+	var firstDataType, ct, finalDataType, type,
+		contents = s.contents,
+		dataTypes = s.dataTypes;
 
-		// Don't do a request if no elements are being requested
-		} else if ( !this.length ) {
-			return this;
+	// Remove auto dataType and get content-type in the process
+	while ( dataTypes[ 0 ] === "*" ) {
+		dataTypes.shift();
+		if ( ct === undefined ) {
+			ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" );
 		}
+	}
 
-		var off = url.indexOf( " " );
-		if ( off >= 0 ) {
-			var selector = url.slice( off, url.length );
-			url = url.slice( 0, off );
+	// Check if we're dealing with a known content-type
+	if ( ct ) {
+		for ( type in contents ) {
+			if ( contents[ type ] && contents[ type ].test( ct ) ) {
+				dataTypes.unshift( type );
+				break;
+			}
 		}
+	}
 
-		// Default to a GET request
-		var type = "GET";
-
-		// If the second parameter was provided
-		if ( params ) {
-			// If it's a function
-			if ( jQuery.isFunction( params ) ) {
-				// We assume that it's the callback
-				callback = params;
-				params = undefined;
+	// Check to see if we have a response for the expected dataType
+	if ( dataTypes[ 0 ] in responses ) {
+		finalDataType = dataTypes[ 0 ];
+	} else {
 
-			// Otherwise, build a param string
-			} else if ( typeof params === "object" ) {
-				params = jQuery.param( params, jQuery.ajaxSettings.traditional );
-				type = "POST";
+		// Try convertible dataTypes
+		for ( type in responses ) {
+			if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) {
+				finalDataType = type;
+				break;
+			}
+			if ( !firstDataType ) {
+				firstDataType = type;
 			}
 		}
 
-		var self = this;
+		// Or just use first one
+		finalDataType = finalDataType || firstDataType;
+	}
 
-		// Request the remote document
-		jQuery.ajax({
-			url: url,
-			type: type,
-			dataType: "html",
-			data: params,
-			// Complete callback (responseText is used internally)
-			complete: function( jqXHR, status, responseText ) {
-				// Store the response as specified by the jqXHR object
-				responseText = jqXHR.responseText;
-				// If successful, inject the HTML into all the matched elements
-				if ( jqXHR.isResolved() ) {
-					// #4825: Get the actual response in case
-					// a dataFilter is present in ajaxSettings
-					jqXHR.done(function( r ) {
-						responseText = r;
-					});
-					// See if a selector was specified
-					self.html( selector ?
-						// Create a dummy div to hold the results
-						jQuery("<div>")
-							// inject the contents of the document in, removing the scripts
-							// to avoid any 'Permission Denied' errors in IE
-							.append(responseText.replace(rscript, ""))
-
-							// Locate the specified elements
-							.find(selector) :
-
-						// If not, just inject the full result
-						responseText );
-				}
+	// If we found a dataType
+	// We add the dataType to the list if needed
+	// and return the corresponding response
+	if ( finalDataType ) {
+		if ( finalDataType !== dataTypes[ 0 ] ) {
+			dataTypes.unshift( finalDataType );
+		}
+		return responses[ finalDataType ];
+	}
+}
 
-				if ( callback ) {
-					self.each( callback, [ responseText, status, jqXHR ] );
-				}
-			}
-		});
+/* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+function ajaxConvert( s, response, jqXHR, isSuccess ) {
+	var conv2, current, conv, tmp, prev,
+		converters = {},
 
-		return this;
-	},
+		// Work with a copy of dataTypes in case we need to modify it for conversion
+		dataTypes = s.dataTypes.slice();
 
-	serialize: function() {
-		return jQuery.param( this.serializeArray() );
-	},
+	// Create converters map with lowercased keys
+	if ( dataTypes[ 1 ] ) {
+		for ( conv in s.converters ) {
+			converters[ conv.toLowerCase() ] = s.converters[ conv ];
+		}
+	}
 
-	serializeArray: function() {
-		return this.map(function(){
-			return this.elements ? jQuery.makeArray( this.elements ) : this;
-		})
-		.filter(function(){
-			return this.name && !this.disabled &&
-				( this.checked || rselectTextarea.test( this.nodeName ) ||
-					rinput.test( this.type ) );
-		})
-		.map(function( i, elem ){
-			var val = jQuery( this ).val();
+	current = dataTypes.shift();
 
-			return val == null ?
-				null :
-				jQuery.isArray( val ) ?
-					jQuery.map( val, function( val, i ){
-						return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
-					}) :
-					{ name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
-		}).get();
-	}
-});
+	// Convert to each sequential dataType
+	while ( current ) {
 
-// Attach a bunch of functions for handling common AJAX events
-jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
-	jQuery.fn[ o ] = function( f ){
-		return this.on( o, f );
-	};
-});
+		if ( s.responseFields[ current ] ) {
+			jqXHR[ s.responseFields[ current ] ] = response;
+		}
 
-jQuery.each( [ "get", "post" ], function( i, method ) {
-	jQuery[ method ] = function( url, data, callback, type ) {
-		// shift arguments if data argument was omitted
-		if ( jQuery.isFunction( data ) ) {
-			type = type || callback;
-			callback = data;
-			data = undefined;
+		// Apply the dataFilter if provided
+		if ( !prev && isSuccess && s.dataFilter ) {
+			response = s.dataFilter( response, s.dataType );
 		}
 
-		return jQuery.ajax({
-			type: method,
-			url: url,
-			data: data,
-			success: callback,
-			dataType: type
-		});
-	};
-});
+		prev = current;
+		current = dataTypes.shift();
 
-jQuery.extend({
+		if ( current ) {
 
-	getScript: function( url, callback ) {
-		return jQuery.get( url, undefined, callback, "script" );
-	},
+			// There's only work to do if current dataType is non-auto
+			if ( current === "*" ) {
 
-	getJSON: function( url, data, callback ) {
-		return jQuery.get( url, data, callback, "json" );
-	},
+				current = prev;
 
-	// Creates a full fledged settings object into target
-	// with both ajaxSettings and settings fields.
-	// If target is omitted, writes into ajaxSettings.
-	ajaxSetup: function( target, settings ) {
-		if ( settings ) {
-			// Building a settings object
-			ajaxExtend( target, jQuery.ajaxSettings );
-		} else {
-			// Extending ajaxSettings
-			settings = target;
-			target = jQuery.ajaxSettings;
+			// Convert response if prev dataType is non-auto and differs from current
+			} else if ( prev !== "*" && prev !== current ) {
+
+				// Seek a direct converter
+				conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+				// If none found, seek a pair
+				if ( !conv ) {
+					for ( conv2 in converters ) {
+
+						// If conv2 outputs current
+						tmp = conv2.split( " " );
+						if ( tmp[ 1 ] === current ) {
+
+							// If prev can be converted to accepted input
+							conv = converters[ prev + " " + tmp[ 0 ] ] ||
+								converters[ "* " + tmp[ 0 ] ];
+							if ( conv ) {
+
+								// Condense equivalence converters
+								if ( conv === true ) {
+									conv = converters[ conv2 ];
+
+								// Otherwise, insert the intermediate dataType
+								} else if ( converters[ conv2 ] !== true ) {
+									current = tmp[ 0 ];
+									dataTypes.unshift( tmp[ 1 ] );
+								}
+								break;
+							}
+						}
+					}
+				}
+
+				// Apply converter (if not an equivalence)
+				if ( conv !== true ) {
+
+					// Unless errors are allowed to bubble, catch and return them
+					if ( conv && s[ "throws" ] ) { // jscs:ignore requireDotNotation
+						response = conv( response );
+					} else {
+						try {
+							response = conv( response );
+						} catch ( e ) {
+							return {
+								state: "parsererror",
+								error: conv ? e : "No conversion from " + prev + " to " + current
+							};
+						}
+					}
+				}
+			}
 		}
-		ajaxExtend( target, settings );
-		return target;
-	},
+	}
+
+	return { state: "success", data: response };
+}
+
+jQuery.extend( {
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {},
 
 	ajaxSettings: {
 		url: ajaxLocation,
+		type: "GET",
 		isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
 		global: true,
-		type: "GET",
-		contentType: "application/x-www-form-urlencoded; charset=UTF-8",
 		processData: true,
 		async: true,
+		contentType: "application/x-www-form-urlencoded; charset=UTF-8",
 		/*
 		timeout: 0,
 		data: null,
@@ -7293,36 +9375,37 @@ jQuery.extend({
 		username: null,
 		password: null,
 		cache: null,
+		throws: false,
 		traditional: false,
 		headers: {},
 		*/
 
 		accepts: {
-			xml: "application/xml, text/xml",
-			html: "text/html",
+			"*": allTypes,
 			text: "text/plain",
-			json: "application/json, text/javascript",
-			"*": allTypes
+			html: "text/html",
+			xml: "application/xml, text/xml",
+			json: "application/json, text/javascript"
 		},
 
 		contents: {
-			xml: /xml/,
-			html: /html/,
-			json: /json/
+			xml: /\bxml\b/,
+			html: /\bhtml/,
+			json: /\bjson\b/
 		},
 
 		responseFields: {
 			xml: "responseXML",
-			text: "responseText"
+			text: "responseText",
+			json: "responseJSON"
 		},
 
-		// List of data converters
-		// 1) key format is "source_type destination_type" (a single space in-between)
-		// 2) the catchall symbol "*" can be used for source_type
+		// Data converters
+		// Keys separate source (or catchall "*") and destination types with a single space
 		converters: {
 
 			// Convert anything to text
-			"* text": window.String,
+			"* text": String,
 
 			// Text to html (true = no transformation)
 			"text html": true,
@@ -7339,11 +9422,24 @@ jQuery.extend({
 		// and when you create one that shouldn't be
 		// deep extended (see ajaxExtend)
 		flatOptions: {
-			context: true,
-			url: true
+			url: true,
+			context: true
 		}
 	},
 
+	// Creates a full fledged settings object into target
+	// with both ajaxSettings and settings fields.
+	// If target is omitted, writes into ajaxSettings.
+	ajaxSetup: function( target, settings ) {
+		return settings ?
+
+			// Building a settings object
+			ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+			// Extending ajaxSettings
+			ajaxExtend( jQuery.ajaxSettings, target );
+	},
+
 	ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
 	ajaxTransport: addToPrefiltersOrTransports( transports ),
 
@@ -7359,74 +9455,92 @@ jQuery.extend({
 		// Force options to be an object
 		options = options || {};
 
-		var // Create the final options object
+		var
+
+			// Cross-domain detection vars
+			parts,
+
+			// Loop variable
+			i,
+
+			// URL without anti-cache param
+			cacheURL,
+
+			// Response headers as string
+			responseHeadersString,
+
+			// timeout handle
+			timeoutTimer,
+
+			// To know if global events are to be dispatched
+			fireGlobals,
+
+			transport,
+
+			// Response headers
+			responseHeaders,
+
+			// Create the final options object
 			s = jQuery.ajaxSetup( {}, options ),
+
 			// Callbacks context
 			callbackContext = s.context || s,
-			// Context for global events
-			// It's the callbackContext if one was provided in the options
-			// and if it's a DOM node or a jQuery collection
-			globalEventContext = callbackContext !== s &&
-				( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
-						jQuery( callbackContext ) : jQuery.event,
+
+			// Context for global events is callbackContext if it is a DOM node or jQuery collection
+			globalEventContext = s.context &&
+				( callbackContext.nodeType || callbackContext.jquery ) ?
+					jQuery( callbackContext ) :
+					jQuery.event,
+
 			// Deferreds
 			deferred = jQuery.Deferred(),
 			completeDeferred = jQuery.Callbacks( "once memory" ),
+
 			// Status-dependent callbacks
 			statusCode = s.statusCode || {},
-			// ifModified key
-			ifModifiedKey,
+
 			// Headers (they are sent all at once)
 			requestHeaders = {},
 			requestHeadersNames = {},
-			// Response headers
-			responseHeadersString,
-			responseHeaders,
-			// transport
-			transport,
-			// timeout handle
-			timeoutTimer,
-			// Cross-domain detection vars
-			parts,
+
 			// The jqXHR state
 			state = 0,
-			// To know if global events are to be dispatched
-			fireGlobals,
-			// Loop variable
-			i,
+
+			// Default abort message
+			strAbort = "canceled",
+
 			// Fake xhr
 			jqXHR = {
-
 				readyState: 0,
 
-				// Caches the header
-				setRequestHeader: function( name, value ) {
-					if ( !state ) {
-						var lname = name.toLowerCase();
-						name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
-						requestHeaders[ name ] = value;
-					}
-					return this;
-				},
-
-				// Raw string
-				getAllResponseHeaders: function() {
-					return state === 2 ? responseHeadersString : null;
-				},
-
 				// Builds headers hashtable if needed
 				getResponseHeader: function( key ) {
 					var match;
 					if ( state === 2 ) {
 						if ( !responseHeaders ) {
 							responseHeaders = {};
-							while( ( match = rheaders.exec( responseHeadersString ) ) ) {
-								responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+							while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
+								responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ];
 							}
 						}
 						match = responseHeaders[ key.toLowerCase() ];
 					}
-					return match === undefined ? null : match;
+					return match == null ? null : match;
+				},
+
+				// Raw string
+				getAllResponseHeaders: function() {
+					return state === 2 ? responseHeadersString : null;
+				},
+
+				// Caches the header
+				setRequestHeader: function( name, value ) {
+					var lname = name.toLowerCase();
+					if ( !state ) {
+						name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+						requestHeaders[ name ] = value;
+					}
+					return this;
 				},
 
 				// Overrides response content-type header
@@ -7437,167 +9551,62 @@ jQuery.extend({
 					return this;
 				},
 
+				// Status-dependent callbacks
+				statusCode: function( map ) {
+					var code;
+					if ( map ) {
+						if ( state < 2 ) {
+							for ( code in map ) {
+
+								// Lazy-add the new callback in a way that preserves old ones
+								statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+							}
+						} else {
+
+							// Execute the appropriate callbacks
+							jqXHR.always( map[ jqXHR.status ] );
+						}
+					}
+					return this;
+				},
+
 				// Cancel the request
 				abort: function( statusText ) {
-					statusText = statusText || "abort";
+					var finalText = statusText || strAbort;
 					if ( transport ) {
-						transport.abort( statusText );
+						transport.abort( finalText );
 					}
-					done( 0, statusText );
+					done( 0, finalText );
 					return this;
 				}
 			};
 
-		// Callback for when everything is done
-		// It is defined here because jslint complains if it is declared
-		// at the end of the function (which would be more logical and readable)
-		function done( status, nativeStatusText, responses, headers ) {
-
-			// Called once
-			if ( state === 2 ) {
-				return;
-			}
-
-			// State is "done" now
-			state = 2;
-
-			// Clear timeout if it exists
-			if ( timeoutTimer ) {
-				clearTimeout( timeoutTimer );
-			}
-
-			// Dereference transport for early garbage collection
-			// (no matter how long the jqXHR object will be used)
-			transport = undefined;
-
-			// Cache response headers
-			responseHeadersString = headers || "";
-
-			// Set readyState
-			jqXHR.readyState = status > 0 ? 4 : 0;
-
-			var isSuccess,
-				success,
-				error,
-				statusText = nativeStatusText,
-				response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined,
-				lastModified,
-				etag;
-
-			// If successful, handle type chaining
-			if ( status >= 200 && status < 300 || status === 304 ) {
-
-				// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
-				if ( s.ifModified ) {
-
-					if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) {
-						jQuery.lastModified[ ifModifiedKey ] = lastModified;
-					}
-					if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) {
-						jQuery.etag[ ifModifiedKey ] = etag;
-					}
-				}
-
-				// If not modified
-				if ( status === 304 ) {
-
-					statusText = "notmodified";
-					isSuccess = true;
-
-				// If we have data
-				} else {
-
-					try {
-						success = ajaxConvert( s, response );
-						statusText = "success";
-						isSuccess = true;
-					} catch(e) {
-						// We have a parsererror
-						statusText = "parsererror";
-						error = e;
-					}
-				}
-			} else {
-				// We extract error from statusText
-				// then normalize statusText and status for non-aborts
-				error = statusText;
-				if ( !statusText || status ) {
-					statusText = "error";
-					if ( status < 0 ) {
-						status = 0;
-					}
-				}
-			}
-
-			// Set data for the fake xhr object
-			jqXHR.status = status;
-			jqXHR.statusText = "" + ( nativeStatusText || statusText );
-
-			// Success/Error
-			if ( isSuccess ) {
-				deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
-			} else {
-				deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
-			}
-
-			// Status-dependent callbacks
-			jqXHR.statusCode( statusCode );
-			statusCode = undefined;
-
-			if ( fireGlobals ) {
-				globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
-						[ jqXHR, s, isSuccess ? success : error ] );
-			}
-
-			// Complete
-			completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
-
-			if ( fireGlobals ) {
-				globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
-				// Handle the global AJAX counter
-				if ( !( --jQuery.active ) ) {
-					jQuery.event.trigger( "ajaxStop" );
-				}
-			}
-		}
-
 		// Attach deferreds
-		deferred.promise( jqXHR );
+		deferred.promise( jqXHR ).complete = completeDeferred.add;
 		jqXHR.success = jqXHR.done;
 		jqXHR.error = jqXHR.fail;
-		jqXHR.complete = completeDeferred.add;
-
-		// Status-dependent callbacks
-		jqXHR.statusCode = function( map ) {
-			if ( map ) {
-				var tmp;
-				if ( state < 2 ) {
-					for ( tmp in map ) {
-						statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
-					}
-				} else {
-					tmp = map[ jqXHR.status ];
-					jqXHR.then( tmp, tmp );
-				}
-			}
-			return this;
-		};
 
 		// Remove hash character (#7531: and string promotion)
 		// Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+		// Handle falsy url in the settings object (#10093: consistency with old signature)
 		// We also use the url parameter if available
-		s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+		s.url = ( ( url || s.url || ajaxLocation ) + "" )
+			.replace( rhash, "" )
+			.replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+		// Alias method option to type as per ticket #12004
+		s.type = options.method || options.type || s.method || s.type;
 
 		// Extract dataTypes list
-		s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax );
+		s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().match( rnotwhite ) || [ "" ];
 
-		// Determine if a cross-domain request is in order
+		// A cross-domain request is in order when we have a protocol:host:port mismatch
 		if ( s.crossDomain == null ) {
 			parts = rurl.exec( s.url.toLowerCase() );
 			s.crossDomain = !!( parts &&
-				( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
-					( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
-						( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+				( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] ||
+					( parts[ 3 ] || ( parts[ 1 ] === "http:" ? "80" : "443" ) ) !==
+						( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? "80" : "443" ) ) )
 			);
 		}
 
@@ -7611,11 +9620,17 @@ jQuery.extend({
 
 		// If request was aborted inside a prefilter, stop there
 		if ( state === 2 ) {
-			return false;
+			return jqXHR;
 		}
 
 		// We can fire global events as of now if asked to
-		fireGlobals = s.global;
+		// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
+		fireGlobals = jQuery.event && s.global;
+
+		// Watch for a new set of requests
+		if ( fireGlobals && jQuery.active++ === 0 ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
 
 		// Uppercase the type
 		s.type = s.type.toUpperCase();
@@ -7623,57 +9638,54 @@ jQuery.extend({
 		// Determine if request has content
 		s.hasContent = !rnoContent.test( s.type );
 
-		// Watch for a new set of requests
-		if ( fireGlobals && jQuery.active++ === 0 ) {
-			jQuery.event.trigger( "ajaxStart" );
-		}
+		// Save the URL in case we're toying with the If-Modified-Since
+		// and/or If-None-Match header later on
+		cacheURL = s.url;
 
 		// More options handling for requests with no content
 		if ( !s.hasContent ) {
 
 			// If data is available, append data to url
 			if ( s.data ) {
-				s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
+				cacheURL = ( s.url += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data );
+
 				// #9682: remove data so that it's not used in an eventual retry
 				delete s.data;
 			}
 
-			// Get ifModifiedKey before adding the anti-cache parameter
-			ifModifiedKey = s.url;
-
 			// Add anti-cache in url if needed
 			if ( s.cache === false ) {
+				s.url = rts.test( cacheURL ) ?
 
-				var ts = jQuery.now(),
-					// try replacing _= if it is there
-					ret = s.url.replace( rts, "$1_=" + ts );
+					// If there is already a '_' parameter, set its value
+					cacheURL.replace( rts, "$1_=" + nonce++ ) :
 
-				// if nothing was replaced, add timestamp to the end
-				s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
+					// Otherwise add one to the end
+					cacheURL + ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + nonce++;
 			}
 		}
 
-		// Set the correct header, if data is being sent
-		if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
-			jqXHR.setRequestHeader( "Content-Type", s.contentType );
-		}
-
 		// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
 		if ( s.ifModified ) {
-			ifModifiedKey = ifModifiedKey || s.url;
-			if ( jQuery.lastModified[ ifModifiedKey ] ) {
-				jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] );
+			if ( jQuery.lastModified[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
 			}
-			if ( jQuery.etag[ ifModifiedKey ] ) {
-				jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] );
+			if ( jQuery.etag[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
 			}
 		}
 
+		// Set the correct header, if data is being sent
+		if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+			jqXHR.setRequestHeader( "Content-Type", s.contentType );
+		}
+
 		// Set the Accepts header for the server, depending on the dataType
 		jqXHR.setRequestHeader(
 			"Accept",
-			s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
-				s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+			s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
+				s.accepts[ s.dataTypes[ 0 ] ] +
+					( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
 				s.accepts[ "*" ]
 		);
 
@@ -7683,13 +9695,16 @@ jQuery.extend({
 		}
 
 		// Allow custom headers/mimetypes and early abort
-		if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
-				// Abort if not done already
-				jqXHR.abort();
-				return false;
+		if ( s.beforeSend &&
+			( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
 
+			// Abort if not done already and return
+			return jqXHR.abort();
 		}
 
+		// aborting is no longer a cancellation
+		strAbort = "abort";
+
 		// Install callbacks on deferreds
 		for ( i in { success: 1, error: 1, complete: 1 } ) {
 			jqXHR[ i ]( s[ i ] );
@@ -7703,13 +9718,20 @@ jQuery.extend({
 			done( -1, "No Transport" );
 		} else {
 			jqXHR.readyState = 1;
+
 			// Send global event
 			if ( fireGlobals ) {
 				globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
 			}
+
+			// If request was aborted inside ajaxSend, stop there
+			if ( state === 2 ) {
+				return jqXHR;
+			}
+
 			// Timeout
 			if ( s.async && s.timeout > 0 ) {
-				timeoutTimer = setTimeout( function(){
+				timeoutTimer = window.setTimeout( function() {
 					jqXHR.abort( "timeout" );
 				}, s.timeout );
 			}
@@ -7717,10 +9739,12 @@ jQuery.extend({
 			try {
 				state = 1;
 				transport.send( requestHeaders, done );
-			} catch (e) {
+			} catch ( e ) {
+
 				// Propagate exception as error if not done
 				if ( state < 2 ) {
 					done( -1, e );
+
 				// Simply rethrow otherwise
 				} else {
 					throw e;
@@ -7728,494 +9752,480 @@ jQuery.extend({
 			}
 		}
 
-		return jqXHR;
-	},
+		// Callback for when everything is done
+		function done( status, nativeStatusText, responses, headers ) {
+			var isSuccess, success, error, response, modified,
+				statusText = nativeStatusText;
 
-	// Serialize an array of form elements or a set of
-	// key/values into a query string
-	param: function( a, traditional ) {
-		var s = [],
-			add = function( key, value ) {
-				// If value is a function, invoke it and return its value
-				value = jQuery.isFunction( value ) ? value() : value;
-				s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
-			};
+			// Called once
+			if ( state === 2 ) {
+				return;
+			}
 
-		// Set traditional to true for jQuery <= 1.3.2 behavior.
-		if ( traditional === undefined ) {
-			traditional = jQuery.ajaxSettings.traditional;
-		}
+			// State is "done" now
+			state = 2;
 
-		// If an array was passed in, assume that it is an array of form elements.
-		if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
-			// Serialize the form elements
-			jQuery.each( a, function() {
-				add( this.name, this.value );
-			});
+			// Clear timeout if it exists
+			if ( timeoutTimer ) {
+				window.clearTimeout( timeoutTimer );
+			}
 
-		} else {
-			// If traditional, encode the "old" way (the way 1.3.2 or older
-			// did it), otherwise encode params recursively.
-			for ( var prefix in a ) {
-				buildParams( prefix, a[ prefix ], traditional, add );
+			// Dereference transport for early garbage collection
+			// (no matter how long the jqXHR object will be used)
+			transport = undefined;
+
+			// Cache response headers
+			responseHeadersString = headers || "";
+
+			// Set readyState
+			jqXHR.readyState = status > 0 ? 4 : 0;
+
+			// Determine if successful
+			isSuccess = status >= 200 && status < 300 || status === 304;
+
+			// Get response data
+			if ( responses ) {
+				response = ajaxHandleResponses( s, jqXHR, responses );
 			}
-		}
 
-		// Return the resulting serialization
-		return s.join( "&" ).replace( r20, "+" );
-	}
-});
+			// Convert no matter what (that way responseXXX fields are always set)
+			response = ajaxConvert( s, response, jqXHR, isSuccess );
 
-function buildParams( prefix, obj, traditional, add ) {
-	if ( jQuery.isArray( obj ) ) {
-		// Serialize array item.
-		jQuery.each( obj, function( i, v ) {
-			if ( traditional || rbracket.test( prefix ) ) {
-				// Treat each array item as a scalar.
-				add( prefix, v );
+			// If successful, handle type chaining
+			if ( isSuccess ) {
+
+				// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+				if ( s.ifModified ) {
+					modified = jqXHR.getResponseHeader( "Last-Modified" );
+					if ( modified ) {
+						jQuery.lastModified[ cacheURL ] = modified;
+					}
+					modified = jqXHR.getResponseHeader( "etag" );
+					if ( modified ) {
+						jQuery.etag[ cacheURL ] = modified;
+					}
+				}
+
+				// if no content
+				if ( status === 204 || s.type === "HEAD" ) {
+					statusText = "nocontent";
 
+				// if not modified
+				} else if ( status === 304 ) {
+					statusText = "notmodified";
+
+				// If we have data, let's convert it
+				} else {
+					statusText = response.state;
+					success = response.data;
+					error = response.error;
+					isSuccess = !error;
+				}
 			} else {
-				// If array item is non-scalar (array or object), encode its
-				// numeric index to resolve deserialization ambiguity issues.
-				// Note that rack (as of 1.0.0) can't currently deserialize
-				// nested arrays properly, and attempting to do so may cause
-				// a server error. Possible fixes are to modify rack's
-				// deserialization algorithm or to provide an option or flag
-				// to force array serialization to be shallow.
-				buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add );
+
+				// We extract error from statusText
+				// then normalize statusText and status for non-aborts
+				error = statusText;
+				if ( status || !statusText ) {
+					statusText = "error";
+					if ( status < 0 ) {
+						status = 0;
+					}
+				}
 			}
-		});
 
-	} else if ( !traditional && jQuery.type( obj ) === "object" ) {
-		// Serialize object item.
-		for ( var name in obj ) {
-			buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
-		}
+			// Set data for the fake xhr object
+			jqXHR.status = status;
+			jqXHR.statusText = ( nativeStatusText || statusText ) + "";
 
-	} else {
-		// Serialize scalar item.
-		add( prefix, obj );
-	}
-}
+			// Success/Error
+			if ( isSuccess ) {
+				deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+			} else {
+				deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+			}
+
+			// Status-dependent callbacks
+			jqXHR.statusCode( statusCode );
+			statusCode = undefined;
 
-// This is still on the jQuery object... for now
-// Want to move this to jQuery.ajax some day
-jQuery.extend({
+			if ( fireGlobals ) {
+				globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+					[ jqXHR, s, isSuccess ? success : error ] );
+			}
 
-	// Counter for holding the number of active queries
-	active: 0,
+			// Complete
+			completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
 
-	// Last-Modified header cache for next request
-	lastModified: {},
-	etag: {}
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
 
-});
+				// Handle the global AJAX counter
+				if ( !( --jQuery.active ) ) {
+					jQuery.event.trigger( "ajaxStop" );
+				}
+			}
+		}
 
-/* Handles responses to an ajax request:
- * - sets all responseXXX fields accordingly
- * - finds the right dataType (mediates between content-type and expected dataType)
- * - returns the corresponding response
- */
-function ajaxHandleResponses( s, jqXHR, responses ) {
+		return jqXHR;
+	},
 
-	var contents = s.contents,
-		dataTypes = s.dataTypes,
-		responseFields = s.responseFields,
-		ct,
-		type,
-		finalDataType,
-		firstDataType;
+	getJSON: function( url, data, callback ) {
+		return jQuery.get( url, data, callback, "json" );
+	},
 
-	// Fill responseXXX fields
-	for ( type in responseFields ) {
-		if ( type in responses ) {
-			jqXHR[ responseFields[type] ] = responses[ type ];
-		}
+	getScript: function( url, callback ) {
+		return jQuery.get( url, undefined, callback, "script" );
 	}
+} );
 
-	// Remove auto dataType and get content-type in the process
-	while( dataTypes[ 0 ] === "*" ) {
-		dataTypes.shift();
-		if ( ct === undefined ) {
-			ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
-		}
-	}
+jQuery.each( [ "get", "post" ], function( i, method ) {
+	jQuery[ method ] = function( url, data, callback, type ) {
 
-	// Check if we're dealing with a known content-type
-	if ( ct ) {
-		for ( type in contents ) {
-			if ( contents[ type ] && contents[ type ].test( ct ) ) {
-				dataTypes.unshift( type );
-				break;
-			}
+		// shift arguments if data argument was omitted
+		if ( jQuery.isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = undefined;
 		}
-	}
 
-	// Check to see if we have a response for the expected dataType
-	if ( dataTypes[ 0 ] in responses ) {
-		finalDataType = dataTypes[ 0 ];
-	} else {
-		// Try convertible dataTypes
-		for ( type in responses ) {
-			if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
-				finalDataType = type;
-				break;
-			}
-			if ( !firstDataType ) {
-				firstDataType = type;
-			}
-		}
-		// Or just use first one
-		finalDataType = finalDataType || firstDataType;
-	}
+		// The url can be an options object (which then must have .url)
+		return jQuery.ajax( jQuery.extend( {
+			url: url,
+			type: method,
+			dataType: type,
+			data: data,
+			success: callback
+		}, jQuery.isPlainObject( url ) && url ) );
+	};
+} );
 
-	// If we found a dataType
-	// We add the dataType to the list if needed
-	// and return the corresponding response
-	if ( finalDataType ) {
-		if ( finalDataType !== dataTypes[ 0 ] ) {
-			dataTypes.unshift( finalDataType );
-		}
-		return responses[ finalDataType ];
-	}
-}
 
-// Chain conversions given the request and the original response
-function ajaxConvert( s, response ) {
+jQuery._evalUrl = function( url ) {
+	return jQuery.ajax( {
+		url: url,
 
-	// Apply the dataFilter if provided
-	if ( s.dataFilter ) {
-		response = s.dataFilter( response, s.dataType );
-	}
+		// Make this explicit, since user can override this through ajaxSetup (#11264)
+		type: "GET",
+		dataType: "script",
+		cache: true,
+		async: false,
+		global: false,
+		"throws": true
+	} );
+};
 
-	var dataTypes = s.dataTypes,
-		converters = {},
-		i,
-		key,
-		length = dataTypes.length,
-		tmp,
-		// Current and previous dataTypes
-		current = dataTypes[ 0 ],
-		prev,
-		// Conversion expression
-		conversion,
-		// Conversion function
-		conv,
-		// Conversion functions (transitive conversion)
-		conv1,
-		conv2;
-
-	// For each dataType in the chain
-	for ( i = 1; i < length; i++ ) {
-
-		// Create converters map
-		// with lowercased keys
-		if ( i === 1 ) {
-			for ( key in s.converters ) {
-				if ( typeof key === "string" ) {
-					converters[ key.toLowerCase() ] = s.converters[ key ];
-				}
-			}
-		}
 
-		// Get the dataTypes
-		prev = current;
-		current = dataTypes[ i ];
-
-		// If current is auto dataType, update it to prev
-		if ( current === "*" ) {
-			current = prev;
-		// If no auto and dataTypes are actually different
-		} else if ( prev !== "*" && prev !== current ) {
-
-			// Get the converter
-			conversion = prev + " " + current;
-			conv = converters[ conversion ] || converters[ "* " + current ];
-
-			// If there is no direct converter, search transitively
-			if ( !conv ) {
-				conv2 = undefined;
-				for ( conv1 in converters ) {
-					tmp = conv1.split( " " );
-					if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) {
-						conv2 = converters[ tmp[1] + " " + current ];
-						if ( conv2 ) {
-							conv1 = converters[ conv1 ];
-							if ( conv1 === true ) {
-								conv = conv2;
-							} else if ( conv2 === true ) {
-								conv = conv1;
-							}
-							break;
-						}
-					}
-				}
-			}
-			// If we found no converter, dispatch an error
-			if ( !( conv || conv2 ) ) {
-				jQuery.error( "No conversion from " + conversion.replace(" "," to ") );
-			}
-			// If found converter is not an equivalence
-			if ( conv !== true ) {
-				// Convert with 1 or 2 converters accordingly
-				response = conv ? conv( response ) : conv2( conv1(response) );
-			}
+jQuery.fn.extend( {
+	wrapAll: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).wrapAll( html.call( this, i ) );
+			} );
 		}
-	}
-	return response;
-}
 
+		if ( this[ 0 ] ) {
 
+			// The elements to wrap the target around
+			var wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
 
+			if ( this[ 0 ].parentNode ) {
+				wrap.insertBefore( this[ 0 ] );
+			}
 
-var jsc = jQuery.now(),
-	jsre = /(\=)\?(&|$)|\?\?/i;
+			wrap.map( function() {
+				var elem = this;
 
-// Default jsonp settings
-jQuery.ajaxSetup({
-	jsonp: "callback",
-	jsonpCallback: function() {
-		return jQuery.expando + "_" + ( jsc++ );
-	}
-});
+				while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+					elem = elem.firstChild;
+				}
 
-// Detect, normalize options and install callbacks for jsonp requests
-jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+				return elem;
+			} ).append( this );
+		}
 
-	var inspectData = ( typeof s.data === "string" ) && /^application\/x\-www\-form\-urlencoded/.test( s.contentType );
-
-	if ( s.dataTypes[ 0 ] === "jsonp" ||
-		s.jsonp !== false && ( jsre.test( s.url ) ||
-				inspectData && jsre.test( s.data ) ) ) {
-
-		var responseContainer,
-			jsonpCallback = s.jsonpCallback =
-				jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback,
-			previous = window[ jsonpCallback ],
-			url = s.url,
-			data = s.data,
-			replace = "$1" + jsonpCallback + "$2";
-
-		if ( s.jsonp !== false ) {
-			url = url.replace( jsre, replace );
-			if ( s.url === url ) {
-				if ( inspectData ) {
-					data = data.replace( jsre, replace );
-				}
-				if ( s.data === data ) {
-					// Add callback manually
-					url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback;
-				}
-			}
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).wrapInner( html.call( this, i ) );
+			} );
 		}
 
-		s.url = url;
-		s.data = data;
+		return this.each( function() {
+			var self = jQuery( this ),
+				contents = self.contents();
 
-		// Install callback
-		window[ jsonpCallback ] = function( response ) {
-			responseContainer = [ response ];
-		};
+			if ( contents.length ) {
+				contents.wrapAll( html );
 
-		// Clean-up function
-		jqXHR.always(function() {
-			// Set callback back to previous value
-			window[ jsonpCallback ] = previous;
-			// Call if it was a function and we have a response
-			if ( responseContainer && jQuery.isFunction( previous ) ) {
-				window[ jsonpCallback ]( responseContainer[ 0 ] );
+			} else {
+				self.append( html );
 			}
-		});
+		} );
+	},
 
-		// Use data converter to retrieve json after script execution
-		s.converters["script json"] = function() {
-			if ( !responseContainer ) {
-				jQuery.error( jsonpCallback + " was not called" );
-			}
-			return responseContainer[ 0 ];
-		};
+	wrap: function( html ) {
+		var isFunction = jQuery.isFunction( html );
 
-		// force json dataType
-		s.dataTypes[ 0 ] = "json";
+		return this.each( function( i ) {
+			jQuery( this ).wrapAll( isFunction ? html.call( this, i ) : html );
+		} );
+	},
 
-		// Delegate to script
-		return "script";
+	unwrap: function() {
+		return this.parent().each( function() {
+			if ( !jQuery.nodeName( this, "body" ) ) {
+				jQuery( this ).replaceWith( this.childNodes );
+			}
+		} ).end();
 	}
-});
+} );
 
 
+function getDisplay( elem ) {
+	return elem.style && elem.style.display || jQuery.css( elem, "display" );
+}
 
+function filterHidden( elem ) {
 
-// Install script dataType
-jQuery.ajaxSetup({
-	accepts: {
-		script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
-	},
-	contents: {
-		script: /javascript|ecmascript/
-	},
-	converters: {
-		"text script": function( text ) {
-			jQuery.globalEval( text );
-			return text;
+	// Disconnected elements are considered hidden
+	if ( !jQuery.contains( elem.ownerDocument || document, elem ) ) {
+		return true;
+	}
+	while ( elem && elem.nodeType === 1 ) {
+		if ( getDisplay( elem ) === "none" || elem.type === "hidden" ) {
+			return true;
 		}
+		elem = elem.parentNode;
 	}
-});
+	return false;
+}
 
-// Handle cache's special case and global
-jQuery.ajaxPrefilter( "script", function( s ) {
-	if ( s.cache === undefined ) {
-		s.cache = false;
-	}
-	if ( s.crossDomain ) {
-		s.type = "GET";
-		s.global = false;
-	}
-});
+jQuery.expr.filters.hidden = function( elem ) {
 
-// Bind script tag hack transport
-jQuery.ajaxTransport( "script", function(s) {
+	// Support: Opera <= 12.12
+	// Opera reports offsetWidths and offsetHeights less than zero on some elements
+	return support.reliableHiddenOffsets() ?
+		( elem.offsetWidth <= 0 && elem.offsetHeight <= 0 &&
+			!elem.getClientRects().length ) :
+			filterHidden( elem );
+};
 
-	// This transport only deals with cross domain requests
-	if ( s.crossDomain ) {
+jQuery.expr.filters.visible = function( elem ) {
+	return !jQuery.expr.filters.hidden( elem );
+};
 
-		var script,
-			head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
 
-		return {
 
-			send: function( _, callback ) {
 
-				script = document.createElement( "script" );
+var r20 = /%20/g,
+	rbracket = /\[\]$/,
+	rCRLF = /\r?\n/g,
+	rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+	rsubmittable = /^(?:input|select|textarea|keygen)/i;
 
-				script.async = "async";
+function buildParams( prefix, obj, traditional, add ) {
+	var name;
 
-				if ( s.scriptCharset ) {
-					script.charset = s.scriptCharset;
-				}
+	if ( jQuery.isArray( obj ) ) {
 
-				script.src = s.url;
+		// Serialize array item.
+		jQuery.each( obj, function( i, v ) {
+			if ( traditional || rbracket.test( prefix ) ) {
 
-				// Attach handlers for all browsers
-				script.onload = script.onreadystatechange = function( _, isAbort ) {
+				// Treat each array item as a scalar.
+				add( prefix, v );
 
-					if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+			} else {
 
-						// Handle memory leak in IE
-						script.onload = script.onreadystatechange = null;
+				// Item is non-scalar (array or object), encode its numeric index.
+				buildParams(
+					prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
+					v,
+					traditional,
+					add
+				);
+			}
+		} );
 
-						// Remove the script
-						if ( head && script.parentNode ) {
-							head.removeChild( script );
-						}
+	} else if ( !traditional && jQuery.type( obj ) === "object" ) {
 
-						// Dereference the script
-						script = undefined;
+		// Serialize object item.
+		for ( name in obj ) {
+			buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+		}
 
-						// Callback if not abort
-						if ( !isAbort ) {
-							callback( 200, "success" );
-						}
-					}
-				};
-				// Use insertBefore instead of appendChild  to circumvent an IE6 bug.
-				// This arises when a base node is used (#2709 and #4378).
-				head.insertBefore( script, head.firstChild );
-			},
+	} else {
 
-			abort: function() {
-				if ( script ) {
-					script.onload( 0, 1 );
-				}
-			}
+		// Serialize scalar item.
+		add( prefix, obj );
+	}
+}
+
+// Serialize an array of form elements or a set of
+// key/values into a query string
+jQuery.param = function( a, traditional ) {
+	var prefix,
+		s = [],
+		add = function( key, value ) {
+
+			// If value is a function, invoke it and return its value
+			value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value );
+			s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
 		};
+
+	// Set traditional to true for jQuery <= 1.3.2 behavior.
+	if ( traditional === undefined ) {
+		traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
 	}
-});
 
+	// If an array was passed in, assume that it is an array of form elements.
+	if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
 
+		// Serialize the form elements
+		jQuery.each( a, function() {
+			add( this.name, this.value );
+		} );
 
+	} else {
 
-var // #5280: Internet Explorer will keep connections alive if we don't abort on unload
-	xhrOnUnloadAbort = window.ActiveXObject ? function() {
-		// Abort all pending requests
-		for ( var key in xhrCallbacks ) {
-			xhrCallbacks[ key ]( 0, 1 );
+		// If traditional, encode the "old" way (the way 1.3.2 or older
+		// did it), otherwise encode params recursively.
+		for ( prefix in a ) {
+			buildParams( prefix, a[ prefix ], traditional, add );
 		}
-	} : false,
-	xhrId = 0,
-	xhrCallbacks;
+	}
 
-// Functions to create xhrs
-function createStandardXHR() {
-	try {
-		return new window.XMLHttpRequest();
-	} catch( e ) {}
-}
+	// Return the resulting serialization
+	return s.join( "&" ).replace( r20, "+" );
+};
+
+jQuery.fn.extend( {
+	serialize: function() {
+		return jQuery.param( this.serializeArray() );
+	},
+	serializeArray: function() {
+		return this.map( function() {
+
+			// Can add propHook for "elements" to filter or add form elements
+			var elements = jQuery.prop( this, "elements" );
+			return elements ? jQuery.makeArray( elements ) : this;
+		} )
+		.filter( function() {
+			var type = this.type;
+
+			// Use .is(":disabled") so that fieldset[disabled] works
+			return this.name && !jQuery( this ).is( ":disabled" ) &&
+				rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+				( this.checked || !rcheckableType.test( type ) );
+		} )
+		.map( function( i, elem ) {
+			var val = jQuery( this ).val();
+
+			return val == null ?
+				null :
+				jQuery.isArray( val ) ?
+					jQuery.map( val, function( val ) {
+						return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+					} ) :
+					{ name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+		} ).get();
+	}
+} );
 
-function createActiveXHR() {
-	try {
-		return new window.ActiveXObject( "Microsoft.XMLHTTP" );
-	} catch( e ) {}
-}
 
 // Create the request object
 // (This is still attached to ajaxSettings for backward compatibility)
-jQuery.ajaxSettings.xhr = window.ActiveXObject ?
-	/* Microsoft failed to properly
-	 * implement the XMLHttpRequest in IE7 (can't request local files),
-	 * so we use the ActiveXObject when it is available
-	 * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
-	 * we need a fallback.
-	 */
+jQuery.ajaxSettings.xhr = window.ActiveXObject !== undefined ?
+
+	// Support: IE6-IE8
 	function() {
-		return !this.isLocal && createStandardXHR() || createActiveXHR();
+
+		// XHR cannot access local files, always use ActiveX for that case
+		if ( this.isLocal ) {
+			return createActiveXHR();
+		}
+
+		// Support: IE 9-11
+		// IE seems to error on cross-domain PATCH requests when ActiveX XHR
+		// is used. In IE 9+ always use the native XHR.
+		// Note: this condition won't catch Edge as it doesn't define
+		// document.documentMode but it also doesn't support ActiveX so it won't
+		// reach this code.
+		if ( document.documentMode > 8 ) {
+			return createStandardXHR();
+		}
+
+		// Support: IE<9
+		// oldIE XHR does not support non-RFC2616 methods (#13240)
+		// See http://msdn.microsoft.com/en-us/library/ie/ms536648(v=vs.85).aspx
+		// and http://www.w3.org/Protocols/rfc2616/rfc2616-sec9.html#sec9
+		// Although this check for six methods instead of eight
+		// since IE also does not support "trace" and "connect"
+		return /^(get|post|head|put|delete|options)$/i.test( this.type ) &&
+			createStandardXHR() || createActiveXHR();
 	} :
+
 	// For all other browsers, use the standard XMLHttpRequest object
 	createStandardXHR;
 
+var xhrId = 0,
+	xhrCallbacks = {},
+	xhrSupported = jQuery.ajaxSettings.xhr();
+
+// Support: IE<10
+// Open requests must be manually aborted on unload (#5280)
+// See https://support.microsoft.com/kb/2856746 for more info
+if ( window.attachEvent ) {
+	window.attachEvent( "onunload", function() {
+		for ( var key in xhrCallbacks ) {
+			xhrCallbacks[ key ]( undefined, true );
+		}
+	} );
+}
+
 // Determine support properties
-(function( xhr ) {
-	jQuery.extend( jQuery.support, {
-		ajax: !!xhr,
-		cors: !!xhr && ( "withCredentials" in xhr )
-	});
-})( jQuery.ajaxSettings.xhr() );
+support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+xhrSupported = support.ajax = !!xhrSupported;
 
 // Create transport if the browser can provide an xhr
-if ( jQuery.support.ajax ) {
+if ( xhrSupported ) {
+
+	jQuery.ajaxTransport( function( options ) {
 
-	jQuery.ajaxTransport(function( s ) {
 		// Cross domain only allowed if supported through XMLHttpRequest
-		if ( !s.crossDomain || jQuery.support.cors ) {
+		if ( !options.crossDomain || support.cors ) {
 
 			var callback;
 
 			return {
 				send: function( headers, complete ) {
-
-					// Get a new xhr
-					var xhr = s.xhr(),
-						handle,
-						i;
+					var i,
+						xhr = options.xhr(),
+						id = ++xhrId;
 
 					// Open the socket
-					// Passing null username, generates a login popup on Opera (#2865)
-					if ( s.username ) {
-						xhr.open( s.type, s.url, s.async, s.username, s.password );
-					} else {
-						xhr.open( s.type, s.url, s.async );
-					}
+					xhr.open(
+						options.type,
+						options.url,
+						options.async,
+						options.username,
+						options.password
+					);
 
 					// Apply custom fields if provided
-					if ( s.xhrFields ) {
-						for ( i in s.xhrFields ) {
-							xhr[ i ] = s.xhrFields[ i ];
+					if ( options.xhrFields ) {
+						for ( i in options.xhrFields ) {
+							xhr[ i ] = options.xhrFields[ i ];
 						}
 					}
 
 					// Override mime type if needed
-					if ( s.mimeType && xhr.overrideMimeType ) {
-						xhr.overrideMimeType( s.mimeType );
+					if ( options.mimeType && xhr.overrideMimeType ) {
+						xhr.overrideMimeType( options.mimeType );
 					}
 
 					// X-Requested-With header
@@ -8223,977 +10233,483 @@ if ( jQuery.support.ajax ) {
 					// akin to a jigsaw puzzle, we simply never set it to be sure.
 					// (it can always be set on a per-request basis or even using ajaxSetup)
 					// For same-domain requests, won't change header if already provided.
-					if ( !s.crossDomain && !headers["X-Requested-With"] ) {
+					if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
 						headers[ "X-Requested-With" ] = "XMLHttpRequest";
 					}
 
-					// Need an extra try/catch for cross domain requests in Firefox 3
-					try {
-						for ( i in headers ) {
-							xhr.setRequestHeader( i, headers[ i ] );
+					// Set headers
+					for ( i in headers ) {
+
+						// Support: IE<9
+						// IE's ActiveXObject throws a 'Type Mismatch' exception when setting
+						// request header to a null-value.
+						//
+						// To keep consistent with other XHR implementations, cast the value
+						// to string and ignore `undefined`.
+						if ( headers[ i ] !== undefined ) {
+							xhr.setRequestHeader( i, headers[ i ] + "" );
 						}
-					} catch( _ ) {}
+					}
 
 					// Do send the request
 					// This may raise an exception which is actually
 					// handled in jQuery.ajax (so no try/catch here)
-					xhr.send( ( s.hasContent && s.data ) || null );
+					xhr.send( ( options.hasContent && options.data ) || null );
 
 					// Listener
 					callback = function( _, isAbort ) {
+						var status, statusText, responses;
 
-						var status,
-							statusText,
-							responseHeaders,
-							responses,
-							xml;
-
-						// Firefox throws exceptions when accessing properties
-						// of an xhr when a network error occured
-						// http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
-						try {
-
-							// Was never called and is aborted or complete
-							if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+						// Was never called and is aborted or complete
+						if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
 
-								// Only called once
-								callback = undefined;
+							// Clean up
+							delete xhrCallbacks[ id ];
+							callback = undefined;
+							xhr.onreadystatechange = jQuery.noop;
 
-								// Do not keep as active anymore
-								if ( handle ) {
-									xhr.onreadystatechange = jQuery.noop;
-									if ( xhrOnUnloadAbort ) {
-										delete xhrCallbacks[ handle ];
-									}
+							// Abort manually if needed
+							if ( isAbort ) {
+								if ( xhr.readyState !== 4 ) {
+									xhr.abort();
+								}
+							} else {
+								responses = {};
+								status = xhr.status;
+
+								// Support: IE<10
+								// Accessing binary-data responseText throws an exception
+								// (#11426)
+								if ( typeof xhr.responseText === "string" ) {
+									responses.text = xhr.responseText;
 								}
 
-								// If it's an abort
-								if ( isAbort ) {
-									// Abort it manually if needed
-									if ( xhr.readyState !== 4 ) {
-										xhr.abort();
-									}
-								} else {
-									status = xhr.status;
-									responseHeaders = xhr.getAllResponseHeaders();
-									responses = {};
-									xml = xhr.responseXML;
-
-									// Construct response list
-									if ( xml && xml.documentElement /* #4958 */ ) {
-										responses.xml = xml;
-									}
+								// Firefox throws an exception when accessing
+								// statusText for faulty cross-domain requests
+								try {
+									statusText = xhr.statusText;
+								} catch ( e ) {
 
-									// When requesting binary data, IE6-9 will throw an exception
-									// on any attempt to access responseText (#11426)
-									try {
-										responses.text = xhr.responseText;
-									} catch( _ ) {
-									}
+									// We normalize with Webkit giving an empty statusText
+									statusText = "";
+								}
 
-									// Firefox throws an exception when accessing
-									// statusText for faulty cross-domain requests
-									try {
-										statusText = xhr.statusText;
-									} catch( e ) {
-										// We normalize with Webkit giving an empty statusText
-										statusText = "";
-									}
+								// Filter status for non standard behaviors
 
-									// Filter status for non standard behaviors
+								// If the request is local and we have data: assume a success
+								// (success with no data won't get notified, that's the best we
+								// can do given current implementations)
+								if ( !status && options.isLocal && !options.crossDomain ) {
+									status = responses.text ? 200 : 404;
 
-									// If the request is local and we have data: assume a success
-									// (success with no data won't get notified, that's the best we
-									// can do given current implementations)
-									if ( !status && s.isLocal && !s.crossDomain ) {
-										status = responses.text ? 200 : 404;
-									// IE - #1450: sometimes returns 1223 when it should be 204
-									} else if ( status === 1223 ) {
-										status = 204;
-									}
+								// IE - #1450: sometimes returns 1223 when it should be 204
+								} else if ( status === 1223 ) {
+									status = 204;
 								}
 							}
-						} catch( firefoxAccessException ) {
-							if ( !isAbort ) {
-								complete( -1, firefoxAccessException );
-							}
 						}
 
 						// Call complete if needed
 						if ( responses ) {
-							complete( status, statusText, responses, responseHeaders );
+							complete( status, statusText, responses, xhr.getAllResponseHeaders() );
 						}
 					};
 
-					// if we're in sync mode or it's in cache
-					// and has been retrieved directly (IE6 & IE7)
-					// we need to manually fire the callback
-					if ( !s.async || xhr.readyState === 4 ) {
+					// Do send the request
+					// `xhr.send` may raise an exception, but it will be
+					// handled in jQuery.ajax (so no try/catch here)
+					if ( !options.async ) {
+
+						// If we're in sync mode we fire the callback
 						callback();
+					} else if ( xhr.readyState === 4 ) {
+
+						// (IE6 & IE7) if it's in cache and has been
+						// retrieved directly we need to fire the callback
+						window.setTimeout( callback );
 					} else {
-						handle = ++xhrId;
-						if ( xhrOnUnloadAbort ) {
-							// Create the active xhrs callbacks list if needed
-							// and attach the unload handler
-							if ( !xhrCallbacks ) {
-								xhrCallbacks = {};
-								jQuery( window ).unload( xhrOnUnloadAbort );
-							}
-							// Add to list of active xhrs callbacks
-							xhrCallbacks[ handle ] = callback;
-						}
-						xhr.onreadystatechange = callback;
+
+						// Register the callback, but delay it in case `xhr.send` throws
+						// Add to the list of active xhr callbacks
+						xhr.onreadystatechange = xhrCallbacks[ id ] = callback;
 					}
 				},
 
 				abort: function() {
 					if ( callback ) {
-						callback(0,1);
+						callback( undefined, true );
 					}
 				}
 			};
 		}
-	});
+	} );
 }
 
+// Functions to create xhrs
+function createStandardXHR() {
+	try {
+		return new window.XMLHttpRequest();
+	} catch ( e ) {}
+}
 
+function createActiveXHR() {
+	try {
+		return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+	} catch ( e ) {}
+}
 
 
-var elemdisplay = {},
-	iframe, iframeDoc,
-	rfxtypes = /^(?:toggle|show|hide)$/,
-	rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,
-	timerId,
-	fxAttrs = [
-		// height animations
-		[ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
-		// width animations
-		[ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
-		// opacity animations
-		[ "opacity" ]
-	],
-	fxNow;
-
-jQuery.fn.extend({
-	show: function( speed, easing, callback ) {
-		var elem, display;
-
-		if ( speed || speed === 0 ) {
-			return this.animate( genFx("show", 3), speed, easing, callback );
-
-		} else {
-			for ( var i = 0, j = this.length; i < j; i++ ) {
-				elem = this[ i ];
-
-				if ( elem.style ) {
-					display = elem.style.display;
-
-					// Reset the inline display of this element to learn if it is
-					// being hidden by cascaded rules or not
-					if ( !jQuery._data(elem, "olddisplay") && display === "none" ) {
-						display = elem.style.display = "";
-					}
-
-					// Set elements which have been overridden with display: none
-					// in a stylesheet to whatever the default browser style is
-					// for such an element
-					if ( (display === "" && jQuery.css(elem, "display") === "none") ||
-						!jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
-						jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) );
-					}
-				}
-			}
-
-			// Set the display of most of the elements in a second loop
-			// to avoid the constant reflow
-			for ( i = 0; i < j; i++ ) {
-				elem = this[ i ];
-
-				if ( elem.style ) {
-					display = elem.style.display;
-
-					if ( display === "" || display === "none" ) {
-						elem.style.display = jQuery._data( elem, "olddisplay" ) || "";
-					}
-				}
-			}
-
-			return this;
-		}
-	},
-
-	hide: function( speed, easing, callback ) {
-		if ( speed || speed === 0 ) {
-			return this.animate( genFx("hide", 3), speed, easing, callback);
-
-		} else {
-			var elem, display,
-				i = 0,
-				j = this.length;
-
-			for ( ; i < j; i++ ) {
-				elem = this[i];
-				if ( elem.style ) {
-					display = jQuery.css( elem, "display" );
-
-					if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) {
-						jQuery._data( elem, "olddisplay", display );
-					}
-				}
-			}
-
-			// Set the display of the elements in a second loop
-			// to avoid the constant reflow
-			for ( i = 0; i < j; i++ ) {
-				if ( this[i].style ) {
-					this[i].style.display = "none";
-				}
-			}
-
-			return this;
-		}
-	},
-
-	// Save the old toggle function
-	_toggle: jQuery.fn.toggle,
-
-	toggle: function( fn, fn2, callback ) {
-		var bool = typeof fn === "boolean";
-
-		if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
-			this._toggle.apply( this, arguments );
-
-		} else if ( fn == null || bool ) {
-			this.each(function() {
-				var state = bool ? fn : jQuery(this).is(":hidden");
-				jQuery(this)[ state ? "show" : "hide" ]();
-			});
-
-		} else {
-			this.animate(genFx("toggle", 3), fn, fn2, callback);
-		}
 
-		return this;
-	},
 
-	fadeTo: function( speed, to, easing, callback ) {
-		return this.filter(":hidden").css("opacity", 0).show().end()
-					.animate({opacity: to}, speed, easing, callback);
+// Install script dataType
+jQuery.ajaxSetup( {
+	accepts: {
+		script: "text/javascript, application/javascript, " +
+			"application/ecmascript, application/x-ecmascript"
 	},
-
-	animate: function( prop, speed, easing, callback ) {
-		var optall = jQuery.speed( speed, easing, callback );
-
-		if ( jQuery.isEmptyObject( prop ) ) {
-			return this.each( optall.complete, [ false ] );
-		}
-
-		// Do not change referenced properties as per-property easing will be lost
-		prop = jQuery.extend( {}, prop );
-
-		function doAnimation() {
-			// XXX 'this' does not always have a nodeName when running the
-			// test suite
-
-			if ( optall.queue === false ) {
-				jQuery._mark( this );
-			}
-
-			var opt = jQuery.extend( {}, optall ),
-				isElement = this.nodeType === 1,
-				hidden = isElement && jQuery(this).is(":hidden"),
-				name, val, p, e, hooks, replace,
-				parts, start, end, unit,
-				method;
-
-			// will store per property easing and be used to determine when an animation is complete
-			opt.animatedProperties = {};
-
-			// first pass over propertys to expand / normalize
-			for ( p in prop ) {
-				name = jQuery.camelCase( p );
-				if ( p !== name ) {
-					prop[ name ] = prop[ p ];
-					delete prop[ p ];
-				}
-
-				if ( ( hooks = jQuery.cssHooks[ name ] ) && "expand" in hooks ) {
-					replace = hooks.expand( prop[ name ] );
-					delete prop[ name ];
-
-					// not quite $.extend, this wont overwrite keys already present.
-					// also - reusing 'p' from above because we have the correct "name"
-					for ( p in replace ) {
-						if ( ! ( p in prop ) ) {
-							prop[ p ] = replace[ p ];
-						}
-					}
-				}
-			}
-
-			for ( name in prop ) {
-				val = prop[ name ];
-				// easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default)
-				if ( jQuery.isArray( val ) ) {
-					opt.animatedProperties[ name ] = val[ 1 ];
-					val = prop[ name ] = val[ 0 ];
-				} else {
-					opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing';
-				}
-
-				if ( val === "hide" && hidden || val === "show" && !hidden ) {
-					return opt.complete.call( this );
-				}
-
-				if ( isElement && ( name === "height" || name === "width" ) ) {
-					// Make sure that nothing sneaks out
-					// Record all 3 overflow attributes because IE does not
-					// change the overflow attribute when overflowX and
-					// overflowY are set to the same value
-					opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
-
-					// Set display property to inline-block for height/width
-					// animations on inline elements that are having width/height animated
-					if ( jQuery.css( this, "display" ) === "inline" &&
-							jQuery.css( this, "float" ) === "none" ) {
-
-						// inline-level elements accept inline-block;
-						// block-level elements need to be inline with layout
-						if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) {
-							this.style.display = "inline-block";
-
-						} else {
-							this.style.zoom = 1;
-						}
-					}
-				}
-			}
-
-			if ( opt.overflow != null ) {
-				this.style.overflow = "hidden";
-			}
-
-			for ( p in prop ) {
-				e = new jQuery.fx( this, opt, p );
-				val = prop[ p ];
-
-				if ( rfxtypes.test( val ) ) {
-
-					// Tracks whether to show or hide based on private
-					// data attached to the element
-					method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 );
-					if ( method ) {
-						jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" );
-						e[ method ]();
-					} else {
-						e[ val ]();
-					}
-
-				} else {
-					parts = rfxnum.exec( val );
-					start = e.cur();
-
-					if ( parts ) {
-						end = parseFloat( parts[2] );
-						unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" );
-
-						// We need to compute starting value
-						if ( unit !== "px" ) {
-							jQuery.style( this, p, (end || 1) + unit);
-							start = ( (end || 1) / e.cur() ) * start;
-							jQuery.style( this, p, start + unit);
-						}
-
-						// If a +=/-= token was provided, we're doing a relative animation
-						if ( parts[1] ) {
-							end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start;
-						}
-
-						e.custom( start, end, unit );
-
-					} else {
-						e.custom( start, val, "" );
-					}
-				}
-			}
-
-			// For JS strict compliance
-			return true;
-		}
-
-		return optall.queue === false ?
-			this.each( doAnimation ) :
-			this.queue( optall.queue, doAnimation );
+	contents: {
+		script: /\b(?:java|ecma)script\b/
 	},
-
-	stop: function( type, clearQueue, gotoEnd ) {
-		if ( typeof type !== "string" ) {
-			gotoEnd = clearQueue;
-			clearQueue = type;
-			type = undefined;
-		}
-		if ( clearQueue && type !== false ) {
-			this.queue( type || "fx", [] );
+	converters: {
+		"text script": function( text ) {
+			jQuery.globalEval( text );
+			return text;
 		}
-
-		return this.each(function() {
-			var index,
-				hadTimers = false,
-				timers = jQuery.timers,
-				data = jQuery._data( this );
-
-			// clear marker counters if we know they won't be
-			if ( !gotoEnd ) {
-				jQuery._unmark( true, this );
-			}
-
-			function stopQueue( elem, data, index ) {
-				var hooks = data[ index ];
-				jQuery.removeData( elem, index, true );
-				hooks.stop( gotoEnd );
-			}
-
-			if ( type == null ) {
-				for ( index in data ) {
-					if ( data[ index ] && data[ index ].stop && index.indexOf(".run") === index.length - 4 ) {
-						stopQueue( this, data, index );
-					}
-				}
-			} else if ( data[ index = type + ".run" ] && data[ index ].stop ){
-				stopQueue( this, data, index );
-			}
-
-			for ( index = timers.length; index--; ) {
-				if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
-					if ( gotoEnd ) {
-
-						// force the next step to be the last
-						timers[ index ]( true );
-					} else {
-						timers[ index ].saveState();
-					}
-					hadTimers = true;
-					timers.splice( index, 1 );
-				}
-			}
-
-			// start the next in the queue if the last step wasn't forced
-			// timers currently will call their complete callbacks, which will dequeue
-			// but only if they were gotoEnd
-			if ( !( gotoEnd && hadTimers ) ) {
-				jQuery.dequeue( this, type );
-			}
-		});
 	}
+} );
 
-});
-
-// Animations created synchronously will run synchronously
-function createFxNow() {
-	setTimeout( clearFxNow, 0 );
-	return ( fxNow = jQuery.now() );
-}
-
-function clearFxNow() {
-	fxNow = undefined;
-}
-
-// Generate parameters to create a standard animation
-function genFx( type, num ) {
-	var obj = {};
-
-	jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() {
-		obj[ this ] = type;
-	});
-
-	return obj;
-}
-
-// Generate shortcuts for custom animations
-jQuery.each({
-	slideDown: genFx( "show", 1 ),
-	slideUp: genFx( "hide", 1 ),
-	slideToggle: genFx( "toggle", 1 ),
-	fadeIn: { opacity: "show" },
-	fadeOut: { opacity: "hide" },
-	fadeToggle: { opacity: "toggle" }
-}, function( name, props ) {
-	jQuery.fn[ name ] = function( speed, easing, callback ) {
-		return this.animate( props, speed, easing, callback );
-	};
-});
-
-jQuery.extend({
-	speed: function( speed, easing, fn ) {
-		var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
-			complete: fn || !fn && easing ||
-				jQuery.isFunction( speed ) && speed,
-			duration: speed,
-			easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
-		};
-
-		opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
-			opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
-
-		// normalize opt.queue - true/undefined/null -> "fx"
-		if ( opt.queue == null || opt.queue === true ) {
-			opt.queue = "fx";
-		}
-
-		// Queueing
-		opt.old = opt.complete;
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+	if ( s.cache === undefined ) {
+		s.cache = false;
+	}
+	if ( s.crossDomain ) {
+		s.type = "GET";
+		s.global = false;
+	}
+} );
 
-		opt.complete = function( noUnmark ) {
-			if ( jQuery.isFunction( opt.old ) ) {
-				opt.old.call( this );
-			}
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function( s ) {
 
-			if ( opt.queue ) {
-				jQuery.dequeue( this, opt.queue );
-			} else if ( noUnmark !== false ) {
-				jQuery._unmark( this );
-			}
-		};
+	// This transport only deals with cross domain requests
+	if ( s.crossDomain ) {
 
-		return opt;
-	},
+		var script,
+			head = document.head || jQuery( "head" )[ 0 ] || document.documentElement;
 
-	easing: {
-		linear: function( p ) {
-			return p;
-		},
-		swing: function( p ) {
-			return ( -Math.cos( p*Math.PI ) / 2 ) + 0.5;
-		}
-	},
+		return {
 
-	timers: [],
+			send: function( _, callback ) {
 
-	fx: function( elem, options, prop ) {
-		this.options = options;
-		this.elem = elem;
-		this.prop = prop;
+				script = document.createElement( "script" );
 
-		options.orig = options.orig || {};
-	}
+				script.async = true;
 
-});
+				if ( s.scriptCharset ) {
+					script.charset = s.scriptCharset;
+				}
 
-jQuery.fx.prototype = {
-	// Simple function for setting a style value
-	update: function() {
-		if ( this.options.step ) {
-			this.options.step.call( this.elem, this.now, this );
-		}
+				script.src = s.url;
 
-		( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this );
-	},
+				// Attach handlers for all browsers
+				script.onload = script.onreadystatechange = function( _, isAbort ) {
 
-	// Get the current size
-	cur: function() {
-		if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) {
-			return this.elem[ this.prop ];
-		}
+					if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
 
-		var parsed,
-			r = jQuery.css( this.elem, this.prop );
-		// Empty strings, null, undefined and "auto" are converted to 0,
-		// complex values such as "rotate(1rad)" are returned as is,
-		// simple values such as "10px" are parsed to Float.
-		return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed;
-	},
+						// Handle memory leak in IE
+						script.onload = script.onreadystatechange = null;
 
-	// Start an animation from one number to another
-	custom: function( from, to, unit ) {
-		var self = this,
-			fx = jQuery.fx;
+						// Remove the script
+						if ( script.parentNode ) {
+							script.parentNode.removeChild( script );
+						}
 
-		this.startTime = fxNow || createFxNow();
-		this.end = to;
-		this.now = this.start = from;
-		this.pos = this.state = 0;
-		this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" );
+						// Dereference the script
+						script = null;
 
-		function t( gotoEnd ) {
-			return self.step( gotoEnd );
-		}
+						// Callback if not abort
+						if ( !isAbort ) {
+							callback( 200, "success" );
+						}
+					}
+				};
+
+				// Circumvent IE6 bugs with base elements (#2709 and #4378) by prepending
+				// Use native DOM manipulation to avoid our domManip AJAX trickery
+				head.insertBefore( script, head.firstChild );
+			},
 
-		t.queue = this.options.queue;
-		t.elem = this.elem;
-		t.saveState = function() {
-			if ( jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) {
-				if ( self.options.hide ) {
-					jQuery._data( self.elem, "fxshow" + self.prop, self.start );
-				} else if ( self.options.show ) {
-					jQuery._data( self.elem, "fxshow" + self.prop, self.end );
+			abort: function() {
+				if ( script ) {
+					script.onload( undefined, true );
 				}
 			}
 		};
+	}
+} );
 
-		if ( t() && jQuery.timers.push(t) && !timerId ) {
-			timerId = setInterval( fx.tick, fx.interval );
-		}
-	},
 
-	// Simple 'show' function
-	show: function() {
-		var dataShow = jQuery._data( this.elem, "fxshow" + this.prop );
 
-		// Remember where we started, so that we can go back to it later
-		this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop );
-		this.options.show = true;
 
-		// Begin the animation
-		// Make sure that we start at a small width/height to avoid any flash of content
-		if ( dataShow !== undefined ) {
-			// This show is picking up where a previous hide or show left off
-			this.custom( this.cur(), dataShow );
-		} else {
-			this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() );
-		}
+var oldCallbacks = [],
+	rjsonp = /(=)\?(?=&|$)|\?\?/;
 
-		// Start by showing the element
-		jQuery( this.elem ).show();
-	},
+// Default jsonp settings
+jQuery.ajaxSetup( {
+	jsonp: "callback",
+	jsonpCallback: function() {
+		var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
+		this[ callback ] = true;
+		return callback;
+	}
+} );
 
-	// Simple 'hide' function
-	hide: function() {
-		// Remember where we started, so that we can go back to it later
-		this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop );
-		this.options.hide = true;
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
 
-		// Begin the animation
-		this.custom( this.cur(), 0 );
-	},
+	var callbackName, overwritten, responseContainer,
+		jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+			"url" :
+			typeof s.data === "string" &&
+				( s.contentType || "" )
+					.indexOf( "application/x-www-form-urlencoded" ) === 0 &&
+				rjsonp.test( s.data ) && "data"
+		);
 
-	// Each step of an animation
-	step: function( gotoEnd ) {
-		var p, n, complete,
-			t = fxNow || createFxNow(),
-			done = true,
-			elem = this.elem,
-			options = this.options;
+	// Handle iff the expected data type is "jsonp" or we have a parameter to set
+	if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
 
-		if ( gotoEnd || t >= options.duration + this.startTime ) {
-			this.now = this.end;
-			this.pos = this.state = 1;
-			this.update();
+		// Get callback name, remembering preexisting value associated with it
+		callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
+			s.jsonpCallback() :
+			s.jsonpCallback;
 
-			options.animatedProperties[ this.prop ] = true;
+		// Insert callback into url or form data
+		if ( jsonProp ) {
+			s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+		} else if ( s.jsonp !== false ) {
+			s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+		}
 
-			for ( p in options.animatedProperties ) {
-				if ( options.animatedProperties[ p ] !== true ) {
-					done = false;
-				}
+		// Use data converter to retrieve json after script execution
+		s.converters[ "script json" ] = function() {
+			if ( !responseContainer ) {
+				jQuery.error( callbackName + " was not called" );
 			}
+			return responseContainer[ 0 ];
+		};
 
-			if ( done ) {
-				// Reset the overflow
-				if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
-
-					jQuery.each( [ "", "X", "Y" ], function( index, value ) {
-						elem.style[ "overflow" + value ] = options.overflow[ index ];
-					});
-				}
-
-				// Hide the element if the "hide" operation was done
-				if ( options.hide ) {
-					jQuery( elem ).hide();
-				}
+		// force json dataType
+		s.dataTypes[ 0 ] = "json";
 
-				// Reset the properties, if the item has been hidden or shown
-				if ( options.hide || options.show ) {
-					for ( p in options.animatedProperties ) {
-						jQuery.style( elem, p, options.orig[ p ] );
-						jQuery.removeData( elem, "fxshow" + p, true );
-						// Toggle data is no longer needed
-						jQuery.removeData( elem, "toggle" + p, true );
-					}
-				}
+		// Install callback
+		overwritten = window[ callbackName ];
+		window[ callbackName ] = function() {
+			responseContainer = arguments;
+		};
 
-				// Execute the complete function
-				// in the event that the complete function throws an exception
-				// we must ensure it won't be called twice. #5684
+		// Clean-up function (fires after converters)
+		jqXHR.always( function() {
 
-				complete = options.complete;
-				if ( complete ) {
+			// If previous value didn't exist - remove it
+			if ( overwritten === undefined ) {
+				jQuery( window ).removeProp( callbackName );
 
-					options.complete = false;
-					complete.call( elem );
-				}
+			// Otherwise restore preexisting value
+			} else {
+				window[ callbackName ] = overwritten;
 			}
 
-			return false;
+			// Save back as free
+			if ( s[ callbackName ] ) {
 
-		} else {
-			// classical easing cannot be used with an Infinity duration
-			if ( options.duration == Infinity ) {
-				this.now = t;
-			} else {
-				n = t - this.startTime;
-				this.state = n / options.duration;
+				// make sure that re-using the options doesn't screw things around
+				s.jsonpCallback = originalSettings.jsonpCallback;
 
-				// Perform the easing function, defaults to swing
-				this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration );
-				this.now = this.start + ( (this.end - this.start) * this.pos );
+				// save the callback name for future use
+				oldCallbacks.push( callbackName );
 			}
-			// Perform the next step of the animation
-			this.update();
-		}
-
-		return true;
-	}
-};
-
-jQuery.extend( jQuery.fx, {
-	tick: function() {
-		var timer,
-			timers = jQuery.timers,
-			i = 0;
 
-		for ( ; i < timers.length; i++ ) {
-			timer = timers[ i ];
-			// Checks the timer has not already been removed
-			if ( !timer() && timers[ i ] === timer ) {
-				timers.splice( i--, 1 );
+			// Call if it was a function and we have a response
+			if ( responseContainer && jQuery.isFunction( overwritten ) ) {
+				overwritten( responseContainer[ 0 ] );
 			}
-		}
 
-		if ( !timers.length ) {
-			jQuery.fx.stop();
-		}
-	},
+			responseContainer = overwritten = undefined;
+		} );
 
-	interval: 13,
+		// Delegate to script
+		return "script";
+	}
+} );
 
-	stop: function() {
-		clearInterval( timerId );
-		timerId = null;
-	},
 
-	speeds: {
-		slow: 600,
-		fast: 200,
-		// Default speed
-		_default: 400
-	},
 
-	step: {
-		opacity: function( fx ) {
-			jQuery.style( fx.elem, "opacity", fx.now );
-		},
 
-		_default: function( fx ) {
-			if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
-				fx.elem.style[ fx.prop ] = fx.now + fx.unit;
-			} else {
-				fx.elem[ fx.prop ] = fx.now;
-			}
-		}
+// data: string of html
+// context (optional): If specified, the fragment will be created in this context,
+// defaults to document
+// keepScripts (optional): If true, will include scripts passed in the html string
+jQuery.parseHTML = function( data, context, keepScripts ) {
+	if ( !data || typeof data !== "string" ) {
+		return null;
 	}
-});
-
-// Ensure props that can't be negative don't go there on undershoot easing
-jQuery.each( fxAttrs.concat.apply( [], fxAttrs ), function( i, prop ) {
-	// exclude marginTop, marginLeft, marginBottom and marginRight from this list
-	if ( prop.indexOf( "margin" ) ) {
-		jQuery.fx.step[ prop ] = function( fx ) {
-			jQuery.style( fx.elem, prop, Math.max(0, fx.now) + fx.unit );
-		};
+	if ( typeof context === "boolean" ) {
+		keepScripts = context;
+		context = false;
 	}
-});
-
-if ( jQuery.expr && jQuery.expr.filters ) {
-	jQuery.expr.filters.animated = function( elem ) {
-		return jQuery.grep(jQuery.timers, function( fn ) {
-			return elem === fn.elem;
-		}).length;
-	};
-}
-
-// Try to restore the default display value of an element
-function defaultDisplay( nodeName ) {
-
-	if ( !elemdisplay[ nodeName ] ) {
+	context = context || document;
 
-		var body = document.body,
-			elem = jQuery( "<" + nodeName + ">" ).appendTo( body ),
-			display = elem.css( "display" );
-		elem.remove();
+	var parsed = rsingleTag.exec( data ),
+		scripts = !keepScripts && [];
 
-		// If the simple way fails,
-		// get element's real default display by attaching it to a temp iframe
-		if ( display === "none" || display === "" ) {
-			// No iframe to use yet, so create it
-			if ( !iframe ) {
-				iframe = document.createElement( "iframe" );
-				iframe.frameBorder = iframe.width = iframe.height = 0;
-			}
+	// Single tag
+	if ( parsed ) {
+		return [ context.createElement( parsed[ 1 ] ) ];
+	}
 
-			body.appendChild( iframe );
+	parsed = buildFragment( [ data ], context, scripts );
 
-			// Create a cacheable copy of the iframe document on first call.
-			// IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML
-			// document to it; WebKit & Firefox won't allow reusing the iframe document.
-			if ( !iframeDoc || !iframe.createElement ) {
-				iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document;
-				iframeDoc.write( ( jQuery.support.boxModel ? "<!doctype html>" : "" ) + "<html><body>" );
-				iframeDoc.close();
-			}
+	if ( scripts && scripts.length ) {
+		jQuery( scripts ).remove();
+	}
 
-			elem = iframeDoc.createElement( nodeName );
+	return jQuery.merge( [], parsed.childNodes );
+};
 
-			iframeDoc.body.appendChild( elem );
 
-			display = jQuery.css( elem, "display" );
-			body.removeChild( iframe );
-		}
+// Keep a copy of the old load method
+var _load = jQuery.fn.load;
 
-		// Store the correct default display
-		elemdisplay[ nodeName ] = display;
+/**
+ * Load a url into a page
+ */
+jQuery.fn.load = function( url, params, callback ) {
+	if ( typeof url !== "string" && _load ) {
+		return _load.apply( this, arguments );
 	}
 
-	return elemdisplay[ nodeName ];
-}
-
-
+	var selector, type, response,
+		self = this,
+		off = url.indexOf( " " );
 
+	if ( off > -1 ) {
+		selector = jQuery.trim( url.slice( off, url.length ) );
+		url = url.slice( 0, off );
+	}
 
-var getOffset,
-	rtable = /^t(?:able|d|h)$/i,
-	rroot = /^(?:body|html)$/i;
+	// If it's a function
+	if ( jQuery.isFunction( params ) ) {
 
-if ( "getBoundingClientRect" in document.documentElement ) {
-	getOffset = function( elem, doc, docElem, box ) {
-		try {
-			box = elem.getBoundingClientRect();
-		} catch(e) {}
+		// We assume that it's the callback
+		callback = params;
+		params = undefined;
 
-		// Make sure we're not dealing with a disconnected DOM node
-		if ( !box || !jQuery.contains( docElem, elem ) ) {
-			return box ? { top: box.top, left: box.left } : { top: 0, left: 0 };
-		}
+	// Otherwise, build a param string
+	} else if ( params && typeof params === "object" ) {
+		type = "POST";
+	}
 
-		var body = doc.body,
-			win = getWindow( doc ),
-			clientTop  = docElem.clientTop  || body.clientTop  || 0,
-			clientLeft = docElem.clientLeft || body.clientLeft || 0,
-			scrollTop  = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop  || body.scrollTop,
-			scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft,
-			top  = box.top  + scrollTop  - clientTop,
-			left = box.left + scrollLeft - clientLeft;
+	// If we have elements to modify, make the request
+	if ( self.length > 0 ) {
+		jQuery.ajax( {
+			url: url,
 
-		return { top: top, left: left };
-	};
+			// If "type" variable is undefined, then "GET" method will be used.
+			// Make value of this field explicit since
+			// user can override it through ajaxSetup method
+			type: type || "GET",
+			dataType: "html",
+			data: params
+		} ).done( function( responseText ) {
 
-} else {
-	getOffset = function( elem, doc, docElem ) {
-		var computedStyle,
-			offsetParent = elem.offsetParent,
-			prevOffsetParent = elem,
-			body = doc.body,
-			defaultView = doc.defaultView,
-			prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
-			top = elem.offsetTop,
-			left = elem.offsetLeft;
-
-		while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
-			if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) {
-				break;
-			}
+			// Save response for use in complete callback
+			response = arguments;
 
-			computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
-			top  -= elem.scrollTop;
-			left -= elem.scrollLeft;
+			self.html( selector ?
 
-			if ( elem === offsetParent ) {
-				top  += elem.offsetTop;
-				left += elem.offsetLeft;
+				// If a selector was specified, locate the right elements in a dummy div
+				// Exclude scripts to avoid IE 'Permission Denied' errors
+				jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
 
-				if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
-					top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
-					left += parseFloat( computedStyle.borderLeftWidth ) || 0;
-				}
+				// Otherwise use the full result
+				responseText );
 
-				prevOffsetParent = offsetParent;
-				offsetParent = elem.offsetParent;
-			}
+		// If the request succeeds, this function gets "data", "status", "jqXHR"
+		// but they are ignored because response was set above.
+		// If it fails, this function gets "jqXHR", "status", "error"
+		} ).always( callback && function( jqXHR, status ) {
+			self.each( function() {
+				callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );
+			} );
+		} );
+	}
 
-			if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
-				top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
-				left += parseFloat( computedStyle.borderLeftWidth ) || 0;
-			}
+	return this;
+};
 
-			prevComputedStyle = computedStyle;
-		}
 
-		if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
-			top  += body.offsetTop;
-			left += body.offsetLeft;
-		}
 
-		if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) {
-			top  += Math.max( docElem.scrollTop, body.scrollTop );
-			left += Math.max( docElem.scrollLeft, body.scrollLeft );
-		}
 
-		return { top: top, left: left };
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( [
+	"ajaxStart",
+	"ajaxStop",
+	"ajaxComplete",
+	"ajaxError",
+	"ajaxSuccess",
+	"ajaxSend"
+], function( i, type ) {
+	jQuery.fn[ type ] = function( fn ) {
+		return this.on( type, fn );
 	};
-}
-
-jQuery.fn.offset = function( options ) {
-	if ( arguments.length ) {
-		return options === undefined ?
-			this :
-			this.each(function( i ) {
-				jQuery.offset.setOffset( this, options, i );
-			});
-	}
+} );
 
-	var elem = this[0],
-		doc = elem && elem.ownerDocument;
 
-	if ( !doc ) {
-		return null;
-	}
 
-	if ( elem === doc.body ) {
-		return jQuery.offset.bodyOffset( elem );
-	}
 
-	return getOffset( elem, doc, doc.documentElement );
+jQuery.expr.filters.animated = function( elem ) {
+	return jQuery.grep( jQuery.timers, function( fn ) {
+		return elem === fn.elem;
+	} ).length;
 };
 
-jQuery.offset = {
 
-	bodyOffset: function( body ) {
-		var top = body.offsetTop,
-			left = body.offsetLeft;
 
-		if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) {
-			top  += parseFloat( jQuery.css(body, "marginTop") ) || 0;
-			left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
-		}
 
-		return { top: top, left: left };
-	},
 
+/**
+ * Gets a window from an element
+ */
+function getWindow( elem ) {
+	return jQuery.isWindow( elem ) ?
+		elem :
+		elem.nodeType === 9 ?
+			elem.defaultView || elem.parentWindow :
+			false;
+}
+
+jQuery.offset = {
 	setOffset: function( elem, options, i ) {
-		var position = jQuery.css( elem, "position" );
+		var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
+			position = jQuery.css( elem, "position" ),
+			curElem = jQuery( elem ),
+			props = {};
 
 		// set position first, in-case top/left are set even on static elem
 		if ( position === "static" ) {
 			elem.style.position = "relative";
 		}
 
-		var curElem = jQuery( elem ),
-			curOffset = curElem.offset(),
-			curCSSTop = jQuery.css( elem, "top" ),
-			curCSSLeft = jQuery.css( elem, "left" ),
-			calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
-			props = {}, curPosition = {}, curTop, curLeft;
+		curOffset = curElem.offset();
+		curCSSTop = jQuery.css( elem, "top" );
+		curCSSLeft = jQuery.css( elem, "left" );
+		calculatePosition = ( position === "absolute" || position === "fixed" ) &&
+			jQuery.inArray( "auto", [ curCSSTop, curCSSLeft ] ) > -1;
 
-		// need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+		// need to be able to calculate position if either top or left
+		// is auto and position is either absolute or fixed
 		if ( calculatePosition ) {
 			curPosition = curElem.position();
 			curTop = curPosition.top;
@@ -9204,7 +10720,9 @@ jQuery.offset = {
 		}
 
 		if ( jQuery.isFunction( options ) ) {
-			options = options.call( elem, i, curOffset );
+
+			// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
+			options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
 		}
 
 		if ( options.top != null ) {
@@ -9222,71 +10740,115 @@ jQuery.offset = {
 	}
 };
 
+jQuery.fn.extend( {
+	offset: function( options ) {
+		if ( arguments.length ) {
+			return options === undefined ?
+				this :
+				this.each( function( i ) {
+					jQuery.offset.setOffset( this, options, i );
+				} );
+		}
+
+		var docElem, win,
+			box = { top: 0, left: 0 },
+			elem = this[ 0 ],
+			doc = elem && elem.ownerDocument;
+
+		if ( !doc ) {
+			return;
+		}
+
+		docElem = doc.documentElement;
+
+		// Make sure it's not a disconnected DOM node
+		if ( !jQuery.contains( docElem, elem ) ) {
+			return box;
+		}
 
-jQuery.fn.extend({
+		// If we don't have gBCR, just use 0,0 rather than error
+		// BlackBerry 5, iOS 3 (original iPhone)
+		if ( typeof elem.getBoundingClientRect !== "undefined" ) {
+			box = elem.getBoundingClientRect();
+		}
+		win = getWindow( doc );
+		return {
+			top: box.top  + ( win.pageYOffset || docElem.scrollTop )  - ( docElem.clientTop  || 0 ),
+			left: box.left + ( win.pageXOffset || docElem.scrollLeft ) - ( docElem.clientLeft || 0 )
+		};
+	},
 
 	position: function() {
-		if ( !this[0] ) {
-			return null;
+		if ( !this[ 0 ] ) {
+			return;
 		}
 
-		var elem = this[0],
+		var offsetParent, offset,
+			parentOffset = { top: 0, left: 0 },
+			elem = this[ 0 ];
 
-		// Get *real* offsetParent
-		offsetParent = this.offsetParent(),
+		// Fixed elements are offset from window (parentOffset = {top:0, left: 0},
+		// because it is its only offset parent
+		if ( jQuery.css( elem, "position" ) === "fixed" ) {
 
-		// Get correct offsets
-		offset       = this.offset(),
-		parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+			// we assume that getBoundingClientRect is available when computed position is fixed
+			offset = elem.getBoundingClientRect();
+		} else {
 
-		// Subtract element margins
-		// note: when an element has margin: auto the offsetLeft and marginLeft
-		// are the same in Safari causing offset.left to incorrectly be 0
-		offset.top  -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
-		offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
+			// Get *real* offsetParent
+			offsetParent = this.offsetParent();
+
+			// Get correct offsets
+			offset = this.offset();
+			if ( !jQuery.nodeName( offsetParent[ 0 ], "html" ) ) {
+				parentOffset = offsetParent.offset();
+			}
 
-		// Add offsetParent borders
-		parentOffset.top  += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
-		parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
+			// Add offsetParent borders
+			parentOffset.top  += jQuery.css( offsetParent[ 0 ], "borderTopWidth", true );
+			parentOffset.left += jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true );
+		}
 
-		// Subtract the two offsets
+		// Subtract parent offsets and element margins
+		// note: when an element has margin: auto the offsetLeft and marginLeft
+		// are the same in Safari causing offset.left to incorrectly be 0
 		return {
-			top:  offset.top  - parentOffset.top,
-			left: offset.left - parentOffset.left
+			top:  offset.top  - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+			left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
 		};
 	},
 
 	offsetParent: function() {
-		return this.map(function() {
-			var offsetParent = this.offsetParent || document.body;
-			while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+		return this.map( function() {
+			var offsetParent = this.offsetParent;
+
+			while ( offsetParent && ( !jQuery.nodeName( offsetParent, "html" ) &&
+				jQuery.css( offsetParent, "position" ) === "static" ) ) {
 				offsetParent = offsetParent.offsetParent;
 			}
-			return offsetParent;
-		});
+			return offsetParent || documentElement;
+		} );
 	}
-});
-
+} );
 
 // Create scrollLeft and scrollTop methods
-jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) {
+jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
 	var top = /Y/.test( prop );
 
 	jQuery.fn[ method ] = function( val ) {
-		return jQuery.access( this, function( elem, method, val ) {
+		return access( this, function( elem, method, val ) {
 			var win = getWindow( elem );
 
 			if ( val === undefined ) {
-				return win ? (prop in win) ? win[ prop ] :
-					jQuery.support.boxModel && win.document.documentElement[ method ] ||
-						win.document.body[ method ] :
+				return win ? ( prop in win ) ? win[ prop ] :
+					win.document.documentElement[ method ] :
 					elem[ method ];
 			}
 
 			if ( win ) {
 				win.scrollTo(
 					!top ? val : jQuery( win ).scrollLeft(),
-					 top ? val : jQuery( win ).scrollTop()
+					top ? val : jQuery( win ).scrollTop()
 				);
 
 			} else {
@@ -9294,111 +10856,156 @@ jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( me
 			}
 		}, method, val, arguments.length, null );
 	};
-});
+} );
+
+// Support: Safari<7-8+, Chrome<37-44+
+// Add the top/left cssHooks using jQuery.fn.position
+// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+// getComputedStyle returns percent when specified for top/left/bottom/right
+// rather than make the css module depend on the offset module, we just check for it here
+jQuery.each( [ "top", "left" ], function( i, prop ) {
+	jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
+		function( elem, computed ) {
+			if ( computed ) {
+				computed = curCSS( elem, prop );
 
-function getWindow( elem ) {
-	return jQuery.isWindow( elem ) ?
-		elem :
-		elem.nodeType === 9 ?
-			elem.defaultView || elem.parentWindow :
-			false;
-}
+				// if curCSS returns percentage, fallback to offset
+				return rnumnonpx.test( computed ) ?
+					jQuery( elem ).position()[ prop ] + "px" :
+					computed;
+			}
+		}
+	);
+} );
 
 
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+	jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name },
+	function( defaultExtra, funcName ) {
 
+		// margin is only for outerHeight, outerWidth
+		jQuery.fn[ funcName ] = function( margin, value ) {
+			var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+				extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
 
-// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods
-jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
-	var clientProp = "client" + name,
-		scrollProp = "scroll" + name,
-		offsetProp = "offset" + name;
-
-	// innerHeight and innerWidth
-	jQuery.fn[ "inner" + name ] = function() {
-		var elem = this[0];
-		return elem ?
-			elem.style ?
-			parseFloat( jQuery.css( elem, type, "padding" ) ) :
-			this[ type ]() :
-			null;
-	};
+			return access( this, function( elem, type, value ) {
+				var doc;
 
-	// outerHeight and outerWidth
-	jQuery.fn[ "outer" + name ] = function( margin ) {
-		var elem = this[0];
-		return elem ?
-			elem.style ?
-			parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) :
-			this[ type ]() :
-			null;
-	};
+				if ( jQuery.isWindow( elem ) ) {
 
-	jQuery.fn[ type ] = function( value ) {
-		return jQuery.access( this, function( elem, type, value ) {
-			var doc, docElemProp, orig, ret;
-
-			if ( jQuery.isWindow( elem ) ) {
-				// 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat
-				doc = elem.document;
-				docElemProp = doc.documentElement[ clientProp ];
-				return jQuery.support.boxModel && docElemProp ||
-					doc.body && doc.body[ clientProp ] || docElemProp;
-			}
-
-			// Get document width or height
-			if ( elem.nodeType === 9 ) {
-				// Either scroll[Width/Height] or offset[Width/Height], whichever is greater
-				doc = elem.documentElement;
-
-				// when a window > document, IE6 reports a offset[Width/Height] > client[Width/Height]
-				// so we can't use max, as it'll choose the incorrect offset[Width/Height]
-				// instead we use the correct client[Width/Height]
-				// support:IE6
-				if ( doc[ clientProp ] >= doc[ scrollProp ] ) {
-					return doc[ clientProp ];
+					// As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
+					// isn't a whole lot we can do. See pull request at this URL for discussion:
+					// https://github.com/jquery/jquery/pull/764
+					return elem.document.documentElement[ "client" + name ];
 				}
 
-				return Math.max(
-					elem.body[ scrollProp ], doc[ scrollProp ],
-					elem.body[ offsetProp ], doc[ offsetProp ]
-				);
-			}
+				// Get document width or height
+				if ( elem.nodeType === 9 ) {
+					doc = elem.documentElement;
 
-			// Get width or height on the element
-			if ( value === undefined ) {
-				orig = jQuery.css( elem, type );
-				ret = parseFloat( orig );
-				return jQuery.isNumeric( ret ) ? ret : orig;
-			}
+					// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
+					// whichever is greatest
+					// unfortunately, this causes bug #3838 in IE6/8 only,
+					// but there is currently no good, small way to fix it.
+					return Math.max(
+						elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+						elem.body[ "offset" + name ], doc[ "offset" + name ],
+						doc[ "client" + name ]
+					);
+				}
 
-			// Set the width or height on the element
-			jQuery( elem ).css( type, value );
-		}, type, value, arguments.length, null );
-	};
-});
+				return value === undefined ?
+
+					// Get width or height on the element, requesting but not forcing parseFloat
+					jQuery.css( elem, type, extra ) :
+
+					// Set width or height on the element
+					jQuery.style( elem, type, value, extra );
+			}, type, chainable ? margin : undefined, chainable, null );
+		};
+	} );
+} );
+
+
+jQuery.fn.extend( {
+
+	bind: function( types, data, fn ) {
+		return this.on( types, null, data, fn );
+	},
+	unbind: function( types, fn ) {
+		return this.off( types, null, fn );
+	},
+
+	delegate: function( selector, types, data, fn ) {
+		return this.on( types, selector, data, fn );
+	},
+	undelegate: function( selector, types, fn ) {
 
+		// ( namespace ) or ( selector, types [, fn] )
+		return arguments.length === 1 ?
+			this.off( selector, "**" ) :
+			this.off( types, selector || "**", fn );
+	}
+} );
+
+// The number of elements contained in the matched element set
+jQuery.fn.size = function() {
+	return this.length;
+};
 
+jQuery.fn.andSelf = jQuery.fn.addBack;
 
 
-// Expose jQuery to the global object
-window.jQuery = window.$ = jQuery;
 
-// Expose jQuery as an AMD module, but only for AMD loaders that
-// understand the issues with loading multiple versions of jQuery
-// in a page that all might call define(). The loader will indicate
-// they have special allowances for multiple jQuery versions by
-// specifying define.amd.jQuery = true. Register as a named module,
-// since jQuery can be concatenated with other files that may use define,
-// but not use a proper concatenation script that understands anonymous
-// AMD modules. A named AMD is safest and most robust way to register.
-// Lowercase jquery is used because AMD module names are derived from
-// file names, and jQuery is normally delivered in a lowercase file name.
-// Do this after creating the global so that if an AMD module wants to call
-// noConflict to hide this version of jQuery, it will work.
-if ( typeof define === "function" && define.amd && define.amd.jQuery ) {
-	define( "jquery", [], function () { return jQuery; } );
+
+// Register as a named AMD module, since jQuery can be concatenated with other
+// files that may use define, but not via a proper concatenation script that
+// understands anonymous AMD modules. A named AMD is safest and most robust
+// way to register. Lowercase jquery is used because AMD module names are
+// derived from file names, and jQuery is normally delivered in a lowercase
+// file name. Do this after creating the global so that if an AMD module wants
+// to call noConflict to hide this version of jQuery, it will work.
+
+// Note that for maximum portability, libraries that are not jQuery should
+// declare themselves as anonymous modules, and avoid setting a global if an
+// AMD loader is present. jQuery is a special case. For more information, see
+// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
+
+if ( typeof define === "function" && define.amd ) {
+	define( "jquery", [], function() {
+		return jQuery;
+	} );
 }
 
 
 
-})( window );
+var
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$;
+
+jQuery.noConflict = function( deep ) {
+	if ( window.$ === jQuery ) {
+		window.$ = _$;
+	}
+
+	if ( deep && window.jQuery === jQuery ) {
+		window.jQuery = _jQuery;
+	}
+
+	return jQuery;
+};
+
+// Expose jQuery and $ identifiers, even in
+// AMD (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
+// and CommonJS for browser emulators (#13566)
+if ( !noGlobal ) {
+	window.jQuery = window.$ = jQuery;
+}
+
+return jQuery;
+}));
diff --git a/www/include/common/javascript/jquery/jquery.min.js b/www/include/common/javascript/jquery/jquery.min.js
index 16ad06c5ac..b2e8ce258f 100644
--- a/www/include/common/javascript/jquery/jquery.min.js
+++ b/www/include/common/javascript/jquery/jquery.min.js
@@ -1,4 +1 @@
-/*! jQuery v1.7.2 jquery.com | jquery.org/license */
-(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cu(a){if(!cj[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),b.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write((f.support.boxModel?"<!doctype html>":"")+"<html><body>"),cl.close();d=cl.createElement(a),cl.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ck)}cj[a]=e}return cj[a]}function ct(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function cs(){cq=b}function cr(){setTimeout(cs,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bD.test(a)?d(a,e):b_(a+"["+(typeof e=="object"?b:"")+"]",e,c,d)});else if(!c&&f.type(b)==="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function bZ(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bS,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bZ(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bZ(a,c,d,e,"*",g));return l}function bY(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bO),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bB(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?1:0,g=4;if(d>0){if(c!=="border")for(;e<g;e+=2)c||(d-=parseFloat(f.css(a,"padding"+bx[e]))||0),c==="margin"?d+=parseFloat(f.css(a,c+bx[e]))||0:d-=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0;return d+"px"}d=by(a,b);if(d<0||d==null)d=a.style[b];if(bt.test(d))return d;d=parseFloat(d)||0;if(c)for(;e<g;e+=2)d+=parseFloat(f.css(a,"padding"+bx[e]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+bx[e]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+bx[e]))||0);return d+"px"}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;b.nodeType===1&&(b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase(),c==="object"?b.outerHTML=a.outerHTML:c!=="input"||a.type!=="checkbox"&&a.type!=="radio"?c==="option"?b.selected=a.defaultSelected:c==="input"||c==="textarea"?b.defaultValue=a.defaultValue:c==="script"&&b.text!==a.text&&(b.text=a.text):(a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value)),b.removeAttribute(f.expando),b.removeAttribute("_submit_attached"),b.removeAttribute("_change_attached"))}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c,i[c][d])}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?+d:j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a!=null&&a==a.window},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){if(typeof c!="string"||!c)return null;var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h,i){var j,k=d==null,l=0,m=a.length;if(d&&typeof d=="object"){for(l in d)e.access(a,c,l,d[l],1,h,f);g=1}else if(f!==b){j=i===b&&e.isFunction(f),k&&(j?(j=c,c=function(a,b,c){return j.call(e(a),c)}):(c.call(a,f),c=null));if(c)for(;l<m;l++)c(a[l],d,j?f.call(a[l],l,c(a[l],d)):f,i);g=1}return g?a:k?c.call(a):m?c(a[0],d):h},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m,n=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?n(g):h==="function"&&(!a.unique||!p.has(g))&&c.push(g)},o=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,j=!0,m=k||0,k=0,l=c.length;for(;c&&m<l;m++)if(c[m].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}j=!1,c&&(a.once?e===!0?p.disable():c=[]:d&&d.length&&(e=d.shift(),p.fireWith(e[0],e[1])))},p={add:function(){if(c){var a=c.length;n(arguments),j?l=c.length:e&&e!==!0&&(k=a,o(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){j&&f<=l&&(l--,f<=m&&m--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&p.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(j?a.once||d.push([b,c]):(!a.once||!e)&&o(b,c));return this},fire:function(){p.fireWith(this,arguments);return this},fired:function(){return!!i}};return p};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p=c.createElement("div"),q=c.documentElement;p.setAttribute("className","t"),p.innerHTML="   <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=p.getElementsByTagName("*"),e=p.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=p.getElementsByTagName("input")[0],b={leadingWhitespace:p.firstChild.nodeType===3,tbody:!p.getElementsByTagName("tbody").length,htmlSerialize:!!p.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:p.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,pixelMargin:!0},f.boxModel=b.boxModel=c.compatMode==="CSS1Compat",i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete p.test}catch(r){b.deleteExpando=!1}!p.addEventListener&&p.attachEvent&&p.fireEvent&&(p.attachEvent("onclick",function(){b.noCloneEvent=!1}),p.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),i.setAttribute("name","t"),p.appendChild(i),j=c.createDocumentFragment(),j.appendChild(p.lastChild),b.checkClone=j.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,j.removeChild(i),j.appendChild(p);if(p.attachEvent)for(n in{submit:1,change:1,focusin:1})m="on"+n,o=m in p,o||(p.setAttribute(m,"return;"),o=typeof p[m]=="function"),b[n+"Bubbles"]=o;j.removeChild(p),j=g=h=p=i=null,f(function(){var d,e,g,h,i,j,l,m,n,q,r,s,t,u=c.getElementsByTagName("body")[0];!u||(m=1,t="padding:0;margin:0;border:",r="position:absolute;top:0;left:0;width:1px;height:1px;",s=t+"0;visibility:hidden;",n="style='"+r+t+"5px solid #000;",q="<div "+n+"display:block;'><div style='"+t+"0;display:block;overflow:hidden;'></div></div>"+"<table "+n+"' cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",d=c.createElement("div"),d.style.cssText=s+"width:0;height:0;position:static;top:0;margin-top:"+m+"px",u.insertBefore(d,u.firstChild),p=c.createElement("div"),d.appendChild(p),p.innerHTML="<table><tr><td style='"+t+"0;display:none'></td><td>t</td></tr></table>",k=p.getElementsByTagName("td"),o=k[0].offsetHeight===0,k[0].style.display="",k[1].style.display="none",b.reliableHiddenOffsets=o&&k[0].offsetHeight===0,a.getComputedStyle&&(p.innerHTML="",l=c.createElement("div"),l.style.width="0",l.style.marginRight="0",p.style.width="2px",p.appendChild(l),b.reliableMarginRight=(parseInt((a.getComputedStyle(l,null)||{marginRight:0}).marginRight,10)||0)===0),typeof p.style.zoom!="undefined"&&(p.innerHTML="",p.style.width=p.style.padding="1px",p.style.border=0,p.style.overflow="hidden",p.style.display="inline",p.style.zoom=1,b.inlineBlockNeedsLayout=p.offsetWidth===3,p.style.display="block",p.style.overflow="visible",p.innerHTML="<div style='width:5px;'></div>",b.shrinkWrapBlocks=p.offsetWidth!==3),p.style.cssText=r+s,p.innerHTML=q,e=p.firstChild,g=e.firstChild,i=e.nextSibling.firstChild.firstChild,j={doesNotAddBorder:g.offsetTop!==5,doesAddBorderForTableAndCells:i.offsetTop===5},g.style.position="fixed",g.style.top="20px",j.fixedPosition=g.offsetTop===20||g.offsetTop===15,g.style.position=g.style.top="",e.style.overflow="hidden",e.style.position="relative",j.subtractsBorderForOverflowNotVisible=g.offsetTop===-5,j.doesNotIncludeMarginInBodyOffset=u.offsetTop!==m,a.getComputedStyle&&(p.style.marginTop="1%",b.pixelMargin=(a.getComputedStyle(p,null)||{marginTop:0}).marginTop!=="1%"),typeof d.style.zoom!="undefined"&&(d.style.zoom=1),u.removeChild(d),l=p=d=null,f.extend(b,j))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h,i,j=this[0],k=0,m=null;if(a===b){if(this.length){m=f.data(j);if(j.nodeType===1&&!f._data(j,"parsedAttrs")){g=j.attributes;for(i=g.length;k<i;k++)h=g[k].name,h.indexOf("data-")===0&&(h=f.camelCase(h.substring(5)),l(j,h,m[h]));f._data(j,"parsedAttrs",!0)}}return m}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split(".",2),d[1]=d[1]?"."+d[1]:"",e=d[1]+"!";return f.access(this,function(c){if(c===b){m=this.triggerHandler("getData"+e,[d[0]]),m===b&&j&&(m=f.data(j,a),m=l(j,a,m));return m===b&&d[1]?this.data(d[0]):m}d[1]=c,this.each(function(){var b=f(this);b.triggerHandler("setData"+e,d),f.data(this,a,c),b.triggerHandler("changeData"+e,d)})},null,c,arguments.length>1,null,!1)},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){var d=2;typeof a!="string"&&(c=a,a="fx",d--);if(arguments.length<d)return f.queue(this[0],a);return c===b?this:this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise(c)}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,f.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,f.prop,a,b,arguments.length>1)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.type]||f.valHooks[this.nodeName.toLowerCase()];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.type]||f.valHooks[g.nodeName.toLowerCase()];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h,i=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;i<g;i++)e=d[i],e&&(c=f.propFix[e]||e,h=u.test(e),h||f.attr(a,e,""),a.removeAttribute(v?e:c),h&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0,coords:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/(?:^|\s)hover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(
-a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")};f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler,g=p.selector),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:g&&G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=f.event.special[c.type]||{},j=[],k,l,m,n,o,p,q,r,s,t,u;g[0]=c,c.delegateTarget=this;if(!i.preDispatch||i.preDispatch.call(this,c)!==!1){if(e&&(!c.button||c.type!=="click")){n=f(this),n.context=this.ownerDocument||this;for(m=c.target;m!=this;m=m.parentNode||this)if(m.disabled!==!0){p={},r=[],n[0]=m;for(k=0;k<e;k++)s=d[k],t=s.selector,p[t]===b&&(p[t]=s.quick?H(m,s.quick):n.is(t)),p[t]&&r.push(s);r.length&&j.push({elem:m,matches:r})}}d.length>e&&j.push({elem:this,matches:d.slice(e)});for(k=0;k<j.length&&!c.isPropagationStopped();k++){q=j[k],c.currentTarget=q.elem;for(l=0;l<q.matches.length&&!c.isImmediatePropagationStopped();l++){s=q.matches[l];if(h||!c.namespace&&!s.namespace||c.namespace_re&&c.namespace_re.test(s.namespace))c.data=s.data,c.handleObj=s,o=((f.event.special[s.origType]||{}).handle||s.handler).apply(q.elem,g),o!==b&&(c.result=o,o===!1&&(c.preventDefault(),c.stopPropagation()))}}i.postDispatch&&i.postDispatch.call(this,c);return c.result}},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){a._submit_bubble=!0}),d._submit_attached=!0)})},postDispatch:function(a){a._submit_bubble&&(delete a._submit_bubble,this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0))},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=d||c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on(a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.origType+"."+e.namespace:e.origType,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9||d===11){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));o.match.globalPOS=p;var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.globalPOS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")[\\s/>]","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){return f.access(this,function(a){return a===b?f.text(this):this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a))},null,a,arguments.length)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f
-.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){return f.access(this,function(a){var c=this[0]||{},d=0,e=this.length;if(a===b)return c.nodeType===1?c.innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(;d<e;d++)c=this[d]||{},c.nodeType===1&&(f.cleanData(c.getElementsByTagName("*")),c.innerHTML=a);c=0}catch(g){}}c&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,function(a,b){b.src?f.ajax({type:"GET",global:!1,url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)})}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||f.isXMLDoc(a)||!bc.test("<"+a.nodeName+">")?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g,h,i,j=[];b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);for(var k=0,l;(l=a[k])!=null;k++){typeof l=="number"&&(l+="");if(!l)continue;if(typeof l=="string")if(!_.test(l))l=b.createTextNode(l);else{l=l.replace(Y,"<$1></$2>");var m=(Z.exec(l)||["",""])[1].toLowerCase(),n=bg[m]||bg._default,o=n[0],p=b.createElement("div"),q=bh.childNodes,r;b===c?bh.appendChild(p):U(b).appendChild(p),p.innerHTML=n[1]+l+n[2];while(o--)p=p.lastChild;if(!f.support.tbody){var s=$.test(l),t=m==="table"&&!s?p.firstChild&&p.firstChild.childNodes:n[1]==="<table>"&&!s?p.childNodes:[];for(i=t.length-1;i>=0;--i)f.nodeName(t[i],"tbody")&&!t[i].childNodes.length&&t[i].parentNode.removeChild(t[i])}!f.support.leadingWhitespace&&X.test(l)&&p.insertBefore(b.createTextNode(X.exec(l)[0]),p.firstChild),l=p.childNodes,p&&(p.parentNode.removeChild(p),q.length>0&&(r=q[q.length-1],r&&r.parentNode&&r.parentNode.removeChild(r)))}var u;if(!f.support.appendChecked)if(l[0]&&typeof (u=l.length)=="number")for(i=0;i<u;i++)bn(l[i]);else bn(l);l.nodeType?j.push(l):j=f.merge(j,l)}if(d){g=function(a){return!a.type||be.test(a.type)};for(k=0;j[k];k++){h=j[k];if(e&&f.nodeName(h,"script")&&(!h.type||be.test(h.type)))e.push(h.parentNode?h.parentNode.removeChild(h):h);else{if(h.nodeType===1){var v=f.grep(h.getElementsByTagName("script"),g);j.splice.apply(j,[k+1,0].concat(v))}d.appendChild(h)}}}return j},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bp=/alpha\([^)]*\)/i,bq=/opacity=([^)]*)/,br=/([A-Z]|^ms)/g,bs=/^[\-+]?(?:\d*\.)?\d+$/i,bt=/^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i,bu=/^([\-+])=([\-+.\de]+)/,bv=/^margin/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Top","Right","Bottom","Left"],by,bz,bA;f.fn.css=function(a,c){return f.access(this,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)},a,c,arguments.length>1)},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=by(a,"opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bu.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(by)return by(a,c)},swap:function(a,b,c){var d={},e,f;for(f in b)d[f]=a.style[f],a.style[f]=b[f];e=c.call(a);for(f in b)a.style[f]=d[f];return e}}),f.curCSS=f.css,c.defaultView&&c.defaultView.getComputedStyle&&(bz=function(a,b){var c,d,e,g,h=a.style;b=b.replace(br,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b))),!f.support.pixelMargin&&e&&bv.test(b)&&bt.test(c)&&(g=h.width,h.width=c,c=e.width,h.width=g);return c}),c.documentElement.currentStyle&&(bA=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f==null&&g&&(e=g[b])&&(f=e),bt.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),by=bz||bA,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){if(c)return a.offsetWidth!==0?bB(a,b,d):f.swap(a,bw,function(){return bB(a,b,d)})},set:function(a,b){return bs.test(b)?b+"px":b}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bq.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bp,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bp.test(g)?g.replace(bp,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){return f.swap(a,{display:"inline-block"},function(){return b?by(a,"margin-right"):a.style.marginRight})}})}),f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)}),f.each({margin:"",padding:"",border:"Width"},function(a,b){f.cssHooks[a+b]={expand:function(c){var d,e=typeof c=="string"?c.split(" "):[c],f={};for(d=0;d<4;d++)f[a+bx[d]+b]=e[d]||e[d-2]||e[0];return f}}});var bC=/%20/g,bD=/\[\]$/,bE=/\r?\n/g,bF=/#.*$/,bG=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bH=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bI=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bJ=/^(?:GET|HEAD)$/,bK=/^\/\//,bL=/\?/,bM=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bN=/^(?:select|textarea)/i,bO=/\s+/,bP=/([?&])_=[^&]*/,bQ=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bR=f.fn.load,bS={},bT={},bU,bV,bW=["*/"]+["*"];try{bU=e.href}catch(bX){bU=c.createElement("a"),bU.href="",bU=bU.href}bV=bQ.exec(bU.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bR)return bR.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bM,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bN.test(this.nodeName)||bH.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bE,"\r\n")}}):{name:b.name,value:c.replace(bE,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b$(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b$(a,b);return a},ajaxSettings:{url:bU,isLocal:bI.test(bV[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bW},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bY(bS),ajaxTransport:bY(bT),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?ca(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cb(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bG.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bF,"").replace(bK,bV[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bO),d.crossDomain==null&&(r=bQ.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bV[1]&&r[2]==bV[2]&&(r[3]||(r[1]==="http:"?80:443))==(bV[3]||(bV[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bZ(bS,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bJ.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bL.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bP,"$1_="+x);d.url=y+(y===d.url?(bL.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bW+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bZ(bT,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bC,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=typeof b.data=="string"&&/^application\/x\-www\-form\-urlencoded/.test(b.contentType);if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n);try{m.text=h.responseText}catch(a){}try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(ct("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),(e===""&&f.css(d,"display")==="none"||!f.contains(d.ownerDocument.documentElement,d))&&f._data(d,"olddisplay",cu(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(ct("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(ct("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o,p,q;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]);if((k=f.cssHooks[g])&&"expand"in k){l=k.expand(a[g]),delete a[g];for(i in l)i in a||(a[i]=l[i])}}for(g in a){h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cu(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cm.test(h)?(q=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),q?(f._data(this,"toggle"+i,q==="show"?"hide":"show"),j[q]()):j[h]()):(m=cn.exec(h),n=j.cur(),m?(o=parseFloat(m[2]),p=m[3]||(f.cssNumber[i]?"":"px"),p!=="px"&&(f.style(this,i,(o||1)+p),n=(o||1)/j.cur()*n,f.style(this,i,n+p)),m[1]&&(o=(m[1]==="-="?-1:1)*o+n),j.custom(n,o,p)):j.custom(n,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:ct("show",1),slideUp:ct("hide",1),slideToggle:ct("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a){return a},swing:function(a){return-Math.cos(a*Math.PI)/2+.5}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cq||cr(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){f._data(e.elem,"fxshow"+e.prop)===b&&(e.options.hide?f._data(e.elem,"fxshow"+e.prop,e.start):e.options.show&&f._data(e.elem,"fxshow"+e.prop,e.end))},h()&&f.timers.push(h)&&!co&&(co=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cq||cr(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(cp.concat.apply([],cp),function(a,b){b.indexOf("margin")&&(f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)})}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cv,cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?cv=function(a,b,c,d){try{d=a.getBoundingClientRect()}catch(e){}if(!d||!f.contains(c,a))return d?{top:d.top,left:d.left}:{top:0,left:0};var g=b.body,h=cy(b),i=c.clientTop||g.clientTop||0,j=c.clientLeft||g.clientLeft||0,k=h.pageYOffset||f.support.boxModel&&c.scrollTop||g.scrollTop,l=h.pageXOffset||f.support.boxModel&&c.scrollLeft||g.scrollLeft,m=d.top+k-i,n=d.left+l-j;return{top:m,left:n}}:cv=function(a,b,c){var d,e=a.offsetParent,g=a,h=b.body,i=b.defaultView,j=i?i.getComputedStyle(a,null):a.currentStyle,k=a.offsetTop,l=a.offsetLeft;while((a=a.parentNode)&&a!==h&&a!==c){if(f.support.fixedPosition&&j.position==="fixed")break;d=i?i.getComputedStyle(a,null):a.currentStyle,k-=a.scrollTop,l-=a.scrollLeft,a===e&&(k+=a.offsetTop,l+=a.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(a.nodeName))&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),g=e,e=a.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"&&(k+=parseFloat(d.borderTopWidth)||0,l+=parseFloat(d.borderLeftWidth)||0),j=d}if(j.position==="relative"||j.position==="static")k+=h.offsetTop,l+=h.offsetLeft;f.support.fixedPosition&&j.position==="fixed"&&(k+=Math.max(c.scrollTop,h.scrollTop),l+=Math.max(c.scrollLeft,h.scrollLeft));return{top:k,left:l}},f.fn.offset=function(a){if(arguments.length)return a===b?this:this.each(function(b){f.offset.setOffset(this,a,b)});var c=this[0],d=c&&c.ownerDocument;if(!d)return null;if(c===d.body)return f.offset.bodyOffset(c);return cv(c,d,d.documentElement)},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,c){var d=/Y/.test(c);f.fn[a]=function(e){return f.access(this,function(a,e,g){var h=cy(a);if(g===b)return h?c in h?h[c]:f.support.boxModel&&h.document.documentElement[e]||h.document.body[e]:a[e];h?h.scrollTo(d?f(h).scrollLeft():g,d?g:f(h).scrollTop()):a[e]=g},a,e,arguments.length,null)}}),f.each({Height:"height",Width:"width"},function(a,c){var d="client"+a,e="scroll"+a,g="offset"+a;f.fn["inner"+a]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,c,"padding")):this[c]():null},f.fn["outer"+a]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,c,a?"margin":"border")):this[c]():null},f.fn[c]=function(a){return f.access(this,function(a,c,h){var i,j,k,l;if(f.isWindow(a)){i=a.document,j=i.documentElement[d];return f.support.boxModel&&j||i.body&&i.body[d]||j}if(a.nodeType===9){i=a.documentElement;if(i[d]>=i[e])return i[d];return Math.max(a.body[e],i[e],a.body[g],i[g])}if(h===b){k=f.css(a,c),l=parseFloat(k);return f.isNumeric(l)?l:k}f(a).css(c,h)},c,a,arguments.length,null)}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window);
\ No newline at end of file
+!function(e,t){"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(e,t){var n=[],r=e.document,i=n.slice,o=n.concat,a=n.push,s=n.indexOf,l={},u=l.toString,c=l.hasOwnProperty,f={},d="1.12.4",p=function(e,t){return new p.fn.init(e,t)},h=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,g=/^-ms-/,m=/-([\da-z])/gi,v=function(e,t){return t.toUpperCase()};function y(e){var t=!!e&&"length"in e&&e.length,n=p.type(e);return"function"!==n&&!p.isWindow(e)&&("array"===n||0===t||"number"==typeof t&&t>0&&t-1 in e)}p.fn=p.prototype={jquery:d,constructor:p,selector:"",length:0,toArray:function(){return i.call(this)},get:function(e){return null!=e?e<0?this[e+this.length]:this[e]:i.call(this)},pushStack:function(e){var t=p.merge(this.constructor(),e);return t.prevObject=this,t.context=this.context,t},each:function(e){return p.each(this,e)},map:function(e){return this.pushStack(p.map(this,function(t,n){return e.call(t,n,t)}))},slice:function(){return this.pushStack(i.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(n>=0&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:a,sort:n.sort,splice:n.splice},p.extend=p.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,l=arguments.length,u=!1;for("boolean"==typeof a&&(u=a,a=arguments[s]||{},s++),"object"==typeof a||p.isFunction(a)||(a={}),s===l&&(a=this,s--);s<l;s++)if(null!=(i=arguments[s]))for(r in i)e=a[r],a!==(n=i[r])&&(u&&n&&(p.isPlainObject(n)||(t=p.isArray(n)))?(t?(t=!1,o=e&&p.isArray(e)?e:[]):o=e&&p.isPlainObject(e)?e:{},a[r]=p.extend(u,o,n)):void 0!==n&&(a[r]=n));return a},p.extend({expando:"jQuery"+(d+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isFunction:function(e){return"function"===p.type(e)},isArray:Array.isArray||function(e){return"array"===p.type(e)},isWindow:function(e){return null!=e&&e==e.window},isNumeric:function(e){var t=e&&e.toString();return!p.isArray(e)&&t-parseFloat(t)+1>=0},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},isPlainObject:function(e){var t;if(!e||"object"!==p.type(e)||e.nodeType||p.isWindow(e))return!1;try{if(e.constructor&&!c.call(e,"constructor")&&!c.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(e){return!1}if(!f.ownFirst)for(t in e)return c.call(e,t);for(t in e);return void 0===t||c.call(e,t)},type:function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?l[u.call(e)]||"object":typeof e},globalEval:function(t){t&&p.trim(t)&&(e.execScript||function(t){e.eval.call(e,t)})(t)},camelCase:function(e){return e.replace(g,"ms-").replace(m,v)},nodeName:function(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()},each:function(e,t){var n,r=0;if(y(e))for(n=e.length;r<n&&!1!==t.call(e[r],r,e[r]);r++);else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},trim:function(e){return null==e?"":(e+"").replace(h,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(y(Object(e))?p.merge(n,"string"==typeof e?[e]:e):a.call(n,e)),n},inArray:function(e,t,n){var r;if(t){if(s)return s.call(t,e,n);for(r=t.length,n=n?n<0?Math.max(0,r+n):n:0;n<r;n++)if(n in t&&t[n]===e)return n}return-1},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;)e[i++]=t[r++];if(n!=n)for(;void 0!==t[r];)e[i++]=t[r++];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,a=0,s=[];if(y(e))for(r=e.length;a<r;a++)null!=(i=t(e[a],a,n))&&s.push(i);else for(a in e)null!=(i=t(e[a],a,n))&&s.push(i);return o.apply([],s)},guid:1,proxy:function(e,t){var n,r,o;if("string"==typeof t&&(o=e[t],t=e,e=o),p.isFunction(e))return n=i.call(arguments,2),(r=function(){return e.apply(t||this,n.concat(i.call(arguments)))}).guid=e.guid=e.guid||p.guid++,r},now:function(){return+new Date},support:f}),"function"==typeof Symbol&&(p.fn[Symbol.iterator]=n[Symbol.iterator]),p.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){l["[object "+t+"]"]=t.toLowerCase()});var x=function(e){var t,n,r,i,o,a,s,l,u,c,f,d,p,h,g,m,v,y,x,b="sizzle"+1*new Date,w=e.document,T=0,C=0,E=oe(),N=oe(),k=oe(),S=function(e,t){return e===t&&(f=!0),0},A=1<<31,D={}.hasOwnProperty,j=[],L=j.pop,H=j.push,q=j.push,_=j.slice,F=function(e,t){for(var n=0,r=e.length;n<r;n++)if(e[n]===t)return n;return-1},M="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",O="[\\x20\\t\\r\\n\\f]",R="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",P="\\["+O+"*("+R+")(?:"+O+"*([*^$|!~]?=)"+O+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+R+"))|)"+O+"*\\]",B=":("+R+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+P+")*)|.*)\\)|)",W=new RegExp(O+"+","g"),I=new RegExp("^"+O+"+|((?:^|[^\\\\])(?:\\\\.)*)"+O+"+$","g"),$=new RegExp("^"+O+"*,"+O+"*"),z=new RegExp("^"+O+"*([>+~]|"+O+")"+O+"*"),X=new RegExp("="+O+"*([^\\]'\"]*?)"+O+"*\\]","g"),U=new RegExp(B),V=new RegExp("^"+R+"$"),Y={ID:new RegExp("^#("+R+")"),CLASS:new RegExp("^\\.("+R+")"),TAG:new RegExp("^("+R+"|[*])"),ATTR:new RegExp("^"+P),PSEUDO:new RegExp("^"+B),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+O+"*(even|odd|(([+-]|)(\\d*)n|)"+O+"*(?:([+-]|)"+O+"*(\\d+)|))"+O+"*\\)|)","i"),bool:new RegExp("^(?:"+M+")$","i"),needsContext:new RegExp("^"+O+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+O+"*((?:-\\d)?\\d*)"+O+"*\\)|)(?=[^-]|$)","i")},J=/^(?:input|select|textarea|button)$/i,G=/^h\d$/i,Q=/^[^{]+\{\s*\[native \w/,K=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,Z=/[+~]/,ee=/'|\\/g,te=new RegExp("\\\\([\\da-f]{1,6}"+O+"?|("+O+")|.)","ig"),ne=function(e,t,n){var r="0x"+t-65536;return r!=r||n?t:r<0?String.fromCharCode(r+65536):String.fromCharCode(r>>10|55296,1023&r|56320)},re=function(){d()};try{q.apply(j=_.call(w.childNodes),w.childNodes),j[w.childNodes.length].nodeType}catch(e){q={apply:j.length?function(e,t){H.apply(e,_.call(t))}:function(e,t){for(var n=e.length,r=0;e[n++]=t[r++];);e.length=n-1}}}function ie(e,t,r,i){var o,s,u,c,f,h,v,y,T=t&&t.ownerDocument,C=t?t.nodeType:9;if(r=r||[],"string"!=typeof e||!e||1!==C&&9!==C&&11!==C)return r;if(!i&&((t?t.ownerDocument||t:w)!==p&&d(t),t=t||p,g)){if(11!==C&&(h=K.exec(e)))if(o=h[1]){if(9===C){if(!(u=t.getElementById(o)))return r;if(u.id===o)return r.push(u),r}else if(T&&(u=T.getElementById(o))&&x(t,u)&&u.id===o)return r.push(u),r}else{if(h[2])return q.apply(r,t.getElementsByTagName(e)),r;if((o=h[3])&&n.getElementsByClassName&&t.getElementsByClassName)return q.apply(r,t.getElementsByClassName(o)),r}if(n.qsa&&!k[e+" "]&&(!m||!m.test(e))){if(1!==C)T=t,y=e;else if("object"!==t.nodeName.toLowerCase()){for((c=t.getAttribute("id"))?c=c.replace(ee,"\\$&"):t.setAttribute("id",c=b),s=(v=a(e)).length,f=V.test(c)?"#"+c:"[id='"+c+"']";s--;)v[s]=f+" "+ge(v[s]);y=v.join(","),T=Z.test(e)&&pe(t.parentNode)||t}if(y)try{return q.apply(r,T.querySelectorAll(y)),r}catch(e){}finally{c===b&&t.removeAttribute("id")}}}return l(e.replace(I,"$1"),t,r,i)}function oe(){var e=[];return function t(n,i){return e.push(n+" ")>r.cacheLength&&delete t[e.shift()],t[n+" "]=i}}function ae(e){return e[b]=!0,e}function se(e){var t=p.createElement("div");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function le(e,t){for(var n=e.split("|"),i=n.length;i--;)r.attrHandle[n[i]]=t}function ue(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&(~t.sourceIndex||A)-(~e.sourceIndex||A);if(r)return r;if(n)for(;n=n.nextSibling;)if(n===t)return-1;return e?1:-1}function ce(e){return function(t){return"input"===t.nodeName.toLowerCase()&&t.type===e}}function fe(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function de(e){return ae(function(t){return t=+t,ae(function(n,r){for(var i,o=e([],n.length,t),a=o.length;a--;)n[i=o[a]]&&(n[i]=!(r[i]=n[i]))})})}function pe(e){return e&&void 0!==e.getElementsByTagName&&e}for(t in n=ie.support={},o=ie.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return!!t&&"HTML"!==t.nodeName},d=ie.setDocument=function(e){var t,i,a=e?e.ownerDocument||e:w;return a!==p&&9===a.nodeType&&a.documentElement?(h=(p=a).documentElement,g=!o(p),(i=p.defaultView)&&i.top!==i&&(i.addEventListener?i.addEventListener("unload",re,!1):i.attachEvent&&i.attachEvent("onunload",re)),n.attributes=se(function(e){return e.className="i",!e.getAttribute("className")}),n.getElementsByTagName=se(function(e){return e.appendChild(p.createComment("")),!e.getElementsByTagName("*").length}),n.getElementsByClassName=Q.test(p.getElementsByClassName),n.getById=se(function(e){return h.appendChild(e).id=b,!p.getElementsByName||!p.getElementsByName(b).length}),n.getById?(r.find.ID=function(e,t){if(void 0!==t.getElementById&&g){var n=t.getElementById(e);return n?[n]:[]}},r.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}}):(delete r.find.ID,r.filter.ID=function(e){var t=e.replace(te,ne);return function(e){var n=void 0!==e.getAttributeNode&&e.getAttributeNode("id");return n&&n.value===t}}),r.find.TAG=n.getElementsByTagName?function(e,t){return void 0!==t.getElementsByTagName?t.getElementsByTagName(e):n.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){for(;n=o[i++];)1===n.nodeType&&r.push(n);return r}return o},r.find.CLASS=n.getElementsByClassName&&function(e,t){if(void 0!==t.getElementsByClassName&&g)return t.getElementsByClassName(e)},v=[],m=[],(n.qsa=Q.test(p.querySelectorAll))&&(se(function(e){h.appendChild(e).innerHTML="<a id='"+b+"'></a><select id='"+b+"-\r\\' msallowcapture=''><option selected=''></option></select>",e.querySelectorAll("[msallowcapture^='']").length&&m.push("[*^$]="+O+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||m.push("\\["+O+"*(?:value|"+M+")"),e.querySelectorAll("[id~="+b+"-]").length||m.push("~="),e.querySelectorAll(":checked").length||m.push(":checked"),e.querySelectorAll("a#"+b+"+*").length||m.push(".#.+[+~]")}),se(function(e){var t=p.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&m.push("name"+O+"*[*^$|!~]?="),e.querySelectorAll(":enabled").length||m.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),m.push(",.*:")})),(n.matchesSelector=Q.test(y=h.matches||h.webkitMatchesSelector||h.mozMatchesSelector||h.oMatchesSelector||h.msMatchesSelector))&&se(function(e){n.disconnectedMatch=y.call(e,"div"),y.call(e,"[s!='']:x"),v.push("!=",B)}),m=m.length&&new RegExp(m.join("|")),v=v.length&&new RegExp(v.join("|")),t=Q.test(h.compareDocumentPosition),x=t||Q.test(h.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)for(;t=t.parentNode;)if(t===e)return!0;return!1},S=t?function(e,t){if(e===t)return f=!0,0;var r=!e.compareDocumentPosition-!t.compareDocumentPosition;return r||(1&(r=(e.ownerDocument||e)===(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!n.sortDetached&&t.compareDocumentPosition(e)===r?e===p||e.ownerDocument===w&&x(w,e)?-1:t===p||t.ownerDocument===w&&x(w,t)?1:c?F(c,e)-F(c,t):0:4&r?-1:1)}:function(e,t){if(e===t)return f=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e===p?-1:t===p?1:i?-1:o?1:c?F(c,e)-F(c,t):0;if(i===o)return ue(e,t);for(n=e;n=n.parentNode;)a.unshift(n);for(n=t;n=n.parentNode;)s.unshift(n);for(;a[r]===s[r];)r++;return r?ue(a[r],s[r]):a[r]===w?-1:s[r]===w?1:0},p):p},ie.matches=function(e,t){return ie(e,null,null,t)},ie.matchesSelector=function(e,t){if((e.ownerDocument||e)!==p&&d(e),t=t.replace(X,"='$1']"),n.matchesSelector&&g&&!k[t+" "]&&(!v||!v.test(t))&&(!m||!m.test(t)))try{var r=y.call(e,t);if(r||n.disconnectedMatch||e.document&&11!==e.document.nodeType)return r}catch(e){}return ie(t,p,null,[e]).length>0},ie.contains=function(e,t){return(e.ownerDocument||e)!==p&&d(e),x(e,t)},ie.attr=function(e,t){(e.ownerDocument||e)!==p&&d(e);var i=r.attrHandle[t.toLowerCase()],o=i&&D.call(r.attrHandle,t.toLowerCase())?i(e,t,!g):void 0;return void 0!==o?o:n.attributes||!g?e.getAttribute(t):(o=e.getAttributeNode(t))&&o.specified?o.value:null},ie.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},ie.uniqueSort=function(e){var t,r=[],i=0,o=0;if(f=!n.detectDuplicates,c=!n.sortStable&&e.slice(0),e.sort(S),f){for(;t=e[o++];)t===e[o]&&(i=r.push(o));for(;i--;)e.splice(r[i],1)}return c=null,e},i=ie.getText=function(e){var t,n="",r=0,o=e.nodeType;if(o){if(1===o||9===o||11===o){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=i(e)}else if(3===o||4===o)return e.nodeValue}else for(;t=e[r++];)n+=i(t);return n},(r=ie.selectors={cacheLength:50,createPseudo:ae,match:Y,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||ie.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&ie.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return Y.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&U.test(n)&&(t=a(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=E[e+" "];return t||(t=new RegExp("(^|"+O+")"+e+"("+O+"|$)"))&&E(e,function(e){return t.test("string"==typeof e.className&&e.className||void 0!==e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=ie.attr(r,e);return null==i?"!="===t:!t||(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i.replace(W," ")+" ").indexOf(n)>-1:"|="===t&&(i===n||i.slice(0,n.length+1)===n+"-"))}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),a="last"!==e.slice(-4),s="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,l){var u,c,f,d,p,h,g=o!==a?"nextSibling":"previousSibling",m=t.parentNode,v=s&&t.nodeName.toLowerCase(),y=!l&&!s,x=!1;if(m){if(o){for(;g;){for(d=t;d=d[g];)if(s?d.nodeName.toLowerCase()===v:1===d.nodeType)return!1;h=g="only"===e&&!h&&"nextSibling"}return!0}if(h=[a?m.firstChild:m.lastChild],a&&y){for(x=(p=(u=(c=(f=(d=m)[b]||(d[b]={}))[d.uniqueID]||(f[d.uniqueID]={}))[e]||[])[0]===T&&u[1])&&u[2],d=p&&m.childNodes[p];d=++p&&d&&d[g]||(x=p=0)||h.pop();)if(1===d.nodeType&&++x&&d===t){c[e]=[T,p,x];break}}else if(y&&(x=p=(u=(c=(f=(d=t)[b]||(d[b]={}))[d.uniqueID]||(f[d.uniqueID]={}))[e]||[])[0]===T&&u[1]),!1===x)for(;(d=++p&&d&&d[g]||(x=p=0)||h.pop())&&((s?d.nodeName.toLowerCase()!==v:1!==d.nodeType)||!++x||(y&&((c=(f=d[b]||(d[b]={}))[d.uniqueID]||(f[d.uniqueID]={}))[e]=[T,x]),d!==t)););return(x-=i)===r||x%r==0&&x/r>=0}}},PSEUDO:function(e,t){var n,i=r.pseudos[e]||r.setFilters[e.toLowerCase()]||ie.error("unsupported pseudo: "+e);return i[b]?i(t):i.length>1?(n=[e,e,"",t],r.setFilters.hasOwnProperty(e.toLowerCase())?ae(function(e,n){for(var r,o=i(e,t),a=o.length;a--;)e[r=F(e,o[a])]=!(n[r]=o[a])}):function(e){return i(e,0,n)}):i}},pseudos:{not:ae(function(e){var t=[],n=[],r=s(e.replace(I,"$1"));return r[b]?ae(function(e,t,n,i){for(var o,a=r(e,null,i,[]),s=e.length;s--;)(o=a[s])&&(e[s]=!(t[s]=o))}):function(e,i,o){return t[0]=e,r(t,null,o,n),t[0]=null,!n.pop()}}),has:ae(function(e){return function(t){return ie(e,t).length>0}}),contains:ae(function(e){return e=e.replace(te,ne),function(t){return(t.textContent||t.innerText||i(t)).indexOf(e)>-1}}),lang:ae(function(e){return V.test(e||"")||ie.error("unsupported lang: "+e),e=e.replace(te,ne).toLowerCase(),function(t){var n;do{if(n=g?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return(n=n.toLowerCase())===e||0===n.indexOf(e+"-")}while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var n=e.location&&e.location.hash;return n&&n.slice(1)===t.id},root:function(e){return e===h},focus:function(e){return e===p.activeElement&&(!p.hasFocus||p.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:function(e){return!1===e.disabled},disabled:function(e){return!0===e.disabled},checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!r.pseudos.empty(e)},header:function(e){return G.test(e.nodeName)},input:function(e){return J.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:de(function(){return[0]}),last:de(function(e,t){return[t-1]}),eq:de(function(e,t,n){return[n<0?n+t:n]}),even:de(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:de(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:de(function(e,t,n){for(var r=n<0?n+t:n;--r>=0;)e.push(r);return e}),gt:de(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=r.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})r.pseudos[t]=ce(t);for(t in{submit:!0,reset:!0})r.pseudos[t]=fe(t);function he(){}function ge(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function me(e,t,n){var r=t.dir,i=n&&"parentNode"===r,o=C++;return t.first?function(t,n,o){for(;t=t[r];)if(1===t.nodeType||i)return e(t,n,o)}:function(t,n,a){var s,l,u,c=[T,o];if(a){for(;t=t[r];)if((1===t.nodeType||i)&&e(t,n,a))return!0}else for(;t=t[r];)if(1===t.nodeType||i){if((s=(l=(u=t[b]||(t[b]={}))[t.uniqueID]||(u[t.uniqueID]={}))[r])&&s[0]===T&&s[1]===o)return c[2]=s[2];if(l[r]=c,c[2]=e(t,n,a))return!0}}}function ve(e){return e.length>1?function(t,n,r){for(var i=e.length;i--;)if(!e[i](t,n,r))return!1;return!0}:e[0]}function ye(e,t,n,r,i){for(var o,a=[],s=0,l=e.length,u=null!=t;s<l;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),u&&t.push(s)));return a}function xe(e,t,n,r,i,o){return r&&!r[b]&&(r=xe(r)),i&&!i[b]&&(i=xe(i,o)),ae(function(o,a,s,l){var u,c,f,d=[],p=[],h=a.length,g=o||function(e,t,n){for(var r=0,i=t.length;r<i;r++)ie(e,t[r],n);return n}(t||"*",s.nodeType?[s]:s,[]),m=!e||!o&&t?g:ye(g,d,e,s,l),v=n?i||(o?e:h||r)?[]:a:m;if(n&&n(m,v,s,l),r)for(u=ye(v,p),r(u,[],s,l),c=u.length;c--;)(f=u[c])&&(v[p[c]]=!(m[p[c]]=f));if(o){if(i||e){if(i){for(u=[],c=v.length;c--;)(f=v[c])&&u.push(m[c]=f);i(null,v=[],u,l)}for(c=v.length;c--;)(f=v[c])&&(u=i?F(o,f):d[c])>-1&&(o[u]=!(a[u]=f))}}else v=ye(v===a?v.splice(h,v.length):v),i?i(null,a,v,l):q.apply(a,v)})}function be(e){for(var t,n,i,o=e.length,a=r.relative[e[0].type],s=a||r.relative[" "],l=a?1:0,c=me(function(e){return e===t},s,!0),f=me(function(e){return F(t,e)>-1},s,!0),d=[function(e,n,r){var i=!a&&(r||n!==u)||((t=n).nodeType?c(e,n,r):f(e,n,r));return t=null,i}];l<o;l++)if(n=r.relative[e[l].type])d=[me(ve(d),n)];else{if((n=r.filter[e[l].type].apply(null,e[l].matches))[b]){for(i=++l;i<o&&!r.relative[e[i].type];i++);return xe(l>1&&ve(d),l>1&&ge(e.slice(0,l-1).concat({value:" "===e[l-2].type?"*":""})).replace(I,"$1"),n,l<i&&be(e.slice(l,i)),i<o&&be(e=e.slice(i)),i<o&&ge(e))}d.push(n)}return ve(d)}return he.prototype=r.filters=r.pseudos,r.setFilters=new he,a=ie.tokenize=function(e,t){var n,i,o,a,s,l,u,c=N[e+" "];if(c)return t?0:c.slice(0);for(s=e,l=[],u=r.preFilter;s;){for(a in n&&!(i=$.exec(s))||(i&&(s=s.slice(i[0].length)||s),l.push(o=[])),n=!1,(i=z.exec(s))&&(n=i.shift(),o.push({value:n,type:i[0].replace(I," ")}),s=s.slice(n.length)),r.filter)!(i=Y[a].exec(s))||u[a]&&!(i=u[a](i))||(n=i.shift(),o.push({value:n,type:a,matches:i}),s=s.slice(n.length));if(!n)break}return t?s.length:s?ie.error(e):N(e,l).slice(0)},s=ie.compile=function(e,t){var n,i,o,s,l,c,f=[],h=[],m=k[e+" "];if(!m){for(t||(t=a(e)),n=t.length;n--;)(m=be(t[n]))[b]?f.push(m):h.push(m);(m=k(e,(i=h,s=(o=f).length>0,l=i.length>0,c=function(e,t,n,a,c){var f,h,m,v=0,y="0",x=e&&[],b=[],w=u,C=e||l&&r.find.TAG("*",c),E=T+=null==w?1:Math.random()||.1,N=C.length;for(c&&(u=t===p||t||c);y!==N&&null!=(f=C[y]);y++){if(l&&f){for(h=0,t||f.ownerDocument===p||(d(f),n=!g);m=i[h++];)if(m(f,t||p,n)){a.push(f);break}c&&(T=E)}s&&((f=!m&&f)&&v--,e&&x.push(f))}if(v+=y,s&&y!==v){for(h=0;m=o[h++];)m(x,b,t,n);if(e){if(v>0)for(;y--;)x[y]||b[y]||(b[y]=L.call(a));b=ye(b)}q.apply(a,b),c&&!e&&b.length>0&&v+o.length>1&&ie.uniqueSort(a)}return c&&(T=E,u=w),x},s?ae(c):c))).selector=e}return m},l=ie.select=function(e,t,i,o){var l,u,c,f,d,p="function"==typeof e&&e,h=!o&&a(e=p.selector||e);if(i=i||[],1===h.length){if((u=h[0]=h[0].slice(0)).length>2&&"ID"===(c=u[0]).type&&n.getById&&9===t.nodeType&&g&&r.relative[u[1].type]){if(!(t=(r.find.ID(c.matches[0].replace(te,ne),t)||[])[0]))return i;p&&(t=t.parentNode),e=e.slice(u.shift().value.length)}for(l=Y.needsContext.test(e)?0:u.length;l--&&(c=u[l],!r.relative[f=c.type]);)if((d=r.find[f])&&(o=d(c.matches[0].replace(te,ne),Z.test(u[0].type)&&pe(t.parentNode)||t))){if(u.splice(l,1),!(e=o.length&&ge(u)))return q.apply(i,o),i;break}}return(p||s(e,h))(o,t,!g,i,!t||Z.test(e)&&pe(t.parentNode)||t),i},n.sortStable=b.split("").sort(S).join("")===b,n.detectDuplicates=!!f,d(),n.sortDetached=se(function(e){return 1&e.compareDocumentPosition(p.createElement("div"))}),se(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||le("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),n.attributes&&se(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||le("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),se(function(e){return null==e.getAttribute("disabled")})||le(M,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),ie}(e);p.find=x,p.expr=x.selectors,p.expr[":"]=p.expr.pseudos,p.uniqueSort=p.unique=x.uniqueSort,p.text=x.getText,p.isXMLDoc=x.isXML,p.contains=x.contains;var b=function(e,t,n){for(var r=[],i=void 0!==n;(e=e[t])&&9!==e.nodeType;)if(1===e.nodeType){if(i&&p(e).is(n))break;r.push(e)}return r},w=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},T=p.expr.match.needsContext,C=/^<([\w-]+)\s*\/?>(?:<\/\1>|)$/,E=/^.[^:#\[\.,]*$/;function N(e,t,n){if(p.isFunction(t))return p.grep(e,function(e,r){return!!t.call(e,r,e)!==n});if(t.nodeType)return p.grep(e,function(e){return e===t!==n});if("string"==typeof t){if(E.test(t))return p.filter(t,e,n);t=p.filter(t,e)}return p.grep(e,function(e){return p.inArray(e,t)>-1!==n})}p.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?p.find.matchesSelector(r,e)?[r]:[]:p.find.matches(e,p.grep(t,function(e){return 1===e.nodeType}))},p.fn.extend({find:function(e){var t,n=[],r=this,i=r.length;if("string"!=typeof e)return this.pushStack(p(e).filter(function(){for(t=0;t<i;t++)if(p.contains(r[t],this))return!0}));for(t=0;t<i;t++)p.find(e,r[t],n);return(n=this.pushStack(i>1?p.unique(n):n)).selector=this.selector?this.selector+" "+e:e,n},filter:function(e){return this.pushStack(N(this,e||[],!1))},not:function(e){return this.pushStack(N(this,e||[],!0))},is:function(e){return!!N(this,"string"==typeof e&&T.test(e)?p(e):e||[],!1).length}});var k,S=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/;(p.fn.init=function(e,t,n){var i,o;if(!e)return this;if(n=n||k,"string"==typeof e){if(!(i="<"===e.charAt(0)&&">"===e.charAt(e.length-1)&&e.length>=3?[null,e,null]:S.exec(e))||!i[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(i[1]){if(t=t instanceof p?t[0]:t,p.merge(this,p.parseHTML(i[1],t&&t.nodeType?t.ownerDocument||t:r,!0)),C.test(i[1])&&p.isPlainObject(t))for(i in t)p.isFunction(this[i])?this[i](t[i]):this.attr(i,t[i]);return this}if((o=r.getElementById(i[2]))&&o.parentNode){if(o.id!==i[2])return k.find(e);this.length=1,this[0]=o}return this.context=r,this.selector=e,this}return e.nodeType?(this.context=this[0]=e,this.length=1,this):p.isFunction(e)?void 0!==n.ready?n.ready(e):e(p):(void 0!==e.selector&&(this.selector=e.selector,this.context=e.context),p.makeArray(e,this))}).prototype=p.fn,k=p(r);var A=/^(?:parents|prev(?:Until|All))/,D={children:!0,contents:!0,next:!0,prev:!0};function j(e,t){do{e=e[t]}while(e&&1!==e.nodeType);return e}p.fn.extend({has:function(e){var t,n=p(e,this),r=n.length;return this.filter(function(){for(t=0;t<r;t++)if(p.contains(this,n[t]))return!0})},closest:function(e,t){for(var n,r=0,i=this.length,o=[],a=T.test(e)||"string"!=typeof e?p(e,t||this.context):0;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?a.index(n)>-1:1===n.nodeType&&p.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(o.length>1?p.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?p.inArray(this[0],p(e)):p.inArray(e.jquery?e[0]:e,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(p.uniqueSort(p.merge(this.get(),p(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),p.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return b(e,"parentNode")},parentsUntil:function(e,t,n){return b(e,"parentNode",n)},next:function(e){return j(e,"nextSibling")},prev:function(e){return j(e,"previousSibling")},nextAll:function(e){return b(e,"nextSibling")},prevAll:function(e){return b(e,"previousSibling")},nextUntil:function(e,t,n){return b(e,"nextSibling",n)},prevUntil:function(e,t,n){return b(e,"previousSibling",n)},siblings:function(e){return w((e.parentNode||{}).firstChild,e)},children:function(e){return w(e.firstChild)},contents:function(e){return p.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:p.merge([],e.childNodes)}},function(e,t){p.fn[e]=function(n,r){var i=p.map(this,t,n);return"Until"!==e.slice(-5)&&(r=n),r&&"string"==typeof r&&(i=p.filter(r,i)),this.length>1&&(D[e]||(i=p.uniqueSort(i)),A.test(e)&&(i=i.reverse())),this.pushStack(i)}});var L,H,q=/\S+/g;function _(){r.addEventListener?(r.removeEventListener("DOMContentLoaded",F),e.removeEventListener("load",F)):(r.detachEvent("onreadystatechange",F),e.detachEvent("onload",F))}function F(){(r.addEventListener||"load"===e.event.type||"complete"===r.readyState)&&(_(),p.ready())}for(H in p.Callbacks=function(e){var t,n;e="string"==typeof e?(t=e,n={},p.each(t.match(q)||[],function(e,t){n[t]=!0}),n):p.extend({},e);var r,i,o,a,s=[],l=[],u=-1,c=function(){for(a=e.once,o=r=!0;l.length;u=-1)for(i=l.shift();++u<s.length;)!1===s[u].apply(i[0],i[1])&&e.stopOnFalse&&(u=s.length,i=!1);e.memory||(i=!1),r=!1,a&&(s=i?[]:"")},f={add:function(){return s&&(i&&!r&&(u=s.length-1,l.push(i)),function t(n){p.each(n,function(n,r){p.isFunction(r)?e.unique&&f.has(r)||s.push(r):r&&r.length&&"string"!==p.type(r)&&t(r)})}(arguments),i&&!r&&c()),this},remove:function(){return p.each(arguments,function(e,t){for(var n;(n=p.inArray(t,s,n))>-1;)s.splice(n,1),n<=u&&u--}),this},has:function(e){return e?p.inArray(e,s)>-1:s.length>0},empty:function(){return s&&(s=[]),this},disable:function(){return a=l=[],s=i="",this},disabled:function(){return!s},lock:function(){return a=!0,i||f.disable(),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],l.push(t),r||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},p.extend({Deferred:function(e){var t=[["resolve","done",p.Callbacks("once memory"),"resolved"],["reject","fail",p.Callbacks("once memory"),"rejected"],["notify","progress",p.Callbacks("memory")]],n="pending",r={state:function(){return n},always:function(){return i.done(arguments).fail(arguments),this},then:function(){var e=arguments;return p.Deferred(function(n){p.each(t,function(t,o){var a=p.isFunction(e[t])&&e[t];i[o[1]](function(){var e=a&&a.apply(this,arguments);e&&p.isFunction(e.promise)?e.promise().progress(n.notify).done(n.resolve).fail(n.reject):n[o[0]+"With"](this===r?n.promise():this,a?[e]:arguments)})}),e=null}).promise()},promise:function(e){return null!=e?p.extend(e,r):r}},i={};return r.pipe=r.then,p.each(t,function(e,o){var a=o[2],s=o[3];r[o[1]]=a.add,s&&a.add(function(){n=s},t[1^e][2].disable,t[2][2].lock),i[o[0]]=function(){return i[o[0]+"With"](this===i?r:this,arguments),this},i[o[0]+"With"]=a.fireWith}),r.promise(i),e&&e.call(i,i),i},when:function(e){var t,n,r,o=0,a=i.call(arguments),s=a.length,l=1!==s||e&&p.isFunction(e.promise)?s:0,u=1===l?e:p.Deferred(),c=function(e,n,r){return function(o){n[e]=this,r[e]=arguments.length>1?i.call(arguments):o,r===t?u.notifyWith(n,r):--l||u.resolveWith(n,r)}};if(s>1)for(t=new Array(s),n=new Array(s),r=new Array(s);o<s;o++)a[o]&&p.isFunction(a[o].promise)?a[o].promise().progress(c(o,n,t)).done(c(o,r,a)).fail(u.reject):--l;return l||u.resolveWith(r,a),u.promise()}}),p.fn.ready=function(e){return p.ready.promise().done(e),this},p.extend({isReady:!1,readyWait:1,holdReady:function(e){e?p.readyWait++:p.ready(!0)},ready:function(e){(!0===e?--p.readyWait:p.isReady)||(p.isReady=!0,!0!==e&&--p.readyWait>0||(L.resolveWith(r,[p]),p.fn.triggerHandler&&(p(r).triggerHandler("ready"),p(r).off("ready"))))}}),p.ready.promise=function(t){if(!L)if(L=p.Deferred(),"complete"===r.readyState||"loading"!==r.readyState&&!r.documentElement.doScroll)e.setTimeout(p.ready);else if(r.addEventListener)r.addEventListener("DOMContentLoaded",F),e.addEventListener("load",F);else{r.attachEvent("onreadystatechange",F),e.attachEvent("onload",F);var n=!1;try{n=null==e.frameElement&&r.documentElement}catch(e){}n&&n.doScroll&&function t(){if(!p.isReady){try{n.doScroll("left")}catch(n){return e.setTimeout(t,50)}_(),p.ready()}}()}return L.promise(t)},p.ready.promise(),p(f))break;f.ownFirst="0"===H,f.inlineBlockNeedsLayout=!1,p(function(){var e,t,n,i;(n=r.getElementsByTagName("body")[0])&&n.style&&(t=r.createElement("div"),(i=r.createElement("div")).style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",n.appendChild(i).appendChild(t),void 0!==t.style.zoom&&(t.style.cssText="display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1",f.inlineBlockNeedsLayout=e=3===t.offsetWidth,e&&(n.style.zoom=1)),n.removeChild(i))}),function(){var e=r.createElement("div");f.deleteExpando=!0;try{delete e.test}catch(e){f.deleteExpando=!1}e=null}();var M,O=function(e){var t=p.noData[(e.nodeName+" ").toLowerCase()],n=+e.nodeType||1;return(1===n||9===n)&&(!t||!0!==t&&e.getAttribute("classid")===t)},R=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,P=/([A-Z])/g;function B(e,t,n){if(void 0===n&&1===e.nodeType){var r="data-"+t.replace(P,"-$1").toLowerCase();if("string"==typeof(n=e.getAttribute(r))){try{n="true"===n||"false"!==n&&("null"===n?null:+n+""===n?+n:R.test(n)?p.parseJSON(n):n)}catch(e){}p.data(e,t,n)}else n=void 0}return n}function W(e){var t;for(t in e)if(("data"!==t||!p.isEmptyObject(e[t]))&&"toJSON"!==t)return!1;return!0}function I(e,t,r,i){if(O(e)){var o,a,s=p.expando,l=e.nodeType,u=l?p.cache:e,c=l?e[s]:e[s]&&s;if(c&&u[c]&&(i||u[c].data)||void 0!==r||"string"!=typeof t)return c||(c=l?e[s]=n.pop()||p.guid++:s),u[c]||(u[c]=l?{}:{toJSON:p.noop}),"object"!=typeof t&&"function"!=typeof t||(i?u[c]=p.extend(u[c],t):u[c].data=p.extend(u[c].data,t)),a=u[c],i||(a.data||(a.data={}),a=a.data),void 0!==r&&(a[p.camelCase(t)]=r),"string"==typeof t?null==(o=a[t])&&(o=a[p.camelCase(t)]):o=a,o}}function $(e,t,n){if(O(e)){var r,i,o=e.nodeType,a=o?p.cache:e,s=o?e[p.expando]:p.expando;if(a[s]){if(t&&(r=n?a[s]:a[s].data)){i=(t=p.isArray(t)?t.concat(p.map(t,p.camelCase)):t in r?[t]:(t=p.camelCase(t))in r?[t]:t.split(" ")).length;for(;i--;)delete r[t[i]];if(n?!W(r):!p.isEmptyObject(r))return}(n||(delete a[s].data,W(a[s])))&&(o?p.cleanData([e],!0):f.deleteExpando||a!=a.window?delete a[s]:a[s]=void 0)}}}p.extend({cache:{},noData:{"applet ":!0,"embed ":!0,"object ":"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"},hasData:function(e){return!!(e=e.nodeType?p.cache[e[p.expando]]:e[p.expando])&&!W(e)},data:function(e,t,n){return I(e,t,n)},removeData:function(e,t){return $(e,t)},_data:function(e,t,n){return I(e,t,n,!0)},_removeData:function(e,t){return $(e,t,!0)}}),p.fn.extend({data:function(e,t){var n,r,i,o=this[0],a=o&&o.attributes;if(void 0===e){if(this.length&&(i=p.data(o),1===o.nodeType&&!p._data(o,"parsedAttrs"))){for(n=a.length;n--;)a[n]&&0===(r=a[n].name).indexOf("data-")&&B(o,r=p.camelCase(r.slice(5)),i[r]);p._data(o,"parsedAttrs",!0)}return i}return"object"==typeof e?this.each(function(){p.data(this,e)}):arguments.length>1?this.each(function(){p.data(this,e,t)}):o?B(o,e,p.data(o,e)):void 0},removeData:function(e){return this.each(function(){p.removeData(this,e)})}}),p.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=p._data(e,t),n&&(!r||p.isArray(n)?r=p._data(e,t,p.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=p.queue(e,t),r=n.length,i=n.shift(),o=p._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){p.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return p._data(e,n)||p._data(e,n,{empty:p.Callbacks("once memory").add(function(){p._removeData(e,t+"queue"),p._removeData(e,n)})})}}),p.fn.extend({queue:function(e,t){var n=2;return"string"!=typeof e&&(t=e,e="fx",n--),arguments.length<n?p.queue(this[0],e):void 0===t?this:this.each(function(){var n=p.queue(this,e,t);p._queueHooks(this,e),"fx"===e&&"inprogress"!==n[0]&&p.dequeue(this,e)})},dequeue:function(e){return this.each(function(){p.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=p.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};for("string"!=typeof e&&(t=e,e=void 0),e=e||"fx";a--;)(n=p._data(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}}),f.shrinkWrapBlocks=function(){return null!=M?M:(M=!1,(t=r.getElementsByTagName("body")[0])&&t.style?(e=r.createElement("div"),(n=r.createElement("div")).style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",t.appendChild(n).appendChild(e),void 0!==e.style.zoom&&(e.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:1px;width:1px;zoom:1",e.appendChild(r.createElement("div")).style.width="5px",M=3!==e.offsetWidth),t.removeChild(n),M):void 0);var e,t,n};var z=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,X=new RegExp("^(?:([+-])=|)("+z+")([a-z%]*)$","i"),U=["Top","Right","Bottom","Left"],V=function(e,t){return e=t||e,"none"===p.css(e,"display")||!p.contains(e.ownerDocument,e)};function Y(e,t,n,r){var i,o=1,a=20,s=r?function(){return r.cur()}:function(){return p.css(e,t,"")},l=s(),u=n&&n[3]||(p.cssNumber[t]?"":"px"),c=(p.cssNumber[t]||"px"!==u&&+l)&&X.exec(p.css(e,t));if(c&&c[3]!==u){u=u||c[3],n=n||[],c=+l||1;do{c/=o=o||".5",p.style(e,t,c+u)}while(o!==(o=s()/l)&&1!==o&&--a)}return n&&(c=+c||+l||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=u,r.start=c,r.end=i)),i}var J,G,Q,K=function(e,t,n,r,i,o,a){var s=0,l=e.length,u=null==n;if("object"===p.type(n))for(s in i=!0,n)K(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,p.isFunction(r)||(a=!0),u&&(a?(t.call(e,r),t=null):(u=t,t=function(e,t,n){return u.call(p(e),n)})),t))for(;s<l;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:u?t.call(e):l?t(e[0],n):o},Z=/^(?:checkbox|radio)$/i,ee=/<([\w:-]+)/,te=/^$|\/(?:java|ecma)script/i,ne=/^\s+/,re="abbr|article|aside|audio|bdi|canvas|data|datalist|details|dialog|figcaption|figure|footer|header|hgroup|main|mark|meter|nav|output|picture|progress|section|summary|template|time|video";function ie(e){var t=re.split("|"),n=e.createDocumentFragment();if(n.createElement)for(;t.length;)n.createElement(t.pop());return n}J=r.createElement("div"),G=r.createDocumentFragment(),Q=r.createElement("input"),J.innerHTML="  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",f.leadingWhitespace=3===J.firstChild.nodeType,f.tbody=!J.getElementsByTagName("tbody").length,f.htmlSerialize=!!J.getElementsByTagName("link").length,f.html5Clone="<:nav></:nav>"!==r.createElement("nav").cloneNode(!0).outerHTML,Q.type="checkbox",Q.checked=!0,G.appendChild(Q),f.appendChecked=Q.checked,J.innerHTML="<textarea>x</textarea>",f.noCloneChecked=!!J.cloneNode(!0).lastChild.defaultValue,G.appendChild(J),(Q=r.createElement("input")).setAttribute("type","radio"),Q.setAttribute("checked","checked"),Q.setAttribute("name","t"),J.appendChild(Q),f.checkClone=J.cloneNode(!0).cloneNode(!0).lastChild.checked,f.noCloneEvent=!!J.addEventListener,J[p.expando]=1,f.attributes=!J.getAttribute(p.expando);var oe={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],area:[1,"<map>","</map>"],param:[1,"<object>","</object>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:f.htmlSerialize?[0,"",""]:[1,"X<div>","</div>"]};function ae(e,t){var n,r,i=0,o=void 0!==e.getElementsByTagName?e.getElementsByTagName(t||"*"):void 0!==e.querySelectorAll?e.querySelectorAll(t||"*"):void 0;if(!o)for(o=[],n=e.childNodes||e;null!=(r=n[i]);i++)!t||p.nodeName(r,t)?o.push(r):p.merge(o,ae(r,t));return void 0===t||t&&p.nodeName(e,t)?p.merge([e],o):o}function se(e,t){for(var n,r=0;null!=(n=e[r]);r++)p._data(n,"globalEval",!t||p._data(t[r],"globalEval"))}oe.optgroup=oe.option,oe.tbody=oe.tfoot=oe.colgroup=oe.caption=oe.thead,oe.th=oe.td;var le=/<|&#?\w+;/,ue=/<tbody/i;function ce(e){Z.test(e.type)&&(e.defaultChecked=e.checked)}function fe(e,t,n,r,i){for(var o,a,s,l,u,c,d,h=e.length,g=ie(t),m=[],v=0;v<h;v++)if((a=e[v])||0===a)if("object"===p.type(a))p.merge(m,a.nodeType?[a]:a);else if(le.test(a)){for(l=l||g.appendChild(t.createElement("div")),u=(ee.exec(a)||["",""])[1].toLowerCase(),d=oe[u]||oe._default,l.innerHTML=d[1]+p.htmlPrefilter(a)+d[2],o=d[0];o--;)l=l.lastChild;if(!f.leadingWhitespace&&ne.test(a)&&m.push(t.createTextNode(ne.exec(a)[0])),!f.tbody)for(o=(a="table"!==u||ue.test(a)?"<table>"!==d[1]||ue.test(a)?0:l:l.firstChild)&&a.childNodes.length;o--;)p.nodeName(c=a.childNodes[o],"tbody")&&!c.childNodes.length&&a.removeChild(c);for(p.merge(m,l.childNodes),l.textContent="";l.firstChild;)l.removeChild(l.firstChild);l=g.lastChild}else m.push(t.createTextNode(a));for(l&&g.removeChild(l),f.appendChecked||p.grep(ae(m,"input"),ce),v=0;a=m[v++];)if(r&&p.inArray(a,r)>-1)i&&i.push(a);else if(s=p.contains(a.ownerDocument,a),l=ae(g.appendChild(a),"script"),s&&se(l),n)for(o=0;a=l[o++];)te.test(a.type||"")&&n.push(a);return l=null,g}!function(){var t,n,i=r.createElement("div");for(t in{submit:!0,change:!0,focusin:!0})n="on"+t,(f[t]=n in e)||(i.setAttribute(n,"t"),f[t]=!1===i.attributes[n].expando);i=null}();var de=/^(?:input|select|textarea)$/i,pe=/^key/,he=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,ge=/^(?:focusinfocus|focusoutblur)$/,me=/^([^.]*)(?:\.(.+)|)/;function ve(){return!0}function ye(){return!1}function xe(){try{return r.activeElement}catch(e){}}function be(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)be(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=ye;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return p().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=p.guid++)),e.each(function(){p.event.add(this,t,i,r,n)})}p.event={global:{},add:function(e,t,n,r,i){var o,a,s,l,u,c,f,d,h,g,m,v=p._data(e);if(v){for(n.handler&&(n=(l=n).handler,i=l.selector),n.guid||(n.guid=p.guid++),(a=v.events)||(a=v.events={}),(c=v.handle)||((c=v.handle=function(e){return void 0===p||e&&p.event.triggered===e.type?void 0:p.event.dispatch.apply(c.elem,arguments)}).elem=e),s=(t=(t||"").match(q)||[""]).length;s--;)h=m=(o=me.exec(t[s])||[])[1],g=(o[2]||"").split(".").sort(),h&&(u=p.event.special[h]||{},h=(i?u.delegateType:u.bindType)||h,u=p.event.special[h]||{},f=p.extend({type:h,origType:m,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&p.expr.match.needsContext.test(i),namespace:g.join(".")},l),(d=a[h])||((d=a[h]=[]).delegateCount=0,u.setup&&!1!==u.setup.call(e,r,g,c)||(e.addEventListener?e.addEventListener(h,c,!1):e.attachEvent&&e.attachEvent("on"+h,c))),u.add&&(u.add.call(e,f),f.handler.guid||(f.handler.guid=n.guid)),i?d.splice(d.delegateCount++,0,f):d.push(f),p.event.global[h]=!0);e=null}},remove:function(e,t,n,r,i){var o,a,s,l,u,c,f,d,h,g,m,v=p.hasData(e)&&p._data(e);if(v&&(c=v.events)){for(u=(t=(t||"").match(q)||[""]).length;u--;)if(h=m=(s=me.exec(t[u])||[])[1],g=(s[2]||"").split(".").sort(),h){for(f=p.event.special[h]||{},d=c[h=(r?f.delegateType:f.bindType)||h]||[],s=s[2]&&new RegExp("(^|\\.)"+g.join("\\.(?:.*\\.|)")+"(\\.|$)"),l=o=d.length;o--;)a=d[o],!i&&m!==a.origType||n&&n.guid!==a.guid||s&&!s.test(a.namespace)||r&&r!==a.selector&&("**"!==r||!a.selector)||(d.splice(o,1),a.selector&&d.delegateCount--,f.remove&&f.remove.call(e,a));l&&!d.length&&(f.teardown&&!1!==f.teardown.call(e,g,v.handle)||p.removeEvent(e,h,v.handle),delete c[h])}else for(h in c)p.event.remove(e,h+t[u],n,r,!0);p.isEmptyObject(c)&&(delete v.handle,p._removeData(e,"events"))}},trigger:function(t,n,i,o){var a,s,l,u,f,d,h,g=[i||r],m=c.call(t,"type")?t.type:t,v=c.call(t,"namespace")?t.namespace.split("."):[];if(l=d=i=i||r,3!==i.nodeType&&8!==i.nodeType&&!ge.test(m+p.event.triggered)&&(m.indexOf(".")>-1&&(m=(v=m.split(".")).shift(),v.sort()),s=m.indexOf(":")<0&&"on"+m,(t=t[p.expando]?t:new p.Event(m,"object"==typeof t&&t)).isTrigger=o?2:3,t.namespace=v.join("."),t.rnamespace=t.namespace?new RegExp("(^|\\.)"+v.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,t.result=void 0,t.target||(t.target=i),n=null==n?[t]:p.makeArray(n,[t]),f=p.event.special[m]||{},o||!f.trigger||!1!==f.trigger.apply(i,n))){if(!o&&!f.noBubble&&!p.isWindow(i)){for(u=f.delegateType||m,ge.test(u+m)||(l=l.parentNode);l;l=l.parentNode)g.push(l),d=l;d===(i.ownerDocument||r)&&g.push(d.defaultView||d.parentWindow||e)}for(h=0;(l=g[h++])&&!t.isPropagationStopped();)t.type=h>1?u:f.bindType||m,(a=(p._data(l,"events")||{})[t.type]&&p._data(l,"handle"))&&a.apply(l,n),(a=s&&l[s])&&a.apply&&O(l)&&(t.result=a.apply(l,n),!1===t.result&&t.preventDefault());if(t.type=m,!o&&!t.isDefaultPrevented()&&(!f._default||!1===f._default.apply(g.pop(),n))&&O(i)&&s&&i[m]&&!p.isWindow(i)){(d=i[s])&&(i[s]=null),p.event.triggered=m;try{i[m]()}catch(e){}p.event.triggered=void 0,d&&(i[s]=d)}return t.result}},dispatch:function(e){e=p.event.fix(e);var t,n,r,o,a,s,l=i.call(arguments),u=(p._data(this,"events")||{})[e.type]||[],c=p.event.special[e.type]||{};if(l[0]=e,e.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,e)){for(s=p.event.handlers.call(this,e,u),t=0;(o=s[t++])&&!e.isPropagationStopped();)for(e.currentTarget=o.elem,n=0;(a=o.handlers[n++])&&!e.isImmediatePropagationStopped();)e.rnamespace&&!e.rnamespace.test(a.namespace)||(e.handleObj=a,e.data=a.data,void 0!==(r=((p.event.special[a.origType]||{}).handle||a.handler).apply(o.elem,l))&&!1===(e.result=r)&&(e.preventDefault(),e.stopPropagation()));return c.postDispatch&&c.postDispatch.call(this,e),e.result}},handlers:function(e,t){var n,r,i,o,a=[],s=t.delegateCount,l=e.target;if(s&&l.nodeType&&("click"!==e.type||isNaN(e.button)||e.button<1))for(;l!=this;l=l.parentNode||this)if(1===l.nodeType&&(!0!==l.disabled||"click"!==e.type)){for(r=[],n=0;n<s;n++)void 0===r[i=(o=t[n]).selector+" "]&&(r[i]=o.needsContext?p(i,this).index(l)>-1:p.find(i,this,null,[l]).length),r[i]&&r.push(o);r.length&&a.push({elem:l,handlers:r})}return s<t.length&&a.push({elem:this,handlers:t.slice(s)}),a},fix:function(e){if(e[p.expando])return e;var t,n,i,o=e.type,a=e,s=this.fixHooks[o];for(s||(this.fixHooks[o]=s=he.test(o)?this.mouseHooks:pe.test(o)?this.keyHooks:{}),i=s.props?this.props.concat(s.props):this.props,e=new p.Event(a),t=i.length;t--;)e[n=i[t]]=a[n];return e.target||(e.target=a.srcElement||r),3===e.target.nodeType&&(e.target=e.target.parentNode),e.metaKey=!!e.metaKey,s.filter?s.filter(e,a):e},props:"altKey bubbles cancelable ctrlKey currentTarget detail eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(e,t){return null==e.which&&(e.which=null!=t.charCode?t.charCode:t.keyCode),e}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(e,t){var n,i,o,a=t.button,s=t.fromElement;return null==e.pageX&&null!=t.clientX&&(o=(i=e.target.ownerDocument||r).documentElement,n=i.body,e.pageX=t.clientX+(o&&o.scrollLeft||n&&n.scrollLeft||0)-(o&&o.clientLeft||n&&n.clientLeft||0),e.pageY=t.clientY+(o&&o.scrollTop||n&&n.scrollTop||0)-(o&&o.clientTop||n&&n.clientTop||0)),!e.relatedTarget&&s&&(e.relatedTarget=s===e.target?t.toElement:s),e.which||void 0===a||(e.which=1&a?1:2&a?3:4&a?2:0),e}},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==xe()&&this.focus)try{return this.focus(),!1}catch(e){}},delegateType:"focusin"},blur:{trigger:function(){if(this===xe()&&this.blur)return this.blur(),!1},delegateType:"focusout"},click:{trigger:function(){if(p.nodeName(this,"input")&&"checkbox"===this.type&&this.click)return this.click(),!1},_default:function(e){return p.nodeName(e.target,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}},simulate:function(e,t,n){var r=p.extend(new p.Event,n,{type:e,isSimulated:!0});p.event.trigger(r,null,t),r.isDefaultPrevented()&&n.preventDefault()}},p.removeEvent=r.removeEventListener?function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)}:function(e,t,n){var r="on"+t;e.detachEvent&&(void 0===e[r]&&(e[r]=null),e.detachEvent(r,n))},p.Event=function(e,t){if(!(this instanceof p.Event))return new p.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?ve:ye):this.type=e,t&&p.extend(this,t),this.timeStamp=e&&e.timeStamp||p.now(),this[p.expando]=!0},p.Event.prototype={constructor:p.Event,isDefaultPrevented:ye,isPropagationStopped:ye,isImmediatePropagationStopped:ye,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=ve,e&&(e.preventDefault?e.preventDefault():e.returnValue=!1)},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=ve,e&&!this.isSimulated&&(e.stopPropagation&&e.stopPropagation(),e.cancelBubble=!0)},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=ve,e&&e.stopImmediatePropagation&&e.stopImmediatePropagation(),this.stopPropagation()}},p.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,t){p.event.special[e]={delegateType:t,bindType:t,handle:function(e){var n,r=e.relatedTarget,i=e.handleObj;return r&&(r===this||p.contains(this,r))||(e.type=i.origType,n=i.handler.apply(this,arguments),e.type=t),n}}}),f.submit||(p.event.special.submit={setup:function(){if(p.nodeName(this,"form"))return!1;p.event.add(this,"click._submit keypress._submit",function(e){var t=e.target,n=p.nodeName(t,"input")||p.nodeName(t,"button")?p.prop(t,"form"):void 0;n&&!p._data(n,"submit")&&(p.event.add(n,"submit._submit",function(e){e._submitBubble=!0}),p._data(n,"submit",!0))})},postDispatch:function(e){e._submitBubble&&(delete e._submitBubble,this.parentNode&&!e.isTrigger&&p.event.simulate("submit",this.parentNode,e))},teardown:function(){if(p.nodeName(this,"form"))return!1;p.event.remove(this,"._submit")}}),f.change||(p.event.special.change={setup:function(){if(de.test(this.nodeName))return"checkbox"!==this.type&&"radio"!==this.type||(p.event.add(this,"propertychange._change",function(e){"checked"===e.originalEvent.propertyName&&(this._justChanged=!0)}),p.event.add(this,"click._change",function(e){this._justChanged&&!e.isTrigger&&(this._justChanged=!1),p.event.simulate("change",this,e)})),!1;p.event.add(this,"beforeactivate._change",function(e){var t=e.target;de.test(t.nodeName)&&!p._data(t,"change")&&(p.event.add(t,"change._change",function(e){!this.parentNode||e.isSimulated||e.isTrigger||p.event.simulate("change",this.parentNode,e)}),p._data(t,"change",!0))})},handle:function(e){var t=e.target;if(this!==t||e.isSimulated||e.isTrigger||"radio"!==t.type&&"checkbox"!==t.type)return e.handleObj.handler.apply(this,arguments)},teardown:function(){return p.event.remove(this,"._change"),!de.test(this.nodeName)}}),f.focusin||p.each({focus:"focusin",blur:"focusout"},function(e,t){var n=function(e){p.event.simulate(t,e.target,p.event.fix(e))};p.event.special[t]={setup:function(){var r=this.ownerDocument||this,i=p._data(r,t);i||r.addEventListener(e,n,!0),p._data(r,t,(i||0)+1)},teardown:function(){var r=this.ownerDocument||this,i=p._data(r,t)-1;i?p._data(r,t,i):(r.removeEventListener(e,n,!0),p._removeData(r,t))}}}),p.fn.extend({on:function(e,t,n,r){return be(this,e,t,n,r)},one:function(e,t,n,r){return be(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,p(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=ye),this.each(function(){p.event.remove(this,e,n,t)})},trigger:function(e,t){return this.each(function(){p.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return p.event.trigger(e,t,n,!0)}});var we=/ jQuery\d+="(?:null|\d+)"/g,Te=new RegExp("<(?:"+re+")[\\s/>]","i"),Ce=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi,Ee=/<script|<style|<link/i,Ne=/checked\s*(?:[^=]|=\s*.checked.)/i,ke=/^true\/(.*)/,Se=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,Ae=ie(r).appendChild(r.createElement("div"));function De(e,t){return p.nodeName(e,"table")&&p.nodeName(11!==t.nodeType?t:t.firstChild,"tr")?e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody")):e}function je(e){return e.type=(null!==p.find.attr(e,"type"))+"/"+e.type,e}function Le(e){var t=ke.exec(e.type);return t?e.type=t[1]:e.removeAttribute("type"),e}function He(e,t){if(1===t.nodeType&&p.hasData(e)){var n,r,i,o=p._data(e),a=p._data(t,o),s=o.events;if(s)for(n in delete a.handle,a.events={},s)for(r=0,i=s[n].length;r<i;r++)p.event.add(t,n,s[n][r]);a.data&&(a.data=p.extend({},a.data))}}function qe(e,t){var n,r,i;if(1===t.nodeType){if(n=t.nodeName.toLowerCase(),!f.noCloneEvent&&t[p.expando]){for(r in(i=p._data(t)).events)p.removeEvent(t,r,i.handle);t.removeAttribute(p.expando)}"script"===n&&t.text!==e.text?(je(t).text=e.text,Le(t)):"object"===n?(t.parentNode&&(t.outerHTML=e.outerHTML),f.html5Clone&&e.innerHTML&&!p.trim(t.innerHTML)&&(t.innerHTML=e.innerHTML)):"input"===n&&Z.test(e.type)?(t.defaultChecked=t.checked=e.checked,t.value!==e.value&&(t.value=e.value)):"option"===n?t.defaultSelected=t.selected=e.defaultSelected:"input"!==n&&"textarea"!==n||(t.defaultValue=e.defaultValue)}}function _e(e,t,n,r){t=o.apply([],t);var i,a,s,l,u,c,d=0,h=e.length,g=h-1,m=t[0],v=p.isFunction(m);if(v||h>1&&"string"==typeof m&&!f.checkClone&&Ne.test(m))return e.each(function(i){var o=e.eq(i);v&&(t[0]=m.call(this,i,o.html())),_e(o,t,n,r)});if(h&&(i=(c=fe(t,e[0].ownerDocument,!1,e,r)).firstChild,1===c.childNodes.length&&(c=i),i||r)){for(s=(l=p.map(ae(c,"script"),je)).length;d<h;d++)a=c,d!==g&&(a=p.clone(a,!0,!0),s&&p.merge(l,ae(a,"script"))),n.call(e[d],a,d);if(s)for(u=l[l.length-1].ownerDocument,p.map(l,Le),d=0;d<s;d++)a=l[d],te.test(a.type||"")&&!p._data(a,"globalEval")&&p.contains(u,a)&&(a.src?p._evalUrl&&p._evalUrl(a.src):p.globalEval((a.text||a.textContent||a.innerHTML||"").replace(Se,"")));c=i=null}return e}function Fe(e,t,n){for(var r,i=t?p.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||p.cleanData(ae(r)),r.parentNode&&(n&&p.contains(r.ownerDocument,r)&&se(ae(r,"script")),r.parentNode.removeChild(r));return e}p.extend({htmlPrefilter:function(e){return e.replace(Ce,"<$1></$2>")},clone:function(e,t,n){var r,i,o,a,s,l=p.contains(e.ownerDocument,e);if(f.html5Clone||p.isXMLDoc(e)||!Te.test("<"+e.nodeName+">")?o=e.cloneNode(!0):(Ae.innerHTML=e.outerHTML,Ae.removeChild(o=Ae.firstChild)),!(f.noCloneEvent&&f.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||p.isXMLDoc(e)))for(r=ae(o),s=ae(e),a=0;null!=(i=s[a]);++a)r[a]&&qe(i,r[a]);if(t)if(n)for(s=s||ae(e),r=r||ae(o),a=0;null!=(i=s[a]);a++)He(i,r[a]);else He(e,o);return(r=ae(o,"script")).length>0&&se(r,!l&&ae(e,"script")),r=s=i=null,o},cleanData:function(e,t){for(var r,i,o,a,s=0,l=p.expando,u=p.cache,c=f.attributes,d=p.event.special;null!=(r=e[s]);s++)if((t||O(r))&&(a=(o=r[l])&&u[o])){if(a.events)for(i in a.events)d[i]?p.event.remove(r,i):p.removeEvent(r,i,a.handle);u[o]&&(delete u[o],c||void 0===r.removeAttribute?r[l]=void 0:r.removeAttribute(l),n.push(o))}}}),p.fn.extend({domManip:_e,detach:function(e){return Fe(this,e,!0)},remove:function(e){return Fe(this,e)},text:function(e){return K(this,function(e){return void 0===e?p.text(this):this.empty().append((this[0]&&this[0].ownerDocument||r).createTextNode(e))},null,e,arguments.length)},append:function(){return _e(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||De(this,e).appendChild(e)})},prepend:function(){return _e(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=De(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return _e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return _e(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++){for(1===e.nodeType&&p.cleanData(ae(e,!1));e.firstChild;)e.removeChild(e.firstChild);e.options&&p.nodeName(e,"select")&&(e.options.length=0)}return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return p.clone(this,e,t)})},html:function(e){return K(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e)return 1===t.nodeType?t.innerHTML.replace(we,""):void 0;if("string"==typeof e&&!Ee.test(e)&&(f.htmlSerialize||!Te.test(e))&&(f.leadingWhitespace||!ne.test(e))&&!oe[(ee.exec(e)||["",""])[1].toLowerCase()]){e=p.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(p.cleanData(ae(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var e=[];return _e(this,arguments,function(t){var n=this.parentNode;p.inArray(this,e)<0&&(p.cleanData(ae(this)),n&&n.replaceChild(t,this))},e)}}),p.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,t){p.fn[e]=function(e){for(var n,r=0,i=[],o=p(e),s=o.length-1;r<=s;r++)n=r===s?this:this.clone(!0),p(o[r])[t](n),a.apply(i,n.get());return this.pushStack(i)}});var Me,Oe={HTML:"block",BODY:"block"};function Re(e,t){var n=p(t.createElement(e)).appendTo(t.body),r=p.css(n[0],"display");return n.detach(),r}function Pe(e){var t=r,n=Oe[e];return n||("none"!==(n=Re(e,t))&&n||((t=((Me=(Me||p("<iframe frameborder='0' width='0' height='0'/>")).appendTo(t.documentElement))[0].contentWindow||Me[0].contentDocument).document).write(),t.close(),n=Re(e,t),Me.detach()),Oe[e]=n),n}var Be=/^margin/,We=new RegExp("^("+z+")(?!px)[a-z%]+$","i"),Ie=function(e,t,n,r){var i,o,a={};for(o in t)a[o]=e.style[o],e.style[o]=t[o];for(o in i=n.apply(e,r||[]),t)e.style[o]=a[o];return i},$e=r.documentElement;!function(){var t,n,i,o,a,s,l=r.createElement("div"),u=r.createElement("div");function c(){var c,f,d=r.documentElement;d.appendChild(l),u.style.cssText="-webkit-box-sizing:border-box;box-sizing:border-box;position:relative;display:block;margin:auto;border:1px;padding:1px;top:1%;width:50%",t=i=s=!1,n=a=!0,e.getComputedStyle&&(f=e.getComputedStyle(u),t="1%"!==(f||{}).top,s="2px"===(f||{}).marginLeft,i="4px"===(f||{width:"4px"}).width,u.style.marginRight="50%",n="4px"===(f||{marginRight:"4px"}).marginRight,(c=u.appendChild(r.createElement("div"))).style.cssText=u.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:0",c.style.marginRight=c.style.width="0",u.style.width="1px",a=!parseFloat((e.getComputedStyle(c)||{}).marginRight),u.removeChild(c)),u.style.display="none",(o=0===u.getClientRects().length)&&(u.style.display="",u.innerHTML="<table><tr><td></td><td>t</td></tr></table>",u.childNodes[0].style.borderCollapse="separate",(c=u.getElementsByTagName("td"))[0].style.cssText="margin:0;border:0;padding:0;display:none",(o=0===c[0].offsetHeight)&&(c[0].style.display="",c[1].style.display="none",o=0===c[0].offsetHeight)),d.removeChild(l)}u.style&&(u.style.cssText="float:left;opacity:.5",f.opacity="0.5"===u.style.opacity,f.cssFloat=!!u.style.cssFloat,u.style.backgroundClip="content-box",u.cloneNode(!0).style.backgroundClip="",f.clearCloneStyle="content-box"===u.style.backgroundClip,(l=r.createElement("div")).style.cssText="border:0;width:8px;height:0;top:0;left:-9999px;padding:0;margin-top:1px;position:absolute",u.innerHTML="",l.appendChild(u),f.boxSizing=""===u.style.boxSizing||""===u.style.MozBoxSizing||""===u.style.WebkitBoxSizing,p.extend(f,{reliableHiddenOffsets:function(){return null==t&&c(),o},boxSizingReliable:function(){return null==t&&c(),i},pixelMarginRight:function(){return null==t&&c(),n},pixelPosition:function(){return null==t&&c(),t},reliableMarginRight:function(){return null==t&&c(),a},reliableMarginLeft:function(){return null==t&&c(),s}}))}();var ze,Xe,Ue=/^(top|right|bottom|left)$/;function Ve(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}e.getComputedStyle?(ze=function(t){var n=t.ownerDocument.defaultView;return n&&n.opener||(n=e),n.getComputedStyle(t)},Xe=function(e,t,n){var r,i,o,a,s=e.style;return""!==(a=(n=n||ze(e))?n.getPropertyValue(t)||n[t]:void 0)&&void 0!==a||p.contains(e.ownerDocument,e)||(a=p.style(e,t)),n&&!f.pixelMarginRight()&&We.test(a)&&Be.test(t)&&(r=s.width,i=s.minWidth,o=s.maxWidth,s.minWidth=s.maxWidth=s.width=a,a=n.width,s.width=r,s.minWidth=i,s.maxWidth=o),void 0===a?a:a+""}):$e.currentStyle&&(ze=function(e){return e.currentStyle},Xe=function(e,t,n){var r,i,o,a,s=e.style;return null==(a=(n=n||ze(e))?n[t]:void 0)&&s&&s[t]&&(a=s[t]),We.test(a)&&!Ue.test(t)&&(r=s.left,(o=(i=e.runtimeStyle)&&i.left)&&(i.left=e.currentStyle.left),s.left="fontSize"===t?"1em":a,a=s.pixelLeft+"px",s.left=r,o&&(i.left=o)),void 0===a?a:a+""||"auto"});var Ye=/alpha\([^)]*\)/i,Je=/opacity\s*=\s*([^)]*)/i,Ge=/^(none|table(?!-c[ea]).+)/,Qe=new RegExp("^("+z+")(.*)$","i"),Ke={position:"absolute",visibility:"hidden",display:"block"},Ze={letterSpacing:"0",fontWeight:"400"},et=["Webkit","O","Moz","ms"],tt=r.createElement("div").style;function nt(e){if(e in tt)return e;for(var t=e.charAt(0).toUpperCase()+e.slice(1),n=et.length;n--;)if((e=et[n]+t)in tt)return e}function rt(e,t){for(var n,r,i,o=[],a=0,s=e.length;a<s;a++)(r=e[a]).style&&(o[a]=p._data(r,"olddisplay"),n=r.style.display,t?(o[a]||"none"!==n||(r.style.display=""),""===r.style.display&&V(r)&&(o[a]=p._data(r,"olddisplay",Pe(r.nodeName)))):(i=V(r),(n&&"none"!==n||!i)&&p._data(r,"olddisplay",i?n:p.css(r,"display"))));for(a=0;a<s;a++)(r=e[a]).style&&(t&&"none"!==r.style.display&&""!==r.style.display||(r.style.display=t?o[a]||"":"none"));return e}function it(e,t,n){var r=Qe.exec(t);return r?Math.max(0,r[1]-(n||0))+(r[2]||"px"):t}function ot(e,t,n,r,i){for(var o=n===(r?"border":"content")?4:"width"===t?1:0,a=0;o<4;o+=2)"margin"===n&&(a+=p.css(e,n+U[o],!0,i)),r?("content"===n&&(a-=p.css(e,"padding"+U[o],!0,i)),"margin"!==n&&(a-=p.css(e,"border"+U[o]+"Width",!0,i))):(a+=p.css(e,"padding"+U[o],!0,i),"padding"!==n&&(a+=p.css(e,"border"+U[o]+"Width",!0,i)));return a}function at(e,t,n){var r=!0,i="width"===t?e.offsetWidth:e.offsetHeight,o=ze(e),a=f.boxSizing&&"border-box"===p.css(e,"boxSizing",!1,o);if(i<=0||null==i){if(((i=Xe(e,t,o))<0||null==i)&&(i=e.style[t]),We.test(i))return i;r=a&&(f.boxSizingReliable()||i===e.style[t]),i=parseFloat(i)||0}return i+ot(e,t,n||(a?"border":"content"),r,o)+"px"}function st(e,t,n,r,i){return new st.prototype.init(e,t,n,r,i)}p.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Xe(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{float:f.cssFloat?"cssFloat":"styleFloat"},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=p.camelCase(t),l=e.style;if(t=p.cssProps[s]||(p.cssProps[s]=nt(s)||s),a=p.cssHooks[t]||p.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];if("string"===(o=typeof n)&&(i=X.exec(n))&&i[1]&&(n=Y(e,t,i),o="number"),null!=n&&n==n&&("number"===o&&(n+=i&&i[3]||(p.cssNumber[s]?"":"px")),f.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),!(a&&"set"in a&&void 0===(n=a.set(e,n,r)))))try{l[t]=n}catch(e){}}},css:function(e,t,n,r){var i,o,a,s=p.camelCase(t);return t=p.cssProps[s]||(p.cssProps[s]=nt(s)||s),(a=p.cssHooks[t]||p.cssHooks[s])&&"get"in a&&(o=a.get(e,!0,n)),void 0===o&&(o=Xe(e,t,r)),"normal"===o&&t in Ze&&(o=Ze[t]),""===n||n?(i=parseFloat(o),!0===n||isFinite(i)?i||0:o):o}}),p.each(["height","width"],function(e,t){p.cssHooks[t]={get:function(e,n,r){if(n)return Ge.test(p.css(e,"display"))&&0===e.offsetWidth?Ie(e,Ke,function(){return at(e,t,r)}):at(e,t,r)},set:function(e,n,r){var i=r&&ze(e);return it(0,n,r?ot(e,t,r,f.boxSizing&&"border-box"===p.css(e,"boxSizing",!1,i),i):0)}}}),f.opacity||(p.cssHooks.opacity={get:function(e,t){return Je.test((t&&e.currentStyle?e.currentStyle.filter:e.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":t?"1":""},set:function(e,t){var n=e.style,r=e.currentStyle,i=p.isNumeric(t)?"alpha(opacity="+100*t+")":"",o=r&&r.filter||n.filter||"";n.zoom=1,(t>=1||""===t)&&""===p.trim(o.replace(Ye,""))&&n.removeAttribute&&(n.removeAttribute("filter"),""===t||r&&!r.filter)||(n.filter=Ye.test(o)?o.replace(Ye,i):o+" "+i)}}),p.cssHooks.marginRight=Ve(f.reliableMarginRight,function(e,t){if(t)return Ie(e,{display:"inline-block"},Xe,[e,"marginRight"])}),p.cssHooks.marginLeft=Ve(f.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Xe(e,"marginLeft"))||(p.contains(e.ownerDocument,e)?e.getBoundingClientRect().left-Ie(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}):0))+"px"}),p.each({margin:"",padding:"",border:"Width"},function(e,t){p.cssHooks[e+t]={expand:function(n){for(var r=0,i={},o="string"==typeof n?n.split(" "):[n];r<4;r++)i[e+U[r]+t]=o[r]||o[r-2]||o[0];return i}},Be.test(e)||(p.cssHooks[e+t].set=it)}),p.fn.extend({css:function(e,t){return K(this,function(e,t,n){var r,i,o={},a=0;if(p.isArray(t)){for(r=ze(e),i=t.length;a<i;a++)o[t[a]]=p.css(e,t[a],!1,r);return o}return void 0!==n?p.style(e,t,n):p.css(e,t)},e,t,arguments.length>1)},show:function(){return rt(this,!0)},hide:function(){return rt(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){V(this)?p(this).show():p(this).hide()})}}),p.Tween=st,st.prototype={constructor:st,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||p.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(p.cssNumber[n]?"":"px")},cur:function(){var e=st.propHooks[this.prop];return e&&e.get?e.get(this):st.propHooks._default.get(this)},run:function(e){var t,n=st.propHooks[this.prop];return this.options.duration?this.pos=t=p.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):st.propHooks._default.set(this),this}},st.prototype.init.prototype=st.prototype,st.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=p.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){p.fx.step[e.prop]?p.fx.step[e.prop](e):1!==e.elem.nodeType||null==e.elem.style[p.cssProps[e.prop]]&&!p.cssHooks[e.prop]?e.elem[e.prop]=e.now:p.style(e.elem,e.prop,e.now+e.unit)}}},st.propHooks.scrollTop=st.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},p.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},p.fx=st.prototype.init,p.fx.step={};var lt,ut,ct,ft,dt,pt,ht,gt=/^(?:toggle|show|hide)$/,mt=/queueHooks$/;function vt(){return e.setTimeout(function(){lt=void 0}),lt=p.now()}function yt(e,t){var n,r={height:e},i=0;for(t=t?1:0;i<4;i+=2-t)r["margin"+(n=U[i])]=r["padding"+n]=e;return t&&(r.opacity=r.width=e),r}function xt(e,t,n){for(var r,i=(bt.tweeners[t]||[]).concat(bt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function bt(e,t,n){var r,i,o=0,a=bt.prefilters.length,s=p.Deferred().always(function(){delete l.elem}),l=function(){if(i)return!1;for(var t=lt||vt(),n=Math.max(0,u.startTime+u.duration-t),r=1-(n/u.duration||0),o=0,a=u.tweens.length;o<a;o++)u.tweens[o].run(r);return s.notifyWith(e,[u,r,n]),r<1&&a?n:(s.resolveWith(e,[u]),!1)},u=s.promise({elem:e,props:p.extend({},t),opts:p.extend(!0,{specialEasing:{},easing:p.easing._default},n),originalProperties:t,originalOptions:n,startTime:lt||vt(),duration:n.duration,tweens:[],createTween:function(t,n){var r=p.Tween(e,u.opts,t,n,u.opts.specialEasing[t]||u.opts.easing);return u.tweens.push(r),r},stop:function(t){var n=0,r=t?u.tweens.length:0;if(i)return this;for(i=!0;n<r;n++)u.tweens[n].run(1);return t?(s.notifyWith(e,[u,1,0]),s.resolveWith(e,[u,t])):s.rejectWith(e,[u,t]),this}}),c=u.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=p.camelCase(n)],o=e[n],p.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=p.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,u.opts.specialEasing);o<a;o++)if(r=bt.prefilters[o].call(u,e,c,u.opts))return p.isFunction(r.stop)&&(p._queueHooks(u.elem,u.opts.queue).stop=p.proxy(r.stop,r)),r;return p.map(c,xt,u),p.isFunction(u.opts.start)&&u.opts.start.call(e,u),p.fx.timer(p.extend(l,{elem:e,anim:u,queue:u.opts.queue})),u.progress(u.opts.progress).done(u.opts.done,u.opts.complete).fail(u.opts.fail).always(u.opts.always)}p.Animation=p.extend(bt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return Y(n.elem,e,X.exec(t),n),n}]},tweener:function(e,t){p.isFunction(e)?(t=e,e=["*"]):e=e.match(q);for(var n,r=0,i=e.length;r<i;r++)n=e[r],bt.tweeners[n]=bt.tweeners[n]||[],bt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,l,u,c=this,d={},h=e.style,g=e.nodeType&&V(e),m=p._data(e,"fxshow");for(r in n.queue||(null==(s=p._queueHooks(e,"fx")).unqueued&&(s.unqueued=0,l=s.empty.fire,s.empty.fire=function(){s.unqueued||l()}),s.unqueued++,c.always(function(){c.always(function(){s.unqueued--,p.queue(e,"fx").length||s.empty.fire()})})),1===e.nodeType&&("height"in t||"width"in t)&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],"inline"===("none"===(u=p.css(e,"display"))?p._data(e,"olddisplay")||Pe(e.nodeName):u)&&"none"===p.css(e,"float")&&(f.inlineBlockNeedsLayout&&"inline"!==Pe(e.nodeName)?h.zoom=1:h.display="inline-block")),n.overflow&&(h.overflow="hidden",f.shrinkWrapBlocks()||c.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),t)if(i=t[r],gt.exec(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!m||void 0===m[r])continue;g=!0}d[r]=m&&m[r]||p.style(e,r)}else u=void 0;if(p.isEmptyObject(d))"inline"===("none"===u?Pe(e.nodeName):u)&&(h.display=u);else for(r in m?"hidden"in m&&(g=m.hidden):m=p._data(e,"fxshow",{}),o&&(m.hidden=!g),g?p(e).show():c.done(function(){p(e).hide()}),c.done(function(){var t;for(t in p._removeData(e,"fxshow"),d)p.style(e,t,d[t])}),d)a=xt(g?m[r]:0,r,c),r in m||(m[r]=a.start,g&&(a.end=a.start,a.start="width"===r||"height"===r?1:0))}],prefilter:function(e,t){t?bt.prefilters.unshift(e):bt.prefilters.push(e)}}),p.speed=function(e,t,n){var r=e&&"object"==typeof e?p.extend({},e):{complete:n||!n&&t||p.isFunction(e)&&e,duration:e,easing:n&&t||t&&!p.isFunction(t)&&t};return r.duration=p.fx.off?0:"number"==typeof r.duration?r.duration:r.duration in p.fx.speeds?p.fx.speeds[r.duration]:p.fx.speeds._default,null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){p.isFunction(r.old)&&r.old.call(this),r.queue&&p.dequeue(this,r.queue)},r},p.fn.extend({fadeTo:function(e,t,n,r){return this.filter(V).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(e,t,n,r){var i=p.isEmptyObject(e),o=p.speed(t,n,r),a=function(){var t=bt(this,p.extend({},e),o);(i||p._data(this,"finish"))&&t.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(e,t,n){var r=function(e){var t=e.stop;delete e.stop,t(n)};return"string"!=typeof e&&(n=t,t=e,e=void 0),t&&!1!==e&&this.queue(e||"fx",[]),this.each(function(){var t=!0,i=null!=e&&e+"queueHooks",o=p.timers,a=p._data(this);if(i)a[i]&&a[i].stop&&r(a[i]);else for(i in a)a[i]&&a[i].stop&&mt.test(i)&&r(a[i]);for(i=o.length;i--;)o[i].elem!==this||null!=e&&o[i].queue!==e||(o[i].anim.stop(n),t=!1,o.splice(i,1));!t&&n||p.dequeue(this,e)})},finish:function(e){return!1!==e&&(e=e||"fx"),this.each(function(){var t,n=p._data(this),r=n[e+"queue"],i=n[e+"queueHooks"],o=p.timers,a=r?r.length:0;for(n.finish=!0,p.queue(this,e,[]),i&&i.stop&&i.stop.call(this,!0),t=o.length;t--;)o[t].elem===this&&o[t].queue===e&&(o[t].anim.stop(!0),o.splice(t,1));for(t=0;t<a;t++)r[t]&&r[t].finish&&r[t].finish.call(this);delete n.finish})}}),p.each(["toggle","show","hide"],function(e,t){var n=p.fn[t];p.fn[t]=function(e,r,i){return null==e||"boolean"==typeof e?n.apply(this,arguments):this.animate(yt(t,!0),e,r,i)}}),p.each({slideDown:yt("show"),slideUp:yt("hide"),slideToggle:yt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,t){p.fn[e]=function(e,n,r){return this.animate(t,e,n,r)}}),p.timers=[],p.fx.tick=function(){var e,t=p.timers,n=0;for(lt=p.now();n<t.length;n++)(e=t[n])()||t[n]!==e||t.splice(n--,1);t.length||p.fx.stop(),lt=void 0},p.fx.timer=function(e){p.timers.push(e),e()?p.fx.start():p.timers.pop()},p.fx.interval=13,p.fx.start=function(){ut||(ut=e.setInterval(p.fx.tick,p.fx.interval))},p.fx.stop=function(){e.clearInterval(ut),ut=null},p.fx.speeds={slow:600,fast:200,_default:400},p.fn.delay=function(t,n){return t=p.fx&&p.fx.speeds[t]||t,n=n||"fx",this.queue(n,function(n,r){var i=e.setTimeout(n,t);r.stop=function(){e.clearTimeout(i)}})},ft=r.createElement("input"),dt=r.createElement("div"),pt=r.createElement("select"),ht=pt.appendChild(r.createElement("option")),(dt=r.createElement("div")).setAttribute("className","t"),dt.innerHTML="  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",ct=dt.getElementsByTagName("a")[0],ft.setAttribute("type","checkbox"),dt.appendChild(ft),(ct=dt.getElementsByTagName("a")[0]).style.cssText="top:1px",f.getSetAttribute="t"!==dt.className,f.style=/top/.test(ct.getAttribute("style")),f.hrefNormalized="/a"===ct.getAttribute("href"),f.checkOn=!!ft.value,f.optSelected=ht.selected,f.enctype=!!r.createElement("form").enctype,pt.disabled=!0,f.optDisabled=!ht.disabled,(ft=r.createElement("input")).setAttribute("value",""),f.input=""===ft.getAttribute("value"),ft.value="t",ft.setAttribute("type","radio"),f.radioValue="t"===ft.value;var wt=/\r/g,Tt=/[\x20\t\r\n\f]+/g;p.fn.extend({val:function(e){var t,n,r,i=this[0];return arguments.length?(r=p.isFunction(e),this.each(function(n){var i;1===this.nodeType&&(null==(i=r?e.call(this,n,p(this).val()):e)?i="":"number"==typeof i?i+="":p.isArray(i)&&(i=p.map(i,function(e){return null==e?"":e+""})),(t=p.valHooks[this.type]||p.valHooks[this.nodeName.toLowerCase()])&&"set"in t&&void 0!==t.set(this,i,"value")||(this.value=i))})):i?(t=p.valHooks[i.type]||p.valHooks[i.nodeName.toLowerCase()])&&"get"in t&&void 0!==(n=t.get(i,"value"))?n:"string"==typeof(n=i.value)?n.replace(wt,""):null==n?"":n:void 0}}),p.extend({valHooks:{option:{get:function(e){var t=p.find.attr(e,"value");return null!=t?t:p.trim(p.text(e)).replace(Tt," ")}},select:{get:function(e){for(var t,n,r=e.options,i=e.selectedIndex,o="select-one"===e.type||i<0,a=o?null:[],s=o?i+1:r.length,l=i<0?s:o?i:0;l<s;l++)if(((n=r[l]).selected||l===i)&&(f.optDisabled?!n.disabled:null===n.getAttribute("disabled"))&&(!n.parentNode.disabled||!p.nodeName(n.parentNode,"optgroup"))){if(t=p(n).val(),o)return t;a.push(t)}return a},set:function(e,t){for(var n,r,i=e.options,o=p.makeArray(t),a=i.length;a--;)if(r=i[a],p.inArray(p.valHooks.option.get(r),o)>-1)try{r.selected=n=!0}catch(e){r.scrollHeight}else r.selected=!1;return n||(e.selectedIndex=-1),i}}}}),p.each(["radio","checkbox"],function(){p.valHooks[this]={set:function(e,t){if(p.isArray(t))return e.checked=p.inArray(p(e).val(),t)>-1}},f.checkOn||(p.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})});var Ct,Et,Nt=p.expr.attrHandle,kt=/^(?:checked|selected)$/i,St=f.getSetAttribute,At=f.input;p.fn.extend({attr:function(e,t){return K(this,p.attr,e,t,arguments.length>1)},removeAttr:function(e){return this.each(function(){p.removeAttr(this,e)})}}),p.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return void 0===e.getAttribute?p.prop(e,t,n):(1===o&&p.isXMLDoc(e)||(t=t.toLowerCase(),i=p.attrHooks[t]||(p.expr.match.bool.test(t)?Et:Ct)),void 0!==n?null===n?void p.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=p.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!f.radioValue&&"radio"===t&&p.nodeName(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r,i=0,o=t&&t.match(q);if(o&&1===e.nodeType)for(;n=o[i++];)r=p.propFix[n]||n,p.expr.match.bool.test(n)?At&&St||!kt.test(n)?e[r]=!1:e[p.camelCase("default-"+n)]=e[r]=!1:p.attr(e,n,""),e.removeAttribute(St?n:r)}}),Et={set:function(e,t,n){return!1===t?p.removeAttr(e,n):At&&St||!kt.test(n)?e.setAttribute(!St&&p.propFix[n]||n,n):e[p.camelCase("default-"+n)]=e[n]=!0,n}},p.each(p.expr.match.bool.source.match(/\w+/g),function(e,t){var n=Nt[t]||p.find.attr;At&&St||!kt.test(t)?Nt[t]=function(e,t,r){var i,o;return r||(o=Nt[t],Nt[t]=i,i=null!=n(e,t,r)?t.toLowerCase():null,Nt[t]=o),i}:Nt[t]=function(e,t,n){if(!n)return e[p.camelCase("default-"+t)]?t.toLowerCase():null}}),At&&St||(p.attrHooks.value={set:function(e,t,n){if(!p.nodeName(e,"input"))return Ct&&Ct.set(e,t,n);e.defaultValue=t}}),St||(Ct={set:function(e,t,n){var r=e.getAttributeNode(n);if(r||e.setAttributeNode(r=e.ownerDocument.createAttribute(n)),r.value=t+="","value"===n||t===e.getAttribute(n))return t}},Nt.id=Nt.name=Nt.coords=function(e,t,n){var r;if(!n)return(r=e.getAttributeNode(t))&&""!==r.value?r.value:null},p.valHooks.button={get:function(e,t){var n=e.getAttributeNode(t);if(n&&n.specified)return n.value},set:Ct.set},p.attrHooks.contenteditable={set:function(e,t,n){Ct.set(e,""!==t&&t,n)}},p.each(["width","height"],function(e,t){p.attrHooks[t]={set:function(e,n){if(""===n)return e.setAttribute(t,"auto"),n}}})),f.style||(p.attrHooks.style={get:function(e){return e.style.cssText||void 0},set:function(e,t){return e.style.cssText=t+""}});var Dt=/^(?:input|select|textarea|button|object)$/i,jt=/^(?:a|area)$/i;p.fn.extend({prop:function(e,t){return K(this,p.prop,e,t,arguments.length>1)},removeProp:function(e){return e=p.propFix[e]||e,this.each(function(){try{this[e]=void 0,delete this[e]}catch(e){}})}}),p.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&p.isXMLDoc(e)||(t=p.propFix[t]||t,i=p.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=p.find.attr(e,"tabindex");return t?parseInt(t,10):Dt.test(e.nodeName)||jt.test(e.nodeName)&&e.href?0:-1}}},propFix:{for:"htmlFor",class:"className"}}),f.hrefNormalized||p.each(["href","src"],function(e,t){p.propHooks[t]={get:function(e){return e.getAttribute(t,4)}}}),f.optSelected||(p.propHooks.selected={get:function(e){var t=e.parentNode;return t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex),null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),p.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){p.propFix[this.toLowerCase()]=this}),f.enctype||(p.propFix.enctype="encoding");var Lt=/[\t\r\n\f]/g;function Ht(e){return p.attr(e,"class")||""}p.fn.extend({addClass:function(e){var t,n,r,i,o,a,s,l=0;if(p.isFunction(e))return this.each(function(t){p(this).addClass(e.call(this,t,Ht(this)))});if("string"==typeof e&&e)for(t=e.match(q)||[];n=this[l++];)if(i=Ht(n),r=1===n.nodeType&&(" "+i+" ").replace(Lt," ")){for(a=0;o=t[a++];)r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=p.trim(r))&&p.attr(n,"class",s)}return this},removeClass:function(e){var t,n,r,i,o,a,s,l=0;if(p.isFunction(e))return this.each(function(t){p(this).removeClass(e.call(this,t,Ht(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof e&&e)for(t=e.match(q)||[];n=this[l++];)if(i=Ht(n),r=1===n.nodeType&&(" "+i+" ").replace(Lt," ")){for(a=0;o=t[a++];)for(;r.indexOf(" "+o+" ")>-1;)r=r.replace(" "+o+" "," ");i!==(s=p.trim(r))&&p.attr(n,"class",s)}return this},toggleClass:function(e,t){var n=typeof e;return"boolean"==typeof t&&"string"===n?t?this.addClass(e):this.removeClass(e):p.isFunction(e)?this.each(function(n){p(this).toggleClass(e.call(this,n,Ht(this),t),t)}):this.each(function(){var t,r,i,o;if("string"===n)for(r=0,i=p(this),o=e.match(q)||[];t=o[r++];)i.hasClass(t)?i.removeClass(t):i.addClass(t);else void 0!==e&&"boolean"!==n||((t=Ht(this))&&p._data(this,"__className__",t),p.attr(this,"class",t||!1===e?"":p._data(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;for(t=" "+e+" ";n=this[r++];)if(1===n.nodeType&&(" "+Ht(n)+" ").replace(Lt," ").indexOf(t)>-1)return!0;return!1}}),p.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(e,t){p.fn[t]=function(e,n){return arguments.length>0?this.on(t,null,e,n):this.trigger(t)}}),p.fn.extend({hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}});var qt=e.location,_t=p.now(),Ft=/\?/,Mt=/(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;p.parseJSON=function(t){if(e.JSON&&e.JSON.parse)return e.JSON.parse(t+"");var n,r=null,i=p.trim(t+"");return i&&!p.trim(i.replace(Mt,function(e,t,i,o){return n&&t&&(r=0),0===r?e:(n=i||t,r+=!o-!i,"")}))?Function("return "+i)():p.error("Invalid JSON: "+t)},p.parseXML=function(t){var n,r;if(!t||"string"!=typeof t)return null;try{e.DOMParser?(r=new e.DOMParser,n=r.parseFromString(t,"text/xml")):((n=new e.ActiveXObject("Microsoft.XMLDOM")).async="false",n.loadXML(t))}catch(e){n=void 0}return n&&n.documentElement&&!n.getElementsByTagName("parsererror").length||p.error("Invalid XML: "+t),n};var Ot=/#.*$/,Rt=/([?&])_=[^&]*/,Pt=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,Bt=/^(?:GET|HEAD)$/,Wt=/^\/\//,It=/^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,$t={},zt={},Xt="*/".concat("*"),Ut=qt.href,Vt=It.exec(Ut.toLowerCase())||[];function Yt(e){return function(t,n){"string"!=typeof t&&(n=t,t="*");var r,i=0,o=t.toLowerCase().match(q)||[];if(p.isFunction(n))for(;r=o[i++];)"+"===r.charAt(0)?(r=r.slice(1)||"*",(e[r]=e[r]||[]).unshift(n)):(e[r]=e[r]||[]).push(n)}}function Jt(e,t,n,r){var i={},o=e===zt;function a(s){var l;return i[s]=!0,p.each(e[s]||[],function(e,s){var u=s(t,n,r);return"string"!=typeof u||o||i[u]?o?!(l=u):void 0:(t.dataTypes.unshift(u),a(u),!1)}),l}return a(t.dataTypes[0])||!i["*"]&&a("*")}function Gt(e,t){var n,r,i=p.ajaxSettings.flatOptions||{};for(r in t)void 0!==t[r]&&((i[r]?e:n||(n={}))[r]=t[r]);return n&&p.extend(!0,e,n),e}p.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Ut,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Vt[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Xt,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":p.parseJSON,"text xml":p.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?Gt(Gt(e,p.ajaxSettings),t):Gt(p.ajaxSettings,e)},ajaxPrefilter:Yt($t),ajaxTransport:Yt(zt),ajax:function(t,n){"object"==typeof t&&(n=t,t=void 0),n=n||{};var r,i,o,a,s,l,u,c,f=p.ajaxSetup({},n),d=f.context||f,h=f.context&&(d.nodeType||d.jquery)?p(d):p.event,g=p.Deferred(),m=p.Callbacks("once memory"),v=f.statusCode||{},y={},x={},b=0,w="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(2===b){if(!c)for(c={};t=Pt.exec(a);)c[t[1].toLowerCase()]=t[2];t=c[e.toLowerCase()]}return null==t?null:t},getAllResponseHeaders:function(){return 2===b?a:null},setRequestHeader:function(e,t){var n=e.toLowerCase();return b||(e=x[n]=x[n]||e,y[e]=t),this},overrideMimeType:function(e){return b||(f.mimeType=e),this},statusCode:function(e){var t;if(e)if(b<2)for(t in e)v[t]=[v[t],e[t]];else T.always(e[T.status]);return this},abort:function(e){var t=e||w;return u&&u.abort(t),C(0,t),this}};if(g.promise(T).complete=m.add,T.success=T.done,T.error=T.fail,f.url=((t||f.url||Ut)+"").replace(Ot,"").replace(Wt,Vt[1]+"//"),f.type=n.method||n.type||f.method||f.type,f.dataTypes=p.trim(f.dataType||"*").toLowerCase().match(q)||[""],null==f.crossDomain&&(r=It.exec(f.url.toLowerCase()),f.crossDomain=!(!r||r[1]===Vt[1]&&r[2]===Vt[2]&&(r[3]||("http:"===r[1]?"80":"443"))===(Vt[3]||("http:"===Vt[1]?"80":"443")))),f.data&&f.processData&&"string"!=typeof f.data&&(f.data=p.param(f.data,f.traditional)),Jt($t,f,n,T),2===b)return T;for(i in(l=p.event&&f.global)&&0==p.active++&&p.event.trigger("ajaxStart"),f.type=f.type.toUpperCase(),f.hasContent=!Bt.test(f.type),o=f.url,f.hasContent||(f.data&&(o=f.url+=(Ft.test(o)?"&":"?")+f.data,delete f.data),!1===f.cache&&(f.url=Rt.test(o)?o.replace(Rt,"$1_="+_t++):o+(Ft.test(o)?"&":"?")+"_="+_t++)),f.ifModified&&(p.lastModified[o]&&T.setRequestHeader("If-Modified-Since",p.lastModified[o]),p.etag[o]&&T.setRequestHeader("If-None-Match",p.etag[o])),(f.data&&f.hasContent&&!1!==f.contentType||n.contentType)&&T.setRequestHeader("Content-Type",f.contentType),T.setRequestHeader("Accept",f.dataTypes[0]&&f.accepts[f.dataTypes[0]]?f.accepts[f.dataTypes[0]]+("*"!==f.dataTypes[0]?", "+Xt+"; q=0.01":""):f.accepts["*"]),f.headers)T.setRequestHeader(i,f.headers[i]);if(f.beforeSend&&(!1===f.beforeSend.call(d,T,f)||2===b))return T.abort();for(i in w="abort",{success:1,error:1,complete:1})T[i](f[i]);if(u=Jt(zt,f,n,T)){if(T.readyState=1,l&&h.trigger("ajaxSend",[T,f]),2===b)return T;f.async&&f.timeout>0&&(s=e.setTimeout(function(){T.abort("timeout")},f.timeout));try{b=1,u.send(y,C)}catch(e){if(!(b<2))throw e;C(-1,e)}}else C(-1,"No Transport");function C(t,n,r,i){var c,y,x,w,C,E=n;2!==b&&(b=2,s&&e.clearTimeout(s),u=void 0,a=i||"",T.readyState=t>0?4:0,c=t>=200&&t<300||304===t,r&&(w=function(e,t,n){for(var r,i,o,a,s=e.contents,l=e.dataTypes;"*"===l[0];)l.shift(),void 0===i&&(i=e.mimeType||t.getResponseHeader("Content-Type"));if(i)for(a in s)if(s[a]&&s[a].test(i)){l.unshift(a);break}if(l[0]in n)o=l[0];else{for(a in n){if(!l[0]||e.converters[a+" "+l[0]]){o=a;break}r||(r=a)}o=o||r}if(o)return o!==l[0]&&l.unshift(o),n[o]}(f,T,r)),w=function(e,t,n,r){var i,o,a,s,l,u={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)u[a.toLowerCase()]=e.converters[a];for(o=c.shift();o;)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!l&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),l=o,o=c.shift())if("*"===o)o=l;else if("*"!==l&&l!==o){if(!(a=u[l+" "+o]||u["* "+o]))for(i in u)if((s=i.split(" "))[1]===o&&(a=u[l+" "+s[0]]||u["* "+s[0]])){!0===a?a=u[i]:!0!==u[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e.throws)t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+l+" to "+o}}}return{state:"success",data:t}}(f,w,T,c),c?(f.ifModified&&((C=T.getResponseHeader("Last-Modified"))&&(p.lastModified[o]=C),(C=T.getResponseHeader("etag"))&&(p.etag[o]=C)),204===t||"HEAD"===f.type?E="nocontent":304===t?E="notmodified":(E=w.state,y=w.data,c=!(x=w.error))):(x=E,!t&&E||(E="error",t<0&&(t=0))),T.status=t,T.statusText=(n||E)+"",c?g.resolveWith(d,[y,E,T]):g.rejectWith(d,[T,E,x]),T.statusCode(v),v=void 0,l&&h.trigger(c?"ajaxSuccess":"ajaxError",[T,f,c?y:x]),m.fireWith(d,[T,E]),l&&(h.trigger("ajaxComplete",[T,f]),--p.active||p.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return p.get(e,t,n,"json")},getScript:function(e,t){return p.get(e,void 0,t,"script")}}),p.each(["get","post"],function(e,t){p[t]=function(e,n,r,i){return p.isFunction(n)&&(i=i||r,r=n,n=void 0),p.ajax(p.extend({url:e,type:t,dataType:i,data:n,success:r},p.isPlainObject(e)&&e))}}),p._evalUrl=function(e){return p.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,throws:!0})},p.fn.extend({wrapAll:function(e){if(p.isFunction(e))return this.each(function(t){p(this).wrapAll(e.call(this,t))});if(this[0]){var t=p(e,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){for(var e=this;e.firstChild&&1===e.firstChild.nodeType;)e=e.firstChild;return e}).append(this)}return this},wrapInner:function(e){return p.isFunction(e)?this.each(function(t){p(this).wrapInner(e.call(this,t))}):this.each(function(){var t=p(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=p.isFunction(e);return this.each(function(n){p(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(){return this.parent().each(function(){p.nodeName(this,"body")||p(this).replaceWith(this.childNodes)}).end()}}),p.expr.filters.hidden=function(e){return f.reliableHiddenOffsets()?e.offsetWidth<=0&&e.offsetHeight<=0&&!e.getClientRects().length:function(e){if(!p.contains(e.ownerDocument||r,e))return!0;for(;e&&1===e.nodeType;){if("none"===((t=e).style&&t.style.display||p.css(t,"display"))||"hidden"===e.type)return!0;e=e.parentNode}var t;return!1}(e)},p.expr.filters.visible=function(e){return!p.expr.filters.hidden(e)};var Qt=/%20/g,Kt=/\[\]$/,Zt=/\r?\n/g,en=/^(?:submit|button|image|reset|file)$/i,tn=/^(?:input|select|textarea|keygen)/i;function nn(e,t,n,r){var i;if(p.isArray(t))p.each(t,function(t,i){n||Kt.test(e)?r(e,i):nn(e+"["+("object"==typeof i&&null!=i?t:"")+"]",i,n,r)});else if(n||"object"!==p.type(t))r(e,t);else for(i in t)nn(e+"["+i+"]",t[i],n,r)}p.param=function(e,t){var n,r=[],i=function(e,t){t=p.isFunction(t)?t():null==t?"":t,r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(t)};if(void 0===t&&(t=p.ajaxSettings&&p.ajaxSettings.traditional),p.isArray(e)||e.jquery&&!p.isPlainObject(e))p.each(e,function(){i(this.name,this.value)});else for(n in e)nn(n,e[n],t,i);return r.join("&").replace(Qt,"+")},p.fn.extend({serialize:function(){return p.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=p.prop(this,"elements");return e?p.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!p(this).is(":disabled")&&tn.test(this.nodeName)&&!en.test(e)&&(this.checked||!Z.test(e))}).map(function(e,t){var n=p(this).val();return null==n?null:p.isArray(n)?p.map(n,function(e){return{name:t.name,value:e.replace(Zt,"\r\n")}}):{name:t.name,value:n.replace(Zt,"\r\n")}}).get()}}),p.ajaxSettings.xhr=void 0!==e.ActiveXObject?function(){return this.isLocal?ln():r.documentMode>8?sn():/^(get|post|head|put|delete|options)$/i.test(this.type)&&sn()||ln()}:sn;var rn=0,on={},an=p.ajaxSettings.xhr();function sn(){try{return new e.XMLHttpRequest}catch(e){}}function ln(){try{return new e.ActiveXObject("Microsoft.XMLHTTP")}catch(e){}}e.attachEvent&&e.attachEvent("onunload",function(){for(var e in on)on[e](void 0,!0)}),f.cors=!!an&&"withCredentials"in an,(an=f.ajax=!!an)&&p.ajaxTransport(function(t){var n;if(!t.crossDomain||f.cors)return{send:function(r,i){var o,a=t.xhr(),s=++rn;if(a.open(t.type,t.url,t.async,t.username,t.password),t.xhrFields)for(o in t.xhrFields)a[o]=t.xhrFields[o];for(o in t.mimeType&&a.overrideMimeType&&a.overrideMimeType(t.mimeType),t.crossDomain||r["X-Requested-With"]||(r["X-Requested-With"]="XMLHttpRequest"),r)void 0!==r[o]&&a.setRequestHeader(o,r[o]+"");a.send(t.hasContent&&t.data||null),n=function(e,r){var o,l,u;if(n&&(r||4===a.readyState))if(delete on[s],n=void 0,a.onreadystatechange=p.noop,r)4!==a.readyState&&a.abort();else{u={},o=a.status,"string"==typeof a.responseText&&(u.text=a.responseText);try{l=a.statusText}catch(e){l=""}o||!t.isLocal||t.crossDomain?1223===o&&(o=204):o=u.text?200:404}u&&i(o,l,u,a.getAllResponseHeaders())},t.async?4===a.readyState?e.setTimeout(n):a.onreadystatechange=on[s]=n:n()},abort:function(){n&&n(void 0,!0)}}}),p.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return p.globalEval(e),e}}}),p.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET",e.global=!1)}),p.ajaxTransport("script",function(e){if(e.crossDomain){var t,n=r.head||p("head")[0]||r.documentElement;return{send:function(i,o){(t=r.createElement("script")).async=!0,e.scriptCharset&&(t.charset=e.scriptCharset),t.src=e.url,t.onload=t.onreadystatechange=function(e,n){(n||!t.readyState||/loaded|complete/.test(t.readyState))&&(t.onload=t.onreadystatechange=null,t.parentNode&&t.parentNode.removeChild(t),t=null,n||o(200,"success"))},n.insertBefore(t,n.firstChild)},abort:function(){t&&t.onload(void 0,!0)}}}});var un=[],cn=/(=)\?(?=&|$)|\?\?/;p.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=un.pop()||p.expando+"_"+_t++;return this[e]=!0,e}}),p.ajaxPrefilter("json jsonp",function(t,n,r){var i,o,a,s=!1!==t.jsonp&&(cn.test(t.url)?"url":"string"==typeof t.data&&0===(t.contentType||"").indexOf("application/x-www-form-urlencoded")&&cn.test(t.data)&&"data");if(s||"jsonp"===t.dataTypes[0])return i=t.jsonpCallback=p.isFunction(t.jsonpCallback)?t.jsonpCallback():t.jsonpCallback,s?t[s]=t[s].replace(cn,"$1"+i):!1!==t.jsonp&&(t.url+=(Ft.test(t.url)?"&":"?")+t.jsonp+"="+i),t.converters["script json"]=function(){return a||p.error(i+" was not called"),a[0]},t.dataTypes[0]="json",o=e[i],e[i]=function(){a=arguments},r.always(function(){void 0===o?p(e).removeProp(i):e[i]=o,t[i]&&(t.jsonpCallback=n.jsonpCallback,un.push(i)),a&&p.isFunction(o)&&o(a[0]),a=o=void 0}),"script"}),p.parseHTML=function(e,t,n){if(!e||"string"!=typeof e)return null;"boolean"==typeof t&&(n=t,t=!1),t=t||r;var i=C.exec(e),o=!n&&[];return i?[t.createElement(i[1])]:(i=fe([e],t,o),o&&o.length&&p(o).remove(),p.merge([],i.childNodes))};var fn=p.fn.load;function dn(e){return p.isWindow(e)?e:9===e.nodeType&&(e.defaultView||e.parentWindow)}p.fn.load=function(e,t,n){if("string"!=typeof e&&fn)return fn.apply(this,arguments);var r,i,o,a=this,s=e.indexOf(" ");return s>-1&&(r=p.trim(e.slice(s,e.length)),e=e.slice(0,s)),p.isFunction(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),a.length>0&&p.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?p("<div>").append(p.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},p.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){p.fn[t]=function(e){return this.on(t,e)}}),p.expr.filters.animated=function(e){return p.grep(p.timers,function(t){return e===t.elem}).length},p.offset={setOffset:function(e,t,n){var r,i,o,a,s,l,u=p.css(e,"position"),c=p(e),f={};"static"===u&&(e.style.position="relative"),s=c.offset(),o=p.css(e,"top"),l=p.css(e,"left"),("absolute"===u||"fixed"===u)&&p.inArray("auto",[o,l])>-1?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(l)||0),p.isFunction(t)&&(t=t.call(e,n,p.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},p.fn.extend({offset:function(e){if(arguments.length)return void 0===e?this:this.each(function(t){p.offset.setOffset(this,e,t)});var t,n,r={top:0,left:0},i=this[0],o=i&&i.ownerDocument;return o?(t=o.documentElement,p.contains(t,i)?(void 0!==i.getBoundingClientRect&&(r=i.getBoundingClientRect()),n=dn(o),{top:r.top+(n.pageYOffset||t.scrollTop)-(t.clientTop||0),left:r.left+(n.pageXOffset||t.scrollLeft)-(t.clientLeft||0)}):r):void 0},position:function(){if(this[0]){var e,t,n={top:0,left:0},r=this[0];return"fixed"===p.css(r,"position")?t=r.getBoundingClientRect():(e=this.offsetParent(),t=this.offset(),p.nodeName(e[0],"html")||(n=e.offset()),n.top+=p.css(e[0],"borderTopWidth",!0),n.left+=p.css(e[0],"borderLeftWidth",!0)),{top:t.top-n.top-p.css(r,"marginTop",!0),left:t.left-n.left-p.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){for(var e=this.offsetParent;e&&!p.nodeName(e,"html")&&"static"===p.css(e,"position");)e=e.offsetParent;return e||$e})}}),p.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(e,t){var n=/Y/.test(t);p.fn[e]=function(r){return K(this,function(e,r,i){var o=dn(e);if(void 0===i)return o?t in o?o[t]:o.document.documentElement[r]:e[r];o?o.scrollTo(n?p(o).scrollLeft():i,n?i:p(o).scrollTop()):e[r]=i},e,r,arguments.length,null)}}),p.each(["top","left"],function(e,t){p.cssHooks[t]=Ve(f.pixelPosition,function(e,n){if(n)return n=Xe(e,t),We.test(n)?p(e).position()[t]+"px":n})}),p.each({Height:"height",Width:"width"},function(e,t){p.each({padding:"inner"+e,content:t,"":"outer"+e},function(n,r){p.fn[r]=function(r,i){var o=arguments.length&&(n||"boolean"!=typeof r),a=n||(!0===r||!0===i?"margin":"border");return K(this,function(t,n,r){var i;return p.isWindow(t)?t.document.documentElement["client"+e]:9===t.nodeType?(i=t.documentElement,Math.max(t.body["scroll"+e],i["scroll"+e],t.body["offset"+e],i["offset"+e],i["client"+e])):void 0===r?p.css(t,n,a):p.style(t,n,r,a)},t,o?r:void 0,o,null)}})}),p.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)}}),p.fn.size=function(){return this.length},p.fn.andSelf=p.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return p});var pn=e.jQuery,hn=e.$;return p.noConflict=function(t){return e.$===p&&(e.$=hn),t&&e.jQuery===p&&(e.jQuery=pn),p},t||(e.jQuery=e.$=p),p});
\ No newline at end of file
diff --git a/www/include/common/javascript/jquery/jquery.ui.widget.js b/www/include/common/javascript/jquery/jquery.ui.widget.js
index 9da8673a58..a4131b2548 100644
--- a/www/include/common/javascript/jquery/jquery.ui.widget.js
+++ b/www/include/common/javascript/jquery/jquery.ui.widget.js
@@ -1,282 +1,748 @@
-/*
- * jQuery UI Widget 1.8.18+amd
- * https://github.com/blueimp/jQuery-File-Upload
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
-
-(function (factory) {
-    if (typeof define === "function" && define.amd) {
-        // Register as an anonymous AMD module:
-        define(["jquery"], factory);
+/*! jQuery UI - v1.12.1 - 2018-02-10
+ * http://jqueryui.com
+ * Includes: widget.js
+ * Copyright jQuery Foundation and other contributors; Licensed MIT */
+
+(function( factory ) {
+  if ( typeof define === "function" && define.amd ) {
+
+    // AMD. Register as an anonymous module.
+    define([ "jquery" ], factory );
+  } else {
+
+    // Browser globals
+    factory( jQuery );
+  }
+}(function( $ ) {
+
+  $.ui = $.ui || {};
+
+  var version = $.ui.version = "1.12.1";
+
+
+  /*!
+   * jQuery UI Widget 1.12.1
+   * http://jqueryui.com
+   *
+   * Copyright jQuery Foundation and other contributors
+   * Released under the MIT license.
+   * http://jquery.org/license
+   */
+
+  //>>label: Widget
+  //>>group: Core
+  //>>description: Provides a factory for creating stateful widgets with a common API.
+  //>>docs: http://api.jqueryui.com/jQuery.widget/
+  //>>demos: http://jqueryui.com/widget/
+
+
+
+  var widgetUuid = 0;
+  var widgetSlice = Array.prototype.slice;
+
+  $.cleanData = ( function( orig ) {
+    return function( elems ) {
+      var events, elem, i;
+      for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) {
+        try {
+
+          // Only trigger remove when necessary to save time
+          events = $._data( elem, "events" );
+          if ( events && events.remove ) {
+            $( elem ).triggerHandler( "remove" );
+          }
+
+          // Http://bugs.jquery.com/ticket/8235
+        } catch ( e ) {}
+      }
+      orig( elems );
+    };
+  } )( $.cleanData );
+
+  $.widget = function( name, base, prototype ) {
+    var existingConstructor, constructor, basePrototype;
+
+    // ProxiedPrototype allows the provided prototype to remain unmodified
+    // so that it can be used as a mixin for multiple widgets (#8876)
+    var proxiedPrototype = {};
+
+    var namespace = name.split( "." )[ 0 ];
+    name = name.split( "." )[ 1 ];
+    var fullName = namespace + "-" + name;
+
+    if ( !prototype ) {
+      prototype = base;
+      base = $.Widget;
+    }
+
+    if ( $.isArray( prototype ) ) {
+      prototype = $.extend.apply( null, [ {} ].concat( prototype ) );
+    }
+
+    // Create selector for plugin
+    $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
+      return !!$.data( elem, fullName );
+    };
+
+    $[ namespace ] = $[ namespace ] || {};
+    existingConstructor = $[ namespace ][ name ];
+    constructor = $[ namespace ][ name ] = function( options, element ) {
+
+      // Allow instantiation without "new" keyword
+      if ( !this._createWidget ) {
+        return new constructor( options, element );
+      }
+
+      // Allow instantiation without initializing for simple inheritance
+      // must use "new" keyword (the code above always passes args)
+      if ( arguments.length ) {
+        this._createWidget( options, element );
+      }
+    };
+
+    // Extend with the existing constructor to carry over any static properties
+    $.extend( constructor, existingConstructor, {
+      version: prototype.version,
+
+      // Copy the object used to create the prototype in case we need to
+      // redefine the widget later
+      _proto: $.extend( {}, prototype ),
+
+      // Track widgets that inherit from this widget in case this widget is
+      // redefined after a widget inherits from it
+      _childConstructors: []
+    } );
+
+    basePrototype = new base();
+
+    // We need to make the options hash a property directly on the new instance
+    // otherwise we'll modify the options hash on the prototype that we're
+    // inheriting from
+    basePrototype.options = $.widget.extend( {}, basePrototype.options );
+    $.each( prototype, function( prop, value ) {
+      if ( !$.isFunction( value ) ) {
+        proxiedPrototype[ prop ] = value;
+        return;
+      }
+      proxiedPrototype[ prop ] = ( function() {
+        function _super() {
+          return base.prototype[ prop ].apply( this, arguments );
+        }
+
+        function _superApply( args ) {
+          return base.prototype[ prop ].apply( this, args );
+        }
+
+        return function() {
+          var __super = this._super;
+          var __superApply = this._superApply;
+          var returnValue;
+
+          this._super = _super;
+          this._superApply = _superApply;
+
+          returnValue = value.apply( this, arguments );
+
+          this._super = __super;
+          this._superApply = __superApply;
+
+          return returnValue;
+        };
+      } )();
+    } );
+    constructor.prototype = $.widget.extend( basePrototype, {
+
+      // TODO: remove support for widgetEventPrefix
+      // always use the name + a colon as the prefix, e.g., draggable:start
+      // don't prefix for widgets that aren't DOM-based
+      widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name
+    }, proxiedPrototype, {
+      constructor: constructor,
+      namespace: namespace,
+      widgetName: name,
+      widgetFullName: fullName
+    } );
+
+    // If this widget is being redefined then we need to find all widgets that
+    // are inheriting from it and redefine all of them so that they inherit from
+    // the new version of this widget. We're essentially trying to replace one
+    // level in the prototype chain.
+    if ( existingConstructor ) {
+      $.each( existingConstructor._childConstructors, function( i, child ) {
+        var childPrototype = child.prototype;
+
+        // Redefine the child widget using the same prototype that was
+        // originally used, but inherit from the new version of the base
+        $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor,
+          child._proto );
+      } );
+
+      // Remove the list of existing child constructors from the old constructor
+      // so the old child constructors can be garbage collected
+      delete existingConstructor._childConstructors;
     } else {
-        // Browser globals:
-        factory(jQuery);
+      base._childConstructors.push( constructor );
+    }
+
+    $.widget.bridge( name, constructor );
+
+    return constructor;
+  };
+
+  $.widget.extend = function( target ) {
+    var input = widgetSlice.call( arguments, 1 );
+    var inputIndex = 0;
+    var inputLength = input.length;
+    var key;
+    var value;
+
+    for ( ; inputIndex < inputLength; inputIndex++ ) {
+      for ( key in input[ inputIndex ] ) {
+        value = input[ inputIndex ][ key ];
+        if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
+
+          // Clone objects
+          if ( $.isPlainObject( value ) ) {
+            target[ key ] = $.isPlainObject( target[ key ] ) ?
+              $.widget.extend( {}, target[ key ], value ) :
+
+              // Don't extend strings, arrays, etc. with objects
+              $.widget.extend( {}, value );
+
+            // Copy everything else by reference
+          } else {
+            target[ key ] = value;
+          }
+        }
+      }
+    }
+    return target;
+  };
+
+  $.widget.bridge = function( name, object ) {
+    var fullName = object.prototype.widgetFullName || name;
+    $.fn[ name ] = function( options ) {
+      var isMethodCall = typeof options === "string";
+      var args = widgetSlice.call( arguments, 1 );
+      var returnValue = this;
+
+      if ( isMethodCall ) {
+
+        // If this is an empty collection, we need to have the instance method
+        // return undefined instead of the jQuery instance
+        if ( !this.length && options === "instance" ) {
+          returnValue = undefined;
+        } else {
+          this.each( function() {
+            var methodValue;
+            var instance = $.data( this, fullName );
+
+            if ( options === "instance" ) {
+              returnValue = instance;
+              return false;
+            }
+
+            if ( !instance ) {
+              return $.error( "cannot call methods on " + name +
+                " prior to initialization; " +
+                "attempted to call method '" + options + "'" );
+            }
+
+            if ( !$.isFunction( instance[ options ] ) || options.charAt( 0 ) === "_" ) {
+              return $.error( "no such method '" + options + "' for " + name +
+                " widget instance" );
+            }
+
+            methodValue = instance[ options ].apply( instance, args );
+
+            if ( methodValue !== instance && methodValue !== undefined ) {
+              returnValue = methodValue && methodValue.jquery ?
+                returnValue.pushStack( methodValue.get() ) :
+                methodValue;
+              return false;
+            }
+          } );
+        }
+      } else {
+
+        // Allow multiple hashes to be passed on init
+        if ( args.length ) {
+          options = $.widget.extend.apply( null, [ options ].concat( args ) );
+        }
+
+        this.each( function() {
+          var instance = $.data( this, fullName );
+          if ( instance ) {
+            instance.option( options || {} );
+            if ( instance._init ) {
+              instance._init();
+            }
+          } else {
+            $.data( this, fullName, new object( options, this ) );
+          }
+        } );
+      }
+
+      return returnValue;
+    };
+  };
+
+  $.Widget = function( /* options, element */ ) {};
+  $.Widget._childConstructors = [];
+
+  $.Widget.prototype = {
+    widgetName: "widget",
+    widgetEventPrefix: "",
+    defaultElement: "<div>",
+
+    options: {
+      classes: {},
+      disabled: false,
+
+      // Callbacks
+      create: null
+    },
+
+    _createWidget: function( options, element ) {
+      element = $( element || this.defaultElement || this )[ 0 ];
+      this.element = $( element );
+      this.uuid = widgetUuid++;
+      this.eventNamespace = "." + this.widgetName + this.uuid;
+
+      this.bindings = $();
+      this.hoverable = $();
+      this.focusable = $();
+      this.classesElementLookup = {};
+
+      if ( element !== this ) {
+        $.data( element, this.widgetFullName, this );
+        this._on( true, this.element, {
+          remove: function( event ) {
+            if ( event.target === element ) {
+              this.destroy();
+            }
+          }
+        } );
+        this.document = $( element.style ?
+
+          // Element within the document
+          element.ownerDocument :
+
+          // Element is window or document
+          element.document || element );
+        this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow );
+      }
+
+      this.options = $.widget.extend( {},
+        this.options,
+        this._getCreateOptions(),
+        options );
+
+      this._create();
+
+      if ( this.options.disabled ) {
+        this._setOptionDisabled( this.options.disabled );
+      }
+
+      this._trigger( "create", null, this._getCreateEventData() );
+      this._init();
+    },
+
+    _getCreateOptions: function() {
+      return {};
+    },
+
+    _getCreateEventData: $.noop,
+
+    _create: $.noop,
+
+    _init: $.noop,
+
+    destroy: function() {
+      var that = this;
+
+      this._destroy();
+      $.each( this.classesElementLookup, function( key, value ) {
+        that._removeClass( value, key );
+      } );
+
+      // We can probably remove the unbind calls in 2.0
+      // all event bindings should go through this._on()
+      this.element
+        .off( this.eventNamespace )
+        .removeData( this.widgetFullName );
+      this.widget()
+        .off( this.eventNamespace )
+        .removeAttr( "aria-disabled" );
+
+      // Clean up events and states
+      this.bindings.off( this.eventNamespace );
+    },
+
+    _destroy: $.noop,
+
+    widget: function() {
+      return this.element;
+    },
+
+    option: function( key, value ) {
+      var options = key;
+      var parts;
+      var curOption;
+      var i;
+
+      if ( arguments.length === 0 ) {
+
+        // Don't return a reference to the internal hash
+        return $.widget.extend( {}, this.options );
+      }
+
+      if ( typeof key === "string" ) {
+
+        // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
+        options = {};
+        parts = key.split( "." );
+        key = parts.shift();
+        if ( parts.length ) {
+          curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
+          for ( i = 0; i < parts.length - 1; i++ ) {
+            curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
+            curOption = curOption[ parts[ i ] ];
+          }
+          key = parts.pop();
+          if ( arguments.length === 1 ) {
+            return curOption[ key ] === undefined ? null : curOption[ key ];
+          }
+          curOption[ key ] = value;
+        } else {
+          if ( arguments.length === 1 ) {
+            return this.options[ key ] === undefined ? null : this.options[ key ];
+          }
+          options[ key ] = value;
+        }
+      }
+
+      this._setOptions( options );
+
+      return this;
+    },
+
+    _setOptions: function( options ) {
+      var key;
+
+      for ( key in options ) {
+        this._setOption( key, options[ key ] );
+      }
+
+      return this;
+    },
+
+    _setOption: function( key, value ) {
+      if ( key === "classes" ) {
+        this._setOptionClasses( value );
+      }
+
+      this.options[ key ] = value;
+
+      if ( key === "disabled" ) {
+        this._setOptionDisabled( value );
+      }
+
+      return this;
+    },
+
+    _setOptionClasses: function( value ) {
+      var classKey, elements, currentElements;
+
+      for ( classKey in value ) {
+        currentElements = this.classesElementLookup[ classKey ];
+        if ( value[ classKey ] === this.options.classes[ classKey ] ||
+          !currentElements ||
+          !currentElements.length ) {
+          continue;
+        }
+
+        // We are doing this to create a new jQuery object because the _removeClass() call
+        // on the next line is going to destroy the reference to the current elements being
+        // tracked. We need to save a copy of this collection so that we can add the new classes
+        // below.
+        elements = $( currentElements.get() );
+        this._removeClass( currentElements, classKey );
+
+        // We don't use _addClass() here, because that uses this.options.classes
+        // for generating the string of classes. We want to use the value passed in from
+        // _setOption(), this is the new value of the classes option which was passed to
+        // _setOption(). We pass this value directly to _classes().
+        elements.addClass( this._classes( {
+          element: elements,
+          keys: classKey,
+          classes: value,
+          add: true
+        } ) );
+      }
+    },
+
+    _setOptionDisabled: function( value ) {
+      this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value );
+
+      // If the widget is becoming disabled, then nothing is interactive
+      if ( value ) {
+        this._removeClass( this.hoverable, null, "ui-state-hover" );
+        this._removeClass( this.focusable, null, "ui-state-focus" );
+      }
+    },
+
+    enable: function() {
+      return this._setOptions( { disabled: false } );
+    },
+
+    disable: function() {
+      return this._setOptions( { disabled: true } );
+    },
+
+    _classes: function( options ) {
+      var full = [];
+      var that = this;
+
+      options = $.extend( {
+        element: this.element,
+        classes: this.options.classes || {}
+      }, options );
+
+      function processClassString( classes, checkOption ) {
+        var current, i;
+        for ( i = 0; i < classes.length; i++ ) {
+          current = that.classesElementLookup[ classes[ i ] ] || $();
+          if ( options.add ) {
+            current = $( $.unique( current.get().concat( options.element.get() ) ) );
+          } else {
+            current = $( current.not( options.element ).get() );
+          }
+          that.classesElementLookup[ classes[ i ] ] = current;
+          full.push( classes[ i ] );
+          if ( checkOption && options.classes[ classes[ i ] ] ) {
+            full.push( options.classes[ classes[ i ] ] );
+          }
+        }
+      }
+
+      this._on( options.element, {
+        "remove": "_untrackClassesElement"
+      } );
+
+      if ( options.keys ) {
+        processClassString( options.keys.match( /\S+/g ) || [], true );
+      }
+      if ( options.extra ) {
+        processClassString( options.extra.match( /\S+/g ) || [] );
+      }
+
+      return full.join( " " );
+    },
+
+    _untrackClassesElement: function( event ) {
+      var that = this;
+      $.each( that.classesElementLookup, function( key, value ) {
+        if ( $.inArray( event.target, value ) !== -1 ) {
+          that.classesElementLookup[ key ] = $( value.not( event.target ).get() );
+        }
+      } );
+    },
+
+    _removeClass: function( element, keys, extra ) {
+      return this._toggleClass( element, keys, extra, false );
+    },
+
+    _addClass: function( element, keys, extra ) {
+      return this._toggleClass( element, keys, extra, true );
+    },
+
+    _toggleClass: function( element, keys, extra, add ) {
+      add = ( typeof add === "boolean" ) ? add : extra;
+      var shift = ( typeof element === "string" || element === null ),
+        options = {
+          extra: shift ? keys : extra,
+          keys: shift ? element : keys,
+          element: shift ? this.element : element,
+          add: add
+        };
+      options.element.toggleClass( this._classes( options ), add );
+      return this;
+    },
+
+    _on: function( suppressDisabledCheck, element, handlers ) {
+      var delegateElement;
+      var instance = this;
+
+      // No suppressDisabledCheck flag, shuffle arguments
+      if ( typeof suppressDisabledCheck !== "boolean" ) {
+        handlers = element;
+        element = suppressDisabledCheck;
+        suppressDisabledCheck = false;
+      }
+
+      // No element argument, shuffle and use this.element
+      if ( !handlers ) {
+        handlers = element;
+        element = this.element;
+        delegateElement = this.widget();
+      } else {
+        element = delegateElement = $( element );
+        this.bindings = this.bindings.add( element );
+      }
+
+      $.each( handlers, function( event, handler ) {
+        function handlerProxy() {
+
+          // Allow widgets to customize the disabled handling
+          // - disabled as an array instead of boolean
+          // - disabled class as method for disabling individual parts
+          if ( !suppressDisabledCheck &&
+            ( instance.options.disabled === true ||
+              $( this ).hasClass( "ui-state-disabled" ) ) ) {
+            return;
+          }
+          return ( typeof handler === "string" ? instance[ handler ] : handler )
+            .apply( instance, arguments );
+        }
+
+        // Copy the guid so direct unbinding works
+        if ( typeof handler !== "string" ) {
+          handlerProxy.guid = handler.guid =
+            handler.guid || handlerProxy.guid || $.guid++;
+        }
+
+        var match = event.match( /^([\w:-]*)\s*(.*)$/ );
+        var eventName = match[ 1 ] + instance.eventNamespace;
+        var selector = match[ 2 ];
+
+        if ( selector ) {
+          delegateElement.on( eventName, selector, handlerProxy );
+        } else {
+          element.on( eventName, handlerProxy );
+        }
+      } );
+    },
+
+    _off: function( element, eventName ) {
+      eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) +
+        this.eventNamespace;
+      element.off( eventName ).off( eventName );
+
+      // Clear the stack to avoid memory leaks (#10056)
+      this.bindings = $( this.bindings.not( element ).get() );
+      this.focusable = $( this.focusable.not( element ).get() );
+      this.hoverable = $( this.hoverable.not( element ).get() );
+    },
+
+    _delay: function( handler, delay ) {
+      function handlerProxy() {
+        return ( typeof handler === "string" ? instance[ handler ] : handler )
+          .apply( instance, arguments );
+      }
+      var instance = this;
+      return setTimeout( handlerProxy, delay || 0 );
+    },
+
+    _hoverable: function( element ) {
+      this.hoverable = this.hoverable.add( element );
+      this._on( element, {
+        mouseenter: function( event ) {
+          this._addClass( $( event.currentTarget ), null, "ui-state-hover" );
+        },
+        mouseleave: function( event ) {
+          this._removeClass( $( event.currentTarget ), null, "ui-state-hover" );
+        }
+      } );
+    },
+
+    _focusable: function( element ) {
+      this.focusable = this.focusable.add( element );
+      this._on( element, {
+        focusin: function( event ) {
+          this._addClass( $( event.currentTarget ), null, "ui-state-focus" );
+        },
+        focusout: function( event ) {
+          this._removeClass( $( event.currentTarget ), null, "ui-state-focus" );
+        }
+      } );
+    },
+
+    _trigger: function( type, event, data ) {
+      var prop, orig;
+      var callback = this.options[ type ];
+
+      data = data || {};
+      event = $.Event( event );
+      event.type = ( type === this.widgetEventPrefix ?
+        type :
+        this.widgetEventPrefix + type ).toLowerCase();
+
+      // The original event may come from any element
+      // so we need to reset the target on the new event
+      event.target = this.element[ 0 ];
+
+      // Copy original event properties over to the new event
+      orig = event.originalEvent;
+      if ( orig ) {
+        for ( prop in orig ) {
+          if ( !( prop in event ) ) {
+            event[ prop ] = orig[ prop ];
+          }
+        }
+      }
+
+      this.element.trigger( event, data );
+      return !( $.isFunction( callback ) &&
+        callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false ||
+        event.isDefaultPrevented() );
     }
-}(function( $, undefined ) {
-
-// jQuery 1.4+
-if ( $.cleanData ) {
-	var _cleanData = $.cleanData;
-	$.cleanData = function( elems ) {
-		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
-			try {
-				$( elem ).triggerHandler( "remove" );
-			// http://bugs.jquery.com/ticket/8235
-			} catch( e ) {}
-		}
-		_cleanData( elems );
-	};
-} else {
-	var _remove = $.fn.remove;
-	$.fn.remove = function( selector, keepData ) {
-		return this.each(function() {
-			if ( !keepData ) {
-				if ( !selector || $.filter( selector, [ this ] ).length ) {
-					$( "*", this ).add( [ this ] ).each(function() {
-						try {
-							$( this ).triggerHandler( "remove" );
-						// http://bugs.jquery.com/ticket/8235
-						} catch( e ) {}
-					});
-				}
-			}
-			return _remove.call( $(this), selector, keepData );
-		});
-	};
-}
-
-$.widget = function( name, base, prototype ) {
-	var namespace = name.split( "." )[ 0 ],
-		fullName;
-	name = name.split( "." )[ 1 ];
-	fullName = namespace + "-" + name;
-
-	if ( !prototype ) {
-		prototype = base;
-		base = $.Widget;
-	}
-
-	// create selector for plugin
-	$.expr[ ":" ][ fullName ] = function( elem ) {
-		return !!$.data( elem, name );
-	};
-
-	$[ namespace ] = $[ namespace ] || {};
-	$[ namespace ][ name ] = function( options, element ) {
-		// allow instantiation without initializing for simple inheritance
-		if ( arguments.length ) {
-			this._createWidget( options, element );
-		}
-	};
-
-	var basePrototype = new base();
-	// we need to make the options hash a property directly on the new instance
-	// otherwise we'll modify the options hash on the prototype that we're
-	// inheriting from
-//	$.each( basePrototype, function( key, val ) {
-//		if ( $.isPlainObject(val) ) {
-//			basePrototype[ key ] = $.extend( {}, val );
-//		}
-//	});
-	basePrototype.options = $.extend( true, {}, basePrototype.options );
-	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
-		namespace: namespace,
-		widgetName: name,
-		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
-		widgetBaseClass: fullName
-	}, prototype );
-
-	$.widget.bridge( name, $[ namespace ][ name ] );
-};
-
-$.widget.bridge = function( name, object ) {
-	$.fn[ name ] = function( options ) {
-		var isMethodCall = typeof options === "string",
-			args = Array.prototype.slice.call( arguments, 1 ),
-			returnValue = this;
-
-		// allow multiple hashes to be passed on init
-		options = !isMethodCall && args.length ?
-			$.extend.apply( null, [ true, options ].concat(args) ) :
-			options;
-
-		// prevent calls to internal methods
-		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
-			return returnValue;
-		}
-
-		if ( isMethodCall ) {
-			this.each(function() {
-				var instance = $.data( this, name ),
-					methodValue = instance && $.isFunction( instance[options] ) ?
-						instance[ options ].apply( instance, args ) :
-						instance;
-				// TODO: add this back in 1.9 and use $.error() (see #5972)
-//				if ( !instance ) {
-//					throw "cannot call methods on " + name + " prior to initialization; " +
-//						"attempted to call method '" + options + "'";
-//				}
-//				if ( !$.isFunction( instance[options] ) ) {
-//					throw "no such method '" + options + "' for " + name + " widget instance";
-//				}
-//				var methodValue = instance[ options ].apply( instance, args );
-				if ( methodValue !== instance && methodValue !== undefined ) {
-					returnValue = methodValue;
-					return false;
-				}
-			});
-		} else {
-			this.each(function() {
-				var instance = $.data( this, name );
-				if ( instance ) {
-					instance.option( options || {} )._init();
-				} else {
-					$.data( this, name, new object( options, this ) );
-				}
-			});
-		}
-
-		return returnValue;
-	};
-};
-
-$.Widget = function( options, element ) {
-	// allow instantiation without initializing for simple inheritance
-	if ( arguments.length ) {
-		this._createWidget( options, element );
-	}
-};
-
-$.Widget.prototype = {
-	widgetName: "widget",
-	widgetEventPrefix: "",
-	options: {
-		disabled: false
-	},
-	_createWidget: function( options, element ) {
-		// $.widget.bridge stores the plugin instance, but we do it anyway
-		// so that it's stored even before the _create function runs
-		$.data( element, this.widgetName, this );
-		this.element = $( element );
-		this.options = $.extend( true, {},
-			this.options,
-			this._getCreateOptions(),
-			options );
-
-		var self = this;
-		this.element.bind( "remove." + this.widgetName, function() {
-			self.destroy();
-		});
-
-		this._create();
-		this._trigger( "create" );
-		this._init();
-	},
-	_getCreateOptions: function() {
-		return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
-	},
-	_create: function() {},
-	_init: function() {},
-
-	destroy: function() {
-		this.element
-			.unbind( "." + this.widgetName )
-			.removeData( this.widgetName );
-		this.widget()
-			.unbind( "." + this.widgetName )
-			.removeAttr( "aria-disabled" )
-			.removeClass(
-				this.widgetBaseClass + "-disabled " +
-				"ui-state-disabled" );
-	},
-
-	widget: function() {
-		return this.element;
-	},
-
-	option: function( key, value ) {
-		var options = key;
-
-		if ( arguments.length === 0 ) {
-			// don't return a reference to the internal hash
-			return $.extend( {}, this.options );
-		}
-
-		if  (typeof key === "string" ) {
-			if ( value === undefined ) {
-				return this.options[ key ];
-			}
-			options = {};
-			options[ key ] = value;
-		}
-
-		this._setOptions( options );
-
-		return this;
-	},
-	_setOptions: function( options ) {
-		var self = this;
-		$.each( options, function( key, value ) {
-			self._setOption( key, value );
-		});
-
-		return this;
-	},
-	_setOption: function( key, value ) {
-		this.options[ key ] = value;
-
-		if ( key === "disabled" ) {
-			this.widget()
-				[ value ? "addClass" : "removeClass"](
-					this.widgetBaseClass + "-disabled" + " " +
-					"ui-state-disabled" )
-				.attr( "aria-disabled", value );
-		}
-
-		return this;
-	},
-
-	enable: function() {
-		return this._setOption( "disabled", false );
-	},
-	disable: function() {
-		return this._setOption( "disabled", true );
-	},
-
-	_trigger: function( type, event, data ) {
-		var prop, orig,
-			callback = this.options[ type ];
-
-		data = data || {};
-		event = $.Event( event );
-		event.type = ( type === this.widgetEventPrefix ?
-			type :
-			this.widgetEventPrefix + type ).toLowerCase();
-		// the original event may come from any element
-		// so we need to reset the target on the new event
-		event.target = this.element[ 0 ];
-
-		// copy original event properties over to the new event
-		orig = event.originalEvent;
-		if ( orig ) {
-			for ( prop in orig ) {
-				if ( !( prop in event ) ) {
-					event[ prop ] = orig[ prop ];
-				}
-			}
-		}
-
-		this.element.trigger( event, data );
-
-		return !( $.isFunction(callback) &&
-			callback.call( this.element[0], event, data ) === false ||
-			event.isDefaultPrevented() );
-	}
-};
+  };
+
+  $.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
+    $.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
+      if ( typeof options === "string" ) {
+        options = { effect: options };
+      }
+
+      var hasOptions;
+      var effectName = !options ?
+        method :
+        options === true || typeof options === "number" ?
+        defaultEffect :
+        options.effect || defaultEffect;
+
+      options = options || {};
+      if ( typeof options === "number" ) {
+        options = { duration: options };
+      }
+
+      hasOptions = !$.isEmptyObject( options );
+      options.complete = callback;
+
+      if ( options.delay ) {
+        element.delay( options.delay );
+      }
+
+      if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) {
+        element[ method ]( options );
+      } else if ( effectName !== method && element[ effectName ] ) {
+        element[ effectName ]( options.duration, options.easing, callback );
+      } else {
+        element.queue( function( next ) {
+          $( this )[ method ]();
+          if ( callback ) {
+            callback.call( element[ 0 ] );
+          }
+          next();
+        } );
+      }
+    };
+  } );
+
+  var widget = $.widget;
+
+
+
 
 }));
diff --git a/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js b/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js
index b5f6e8382b..b5109a262e 100644
--- a/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js
+++ b/www/include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js
@@ -1,4 +1,6 @@
-// ColorBox v1.3.17.1 - a full featured, light-weight, customizable lightbox based on jQuery 1.3+
-// Copyright (c) 2011 Jack Moore - jack@colorpowered.com
-// Licensed under the MIT license: http://www.opensource.org/licenses/mit-license.php
-(function(a,b,c){function bc(b){if(!T){O=b,_(a.extend(J,a.data(O,e))),x=a(O),P=0,J.rel!=="nofollow"&&(x=a("."+X).filter(function(){var b=a.data(this,e).rel||this.rel;return b===J.rel}),P=x.index(O),P===-1&&(x=x.add(O),P=x.length-1));if(!R){R=S=!0,q.show();if(J.returnFocus)try{O.blur(),a(O).one(k,function(){try{this.focus()}catch(a){}})}catch(c){}p.css({opacity:+J.opacity,cursor:J.overlayClose?"pointer":"auto"}).show(),J.w=Z(J.initialWidth,"x"),J.h=Z(J.initialHeight,"y"),W.position(0),n&&y.bind("resize."+o+" scroll."+o,function(){p.css({width:y.width(),height:y.height(),top:y.scrollTop(),left:y.scrollLeft()})}).trigger("resize."+o),ba(g,J.onOpen),I.add(C).hide(),H.html(J.close).show()}W.load(!0)}}function bb(){var a,b=f+"Slideshow_",c="click."+f,d,e,g;J.slideshow&&x[1]?(d=function(){E.text(J.slideshowStop).unbind(c).bind(i,function(){if(P<x.length-1||J.loop)a=setTimeout(W.next,J.slideshowSpeed)}).bind(h,function(){clearTimeout(a)}).one(c+" "+j,e),q.removeClass(b+"off").addClass(b+"on"),a=setTimeout(W.next,J.slideshowSpeed)},e=function(){clearTimeout(a),E.text(J.slideshowStart).unbind([i,h,j,c].join(" ")).one(c,d),q.removeClass(b+"on").addClass(b+"off")},J.slideshowAuto?d():e()):q.removeClass(b+"off "+b+"on")}function ba(b,c){c&&c.call(O),a.event.trigger(b)}function _(b){for(var c in b)a.isFunction(b[c])&&c.substring(0,2)!=="on"&&(b[c]=b[c].call(O));b.rel=b.rel||O.rel||"nofollow",b.href=b.href||a(O).attr("href"),b.title=b.title||O.title,typeof b.href=="string"&&(b.href=a.trim(b.href))}function $(a){return J.photo||/\.(gif|png|jpg|jpeg|bmp)(?:\?([^#]*))?(?:#(\.*))?$/i.test(a)}function Z(a,b){b=b==="x"?y.width():y.height();return typeof a=="string"?Math.round(/%/.test(a)?b/100*parseInt(a,10):parseInt(a,10)):a}function Y(c,d){var e=b.createElement("div");c&&(e.id=f+c),e.style.cssText=d||"";return a(e)}var d={transition:"elastic",speed:300,width:!1,initialWidth:"600",innerWidth:!1,maxWidth:!1,height:!1,initialHeight:"450",innerHeight:!1,maxHeight:!1,scalePhotos:!0,scrolling:!0,inline:!1,html:!1,iframe:!1,fastIframe:!0,photo:!1,href:!1,title:!1,rel:!1,opacity:.9,preloading:!0,current:"image {current} of {total}",previous:"previous",next:"next",close:"close",open:!1,returnFocus:!0,loop:!0,slideshow:!1,slideshowAuto:!0,slideshowSpeed:2500,slideshowStart:"start slideshow",slideshowStop:"stop slideshow",onOpen:!1,onLoad:!1,onComplete:!1,onCleanup:!1,onClosed:!1,overlayClose:!0,escKey:!0,arrowKey:!0,top:!1,bottom:!1,left:!1,right:!1,fixed:!1,data:!1},e="colorbox",f="cbox",g=f+"_open",h=f+"_load",i=f+"_complete",j=f+"_cleanup",k=f+"_closed",l=f+"_purge",m=a.browser.msie&&!a.support.opacity,n=m&&a.browser.version<7,o=f+"_IE6",p,q,r,s,t,u,v,w,x,y,z,A,B,C,D,E,F,G,H,I,J={},K,L,M,N,O,P,Q,R,S,T,U,V,W,X=f+"Element";W=a.fn[e]=a[e]=function(b,c){var f=this,g;if(!f[0]&&f.selector)return f;b=b||{},c&&(b.onComplete=c);if(!f[0]||f.selector===undefined)f=a("<a/>"),b.open=!0;f.each(function(){a.data(this,e,a.extend({},a.data(this,e)||d,b)),a(this).addClass(X)}),g=b.open,a.isFunction(g)&&(g=g.call(f)),g&&bc(f[0]);return f},W.init=function(){y=a(c),q=Y().attr({id:e,"class":m?f+(n?"IE6":"IE"):""}),p=Y("Overlay",n?"position:absolute":"").hide(),r=Y("Wrapper"),s=Y("Content").append(z=Y("LoadedContent","width:0; height:0; overflow:hidden"),B=Y("LoadingOverlay").add(Y("LoadingGraphic")),C=Y("Title"),D=Y("Current"),F=Y("Next"),G=Y("Previous"),E=Y("Slideshow").bind(g,bb),H=Y("Close")),r.append(Y().append(Y("TopLeft"),t=Y("TopCenter"),Y("TopRight")),Y(!1,"clear:left").append(u=Y("MiddleLeft"),s,v=Y("MiddleRight")),Y(!1,"clear:left").append(Y("BottomLeft"),w=Y("BottomCenter"),Y("BottomRight"))).children().children().css({"float":"left"}),A=Y(!1,"position:absolute; width:9999px; visibility:hidden; display:none"),a("body").prepend(p,q.append(r,A)),s.children().hover(function(){a(this).addClass("hover")},function(){a(this).removeClass("hover")}).addClass("hover"),K=t.height()+w.height()+s.outerHeight(!0)-s.height(),L=u.width()+v.width()+s.outerWidth(!0)-s.width(),M=z.outerHeight(!0),N=z.outerWidth(!0),q.css({"padding-bottom":K,"padding-right":L}).hide(),F.click(function(){W.next()}),G.click(function(){W.prev()}),H.click(function(){W.close()}),I=F.add(G).add(D).add(E),s.children().removeClass("hover"),p.click(function(){J.overlayClose&&W.close()}),a(b).bind("keydown."+f,function(a){var b=a.keyCode;R&&J.escKey&&b===27&&(a.preventDefault(),W.close()),R&&J.arrowKey&&x[1]&&(b===37?(a.preventDefault(),G.click()):b===39&&(a.preventDefault(),F.click()))})},W.remove=function(){q.add(p).remove(),a("."+X).removeData(e).removeClass(X)},W.position=function(a,c){function g(a){t[0].style.width=w[0].style.width=s[0].style.width=a.style.width,B[0].style.height=B[1].style.height=s[0].style.height=u[0].style.height=v[0].style.height=a.style.height}var d,e=0,f=0;q.hide(),J.fixed&&!n?q.css({position:"fixed"}):(e=y.scrollTop(),f=y.scrollLeft(),q.css({position:"absolute"})),J.right!==!1?f+=Math.max(y.width()-J.w-N-L-Z(J.right,"x"),0):J.left!==!1?f+=Z(J.left,"x"):f+=Math.max(y.width()-J.w-N-L,0)/2,J.bottom!==!1?e+=Math.max(b.documentElement.clientHeight-J.h-M-K-Z(J.bottom,"y"),0):J.top!==!1?e+=Z(J.top,"y"):e+=Math.max(b.documentElement.clientHeight-J.h-M-K,0)/2,q.show(),d=q.width()===J.w+N&&q.height()===J.h+M?0:a,r[0].style.width=r[0].style.height="9999px",q.dequeue().animate({width:J.w+N,height:J.h+M,top:e,left:f},{duration:d,complete:function(){g(this),S=!1,r[0].style.width=J.w+N+L+"px",r[0].style.height=J.h+M+K+"px",c&&c()},step:function(){g(this)}})},W.resize=function(a){if(R){a=a||{},a.width&&(J.w=Z(a.width,"x")-N-L),a.innerWidth&&(J.w=Z(a.innerWidth,"x")),z.css({width:J.w}),a.height&&(J.h=Z(a.height,"y")-M-K),a.innerHeight&&(J.h=Z(a.innerHeight,"y"));if(!a.innerHeight&&!a.height){var b=z.wrapInner("<div style='overflow:auto'></div>").children();J.h=b.height(),b.replaceWith(b.children())}z.css({height:J.h}),W.position(J.transition==="none"?0:J.speed)}},W.prep=function(b){function h(b){W.position(b,function(){function o(){m&&q[0].style.removeAttribute("filter")}var b,d,g,h,j=x.length,k,n;!R||(n=function(){clearTimeout(V),B.hide(),ba(i,J.onComplete)},m&&Q&&z.fadeIn(100),C.html(J.title).add(z).show(),j>1?(typeof J.current=="string"&&D.html(J.current.replace(/\{current\}/,P+1).replace(/\{total\}/,j)).show(),F[J.loop||P<j-1?"show":"hide"]().html(J.next),G[J.loop||P?"show":"hide"]().html(J.previous),b=P?x[P-1]:x[j-1],g=P<j-1?x[P+1]:x[0],J.slideshow&&E.show(),J.preloading&&(h=a.data(g,e).href||g.href,d=a.data(b,e).href||b.href,h=a.isFunction(h)?h.call(g):h,d=a.isFunction(d)?d.call(b):d,$(h)&&(a("<img/>")[0].src=h),$(d)&&(a("<img/>")[0].src=d))):I.hide(),J.iframe?(k=a("<iframe/>").addClass(f+"Iframe")[0],J.fastIframe?n():a(k).one("load",n),k.name=f+ +(new Date),k.src=J.href,J.scrolling||(k.scrolling="no"),m&&(k.frameBorder=0,k.allowTransparency="true"),a(k).appendTo(z).one(l,function(){k.src="//about:blank"})):n(),J.transition==="fade"?q.fadeTo(c,1,o):o(),y.bind("resize."+f,function(){W.position(0)}))})}function g(){J.h=J.h||z.height(),J.h=J.mh&&J.mh<J.h?J.mh:J.h;return J.h}function d(){J.w=J.w||z.width(),J.w=J.mw&&J.mw<J.w?J.mw:J.w;return J.w}if(!!R){var c=J.transition==="none"?0:J.speed;y.unbind("resize."+f),z.remove(),z=Y("LoadedContent").html(b),z.hide().appendTo(A.show()).css({width:d(),overflow:J.scrolling?"auto":"hidden"}).css({height:g()}).prependTo(s),A.hide(),a(Q).css({"float":"none"}),n&&a("select").not(q.find("select")).filter(function(){return this.style.visibility!=="hidden"}).css({visibility:"hidden"}).one(j,function(){this.style.visibility="inherit"}),J.transition==="fade"?q.fadeTo(c,0,function(){h(0)}):h(c)}},W.load=function(b){var c,d,g=W.prep;S=!0,Q=!1,O=x[P],b||_(a.extend(J,a.data(O,e))),ba(l),ba(h,J.onLoad),J.h=J.height?Z(J.height,"y")-M-K:J.innerHeight&&Z(J.innerHeight,"y"),J.w=J.width?Z(J.width,"x")-N-L:J.innerWidth&&Z(J.innerWidth,"x"),J.mw=J.w,J.mh=J.h,J.maxWidth&&(J.mw=Z(J.maxWidth,"x")-N-L,J.mw=J.w&&J.w<J.mw?J.w:J.mw),J.maxHeight&&(J.mh=Z(J.maxHeight,"y")-M-K,J.mh=J.h&&J.h<J.mh?J.h:J.mh),c=J.href,V=setTimeout(function(){B.show()},100),J.inline?(Y().hide().insertBefore(a(c)[0]).one(l,function(){a(this).replaceWith(z.children())}),g(a(c))):J.iframe?g(" "):J.html?g(J.html):$(c)?(a(Q=new Image).addClass(f+"Photo").error(function(){J.title=!1,g(Y("Error").text("This image could not be loaded"))}).load(function(){var a;Q.onload=null,J.scalePhotos&&(d=function(){Q.height-=Q.height*a,Q.width-=Q.width*a},J.mw&&Q.width>J.mw&&(a=(Q.width-J.mw)/Q.width,d()),J.mh&&Q.height>J.mh&&(a=(Q.height-J.mh)/Q.height,d())),J.h&&(Q.style.marginTop=Math.max(J.h-Q.height,0)/2+"px"),x[1]&&(P<x.length-1||J.loop)&&(Q.style.cursor="pointer",Q.onclick=function(){W.next()}),m&&(Q.style.msInterpolationMode="bicubic"),setTimeout(function(){g(Q)},1)}),setTimeout(function(){Q.src=c},1)):c&&A.load(c,J.data,function(b,c,d){g(c==="error"?Y("Error").text("Request unsuccessful: "+d.statusText):a(this).contents())})},W.next=function(){!S&&x[1]&&(P<x.length-1||J.loop)&&(P=P<x.length-1?P+1:0,W.load())},W.prev=function(){!S&&x[1]&&(P||J.loop)&&(P=P?P-1:x.length-1,W.load())},W.close=function(){R&&!T&&(T=!0,R=!1,ba(j,J.onCleanup),y.unbind("."+f+" ."+o),p.fadeTo(200,0),q.stop().fadeTo(300,0,function(){q.add(p).css({opacity:1,cursor:"auto"}).hide(),ba(l),z.remove(),setTimeout(function(){T=!1,ba(k,J.onClosed)},1)}))},W.element=function(){return a(O)},W.settings=d,U=function(a){a.button!==0&&typeof a.button!="undefined"||a.ctrlKey||a.shiftKey||a.altKey||(a.preventDefault(),bc(this))},a.fn.delegate?a(b).delegate("."+X,"click",U):a("."+X).live("click",U),a(W.init)})(jQuery,document,this)
\ No newline at end of file
+/*!
+	Colorbox 1.6.4
+	license: MIT
+	http://www.jacklmoore.com/colorbox
+*/
+(function(t,e,i){function n(i,n,o){var r=e.createElement(i);return n&&(r.id=Z+n),o&&(r.style.cssText=o),t(r)}function o(){return i.innerHeight?i.innerHeight:t(i).height()}function r(e,i){i!==Object(i)&&(i={}),this.cache={},this.el=e,this.value=function(e){var n;return void 0===this.cache[e]&&(n=t(this.el).attr("data-cbox-"+e),void 0!==n?this.cache[e]=n:void 0!==i[e]?this.cache[e]=i[e]:void 0!==X[e]&&(this.cache[e]=X[e])),this.cache[e]},this.get=function(e){var i=this.value(e);return t.isFunction(i)?i.call(this.el,this):i}}function h(t){var e=W.length,i=(A+t)%e;return 0>i?e+i:i}function a(t,e){return Math.round((/%/.test(t)?("x"===e?E.width():o())/100:1)*parseInt(t,10))}function s(t,e){return t.get("photo")||t.get("photoRegex").test(e)}function l(t,e){return t.get("retinaUrl")&&i.devicePixelRatio>1?e.replace(t.get("photoRegex"),t.get("retinaSuffix")):e}function d(t){"contains"in x[0]&&!x[0].contains(t.target)&&t.target!==v[0]&&(t.stopPropagation(),x.focus())}function c(t){c.str!==t&&(x.add(v).removeClass(c.str).addClass(t),c.str=t)}function g(e){A=0,e&&e!==!1&&"nofollow"!==e?(W=t("."+te).filter(function(){var i=t.data(this,Y),n=new r(this,i);return n.get("rel")===e}),A=W.index(_.el),-1===A&&(W=W.add(_.el),A=W.length-1)):W=t(_.el)}function u(i){t(e).trigger(i),ae.triggerHandler(i)}function f(i){var o;if(!G){if(o=t(i).data(Y),_=new r(i,o),g(_.get("rel")),!U){U=$=!0,c(_.get("className")),x.css({visibility:"hidden",display:"block",opacity:""}),I=n(se,"LoadedContent","width:0; height:0; overflow:hidden; visibility:hidden"),b.css({width:"",height:""}).append(I),j=T.height()+k.height()+b.outerHeight(!0)-b.height(),D=C.width()+H.width()+b.outerWidth(!0)-b.width(),N=I.outerHeight(!0),z=I.outerWidth(!0);var h=a(_.get("initialWidth"),"x"),s=a(_.get("initialHeight"),"y"),l=_.get("maxWidth"),f=_.get("maxHeight");_.w=Math.max((l!==!1?Math.min(h,a(l,"x")):h)-z-D,0),_.h=Math.max((f!==!1?Math.min(s,a(f,"y")):s)-N-j,0),I.css({width:"",height:_.h}),J.position(),u(ee),_.get("onOpen"),O.add(F).hide(),x.focus(),_.get("trapFocus")&&e.addEventListener&&(e.addEventListener("focus",d,!0),ae.one(re,function(){e.removeEventListener("focus",d,!0)})),_.get("returnFocus")&&ae.one(re,function(){t(_.el).focus()})}var p=parseFloat(_.get("opacity"));v.css({opacity:p===p?p:"",cursor:_.get("overlayClose")?"pointer":"",visibility:"visible"}).show(),_.get("closeButton")?B.html(_.get("close")).appendTo(b):B.appendTo("<div/>"),w()}}function p(){x||(V=!1,E=t(i),x=n(se).attr({id:Y,"class":t.support.opacity===!1?Z+"IE":"",role:"dialog",tabindex:"-1"}).hide(),v=n(se,"Overlay").hide(),L=t([n(se,"LoadingOverlay")[0],n(se,"LoadingGraphic")[0]]),y=n(se,"Wrapper"),b=n(se,"Content").append(F=n(se,"Title"),R=n(se,"Current"),P=t('<button type="button"/>').attr({id:Z+"Previous"}),K=t('<button type="button"/>').attr({id:Z+"Next"}),S=t('<button type="button"/>').attr({id:Z+"Slideshow"}),L),B=t('<button type="button"/>').attr({id:Z+"Close"}),y.append(n(se).append(n(se,"TopLeft"),T=n(se,"TopCenter"),n(se,"TopRight")),n(se,!1,"clear:left").append(C=n(se,"MiddleLeft"),b,H=n(se,"MiddleRight")),n(se,!1,"clear:left").append(n(se,"BottomLeft"),k=n(se,"BottomCenter"),n(se,"BottomRight"))).find("div div").css({"float":"left"}),M=n(se,!1,"position:absolute; width:9999px; visibility:hidden; display:none; max-width:none;"),O=K.add(P).add(R).add(S)),e.body&&!x.parent().length&&t(e.body).append(v,x.append(y,M))}function m(){function i(t){t.which>1||t.shiftKey||t.altKey||t.metaKey||t.ctrlKey||(t.preventDefault(),f(this))}return x?(V||(V=!0,K.click(function(){J.next()}),P.click(function(){J.prev()}),B.click(function(){J.close()}),v.click(function(){_.get("overlayClose")&&J.close()}),t(e).bind("keydown."+Z,function(t){var e=t.keyCode;U&&_.get("escKey")&&27===e&&(t.preventDefault(),J.close()),U&&_.get("arrowKey")&&W[1]&&!t.altKey&&(37===e?(t.preventDefault(),P.click()):39===e&&(t.preventDefault(),K.click()))}),t.isFunction(t.fn.on)?t(e).on("click."+Z,"."+te,i):t("."+te).live("click."+Z,i)),!0):!1}function w(){var e,o,r,h=J.prep,d=++le;if($=!0,q=!1,u(he),u(ie),_.get("onLoad"),_.h=_.get("height")?a(_.get("height"),"y")-N-j:_.get("innerHeight")&&a(_.get("innerHeight"),"y"),_.w=_.get("width")?a(_.get("width"),"x")-z-D:_.get("innerWidth")&&a(_.get("innerWidth"),"x"),_.mw=_.w,_.mh=_.h,_.get("maxWidth")&&(_.mw=a(_.get("maxWidth"),"x")-z-D,_.mw=_.w&&_.w<_.mw?_.w:_.mw),_.get("maxHeight")&&(_.mh=a(_.get("maxHeight"),"y")-N-j,_.mh=_.h&&_.h<_.mh?_.h:_.mh),e=_.get("href"),Q=setTimeout(function(){L.show()},100),_.get("inline")){var c=t(e).eq(0);r=t("<div>").hide().insertBefore(c),ae.one(he,function(){r.replaceWith(c)}),h(c)}else _.get("iframe")?h(" "):_.get("html")?h(_.get("html")):s(_,e)?(e=l(_,e),q=_.get("createImg"),t(q).addClass(Z+"Photo").bind("error."+Z,function(){h(n(se,"Error").html(_.get("imgError")))}).one("load",function(){d===le&&setTimeout(function(){var e;_.get("retinaImage")&&i.devicePixelRatio>1&&(q.height=q.height/i.devicePixelRatio,q.width=q.width/i.devicePixelRatio),_.get("scalePhotos")&&(o=function(){q.height-=q.height*e,q.width-=q.width*e},_.mw&&q.width>_.mw&&(e=(q.width-_.mw)/q.width,o()),_.mh&&q.height>_.mh&&(e=(q.height-_.mh)/q.height,o())),_.h&&(q.style.marginTop=Math.max(_.mh-q.height,0)/2+"px"),W[1]&&(_.get("loop")||W[A+1])&&(q.style.cursor="pointer",t(q).bind("click."+Z,function(){J.next()})),q.style.width=q.width+"px",q.style.height=q.height+"px",h(q)},1)}),q.src=e):e&&M.load(e,_.get("data"),function(e,i){d===le&&h("error"===i?n(se,"Error").html(_.get("xhrError")):t(this).contents())})}var v,x,y,b,T,C,H,k,W,E,I,M,L,F,R,S,K,P,B,O,_,j,D,N,z,A,q,U,$,G,Q,J,V,X={html:!1,photo:!1,iframe:!1,inline:!1,transition:"elastic",speed:300,fadeOut:300,width:!1,initialWidth:"600",innerWidth:!1,maxWidth:!1,height:!1,initialHeight:"450",innerHeight:!1,maxHeight:!1,scalePhotos:!0,scrolling:!0,opacity:.9,preloading:!0,className:!1,overlayClose:!0,escKey:!0,arrowKey:!0,top:!1,bottom:!1,left:!1,right:!1,fixed:!1,data:void 0,closeButton:!0,fastIframe:!0,open:!1,reposition:!0,loop:!0,slideshow:!1,slideshowAuto:!0,slideshowSpeed:2500,slideshowStart:"start slideshow",slideshowStop:"stop slideshow",photoRegex:/\.(gif|png|jp(e|g|eg)|bmp|ico|webp|jxr|svg)((#|\?).*)?$/i,retinaImage:!1,retinaUrl:!1,retinaSuffix:"@2x.$1",current:"image {current} of {total}",previous:"previous",next:"next",close:"close",xhrError:"This content failed to load.",imgError:"This image failed to load.",returnFocus:!0,trapFocus:!0,onOpen:!1,onLoad:!1,onComplete:!1,onCleanup:!1,onClosed:!1,rel:function(){return this.rel},href:function(){return t(this).attr("href")},title:function(){return this.title},createImg:function(){var e=new Image,i=t(this).data("cbox-img-attrs");return"object"==typeof i&&t.each(i,function(t,i){e[t]=i}),e},createIframe:function(){var i=e.createElement("iframe"),n=t(this).data("cbox-iframe-attrs");return"object"==typeof n&&t.each(n,function(t,e){i[t]=e}),"frameBorder"in i&&(i.frameBorder=0),"allowTransparency"in i&&(i.allowTransparency="true"),i.name=(new Date).getTime(),i.allowFullscreen=!0,i}},Y="colorbox",Z="cbox",te=Z+"Element",ee=Z+"_open",ie=Z+"_load",ne=Z+"_complete",oe=Z+"_cleanup",re=Z+"_closed",he=Z+"_purge",ae=t("<a/>"),se="div",le=0,de={},ce=function(){function t(){clearTimeout(h)}function e(){(_.get("loop")||W[A+1])&&(t(),h=setTimeout(J.next,_.get("slideshowSpeed")))}function i(){S.html(_.get("slideshowStop")).unbind(s).one(s,n),ae.bind(ne,e).bind(ie,t),x.removeClass(a+"off").addClass(a+"on")}function n(){t(),ae.unbind(ne,e).unbind(ie,t),S.html(_.get("slideshowStart")).unbind(s).one(s,function(){J.next(),i()}),x.removeClass(a+"on").addClass(a+"off")}function o(){r=!1,S.hide(),t(),ae.unbind(ne,e).unbind(ie,t),x.removeClass(a+"off "+a+"on")}var r,h,a=Z+"Slideshow_",s="click."+Z;return function(){r?_.get("slideshow")||(ae.unbind(oe,o),o()):_.get("slideshow")&&W[1]&&(r=!0,ae.one(oe,o),_.get("slideshowAuto")?i():n(),S.show())}}();t[Y]||(t(p),J=t.fn[Y]=t[Y]=function(e,i){var n,o=this;return e=e||{},t.isFunction(o)&&(o=t("<a/>"),e.open=!0),o[0]?(p(),m()&&(i&&(e.onComplete=i),o.each(function(){var i=t.data(this,Y)||{};t.data(this,Y,t.extend(i,e))}).addClass(te),n=new r(o[0],e),n.get("open")&&f(o[0])),o):o},J.position=function(e,i){function n(){T[0].style.width=k[0].style.width=b[0].style.width=parseInt(x[0].style.width,10)-D+"px",b[0].style.height=C[0].style.height=H[0].style.height=parseInt(x[0].style.height,10)-j+"px"}var r,h,s,l=0,d=0,c=x.offset();if(E.unbind("resize."+Z),x.css({top:-9e4,left:-9e4}),h=E.scrollTop(),s=E.scrollLeft(),_.get("fixed")?(c.top-=h,c.left-=s,x.css({position:"fixed"})):(l=h,d=s,x.css({position:"absolute"})),d+=_.get("right")!==!1?Math.max(E.width()-_.w-z-D-a(_.get("right"),"x"),0):_.get("left")!==!1?a(_.get("left"),"x"):Math.round(Math.max(E.width()-_.w-z-D,0)/2),l+=_.get("bottom")!==!1?Math.max(o()-_.h-N-j-a(_.get("bottom"),"y"),0):_.get("top")!==!1?a(_.get("top"),"y"):Math.round(Math.max(o()-_.h-N-j,0)/2),x.css({top:c.top,left:c.left,visibility:"visible"}),y[0].style.width=y[0].style.height="9999px",r={width:_.w+z+D,height:_.h+N+j,top:l,left:d},e){var g=0;t.each(r,function(t){return r[t]!==de[t]?(g=e,void 0):void 0}),e=g}de=r,e||x.css(r),x.dequeue().animate(r,{duration:e||0,complete:function(){n(),$=!1,y[0].style.width=_.w+z+D+"px",y[0].style.height=_.h+N+j+"px",_.get("reposition")&&setTimeout(function(){E.bind("resize."+Z,J.position)},1),t.isFunction(i)&&i()},step:n})},J.resize=function(t){var e;U&&(t=t||{},t.width&&(_.w=a(t.width,"x")-z-D),t.innerWidth&&(_.w=a(t.innerWidth,"x")),I.css({width:_.w}),t.height&&(_.h=a(t.height,"y")-N-j),t.innerHeight&&(_.h=a(t.innerHeight,"y")),t.innerHeight||t.height||(e=I.scrollTop(),I.css({height:"auto"}),_.h=I.height()),I.css({height:_.h}),e&&I.scrollTop(e),J.position("none"===_.get("transition")?0:_.get("speed")))},J.prep=function(i){function o(){return _.w=_.w||I.width(),_.w=_.mw&&_.mw<_.w?_.mw:_.w,_.w}function a(){return _.h=_.h||I.height(),_.h=_.mh&&_.mh<_.h?_.mh:_.h,_.h}if(U){var d,g="none"===_.get("transition")?0:_.get("speed");I.remove(),I=n(se,"LoadedContent").append(i),I.hide().appendTo(M.show()).css({width:o(),overflow:_.get("scrolling")?"auto":"hidden"}).css({height:a()}).prependTo(b),M.hide(),t(q).css({"float":"none"}),c(_.get("className")),d=function(){function i(){t.support.opacity===!1&&x[0].style.removeAttribute("filter")}var n,o,a=W.length;U&&(o=function(){clearTimeout(Q),L.hide(),u(ne),_.get("onComplete")},F.html(_.get("title")).show(),I.show(),a>1?("string"==typeof _.get("current")&&R.html(_.get("current").replace("{current}",A+1).replace("{total}",a)).show(),K[_.get("loop")||a-1>A?"show":"hide"]().html(_.get("next")),P[_.get("loop")||A?"show":"hide"]().html(_.get("previous")),ce(),_.get("preloading")&&t.each([h(-1),h(1)],function(){var i,n=W[this],o=new r(n,t.data(n,Y)),h=o.get("href");h&&s(o,h)&&(h=l(o,h),i=e.createElement("img"),i.src=h)})):O.hide(),_.get("iframe")?(n=_.get("createIframe"),_.get("scrolling")||(n.scrolling="no"),t(n).attr({src:_.get("href"),"class":Z+"Iframe"}).one("load",o).appendTo(I),ae.one(he,function(){n.src="//about:blank"}),_.get("fastIframe")&&t(n).trigger("load")):o(),"fade"===_.get("transition")?x.fadeTo(g,1,i):i())},"fade"===_.get("transition")?x.fadeTo(g,0,function(){J.position(0,d)}):J.position(g,d)}},J.next=function(){!$&&W[1]&&(_.get("loop")||W[A+1])&&(A=h(1),f(W[A]))},J.prev=function(){!$&&W[1]&&(_.get("loop")||A)&&(A=h(-1),f(W[A]))},J.close=function(){U&&!G&&(G=!0,U=!1,u(oe),_.get("onCleanup"),E.unbind("."+Z),v.fadeTo(_.get("fadeOut")||0,0),x.stop().fadeTo(_.get("fadeOut")||0,0,function(){x.hide(),v.hide(),u(he),I.remove(),setTimeout(function(){G=!1,u(re),_.get("onClosed")},1)}))},J.remove=function(){x&&(x.stop(),t[Y].close(),x.stop(!1,!0).remove(),v.remove(),G=!1,x=null,t("."+te).removeData(Y).removeClass(te),t(e).unbind("click."+Z).unbind("keydown."+Z))},J.element=function(){return t(_.el)},J.settings=X)})(jQuery,document,window);
\ No newline at end of file
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js
new file mode 100644
index 0000000000..a253776198
--- /dev/null
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-audio.js
@@ -0,0 +1,113 @@
+/*
+ * jQuery File Upload Audio Preview Plugin
+ * https://github.com/blueimp/jQuery-File-Upload
+ *
+ * Copyright 2013, Sebastian Tschan
+ * https://blueimp.net
+ *
+ * Licensed under the MIT license:
+ * https://opensource.org/licenses/MIT
+ */
+
+/* jshint nomen:false */
+/* global define, require, window, document */
+
+;(function (factory) {
+    'use strict';
+    if (typeof define === 'function' && define.amd) {
+        // Register as an anonymous AMD module:
+        define([
+            'jquery',
+            'load-image',
+            './jquery.fileupload-process'
+        ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('blueimp-load-image/js/load-image'),
+            require('./jquery.fileupload-process')
+        );
+    } else {
+        // Browser globals:
+        factory(
+            window.jQuery,
+            window.loadImage
+        );
+    }
+}(function ($, loadImage) {
+    'use strict';
+
+    // Prepend to the default processQueue:
+    $.blueimp.fileupload.prototype.options.processQueue.unshift(
+        {
+            action: 'loadAudio',
+            // Use the action as prefix for the "@" options:
+            prefix: true,
+            fileTypes: '@',
+            maxFileSize: '@',
+            disabled: '@disableAudioPreview'
+        },
+        {
+            action: 'setAudio',
+            name: '@audioPreviewName',
+            disabled: '@disableAudioPreview'
+        }
+    );
+
+    // The File Upload Audio Preview plugin extends the fileupload widget
+    // with audio preview functionality:
+    $.widget('blueimp.fileupload', $.blueimp.fileupload, {
+
+        options: {
+            // The regular expression for the types of audio files to load,
+            // matched against the file type:
+            loadAudioFileTypes: /^audio\/.*$/
+        },
+
+        _audioElement: document.createElement('audio'),
+
+        processActions: {
+
+            // Loads the audio file given via data.files and data.index
+            // as audio element if the browser supports playing it.
+            // Accepts the options fileTypes (regular expression)
+            // and maxFileSize (integer) to limit the files to load:
+            loadAudio: function (data, options) {
+                if (options.disabled) {
+                    return data;
+                }
+                var file = data.files[data.index],
+                    url,
+                    audio;
+                if (this._audioElement.canPlayType &&
+                        this._audioElement.canPlayType(file.type) &&
+                        ($.type(options.maxFileSize) !== 'number' ||
+                            file.size <= options.maxFileSize) &&
+                        (!options.fileTypes ||
+                            options.fileTypes.test(file.type))) {
+                    url = loadImage.createObjectURL(file);
+                    if (url) {
+                        audio = this._audioElement.cloneNode(false);
+                        audio.src = url;
+                        audio.controls = true;
+                        data.audio = audio;
+                        return data;
+                    }
+                }
+                return data;
+            },
+
+            // Sets the audio element as a property of the file object:
+            setAudio: function (data, options) {
+                if (data.audio && !options.disabled) {
+                    data.files[data.index][options.name || 'preview'] = data.audio;
+                }
+                return data;
+            }
+
+        }
+
+    });
+
+}));
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js
new file mode 100644
index 0000000000..65fc6d7b8c
--- /dev/null
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-image.js
@@ -0,0 +1,326 @@
+/*
+ * jQuery File Upload Image Preview & Resize Plugin
+ * https://github.com/blueimp/jQuery-File-Upload
+ *
+ * Copyright 2013, Sebastian Tschan
+ * https://blueimp.net
+ *
+ * Licensed under the MIT license:
+ * https://opensource.org/licenses/MIT
+ */
+
+/* jshint nomen:false */
+/* global define, require, window, Blob */
+
+;(function (factory) {
+    'use strict';
+    if (typeof define === 'function' && define.amd) {
+        // Register as an anonymous AMD module:
+        define([
+            'jquery',
+            'load-image',
+            'load-image-meta',
+            'load-image-scale',
+            'load-image-exif',
+            'canvas-to-blob',
+            './jquery.fileupload-process'
+        ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('blueimp-load-image/js/load-image'),
+            require('blueimp-load-image/js/load-image-meta'),
+            require('blueimp-load-image/js/load-image-scale'),
+            require('blueimp-load-image/js/load-image-exif'),
+            require('blueimp-canvas-to-blob'),
+            require('./jquery.fileupload-process')
+        );
+    } else {
+        // Browser globals:
+        factory(
+            window.jQuery,
+            window.loadImage
+        );
+    }
+}(function ($, loadImage) {
+    'use strict';
+
+    // Prepend to the default processQueue:
+    $.blueimp.fileupload.prototype.options.processQueue.unshift(
+        {
+            action: 'loadImageMetaData',
+            disableImageHead: '@',
+            disableExif: '@',
+            disableExifThumbnail: '@',
+            disableExifSub: '@',
+            disableExifGps: '@',
+            disabled: '@disableImageMetaDataLoad'
+        },
+        {
+            action: 'loadImage',
+            // Use the action as prefix for the "@" options:
+            prefix: true,
+            fileTypes: '@',
+            maxFileSize: '@',
+            noRevoke: '@',
+            disabled: '@disableImageLoad'
+        },
+        {
+            action: 'resizeImage',
+            // Use "image" as prefix for the "@" options:
+            prefix: 'image',
+            maxWidth: '@',
+            maxHeight: '@',
+            minWidth: '@',
+            minHeight: '@',
+            crop: '@',
+            orientation: '@',
+            forceResize: '@',
+            disabled: '@disableImageResize'
+        },
+        {
+            action: 'saveImage',
+            quality: '@imageQuality',
+            type: '@imageType',
+            disabled: '@disableImageResize'
+        },
+        {
+            action: 'saveImageMetaData',
+            disabled: '@disableImageMetaDataSave'
+        },
+        {
+            action: 'resizeImage',
+            // Use "preview" as prefix for the "@" options:
+            prefix: 'preview',
+            maxWidth: '@',
+            maxHeight: '@',
+            minWidth: '@',
+            minHeight: '@',
+            crop: '@',
+            orientation: '@',
+            thumbnail: '@',
+            canvas: '@',
+            disabled: '@disableImagePreview'
+        },
+        {
+            action: 'setImage',
+            name: '@imagePreviewName',
+            disabled: '@disableImagePreview'
+        },
+        {
+            action: 'deleteImageReferences',
+            disabled: '@disableImageReferencesDeletion'
+        }
+    );
+
+    // The File Upload Resize plugin extends the fileupload widget
+    // with image resize functionality:
+    $.widget('blueimp.fileupload', $.blueimp.fileupload, {
+
+        options: {
+            // The regular expression for the types of images to load:
+            // matched against the file type:
+            loadImageFileTypes: /^image\/(gif|jpeg|png|svg\+xml)$/,
+            // The maximum file size of images to load:
+            loadImageMaxFileSize: 10000000, // 10MB
+            // The maximum width of resized images:
+            imageMaxWidth: 1920,
+            // The maximum height of resized images:
+            imageMaxHeight: 1080,
+            // Defines the image orientation (1-8) or takes the orientation
+            // value from Exif data if set to true:
+            imageOrientation: false,
+            // Define if resized images should be cropped or only scaled:
+            imageCrop: false,
+            // Disable the resize image functionality by default:
+            disableImageResize: true,
+            // The maximum width of the preview images:
+            previewMaxWidth: 80,
+            // The maximum height of the preview images:
+            previewMaxHeight: 80,
+            // Defines the preview orientation (1-8) or takes the orientation
+            // value from Exif data if set to true:
+            previewOrientation: true,
+            // Create the preview using the Exif data thumbnail:
+            previewThumbnail: true,
+            // Define if preview images should be cropped or only scaled:
+            previewCrop: false,
+            // Define if preview images should be resized as canvas elements:
+            previewCanvas: true
+        },
+
+        processActions: {
+
+            // Loads the image given via data.files and data.index
+            // as img element, if the browser supports the File API.
+            // Accepts the options fileTypes (regular expression)
+            // and maxFileSize (integer) to limit the files to load:
+            loadImage: function (data, options) {
+                if (options.disabled) {
+                    return data;
+                }
+                var that = this,
+                    file = data.files[data.index],
+                    dfd = $.Deferred();
+                if (($.type(options.maxFileSize) === 'number' &&
+                            file.size > options.maxFileSize) ||
+                        (options.fileTypes &&
+                            !options.fileTypes.test(file.type)) ||
+                        !loadImage(
+                            file,
+                            function (img) {
+                                if (img.src) {
+                                    data.img = img;
+                                }
+                                dfd.resolveWith(that, [data]);
+                            },
+                            options
+                        )) {
+                    return data;
+                }
+                return dfd.promise();
+            },
+
+            // Resizes the image given as data.canvas or data.img
+            // and updates data.canvas or data.img with the resized image.
+            // Also stores the resized image as preview property.
+            // Accepts the options maxWidth, maxHeight, minWidth,
+            // minHeight, canvas and crop:
+            resizeImage: function (data, options) {
+                if (options.disabled || !(data.canvas || data.img)) {
+                    return data;
+                }
+                options = $.extend({canvas: true}, options);
+                var that = this,
+                    dfd = $.Deferred(),
+                    img = (options.canvas && data.canvas) || data.img,
+                    resolve = function (newImg) {
+                        if (newImg && (newImg.width !== img.width ||
+                                newImg.height !== img.height ||
+                                options.forceResize)) {
+                            data[newImg.getContext ? 'canvas' : 'img'] = newImg;
+                        }
+                        data.preview = newImg;
+                        dfd.resolveWith(that, [data]);
+                    },
+                    thumbnail;
+                if (data.exif) {
+                    if (options.orientation === true) {
+                        options.orientation = data.exif.get('Orientation');
+                    }
+                    if (options.thumbnail) {
+                        thumbnail = data.exif.get('Thumbnail');
+                        if (thumbnail) {
+                            loadImage(thumbnail, resolve, options);
+                            return dfd.promise();
+                        }
+                    }
+                    // Prevent orienting the same image twice:
+                    if (data.orientation) {
+                        delete options.orientation;
+                    } else {
+                        data.orientation = options.orientation;
+                    }
+                }
+                if (img) {
+                    resolve(loadImage.scale(img, options));
+                    return dfd.promise();
+                }
+                return data;
+            },
+
+            // Saves the processed image given as data.canvas
+            // inplace at data.index of data.files:
+            saveImage: function (data, options) {
+                if (!data.canvas || options.disabled) {
+                    return data;
+                }
+                var that = this,
+                    file = data.files[data.index],
+                    dfd = $.Deferred();
+                if (data.canvas.toBlob) {
+                    data.canvas.toBlob(
+                        function (blob) {
+                            if (!blob.name) {
+                                if (file.type === blob.type) {
+                                    blob.name = file.name;
+                                } else if (file.name) {
+                                    blob.name = file.name.replace(
+                                        /\.\w+$/,
+                                        '.' + blob.type.substr(6)
+                                    );
+                                }
+                            }
+                            // Don't restore invalid meta data:
+                            if (file.type !== blob.type) {
+                                delete data.imageHead;
+                            }
+                            // Store the created blob at the position
+                            // of the original file in the files list:
+                            data.files[data.index] = blob;
+                            dfd.resolveWith(that, [data]);
+                        },
+                        options.type || file.type,
+                        options.quality
+                    );
+                } else {
+                    return data;
+                }
+                return dfd.promise();
+            },
+
+            loadImageMetaData: function (data, options) {
+                if (options.disabled) {
+                    return data;
+                }
+                var that = this,
+                    dfd = $.Deferred();
+                loadImage.parseMetaData(data.files[data.index], function (result) {
+                    $.extend(data, result);
+                    dfd.resolveWith(that, [data]);
+                }, options);
+                return dfd.promise();
+            },
+
+            saveImageMetaData: function (data, options) {
+                if (!(data.imageHead && data.canvas &&
+                        data.canvas.toBlob && !options.disabled)) {
+                    return data;
+                }
+                var file = data.files[data.index],
+                    blob = new Blob([
+                        data.imageHead,
+                        // Resized images always have a head size of 20 bytes,
+                        // including the JPEG marker and a minimal JFIF header:
+                        this._blobSlice.call(file, 20)
+                    ], {type: file.type});
+                blob.name = file.name;
+                data.files[data.index] = blob;
+                return data;
+            },
+
+            // Sets the resized version of the image as a property of the
+            // file object, must be called after "saveImage":
+            setImage: function (data, options) {
+                if (data.preview && !options.disabled) {
+                    data.files[data.index][options.name || 'preview'] = data.preview;
+                }
+                return data;
+            },
+
+            deleteImageReferences: function (data, options) {
+                if (!options.disabled) {
+                    delete data.img;
+                    delete data.canvas;
+                    delete data.preview;
+                    delete data.imageHead;
+                }
+                return data;
+            }
+
+        }
+
+    });
+
+}));
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js
new file mode 100644
index 0000000000..638f0d26b4
--- /dev/null
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js
@@ -0,0 +1,178 @@
+/*
+ * jQuery File Upload Processing Plugin
+ * https://github.com/blueimp/jQuery-File-Upload
+ *
+ * Copyright 2012, Sebastian Tschan
+ * https://blueimp.net
+ *
+ * Licensed under the MIT license:
+ * https://opensource.org/licenses/MIT
+ */
+
+/* jshint nomen:false */
+/* global define, require, window */
+
+;(function (factory) {
+    'use strict';
+    if (typeof define === 'function' && define.amd) {
+        // Register as an anonymous AMD module:
+        define([
+            'jquery',
+            './jquery.fileupload'
+        ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('./jquery.fileupload')
+        );
+    } else {
+        // Browser globals:
+        factory(
+            window.jQuery
+        );
+    }
+}(function ($) {
+    'use strict';
+
+    var originalAdd = $.blueimp.fileupload.prototype.options.add;
+
+    // The File Upload Processing plugin extends the fileupload widget
+    // with file processing functionality:
+    $.widget('blueimp.fileupload', $.blueimp.fileupload, {
+
+        options: {
+            // The list of processing actions:
+            processQueue: [
+                /*
+                {
+                    action: 'log',
+                    type: 'debug'
+                }
+                */
+            ],
+            add: function (e, data) {
+                var $this = $(this);
+                data.process(function () {
+                    return $this.fileupload('process', data);
+                });
+                originalAdd.call(this, e, data);
+            }
+        },
+
+        processActions: {
+            /*
+            log: function (data, options) {
+                console[options.type](
+                    'Processing "' + data.files[data.index].name + '"'
+                );
+            }
+            */
+        },
+
+        _processFile: function (data, originalData) {
+            var that = this,
+                dfd = $.Deferred().resolveWith(that, [data]),
+                chain = dfd.promise();
+            this._trigger('process', null, data);
+            $.each(data.processQueue, function (i, settings) {
+                var func = function (data) {
+                    if (originalData.errorThrown) {
+                        return $.Deferred()
+                                .rejectWith(that, [originalData]).promise();
+                    }
+                    return that.processActions[settings.action].call(
+                        that,
+                        data,
+                        settings
+                    );
+                };
+                chain = chain.then(func, settings.always && func);
+            });
+            chain
+                .done(function () {
+                    that._trigger('processdone', null, data);
+                    that._trigger('processalways', null, data);
+                })
+                .fail(function () {
+                    that._trigger('processfail', null, data);
+                    that._trigger('processalways', null, data);
+                });
+            return chain;
+        },
+
+        // Replaces the settings of each processQueue item that
+        // are strings starting with an "@", using the remaining
+        // substring as key for the option map,
+        // e.g. "@autoUpload" is replaced with options.autoUpload:
+        _transformProcessQueue: function (options) {
+            var processQueue = [];
+            $.each(options.processQueue, function () {
+                var settings = {},
+                    action = this.action,
+                    prefix = this.prefix === true ? action : this.prefix;
+                $.each(this, function (key, value) {
+                    if ($.type(value) === 'string' &&
+                            value.charAt(0) === '@') {
+                        settings[key] = options[
+                            value.slice(1) || (prefix ? prefix +
+                                key.charAt(0).toUpperCase() + key.slice(1) : key)
+                        ];
+                    } else {
+                        settings[key] = value;
+                    }
+
+                });
+                processQueue.push(settings);
+            });
+            options.processQueue = processQueue;
+        },
+
+        // Returns the number of files currently in the processsing queue:
+        processing: function () {
+            return this._processing;
+        },
+
+        // Processes the files given as files property of the data parameter,
+        // returns a Promise object that allows to bind callbacks:
+        process: function (data) {
+            var that = this,
+                options = $.extend({}, this.options, data);
+            if (options.processQueue && options.processQueue.length) {
+                this._transformProcessQueue(options);
+                if (this._processing === 0) {
+                    this._trigger('processstart');
+                }
+                $.each(data.files, function (index) {
+                    var opts = index ? $.extend({}, options) : options,
+                        func = function () {
+                            if (data.errorThrown) {
+                                return $.Deferred()
+                                        .rejectWith(that, [data]).promise();
+                            }
+                            return that._processFile(opts, data);
+                        };
+                    opts.index = index;
+                    that._processing += 1;
+                    that._processingQueue = that._processingQueue.then(func, func)
+                        .always(function () {
+                            that._processing -= 1;
+                            if (that._processing === 0) {
+                                that._trigger('processstop');
+                            }
+                        });
+                });
+            }
+            return this._processingQueue;
+        },
+
+        _create: function () {
+            this._super();
+            this._processing = 0;
+            this._processingQueue = $.Deferred().resolveWith(this)
+                .promise();
+        }
+
+    });
+
+}));
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js
index e330fe16a3..5058084b4d 100644
--- a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js
@@ -1,71 +1,64 @@
 /*
- * jQuery File Upload User Interface Plugin 6.9.1
+ * jQuery File Upload User Interface Plugin
  * https://github.com/blueimp/jQuery-File-Upload
  *
  * Copyright 2010, Sebastian Tschan
  * https://blueimp.net
  *
  * Licensed under the MIT license:
- * http://www.opensource.org/licenses/MIT
+ * https://opensource.org/licenses/MIT
  */
 
-/*jslint nomen: true, unparam: true, regexp: true */
-/*global define, window, document, URL, webkitURL, FileReader */
+/* jshint nomen:false */
+/* global define, require, window */
 
-(function (factory) {
+;(function (factory) {
     'use strict';
     if (typeof define === 'function' && define.amd) {
         // Register as an anonymous AMD module:
         define([
             'jquery',
-            'tmpl',
-            'load-image',
-            './jquery.fileupload-fp'
+            'blueimp-tmpl',
+            './jquery.fileupload-image',
+            './jquery.fileupload-audio',
+            './jquery.fileupload-video',
+            './jquery.fileupload-validate'
         ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('blueimp-tmpl'),
+            require('./jquery.fileupload-image'),
+            require('./jquery.fileupload-audio'),
+            require('./jquery.fileupload-video'),
+            require('./jquery.fileupload-validate')
+        );
     } else {
         // Browser globals:
         factory(
             window.jQuery,
-            window.tmpl,
-            window.loadImage
+            window.tmpl
         );
     }
-}(function ($, tmpl, loadImage) {
+}(function ($, tmpl) {
     'use strict';
 
-    // The UI version extends the FP (file processing) version or the basic
-    // file upload widget and adds complete user interface interaction:
-    var parentWidget = ($.blueimpFP || $.blueimp).fileupload;
-    $.widget('blueimpUI.fileupload', parentWidget, {
+    $.blueimp.fileupload.prototype._specialOptions.push(
+        'filesContainer',
+        'uploadTemplateId',
+        'downloadTemplateId'
+    );
+
+    // The UI version extends the file upload widget
+    // and adds complete user interface interaction:
+    $.widget('blueimp.fileupload', $.blueimp.fileupload, {
 
         options: {
             // By default, files added to the widget are uploaded as soon
             // as the user clicks on the start buttons. To enable automatic
             // uploads, set the following option to true:
             autoUpload: false,
-            // The following option limits the number of files that are
-            // allowed to be uploaded using this widget:
-            maxNumberOfFiles: undefined,
-            // The maximum allowed file size:
-            maxFileSize: undefined,
-            // The minimum allowed file size:
-            minFileSize: undefined,
-            // The regular expression for allowed file types, matches
-            // against either file type or file name:
-            acceptFileTypes:  /.+$/i,
-            // The regular expression to define for which files a preview
-            // image is shown, matched against the file type:
-            previewSourceFileTypes: /^image\/(gif|jpeg|png)$/,
-            // The maximum file size of images that are to be displayed as preview:
-            previewSourceMaxFileSize: 5000000, // 5MB
-            // The maximum width of the preview images:
-            previewMaxWidth: 80,
-            // The maximum height of the preview images:
-            previewMaxHeight: 80,
-            // By default, preview images are displayed as canvas elements
-            // if supported by the browser. Set the following option to false
-            // to always display preview images as img elements:
-            previewAsCanvas: true,
             // The ID of the upload template:
             uploadTemplateId: 'template-upload',
             // The ID of the download template:
@@ -80,45 +73,79 @@
             // option of the $.ajax upload requests:
             dataType: 'json',
 
+            // Error and info messages:
+            messages: {
+                unknownError: 'Unknown error'
+            },
+
+            // Function returning the current number of files,
+            // used by the maxNumberOfFiles validation:
+            getNumberOfFiles: function () {
+                return this.filesContainer.children()
+                    .not('.processing').length;
+            },
+
+            // Callback to retrieve the list of files from the server response:
+            getFilesFromResponse: function (data) {
+                if (data.result && $.isArray(data.result.files)) {
+                    return data.result.files;
+                }
+                return [];
+            },
+
             // The add callback is invoked as soon as files are added to the fileupload
             // widget (via file input selection, drag & drop or add API call).
             // See the basic file upload widget for more information:
             add: function (e, data) {
-                var that = $(this).data('fileupload'),
-                    options = that.options,
-                    files = data.files;
-                $(this).fileupload('process', data).done(function () {
-                    that._adjustMaxNumberOfFiles(-files.length);
-                    data.isAdjusted = true;
-                    data.files.valid = data.isValidated = that._validate(files);
-                    data.context = that._renderUpload(files).data('data', data);
-                    options.filesContainer[
-                        options.prependFiles ? 'prepend' : 'append'
-                    ](data.context);
-                    that._renderPreviews(files, data.context);
-                    that._forceReflow(data.context);
-                    that._transition(data.context).done(
-                        function () {
-                            if ((that._trigger('added', e, data) !== false) &&
-                                    (options.autoUpload || data.autoUpload) &&
-                                    data.autoUpload !== false && data.isValidated) {
-                                data.submit();
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var $this = $(this),
+                    that = $this.data('blueimp-fileupload') ||
+                        $this.data('fileupload'),
+                    options = that.options;
+                data.context = that._renderUpload(data.files)
+                    .data('data', data)
+                    .addClass('processing');
+                options.filesContainer[
+                    options.prependFiles ? 'prepend' : 'append'
+                ](data.context);
+                that._forceReflow(data.context);
+                that._transition(data.context);
+                data.process(function () {
+                    return $this.fileupload('process', data);
+                }).always(function () {
+                    data.context.each(function (index) {
+                        $(this).find('.size').text(
+                            that._formatFileSize(data.files[index].size)
+                        );
+                    }).removeClass('processing');
+                    that._renderPreviews(data);
+                }).done(function () {
+                    data.context.find('.start').prop('disabled', false);
+                    if ((that._trigger('added', e, data) !== false) &&
+                            (options.autoUpload || data.autoUpload) &&
+                            data.autoUpload !== false) {
+                        data.submit();
+                    }
+                }).fail(function () {
+                    if (data.files.error) {
+                        data.context.each(function (index) {
+                            var error = data.files[index].error;
+                            if (error) {
+                                $(this).find('.error').text(error);
                             }
-                        }
-                    );
+                        });
+                    }
                 });
             },
             // Callback for the start of each file upload request:
             send: function (e, data) {
-                var that = $(this).data('fileupload');
-                if (!data.isValidated) {
-                    if (!data.isAdjusted) {
-                        that._adjustMaxNumberOfFiles(-data.files.length);
-                    }
-                    if (!that._validate(data.files)) {
-                        return false;
-                    }
+                if (e.isDefaultPrevented()) {
+                    return false;
                 }
+                var that = $(this).data('blueimp-fileupload') ||
+                        $(this).data('fileupload');
                 if (data.context && data.dataType &&
                         data.dataType.substr(0, 6) === 'iframe') {
                     // Iframe Transport does not support progress events.
@@ -129,7 +156,7 @@
                             !$.support.transition && 'progress-animated'
                         )
                         .attr('aria-valuenow', 100)
-                        .find('.bar').css(
+                        .children().first().css(
                             'width',
                             '100%'
                         );
@@ -138,54 +165,70 @@
             },
             // Callback for successful uploads:
             done: function (e, data) {
-                var that = $(this).data('fileupload'),
-                    template;
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var that = $(this).data('blueimp-fileupload') ||
+                        $(this).data('fileupload'),
+                    getFilesFromResponse = data.getFilesFromResponse ||
+                        that.options.getFilesFromResponse,
+                    files = getFilesFromResponse(data),
+                    template,
+                    deferred;
                 if (data.context) {
                     data.context.each(function (index) {
-                        var file = ($.isArray(data.result) &&
-                                data.result[index]) || {error: 'emptyResult'};
-                        if (file.error) {
-                            that._adjustMaxNumberOfFiles(1);
-                        }
+                        var file = files[index] ||
+                                {error: 'Empty file upload result'};
+                        deferred = that._addFinishedDeferreds();
                         that._transition($(this)).done(
                             function () {
                                 var node = $(this);
                                 template = that._renderDownload([file])
-                                    .css('height', node.height())
                                     .replaceAll(node);
                                 that._forceReflow(template);
                                 that._transition(template).done(
                                     function () {
                                         data.context = $(this);
                                         that._trigger('completed', e, data);
+                                        that._trigger('finished', e, data);
+                                        deferred.resolve();
                                     }
                                 );
                             }
                         );
                     });
                 } else {
-                    template = that._renderDownload(data.result)
-                        .appendTo(that.options.filesContainer);
+                    template = that._renderDownload(files)[
+                        that.options.prependFiles ? 'prependTo' : 'appendTo'
+                    ](that.options.filesContainer);
                     that._forceReflow(template);
+                    deferred = that._addFinishedDeferreds();
                     that._transition(template).done(
                         function () {
                             data.context = $(this);
                             that._trigger('completed', e, data);
+                            that._trigger('finished', e, data);
+                            deferred.resolve();
                         }
                     );
                 }
             },
             // Callback for failed (abort or error) uploads:
             fail: function (e, data) {
-                var that = $(this).data('fileupload'),
-                    template;
-                that._adjustMaxNumberOfFiles(data.files.length);
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var that = $(this).data('blueimp-fileupload') ||
+                        $(this).data('fileupload'),
+                    template,
+                    deferred;
                 if (data.context) {
                     data.context.each(function (index) {
                         if (data.errorThrown !== 'abort') {
                             var file = data.files[index];
                             file.error = file.error || data.errorThrown ||
-                                true;
+                                data.i18n('unknownError');
+                            deferred = that._addFinishedDeferreds();
                             that._transition($(this)).done(
                                 function () {
                                     var node = $(this);
@@ -196,70 +239,94 @@
                                         function () {
                                             data.context = $(this);
                                             that._trigger('failed', e, data);
+                                            that._trigger('finished', e, data);
+                                            deferred.resolve();
                                         }
                                     );
                                 }
                             );
                         } else {
+                            deferred = that._addFinishedDeferreds();
                             that._transition($(this)).done(
                                 function () {
                                     $(this).remove();
                                     that._trigger('failed', e, data);
+                                    that._trigger('finished', e, data);
+                                    deferred.resolve();
                                 }
                             );
                         }
                     });
                 } else if (data.errorThrown !== 'abort') {
-                    that._adjustMaxNumberOfFiles(-data.files.length);
-                    data.context = that._renderUpload(data.files)
-                        .appendTo(that.options.filesContainer)
+                    data.context = that._renderUpload(data.files)[
+                        that.options.prependFiles ? 'prependTo' : 'appendTo'
+                    ](that.options.filesContainer)
                         .data('data', data);
                     that._forceReflow(data.context);
+                    deferred = that._addFinishedDeferreds();
                     that._transition(data.context).done(
                         function () {
                             data.context = $(this);
                             that._trigger('failed', e, data);
+                            that._trigger('finished', e, data);
+                            deferred.resolve();
                         }
                     );
                 } else {
                     that._trigger('failed', e, data);
+                    that._trigger('finished', e, data);
+                    that._addFinishedDeferreds().resolve();
                 }
             },
             // Callback for upload progress events:
             progress: function (e, data) {
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var progress = Math.floor(data.loaded / data.total * 100);
                 if (data.context) {
-                    var progress = parseInt(data.loaded / data.total * 100, 10);
-                    data.context.find('.progress')
-                        .attr('aria-valuenow', progress)
-                        .find('.bar').css(
-                            'width',
-                            progress + '%'
-                        );
+                    data.context.each(function () {
+                        $(this).find('.progress')
+                            .attr('aria-valuenow', progress)
+                            .children().first().css(
+                                'width',
+                                progress + '%'
+                            );
+                    });
                 }
             },
             // Callback for global upload progress events:
             progressall: function (e, data) {
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
                 var $this = $(this),
-                    progress = parseInt(data.loaded / data.total * 100, 10),
+                    progress = Math.floor(data.loaded / data.total * 100),
                     globalProgressNode = $this.find('.fileupload-progress'),
                     extendedProgressNode = globalProgressNode
                         .find('.progress-extended');
                 if (extendedProgressNode.length) {
                     extendedProgressNode.html(
-                        $this.data('fileupload')._renderExtendedProgress(data)
+                        ($this.data('blueimp-fileupload') || $this.data('fileupload'))
+                            ._renderExtendedProgress(data)
                     );
                 }
                 globalProgressNode
                     .find('.progress')
                     .attr('aria-valuenow', progress)
-                    .find('.bar').css(
+                    .children().first().css(
                         'width',
                         progress + '%'
                     );
             },
             // Callback for uploads start, equivalent to the global ajaxStart event:
             start: function (e) {
-                var that = $(this).data('fileupload');
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var that = $(this).data('blueimp-fileupload') ||
+                        $(this).data('fileupload');
+                that._resetFinishedDeferreds();
                 that._transition($(this).find('.fileupload-progress')).done(
                     function () {
                         that._trigger('started', e);
@@ -268,33 +335,80 @@
             },
             // Callback for uploads stop, equivalent to the global ajaxStop event:
             stop: function (e) {
-                var that = $(this).data('fileupload');
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var that = $(this).data('blueimp-fileupload') ||
+                        $(this).data('fileupload'),
+                    deferred = that._addFinishedDeferreds();
+                $.when.apply($, that._getFinishedDeferreds())
+                    .done(function () {
+                        that._trigger('stopped', e);
+                    });
                 that._transition($(this).find('.fileupload-progress')).done(
                     function () {
                         $(this).find('.progress')
                             .attr('aria-valuenow', '0')
-                            .find('.bar').css('width', '0%');
+                            .children().first().css('width', '0%');
                         $(this).find('.progress-extended').html('&nbsp;');
-                        that._trigger('stopped', e);
+                        deferred.resolve();
                     }
                 );
             },
+            processstart: function (e) {
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                $(this).addClass('fileupload-processing');
+            },
+            processstop: function (e) {
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                $(this).removeClass('fileupload-processing');
+            },
             // Callback for file deletion:
             destroy: function (e, data) {
-                var that = $(this).data('fileupload');
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                var that = $(this).data('blueimp-fileupload') ||
+                        $(this).data('fileupload'),
+                    removeNode = function () {
+                        that._transition(data.context).done(
+                            function () {
+                                $(this).remove();
+                                that._trigger('destroyed', e, data);
+                            }
+                        );
+                    };
                 if (data.url) {
-                    $.ajax(data);
-                    that._adjustMaxNumberOfFiles(1);
+                    data.dataType = data.dataType || that.options.dataType;
+                    $.ajax(data).done(removeNode).fail(function () {
+                        that._trigger('destroyfailed', e, data);
+                    });
+                } else {
+                    removeNode();
                 }
-                that._transition(data.context).done(
-                    function () {
-                        $(this).remove();
-                        that._trigger('destroyed', e, data);
-                    }
-                );
             }
         },
 
+        _resetFinishedDeferreds: function () {
+            this._finishedUploads = [];
+        },
+
+        _addFinishedDeferreds: function (deferred) {
+            if (!deferred) {
+                deferred = $.Deferred();
+            }
+            this._finishedUploads.push(deferred);
+            return deferred;
+        },
+
+        _getFinishedDeferreds: function () {
+            return this._finishedUploads;
+        },
+
         // Link handler, that allows to download files
         // by drag & drop of the links to the desktop:
         _enableDragToDesktop: function () {
@@ -308,21 +422,10 @@
                         'DownloadURL',
                         [type, name, url].join(':')
                     );
-                } catch (err) {}
+                } catch (ignore) {}
             });
         },
 
-        _adjustMaxNumberOfFiles: function (operand) {
-            if (typeof this.options.maxNumberOfFiles === 'number') {
-                this.options.maxNumberOfFiles += operand;
-                if (this.options.maxNumberOfFiles < 1) {
-                    this._disableFileInputButton();
-                } else {
-                    this._enableFileInputButton();
-                }
-            }
-        },
-
         _formatFileSize: function (bytes) {
             if (typeof bytes !== 'number') {
                 return '';
@@ -349,12 +452,12 @@
             if (bits >= 1000) {
                 return (bits / 1000).toFixed(2) + ' kbit/s';
             }
-            return bits + ' bit/s';
+            return bits.toFixed(2) + ' bit/s';
         },
 
         _formatTime: function (seconds) {
             var date = new Date(seconds * 1000),
-                days = parseInt(seconds / 86400, 10);
+                days = Math.floor(seconds / 86400);
             days = days ? days + 'd ' : '';
             return days +
                 ('0' + date.getUTCHours()).slice(-2) + ':' +
@@ -378,46 +481,6 @@
                 this._formatFileSize(data.total);
         },
 
-        _hasError: function (file) {
-            if (file.error) {
-                return file.error;
-            }
-            // The number of added files is subtracted from
-            // maxNumberOfFiles before validation, so we check if
-            // maxNumberOfFiles is below 0 (instead of below 1):
-            if (this.options.maxNumberOfFiles < 0) {
-                return 'maxNumberOfFiles';
-            }
-            // Files are accepted if either the file type or the file name
-            // matches against the acceptFileTypes regular expression, as
-            // only browsers with support for the File API report the type:
-            if (!(this.options.acceptFileTypes.test(file.type) ||
-                    this.options.acceptFileTypes.test(file.name))) {
-                return 'acceptFileTypes';
-            }
-            if (this.options.maxFileSize &&
-                    file.size > this.options.maxFileSize) {
-                return 'maxFileSize';
-            }
-            if (typeof file.size === 'number' &&
-                    file.size < this.options.minFileSize) {
-                return 'minFileSize';
-            }
-            return null;
-        },
-
-        _validate: function (files) {
-            var that = this,
-                valid = !!files.length;
-            $.each(files, function (index, file) {
-                file.error = that._hasError(file);
-                if (file.error) {
-                    valid = false;
-                }
-            });
-            return valid;
-        },
-
         _renderTemplate: function (func, files) {
             if (!func) {
                 return $();
@@ -433,53 +496,10 @@
             return $(this.options.templatesContainer).html(result).children();
         },
 
-        _renderPreview: function (file, node) {
-            var that = this,
-                options = this.options,
-                dfd = $.Deferred();
-            return ((loadImage && loadImage(
-                file,
-                function (img) {
-                    node.append(img);
-                    that._forceReflow(node);
-                    that._transition(node).done(function () {
-                        dfd.resolveWith(node);
-                    });
-                    if (!$.contains(document.body, node[0])) {
-                        // If the element is not part of the DOM,
-                        // transition events are not triggered,
-                        // so we have to resolve manually:
-                        dfd.resolveWith(node);
-                    }
-                },
-                {
-                    maxWidth: options.previewMaxWidth,
-                    maxHeight: options.previewMaxHeight,
-                    canvas: options.previewAsCanvas
-                }
-            )) || dfd.resolveWith(node)) && dfd;
-        },
-
-        _renderPreviews: function (files, nodes) {
-            var that = this,
-                options = this.options;
-            nodes.find('.preview span').each(function (index, element) {
-                var file = files[index];
-                if (options.previewSourceFileTypes.test(file.type) &&
-                        ($.type(options.previewSourceMaxFileSize) !== 'number' ||
-                        file.size < options.previewSourceMaxFileSize)) {
-                    that._processingQueue = that._processingQueue.pipe(function () {
-                        var dfd = $.Deferred();
-                        that._renderPreview(file, $(element)).done(
-                            function () {
-                                dfd.resolveWith(that);
-                            }
-                        );
-                        return dfd.promise();
-                    });
-                }
+        _renderPreviews: function (data) {
+            data.context.find('.preview').each(function (index, elm) {
+                $(elm).append(data.files[index].preview);
             });
-            return this._processingQueue;
         },
 
         _renderUpload: function (files) {
@@ -498,35 +518,36 @@
 
         _startHandler: function (e) {
             e.preventDefault();
-            var button = $(this),
+            var button = $(e.currentTarget),
                 template = button.closest('.template-upload'),
                 data = template.data('data');
-            if (data && data.submit && !data.jqXHR && data.submit()) {
-                button.prop('disabled', true);
+            button.prop('disabled', true);
+            if (data && data.submit) {
+                data.submit();
             }
         },
 
         _cancelHandler: function (e) {
             e.preventDefault();
-            var template = $(this).closest('.template-upload'),
+            var template = $(e.currentTarget)
+                    .closest('.template-upload,.template-download'),
                 data = template.data('data') || {};
-            if (!data.jqXHR) {
-                data.errorThrown = 'abort';
-                e.data.fileupload._trigger('fail', e, data);
+            data.context = data.context || template;
+            if (data.abort) {
+                data.abort();
             } else {
-                data.jqXHR.abort();
+                data.errorThrown = 'abort';
+                this._trigger('fail', e, data);
             }
         },
 
         _deleteHandler: function (e) {
             e.preventDefault();
-            var button = $(this);
-            e.data.fileupload._trigger('destroy', e, {
+            var button = $(e.currentTarget);
+            this._trigger('destroy', e, $.extend({
                 context: button.closest('.template-download'),
-                url: button.attr('data-url'),
-                type: button.attr('data-type') || 'DELETE',
-                dataType: e.data.fileupload.options.dataType
-            });
+                type: 'DELETE'
+            }, button.data()));
         },
 
         _forceReflow: function (node) {
@@ -536,7 +557,7 @@
 
         _transition: function (node) {
             var dfd = $.Deferred();
-            if ($.support.transition && node.hasClass('fade')) {
+            if ($.support.transition && node.hasClass('fade') && node.is(':visible')) {
                 node.bind(
                     $.support.transition.end,
                     function (e) {
@@ -557,75 +578,65 @@
 
         _initButtonBarEventHandlers: function () {
             var fileUploadButtonBar = this.element.find('.fileupload-buttonbar'),
-                filesList = this.options.filesContainer,
-                ns = this.options.namespace;
-            fileUploadButtonBar.find('.start')
-                .bind('click.' + ns, function (e) {
+                filesList = this.options.filesContainer;
+            this._on(fileUploadButtonBar.find('.start'), {
+                click: function (e) {
                     e.preventDefault();
-                    filesList.find('.start button').click();
-                });
-            fileUploadButtonBar.find('.cancel')
-                .bind('click.' + ns, function (e) {
+                    filesList.find('.start').click();
+                }
+            });
+            this._on(fileUploadButtonBar.find('.cancel'), {
+                click: function (e) {
                     e.preventDefault();
-                    filesList.find('.cancel button').click();
-                });
-            fileUploadButtonBar.find('.delete')
-                .bind('click.' + ns, function (e) {
+                    filesList.find('.cancel').click();
+                }
+            });
+            this._on(fileUploadButtonBar.find('.delete'), {
+                click: function (e) {
                     e.preventDefault();
-                    filesList.find('.delete input:checked')
-                        .siblings('button').click();
+                    filesList.find('.toggle:checked')
+                        .closest('.template-download')
+                        .find('.delete').click();
                     fileUploadButtonBar.find('.toggle')
                         .prop('checked', false);
-                });
-            fileUploadButtonBar.find('.toggle')
-                .bind('change.' + ns, function (e) {
-                    filesList.find('.delete input').prop(
+                }
+            });
+            this._on(fileUploadButtonBar.find('.toggle'), {
+                change: function (e) {
+                    filesList.find('.toggle').prop(
                         'checked',
-                        $(this).is(':checked')
+                        $(e.currentTarget).is(':checked')
                     );
-                });
+                }
+            });
         },
 
         _destroyButtonBarEventHandlers: function () {
-            this.element.find('.fileupload-buttonbar button')
-                .unbind('click.' + this.options.namespace);
-            this.element.find('.fileupload-buttonbar .toggle')
-                .unbind('change.' + this.options.namespace);
+            this._off(
+                this.element.find('.fileupload-buttonbar')
+                    .find('.start, .cancel, .delete'),
+                'click'
+            );
+            this._off(
+                this.element.find('.fileupload-buttonbar .toggle'),
+                'change.'
+            );
         },
 
         _initEventHandlers: function () {
-            parentWidget.prototype._initEventHandlers.call(this);
-            var eventData = {fileupload: this};
-            this.options.filesContainer
-                .delegate(
-                    '.start button',
-                    'click.' + this.options.namespace,
-                    eventData,
-                    this._startHandler
-                )
-                .delegate(
-                    '.cancel button',
-                    'click.' + this.options.namespace,
-                    eventData,
-                    this._cancelHandler
-                )
-                .delegate(
-                    '.delete button',
-                    'click.' + this.options.namespace,
-                    eventData,
-                    this._deleteHandler
-                );
+            this._super();
+            this._on(this.options.filesContainer, {
+                'click .start': this._startHandler,
+                'click .cancel': this._cancelHandler,
+                'click .delete': this._deleteHandler
+            });
             this._initButtonBarEventHandlers();
         },
 
         _destroyEventHandlers: function () {
-            var options = this.options;
             this._destroyButtonBarEventHandlers();
-            options.filesContainer
-                .undelegate('.start button', 'click.' + options.namespace)
-                .undelegate('.cancel button', 'click.' + options.namespace)
-                .undelegate('.delete button', 'click.' + options.namespace);
-            parentWidget.prototype._destroyEventHandlers.call(this);
+            this._off(this.options.filesContainer, 'click');
+            this._super();
         },
 
         _enableFileInputButton: function () {
@@ -642,7 +653,7 @@
 
         _initTemplates: function () {
             var options = this.options;
-            options.templatesContainer = document.createElement(
+            options.templatesContainer = this.document[0].createElement(
                 options.filesContainer.prop('nodeName')
             );
             if (tmpl) {
@@ -665,36 +676,37 @@
         },
 
         _initSpecialOptions: function () {
-            parentWidget.prototype._initSpecialOptions.call(this);
+            this._super();
             this._initFilesContainer();
             this._initTemplates();
         },
 
         _create: function () {
-            parentWidget.prototype._create.call(this);
-            this._refreshOptionsList.push(
-                'filesContainer',
-                'uploadTemplateId',
-                'downloadTemplateId'
-            );
-            if (!$.blueimpFP) {
-                this._processingQueue = $.Deferred().resolveWith(this).promise();
-                this.process = function () {
-                    return this._processingQueue;
-                };
+            this._super();
+            this._resetFinishedDeferreds();
+            if (!$.support.fileInput) {
+                this._disableFileInputButton();
             }
         },
 
         enable: function () {
-            parentWidget.prototype.enable.call(this);
-            this.element.find('input, button').prop('disabled', false);
-            this._enableFileInputButton();
+            var wasDisabled = false;
+            if (this.options.disabled) {
+                wasDisabled = true;
+            }
+            this._super();
+            if (wasDisabled) {
+                this.element.find('input, button').prop('disabled', false);
+                this._enableFileInputButton();
+            }
         },
 
         disable: function () {
-            this.element.find('input, button').prop('disabled', true);
-            this._disableFileInputButton();
-            parentWidget.prototype.disable.call(this);
+            if (!this.options.disabled) {
+                this.element.find('input, button').prop('disabled', true);
+                this._disableFileInputButton();
+            }
+            this._super();
         }
 
     });
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js
new file mode 100644
index 0000000000..eebeb37337
--- /dev/null
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-validate.js
@@ -0,0 +1,125 @@
+/*
+ * jQuery File Upload Validation Plugin
+ * https://github.com/blueimp/jQuery-File-Upload
+ *
+ * Copyright 2013, Sebastian Tschan
+ * https://blueimp.net
+ *
+ * Licensed under the MIT license:
+ * https://opensource.org/licenses/MIT
+ */
+
+/* global define, require, window */
+
+;(function (factory) {
+    'use strict';
+    if (typeof define === 'function' && define.amd) {
+        // Register as an anonymous AMD module:
+        define([
+            'jquery',
+            './jquery.fileupload-process'
+        ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('./jquery.fileupload-process')
+        );
+    } else {
+        // Browser globals:
+        factory(
+            window.jQuery
+        );
+    }
+}(function ($) {
+    'use strict';
+
+    // Append to the default processQueue:
+    $.blueimp.fileupload.prototype.options.processQueue.push(
+        {
+            action: 'validate',
+            // Always trigger this action,
+            // even if the previous action was rejected:
+            always: true,
+            // Options taken from the global options map:
+            acceptFileTypes: '@',
+            maxFileSize: '@',
+            minFileSize: '@',
+            maxNumberOfFiles: '@',
+            disabled: '@disableValidation'
+        }
+    );
+
+    // The File Upload Validation plugin extends the fileupload widget
+    // with file validation functionality:
+    $.widget('blueimp.fileupload', $.blueimp.fileupload, {
+
+        options: {
+            /*
+            // The regular expression for allowed file types, matches
+            // against either file type or file name:
+            acceptFileTypes: /(\.|\/)(gif|jpe?g|png)$/i,
+            // The maximum allowed file size in bytes:
+            maxFileSize: 10000000, // 10 MB
+            // The minimum allowed file size in bytes:
+            minFileSize: undefined, // No minimal file size
+            // The limit of files to be uploaded:
+            maxNumberOfFiles: 10,
+            */
+
+            // Function returning the current number of files,
+            // has to be overriden for maxNumberOfFiles validation:
+            getNumberOfFiles: $.noop,
+
+            // Error and info messages:
+            messages: {
+                maxNumberOfFiles: 'Maximum number of files exceeded',
+                acceptFileTypes: 'File type not allowed',
+                maxFileSize: 'File is too large',
+                minFileSize: 'File is too small'
+            }
+        },
+
+        processActions: {
+
+            validate: function (data, options) {
+                if (options.disabled) {
+                    return data;
+                }
+                var dfd = $.Deferred(),
+                    settings = this.options,
+                    file = data.files[data.index],
+                    fileSize;
+                if (options.minFileSize || options.maxFileSize) {
+                    fileSize = file.size;
+                }
+                if ($.type(options.maxNumberOfFiles) === 'number' &&
+                        (settings.getNumberOfFiles() || 0) + data.files.length >
+                            options.maxNumberOfFiles) {
+                    file.error = settings.i18n('maxNumberOfFiles');
+                } else if (options.acceptFileTypes &&
+                        !(options.acceptFileTypes.test(file.type) ||
+                        options.acceptFileTypes.test(file.name))) {
+                    file.error = settings.i18n('acceptFileTypes');
+                } else if (fileSize > options.maxFileSize) {
+                    file.error = settings.i18n('maxFileSize');
+                } else if ($.type(fileSize) === 'number' &&
+                        fileSize < options.minFileSize) {
+                    file.error = settings.i18n('minFileSize');
+                } else {
+                    delete file.error;
+                }
+                if (file.error || data.files.error) {
+                    data.files.error = true;
+                    dfd.rejectWith(this, [data]);
+                } else {
+                    dfd.resolveWith(this, [data]);
+                }
+                return dfd.promise();
+            }
+
+        }
+
+    });
+
+}));
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js
new file mode 100644
index 0000000000..aedcec2ba5
--- /dev/null
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-video.js
@@ -0,0 +1,113 @@
+/*
+ * jQuery File Upload Video Preview Plugin
+ * https://github.com/blueimp/jQuery-File-Upload
+ *
+ * Copyright 2013, Sebastian Tschan
+ * https://blueimp.net
+ *
+ * Licensed under the MIT license:
+ * https://opensource.org/licenses/MIT
+ */
+
+/* jshint nomen:false */
+/* global define, require, window, document */
+
+;(function (factory) {
+    'use strict';
+    if (typeof define === 'function' && define.amd) {
+        // Register as an anonymous AMD module:
+        define([
+            'jquery',
+            'load-image',
+            './jquery.fileupload-process'
+        ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('blueimp-load-image/js/load-image'),
+            require('./jquery.fileupload-process')
+        );
+    } else {
+        // Browser globals:
+        factory(
+            window.jQuery,
+            window.loadImage
+        );
+    }
+}(function ($, loadImage) {
+    'use strict';
+
+    // Prepend to the default processQueue:
+    $.blueimp.fileupload.prototype.options.processQueue.unshift(
+        {
+            action: 'loadVideo',
+            // Use the action as prefix for the "@" options:
+            prefix: true,
+            fileTypes: '@',
+            maxFileSize: '@',
+            disabled: '@disableVideoPreview'
+        },
+        {
+            action: 'setVideo',
+            name: '@videoPreviewName',
+            disabled: '@disableVideoPreview'
+        }
+    );
+
+    // The File Upload Video Preview plugin extends the fileupload widget
+    // with video preview functionality:
+    $.widget('blueimp.fileupload', $.blueimp.fileupload, {
+
+        options: {
+            // The regular expression for the types of video files to load,
+            // matched against the file type:
+            loadVideoFileTypes: /^video\/.*$/
+        },
+
+        _videoElement: document.createElement('video'),
+
+        processActions: {
+
+            // Loads the video file given via data.files and data.index
+            // as video element if the browser supports playing it.
+            // Accepts the options fileTypes (regular expression)
+            // and maxFileSize (integer) to limit the files to load:
+            loadVideo: function (data, options) {
+                if (options.disabled) {
+                    return data;
+                }
+                var file = data.files[data.index],
+                    url,
+                    video;
+                if (this._videoElement.canPlayType &&
+                        this._videoElement.canPlayType(file.type) &&
+                        ($.type(options.maxFileSize) !== 'number' ||
+                            file.size <= options.maxFileSize) &&
+                        (!options.fileTypes ||
+                            options.fileTypes.test(file.type))) {
+                    url = loadImage.createObjectURL(file);
+                    if (url) {
+                        video = this._videoElement.cloneNode(false);
+                        video.src = url;
+                        video.controls = true;
+                        data.video = video;
+                        return data;
+                    }
+                }
+                return data;
+            },
+
+            // Sets the video element as a property of the file object:
+            setVideo: function (data, options) {
+                if (data.video && !options.disabled) {
+                    data.files[data.index][options.name || 'preview'] = data.video;
+                }
+                return data;
+            }
+
+        }
+
+    });
+
+}));
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js
index c1bc9220fc..629f57a258 100644
--- a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js
@@ -1,25 +1,31 @@
 /*
- * jQuery File Upload Plugin 5.12
+ * jQuery File Upload Plugin
  * https://github.com/blueimp/jQuery-File-Upload
  *
  * Copyright 2010, Sebastian Tschan
  * https://blueimp.net
  *
  * Licensed under the MIT license:
- * http://www.opensource.org/licenses/MIT
+ * https://opensource.org/licenses/MIT
  */
 
-/*jslint nomen: true, unparam: true, regexp: true */
-/*global define, window, document, Blob, FormData, location */
+/* jshint nomen:false */
+/* global define, require, window, document, location, Blob, FormData */
 
-(function (factory) {
+;(function (factory) {
     'use strict';
     if (typeof define === 'function' && define.amd) {
         // Register as an anonymous AMD module:
         define([
             'jquery',
-            'jquery.ui.widget'
+            'jquery-ui/ui/widget'
         ], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(
+            require('jquery'),
+            require('./vendor/jquery.ui.widget')
+        );
     } else {
         // Browser globals:
         factory(window.jQuery);
@@ -27,12 +33,49 @@
 }(function ($) {
     'use strict';
 
+    // Detect file input support, based on
+    // http://viljamis.com/blog/2012/file-upload-support-on-mobile/
+    $.support.fileInput = !(new RegExp(
+        // Handle devices which give false positives for the feature detection:
+        '(Android (1\\.[0156]|2\\.[01]))' +
+            '|(Windows Phone (OS 7|8\\.0))|(XBLWP)|(ZuneWP)|(WPDesktop)' +
+            '|(w(eb)?OSBrowser)|(webOS)' +
+            '|(Kindle/(1\\.0|2\\.[05]|3\\.0))'
+    ).test(window.navigator.userAgent) ||
+        // Feature detection for all other devices:
+        $('<input type="file"/>').prop('disabled'));
+
     // The FileReader API is not actually used, but works as feature detection,
-    // as e.g. Safari supports XHR file uploads via the FormData API,
-    // but not non-multipart XHR file uploads:
-    $.support.xhrFileUpload = !!(window.XMLHttpRequestUpload && window.FileReader);
+    // as some Safari versions (5?) support XHR file uploads via the FormData API,
+    // but not non-multipart XHR file uploads.
+    // window.XMLHttpRequestUpload is not available on IE10, so we check for
+    // window.ProgressEvent instead to detect XHR2 file upload capability:
+    $.support.xhrFileUpload = !!(window.ProgressEvent && window.FileReader);
     $.support.xhrFormDataFileUpload = !!window.FormData;
 
+    // Detect support for Blob slicing (required for chunked uploads):
+    $.support.blobSlice = window.Blob && (Blob.prototype.slice ||
+        Blob.prototype.webkitSlice || Blob.prototype.mozSlice);
+
+    // Helper function to create drag handlers for dragover/dragenter/dragleave:
+    function getDragHandler(type) {
+        var isDragOver = type === 'dragover';
+        return function (e) {
+            e.dataTransfer = e.originalEvent && e.originalEvent.dataTransfer;
+            var dataTransfer = e.dataTransfer;
+            if (dataTransfer && $.inArray('Files', dataTransfer.types) !== -1 &&
+                    this._trigger(
+                        type,
+                        $.Event(type, {delegatedEvent: e})
+                    ) !== false) {
+                e.preventDefault();
+                if (isDragOver) {
+                    dataTransfer.dropEffect = 'copy';
+                }
+            }
+        };
+    }
+
     // The fileupload widget listens for change events on file input fields defined
     // via fileInput setting and paste or drop events of the given dropZone.
     // In addition to the default jQuery Widget methods, the fileupload widget
@@ -44,17 +87,16 @@
     $.widget('blueimp.fileupload', {
 
         options: {
-            // The namespace used for event handler binding on the dropZone and
-            // fileInput collections.
-            // If not set, the name of the widget ("fileupload") is used.
-            namespace: undefined,
-            // The drop target collection, by the default the complete document.
-            // Set to null or an empty collection to disable drag & drop support:
+            // The drop target element(s), by the default the complete document.
+            // Set to null to disable drag & drop support:
             dropZone: $(document),
-            // The file input field collection, that is listened for change events.
+            // The paste target element(s), by the default undefined.
+            // Set to a DOM node or jQuery object to enable file pasting:
+            pasteZone: undefined,
+            // The file input field(s), that are listened to for change events.
             // If undefined, it is set to the file input fields inside
             // of the widget element on plugin initialization.
-            // Set to null or an empty collection to disable the change listener.
+            // Set to null to disable the change listener.
             fileInput: undefined,
             // By default, the file input field is replaced with a clone after
             // each input field change event. This is required for iframe transport
@@ -73,6 +115,14 @@
             // To limit the number of files uploaded with one XHR request,
             // set the following option to an integer greater than 0:
             limitMultiFileUploads: undefined,
+            // The following option limits the number of files uploaded with one
+            // XHR request to keep the request size under or equal to the defined
+            // limit in bytes:
+            limitMultiFileUploadSize: undefined,
+            // Multipart file uploads add a number of bytes to each uploaded file,
+            // therefore the following option adds an overhead for each file used
+            // in the limitMultiFileUploadSize configuration:
+            limitMultiFileUploadSizeOverhead: 512,
             // Set the following option to true to issue all file upload requests
             // in a sequential order:
             sequentialUploads: false,
@@ -113,6 +163,25 @@
             progressInterval: 100,
             // Interval in milliseconds to calculate progress bitrate:
             bitrateInterval: 500,
+            // By default, uploads are started automatically when adding files:
+            autoUpload: true,
+
+            // Error and info messages:
+            messages: {
+                uploadedBytes: 'Uploaded bytes exceed file size'
+            },
+
+            // Translation function, gets the message key to be translated
+            // and an object with context specific data as arguments:
+            i18n: function (message, context) {
+                message = this.messages[message] || message.toString();
+                if (context) {
+                    $.each(context, function (key, value) {
+                        message = message.replace('{' + key + '}', value);
+                    });
+                }
+                return message;
+            },
 
             // Additional form data to be sent along with the file uploads can be set
             // using this option, which accepts an array of objects with name and
@@ -126,66 +195,109 @@
             // The add callback is invoked as soon as files are added to the fileupload
             // widget (via file input selection, drag & drop, paste or add API call).
             // If the singleFileUploads option is enabled, this callback will be
-            // called once for each file in the selection for XHR file uplaods, else
+            // called once for each file in the selection for XHR file uploads, else
             // once for each file selection.
+            //
             // The upload starts when the submit method is invoked on the data parameter.
             // The data object contains a files property holding the added files
-            // and allows to override plugin options as well as define ajax settings.
+            // and allows you to override plugin options as well as define ajax settings.
+            //
             // Listeners for this callback can also be bound the following way:
             // .bind('fileuploadadd', func);
+            //
             // data.submit() returns a Promise object and allows to attach additional
             // handlers using jQuery's Deferred callbacks:
             // data.submit().done(func).fail(func).always(func);
             add: function (e, data) {
-                data.submit();
+                if (e.isDefaultPrevented()) {
+                    return false;
+                }
+                if (data.autoUpload || (data.autoUpload !== false &&
+                        $(this).fileupload('option', 'autoUpload'))) {
+                    data.process().done(function () {
+                        data.submit();
+                    });
+                }
             },
 
             // Other callbacks:
+
             // Callback for the submit event of each file upload:
             // submit: function (e, data) {}, // .bind('fileuploadsubmit', func);
+
             // Callback for the start of each file upload request:
             // send: function (e, data) {}, // .bind('fileuploadsend', func);
+
             // Callback for successful uploads:
             // done: function (e, data) {}, // .bind('fileuploaddone', func);
+
             // Callback for failed (abort or error) uploads:
             // fail: function (e, data) {}, // .bind('fileuploadfail', func);
+
             // Callback for completed (success, abort or error) requests:
             // always: function (e, data) {}, // .bind('fileuploadalways', func);
+
             // Callback for upload progress events:
             // progress: function (e, data) {}, // .bind('fileuploadprogress', func);
+
             // Callback for global upload progress events:
             // progressall: function (e, data) {}, // .bind('fileuploadprogressall', func);
+
             // Callback for uploads start, equivalent to the global ajaxStart event:
             // start: function (e) {}, // .bind('fileuploadstart', func);
+
             // Callback for uploads stop, equivalent to the global ajaxStop event:
             // stop: function (e) {}, // .bind('fileuploadstop', func);
-            // Callback for change events of the fileInput collection:
+
+            // Callback for change events of the fileInput(s):
             // change: function (e, data) {}, // .bind('fileuploadchange', func);
-            // Callback for paste events to the dropZone collection:
+
+            // Callback for paste events to the pasteZone(s):
             // paste: function (e, data) {}, // .bind('fileuploadpaste', func);
-            // Callback for drop events of the dropZone collection:
+
+            // Callback for drop events of the dropZone(s):
             // drop: function (e, data) {}, // .bind('fileuploaddrop', func);
-            // Callback for dragover events of the dropZone collection:
+
+            // Callback for dragover events of the dropZone(s):
             // dragover: function (e) {}, // .bind('fileuploaddragover', func);
 
+            // Callback for the start of each chunk upload request:
+            // chunksend: function (e, data) {}, // .bind('fileuploadchunksend', func);
+
+            // Callback for successful chunk uploads:
+            // chunkdone: function (e, data) {}, // .bind('fileuploadchunkdone', func);
+
+            // Callback for failed (abort or error) chunk uploads:
+            // chunkfail: function (e, data) {}, // .bind('fileuploadchunkfail', func);
+
+            // Callback for completed (success, abort or error) chunk upload requests:
+            // chunkalways: function (e, data) {}, // .bind('fileuploadchunkalways', func);
+
             // The plugin options are used as settings object for the ajax calls.
             // The following are jQuery ajax settings required for the file uploads:
             processData: false,
             contentType: false,
-            cache: false
+            cache: false,
+            timeout: 0
         },
 
-        // A list of options that require a refresh after assigning a new value:
-        _refreshOptionsList: [
-            'namespace',
-            'dropZone',
+        // A list of options that require reinitializing event listeners and/or
+        // special initialization code:
+        _specialOptions: [
             'fileInput',
+            'dropZone',
+            'pasteZone',
             'multipart',
             'forceIframeTransport'
         ],
 
+        _blobSlice: $.support.blobSlice && function () {
+            var slice = this.slice || this.webkitSlice || this.mozSlice;
+            return slice.apply(this, arguments);
+        },
+
         _BitrateTimer: function () {
-            this.timestamp = +(new Date());
+            this.timestamp = ((Date.now) ? Date.now() : (new Date()).getTime());
             this.loaded = 0;
             this.bitrate = 0;
             this.getBitrate = function (now, loaded, interval) {
@@ -207,13 +319,13 @@
 
         _getFormData: function (options) {
             var formData;
-            if (typeof options.formData === 'function') {
+            if ($.type(options.formData) === 'function') {
                 return options.formData(options.form);
             }
-			if ($.isArray(options.formData)) {
+            if ($.isArray(options.formData)) {
                 return options.formData;
             }
-			if (options.formData) {
+            if ($.type(options.formData) === 'object') {
                 formData = [];
                 $.each(options.formData, function (name, value) {
                     formData.push({name: name, value: value});
@@ -231,10 +343,35 @@
             return total;
         },
 
+        _initProgressObject: function (obj) {
+            var progress = {
+                loaded: 0,
+                total: 0,
+                bitrate: 0
+            };
+            if (obj._progress) {
+                $.extend(obj._progress, progress);
+            } else {
+                obj._progress = progress;
+            }
+        },
+
+        _initResponseObject: function (obj) {
+            var prop;
+            if (obj._response) {
+                for (prop in obj._response) {
+                    if (obj._response.hasOwnProperty(prop)) {
+                        delete obj._response[prop];
+                    }
+                }
+            } else {
+                obj._response = {};
+            }
+        },
+
         _onProgress: function (e, data) {
             if (e.lengthComputable) {
-                var now = +(new Date()),
-                    total,
+                var now = ((Date.now) ? Date.now() : (new Date()).getTime()),
                     loaded;
                 if (data._time && data.progressInterval &&
                         (now - data._time < data.progressInterval) &&
@@ -242,16 +379,19 @@
                     return;
                 }
                 data._time = now;
-                total = data.total || this._getTotal(data.files);
-                loaded = parseInt(
-                    e.loaded / e.total * (data.chunkSize || total),
-                    10
+                loaded = Math.floor(
+                    e.loaded / e.total * (data.chunkSize || data._progress.total)
                 ) + (data.uploadedBytes || 0);
-                this._loaded += loaded - (data.loaded || data.uploadedBytes || 0);
-                data.lengthComputable = true;
-                data.loaded = loaded;
-                data.total = total;
-                data.bitrate = data._bitrateTimer.getBitrate(
+                // Add the difference from the previously loaded state
+                // to the global loaded counter:
+                this._progress.loaded += (loaded - data._progress.loaded);
+                this._progress.bitrate = this._bitrateTimer.getBitrate(
+                    now,
+                    this._progress.loaded,
+                    data.bitrateInterval
+                );
+                data._progress.loaded = data.loaded = loaded;
+                data._progress.bitrate = data.bitrate = data._bitrateTimer.getBitrate(
                     now,
                     loaded,
                     data.bitrateInterval
@@ -259,19 +399,18 @@
                 // Trigger a custom progress event with a total data property set
                 // to the file size(s) of the current upload and a loaded data
                 // property calculated accordingly:
-                this._trigger('progress', e, data);
+                this._trigger(
+                    'progress',
+                    $.Event('progress', {delegatedEvent: e}),
+                    data
+                );
                 // Trigger a global progress event for all current file uploads,
                 // including ajax calls queued for sequential file uploads:
-                this._trigger('progressall', e, {
-                    lengthComputable: true,
-                    loaded: this._loaded,
-                    total: this._total,
-                    bitrate: this._bitrateTimer.getBitrate(
-                        now,
-                        this._loaded,
-                        data.bitrateInterval
-                    )
-                });
+                this._trigger(
+                    'progressall',
+                    $.Event('progressall', {delegatedEvent: e}),
+                    this._progress
+                );
             }
         },
 
@@ -295,35 +434,31 @@
             }
         },
 
+        _isInstanceOf: function (type, obj) {
+            // Cross-frame instanceof check
+            return Object.prototype.toString.call(obj) === '[object ' + type + ']';
+        },
+
         _initXHRData: function (options) {
-            var formData,
+            var that = this,
+                formData,
                 file = options.files[0],
                 // Ignore non-multipart setting if not supported:
                 multipart = options.multipart || !$.support.xhrFileUpload,
-                paramName = options.paramName[0];
-            if (!multipart || options.blob) {
-                // For non-multipart uploads and chunked uploads,
-                // file meta data is not part of the request body,
-                // so we transmit this data as part of the HTTP headers.
-                // For cross domain requests, these headers must be allowed
-                // via Access-Control-Allow-Headers or removed using
-                // the beforeSend callback:
-                options.headers = $.extend(options.headers, {
-                    'X-File-Name': file.name,
-                    'X-File-Type': file.type,
-                    'X-File-Size': file.size
-                });
-                if (!options.blob) {
-                    // Non-chunked non-multipart upload:
-                    options.contentType = file.type;
-                    options.data = file;
-                } else if (!multipart) {
-                    // Chunked non-multipart upload:
-                    options.contentType = 'application/octet-stream';
-                    options.data = options.blob;
-                }
+                paramName = $.type(options.paramName) === 'array' ?
+                    options.paramName[0] : options.paramName;
+            options.headers = $.extend({}, options.headers);
+            if (options.contentRange) {
+                options.headers['Content-Range'] = options.contentRange;
+            }
+            if (!multipart || options.blob || !this._isInstanceOf('File', file)) {
+                options.headers['Content-Disposition'] = 'attachment; filename="' +
+                    encodeURI(file.uploadName || file.name) + '"';
             }
-            if (multipart && $.support.xhrFormDataFileUpload) {
+            if (!multipart) {
+                options.contentType = file.type || 'application/octet-stream';
+                options.data = options.blob || file;
+            } else if ($.support.xhrFormDataFileUpload) {
                 if (options.postMessage) {
                     // window.postMessage does not allow sending FormData
                     // objects, so we just add the File/Blob objects to
@@ -338,13 +473,14 @@
                     } else {
                         $.each(options.files, function (index, file) {
                             formData.push({
-                                name: options.paramName[index] || paramName,
+                                name: ($.type(options.paramName) === 'array' &&
+                                    options.paramName[index]) || paramName,
                                 value: file
                             });
                         });
                     }
                 } else {
-                    if (options.formData instanceof FormData) {
+                    if (that._isInstanceOf('FormData', options.formData)) {
                         formData = options.formData;
                     } else {
                         formData = new FormData();
@@ -353,17 +489,22 @@
                         });
                     }
                     if (options.blob) {
-                        formData.append(paramName, options.blob, file.name);
+                        formData.append(
+                            paramName,
+                            options.blob,
+                            file.uploadName || file.name
+                        );
                     } else {
                         $.each(options.files, function (index, file) {
-                            // File objects are also Blob instances.
                             // This check allows the tests to run with
                             // dummy objects:
-                            if (file instanceof Blob) {
+                            if (that._isInstanceOf('File', file) ||
+                                    that._isInstanceOf('Blob', file)) {
                                 formData.append(
-                                    options.paramName[index] || paramName,
+                                    ($.type(options.paramName) === 'array' &&
+                                        options.paramName[index]) || paramName,
                                     file,
-                                    file.name
+                                    file.uploadName || file.name
                                 );
                             }
                         });
@@ -376,13 +517,13 @@
         },
 
         _initIframeSettings: function (options) {
+            var targetHost = $('<a></a>').prop('href', options.url).prop('host');
             // Setting the dataType to iframe enables the iframe transport:
             options.dataType = 'iframe ' + (options.dataType || '');
             // The iframe transport accepts a serialized array as form data:
             options.formData = this._getFormData(options);
             // Add redirect url to form data on cross-domain uploads:
-            if (options.redirect && $('<a></a>').prop('href', options.url)
-                    .prop('host') !== location.host) {
+            if (options.redirect && targetHost && targetHost !== location.host) {
                 options.formData.push({
                     name: options.redirectParamName || 'redirect',
                     value: options.redirect
@@ -404,7 +545,7 @@
                     options.dataType = 'postmessage ' + (options.dataType || '');
                 }
             } else {
-                this._initIframeSettings(options, 'iframe');
+                this._initIframeSettings(options);
             }
         },
 
@@ -436,17 +577,28 @@
             // associated form, if available:
             if (!options.form || !options.form.length) {
                 options.form = $(options.fileInput.prop('form'));
+                // If the given file input doesn't have an associated form,
+                // use the default widget file input's form:
+                if (!options.form.length) {
+                    options.form = $(this.options.fileInput.prop('form'));
+                }
             }
             options.paramName = this._getParamName(options);
             if (!options.url) {
                 options.url = options.form.prop('action') || location.href;
             }
             // The HTTP request method must be "POST" or "PUT":
-            options.type = (options.type || options.form.prop('method') || '')
-                .toUpperCase();
-            if (options.type !== 'POST' && options.type !== 'PUT') {
+            options.type = (options.type ||
+                ($.type(options.form.prop('method')) === 'string' &&
+                    options.form.prop('method')) || ''
+                ).toUpperCase();
+            if (options.type !== 'POST' && options.type !== 'PUT' &&
+                    options.type !== 'PATCH') {
                 options.type = 'POST';
             }
+            if (!options.formAcceptCharset) {
+                options.formAcceptCharset = options.form.attr('accept-charset');
+            }
         },
 
         _getAJAXSettings: function (data) {
@@ -456,6 +608,21 @@
             return options;
         },
 
+        // jQuery 1.6 doesn't provide .state(),
+        // while jQuery 1.8+ removed .isRejected() and .isResolved():
+        _getDeferredState: function (deferred) {
+            if (deferred.state) {
+                return deferred.state();
+            }
+            if (deferred.isResolved()) {
+                return 'resolved';
+            }
+            if (deferred.isRejected()) {
+                return 'rejected';
+            }
+            return 'pending';
+        },
+
         // Maps jqXHR callbacks to the equivalent
         // methods of the given Promise object:
         _enhancePromise: function (promise) {
@@ -480,25 +647,94 @@
             return this._enhancePromise(promise);
         },
 
+        // Adds convenience methods to the data callback argument:
+        _addConvenienceMethods: function (e, data) {
+            var that = this,
+                getPromise = function (args) {
+                    return $.Deferred().resolveWith(that, args).promise();
+                };
+            data.process = function (resolveFunc, rejectFunc) {
+                if (resolveFunc || rejectFunc) {
+                    data._processQueue = this._processQueue =
+                        (this._processQueue || getPromise([this])).then(
+                            function () {
+                                if (data.errorThrown) {
+                                    return $.Deferred()
+                                        .rejectWith(that, [data]).promise();
+                                }
+                                return getPromise(arguments);
+                            }
+                        ).then(resolveFunc, rejectFunc);
+                }
+                return this._processQueue || getPromise([this]);
+            };
+            data.submit = function () {
+                if (this.state() !== 'pending') {
+                    data.jqXHR = this.jqXHR =
+                        (that._trigger(
+                            'submit',
+                            $.Event('submit', {delegatedEvent: e}),
+                            this
+                        ) !== false) && that._onSend(e, this);
+                }
+                return this.jqXHR || that._getXHRPromise();
+            };
+            data.abort = function () {
+                if (this.jqXHR) {
+                    return this.jqXHR.abort();
+                }
+                this.errorThrown = 'abort';
+                that._trigger('fail', null, this);
+                return that._getXHRPromise(false);
+            };
+            data.state = function () {
+                if (this.jqXHR) {
+                    return that._getDeferredState(this.jqXHR);
+                }
+                if (this._processQueue) {
+                    return that._getDeferredState(this._processQueue);
+                }
+            };
+            data.processing = function () {
+                return !this.jqXHR && this._processQueue && that
+                    ._getDeferredState(this._processQueue) === 'pending';
+            };
+            data.progress = function () {
+                return this._progress;
+            };
+            data.response = function () {
+                return this._response;
+            };
+        },
+
+        // Parses the Range header from the server response
+        // and returns the uploaded bytes:
+        _getUploadedBytes: function (jqXHR) {
+            var range = jqXHR.getResponseHeader('Range'),
+                parts = range && range.split('-'),
+                upperBytesPos = parts && parts.length > 1 &&
+                    parseInt(parts[1], 10);
+            return upperBytesPos && upperBytesPos + 1;
+        },
+
         // Uploads a file in multiple, sequential requests
         // by splitting the file up in multiple blob chunks.
         // If the second parameter is true, only tests if the file
         // should be uploaded in chunks, but does not invoke any
         // upload requests:
         _chunkedUpload: function (options, testOnly) {
+            options.uploadedBytes = options.uploadedBytes || 0;
             var that = this,
                 file = options.files[0],
                 fs = file.size,
-                ub = options.uploadedBytes = options.uploadedBytes || 0,
+                ub = options.uploadedBytes,
                 mcs = options.maxChunkSize || fs,
-                // Use the Blob methods with the slice implementation
-                // according to the W3C Blob API specification:
-                slice = file.webkitSlice || file.mozSlice || file.slice,
-                upload,
-                n,
+                slice = this._blobSlice,
+                dfd = $.Deferred(),
+                promise = dfd.promise(),
                 jqXHR,
-                pipe;
-            if (!(this._isXHRUpload(options) && slice && (ub || mcs < fs)) ||
+                upload;
+            if (!(this._isXHRUpload(options) && slice && (ub || ($.type(mcs) === 'function' ? mcs(options) : mcs) < fs)) ||
                     options.data) {
                 return false;
             }
@@ -506,62 +742,84 @@
                 return true;
             }
             if (ub >= fs) {
-                file.error = 'uploadedBytes';
+                file.error = options.i18n('uploadedBytes');
                 return this._getXHRPromise(
                     false,
                     options.context,
                     [null, 'error', file.error]
                 );
             }
-            // n is the number of blobs to upload,
-            // calculated via filesize, uploaded bytes and max chunk size:
-            n = Math.ceil((fs - ub) / mcs);
-            // The chunk upload method accepting the chunk number as parameter:
-            upload = function (i) {
-                if (!i) {
-                    return that._getXHRPromise(true, options.context);
-                }
-                // Upload the blobs in sequential order:
-                return upload(i -= 1).pipe(function () {
-                    // Clone the options object for each chunk upload:
-                    var o = $.extend({}, options);
-                    o.blob = slice.call(
-                        file,
-                        ub + i * mcs,
-                        ub + (i + 1) * mcs
-                    );
-                    // Store the current chunk size, as the blob itself
-                    // will be dereferenced after data processing:
-                    o.chunkSize = o.blob.size;
-                    // Process the upload data (the blob and potential form data):
-                    that._initXHRData(o);
-                    // Add progress listeners for this chunk upload:
-                    that._initProgressListener(o);
-                    jqXHR = ($.ajax(o) || that._getXHRPromise(false, o.context))
-                        .done(function () {
-                            // Create a progress event if upload is done and
-                            // no progress event has been invoked for this chunk:
-                            if (!o.loaded) {
-                                that._onProgress($.Event('progress', {
-                                    lengthComputable: true,
-                                    loaded: o.chunkSize,
-                                    total: o.chunkSize
-                                }), o);
-                            }
-                            options.uploadedBytes = o.uploadedBytes +=
-                                o.chunkSize;
-                        });
-                    return jqXHR;
-                });
+            // The chunk upload method:
+            upload = function () {
+                // Clone the options object for each chunk upload:
+                var o = $.extend({}, options),
+                    currentLoaded = o._progress.loaded;
+                o.blob = slice.call(
+                    file,
+                    ub,
+                    ub + ($.type(mcs) === 'function' ? mcs(o) : mcs),
+                    file.type
+                );
+                // Store the current chunk size, as the blob itself
+                // will be dereferenced after data processing:
+                o.chunkSize = o.blob.size;
+                // Expose the chunk bytes position range:
+                o.contentRange = 'bytes ' + ub + '-' +
+                    (ub + o.chunkSize - 1) + '/' + fs;
+                // Process the upload data (the blob and potential form data):
+                that._initXHRData(o);
+                // Add progress listeners for this chunk upload:
+                that._initProgressListener(o);
+                jqXHR = ((that._trigger('chunksend', null, o) !== false && $.ajax(o)) ||
+                        that._getXHRPromise(false, o.context))
+                    .done(function (result, textStatus, jqXHR) {
+                        ub = that._getUploadedBytes(jqXHR) ||
+                            (ub + o.chunkSize);
+                        // Create a progress event if no final progress event
+                        // with loaded equaling total has been triggered
+                        // for this chunk:
+                        if (currentLoaded + o.chunkSize - o._progress.loaded) {
+                            that._onProgress($.Event('progress', {
+                                lengthComputable: true,
+                                loaded: ub - o.uploadedBytes,
+                                total: ub - o.uploadedBytes
+                            }), o);
+                        }
+                        options.uploadedBytes = o.uploadedBytes = ub;
+                        o.result = result;
+                        o.textStatus = textStatus;
+                        o.jqXHR = jqXHR;
+                        that._trigger('chunkdone', null, o);
+                        that._trigger('chunkalways', null, o);
+                        if (ub < fs) {
+                            // File upload not yet complete,
+                            // continue with the next chunk:
+                            upload();
+                        } else {
+                            dfd.resolveWith(
+                                o.context,
+                                [result, textStatus, jqXHR]
+                            );
+                        }
+                    })
+                    .fail(function (jqXHR, textStatus, errorThrown) {
+                        o.jqXHR = jqXHR;
+                        o.textStatus = textStatus;
+                        o.errorThrown = errorThrown;
+                        that._trigger('chunkfail', null, o);
+                        that._trigger('chunkalways', null, o);
+                        dfd.rejectWith(
+                            o.context,
+                            [jqXHR, textStatus, errorThrown]
+                        );
+                    });
             };
-            // Return the piped Promise object, enhanced with an abort method,
-            // which is delegated to the jqXHR object of the current upload,
-            // and jqXHR callbacks mapped to the equivalent Promise methods:
-            pipe = upload(n);
-            pipe.abort = function () {
+            this._enhancePromise(promise);
+            promise.abort = function () {
                 return jqXHR.abort();
             };
-            return this._enhancePromise(pipe);
+            upload();
+            return promise;
         },
 
         _beforeSend: function (e, data) {
@@ -572,102 +830,115 @@
                 this._trigger('start');
                 // Set timer for global bitrate progress calculation:
                 this._bitrateTimer = new this._BitrateTimer();
+                // Reset the global progress values:
+                this._progress.loaded = this._progress.total = 0;
+                this._progress.bitrate = 0;
             }
+            // Make sure the container objects for the .response() and
+            // .progress() methods on the data object are available
+            // and reset to their initial state:
+            this._initResponseObject(data);
+            this._initProgressObject(data);
+            data._progress.loaded = data.loaded = data.uploadedBytes || 0;
+            data._progress.total = data.total = this._getTotal(data.files) || 1;
+            data._progress.bitrate = data.bitrate = 0;
             this._active += 1;
             // Initialize the global progress values:
-            this._loaded += data.uploadedBytes || 0;
-            this._total += this._getTotal(data.files);
+            this._progress.loaded += data.loaded;
+            this._progress.total += data.total;
         },
 
         _onDone: function (result, textStatus, jqXHR, options) {
-            if (!this._isXHRUpload(options)) {
-                // Create a progress event for each iframe load:
+            var total = options._progress.total,
+                response = options._response;
+            if (options._progress.loaded < total) {
+                // Create a progress event if no final progress event
+                // with loaded equaling total has been triggered:
                 this._onProgress($.Event('progress', {
                     lengthComputable: true,
-                    loaded: 1,
-                    total: 1
+                    loaded: total,
+                    total: total
                 }), options);
             }
-            options.result = result;
-            options.textStatus = textStatus;
-            options.jqXHR = jqXHR;
+            response.result = options.result = result;
+            response.textStatus = options.textStatus = textStatus;
+            response.jqXHR = options.jqXHR = jqXHR;
             this._trigger('done', null, options);
         },
 
         _onFail: function (jqXHR, textStatus, errorThrown, options) {
-            options.jqXHR = jqXHR;
-            options.textStatus = textStatus;
-            options.errorThrown = errorThrown;
-            this._trigger('fail', null, options);
+            var response = options._response;
             if (options.recalculateProgress) {
                 // Remove the failed (error or abort) file upload from
                 // the global progress calculation:
-                this._loaded -= options.loaded || options.uploadedBytes || 0;
-                this._total -= options.total || this._getTotal(options.files);
+                this._progress.loaded -= options._progress.loaded;
+                this._progress.total -= options._progress.total;
             }
+            response.jqXHR = options.jqXHR = jqXHR;
+            response.textStatus = options.textStatus = textStatus;
+            response.errorThrown = options.errorThrown = errorThrown;
+            this._trigger('fail', null, options);
         },
 
         _onAlways: function (jqXHRorResult, textStatus, jqXHRorError, options) {
-            this._active -= 1;
-            options.textStatus = textStatus;
-            if (jqXHRorError && jqXHRorError.always) {
-                options.jqXHR = jqXHRorError;
-                options.result = jqXHRorResult;
-            } else {
-                options.jqXHR = jqXHRorResult;
-                options.errorThrown = jqXHRorError;
-            }
+            // jqXHRorResult, textStatus and jqXHRorError are added to the
+            // options object via done and fail callbacks
             this._trigger('always', null, options);
-            if (this._active === 0) {
-                // The stop callback is triggered when all uploads have
-                // been completed, equivalent to the global ajaxStop event:
-                this._trigger('stop');
-                // Reset the global progress values:
-                this._loaded = this._total = 0;
-                this._bitrateTimer = null;
-            }
         },
 
         _onSend: function (e, data) {
+            if (!data.submit) {
+                this._addConvenienceMethods(e, data);
+            }
             var that = this,
                 jqXHR,
+                aborted,
                 slot,
                 pipe,
                 options = that._getAJAXSettings(data),
-                send = function (resolve, args) {
+                send = function () {
                     that._sending += 1;
                     // Set timer for bitrate progress calculation:
                     options._bitrateTimer = new that._BitrateTimer();
                     jqXHR = jqXHR || (
-                        (resolve !== false &&
-                        that._trigger('send', e, options) !== false &&
-                        (that._chunkedUpload(options) || $.ajax(options))) ||
-                        that._getXHRPromise(false, options.context, args)
+                        ((aborted || that._trigger(
+                            'send',
+                            $.Event('send', {delegatedEvent: e}),
+                            options
+                        ) === false) &&
+                        that._getXHRPromise(false, options.context, aborted)) ||
+                        that._chunkedUpload(options) || $.ajax(options)
                     ).done(function (result, textStatus, jqXHR) {
                         that._onDone(result, textStatus, jqXHR, options);
                     }).fail(function (jqXHR, textStatus, errorThrown) {
                         that._onFail(jqXHR, textStatus, errorThrown, options);
                     }).always(function (jqXHRorResult, textStatus, jqXHRorError) {
-                        that._sending -= 1;
                         that._onAlways(
                             jqXHRorResult,
                             textStatus,
                             jqXHRorError,
                             options
                         );
+                        that._sending -= 1;
+                        that._active -= 1;
                         if (options.limitConcurrentUploads &&
                                 options.limitConcurrentUploads > that._sending) {
                             // Start the next queued upload,
                             // that has not been aborted:
                             var nextSlot = that._slots.shift();
                             while (nextSlot) {
-                                if (!nextSlot.isRejected()) {
+                                if (that._getDeferredState(nextSlot) === 'pending') {
                                     nextSlot.resolve();
                                     break;
                                 }
                                 nextSlot = that._slots.shift();
                             }
                         }
+                        if (that._active === 0) {
+                            // The stop callback is triggered when all uploads have
+                            // been completed, equivalent to the global ajaxStop event:
+                            that._trigger('stop');
+                        }
                     });
                     return jqXHR;
                 };
@@ -678,20 +949,21 @@
                 if (this.options.limitConcurrentUploads > 1) {
                     slot = $.Deferred();
                     this._slots.push(slot);
-                    pipe = slot.pipe(send);
+                    pipe = slot.then(send);
                 } else {
-                    pipe = (this._sequence = this._sequence.pipe(send, send));
+                    this._sequence = this._sequence.then(send, send);
+                    pipe = this._sequence;
                 }
                 // Return the piped Promise object, enhanced with an abort method,
                 // which is delegated to the jqXHR object of the current upload,
                 // and jqXHR callbacks mapped to the equivalent Promise methods:
                 pipe.abort = function () {
-                    var args = [undefined, 'abort', 'abort'];
+                    aborted = [undefined, 'abort', 'abort'];
                     if (!jqXHR) {
                         if (slot) {
-                            slot.rejectWith(args);
+                            slot.rejectWith(options.context, aborted);
                         }
-                        return send(false, args);
+                        return send();
                     }
                     return jqXHR.abort();
                 };
@@ -704,64 +976,97 @@
             var that = this,
                 result = true,
                 options = $.extend({}, this.options, data),
+                files = data.files,
+                filesLength = files.length,
                 limit = options.limitMultiFileUploads,
+                limitSize = options.limitMultiFileUploadSize,
+                overhead = options.limitMultiFileUploadSizeOverhead,
+                batchSize = 0,
                 paramName = this._getParamName(options),
                 paramNameSet,
                 paramNameSlice,
                 fileSet,
-                i;
-            if (!(options.singleFileUploads || limit) ||
+                i,
+                j = 0;
+            if (!filesLength) {
+                return false;
+            }
+            if (limitSize && files[0].size === undefined) {
+                limitSize = undefined;
+            }
+            if (!(options.singleFileUploads || limit || limitSize) ||
                     !this._isXHRUpload(options)) {
-                fileSet = [data.files];
+                fileSet = [files];
                 paramNameSet = [paramName];
-            } else if (!options.singleFileUploads && limit) {
+            } else if (!(options.singleFileUploads || limitSize) && limit) {
                 fileSet = [];
                 paramNameSet = [];
-                for (i = 0; i < data.files.length; i += limit) {
-                    fileSet.push(data.files.slice(i, i + limit));
+                for (i = 0; i < filesLength; i += limit) {
+                    fileSet.push(files.slice(i, i + limit));
                     paramNameSlice = paramName.slice(i, i + limit);
                     if (!paramNameSlice.length) {
                         paramNameSlice = paramName;
                     }
                     paramNameSet.push(paramNameSlice);
                 }
+            } else if (!options.singleFileUploads && limitSize) {
+                fileSet = [];
+                paramNameSet = [];
+                for (i = 0; i < filesLength; i = i + 1) {
+                    batchSize += files[i].size + overhead;
+                    if (i + 1 === filesLength ||
+                            ((batchSize + files[i + 1].size + overhead) > limitSize) ||
+                            (limit && i + 1 - j >= limit)) {
+                        fileSet.push(files.slice(j, i + 1));
+                        paramNameSlice = paramName.slice(j, i + 1);
+                        if (!paramNameSlice.length) {
+                            paramNameSlice = paramName;
+                        }
+                        paramNameSet.push(paramNameSlice);
+                        j = i + 1;
+                        batchSize = 0;
+                    }
+                }
             } else {
                 paramNameSet = paramName;
             }
-            data.originalFiles = data.files;
-            $.each(fileSet || data.files, function (index, element) {
+            data.originalFiles = files;
+            $.each(fileSet || files, function (index, element) {
                 var newData = $.extend({}, data);
                 newData.files = fileSet ? element : [element];
                 newData.paramName = paramNameSet[index];
-                newData.submit = function () {
-                    newData.jqXHR = this.jqXHR =
-                        (that._trigger('submit', e, this) !== false) &&
-                        that._onSend(e, this);
-                    return this.jqXHR;
-                };
-                return (result = that._trigger('add', e, newData));
+                that._initResponseObject(newData);
+                that._initProgressObject(newData);
+                that._addConvenienceMethods(e, newData);
+                result = that._trigger(
+                    'add',
+                    $.Event('add', {delegatedEvent: e}),
+                    newData
+                );
+                return result;
             });
             return result;
         },
 
-        // File Normalization for Gecko 1.9.1 (Firefox 3.5) support:
-        _normalizeFile: function (index, file) {
-            if (file.name === undefined && file.size === undefined) {
-                file.name = file.fileName;
-                file.size = file.fileSize;
-            }
-        },
-
-        _replaceFileInput: function (input) {
-            var inputClone = input.clone(true);
+        _replaceFileInput: function (data) {
+            var input = data.fileInput,
+                inputClone = input.clone(true),
+                restoreFocus = input.is(document.activeElement);
+            // Add a reference for the new cloned file input to the data argument:
+            data.fileInputClone = inputClone;
             $('<form></form>').append(inputClone)[0].reset();
             // Detaching allows to insert the fileInput on another form
             // without loosing the file input value:
             input.after(inputClone).detach();
+            // If the fileInput had focus before it was detached,
+            // restore focus to the inputClone.
+            if (restoreFocus) {
+                inputClone.focus();
+            }
             // Avoid memory leaks with the detached file input:
             $.cleanData(input.unbind('remove'));
             // Replace the original file input element in the fileInput
-            // collection with the clone, which has been copied including
+            // elements set with the clone, which has been copied including
             // event handlers:
             this.options.fileInput = this.options.fileInput.map(function (i, el) {
                 if (el === input[0]) {
@@ -776,113 +1081,252 @@
             }
         },
 
-        _getFileInputFiles: function (fileInput) {
+        _handleFileTreeEntry: function (entry, path) {
+            var that = this,
+                dfd = $.Deferred(),
+                entries = [],
+                dirReader,
+                errorHandler = function (e) {
+                    if (e && !e.entry) {
+                        e.entry = entry;
+                    }
+                    // Since $.when returns immediately if one
+                    // Deferred is rejected, we use resolve instead.
+                    // This allows valid files and invalid items
+                    // to be returned together in one set:
+                    dfd.resolve([e]);
+                },
+                successHandler = function (entries) {
+                    that._handleFileTreeEntries(
+                        entries,
+                        path + entry.name + '/'
+                    ).done(function (files) {
+                        dfd.resolve(files);
+                    }).fail(errorHandler);
+                },
+                readEntries = function () {
+                    dirReader.readEntries(function (results) {
+                        if (!results.length) {
+                            successHandler(entries);
+                        } else {
+                            entries = entries.concat(results);
+                            readEntries();
+                        }
+                    }, errorHandler);
+                };
+            path = path || '';
+            if (entry.isFile) {
+                if (entry._file) {
+                    // Workaround for Chrome bug #149735
+                    entry._file.relativePath = path;
+                    dfd.resolve(entry._file);
+                } else {
+                    entry.file(function (file) {
+                        file.relativePath = path;
+                        dfd.resolve(file);
+                    }, errorHandler);
+                }
+            } else if (entry.isDirectory) {
+                dirReader = entry.createReader();
+                readEntries();
+            } else {
+                // Return an empty list for file system items
+                // other than files or directories:
+                dfd.resolve([]);
+            }
+            return dfd.promise();
+        },
+
+        _handleFileTreeEntries: function (entries, path) {
+            var that = this;
+            return $.when.apply(
+                $,
+                $.map(entries, function (entry) {
+                    return that._handleFileTreeEntry(entry, path);
+                })
+            ).then(function () {
+                return Array.prototype.concat.apply(
+                    [],
+                    arguments
+                );
+            });
+        },
+
+        _getDroppedFiles: function (dataTransfer) {
+            dataTransfer = dataTransfer || {};
+            var items = dataTransfer.items;
+            if (items && items.length && (items[0].webkitGetAsEntry ||
+                    items[0].getAsEntry)) {
+                return this._handleFileTreeEntries(
+                    $.map(items, function (item) {
+                        var entry;
+                        if (item.webkitGetAsEntry) {
+                            entry = item.webkitGetAsEntry();
+                            if (entry) {
+                                // Workaround for Chrome bug #149735:
+                                entry._file = item.getAsFile();
+                            }
+                            return entry;
+                        }
+                        return item.getAsEntry();
+                    })
+                );
+            }
+            return $.Deferred().resolve(
+                $.makeArray(dataTransfer.files)
+            ).promise();
+        },
+
+        _getSingleFileInputFiles: function (fileInput) {
             fileInput = $(fileInput);
-            var files = $.each($.makeArray(fileInput.prop('files')), this._normalizeFile),
+            var entries = fileInput.prop('webkitEntries') ||
+                    fileInput.prop('entries'),
+                files,
                 value;
+            if (entries && entries.length) {
+                return this._handleFileTreeEntries(entries);
+            }
+            files = $.makeArray(fileInput.prop('files'));
             if (!files.length) {
                 value = fileInput.prop('value');
                 if (!value) {
-                    return [];
+                    return $.Deferred().resolve([]).promise();
                 }
                 // If the files property is not available, the browser does not
                 // support the File API and we add a pseudo File object with
                 // the input value as name with path information removed:
                 files = [{name: value.replace(/^.*\\/, '')}];
+            } else if (files[0].name === undefined && files[0].fileName) {
+                // File normalization for Safari 4 and Firefox 3:
+                $.each(files, function (index, file) {
+                    file.name = file.fileName;
+                    file.size = file.fileSize;
+                });
             }
-            return files;
+            return $.Deferred().resolve(files).promise();
+        },
+
+        _getFileInputFiles: function (fileInput) {
+            if (!(fileInput instanceof $) || fileInput.length === 1) {
+                return this._getSingleFileInputFiles(fileInput);
+            }
+            return $.when.apply(
+                $,
+                $.map(fileInput, this._getSingleFileInputFiles)
+            ).then(function () {
+                return Array.prototype.concat.apply(
+                    [],
+                    arguments
+                );
+            });
         },
 
         _onChange: function (e) {
-            var that = e.data.fileupload,
+            var that = this,
                 data = {
                     fileInput: $(e.target),
                     form: $(e.target.form)
                 };
-            data.files = that._getFileInputFiles(data.fileInput);
-            if (that.options.replaceFileInput) {
-                that._replaceFileInput(data.fileInput);
-            }
-            if (that._trigger('change', e, data) === false ||
-                    that._onAdd(e, data) === false) {
-                return false;
-            }
+            this._getFileInputFiles(data.fileInput).always(function (files) {
+                data.files = files;
+                if (that.options.replaceFileInput) {
+                    that._replaceFileInput(data);
+                }
+                if (that._trigger(
+                        'change',
+                        $.Event('change', {delegatedEvent: e}),
+                        data
+                    ) !== false) {
+                    that._onAdd(e, data);
+                }
+            });
         },
 
         _onPaste: function (e) {
-            var that = e.data.fileupload,
-                cbd = e.originalEvent.clipboardData,
-                items = (cbd && cbd.items) || [],
+            var items = e.originalEvent && e.originalEvent.clipboardData &&
+                    e.originalEvent.clipboardData.items,
                 data = {files: []};
-            $.each(items, function (index, item) {
-                var file = item.getAsFile && item.getAsFile();
-                if (file) {
-                    data.files.push(file);
+            if (items && items.length) {
+                $.each(items, function (index, item) {
+                    var file = item.getAsFile && item.getAsFile();
+                    if (file) {
+                        data.files.push(file);
+                    }
+                });
+                if (this._trigger(
+                        'paste',
+                        $.Event('paste', {delegatedEvent: e}),
+                        data
+                    ) !== false) {
+                    this._onAdd(e, data);
                 }
-            });
-            if (that._trigger('paste', e, data) === false ||
-                    that._onAdd(e, data) === false) {
-                return false;
             }
         },
 
         _onDrop: function (e) {
-            var that = e.data.fileupload,
-                dataTransfer = e.dataTransfer = e.originalEvent.dataTransfer,
-                data = {
-                    files: $.each(
-                        $.makeArray(dataTransfer && dataTransfer.files),
-                        that._normalizeFile
-                    )
-                };
-            if (that._trigger('drop', e, data) === false ||
-                    that._onAdd(e, data) === false) {
-                return false;
+            e.dataTransfer = e.originalEvent && e.originalEvent.dataTransfer;
+            var that = this,
+                dataTransfer = e.dataTransfer,
+                data = {};
+            if (dataTransfer && dataTransfer.files && dataTransfer.files.length) {
+                e.preventDefault();
+                this._getDroppedFiles(dataTransfer).always(function (files) {
+                    data.files = files;
+                    if (that._trigger(
+                            'drop',
+                            $.Event('drop', {delegatedEvent: e}),
+                            data
+                        ) !== false) {
+                        that._onAdd(e, data);
+                    }
+                });
             }
-            e.preventDefault();
         },
 
-        _onDragOver: function (e) {
-            var that = e.data.fileupload,
-                dataTransfer = e.dataTransfer = e.originalEvent.dataTransfer;
-            if (that._trigger('dragover', e) === false) {
-                return false;
-            }
-            if (dataTransfer) {
-                dataTransfer.dropEffect = 'copy';
-            }
-            e.preventDefault();
-        },
+        _onDragOver: getDragHandler('dragover'),
+
+        _onDragEnter: getDragHandler('dragenter'),
+
+        _onDragLeave: getDragHandler('dragleave'),
 
         _initEventHandlers: function () {
-            var ns = this.options.namespace;
             if (this._isXHRUpload(this.options)) {
-                this.options.dropZone
-                    .bind('dragover.' + ns, {fileupload: this}, this._onDragOver)
-                    .bind('drop.' + ns, {fileupload: this}, this._onDrop)
-                    .bind('paste.' + ns, {fileupload: this}, this._onPaste);
+                this._on(this.options.dropZone, {
+                    dragover: this._onDragOver,
+                    drop: this._onDrop,
+                    // event.preventDefault() on dragenter is required for IE10+:
+                    dragenter: this._onDragEnter,
+                    // dragleave is not required, but added for completeness:
+                    dragleave: this._onDragLeave
+                });
+                this._on(this.options.pasteZone, {
+                    paste: this._onPaste
+                });
+            }
+            if ($.support.fileInput) {
+                this._on(this.options.fileInput, {
+                    change: this._onChange
+                });
             }
-            this.options.fileInput
-                .bind('change.' + ns, {fileupload: this}, this._onChange);
         },
 
         _destroyEventHandlers: function () {
-            var ns = this.options.namespace;
-            this.options.dropZone
-                .unbind('dragover.' + ns, this._onDragOver)
-                .unbind('drop.' + ns, this._onDrop)
-                .unbind('paste.' + ns, this._onPaste);
-            this.options.fileInput
-                .unbind('change.' + ns, this._onChange);
+            this._off(this.options.dropZone, 'dragenter dragleave dragover drop');
+            this._off(this.options.pasteZone, 'paste');
+            this._off(this.options.fileInput, 'change');
+        },
+
+        _destroy: function () {
+            this._destroyEventHandlers();
         },
 
         _setOption: function (key, value) {
-            var refresh = $.inArray(key, this._refreshOptionsList) !== -1;
-            if (refresh) {
+            var reinit = $.inArray(key, this._specialOptions) !== -1;
+            if (reinit) {
                 this._destroyEventHandlers();
             }
-            $.Widget.prototype._setOption.call(this, key, value);
-            if (refresh) {
+            this._super(key, value);
+            if (reinit) {
                 this._initSpecialOptions();
                 this._initEventHandlers();
             }
@@ -891,41 +1335,78 @@
         _initSpecialOptions: function () {
             var options = this.options;
             if (options.fileInput === undefined) {
-                options.fileInput = this.element.is('input:file') ?
-                        this.element : this.element.find('input:file');
+                options.fileInput = this.element.is('input[type="file"]') ?
+                        this.element : this.element.find('input[type="file"]');
             } else if (!(options.fileInput instanceof $)) {
                 options.fileInput = $(options.fileInput);
             }
             if (!(options.dropZone instanceof $)) {
                 options.dropZone = $(options.dropZone);
             }
+            if (!(options.pasteZone instanceof $)) {
+                options.pasteZone = $(options.pasteZone);
+            }
         },
 
-        _create: function () {
-            var options = this.options;
+        _getRegExp: function (str) {
+            var parts = str.split('/'),
+                modifiers = parts.pop();
+            parts.shift();
+            return new RegExp(parts.join('/'), modifiers);
+        },
+
+        _isRegExpOption: function (key, value) {
+            return key !== 'url' && $.type(value) === 'string' &&
+                /^\/.*\/[igm]{0,3}$/.test(value);
+        },
+
+        _initDataAttributes: function () {
+            var that = this,
+                options = this.options,
+                data = this.element.data();
             // Initialize options set via HTML5 data-attributes:
-            $.extend(options, $(this.element[0].cloneNode(false)).data());
-            options.namespace = options.namespace || this.widgetName;
+            $.each(
+                this.element[0].attributes,
+                function (index, attr) {
+                    var key = attr.name.toLowerCase(),
+                        value;
+                    if (/^data-/.test(key)) {
+                        // Convert hyphen-ated key to camelCase:
+                        key = key.slice(5).replace(/-[a-z]/g, function (str) {
+                            return str.charAt(1).toUpperCase();
+                        });
+                        value = data[key];
+                        if (that._isRegExpOption(key, value)) {
+                            value = that._getRegExp(value);
+                        }
+                        options[key] = value;
+                    }
+                }
+            );
+        },
+
+        _create: function () {
+            this._initDataAttributes();
             this._initSpecialOptions();
             this._slots = [];
             this._sequence = this._getXHRPromise(true);
-            this._sending = this._active = this._loaded = this._total = 0;
+            this._sending = this._active = 0;
+            this._initProgressObject(this);
             this._initEventHandlers();
         },
 
-        destroy: function () {
-            this._destroyEventHandlers();
-            $.Widget.prototype.destroy.call(this);
-        },
-
-        enable: function () {
-            $.Widget.prototype.enable.call(this);
-            this._initEventHandlers();
+        // This method is exposed to the widget API and allows to query
+        // the number of active uploads:
+        active: function () {
+            return this._active;
         },
 
-        disable: function () {
-            this._destroyEventHandlers();
-            $.Widget.prototype.disable.call(this);
+        // This method is exposed to the widget API and allows to query
+        // the widget upload progress.
+        // It returns an object with loaded, total and bitrate properties
+        // for the running uploads:
+        progress: function () {
+            return this._progress;
         },
 
         // This method is exposed to the widget API and allows adding files
@@ -933,29 +1414,66 @@
         // must have a files property and can contain additional options:
         // .fileupload('add', {files: filesList});
         add: function (data) {
+            var that = this;
             if (!data || this.options.disabled) {
                 return;
             }
             if (data.fileInput && !data.files) {
-                data.files = this._getFileInputFiles(data.fileInput);
+                this._getFileInputFiles(data.fileInput).always(function (files) {
+                    data.files = files;
+                    that._onAdd(null, data);
+                });
             } else {
-                data.files = $.each($.makeArray(data.files), this._normalizeFile);
+                data.files = $.makeArray(data.files);
+                this._onAdd(null, data);
             }
-            this._onAdd(null, data);
         },
 
         // This method is exposed to the widget API and allows sending files
         // using the fileupload API. The data parameter accepts an object which
-        // must have a files property and can contain additional options:
+        // must have a files or fileInput property and can contain additional options:
         // .fileupload('send', {files: filesList});
         // The method returns a Promise object for the file upload call.
         send: function (data) {
             if (data && !this.options.disabled) {
                 if (data.fileInput && !data.files) {
-                    data.files = this._getFileInputFiles(data.fileInput);
-                } else {
-                    data.files = $.each($.makeArray(data.files), this._normalizeFile);
+                    var that = this,
+                        dfd = $.Deferred(),
+                        promise = dfd.promise(),
+                        jqXHR,
+                        aborted;
+                    promise.abort = function () {
+                        aborted = true;
+                        if (jqXHR) {
+                            return jqXHR.abort();
+                        }
+                        dfd.reject(null, 'abort', 'abort');
+                        return promise;
+                    };
+                    this._getFileInputFiles(data.fileInput).always(
+                        function (files) {
+                            if (aborted) {
+                                return;
+                            }
+                            if (!files.length) {
+                                dfd.reject();
+                                return;
+                            }
+                            data.files = files;
+                            jqXHR = that._onSend(null, data);
+                            jqXHR.then(
+                                function (result, textStatus, jqXHR) {
+                                    dfd.resolve(result, textStatus, jqXHR);
+                                },
+                                function (jqXHR, textStatus, errorThrown) {
+                                    dfd.reject(jqXHR, textStatus, errorThrown);
+                                }
+                            );
+                        }
+                    );
+                    return this._enhancePromise(promise);
                 }
+                data.files = $.makeArray(data.files);
                 if (data.files.length) {
                     return this._onSend(null, data);
                 }
diff --git a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js
index 04a5662308..8d25c46415 100644
--- a/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js
+++ b/www/include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js
@@ -1,22 +1,24 @@
 /*
- * jQuery Iframe Transport Plugin 1.4
+ * jQuery Iframe Transport Plugin
  * https://github.com/blueimp/jQuery-File-Upload
  *
  * Copyright 2011, Sebastian Tschan
  * https://blueimp.net
  *
  * Licensed under the MIT license:
- * http://www.opensource.org/licenses/MIT
+ * https://opensource.org/licenses/MIT
  */
 
-/*jslint unparam: true, nomen: true */
-/*global define, window, document */
+/* global define, require, window, document, JSON */
 
-(function (factory) {
+;(function (factory) {
     'use strict';
     if (typeof define === 'function' && define.amd) {
         // Register as an anonymous AMD module:
         define(['jquery'], factory);
+    } else if (typeof exports === 'object') {
+        // Node/CommonJS:
+        factory(require('jquery'));
     } else {
         // Browser globals:
         factory(window.jQuery);
@@ -25,9 +27,16 @@
     'use strict';
 
     // Helper variable to create unique names for the transport iframes:
-    var counter = 0;
+    var counter = 0,
+        jsonAPI = $,
+        jsonParse = 'parseJSON';
 
-    // The iframe transport accepts three additional options:
+    if ('JSON' in window && 'parse' in JSON) {
+      jsonAPI = JSON;
+      jsonParse = 'parse';
+    }
+
+    // The iframe transport accepts four additional options:
     // options.fileInput: a jQuery collection of file input fields
     // options.paramName: the parameter name for the file form data,
     //  overrides the name property of the file input field(s),
@@ -35,21 +44,41 @@
     // options.formData: an array of objects with name and value properties,
     //  equivalent to the return data of .serializeArray(), e.g.:
     //  [{name: 'a', value: 1}, {name: 'b', value: 2}]
+    // options.initialIframeSrc: the URL of the initial iframe src,
+    //  by default set to "javascript:false;"
     $.ajaxTransport('iframe', function (options) {
-        if (options.async && (options.type === 'POST' || options.type === 'GET')) {
-            var form,
-                iframe;
+        if (options.async) {
+            // javascript:false as initial iframe src
+            // prevents warning popups on HTTPS in IE6:
+            /*jshint scripturl: true */
+            var initialIframeSrc = options.initialIframeSrc || 'javascript:false;',
+            /*jshint scripturl: false */
+                form,
+                iframe,
+                addParamChar;
             return {
                 send: function (_, completeCallback) {
                     form = $('<form style="display:none;"></form>');
-                    // javascript:false as initial iframe src
-                    // prevents warning popups on HTTPS in IE6.
+                    form.attr('accept-charset', options.formAcceptCharset);
+                    addParamChar = /\?/.test(options.url) ? '&' : '?';
+                    // XDomainRequest only supports GET and POST:
+                    if (options.type === 'DELETE') {
+                        options.url = options.url + addParamChar + '_method=DELETE';
+                        options.type = 'POST';
+                    } else if (options.type === 'PUT') {
+                        options.url = options.url + addParamChar + '_method=PUT';
+                        options.type = 'POST';
+                    } else if (options.type === 'PATCH') {
+                        options.url = options.url + addParamChar + '_method=PATCH';
+                        options.type = 'POST';
+                    }
                     // IE versions below IE8 cannot set the name property of
                     // elements that have already been added to the DOM,
                     // so we set the name along with the iframe HTML markup:
+                    counter += 1;
                     iframe = $(
-                        '<iframe src="javascript:false;" name="iframe-transport-' +
-                            (counter += 1) + '"></iframe>'
+                        '<iframe src="' + initialIframeSrc +
+                            '" name="iframe-transport-' + counter + '"></iframe>'
                     ).bind('load', function () {
                         var fileInputClones,
                             paramNames = $.isArray(options.paramName) ?
@@ -80,9 +109,14 @@
                                 );
                                 // Fix for IE endless progress bar activity bug
                                 // (happens on form submits to iframe targets):
-                                $('<iframe src="javascript:false;"></iframe>')
+                                $('<iframe src="' + initialIframeSrc + '"></iframe>')
                                     .appendTo(form);
-                                form.remove();
+                                window.setTimeout(function () {
+                                    // Removing the form in a setTimeout call
+                                    // allows Chrome's developer tools to display
+                                    // the response result
+                                    form.remove();
+                                }, 0);
                             });
                         form
                             .prop('target', iframe.prop('name'))
@@ -118,6 +152,8 @@
                                 .prop('enctype', 'multipart/form-data')
                                 // enctype must be set as encoding for IE:
                                 .prop('encoding', 'multipart/form-data');
+                            // Remove the HTML5 form attribute from the input(s):
+                            options.fileInput.removeAttr('form');
                         }
                         form.submit();
                         // Insert the file input fields at their original location
@@ -125,7 +161,10 @@
                         if (fileInputClones && fileInputClones.length) {
                             options.fileInput.each(function (index, input) {
                                 var clone = $(fileInputClones[index]);
-                                $(input).prop('name', clone.prop('name'));
+                                // Restore the original name and form properties:
+                                $(input)
+                                    .prop('name', clone.prop('name'))
+                                    .attr('form', clone.attr('form'));
                                 clone.replaceWith(input);
                             });
                         }
@@ -139,7 +178,7 @@
                         // concat is used to avoid the "Script URL" JSLint error:
                         iframe
                             .unbind('load')
-                            .prop('src', 'javascript'.concat(':false;'));
+                            .prop('src', initialIframeSrc);
                     }
                     if (form) {
                         form.remove();
@@ -150,20 +189,34 @@
     });
 
     // The iframe transport returns the iframe content document as response.
-    // The following adds converters from iframe to text, json, html, and script:
+    // The following adds converters from iframe to text, json, html, xml
+    // and script.
+    // Please note that the Content-Type for JSON responses has to be text/plain
+    // or text/html, if the browser doesn't include application/json in the
+    // Accept header, else IE will show a download dialog.
+    // The Content-Type for XML responses on the other hand has to be always
+    // application/xml or text/xml, so IE properly parses the XML response.
+    // See also
+    // https://github.com/blueimp/jQuery-File-Upload/wiki/Setup#content-type-negotiation
     $.ajaxSetup({
         converters: {
             'iframe text': function (iframe) {
-                return $(iframe[0].body).text();
+                return iframe && $(iframe[0].body).text();
             },
             'iframe json': function (iframe) {
-                return $.parseJSON($(iframe[0].body).text());
+                return iframe && jsonAPI[jsonParse]($(iframe[0].body).text());
             },
             'iframe html': function (iframe) {
-                return $(iframe[0].body).html();
+                return iframe && $(iframe[0].body).html();
+            },
+            'iframe xml': function (iframe) {
+                var xmlDoc = iframe && iframe[0];
+                return xmlDoc && $.isXMLDoc(xmlDoc) ? xmlDoc :
+                        $.parseXML((xmlDoc.XMLDocument && xmlDoc.XMLDocument.xml) ||
+                            $(xmlDoc.body).html());
             },
             'iframe script': function (iframe) {
-                return $.globalEval($(iframe[0].body).text());
+                return iframe && $.globalEval($(iframe[0].body).text());
             }
         }
     });
diff --git a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css
index 018e7bd0eb..8867fc6f1b 100644
--- a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css
+++ b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.css
@@ -1 +1 @@
-/*!* qTip2 - Pretty powerful tooltips * http://craigsworks.com/projects/qtip2/ * * Version:nightly * Copyright 2009-2010 Craig Michael Thompson - http://craigsworks.com * * Dual licensed under MIT or GPLv2 licenses * http://en.wikipedia.org/wiki/MIT_License * http://en.wikipedia.org/wiki/GNU_General_Public_License * * Date:Sun Jul 15 16:44:57.0000000000 2012 */ .ui-tooltip,.qtip{position:absolute;left:-28000px;top:-28000px;display:none;max-width:280px;min-width:50px;font-size:10.5px;line-height:12px;border-width:1px;border-style:solid;}.ui-tooltip-fluid{display:block;visibility:hidden;position:static!important;float:left!important;}.ui-tooltip-content{position:relative;padding:5px 9px;overflow:hidden;text-align:left;word-wrap:break-word;overflow:hidden;}.ui-tooltip-titlebar{position:relative;min-height:14px;padding:5px 35px 5px 10px;overflow:hidden;border-width:0 0 1px;font-weight:bold;}.ui-tooltip-titlebar+.ui-tooltip-content{border-top-width:0!important;}/*!Default close button class */ .ui-tooltip-titlebar .ui-state-default{position:absolute;right:4px;top:50%;margin-top:-9px;cursor:pointer;outline:medium none;border-width:1px;border-style:solid;}* html .ui-tooltip-titlebar .ui-state-default{top:16px;}.ui-tooltip-titlebar .ui-icon,.ui-tooltip-icon .ui-icon{display:block;text-indent:-1000em;}.ui-tooltip-icon,.ui-tooltip-icon .ui-icon{-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px;text-decoration:none;}.ui-tooltip-icon .ui-icon{width:18px;height:14px;text-align:center;text-indent:0;font:normal bold 10px/13px Tahoma,sans-serif;color:inherit;background:transparent none no-repeat -100em -100em;}/*!Default tooltip style */ .ui-tooltip-default{border-color:#F1D031;background-color:#FFFFA3;color:#555;}.ui-tooltip-default .ui-tooltip-titlebar{background-color:#FFEF93;}.ui-tooltip-default .ui-tooltip-icon{border-color:#CCC;background:#F1F1F1;color:#777;}.ui-tooltip-default .ui-tooltip-titlebar .ui-state-hover{border-color:#AAA;color:#111;}#qtip-overlay{position:fixed;left:-10000em;top:-10000em;}#qtip-overlay.blurs{cursor:pointer;}#qtip-overlay div{position:absolute;left:0;top:0;width:100%;height:100%;background-color:black;opacity:.7;filter:alpha(opacity=70);-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=70)";}.ui-tooltip .ui-tooltip-tip{margin:0 auto;overflow:hidden;z-index:10;}.ui-tooltip .ui-tooltip-tip,.ui-tooltip .ui-tooltip-tip *{position:absolute;line-height:.1px!important;font-size:.1px!important;color:#123456;background:transparent;border:0 dashed transparent;}.ui-tooltip .ui-tooltip-tip canvas{top:0;left:0;}/*!Light tooltip style */ .ui-tooltip-light{background-color:white;border-color:#E2E2E2;color:#454545;}.ui-tooltip-light .ui-tooltip-titlebar{background-color:#f1f1f1;}/*!Dark tooltip style */ .ui-tooltip-dark{background-color:#505050;border-color:#303030;color:#f3f3f3;}.ui-tooltip-dark .ui-tooltip-titlebar{background-color:#404040;}.ui-tooltip-dark .ui-tooltip-icon{border-color:#444;}.ui-tooltip-dark .ui-tooltip-titlebar .ui-state-hover{border-color:#303030;}/*!Cream tooltip style */ .ui-tooltip-cream{background-color:#FBF7AA;border-color:#F9E98E;color:#A27D35;}.ui-tooltip-cream .ui-tooltip-titlebar{background-color:#F0DE7D;}.ui-tooltip-cream .ui-state-default .ui-tooltip-icon{background-position:-82px 0;}/*!Red tooltip style */ .ui-tooltip-red{background-color:#F78B83;border-color:#D95252;color:#912323;}.ui-tooltip-red .ui-tooltip-titlebar{background-color:#F06D65;}.ui-tooltip-red .ui-state-default .ui-tooltip-icon{background-position:-102px 0;}.ui-tooltip-red .ui-tooltip-icon{border-color:#D95252;}.ui-tooltip-red .ui-tooltip-titlebar .ui-state-hover{border-color:#D95252;}/*!Green tooltip style */ .ui-tooltip-green{background-color:#CAED9E;border-color:#90D93F;color:#3F6219;}.ui-tooltip-green .ui-tooltip-titlebar{background-color:#B0DE78;}.ui-tooltip-green .ui-state-default .ui-tooltip-icon{background-position:-42px 0;}/*!Blue tooltip style */ .ui-tooltip-blue{background-color:#E5F6FE;border-color:#ADD9ED;color:#5E99BD;}.ui-tooltip-blue .ui-tooltip-titlebar{background-color:#D0E9F5;}.ui-tooltip-blue .ui-state-default .ui-tooltip-icon{background-position:-2px 0;}/*!Add shadows to your tooltips in:FF3+,Chrome 2+,Opera 10.6+,IE9+,Safari 2+*/ .ui-tooltip-shadow{-webkit-box-shadow:1px 1px 3px 1px rgba(0,0,0,0.15);-moz-box-shadow:1px 1px 3px 1px rgba(0,0,0,0.15);box-shadow:1px 1px 3px 1px rgba(0,0,0,0.15);}/*!Add rounded corners to your tooltips in:FF3+,Chrome 2+,Opera 10.6+,IE9+,Safari 2+*/ .ui-tooltip-rounded,.ui-tooltip-tipsy,.ui-tooltip-bootstrap{-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px;}/*!Youtube tooltip style */ .ui-tooltip-youtube{-moz-border-radius:2px;-webkit-border-radius:2px;border-radius:2px;-webkit-box-shadow:0 0 3px #333;-moz-box-shadow:0 0 3px #333;box-shadow:0 0 3px #333;color:white;border-width:0;background:#4A4A4A;background-image:-moz-linear-gradient(top,#4A4A4A 0,black 100%);background-image:-ms-linear-gradient(top,#4A4A4A 0,black 100%);background-image:-o-linear-gradient(top,#4A4A4A 0,black 100%);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#4A4A4A),color-stop(100%,black));background-image:-webkit-linear-gradient(top,#4A4A4A 0,black 100%);background-image:linear-gradient(to bottom,#4A4A4A 0,black 100%);}.ui-tooltip-youtube .ui-tooltip-titlebar{background-color:#4A4A4A;background-color:rgba(0,0,0,0);}.ui-tooltip-youtube .ui-tooltip-content{padding:.75em;font:12px arial,sans-serif;filter:progid:DXImageTransform.Microsoft.Gradient(GradientType=0,StartColorStr=#4a4a4a,EndColorStr=#000000);-ms-filter:"progid:DXImageTransform.Microsoft.Gradient(GradientType=0,StartColorStr=#4a4a4a,EndColorStr=#000000);";}.ui-tooltip-youtube .ui-tooltip-icon{border-color:#222;}.ui-tooltip-youtube .ui-tooltip-titlebar .ui-state-hover{border-color:#303030;}.ui-tooltip-jtools{background:#232323;background:rgba(0,0,0,0.7);background-image:-moz-linear-gradient(top,#717171,#232323);background-image:-webkit-gradient(linear,left top,left bottom,from(#717171),to(#232323));border:2px solid #ddd;border:2px solid rgba(241,241,241,1);-moz-border-radius:2px;-webkit-border-radius:2px;border-radius:2px;-webkit-box-shadow:0 0 12px #333;-moz-box-shadow:0 0 12px #333;box-shadow:0 0 12px #333;}.ui-tooltip-jtools .ui-tooltip-titlebar{background-color:transparent;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr=#717171,endColorstr=#4A4A4A);-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#717171,endColorstr=#4A4A4A)";}.ui-tooltip-jtools .ui-tooltip-content{filter:progid:DXImageTransform.Microsoft.gradient(startColorstr=#4A4A4A,endColorstr=#232323);-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#4A4A4A,endColorstr=#232323)";}.ui-tooltip-jtools .ui-tooltip-titlebar,.ui-tooltip-jtools .ui-tooltip-content{background:transparent;color:white;border:0 dashed transparent;}.ui-tooltip-jtools .ui-tooltip-icon{border-color:#555;}.ui-tooltip-jtools .ui-tooltip-titlebar .ui-state-hover{border-color:#333;}.ui-tooltip-cluetip{-webkit-box-shadow:4px 4px 5px rgba(0,0,0,0.4);-moz-box-shadow:4px 4px 5px rgba(0,0,0,0.4);box-shadow:4px 4px 5px rgba(0,0,0,0.4);background-color:#D9D9C2;color:#111;border:0 dashed transparent;}.ui-tooltip-cluetip .ui-tooltip-titlebar{background-color:#87876A;color:white;border:0 dashed transparent;}.ui-tooltip-cluetip .ui-tooltip-icon{border-color:#808064;}.ui-tooltip-cluetip .ui-tooltip-titlebar .ui-state-hover{border-color:#696952;color:#696952;}.ui-tooltip-tipsy{background:black;background:rgba(0,0,0,.87);color:white;border:0 solid transparent;font-size:11px;font-family:'Lucida Grande',sans-serif;font-weight:bold;line-height:16px;text-shadow:0 1px black;}.ui-tooltip-tipsy .ui-tooltip-titlebar{padding:6px 35px 0 10;background-color:transparent;}.ui-tooltip-tipsy .ui-tooltip-content{padding:6px 10;}.ui-tooltip-tipsy .ui-tooltip-icon{border-color:#222;text-shadow:none;}.ui-tooltip-tipsy .ui-tooltip-titlebar .ui-state-hover{border-color:#303030;}.ui-tooltip-tipped{border:3px solid #959FA9;-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px;background-color:#F9F9F9;color:#454545;font-weight:normal;font-family:serif;}.ui-tooltip-tipped .ui-tooltip-titlebar{border-bottom-width:0;color:white;background:#3A79B8;background-image:-moz-linear-gradient(top,#3A79B8,#2E629D);background-image:-webkit-gradient(linear,left top,left bottom,from(#3A79B8),to(#2E629D));filter:progid:DXImageTransform.Microsoft.gradient(startColorstr=#3A79B8,endColorstr=#2E629D);-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#3A79B8,endColorstr=#2E629D)";}.ui-tooltip-tipped .ui-tooltip-icon{border:2px solid #285589;background:#285589;}.ui-tooltip-tipped .ui-tooltip-icon .ui-icon{background-color:#FBFBFB;color:#555;}.ui-tooltip-bootstrap{font-size:13px;line-height:18px;color:#333;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);*border-right-width:2px;*border-bottom-width:2px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,0.2);-moz-box-shadow:0 5px 10px rgba(0,0,0,0.2);box-shadow:0 5px 10px rgba(0,0,0,0.2);-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box;}.ui-tooltip-bootstrap .ui-tooltip-titlebar{font-size:18px;line-height:22px;border-bottom:1px solid #ccc;background-color:transparent;}.ui-tooltip-bootstrap .ui-tooltip-titlebar .ui-state-default{right:9px;top:49%;border-style:none;}.ui-tooltip-bootstrap .ui-tooltip-icon{background:white;}.ui-tooltip-bootstrap .ui-tooltip-icon .ui-icon{width:auto;height:auto;float:right;font-size:20px;font-weight:bold;line-height:18px;color:#000;text-shadow:0 1px 0 #fff;opacity:.2;filter:alpha(opacity=20);}.ui-tooltip-bootstrap .ui-tooltip-icon .ui-icon:hover{color:#000;text-decoration:none;cursor:pointer;opacity:.4;filter:alpha(opacity=40);}.ui-tooltip:not(.ie9haxors) div.ui-tooltip-content,.ui-tooltip:not(.ie9haxors) div.ui-tooltip-titlebar{filter:none;-ms-filter:none;}
\ No newline at end of file
+.qtip{position:absolute;left:-28000px;top:-28000px;display:none;max-width:280px;min-width:50px;font-size:10.5px;line-height:12px;direction:ltr;box-shadow:none;padding:0}.qtip-content,.qtip-titlebar{position:relative;overflow:hidden}.qtip-content{padding:5px 9px;text-align:left;word-wrap:break-word}.qtip-titlebar{padding:5px 35px 5px 10px;border-width:0 0 1px;font-weight:700}.qtip-titlebar+.qtip-content{border-top-width:0!important}.qtip-close{position:absolute;right:-9px;top:-9px;z-index:11;cursor:pointer;outline:0;border:1px solid transparent}.qtip-titlebar .qtip-close{right:4px;top:50%;margin-top:-9px}* html .qtip-titlebar .qtip-close{top:16px}.qtip-icon .ui-icon,.qtip-titlebar .ui-icon{display:block;text-indent:-1000em;direction:ltr}.qtip-icon,.qtip-icon .ui-icon{-moz-border-radius:3px;-webkit-border-radius:3px;border-radius:3px;text-decoration:none}.qtip-icon .ui-icon{width:18px;height:14px;line-height:14px;text-align:center;text-indent:0;font:normal 700 10px/13px Tahoma,sans-serif;color:inherit;background:-100em -100em no-repeat}.qtip-default{border:1px solid #F1D031;background-color:#FFFFA3;color:#555}.qtip-default .qtip-titlebar{background-color:#FFEF93}.qtip-default .qtip-icon{border-color:#CCC;background:#F1F1F1;color:#777}.qtip-default .qtip-titlebar .qtip-close{border-color:#AAA;color:#111}
\ No newline at end of file
diff --git a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js
index 4c35809daa..f552227f97 100644
--- a/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js
+++ b/www/include/common/javascript/jquery/plugins/qtip/jquery-qtip.js
@@ -1,13 +1,4 @@
-/*!
-* qTip2 - Pretty powerful tooltips
-* http://craigsworks.com/projects/qtip2/
-*
-* Version: nightly
-* Copyright 2009-2010 Craig Michael Thompson - http://craigsworks.com
-*
-* Dual licensed under MIT or GPLv2 licenses
-*   http://en.wikipedia.org/wiki/MIT_License
-*   http://en.wikipedia.org/wiki/GNU_General_Public_License
-*
-* Date: Sun Jul 15 16:44:57.0000000000 2012
-*//*jslint browser: true, onevar: true, undef: true, nomen: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: true *//*global window: false, jQuery: false, console: false, define: false */(function(a){typeof define==="function"&&define.amd?define(["jquery"],a):jQuery&&!jQuery.fn.qtip&&a(jQuery)})(function(a){function P(b){var c=this,d=b.elements,e=d.tooltip,f=".bgiframe-"+b.id;a.extend(c,{init:function(){d.bgiframe=a('<iframe class="ui-tooltip-bgiframe" frameborder="0" tabindex="-1" src="javascript:\'\';"  style="display:block; position:absolute; z-index:-1; filter:alpha(opacity=0); -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";"></iframe>'),d.bgiframe.appendTo(e),e.bind("tooltipmove"+f,c.adjust)},adjust:function(){var a=b.get("dimensions"),c=b.plugins.tip,f=d.tip,g,h;h=parseInt(e.css("border-left-width"),10)||0,h={left:-h,top:-h},c&&f&&(g=c.corner.precedance==="x"?["width","left"]:["height","top"],h[g[1]]-=f[g[0]]()),d.bgiframe.css(h).css(a)},destroy:function(){d.bgiframe.remove(),e.unbind(f)}}),c.init()}function O(o,p){function I(a){var b=a.precedance===g,c=x[b?h:i],d=x[b?i:h],e=a.string().indexOf(n)>-1,f=c*(e?.5:1),j=Math.pow,k=Math.round,l,m,o,p=Math.sqrt(j(f,2)+j(d,2)),q=[z/f*p,z/d*p];q[2]=Math.sqrt(j(q[0],2)-j(z,2)),q[3]=Math.sqrt(j(q[1],2)-j(z,2)),l=p+q[2]+q[3]+(e?0:q[0]),m=l/p,o=[k(m*d),k(m*c)];return{height:o[b?0:1],width:o[b?1:0]}}function H(b){var c=u.titlebar&&b.y===j,d=c?u.titlebar:u.content,e=a.browser.mozilla,f=e?"-moz-":a.browser.webkit?"-webkit-":"",g=b.y+(e?"":"-")+b.x,h=f+(e?"border-radius-"+g:"border-"+g+"-radius");return parseInt(d.css(h),10)||parseInt(v.css(h),10)||0}function G(a,b,c){b=b?b:a[a.precedance];var d=v.hasClass(C),e=u.titlebar&&a.y===j,f=e?u.titlebar:u.tooltip,g="border-"+b+"-width",h;v.addClass(C),h=parseInt(f.css(g),10),h=(c?h||parseInt(v.css(g),10):h)||0,v.toggleClass(C,d);return h}function F(a,d,h,i){if(u.tip){var p=r.corner.clone(),s=h.adjusted,v=o.options.position.adjust.method.split(" "),x=v[0],y=v[1]||v[0],z={left:c,top:c,x:0,y:0},A,B={},C;r.corner.fixed!==b&&(x===q&&p.precedance===f&&s.left&&p.y!==n?p.precedance=p.precedance===f?g:f:x!==q&&s.left&&(p.x=p.x===n?s.left>0?k:m:p.x===k?m:k),y===q&&p.precedance===g&&s.top&&p.x!==n?p.precedance=p.precedance===g?f:g:y!==q&&s.top&&(p.y=p.y===n?s.top>0?j:l:p.y===j?l:j),p.string()!==w.corner.string()&&(w.top!==s.top||w.left!==s.left)&&r.update(p,c)),A=r.position(p,s),A[p.x]+=G(p,p.x,b),A[p.y]+=G(p,p.y,b),A.right!==e&&(A.left=-A.right),A.bottom!==e&&(A.top=-A.bottom),A.user=Math.max(0,t.offset);if(z.left=x===q&&!!s.left)p.x===n?B["margin-left"]=z.x=A["margin-left"]-s.left:(C=A.right!==e?[s.left,-A.left]:[-s.left,A.left],(z.x=Math.max(C[0],C[1]))>C[0]&&(h.left-=s.left,z.left=c),B[A.right!==e?m:k]=z.x);if(z.top=y===q&&!!s.top)p.y===n?B["margin-top"]=z.y=A["margin-top"]-s.top:(C=A.bottom!==e?[s.top,-A.top]:[-s.top,A.top],(z.y=Math.max(C[0],C[1]))>C[0]&&(h.top-=s.top,z.top=c),B[A.bottom!==e?l:j]=z.y);u.tip.css(B).toggle(!(z.x&&z.y||p.x===n&&z.y||p.y===n&&z.x)),h.left-=A.left.charAt?A.user:x!==q||z.top||!z.left&&!z.top?A.left:0,h.top-=A.top.charAt?A.user:y!==q||z.left||!z.left&&!z.top?A.top:0,w.left=s.left,w.top=s.top,w.corner=p.clone()}}function E(){x.width=t.width,x.height=t.height}function D(){x.width=t.height,x.height=t.width}var r=this,t=o.options.style.tip,u=o.elements,v=u.tooltip,w={top:0,left:0},x={width:t.width,height:t.height},y={},z=t.border||0,A=".qtip-tip",B=!!(a("<canvas />")[0]||{}).getContext;r.mimic=r.corner=d,r.border=z,r.offset=t.offset,r.size=x,o.checks.tip={"^position.my|style.tip.(corner|mimic|border)$":function(){r.init()||r.destroy(),o.reposition()},"^style.tip.(height|width)$":function(){x={width:t.width,height:t.height},r.create(),r.update(),o.reposition()},"^content.title.text|style.(classes|widget)$":function(){u.tip&&u.tip.length&&r.update()}},a.extend(r,{init:function(){var b=r.detectCorner()&&(B||a.browser.msie);b&&(r.create(),r.update(),v.unbind(A).bind("tooltipmove"+A,F));return b},detectCorner:function(){var a=t.corner,d=o.options.position,e=d.at,f=d.my.string?d.my.string():d.my;if(a===c||f===c&&e===c)return c;a===b?r.corner=new s.Corner(f):a.string||(r.corner=new s.Corner(a),r.corner.fixed=b),w.corner=new s.Corner(r.corner.string());return r.corner.string()!=="centercenter"},detectColours:function(b){var c,d,e,f=u.tip.css("cssText",""),g=b||r.corner,h=g[g.precedance],i="border-"+h+"-color",k="border"+h.charAt(0)+h.substr(1)+"Color",l=/rgba?\(0, 0, 0(, 0)?\)|transparent|#123456/i,m="background-color",o="transparent",p=" !important",q=u.titlebar&&(g.y===j||g.y===n&&f.position().top+x.height/2+t.offset<u.titlebar.outerHeight(1)),s=q?u.titlebar:u.tooltip;v.addClass(C),y.fill=d=f.css(m),y.border=e=f[0].style[k]||f.css(i)||v.css(i);if(!d||l.test(d))y.fill=s.css(m)||o,l.test(y.fill)&&(y.fill=v.css(m)||d);if(!e||l.test(e)||e===a(document.body).css("color")){y.border=s.css(i)||o;if(l.test(y.border)||y.border===s.css("color"))y.border=v.css(i)||v.css(k)||e}a("*",f).add(f).css("cssText",m+":"+o+p+";border:0"+p+";"),v.removeClass(C)},create:function(){var b=x.width,c=x.height,d;u.tip&&u.tip.remove(),u.tip=a("<div />",{"class":"ui-tooltip-tip"}).css({width:b,height:c}).prependTo(v),B?a("<canvas />").appendTo(u.tip)[0].getContext("2d").save():(d='<vml:shape coordorigin="0,0" style="display:inline-block; position:absolute; behavior:url(#default#VML);"></vml:shape>',u.tip.html(d+d),a("*",u.tip).bind("click mousedown",function(a){a.stopPropagation()}))},update:function(e,h){var i=u.tip,o=i.children(),p=x.width,q=x.height,A="px solid ",C="px dashed transparent",F=t.mimic,H=Math.round,J,K,L,M,O;e||(e=w.corner||r.corner),F===c?F=e:(F=new s.Corner(F),F.precedance=e.precedance,F.x==="inherit"?F.x=e.x:F.y==="inherit"?F.y=e.y:F.x===F.y&&(F[e.precedance]=e[e.precedance])),J=F.precedance,e.precedance===f?D():E(),u.tip.css({width:p=x.width,height:q=x.height}),r.detectColours(e),y.border!=="transparent"?(z=G(e,d,b),t.border===0&&z>0&&(y.fill=y.border),r.border=z=t.border!==b?t.border:z):r.border=z=0,L=N(F,p,q),r.size=O=I(e),i.css(O),e.precedance===g?M=[H(F.x===k?z:F.x===m?O.width-p-z:(O.width-p)/2),H(F.y===j?O.height-q:0)]:M=[H(F.x===k?O.width-p:0),H(F.y===j?z:F.y===l?O.height-q-z:(O.height-q)/2)],B?(o.attr(O),K=o[0].getContext("2d"),K.restore(),K.save(),K.clearRect(0,0,3e3,3e3),K.fillStyle=y.fill,K.strokeStyle=y.border,K.lineWidth=z*2,K.lineJoin="miter",K.miterLimit=100,K.translate(M[0],M[1]),K.beginPath(),K.moveTo(L[0][0],L[0][1]),K.lineTo(L[1][0],L[1][1]),K.lineTo(L[2][0],L[2][1]),K.closePath(),z&&(v.css("background-clip")==="border-box"&&(K.strokeStyle=y.fill,K.stroke()),K.strokeStyle=y.border,K.stroke()),K.fill()):(L="m"+L[0][0]+","+L[0][1]+" l"+L[1][0]+","+L[1][1]+" "+L[2][0]+","+L[2][1]+" xe",M[2]=z&&/^(r|b)/i.test(e.string())?parseFloat(a.browser.version,10)===8?2:1:0,o.css({antialias:""+(F.string().indexOf(n)>-1),left:M[0]-M[2]*Number(J===f),top:M[1]-M[2]*Number(J===g),width:p+z,height:q+z}).each(function(b){var c=a(this);c[c.prop?"prop":"attr"]({coordsize:p+z+" "+(q+z),path:L,fillcolor:y.fill,filled:!!b,stroked:!b}).css({display:z||b?"block":"none"}),!b&&c.html()===""&&c.html('<vml:stroke weight="'+z*2+'px" color="'+y.border+'" miterlimit="1000" joinstyle="miter"  style="behavior:url(#default#VML); display:inline-block;" />')})),h!==c&&r.position(e)},position:function(b){var d=u.tip,e={},l=Math.max(0,t.offset),m,o,p;if(t.corner===c||!d)return c;b=b||r.corner,m=b.precedance,o=I(b),p=[b.x,b.y],m===f&&p.reverse(),a.each(p,function(a,c){var d,f;c===n?(d=m===g?k:j,e[d]="50%",e["margin-"+d]=-Math.round(o[m===g?h:i]/2)+l):(d=G(b,c),f=H(b),e[c]=a?0:l+(f>d?f:-d))}),e[b[m]]-=o[m===f?h:i],d.css({top:"",bottom:"",left:"",right:"",margin:""}).css(e);return e},destroy:function(){u.tip&&u.tip.remove(),u.tip=!1,v.unbind(A)}}),r.init()}function N(a,b,c){var d=Math.ceil(b/2),e=Math.ceil(c/2),f={bottomright:[[0,0],[b,c],[b,0]],bottomleft:[[0,0],[b,0],[0,c]],topright:[[0,c],[b,0],[b,c]],topleft:[[0,0],[0,c],[b,c]],topcenter:[[0,c],[d,0],[b,c]],bottomcenter:[[0,0],[b,0],[d,c]],rightcenter:[[0,0],[b,e],[0,c]],leftcenter:[[b,0],[b,c],[0,e]]};f.lefttop=f.bottomright,f.righttop=f.bottomleft,f.leftbottom=f.topright,f.rightbottom=f.topleft;return f[a.string()]}function M(d){function t(b){var d=a(b.target),e=d.closest(".qtip"),f;f=e.length<1?c:parseInt(e[0].style.zIndex,10)>parseInt(h[0].style.zIndex,10),!f&&a(b.target).closest(y)[0]!==h[0]&&r(d)}function r(a){o.length<1&&a.length?a.not("body").blur():o.first().focus()}function q(){o=a(n,h).not("[disabled]").map(function(){return typeof this.focus==="function"?this:null})}var e=this,f=d.options.show.modal,g=d.elements,h=g.tooltip,i="#qtip-overlay",j=".qtipmodal",k=j+d.id,l="is-modal-qtip",m=a(document.body),n=s.modal.focusable.join(","),o={},p;d.checks.modal={"^show.modal.(on|blur)$":function(){e.init(),g.overlay.toggle(h.is(":visible"))},"^content.text$":q},a.extend(e,{init:function(){if(!f.on)return e;p=e.create(),h.attr(l,b).css("z-index",s.modal.zindex+a(y+"["+l+"]").length).unbind(j).unbind(k).bind("tooltipshow"+j+" tooltiphide"+j,function(b,c,d){var f=b.originalEvent;if(b.target===h[0])if(f&&b.type==="tooltiphide"&&/mouse(leave|enter)/.test(f.type)&&a(f.relatedTarget).closest(p[0]).length)try{b.preventDefault()}catch(g){}else(!f||f&&!f.solo)&&e[b.type.replace("tooltip","")](b,d)}).bind("tooltipfocus"+j,function(b){if(!b.isDefaultPrevented()&&b.target===h[0]){var c=a(y).filter("["+l+"]"),d=s.modal.zindex+c.length,e=parseInt(h[0].style.zIndex,10);p[0].style.zIndex=d-2,c.each(function(){this.style.zIndex>e&&(this.style.zIndex-=1)}),c.end().filter("."+A).qtip("blur",b.originalEvent),h.addClass(A)[0].style.zIndex=d;try{b.preventDefault()}catch(f){}}}).bind("tooltiphide"+j,function(b){b.target===h[0]&&a("["+l+"]").filter(":visible").not(h).last().qtip("focus",b)}),f.escape&&a(document).unbind(k).bind("keydown"+k,function(a){a.keyCode===27&&h.hasClass(A)&&d.hide(a)}),f.blur&&g.overlay.unbind(k).bind("click"+k,function(a){h.hasClass(A)&&d.hide(a)}),q();return e},create:function(){function d(){p.css({height:a(window).height(),width:a(window).width()})}var b=a(i);if(b.length)return g.overlay=b.insertAfter(a(y).last());p=g.overlay=a("<div />",{id:i.substr(1),html:"<div></div>",mousedown:function(){return c}}).hide().insertAfter(a(y).last()),a(window).unbind(j).bind("resize"+j,d),d();return p},toggle:function(d,g,i){if(d&&d.isDefaultPrevented())return e;var j=f.effect,n=g?"show":"hide",o=p.is(":visible"),q=a("["+l+"]").filter(":visible").not(h),s;p||(p=e.create());if(p.is(":animated")&&o===g||!g&&q.length)return e;g?(p.css({left:0,top:0}),p.toggleClass("blurs",f.blur),f.stealfocus!==c&&(m.bind("focusin"+k,t),r(a("body *")))):m.unbind("focusin"+k),p.stop(b,c),a.isFunction(j)?j.call(p,g):j===c?p[n]():p.fadeTo(parseInt(i,10)||90,g?1:0,function(){g||a(this).hide()}),g||p.queue(function(a){p.css({left:"",top:""}),a()});return e},show:function(a,c){return e.toggle(a,b,c)},hide:function(a,b){return e.toggle(a,c,b)},destroy:function(){var b=p;b&&(b=a("["+l+"]").not(h).length<1,b?(g.overlay.remove(),a(document).unbind(j)):g.overlay.unbind(j+d.id),m.undelegate("*","focusin"+k));return h.removeAttr(l).unbind(j)}}),e.init()}function L(d){var e=this,f=d.elements.tooltip,g=d.options.content.ajax,h=r.defaults.content.ajax,i=".qtip-ajax",j=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,k=b,l=c,m;d.checks.ajax={"^content.ajax":function(a,b,c){b==="ajax"&&(g=c),b==="once"?e.init():g&&g.url?e.load():f.unbind(i)}},a.extend(e,{init:function(){g&&g.url&&f.unbind(i)[g.once?"one":"bind"]("tooltipshow"+i,e.load);return e},load:function(f){function t(a,b,c){!d.destroyed&&a.status!==0&&d.set("content.text",b+": "+c)}function s(b,c,e){var f;d.destroyed||(o&&(b=a("<div/>").append(b.replace(j,"")).find(o)),(f=h.success||g.success)&&a.isFunction(f)?f.call(g.context||d,b,c,e):d.set("content.text",b))}function r(){var e;d.destroyed||(k=c,p&&(l=b,d.show(f.originalEvent)),(e=h.complete||g.complete)&&a.isFunction(e)&&e.apply(g.context||d,arguments))}if(l)l=c;else{var i=g.url.indexOf(" "),n=g.url,o,p=!g.loading&&k;if(p)try{f.preventDefault()}catch(q){}else if(f&&f.isDefaultPrevented())return e;m&&m.abort&&m.abort(),i>-1&&(o=n.substr(i),n=n.substr(0,i)),m=a.ajax(a.extend({error:h.error||t,context:d},g,{url:n,success:s,complete:r}))}},destroy:function(){m&&m.abort&&m.abort(),d.destroyed=b}}),e.init()}function K(e,f){var g,h,i,j,k,l=a(this),m=a(document.body),n=this===document?m:l,o=l.metadata?l.metadata(f.metadata):d,p=f.metadata.type==="html5"&&o?o[f.metadata.name]:d,q=l.data(f.metadata.name||"qtipopts");try{q=typeof q==="string"?(new Function("return "+q))():q}catch(t){H("Unable to parse HTML5 attribute data: "+q)}j=a.extend(b,{},r.defaults,f,typeof q==="object"?I(q):d,I(p||o)),h=j.position,j.id=e;if("boolean"===typeof j.content.text){i=l.attr(j.content.attr);if(j.content.attr!==c&&i)j.content.text=i;else{H("Unable to locate content for tooltip! Aborting render of tooltip on element: ",l);return c}}h.container.length||(h.container=m),h.target===c&&(h.target=n),j.show.target===c&&(j.show.target=n),j.show.solo===b&&(j.show.solo=h.container.closest("body")),j.hide.target===c&&(j.hide.target=n),j.position.viewport===b&&(j.position.viewport=h.container),h.container=h.container.eq(0),h.at=new s.Corner(h.at),h.my=new s.Corner(h.my);if(a.data(this,"qtip"))if(j.overwrite)l.qtip("destroy");else if(j.overwrite===c)return c;j.suppress&&(k=a.attr(this,"title"))&&a(this).removeAttr("title").attr(F,k).attr("title",""),g=new J(l,j,e,!!i),a.data(this,"qtip",g),l.bind("remove.qtip-"+e+" removeqtip.qtip-"+e,function(){g.destroy()});return g}function J(f,g,o,p){function X(){var b=[g.show.target[0],g.hide.target[0],q.rendered&&M.tooltip[0],g.position.container[0],g.position.viewport[0],window,document];q.rendered?a([]).pushStack(a.grep(b,function(a){return typeof a==="object"})).unbind(L):g.show.target.unbind(L+"-create")}function W(){function m(a){q.rendered&&K[0].offsetWidth>0&&q.reposition(a)}function l(a){if(K.hasClass(x))return c;clearTimeout(q.timers.inactive),q.timers.inactive=setTimeout(function(){q.hide(a)},g.hide.inactive)}function k(b){if(K.hasClass(x)||H||J)return c;var f=a(b.relatedTarget||b.target),h=f.closest(y)[0]===K[0],i=f[0]===e.show[0];clearTimeout(q.timers.show),clearTimeout(q.timers.hide);if(d.target==="mouse"&&h||g.hide.fixed&&(/mouse(out|leave|move)/.test(b.type)&&(h||i)))try{b.preventDefault(),b.stopImmediatePropagation()}catch(j){}else g.hide.delay>0?q.timers.hide=setTimeout(function(){q.hide(b)},g.hide.delay):q.hide(b)}function j(a){if(K.hasClass(x))return c;clearTimeout(q.timers.show),clearTimeout(q.timers.hide);var d=function(){q.toggle(b,a)};g.show.delay>0?q.timers.show=setTimeout(d,g.show.delay):d()}var d=g.position,e={show:g.show.target,hide:g.hide.target,viewport:a(d.viewport),document:a(document),body:a(document.body),window:a(window)},h={show:a.trim(""+g.show.event).split(" "),hide:a.trim(""+g.hide.event).split(" ")},i=a.browser.msie&&parseInt(a.browser.version,10)===6;K.bind("mouseenter"+L+" mouseleave"+L,function(a){var b=a.type==="mouseenter";b&&q.focus(a),K.toggleClass(B,b)}),/mouse(out|leave)/i.test(g.hide.event)&&(g.hide.leave==="window"&&e.window.bind("mouseleave"+L+" blur"+L,function(a){!/select|option/.test(a.target.nodeName)&&!a.relatedTarget&&q.hide(a)})),g.hide.fixed?(e.hide=e.hide.add(K),K.bind("mouseover"+L,function(){K.hasClass(x)||clearTimeout(q.timers.hide)})):/mouse(over|enter)/i.test(g.show.event)&&e.hide.bind("mouseleave"+L,function(a){clearTimeout(q.timers.show)}),(""+g.hide.event).indexOf("unfocus")>-1&&d.container.closest("html").bind("mousedown"+L,function(b){var c=a(b.target),d=q.rendered&&!K.hasClass(x)&&K[0].offsetWidth>0,e=c.parents(y).filter(K[0]).length>0;c[0]!==f[0]&&c[0]!==K[0]&&!e&&!f.has(c[0]).length&&!c.attr("disabled")&&q.hide(b)}),"number"===typeof g.hide.inactive&&(e.show.bind("qtip-"+o+"-inactive",l),a.each(r.inactiveEvents,function(a,b){e.hide.add(M.tooltip).bind(b+L+"-inactive",l)})),a.each(h.hide,function(b,c){var d=a.inArray(c,h.show),f=a(e.hide);d>-1&&f.add(e.show).length===f.length||c==="unfocus"?(e.show.bind(c+L,function(a){K[0].offsetWidth>0?k(a):j(a)}),delete h.show[d]):e.hide.bind(c+L,k)}),a.each(h.show,function(a,b){e.show.bind(b+L,j)}),"number"===typeof g.hide.distance&&e.show.add(K).bind("mousemove"+L,function(a){var b=N.origin||{},c=g.hide.distance,d=Math.abs;(d(a.pageX-b.pageX)>=c||d(a.pageY-b.pageY)>=c)&&q.hide(a)}),d.target==="mouse"&&(e.show.bind("mousemove"+L,function(a){t={pageX:a.pageX,pageY:a.pageY,type:"mousemove"}}),d.adjust.mouse&&(g.hide.event&&(K.bind("mouseleave"+L,function(a){(a.relatedTarget||a.target)!==e.show[0]&&q.hide(a)}),M.target.bind("mouseenter"+L+" mouseleave"+L,function(a){N.onTarget=a.type==="mouseenter"})),e.document.bind("mousemove"+L,function(a){q.rendered&&N.onTarget&&!K.hasClass(x)&&K[0].offsetWidth>0&&q.reposition(a||t)}))),(d.adjust.resize||e.viewport.length)&&(a.event.special.resize?e.viewport:e.window).bind("resize"+L,m),(e.viewport.length||i&&K.css("position")==="fixed")&&e.viewport.bind("scroll"+L,m)}function V(b,d){function h(b){function i(e){e&&(delete h[e.src],clearTimeout(q.timers.img[e.src]),a(e).unbind(L)),a.isEmptyObject(h)&&(q.redraw(),d!==c&&q.reposition(N.event),b())}var f,h={};if((f=g.find("img[src]:not([height]):not([width])")).length===0)return i();f.each(function(b,c){if(h[c.src]===e){var d=0,f=3;(function g(){if(c.height||c.width||d>f)return i(c);d+=1,q.timers.img[c.src]=setTimeout(g,700)})(),a(c).bind("error"+L+" load"+L,function(){i(this)}),h[c.src]=c}})}var g=M.content;if(!q.rendered||!b)return c;a.isFunction(b)&&(b=b.call(f,N.event,q)||""),b.jquery&&b.length>0?g.empty().append(b.css({display:"block"})):g.html(b),q.rendered<0?K.queue("fx",h):(J=0,h(a.noop));return q}function U(b,d){var e=M.title;if(!q.rendered||!b)return c;a.isFunction(b)&&(b=b.call(f,N.event,q));if(b===c||!b&&b!=="")return Q(c);b.jquery&&b.length>0?e.empty().append(b.css({display:"block"})):e.html(b),q.redraw(),d!==c&&q.rendered&&K[0].offsetWidth>0&&q.reposition(N.event)}function T(a){var b=M.button,d=M.title;if(!q.rendered)return c;a?(d||S(),R()):b.remove()}function S(){var c=E+"-title";M.titlebar&&Q(),M.titlebar=a("<div />",{"class":v+"-titlebar "+(g.style.widget?"ui-widget-header":"")}).append(M.title=a("<div />",{id:c,"class":v+"-title","aria-atomic":b})).insertBefore(M.content).delegate(".ui-tooltip-close","mousedown keydown mouseup keyup mouseout",function(b){a(this).toggleClass("ui-state-active ui-state-focus",b.type.substr(-4)==="down")}).delegate(".ui-tooltip-close","mouseover mouseout",function(b){a(this).toggleClass("ui-state-hover",b.type==="mouseover")}),g.content.title.button?R():q.rendered&&q.redraw()}function R(){var b=g.content.title.button,d=typeof b==="string",e=d?b:"Close tooltip";M.button&&M.button.remove(),b.jquery?M.button=b:M.button=a("<a />",{"class":"ui-state-default ui-tooltip-close "+(g.style.widget?"":v+"-icon"),title:e,"aria-label":e}).prepend(a("<span />",{"class":"ui-icon ui-icon-close",html:"&times;"})),M.button.appendTo(M.titlebar).attr("role","button").click(function(a){K.hasClass(x)||q.hide(a);return c}),q.redraw()}function Q(a){M.title&&(M.titlebar.remove(),M.titlebar=M.title=M.button=d,a!==c&&q.reposition())}function P(){var a=g.style.widget;K.toggleClass(w,a).toggleClass(z,g.style.def&&!a),M.content.toggleClass(w+"-content",a),M.titlebar&&M.titlebar.toggleClass(w+"-header",a),M.button&&M.button.toggleClass(v+"-icon",!a)}function O(a){var b=0,c,d=g,e=a.split(".");while(d=d[e[b++]])b<e.length&&(c=d);return[c||g,e.pop()]}var q=this,D=document.body,E=v+"-"+o,H=0,J=0,K=a(),L=".qtip-"+o,M,N;q.id=o,q.destroyed=q.rendered=c,q.elements=M={target:f},q.timers={img:{}},q.options=g,q.checks={},q.plugins={},q.cache=N={event:{},target:a(),disabled:c,attr:p,onTarget:c,lastClass:""},q.checks.builtin={"^id$":function(d,e,f){var g=f===b?r.nextid:f,h=v+"-"+g;g!==c&&g.length>0&&!a("#"+h).length&&(K[0].id=h,M.content[0].id=h+"-content",M.title[0].id=h+"-title")},"^content.text$":function(a,b,c){V(c)},"^content.title.text$":function(a,b,c){if(!c)return Q();!M.title&&c&&S(),U(c)},"^content.title.button$":function(a,b,c){T(c)},"^position.(my|at)$":function(a,b,c){"string"===typeof c&&(a[b]=new s.Corner(c))},"^position.container$":function(a,b,c){q.rendered&&K.appendTo(c)},"^show.ready$":function(){q.rendered?q.toggle(b):q.render(1)},"^style.classes$":function(a,b,c){K.attr("class",v+" qtip ui-helper-reset "+c)},"^style.widget|content.title":P,"^events.(render|show|move|hide|focus|blur)$":function(b,c,d){K[(a.isFunction(d)?"":"un")+"bind"]("tooltip"+c,d)},"^(show|hide|position).(event|target|fixed|inactive|leave|distance|viewport|adjust)":function(){var a=g.position;K.attr("tracking",a.target==="mouse"&&a.adjust.mouse),X(),W()}},a.extend(q,{render:function(d){if(q.rendered)return q;var e=g.content.text,h=g.content.title.text,i=g.position,j=a.Event("tooltiprender");a.attr(f[0],"aria-describedby",E),K=M.tooltip=a("<div/>",{id:E,"class":v+" qtip ui-helper-reset "+z+" "+g.style.classes+" "+v+"-pos-"+g.position.my.abbrev(),width:g.style.width||"",height:g.style.height||"",tracking:i.target==="mouse"&&i.adjust.mouse,role:"alert","aria-live":"polite","aria-atomic":c,"aria-describedby":E+"-content","aria-hidden":b}).toggleClass(x,N.disabled).data("qtip",q).appendTo(g.position.container).append(M.content=a("<div />",{"class":v+"-content",id:E+"-content","aria-atomic":b})),q.rendered=-1,H=J=1,h&&(S(),a.isFunction(h)||U(h,c)),a.isFunction(e)||V(e,c),q.rendered=b,P(),a.each(g.events,function(b,c){a.isFunction(c)&&K.bind(b==="toggle"?"tooltipshow tooltiphide":"tooltip"+b,c)}),a.each(s,function(){this.initialize==="render"&&this(q)}),W(),K.queue("fx",function(a){j.originalEvent=N.event,K.trigger(j,[q]),H=J=0,q.redraw(),(g.show.ready||d)&&q.toggle(b,N.event,c),a()});return q},get:function(a){var b,c;switch(a.toLowerCase()){case"dimensions":b={height:K.outerHeight(),width:K.outerWidth()};break;case"offset":b=s.offset(K,g.position.container);break;default:c=O(a.toLowerCase()),b=c[0][c[1]],b=b.precedance?b.string():b}return b},set:function(e,f){function n(a,b){var c,d,e;for(c in l)for(d in l[c])if(e=(new RegExp(d,"i")).exec(a))b.push(e),l[c][d].apply(q,b)}var h=/^position\.(my|at|adjust|target|container)|style|content|show\.ready/i,i=/^content\.(title|attr)|style/i,j=c,k=c,l=q.checks,m;"string"===typeof e?(m=e,e={},e[m]=f):e=a.extend(b,{},e),a.each(e,function(b,c){var d=O(b.toLowerCase()),f;f=d[0][d[1]],d[0][d[1]]="object"===typeof c&&c.nodeType?a(c):c,e[b]=[d[0],d[1],c,f],j=h.test(b)||j,k=i.test(b)||k}),I(g),H=J=1,a.each(e,n),H=J=0,q.rendered&&K[0].offsetWidth>0&&(j&&q.reposition(g.position.target==="mouse"?d:N.event),k&&q.redraw());return q},toggle:function(e,f){function u(){e?(a.browser.msie&&K[0].style.removeAttribute("filter"),K.css("overflow",""),"string"===typeof i.autofocus&&a(i.autofocus,K).focus(),i.target.trigger("qtip-"+o+"-inactive")):K.css({display:"",visibility:"",opacity:"",left:"",top:""}),s=a.Event("tooltip"+(e?"visible":"hidden")),s.originalEvent=f?N.event:d,K.trigger(s,[q])}if(!q.rendered)return e?q.render(1):q;var h=e?"show":"hide",i=g[h],j=g[e?"hide":"show"],k=g.position,l=g.content,m=K[0].offsetWidth>0,n=e||i.target.length===1,p=!f||i.target.length<2||N.target[0]===f.target,r,s;(typeof e).search("boolean|number")&&(e=!m);if(!K.is(":animated")&&m===e&&p)return q;if(f){if(/over|enter/.test(f.type)&&/out|leave/.test(N.event.type)&&g.show.target.add(f.target).length===g.show.target.length&&K.has(f.relatedTarget).length)return q;N.event=a.extend({},f)}s=a.Event("tooltip"+h),s.originalEvent=f?N.event:d,K.trigger(s,[q,90]);if(s.isDefaultPrevented())return q;a.attr(K[0],"aria-hidden",!e),e?(N.origin=a.extend({},t),q.focus(f),a.isFunction(l.text)&&V(l.text,c),a.isFunction(l.title.text)&&U(l.title.text,c),!G&&k.target==="mouse"&&k.adjust.mouse&&(a(document).bind("mousemove.qtip",function(a){t={pageX:a.pageX,pageY:a.pageY,type:"mousemove"}}),G=b),q.reposition(f,arguments[2]),(s.solo=!!i.solo)&&a(y,i.solo).not(K).qtip("hide",s)):(clearTimeout(q.timers.show),delete N.origin,G&&!a(y+'[tracking="true"]:visible',i.solo).not(K).length&&(a(document).unbind("mousemove.qtip"),G=c),q.blur(f)),i.effect===c||n===c?(K[h](),u.call(K)):a.isFunction(i.effect)?(K.stop(1,1),i.effect.call(K,q),K.queue("fx",function(a){u(),a()})):K.fadeTo(90,e?1:0,u),e&&i.target.trigger("qtip-"+o+"-inactive");return q},show:function(a){return q.toggle(b,a)},hide:function(a){return q.toggle(c,a)},focus:function(b){if(!q.rendered)return q;var c=a(y),d=parseInt(K[0].style.zIndex,10),e=r.zindex+c.length,f=a.extend({},b),g,h;K.hasClass(A)||(h=a.Event("tooltipfocus"),h.originalEvent=f,K.trigger(h,[q,e]),h.isDefaultPrevented()||(d!==e&&(c.each(function(){this.style.zIndex>d&&(this.style.zIndex=this.style.zIndex-1)}),c.filter("."+A).qtip("blur",f)),K.addClass(A)[0].style.zIndex=e));return q},blur:function(b){var c=a.extend({},b),d;K.removeClass(A),d=a.Event("tooltipblur"),d.originalEvent=c,K.trigger(d,[q]);return q},reposition:function(b,d){if(!q.rendered||H)return q;H=1;var e=g.position.target,f=g.position,h=f.my,i=f.at,o=f.adjust,p=o.method.split(" "),r=K.outerWidth(),u=K.outerHeight(),v=0,w=0,x=a.Event("tooltipmove"),y=K.css("position")==="fixed",z=f.viewport,A={left:0,top:0},B=f.container,C=K[0].offsetWidth>0,D,E,F;if(a.isArray(e)&&e.length===2)i={x:k,y:j},A={left:e[0],top:e[1]};else if(e==="mouse"&&(b&&b.pageX||N.event.pageX))i={x:k,y:j},b=(b&&(b.type==="resize"||b.type==="scroll")?N.event:b&&b.pageX&&b.type==="mousemove"?b:t&&t.pageX&&(o.mouse||!b||!b.pageX)?{pageX:t.pageX,pageY:t.pageY}:!o.mouse&&N.origin&&N.origin.pageX&&g.show.distance?N.origin:b)||b||N.event||t||{},A={top:b.pageY,left:b.pageX};else{e==="event"&&b&&b.target&&b.type!=="scroll"&&b.type!=="resize"?N.target=a(b.target):e!=="event"&&(N.target=a(e.jquery?e:M.target)),e=N.target,e=a(e).eq(0);if(e.length===0)return q;e[0]===document||e[0]===window?(v=s.iOS?window.innerWidth:e.width(),w=s.iOS?window.innerHeight:e.height(),e[0]===window&&(A={top:(z||e).scrollTop(),left:(z||e).scrollLeft()})):s.imagemap&&e.is("area")?D=s.imagemap(q,e,i,s.viewport?p:c):s.svg&&typeof e[0].xmlbase==="string"?D=s.svg(q,e,i,s.viewport?p:c):(v=e.outerWidth(),w=e.outerHeight(),A=s.offset(e,B)),D&&(v=D.width,w=D.height,E=D.offset,A=D.position);if(s.iOS>3.1&&s.iOS<4.1||s.iOS>=4.3&&s.iOS<4.33||!s.iOS&&y)F=a(window),A.left-=F.scrollLeft(),A.top-=F.scrollTop();A.left+=i.x===m?v:i.x===n?v/2:0,A.top+=i.y===l?w:i.y===n?w/2:0}A.left+=o.x+(h.x===m?-r:h.x===n?-r/2:0),A.top+=o.y+(h.y===l?-u:h.y===n?-u/2:0),s.viewport?(A.adjusted=s.viewport(q,A,f,v,w,r,u),E&&A.adjusted.left&&(A.left+=E.left),E&&A.adjusted.top&&(A.top+=E.top)):A.adjusted={left:0,top:0},x.originalEvent=a.extend({},b),K.trigger(x,[q,A,z.elem||z]);if(x.isDefaultPrevented())return q;delete A.adjusted,d===c||!C||isNaN(A.left)||isNaN(A.top)||e==="mouse"||!a.isFunction(f.effect)?K.css(A):a.isFunction(f.effect)&&(f.effect.call(K,q,a.extend({},A)),K.queue(function(b){a(this).css({opacity:"",height:""}),a.browser.msie&&this.style.removeAttribute("filter"),b()})),H=0;return q},redraw:function(){if(q.rendered<1||J)return q;var a=g.position.container,b,c,d,e;J=1,g.style.height&&K.css(i,g.style.height),g.style.width?K.css(h,g.style.width):(K.css(h,"").addClass(C),c=K.width()+1,d=K.css("max-width")||"",e=K.css("min-width")||"",b=(d+e).indexOf("%")>-1?a.width()/100:0,d=(d.indexOf("%")>-1?b:1)*parseInt(d,10)||c,e=(e.indexOf("%")>-1?b:1)*parseInt(e,10)||0,c=d+e?Math.min(Math.max(c,e),d):c,K.css(h,Math.round(c)).removeClass(C)),J=0;return q},disable:function(b){"boolean"!==typeof b&&(b=!K.hasClass(x)&&!N.disabled),q.rendered?(K.toggleClass(x,b),a.attr(K[0],"aria-disabled",b)):N.disabled=!!b;return q},enable:function(){return q.disable(c)},destroy:function(){var c=f[0],d=a.attr(c,F),e=f.data("qtip");q.destroyed=b,q.rendered&&(K.stop(1,0).remove(),a.each(q.plugins,function(){this.destroy&&this.destroy()})),clearTimeout(q.timers.show),clearTimeout(q.timers.hide),X();if(!e||q===e)a.removeData(c,"qtip"),g.suppress&&d&&(a.attr(c,"title",d),f.removeAttr(F)),f.removeAttr("aria-describedby");f.unbind(".qtip-"+o),delete u[q.id];return f}})}function I(b){var e;if(!b||"object"!==typeof b)return c;if(b.metadata===d||"object"!==typeof b.metadata)b.metadata={type:b.metadata};if("content"in b){if(b.content===d||"object"!==typeof b.content||b.content.jquery)b.content={text:b.content};e=b.content.text||c,!a.isFunction(e)&&(!e&&!e.attr||e.length<1||"object"===typeof e&&!e.jquery)&&(b.content.text=c);if("title"in b.content){if(b.content.title===d||"object"!==typeof b.content.title)b.content.title={text:b.content.title};e=b.content.title.text||c,!a.isFunction(e)&&(!e&&!e.attr||e.length<1||"object"===typeof e&&!e.jquery)&&(b.content.title.text=c)}}if("position"in b)if(b.position===d||"object"!==typeof b.position)b.position={my:b.position,at:b.position};if("show"in b)if(b.show===d||"object"!==typeof b.show)b.show.jquery?b.show={target:b.show}:b.show={event:b.show};if("hide"in b)if(b.hide===d||"object"!==typeof b.hide)b.hide.jquery?b.hide={target:b.hide}:b.hide={event:b.hide};if("style"in b)if(b.style===d||"object"!==typeof b.style)b.style={classes:b.style};a.each(s,function(){this.sanitize&&this.sanitize(b)});return b}function H(){H.history=H.history||[],H.history.push(arguments);if("object"===typeof console){var a=console[console.warn?"warn":"log"],b=Array.prototype.slice.call(arguments),c;typeof arguments[0]==="string"&&(b[0]="qTip2: "+b[0]),c=a.apply?a.apply(console,b):a(b)}}"use strict";var b=!0,c=!1,d=null,e,f="x",g="y",h="width",i="height",j="top",k="left",l="bottom",m="right",n="center",o="flip",p="flipinvert",q="shift",r,s,t,u={},v="ui-tooltip",w="ui-widget",x="ui-state-disabled",y="div.qtip."+v,z=v+"-default",A=v+"-focus",B=v+"-hover",C=v+"-fluid",D="-31000px",E="_replacedByqTip",F="oldtitle",G;r=a.fn.qtip=function(f,g,h){var i=(""+f).toLowerCase(),j=d,k=a.makeArray(arguments).slice(1),l=k[k.length-1],m=this[0]?a.data(this[0],"qtip"):d;if(!arguments.length&&m||i==="api")return m;if("string"===typeof f){this.each(function(){var d=a.data(this,"qtip");if(!d)return b;l&&l.timeStamp&&(d.cache.event=l);if(i!=="option"&&i!=="options"||!g)d[i]&&d[i].apply(d[i],k);else if(a.isPlainObject(g)||h!==e)d.set(g,h);else{j=d.get(g);return c}});return j!==d?j:this}if("object"===typeof f||!arguments.length){m=I(a.extend(b,{},f));return r.bind.call(this,m,l)}},r.bind=function(d,f){return this.each(function(g){function n(b){function d(){l.render(typeof b==="object"||h.show.ready),i.show.add(i.hide).unbind(k)}if(l.cache.disabled)return c;l.cache.event=a.extend({},b),l.cache.target=b?a(b.target):[e],h.show.delay>0?(clearTimeout(l.timers.show),l.timers.show=setTimeout(d,h.show.delay),j.show!==j.hide&&i.hide.bind(j.hide,function(){clearTimeout(l.timers.show)})):d()}var h,i,j,k,l,m;m=a.isArray(d.id)?d.id[g]:d.id,m=!m||m===c||m.length<1||u[m]?r.nextid++:u[m]=m,k=".qtip-"+m+"-create",l=K.call(this,m,d);if(l===c)return b;h=l.options,a.each(s,function(){this.initialize==="initialize"&&this(l)}),i={show:h.show.target,hide:h.hide.target},j={show:a.trim(""+h.show.event).replace(/ /g,k+" ")+k,hide:a.trim(""+h.hide.event).replace(/ /g,k+" ")+k},/mouse(over|enter)/i.test(j.show)&&!/mouse(out|leave)/i.test(j.hide)&&(j.hide+=" mouseleave"+k),i.show.bind("mousemove"+k,function(a){t={pageX:a.pageX,pageY:a.pageY,type:"mousemove"},l.cache.onTarget=b}),i.show.bind(j.show,n),(h.show.ready||h.prerender)&&n(f)})},s=r.plugins={Corner:function(a){a=(""+a).replace(/([A-Z])/," $1").replace(/middle/gi,n).toLowerCase(),this.x=(a.match(/left|right/i)||a.match(/center/)||["inherit"])[0].toLowerCase(),this.y=(a.match(/top|bottom|center/i)||["inherit"])[0].toLowerCase();var b=a.charAt(0);this.precedance=b==="t"||b==="b"?g:f,this.string=function(){return this.precedance===g?this.y+this.x:this.x+this.y},this.abbrev=function(){var a=this.x.substr(0,1),b=this.y.substr(0,1);return a===b?a:this.precedance===g?b+a:a+b},this.invertx=function(a){this.x=this.x===k?m:this.x===m?k:a||this.x},this.inverty=function(a){this.y=this.y===j?l:this.y===l?j:a||this.y},this.clone=function(){return{x:this.x,y:this.y,precedance:this.precedance,string:this.string,abbrev:this.abbrev,clone:this.clone,invertx:this.invertx,inverty:this.inverty}}},offset:function(b,c){function j(a,b){d.left+=b*a.scrollLeft(),d.top+=b*a.scrollTop()}var d=b.offset(),e=b.closest("body")[0],f=c,g,h,i;if(f){do f.css("position")!=="static"&&(h=f.position(),d.left-=h.left+(parseInt(f.css("borderLeftWidth"),10)||0)+(parseInt(f.css("marginLeft"),10)||0),d.top-=h.top+(parseInt(f.css("borderTopWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0),!g&&(i=f.css("overflow"))!=="hidden"&&i!=="visible"&&(g=f));while((f=a(f[0].offsetParent)).length);g&&g[0]!==e&&j(g,1)}return d},iOS:parseFloat((""+(/CPU.*OS ([0-9_]{1,5})|(CPU like).*AppleWebKit.*Mobile/i.exec(navigator.userAgent)||[0,""])[1]).replace("undefined","3_2").replace("_",".").replace("_",""))||c,fn:{attr:function(b,c){if(this.length){var d=this[0],e="title",f=a.data(d,"qtip");if(b===e&&f&&"object"===typeof f&&f.options.suppress){if(arguments.length<2)return a.attr(d,F);f&&f.options.content.attr===e&&f.cache.attr&&f.set("content.text",c);return this.attr(F,c)}}return a.fn["attr"+E].apply(this,arguments)},clone:function(b){var c=a([]),d="title",e=a.fn["clone"+E].apply(this,arguments);b||e.filter("["+F+"]").attr("title",function(){return a.attr(this,F)}).removeAttr(F);return e}}},a.each(s.fn,function(c,d){if(!d||a.fn[c+E])return b;var e=a.fn[c+E]=a.fn[c];a.fn[c]=function(){return d.apply(this,arguments)||e.apply(this,arguments)}}),a.ui||(a["cleanData"+E]=a.cleanData,a.cleanData=function(b){for(var c=0,d;(d=b[c])!==e;c++)try{a(d).triggerHandler("removeqtip")}catch(f){}a["cleanData"+E](b)}),r.version="nightly",r.nextid=0,r.inactiveEvents="click dblclick mousedown mouseup mousemove mouseleave mouseenter".split(" "),r.zindex=15e3,r.defaults={prerender:c,id:c,overwrite:b,suppress:b,content:{text:b,attr:"title",title:{text:c,button:c}},position:{my:"top left",at:"bottom right",target:c,container:c,viewport:c,adjust:{x:0,y:0,mouse:b,resize:b,method:"flip flip"},effect:function(b,d,e){a(this).animate(d,{duration:200,queue:c})}},show:{target:c,event:"mouseenter",effect:b,delay:90,solo:c,ready:c,autofocus:c},hide:{target:c,event:"mouseleave",effect:b,delay:0,fixed:c,inactive:c,leave:"window",distance:c},style:{classes:"",widget:c,width:c,height:c,def:b},events:{render:d,move:d,show:d,hide:d,toggle:d,visible:d,hidden:d,focus:d,blur:d}},s.ajax=function(a){var b=a.plugins.ajax;return"object"===typeof b?b:a.plugins.ajax=new L(a)},s.ajax.initialize="render",s.ajax.sanitize=function(a){var b=a.content,c;b&&"ajax"in b&&(c=b.ajax,typeof c!=="object"&&(c=a.content.ajax={url:c}),"boolean"!==typeof c.once&&c.once&&(c.once=!!c.once))},a.extend(b,r.defaults,{content:{ajax:{loading:b,once:b}}}),s.viewport=function(a,b,c,d,o,r,s){function K(a,c,d,f,g,h,i,j,k){var l=b[g],m=w[a],o=x[a],r=d===q,s=-D.offset[g]+C.offset[g]+C["scroll"+g],t=m===g?k:m===h?-k:-k/2,u=o===g?j:o===h?-j:-j/2,v=F&&F.size?F.size[i]||0:0,y=F&&F.corner&&F.corner.precedance===a&&!r?v:0,z=s-l+y,A=l+k-C[i]-s+y,B=t-(w.precedance===a||m===w[c]?u:0)-(o===n?j/2:0);r?(y=F&&F.corner&&F.corner.precedance===c?v:0,B=(m===g?1:-1)*t-y,b[g]+=z>0?z:A>0?-A:0,b[g]=Math.max(-D.offset[g]+C.offset[g]+(y&&F.corner[a]===n?F.offset:0),l-B,Math.min(Math.max(-D.offset[g]+C.offset[g]+C[i],l+B),b[g]))):(f*=d===p?2:0,z>0&&(m!==g||A>0)?(b[g]-=B+f,I["invert"+a](g)):A>0&&(m!==h||z>0)&&(b[g]-=(m===n?-B:B)+f,I["invert"+a](h)),b[g]<s&&-b[g]>A&&(b[g]=l,I=e));return b[g]-l}var t=c.target,u=a.elements.tooltip,w=c.my,x=c.at,y=c.adjust,z=y.method.split(" "),A=z[0],B=z[1]||z[0],C=c.viewport,D=c.container,E=a.cache,F=a.plugins.tip,G={left:0,top:0},H,I,J;if(!C.jquery||t[0]===window||t[0]===document.body||y.method==="none")return G;H=u.css("position")==="fixed",C={elem:C,height:C[(C[0]===window?"h":"outerH")+"eight"](),width:C[(C[0]===window?"w":"outerW")+"idth"](),scrollleft:H?0:C.scrollLeft(),scrolltop:H?0:C.scrollTop(),offset:C.offset()||{left:0,top:0}},D={elem:D,scrollLeft:D.scrollLeft(),scrollTop:D.scrollTop(),offset:D.offset()||{left:0,top:0}};if(A!=="shift"||B!=="shift")I=w.clone();G={left:A!=="none"?K(f,g,A,y.x,k,m,h,d,r):0,top:B!=="none"?K(g,f,B,y.y,j,l,i,o,s):0},I&&E.lastClass!==(J=v+"-pos-"+I.abbrev())&&u.removeClass(a.cache.lastClass).addClass(a.cache.lastClass=J);return G},s.modal=function(a){var b=a.plugins.modal;return"object"===typeof b?b:a.plugins.modal=new M(a)},s.modal.initialize="render",s.modal.sanitize=function(a){a.show&&(typeof a.show.modal!=="object"?a.show.modal={on:!!a.show.modal}:typeof a.show.modal.on==="undefined"&&(a.show.modal.on=b))},s.modal.zindex=r.zindex+1e3,s.modal.focusable=["a[href]","area[href]","input","select","textarea","button","iframe","object","embed","[tabindex]","[contenteditable]"],a.extend(b,r.defaults,{show:{modal:{on:c,effect:b,blur:b,stealfocus:b,escape:b}}}),s.imagemap=function(b,c,d,e){function v(a,b,c){var d=0,e=1,f=1,g=0,h=0,i=a.width,o=a.height;while(i>0&&o>0&&e>0&&f>0){i=Math.floor(i/2),o=Math.floor(o/2),c.x===k?e=i:c.x===m?e=a.width-i:e+=Math.floor(i/2),c.y===j?f=o:c.y===l?f=a.height-o:f+=Math.floor(o/2),d=b.length;while(d--){if(b.length<2)break;g=b[d][0]-a.position.left,h=b[d][1]-a.position.top,(c.x===k&&g>=e||c.x===m&&g<=e||c.x===n&&(g<e||g>a.width-e)||c.y===j&&h>=f||c.y===l&&h<=f||c.y===n&&(h<f||h>a.height-f))&&b.splice(d,1)}}return{left:b[0][0],top:b[0][1]}}c.jquery||(c=a(c));var f=b.cache.areas={},g=(c[0].shape||c.attr("shape")).toLowerCase(),h=c[0].coords||c.attr("coords"),i=h.split(","),o=[],p=a('img[usemap="#'+c.parent("map").attr("name")+'"]'),q=p.offset(),r={width:0,height:0,position:{top:1e10,right:0,bottom:0,left:1e10}},s=0,t=0,u;q.left+=Math.ceil((p.outerWidth()-p.width())/2),q.top+=Math.ceil((p.outerHeight()-p.height())/2);if(g==="poly"){s=i.length;while(s--)t=[parseInt(i[--s],10),parseInt(i[s+1],10)],t[0]>r.position.right&&(r.position.right=t[0]),t[0]<r.position.left&&(r.position.left=t[0]),t[1]>r.position.bottom&&(r.position.bottom=t[1]),t[1]<r.position.top&&(r.position.top=t[1]),o.push(t)}else{s=-1;while(s++<i.length)o.push(parseInt(i[s],10))}switch(g){case"rect":r={width:Math.abs(o[2]-o[0]),height:Math.abs(o[3]-o[1]),position:{left:Math.min(o[0],o[2]),top:Math.min(o[1],o[3])}};break;case"circle":r={width:o[2]+2,height:o[2]+2,position:{left:o[0],top:o[1]}};break;case"poly":r.width=Math.abs(r.position.right-r.position.left),r.height=Math.abs(r.position.bottom-r.position.top),d.abbrev()==="c"?r.position={left:r.position.left+r.width/2,top:r.position.top+r.height/2}:(f[d+h]||(r.position=v(r,o.slice(),d),e&&(e[0]==="flip"||e[1]==="flip")&&(r.offset=v(r,o.slice(),{x:d.x===k?m:d.x===m?k:n,y:d.y===j?l:d.y===l?j:n}),r.offset.left-=r.position.left,r.offset.top-=r.position.top),f[d+h]=r),r=f[d+h]),r.width=r.height=0}r.position.left+=q.left,r.position.top+=q.top;return r},s.tip=function(a){var b=a.plugins.tip;return"object"===typeof b?b:a.plugins.tip=new O(a)},s.tip.initialize="render",s.tip.sanitize=function(a){var c=a.style,d;c&&"tip"in c&&(d=a.style.tip,typeof d!=="object"&&(a.style.tip={corner:d}),/string|boolean/i.test(typeof d.corner)||(d.corner=b),typeof d.width!=="number"&&delete d.width,typeof d.height!=="number"&&delete d.height,typeof d.border!=="number"&&d.border!==b&&delete d.border,typeof d.offset!=="number"&&delete d.offset)},a.extend(b,r.defaults,{style:{tip:{corner:b,mimic:c,width:6,height:6,border:b,offset:0}}}),s.svg=function(b,c,d,e){var f=a(document),g=c[0],h={width:0,height:0,position:{top:1e10,left:1e10}},i,j,k,l,m;while(!g.getBBox)g=g.parentNode;if(g.getBBox&&g.parentNode){i=g.getBBox(),j=g.getScreenCTM(),k=g.farthestViewportElement||g;if(!k.createSVGPoint)return h;l=k.createSVGPoint(),l.x=i.x,l.y=i.y,m=l.matrixTransform(j),h.position.left=m.x,h.position.top=m.y,l.x+=i.width,l.y+=i.height,m=l.matrixTransform(j),h.width=m.x-h.position.left,h.height=m.y-h.position.top,h.position.left+=f.scrollLeft(),h.position.top+=f.scrollTop()}return h},s.bgiframe=function(b){var d=a.browser,e=b.plugins.bgiframe;if(a("select, object").length<1||(!d.msie||(""+d.version).charAt(0)!=="6"))return c;return"object"===typeof e?e:b.plugins.bgiframe=new P(b)},s.bgiframe.initialize="render"})
\ No newline at end of file
+/* qtip2 v3.0.3 | Plugins: None | Styles: core | qtip2.com | Licensed MIT | Sun Aug 27 2017 15:28:58 */
+
+!function(a,b,c){!function(a){"use strict";"function"==typeof define&&define.amd?define(["jquery"],a):jQuery&&!jQuery.fn.qtip&&a(jQuery)}(function(d){"use strict";function e(a,b,c,e){this.id=c,this.target=a,this.tooltip=z,this.elements={target:a},this._id=I+"-"+c,this.timers={img:{}},this.options=b,this.plugins={},this.cache={event:{},target:d(),disabled:y,attr:e,onTooltip:y,lastClass:""},this.rendered=this.destroyed=this.disabled=this.waiting=this.hiddenDuringWait=this.positioning=this.triggering=y}function f(a){return a===z||"object"!==d.type(a)}function g(a){return!(d.isFunction(a)||a&&a.attr||a.length||"object"===d.type(a)&&(a.jquery||a.then))}function h(a){var b,c,e,h;return f(a)?y:(f(a.metadata)&&(a.metadata={type:a.metadata}),"content"in a&&(b=a.content,f(b)||b.jquery||b.done?(c=g(b)?y:b,b=a.content={text:c}):c=b.text,"ajax"in b&&(e=b.ajax,h=e&&e.once!==y,delete b.ajax,b.text=function(a,b){var f=c||d(this).attr(b.options.content.attr)||"Loading...",g=d.ajax(d.extend({},e,{context:b})).then(e.success,z,e.error).then(function(a){return a&&h&&b.set("content.text",a),a},function(a,c,d){b.destroyed||0===a.status||b.set("content.text",c+": "+d)});return h?f:(b.set("content.text",f),g)}),"title"in b&&(d.isPlainObject(b.title)&&(b.button=b.title.button,b.title=b.title.text),g(b.title||y)&&(b.title=y))),"position"in a&&f(a.position)&&(a.position={my:a.position,at:a.position}),"show"in a&&f(a.show)&&(a.show=a.show.jquery?{target:a.show}:a.show===x?{ready:x}:{event:a.show}),"hide"in a&&f(a.hide)&&(a.hide=a.hide.jquery?{target:a.hide}:{event:a.hide}),"style"in a&&f(a.style)&&(a.style={classes:a.style}),d.each(H,function(){this.sanitize&&this.sanitize(a)}),a)}function i(a,b){for(var c,d=0,e=a,f=b.split(".");e=e[f[d++]];)d<f.length&&(c=e);return[c||a,f.pop()]}function j(a,b){var c,d,e;for(c in this.checks)if(this.checks.hasOwnProperty(c))for(d in this.checks[c])this.checks[c].hasOwnProperty(d)&&(e=new RegExp(d,"i").exec(a))&&(b.push(e),("builtin"===c||this.plugins[c])&&this.checks[c][d].apply(this.plugins[c]||this,b))}function k(a){return L.concat("").join(a?"-"+a+" ":" ")}function l(a,b){return b>0?setTimeout(d.proxy(a,this),b):void a.call(this)}function m(a){this.tooltip.hasClass(S)||(clearTimeout(this.timers.show),clearTimeout(this.timers.hide),this.timers.show=l.call(this,function(){this.toggle(x,a)},this.options.show.delay))}function n(a){if(!this.tooltip.hasClass(S)&&!this.destroyed){var b=d(a.relatedTarget),c=b.closest(M)[0]===this.tooltip[0],e=b[0]===this.options.show.target[0];if(clearTimeout(this.timers.show),clearTimeout(this.timers.hide),this!==b[0]&&"mouse"===this.options.position.target&&c||this.options.hide.fixed&&/mouse(out|leave|move)/.test(a.type)&&(c||e))try{a.preventDefault(),a.stopImmediatePropagation()}catch(f){}else this.timers.hide=l.call(this,function(){this.toggle(y,a)},this.options.hide.delay,this)}}function o(a){!this.tooltip.hasClass(S)&&this.options.hide.inactive&&(clearTimeout(this.timers.inactive),this.timers.inactive=l.call(this,function(){this.hide(a)},this.options.hide.inactive))}function p(a){this.rendered&&this.tooltip[0].offsetWidth>0&&this.reposition(a)}function q(a,c,e){d(b.body).delegate(a,(c.split?c:c.join("."+I+" "))+"."+I,function(){var a=s.api[d.attr(this,K)];a&&!a.disabled&&e.apply(a,arguments)})}function r(a,c,f){var g,i,j,k,l,m=d(b.body),n=a[0]===b?m:a,o=a.metadata?a.metadata(f.metadata):z,p="html5"===f.metadata.type&&o?o[f.metadata.name]:z,q=a.data(f.metadata.name||"qtipopts");try{q="string"==typeof q?d.parseJSON(q):q}catch(r){}if(k=d.extend(x,{},s.defaults,f,"object"==typeof q?h(q):z,h(p||o)),i=k.position,k.id=c,"boolean"==typeof k.content.text){if(j=a.attr(k.content.attr),k.content.attr===y||!j)return y;k.content.text=j}if(i.container.length||(i.container=m),i.target===y&&(i.target=n),k.show.target===y&&(k.show.target=n),k.show.solo===x&&(k.show.solo=i.container.closest("body")),k.hide.target===y&&(k.hide.target=n),k.position.viewport===x&&(k.position.viewport=i.container),i.container=i.container.eq(0),i.at=new u(i.at,x),i.my=new u(i.my),a.data(I))if(k.overwrite)a.qtip("destroy",!0);else if(k.overwrite===y)return y;return a.attr(J,c),k.suppress&&(l=a.attr("title"))&&a.removeAttr("title").attr(U,l).attr("title",""),g=new e(a,k,c,!!j),a.data(I,g),g}var s,t,u,v,w,x=!0,y=!1,z=null,A="x",B="y",C="top",D="left",E="bottom",F="right",G="center",H={},I="qtip",J="data-hasqtip",K="data-qtip-id",L=["ui-widget","ui-tooltip"],M="."+I,N="click dblclick mousedown mouseup mousemove mouseleave mouseenter".split(" "),O=I+"-fixed",P=I+"-default",Q=I+"-focus",R=I+"-hover",S=I+"-disabled",T="_replacedByqTip",U="oldtitle",V={ie:function(){var a,c;for(a=4,c=b.createElement("div");(c.innerHTML="<!--[if gt IE "+a+"]><i></i><![endif]-->")&&c.getElementsByTagName("i")[0];a+=1);return a>4?a:NaN}(),iOS:parseFloat((""+(/CPU.*OS ([0-9_]{1,5})|(CPU like).*AppleWebKit.*Mobile/i.exec(navigator.userAgent)||[0,""])[1]).replace("undefined","3_2").replace("_",".").replace("_",""))||y};t=e.prototype,t._when=function(a){return d.when.apply(d,a)},t.render=function(a){if(this.rendered||this.destroyed)return this;var b=this,c=this.options,e=this.cache,f=this.elements,g=c.content.text,h=c.content.title,i=c.content.button,j=c.position,k=[];return d.attr(this.target[0],"aria-describedby",this._id),e.posClass=this._createPosClass((this.position={my:j.my,at:j.at}).my),this.tooltip=f.tooltip=d("<div/>",{id:this._id,"class":[I,P,c.style.classes,e.posClass].join(" "),width:c.style.width||"",height:c.style.height||"",tracking:"mouse"===j.target&&j.adjust.mouse,role:"alert","aria-live":"polite","aria-atomic":y,"aria-describedby":this._id+"-content","aria-hidden":x}).toggleClass(S,this.disabled).attr(K,this.id).data(I,this).appendTo(j.container).append(f.content=d("<div />",{"class":I+"-content",id:this._id+"-content","aria-atomic":x})),this.rendered=-1,this.positioning=x,h&&(this._createTitle(),d.isFunction(h)||k.push(this._updateTitle(h,y))),i&&this._createButton(),d.isFunction(g)||k.push(this._updateContent(g,y)),this.rendered=x,this._setWidget(),d.each(H,function(a){var c;"render"===this.initialize&&(c=this(b))&&(b.plugins[a]=c)}),this._unassignEvents(),this._assignEvents(),this._when(k).then(function(){b._trigger("render"),b.positioning=y,b.hiddenDuringWait||!c.show.ready&&!a||b.toggle(x,e.event,y),b.hiddenDuringWait=y}),s.api[this.id]=this,this},t.destroy=function(a){function b(){if(!this.destroyed){this.destroyed=x;var a,b=this.target,c=b.attr(U);this.rendered&&this.tooltip.stop(1,0).find("*").remove().end().remove(),d.each(this.plugins,function(){this.destroy&&this.destroy()});for(a in this.timers)this.timers.hasOwnProperty(a)&&clearTimeout(this.timers[a]);b.removeData(I).removeAttr(K).removeAttr(J).removeAttr("aria-describedby"),this.options.suppress&&c&&b.attr("title",c).removeAttr(U),this._unassignEvents(),this.options=this.elements=this.cache=this.timers=this.plugins=this.mouse=z,delete s.api[this.id]}}return this.destroyed?this.target:(a===x&&"hide"!==this.triggering||!this.rendered?b.call(this):(this.tooltip.one("tooltiphidden",d.proxy(b,this)),!this.triggering&&this.hide()),this.target)},v=t.checks={builtin:{"^id$":function(a,b,c,e){var f=c===x?s.nextid:c,g=I+"-"+f;f!==y&&f.length>0&&!d("#"+g).length?(this._id=g,this.rendered&&(this.tooltip[0].id=this._id,this.elements.content[0].id=this._id+"-content",this.elements.title[0].id=this._id+"-title")):a[b]=e},"^prerender":function(a,b,c){c&&!this.rendered&&this.render(this.options.show.ready)},"^content.text$":function(a,b,c){this._updateContent(c)},"^content.attr$":function(a,b,c,d){this.options.content.text===this.target.attr(d)&&this._updateContent(this.target.attr(c))},"^content.title$":function(a,b,c){return c?(c&&!this.elements.title&&this._createTitle(),void this._updateTitle(c)):this._removeTitle()},"^content.button$":function(a,b,c){this._updateButton(c)},"^content.title.(text|button)$":function(a,b,c){this.set("content."+b,c)},"^position.(my|at)$":function(a,b,c){"string"==typeof c&&(this.position[b]=a[b]=new u(c,"at"===b))},"^position.container$":function(a,b,c){this.rendered&&this.tooltip.appendTo(c)},"^show.ready$":function(a,b,c){c&&(!this.rendered&&this.render(x)||this.toggle(x))},"^style.classes$":function(a,b,c,d){this.rendered&&this.tooltip.removeClass(d).addClass(c)},"^style.(width|height)":function(a,b,c){this.rendered&&this.tooltip.css(b,c)},"^style.widget|content.title":function(){this.rendered&&this._setWidget()},"^style.def":function(a,b,c){this.rendered&&this.tooltip.toggleClass(P,!!c)},"^events.(render|show|move|hide|focus|blur)$":function(a,b,c){this.rendered&&this.tooltip[(d.isFunction(c)?"":"un")+"bind"]("tooltip"+b,c)},"^(show|hide|position).(event|target|fixed|inactive|leave|distance|viewport|adjust)":function(){if(this.rendered){var a=this.options.position;this.tooltip.attr("tracking","mouse"===a.target&&a.adjust.mouse),this._unassignEvents(),this._assignEvents()}}}},t.get=function(a){if(this.destroyed)return this;var b=i(this.options,a.toLowerCase()),c=b[0][b[1]];return c.precedance?c.string():c};var W=/^position\.(my|at|adjust|target|container|viewport)|style|content|show\.ready/i,X=/^prerender|show\.ready/i;t.set=function(a,b){if(this.destroyed)return this;var c,e=this.rendered,f=y,g=this.options;return"string"==typeof a?(c=a,a={},a[c]=b):a=d.extend({},a),d.each(a,function(b,c){if(e&&X.test(b))return void delete a[b];var h,j=i(g,b.toLowerCase());h=j[0][j[1]],j[0][j[1]]=c&&c.nodeType?d(c):c,f=W.test(b)||f,a[b]=[j[0],j[1],c,h]}),h(g),this.positioning=x,d.each(a,d.proxy(j,this)),this.positioning=y,this.rendered&&this.tooltip[0].offsetWidth>0&&f&&this.reposition("mouse"===g.position.target?z:this.cache.event),this},t._update=function(a,b){var c=this,e=this.cache;return this.rendered&&a?(d.isFunction(a)&&(a=a.call(this.elements.target,e.event,this)||""),d.isFunction(a.then)?(e.waiting=x,a.then(function(a){return e.waiting=y,c._update(a,b)},z,function(a){return c._update(a,b)})):a===y||!a&&""!==a?y:(a.jquery&&a.length>0?b.empty().append(a.css({display:"block",visibility:"visible"})):b.html(a),this._waitForContent(b).then(function(a){c.rendered&&c.tooltip[0].offsetWidth>0&&c.reposition(e.event,!a.length)}))):y},t._waitForContent=function(a){var b=this.cache;return b.waiting=x,(d.fn.imagesLoaded?a.imagesLoaded():(new d.Deferred).resolve([])).done(function(){b.waiting=y}).promise()},t._updateContent=function(a,b){this._update(a,this.elements.content,b)},t._updateTitle=function(a,b){this._update(a,this.elements.title,b)===y&&this._removeTitle(y)},t._createTitle=function(){var a=this.elements,b=this._id+"-title";a.titlebar&&this._removeTitle(),a.titlebar=d("<div />",{"class":I+"-titlebar "+(this.options.style.widget?k("header"):"")}).append(a.title=d("<div />",{id:b,"class":I+"-title","aria-atomic":x})).insertBefore(a.content).delegate(".qtip-close","mousedown keydown mouseup keyup mouseout",function(a){d(this).toggleClass("ui-state-active ui-state-focus","down"===a.type.substr(-4))}).delegate(".qtip-close","mouseover mouseout",function(a){d(this).toggleClass("ui-state-hover","mouseover"===a.type)}),this.options.content.button&&this._createButton()},t._removeTitle=function(a){var b=this.elements;b.title&&(b.titlebar.remove(),b.titlebar=b.title=b.button=z,a!==y&&this.reposition())},t._createPosClass=function(a){return I+"-pos-"+(a||this.options.position.my).abbrev()},t.reposition=function(c,e){if(!this.rendered||this.positioning||this.destroyed)return this;this.positioning=x;var f,g,h,i,j=this.cache,k=this.tooltip,l=this.options.position,m=l.target,n=l.my,o=l.at,p=l.viewport,q=l.container,r=l.adjust,s=r.method.split(" "),t=k.outerWidth(y),u=k.outerHeight(y),v=0,w=0,z=k.css("position"),A={left:0,top:0},B=k[0].offsetWidth>0,I=c&&"scroll"===c.type,J=d(a),K=q[0].ownerDocument,L=this.mouse;if(d.isArray(m)&&2===m.length)o={x:D,y:C},A={left:m[0],top:m[1]};else if("mouse"===m)o={x:D,y:C},(!r.mouse||this.options.hide.distance)&&j.origin&&j.origin.pageX?c=j.origin:!c||c&&("resize"===c.type||"scroll"===c.type)?c=j.event:L&&L.pageX&&(c=L),"static"!==z&&(A=q.offset()),K.body.offsetWidth!==(a.innerWidth||K.documentElement.clientWidth)&&(g=d(b.body).offset()),A={left:c.pageX-A.left+(g&&g.left||0),top:c.pageY-A.top+(g&&g.top||0)},r.mouse&&I&&L&&(A.left-=(L.scrollX||0)-J.scrollLeft(),A.top-=(L.scrollY||0)-J.scrollTop());else{if("event"===m?c&&c.target&&"scroll"!==c.type&&"resize"!==c.type?j.target=d(c.target):c.target||(j.target=this.elements.target):"event"!==m&&(j.target=d(m.jquery?m:this.elements.target)),m=j.target,m=d(m).eq(0),0===m.length)return this;m[0]===b||m[0]===a?(v=V.iOS?a.innerWidth:m.width(),w=V.iOS?a.innerHeight:m.height(),m[0]===a&&(A={top:(p||m).scrollTop(),left:(p||m).scrollLeft()})):H.imagemap&&m.is("area")?f=H.imagemap(this,m,o,H.viewport?s:y):H.svg&&m&&m[0].ownerSVGElement?f=H.svg(this,m,o,H.viewport?s:y):(v=m.outerWidth(y),w=m.outerHeight(y),A=m.offset()),f&&(v=f.width,w=f.height,g=f.offset,A=f.position),A=this.reposition.offset(m,A,q),(V.iOS>3.1&&V.iOS<4.1||V.iOS>=4.3&&V.iOS<4.33||!V.iOS&&"fixed"===z)&&(A.left-=J.scrollLeft(),A.top-=J.scrollTop()),(!f||f&&f.adjustable!==y)&&(A.left+=o.x===F?v:o.x===G?v/2:0,A.top+=o.y===E?w:o.y===G?w/2:0)}return A.left+=r.x+(n.x===F?-t:n.x===G?-t/2:0),A.top+=r.y+(n.y===E?-u:n.y===G?-u/2:0),H.viewport?(h=A.adjusted=H.viewport(this,A,l,v,w,t,u),g&&h.left&&(A.left+=g.left),g&&h.top&&(A.top+=g.top),h.my&&(this.position.my=h.my)):A.adjusted={left:0,top:0},j.posClass!==(i=this._createPosClass(this.position.my))&&(j.posClass=i,k.removeClass(j.posClass).addClass(i)),this._trigger("move",[A,p.elem||p],c)?(delete A.adjusted,e===y||!B||isNaN(A.left)||isNaN(A.top)||"mouse"===m||!d.isFunction(l.effect)?k.css(A):d.isFunction(l.effect)&&(l.effect.call(k,this,d.extend({},A)),k.queue(function(a){d(this).css({opacity:"",height:""}),V.ie&&this.style.removeAttribute("filter"),a()})),this.positioning=y,this):this},t.reposition.offset=function(a,c,e){function f(a,b){c.left+=b*a.scrollLeft(),c.top+=b*a.scrollTop()}if(!e[0])return c;var g,h,i,j,k=d(a[0].ownerDocument),l=!!V.ie&&"CSS1Compat"!==b.compatMode,m=e[0];do"static"!==(h=d.css(m,"position"))&&("fixed"===h?(i=m.getBoundingClientRect(),f(k,-1)):(i=d(m).position(),i.left+=parseFloat(d.css(m,"borderLeftWidth"))||0,i.top+=parseFloat(d.css(m,"borderTopWidth"))||0),c.left-=i.left+(parseFloat(d.css(m,"marginLeft"))||0),c.top-=i.top+(parseFloat(d.css(m,"marginTop"))||0),g||"hidden"===(j=d.css(m,"overflow"))||"visible"===j||(g=d(m)));while(m=m.offsetParent);return g&&(g[0]!==k[0]||l)&&f(g,1),c};var Y=(u=t.reposition.Corner=function(a,b){a=(""+a).replace(/([A-Z])/," $1").replace(/middle/gi,G).toLowerCase(),this.x=(a.match(/left|right/i)||a.match(/center/)||["inherit"])[0].toLowerCase(),this.y=(a.match(/top|bottom|center/i)||["inherit"])[0].toLowerCase(),this.forceY=!!b;var c=a.charAt(0);this.precedance="t"===c||"b"===c?B:A}).prototype;Y.invert=function(a,b){this[a]=this[a]===D?F:this[a]===F?D:b||this[a]},Y.string=function(a){var b=this.x,c=this.y,d=b!==c?"center"===b||"center"!==c&&(this.precedance===B||this.forceY)?[c,b]:[b,c]:[b];return a!==!1?d.join(" "):d},Y.abbrev=function(){var a=this.string(!1);return a[0].charAt(0)+(a[1]&&a[1].charAt(0)||"")},Y.clone=function(){return new u(this.string(),this.forceY)},t.toggle=function(a,c){var e=this.cache,f=this.options,g=this.tooltip;if(c){if(/over|enter/.test(c.type)&&e.event&&/out|leave/.test(e.event.type)&&f.show.target.add(c.target).length===f.show.target.length&&g.has(c.relatedTarget).length)return this;e.event=d.event.fix(c)}if(this.waiting&&!a&&(this.hiddenDuringWait=x),!this.rendered)return a?this.render(1):this;if(this.destroyed||this.disabled)return this;var h,i,j,k=a?"show":"hide",l=this.options[k],m=this.options.position,n=this.options.content,o=this.tooltip.css("width"),p=this.tooltip.is(":visible"),q=a||1===l.target.length,r=!c||l.target.length<2||e.target[0]===c.target;return(typeof a).search("boolean|number")&&(a=!p),h=!g.is(":animated")&&p===a&&r,i=h?z:!!this._trigger(k,[90]),this.destroyed?this:(i!==y&&a&&this.focus(c),!i||h?this:(d.attr(g[0],"aria-hidden",!a),a?(this.mouse&&(e.origin=d.event.fix(this.mouse)),d.isFunction(n.text)&&this._updateContent(n.text,y),d.isFunction(n.title)&&this._updateTitle(n.title,y),!w&&"mouse"===m.target&&m.adjust.mouse&&(d(b).bind("mousemove."+I,this._storeMouse),w=x),o||g.css("width",g.outerWidth(y)),this.reposition(c,arguments[2]),o||g.css("width",""),l.solo&&("string"==typeof l.solo?d(l.solo):d(M,l.solo)).not(g).not(l.target).qtip("hide",new d.Event("tooltipsolo"))):(clearTimeout(this.timers.show),delete e.origin,w&&!d(M+'[tracking="true"]:visible',l.solo).not(g).length&&(d(b).unbind("mousemove."+I),w=y),this.blur(c)),j=d.proxy(function(){a?(V.ie&&g[0].style.removeAttribute("filter"),g.css("overflow",""),"string"==typeof l.autofocus&&d(this.options.show.autofocus,g).focus(),this.options.show.target.trigger("qtip-"+this.id+"-inactive")):g.css({display:"",visibility:"",opacity:"",left:"",top:""}),this._trigger(a?"visible":"hidden")},this),l.effect===y||q===y?(g[k](),j()):d.isFunction(l.effect)?(g.stop(1,1),l.effect.call(g,this),g.queue("fx",function(a){j(),a()})):g.fadeTo(90,a?1:0,j),a&&l.target.trigger("qtip-"+this.id+"-inactive"),this))},t.show=function(a){return this.toggle(x,a)},t.hide=function(a){return this.toggle(y,a)},t.focus=function(a){if(!this.rendered||this.destroyed)return this;var b=d(M),c=this.tooltip,e=parseInt(c[0].style.zIndex,10),f=s.zindex+b.length;return c.hasClass(Q)||this._trigger("focus",[f],a)&&(e!==f&&(b.each(function(){this.style.zIndex>e&&(this.style.zIndex=this.style.zIndex-1)}),b.filter("."+Q).qtip("blur",a)),c.addClass(Q)[0].style.zIndex=f),this},t.blur=function(a){return!this.rendered||this.destroyed?this:(this.tooltip.removeClass(Q),this._trigger("blur",[this.tooltip.css("zIndex")],a),this)},t.disable=function(a){return this.destroyed?this:("toggle"===a?a=!(this.rendered?this.tooltip.hasClass(S):this.disabled):"boolean"!=typeof a&&(a=x),this.rendered&&this.tooltip.toggleClass(S,a).attr("aria-disabled",a),this.disabled=!!a,this)},t.enable=function(){return this.disable(y)},t._createButton=function(){var a=this,b=this.elements,c=b.tooltip,e=this.options.content.button,f="string"==typeof e,g=f?e:"Close tooltip";b.button&&b.button.remove(),e.jquery?b.button=e:b.button=d("<a />",{"class":"qtip-close "+(this.options.style.widget?"":I+"-icon"),title:g,"aria-label":g}).prepend(d("<span />",{"class":"ui-icon ui-icon-close",html:"&times;"})),b.button.appendTo(b.titlebar||c).attr("role","button").click(function(b){return c.hasClass(S)||a.hide(b),y})},t._updateButton=function(a){if(!this.rendered)return y;var b=this.elements.button;a?this._createButton():b.remove()},t._setWidget=function(){var a=this.options.style.widget,b=this.elements,c=b.tooltip,d=c.hasClass(S);c.removeClass(S),S=a?"ui-state-disabled":"qtip-disabled",c.toggleClass(S,d),c.toggleClass("ui-helper-reset "+k(),a).toggleClass(P,this.options.style.def&&!a),b.content&&b.content.toggleClass(k("content"),a),b.titlebar&&b.titlebar.toggleClass(k("header"),a),b.button&&b.button.toggleClass(I+"-icon",!a)},t._storeMouse=function(a){return(this.mouse=d.event.fix(a)).type="mousemove",this},t._bind=function(a,b,c,e,f){if(a&&c&&b.length){var g="."+this._id+(e?"-"+e:"");return d(a).bind((b.split?b:b.join(g+" "))+g,d.proxy(c,f||this)),this}},t._unbind=function(a,b){return a&&d(a).unbind("."+this._id+(b?"-"+b:"")),this},t._trigger=function(a,b,c){var e=new d.Event("tooltip"+a);return e.originalEvent=c&&d.extend({},c)||this.cache.event||z,this.triggering=a,this.tooltip.trigger(e,[this].concat(b||[])),this.triggering=y,!e.isDefaultPrevented()},t._bindEvents=function(a,b,c,e,f,g){var h=c.filter(e).add(e.filter(c)),i=[];h.length&&(d.each(b,function(b,c){var e=d.inArray(c,a);e>-1&&i.push(a.splice(e,1)[0])}),i.length&&(this._bind(h,i,function(a){var b=this.rendered?this.tooltip[0].offsetWidth>0:!1;(b?g:f).call(this,a)}),c=c.not(h),e=e.not(h))),this._bind(c,a,f),this._bind(e,b,g)},t._assignInitialEvents=function(a){function b(a){return this.disabled||this.destroyed?y:(this.cache.event=a&&d.event.fix(a),this.cache.target=a&&d(a.target),clearTimeout(this.timers.show),void(this.timers.show=l.call(this,function(){this.render("object"==typeof a||c.show.ready)},c.prerender?0:c.show.delay)))}var c=this.options,e=c.show.target,f=c.hide.target,g=c.show.event?d.trim(""+c.show.event).split(" "):[],h=c.hide.event?d.trim(""+c.hide.event).split(" "):[];this._bind(this.elements.target,["remove","removeqtip"],function(){this.destroy(!0)},"destroy"),/mouse(over|enter)/i.test(c.show.event)&&!/mouse(out|leave)/i.test(c.hide.event)&&h.push("mouseleave"),this._bind(e,"mousemove",function(a){this._storeMouse(a),this.cache.onTarget=x}),this._bindEvents(g,h,e,f,b,function(){return this.timers?void clearTimeout(this.timers.show):y}),(c.show.ready||c.prerender)&&b.call(this,a)},t._assignEvents=function(){var c=this,e=this.options,f=e.position,g=this.tooltip,h=e.show.target,i=e.hide.target,j=f.container,k=f.viewport,l=d(b),q=d(a),r=e.show.event?d.trim(""+e.show.event).split(" "):[],t=e.hide.event?d.trim(""+e.hide.event).split(" "):[];d.each(e.events,function(a,b){c._bind(g,"toggle"===a?["tooltipshow","tooltiphide"]:["tooltip"+a],b,null,g)}),/mouse(out|leave)/i.test(e.hide.event)&&"window"===e.hide.leave&&this._bind(l,["mouseout","blur"],function(a){/select|option/.test(a.target.nodeName)||a.relatedTarget||this.hide(a)}),e.hide.fixed?i=i.add(g.addClass(O)):/mouse(over|enter)/i.test(e.show.event)&&this._bind(i,"mouseleave",function(){clearTimeout(this.timers.show)}),(""+e.hide.event).indexOf("unfocus")>-1&&this._bind(j.closest("html"),["mousedown","touchstart"],function(a){var b=d(a.target),c=this.rendered&&!this.tooltip.hasClass(S)&&this.tooltip[0].offsetWidth>0,e=b.parents(M).filter(this.tooltip[0]).length>0;b[0]===this.target[0]||b[0]===this.tooltip[0]||e||this.target.has(b[0]).length||!c||this.hide(a)}),"number"==typeof e.hide.inactive&&(this._bind(h,"qtip-"+this.id+"-inactive",o,"inactive"),this._bind(i.add(g),s.inactiveEvents,o)),this._bindEvents(r,t,h,i,m,n),this._bind(h.add(g),"mousemove",function(a){if("number"==typeof e.hide.distance){var b=this.cache.origin||{},c=this.options.hide.distance,d=Math.abs;(d(a.pageX-b.pageX)>=c||d(a.pageY-b.pageY)>=c)&&this.hide(a)}this._storeMouse(a)}),"mouse"===f.target&&f.adjust.mouse&&(e.hide.event&&this._bind(h,["mouseenter","mouseleave"],function(a){return this.cache?void(this.cache.onTarget="mouseenter"===a.type):y}),this._bind(l,"mousemove",function(a){this.rendered&&this.cache.onTarget&&!this.tooltip.hasClass(S)&&this.tooltip[0].offsetWidth>0&&this.reposition(a)})),(f.adjust.resize||k.length)&&this._bind(d.event.special.resize?k:q,"resize",p),f.adjust.scroll&&this._bind(q.add(f.container),"scroll",p)},t._unassignEvents=function(){var c=this.options,e=c.show.target,f=c.hide.target,g=d.grep([this.elements.target[0],this.rendered&&this.tooltip[0],c.position.container[0],c.position.viewport[0],c.position.container.closest("html")[0],a,b],function(a){return"object"==typeof a});e&&e.toArray&&(g=g.concat(e.toArray())),f&&f.toArray&&(g=g.concat(f.toArray())),this._unbind(g)._unbind(g,"destroy")._unbind(g,"inactive")},d(function(){q(M,["mouseenter","mouseleave"],function(a){var b="mouseenter"===a.type,c=d(a.currentTarget),e=d(a.relatedTarget||a.target),f=this.options;b?(this.focus(a),c.hasClass(O)&&!c.hasClass(S)&&clearTimeout(this.timers.hide)):"mouse"===f.position.target&&f.position.adjust.mouse&&f.hide.event&&f.show.target&&!e.closest(f.show.target[0]).length&&this.hide(a),c.toggleClass(R,b)}),q("["+K+"]",N,o)}),s=d.fn.qtip=function(a,b,e){var f=(""+a).toLowerCase(),g=z,i=d.makeArray(arguments).slice(1),j=i[i.length-1],k=this[0]?d.data(this[0],I):z;return!arguments.length&&k||"api"===f?k:"string"==typeof a?(this.each(function(){var a=d.data(this,I);if(!a)return x;if(j&&j.timeStamp&&(a.cache.event=j),!b||"option"!==f&&"options"!==f)a[f]&&a[f].apply(a,i);else{if(e===c&&!d.isPlainObject(b))return g=a.get(b),y;a.set(b,e)}}),g!==z?g:this):"object"!=typeof a&&arguments.length?void 0:(k=h(d.extend(x,{},a)),this.each(function(a){var b,c;return c=d.isArray(k.id)?k.id[a]:k.id,c=!c||c===y||c.length<1||s.api[c]?s.nextid++:c,b=r(d(this),c,k),b===y?x:(s.api[c]=b,d.each(H,function(){"initialize"===this.initialize&&this(b)}),void b._assignInitialEvents(j))}))},d.qtip=e,s.api={},d.each({attr:function(a,b){if(this.length){var c=this[0],e="title",f=d.data(c,"qtip");if(a===e&&f&&f.options&&"object"==typeof f&&"object"==typeof f.options&&f.options.suppress)return arguments.length<2?d.attr(c,U):(f&&f.options.content.attr===e&&f.cache.attr&&f.set("content.text",b),this.attr(U,b))}return d.fn["attr"+T].apply(this,arguments)},clone:function(a){var b=d.fn["clone"+T].apply(this,arguments);return a||b.filter("["+U+"]").attr("title",function(){return d.attr(this,U)}).removeAttr(U),b}},function(a,b){if(!b||d.fn[a+T])return x;var c=d.fn[a+T]=d.fn[a];d.fn[a]=function(){return b.apply(this,arguments)||c.apply(this,arguments)}}),d.ui||(d["cleanData"+T]=d.cleanData,d.cleanData=function(a){for(var b,c=0;(b=d(a[c])).length;c++)if(b.attr(J))try{b.triggerHandler("removeqtip")}catch(e){}d["cleanData"+T].apply(this,arguments)}),s.version="3.0.3",s.nextid=0,s.inactiveEvents=N,s.zindex=15e3,s.defaults={prerender:y,id:y,overwrite:x,suppress:x,content:{text:x,attr:"title",title:y,button:y},position:{my:"top left",at:"bottom right",target:y,container:y,viewport:y,adjust:{x:0,y:0,mouse:x,scroll:x,resize:x,method:"flipinvert flipinvert"},effect:function(a,b){d(this).animate(b,{duration:200,queue:y})}},show:{target:y,event:"mouseenter",effect:x,delay:90,solo:y,ready:y,autofocus:y},hide:{target:y,event:"mouseleave",effect:x,delay:0,fixed:y,inactive:y,leave:"window",distance:y},style:{classes:"",widget:y,width:y,height:y,def:x},events:{render:z,move:z,show:z,hide:z,toggle:z,visible:z,hidden:z,focus:z,blur:z}}})}(window,document);
+//# sourceMappingURL=jquery.qtip.min.map
\ No newline at end of file
diff --git a/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js b/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js
index c6bb63383a..1f9a823bce 100644
--- a/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js
+++ b/www/include/common/javascript/jquery/plugins/sheepit/jquery.sheepItPlugin.min.js
@@ -61,6 +61,7 @@
          */
         function clickOnAdd(event)
         {
+        	////console.log('clickOnAdd');
             event.preventDefault();
             addForm();
         }
@@ -70,6 +71,7 @@
          */
         function clickOnAddN(event)
         {
+        	////console.log('clickOnAddN');
             event.preventDefault();
             if (addNInput.value !== '') {
                 addNForms(addNInput.attr('value'));
@@ -139,13 +141,15 @@
         }
         
         function getOrSetTemplate(element, attrname){
-          //var template=element.attr(attrname+"template");
-          //if(template) {
-          //  return unescape(template);
-          //}
-          var att=element.attr(attrname);
+          var template=element.prop(attrname+"template");
+          //console.log(template);
+          if(template) {
+            return unescape(template);
+          }
+          var att=element.prop(attrname);
+          //console.log(att);
           // Hide index occurrences inside the template (todo: better escaping method)      
-          element.attr(attrname+"template", escape(att));
+          element.prop(attrname+"template", escape(att));
           return att;
         }
 
@@ -158,24 +162,21 @@
                 var that = $(this)
                     ,idTemplateAttr = getOrSetTemplate(that,"id")
                     ,nameTemplateAttr = getOrSetTemplate(that, "name")
-                    ,idAttr = that.attr("id")
-                    ,nameAttr = that.attr("name")
+                    ,idAttr = that.prop("id")
+                    ,nameAttr = that.prop("name")
                     
                 /* Normalize field name attributes */
-		if(typeof(newNameAttr)=='string'){
-                	newNameAttr = nameTemplateAttr.replace(options.indexFormat, index);
-                	that.attr("name", newNameAttr);
-		}
+                
+                var newNameAttr = nameTemplateAttr.replace(options.indexFormat, index);
+                that.attr("name", newNameAttr);
 
                 /* Normalize field id attributes */
-                if(typeof(newIdAttr)=='string'){
-                        newIdAttr = idTemplateAttr.replace(options.indexFormat, index);
+                var newIdAttr = idTemplateAttr.replace(options.indexFormat, index);
 
-                        form.find("label[for='"+idAttr+"']").each(function(){
-                        	$(this).attr("for", newIdAttr);
-                    	});
-                        that.attr("id", newIdAttr);
-                }
+                form.find("label[for='"+idAttr+"']").each(function(){
+                        $(this).attr("for", newIdAttr);
+                    });
+                that.attr("id", newIdAttr);
             });
         }
 
@@ -290,15 +291,21 @@
 
         function normalizeForm(form, index)
         {
+        	
+        	
             if (typeof index == 'undefined') {
                 index=getIndex();
+                //console.log(index+' index in normalizeForm');
             }
+            var formcount=getFormsCount();
+            
+        	//console.log(formcount+' formcount in normalizeForm');
             
             var idTemplate=getOrSetTemplate(form, "id");
 
             // Normalize form id
-            if (form.attr("id")) {
-                form.attr("id", idTemplate + index);
+            if (form.prop("id")) {
+                form.prop("id", idTemplate + index);
             }
             
             
@@ -377,6 +384,7 @@
             if (canAddForm() && newForm) {
                 
                 newForm = normalizeForm(newForm);
+                
 
                 // Remove current control
                 var removeCurrentBtn = newForm.find(options.removeCurrentSelector).first();
@@ -384,6 +392,7 @@
                 removeCurrentBtn.click(clickOnRemoveCurrent);
                 removeCurrentBtn.data('removableClone', newForm);
                 
+                
                 // Index
                 newForm.data('formIndex', getIndex());
                 
@@ -499,12 +508,13 @@
             }
 
             if (canRemoveAllForms()) {
-		var count = forms.length;
-		for (i = 0; i < count; i++) {
-                    if (forms[i]) {
-                        removeForm(forms[i]);
+                var x = [];
+                forms.forEach(function(form) {
+                    if (form) {
+                        removeForm(form);
                     }
-                }
+                });
+				forms.length=0;
                 if (normalize) {
                     normalizeAll();
                 }
@@ -705,11 +715,9 @@
         {
             if (forms.length > 0) {
                 var count = 0;
-                var num = forms.length;
-		var i = 0;
-
-                for (i = 0; i < forms.length; i++) {
-                    if (forms[i]) {
+                var x = [];
+                for (x in forms) {
+                    if (forms[x] ) {
                         count++;
                     }
                 }
@@ -745,9 +753,10 @@
             var count = 0;
             var index = false;
 
-            for (x=0; x < forms.length; x++) {
+            for (x in forms) {
                 if (forms[x]) {
                     count++;
+                    // get index for position
                     if (position == count) {
                         index = x;
                     }
@@ -929,14 +938,19 @@
             
             var form = '';
 
+
             // Position
             if (typeof(index) == 'number') {
+//console.log('fillData index:  '+index);
 
                 // Correction of index to position
                 index++;
 
                 // Need more forms?
+                var $count=getFormsCount();
+                	////console.log('forms count:'+$count); 
                 if ((index) > getFormsCount()) {
+                	
                    addForm();
                 }
 
@@ -963,24 +977,21 @@
 
             // For each element, try to get the correct field or fields
             $.each(data, function(index, value) {
-                
-                var formId = source.attr('id');
+               //console.log('formData: '+JSON.stringify(form.data));
+                var formId = source.prop('id');
                 var formIndex = form.data('formIndex');
-
-
-                var iFormat = '#index#';
-        	if (typeof(options.indexFormat) != 'undefined' && options.indexFormat){
-            		iFormat = options.indexFormat;
-        	}
+                //console.log('formId: '+formId+'  formIndex  '+formIndex);
 
 
                 // Replace form Id and form Index with current values
-                if (index.indexOf('#form#') != -1 || index.indexOf(iFormat) != -1) {
-                	index = index.replace('#form#', formId);
-                        index = index.replace(iFormat, formIndex);
+                if (index.indexOf('#form#') != -1 || index.indexOf('#index#') != -1) {
+                    index = index.replace('#form#', formId);
+                    index = index.replace('#index#', formIndex);
                 } else {
-                        index = formId + '_' + formIndex + '_' + index;
+                    index = formId + '_' + formIndex + '_' + index;
                 }
+                
+               //console.log('index: '+index);
 
                 /**
                  * Search for field (by id, by name, etc)
@@ -988,7 +999,7 @@
                 
                 // Search by id
                 var field = form.find(':input[id="' + index + '"]');
-
+                   
                 // Search by name
                 if (field.length == 0) {
 
@@ -998,10 +1009,6 @@
                     if (field.length == 0) {
                         // Search by name array format
                         field = form.find(':input[name="' + index + '[]"]');
-                        if (field.length == 0) {
-                            //console.log(':input[name="' + index + '[.*?]"]');
-                            field = form.find(':input[name^="' + index + '["][name$=.+\]]');
-                        }
                     } 
                 }
                 
@@ -1009,7 +1016,7 @@
 
                 // Field was found
                 if (field.length > 0) {
-					
+					        //console.log('field is found');
                     // Multiple values?
                     var mv = false;
                     if (typeof(value) == 'object') {
@@ -1021,7 +1028,7 @@
                     if (field.length > 1) {
                         mf = true;
                     }
-
+										////console.log('mv'+mv+'mf'+mf);
                     if (mf) {
 
                         if (mv) {
@@ -1077,8 +1084,9 @@
         function fillFormField(field, value)
         {
             var type = field.prop('type');
+                  //console.log('type: '+type);
             // hidden, text, password
-            if (type == 'text' || type == 'hidden' || type == 'password') {
+            if (type == 'text' || type == 'hidden' || type == 'password' || type == 'number' || type == 'date' || type == 'tel') {
                 field.attr('value', value);
                 return true;
             }
@@ -1095,8 +1103,8 @@
             // select-one, select-multiple
             else if (type == 'select-one' || type == 'select-multiple') {
                 field.find("option").each(function() {
-                    if($(this).text() == value || $(this).attr("value") == value) {
-                            $(this).attr("selected", "selected");
+                    if($(this).text() == value || $(this).prop("value") == value) {
+                            $(this).prop("selected", "selected");
                     }
                 });
                 return true;
@@ -1366,6 +1374,8 @@
                     inject: function(data) {
                         
                         // Loop over each data using a Proxy (function , context)
+                       // //console.log('data for fillData: '+JSON.stringify(data));
+                       //  //console.log('Source for fillData: '+JSON.stringify(source));
                         $.each(data, $.proxy( fillData, source ));
                     }
                     
diff --git a/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js b/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js
index 08aa798ad0..b8053baaa1 100644
--- a/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js
+++ b/www/include/common/javascript/jquery/plugins/xml2json/jquery.xml2json.js
@@ -1,9 +1,7 @@
 /*
- ### jQuery XML to JSON Plugin v1.1 - 2008-07-01 ###
+ ### jQuery XML to JSON Plugin v1.3 - 2013-02-18 ###
  * http://www.fyneworks.com/ - diego@fyneworks.com
- * Dual licensed under the MIT and GPL licenses:
- *   http://www.opensource.org/licenses/mit-license.php
- *   http://www.gnu.org/licenses/gpl.html
+	* Licensed under http://en.wikipedia.org/wiki/MIT_License
  ###
  Website: http://www.fyneworks.com/jquery/xml-to-json/
 *//*
@@ -101,7 +99,8 @@
     };//node.attributes
     if(obj){
      obj = $.extend( (txt!='' ? new String(txt) : {}),/* {text:txt},*/ obj || {}/*, att || {}*/);
-     txt = (obj.text) ? (typeof(obj.text)=='object' ? obj.text : [obj.text || '']).concat([txt]) : txt;
+     //txt = (obj.text) ? (typeof(obj.text)=='object' ? obj.text : [obj.text || '']).concat([txt]) : txt;
+     txt = (obj.text) ? ([obj.text || '']).concat([txt]) : txt;
      if(txt) obj.text = txt;
      txt = '';
     };
@@ -170,16 +169,23 @@
   text2xml: function(str) {
    // NOTE: I'd like to use jQuery for this, but jQuery makes all tags uppercase
    //return $(xml)[0];
+   
+   /* prior to jquery 1.9 */
+   /*
    var out;
    try{
-    var xml = ($.browser.msie)?new ActiveXObject("Microsoft.XMLDOM"):new DOMParser();
+    var xml = ((!$.support.opacity && !$.support.style))?new ActiveXObject("Microsoft.XMLDOM"):new DOMParser();
     xml.async = false;
    }catch(e){ throw new Error("XML Parser could not be instantiated") };
    try{
-    if($.browser.msie) out = (xml.loadXML(str))?xml:false;
+    if((!$.support.opacity && !$.support.style)) out = (xml.loadXML(str))?xml:false;
     else out = xml.parseFromString(str, "text/xml");
    }catch(e){ throw new Error("Error parsing XML string") };
    return out;
+   */
+
+   /* jquery 1.9+ */
+   return $.parseXML(str);
   }
 		
  }); // extend $
diff --git a/www/include/core/header/htmlHeader.php b/www/include/core/header/htmlHeader.php
index 8d703944f1..9f007d1946 100644
--- a/www/include/core/header/htmlHeader.php
+++ b/www/include/core/header/htmlHeader.php
@@ -86,6 +86,7 @@ print "<?xml version=\"1.0\" encoding=\"utf-8\"?>\n";
         <script type="text/javascript" src="./include/common/javascript/jquery/plugins/select2/js/select2.full.min.js"></script>
         <script type="text/javascript" src="./include/common/javascript/centreon/centreon-select2.js"></script>
         <script type="text/javascript" src="./include/common/javascript/jquery/jquery-ui.js"></script>
+        <script type="text/javascript" src="./include/common/javascript/jquery/jquery-ui-tabs-rotate.js"></script>
         <script type="text/javascript">jQuery.noConflict();</script>
         <script type="text/javascript" src="./include/common/javascript/jquery/plugins/colorbox/jquery.colorbox-min.js"></script>
         <script type="text/javascript" src="./include/common/javascript/jquery/plugins/jeditable/jquery.jeditable-min.js"></script>
diff --git a/www/include/home/customViews/index.ihtml b/www/include/home/customViews/index.ihtml
index 331dfbb757..f559591c75 100644
--- a/www/include/home/customViews/index.ihtml
+++ b/www/include/home/customViews/index.ihtml
@@ -207,8 +207,8 @@
                 <div class="toggle_wrapper inactive" id="rotationTabs">
                 <div id='rotation_timer'></div>
                 <div id='timer_value'></div>
-                <div class="button_group_center">
-                    <input type='button' value='{t}Apply{/t}' class="btc bt_success" onClick='submitRotation();'/>
+                <div class="button_group button_group_center">
+                    <input type='button' value='{t}Apply{/t}' class="btc bt_success bt_widget" onClick='submitRotation();'/>
                 </div>
             </div>
             </div>
@@ -224,8 +224,7 @@
                 {t}No view available. To create a new view, please click "Add view" button.{/t}
             </h4>
         </div>
-        <ul class="tabs_header">
-        </ul>
+        <ul class="tabs_header"></ul>
     </div>
 </div>
 <div hidden>
@@ -253,6 +252,10 @@
 </div>
 <script>
 {literal}
+
+var rotationTimeout;
+var rotationTimer = {/literal}{$rotationTimer}{literal};
+
 /* Display or hide the information for add a new view */
 function infoEmptyTab() {
   if (jQuery('#tabs .tabs_header > li').length > 0) {
@@ -313,7 +316,7 @@ function deleteTab(viewId) {
   });
 
   if (jQuery('#tabs .tabs_header > li').length > 0) {
-    jQuery('#tabs').tabs('select', 1);
+    jQuery('#tabs').tabs('option', 'active', 1);
   }
 
   infoEmptyTab();
@@ -370,7 +373,7 @@ function submitAddView() {
               public: (jQuery('#formAddView input[name="public"]:checked').length ? true : false),
               nbCols: jQuery('#formAddView input[name="layout[layout]"]:checked').val()
             });
-            jQuery("#tabs").tabs('select', getTabPos(viewId));
+            jQuery("#tabs").tabs('option', 'active', getTabPos(viewId));
             jQuery('#formAddView').parents('.toggle_wrapper').hide();
         }else{
             jQuery('#formAddView').parents('.toggle_wrapper').hide();
@@ -441,7 +444,7 @@ function submitAddWidget() {
 /* Delete action */
 function submitDeleteView() {
   var viewId = jQuery(
-    jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+    jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
   ).data('cvId');
   jQuery.ajax({
     type: "POST",
@@ -465,7 +468,7 @@ function submitDeleteView() {
 /* Set default action */
 function submitSetDefaultView() {
   var viewId = jQuery(
-    jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+    jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
   ).data('cvId');
   jQuery.ajax({
     type: "POST",
@@ -493,7 +496,7 @@ function submitRotation() {
       var view = response.getElementsByTagName('custom_view_id');
       var error = response.getElementsByTagName('error');
       if (typeof(view) != 'undefined') {
-        jQuery("#tabs").tabs('rotate', (rotationTimer * 1000));
+        jQuery("#tabs").tabs('rotate', (rotationTimer * 1000), true);
         jQuery('#rotation_timer').parents('.toggle_wrapper').hide();
       } else if (typeof(err) != 'undefined') {
         var errorMsg = err.item(0).firstChild.data;
@@ -506,7 +509,7 @@ function submitRotation() {
 function submitShareView()
 {
   var viewId = jQuery(
-    jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+    jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
   ).data('cvId');
   var lockedUsers = jQuery("#formShareView").find('select[name="locked_user_id[]"]').val();
   lockedUsers = (lockedUsers == null) ? [] : lockedUsers.filter(function (elem) {return elem !== '';});
@@ -608,7 +611,7 @@ function toggleEdit(show) {
 function removeUserFromView(user_id) {
 
   var viewId = jQuery(
-    jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+    jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
   ).data('cvId');
   jQuery.ajax({
     type: "POST",
@@ -638,7 +641,7 @@ function removeUserFromView(user_id) {
 
 function removeUsergroupFromView(usergroup_id) {
   var viewId = jQuery(
-    jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+    jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
   ).data('cvId');
   jQuery.ajax({
     type: "POST",
@@ -667,10 +670,11 @@ function removeUsergroupFromView(usergroup_id) {
 }
 
 jQuery(function () {
+  jQuery('#tabs').tabs();
   toggleEdit(defaultShow);
 
   /* Initialize buttons */
-  jQuery('.addView').button({ icons : { primary: 'ui-icon-plus'}}).on('click', function () {
+  jQuery('.addView').button({icon: "ui-icon-plus"}).on('click', function () {
     //reset select2
     jQuery("#formAddView #viewLoad").empty().append($('<option>'));
     //reset add view form
@@ -691,7 +695,7 @@ jQuery(function () {
   jQuery('.shareView').button({ icons : { primary: 'ui-icon-folder-open'}}).on('click', function () {
     /* Get default information for a share view */
     var viewId = jQuery(
-      jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+      jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
     ).data('cvId');
     jQuery("#locked_user_id option").remove();
     jQuery("#unlocked_user_id option").remove();
@@ -758,7 +762,6 @@ jQuery(function () {
   /* Initialize tabs */
   jQuery(".ui-tabs-panel").css('overflow', 'auto');
 
-  var rotationTimer = {/literal}{$rotationTimer}{literal};
   jQuery("#rotation_timer").slider({
     value: rotationTimer,
     min: 0,
@@ -774,7 +777,7 @@ jQuery(function () {
 
   /* Add event for close all form */
   jQuery(document).on('click', function (e) {
-    /* 
+    /*
      * if were are in dropdown selection or popin select all.
      */
     if (jQuery(e.target).parents('.cntn').length === 0 &&
@@ -787,7 +790,7 @@ jQuery(function () {
 
   jQuery('.editView').on('click', function () {
     var tabActive = jQuery(
-      jQuery('#tabs .ui-tabs-selected.ui-state-active')[0]
+      jQuery('#tabs .ui-tabs-tab.ui-state-active')[0]
     );
 
     jQuery('#formEditView input[name="custom_view_id"]').val(tabActive.data('cvId'));
@@ -841,21 +844,21 @@ jQuery(function () {
     method: 'get',
     methodType: 'json',
     success: function (data) {
-      jQuery.each(data.tabs, function (idx, tab) {
-        addTab(tab, true);
-      });
+
       if (data.tabs.length > 0) {
+        jQuery('#tabs').tabs("destroy");
+
+        jQuery.each(data.tabs, function (idx, tab) {
+          addTab(tab, true);
+        });
+
         jQuery("#tabs").tabs({
-          ajaxOptions: { async: true },
-          select: function() {
-            jQuery('.viewBody').empty();
-          },
-          selected: -1
+          active: getTabPos(data.current)
         });
+        jQuery("#tabs").tabs('rotate', (rotationTimer * 1000), true);
       }
-      jQuery("#tabs").tabs('select', getTabPos(data.current));
+
       infoEmptyTab();
-      jQuery("#tabs").tabs('rotate', (rotationTimer * 1000));
     }
   });
 
diff --git a/www/include/monitoring/recurrentDowntime/formDowntime.html b/www/include/monitoring/recurrentDowntime/formDowntime.html
index 7fa65818f2..6ccf0871a7 100644
--- a/www/include/monitoring/recurrentDowntime/formDowntime.html
+++ b/www/include/monitoring/recurrentDowntime/formDowntime.html
@@ -16,17 +16,7 @@ jQuery(function(){
         });
     };
 
-    jQuery("#tabs_periods").tabs({
-        closable: true,
-        add: function(event, ui) {
-            jQuery(this).tabs('select',ui.index);
-            removetab(jQuery(this), ui.index);
-        },
-        show: function(event, ui) {
-            //load function to close selected tabs
-            removetab(jQuery(this), ui.index);
-        }
-    });
+    jQuery("#tabs_periods").tabs();
 
     if ($$('input[name="dt_id"]')[0].value) {
         jQuery.ajax({
@@ -48,12 +38,17 @@ jQuery(function(){
 function addPeriods() {
     periods++;
 
-    jQuery("#ul_tabs").after("<div id=\"p_"+periods+"\"></div>");
-    jQuery("#p_"+periods).load('./main.php?p={/literal}{$p}{literal}&min=1&iframe=1&period=' + periods);
+    var ulTabs = jQuery("#ul_tabs");
+
+    ulTabs.after("<div id=\"p_" + periods + "\"></div>");
+    jQuery("#p_" + periods).load('./main.php?p={/literal}{$p}{literal}&min=1&iframe=1&period=' + periods);
 
     var href = "#p_"+periods;
     var title = '{/literal}{$period}{literal} ' + periods;
-    jQuery("#tabs_periods").tabs( 'add' , href , title+' &nbsp;');
+
+    jQuery('<li><a href="' + href + '">' + title + '</a>').appendTo(ulTabs);
+    jQuery("#tabs_periods").tabs("refresh");
+    jQuery("#tabs_periods").tabs("option", "active", (periods - 1));
 
     return false;
 }
diff --git a/www/include/options/oreon/modules/listModules.ihtml b/www/include/options/oreon/modules/listModules.ihtml
index 072e0224b2..ef644aaadf 100644
--- a/www/include/options/oreon/modules/listModules.ihtml
+++ b/www/include/options/oreon/modules/listModules.ihtml
@@ -6,6 +6,7 @@
 <script type="text/javascript" src="./include/common/javascript/jquery/jquery.ui.widget.js"></script>
 <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload.js"></script>
 <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-ui.js"></script>
+<script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.fileupload-process.js"></script>
 <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.iframe-transport.js"></script>
 <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.xdr-transport.js"></script>
 <script type="text/javascript" src="./include/common/javascript/jquery/plugins/fileUpload/jquery.postmessage-transport.js"></script>
@@ -54,10 +55,9 @@
             {if $elemArr[elem].RowMenu_link_delete}
 				<a id="action{$elemArr[elem].RowMenu_name}" href="{$elemArr[elem].RowMenu_link_delete}"  onclick="return confirm('{t}Do you confirm the deletion?{/t}')"><img src='./img/icons/delete.png' class='ico-16 margin_right' title='{t}Uninstall Module{/t}' alt='{t}Uninstall Module{/t}'></a>
 			{/if}
-			
 		</td>
 	</tr>
-	{/section}	
+	{/section}
 </table>
 
 <link rel="stylesheet" type="text/css" href="./include/common/javascript/jquery/plugins/qtip/jquery-qtip.css" />
@@ -75,7 +75,7 @@
                 {
                     mydata: 1,
                     mydata2: 2
-                }, 
+                },
                 success: function(data, textStatus, jqXHR)
                 {
                     var myResponse = jQuery.xml2json(data);
@@ -88,7 +88,7 @@
             });
         });
     }
-    
+
     function displayResults(moduleList) {
         for (var i = 0; i < moduleList.length; i++) {
             module = moduleList[i];
-- 
GitLab